CA2871637A1 - Imidazothiadiazole derivatives as protease activated receptor 4 (par4) inhibitors for treating platelet aggregation - Google Patents
Imidazothiadiazole derivatives as protease activated receptor 4 (par4) inhibitors for treating platelet aggregation Download PDFInfo
- Publication number
- CA2871637A1 CA2871637A1 CA2871637A CA2871637A CA2871637A1 CA 2871637 A1 CA2871637 A1 CA 2871637A1 CA 2871637 A CA2871637 A CA 2871637A CA 2871637 A CA2871637 A CA 2871637A CA 2871637 A1 CA2871637 A1 CA 2871637A1
- Authority
- CA
- Canada
- Prior art keywords
- groups
- alkyl
- substituted
- alkoxy
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 208000010110 spontaneous platelet aggregation Diseases 0.000 title claims abstract description 17
- 239000003112 inhibitor Substances 0.000 title abstract description 12
- BOXRDDIXJOUZLV-UHFFFAOYSA-N 2h-imidazo[4,5-d]thiadiazole Chemical class N1SC2=NC=NC2=N1 BOXRDDIXJOUZLV-UHFFFAOYSA-N 0.000 title abstract description 11
- 102000004885 Protease-activated receptor 4 Human genes 0.000 title description 11
- 108090001010 Protease-activated receptor 4 Proteins 0.000 title description 11
- 102100040853 PRKC apoptosis WT1 regulator protein Human genes 0.000 title 1
- 101710162991 PRKC apoptosis WT1 regulator protein Proteins 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 198
- 150000003839 salts Chemical group 0.000 claims abstract description 56
- 239000012453 solvate Chemical group 0.000 claims abstract description 48
- 239000003814 drug Substances 0.000 claims abstract description 11
- 238000000034 method Methods 0.000 claims description 468
- 239000000203 mixture Substances 0.000 claims description 163
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 123
- -1 carboxy, carbonyl Chemical group 0.000 claims description 111
- 229910052739 hydrogen Inorganic materials 0.000 claims description 85
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 75
- 125000000217 alkyl group Chemical group 0.000 claims description 64
- 125000005843 halogen group Chemical group 0.000 claims description 58
- 229940002612 prodrug Drugs 0.000 claims description 48
- 239000000651 prodrug Substances 0.000 claims description 48
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 45
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 44
- 229910052731 fluorine Inorganic materials 0.000 claims description 41
- 229910052757 nitrogen Inorganic materials 0.000 claims description 41
- 229910052801 chlorine Inorganic materials 0.000 claims description 38
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 36
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 36
- 125000003545 alkoxy group Chemical group 0.000 claims description 35
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 35
- 230000009424 thromboembolic effect Effects 0.000 claims description 35
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 35
- 125000001072 heteroaryl group Chemical group 0.000 claims description 30
- 125000003118 aryl group Chemical group 0.000 claims description 29
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 28
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 28
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 28
- 229910052794 bromium Inorganic materials 0.000 claims description 27
- 125000001424 substituent group Chemical group 0.000 claims description 27
- 125000001153 fluoro group Chemical group F* 0.000 claims description 23
- 125000004414 alkyl thio group Chemical group 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 235000019000 fluorine Nutrition 0.000 claims description 20
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims description 19
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 17
- 229910052799 carbon Inorganic materials 0.000 claims description 17
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 17
- 125000000623 heterocyclic group Chemical group 0.000 claims description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 17
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 17
- 238000011282 treatment Methods 0.000 claims description 17
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 16
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 15
- 238000011321 prophylaxis Methods 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 12
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 11
- 125000000304 alkynyl group Chemical group 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 10
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052740 iodine Inorganic materials 0.000 claims description 9
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 9
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 claims description 8
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 claims description 7
- 239000008194 pharmaceutical composition Substances 0.000 claims description 7
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 6
- 125000000041 C6-C10 aryl group Chemical group 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- 229940126629 PAR4 antagonist Drugs 0.000 claims description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 150000001721 carbon Chemical group 0.000 claims description 5
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 5
- 230000002526 effect on cardiovascular system Effects 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 4
- 125000006661 (C4-C6) heterocyclic group Chemical group 0.000 claims description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 claims description 4
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 3
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 3
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 3
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 3
- 229940124597 therapeutic agent Drugs 0.000 claims description 3
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 2
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 2
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 2
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical group F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 claims description 2
- 108010081348 HRT1 protein Hairy Chemical group 0.000 claims description 2
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 claims description 2
- 101150020251 NR13 gene Proteins 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000000638 benzylaminocarbonyl group Chemical group C(C1=CC=CC=C1)NC(=O)* 0.000 claims description 2
- 125000005366 cycloalkylthio group Chemical group 0.000 claims description 2
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 claims description 2
- 125000005368 heteroarylthio group Chemical group 0.000 claims description 2
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 2
- 125000004468 heterocyclylthio group Chemical group 0.000 claims description 2
- 230000002401 inhibitory effect Effects 0.000 claims description 2
- 230000003836 peripheral circulation Effects 0.000 claims description 2
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 4
- 125000002653 sulfanylmethyl group Chemical group [H]SC([H])([H])[*] 0.000 claims 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 438
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 303
- 238000005160 1H NMR spectroscopy Methods 0.000 description 253
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 237
- 239000007787 solid Substances 0.000 description 195
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 168
- 101150041968 CDC13 gene Proteins 0.000 description 164
- 238000004128 high performance liquid chromatography Methods 0.000 description 150
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 147
- 230000014759 maintenance of location Effects 0.000 description 141
- 239000000463 material Substances 0.000 description 119
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 112
- 239000000243 solution Substances 0.000 description 107
- 238000005481 NMR spectroscopy Methods 0.000 description 100
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 92
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 90
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 84
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 82
- 239000011541 reaction mixture Substances 0.000 description 81
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 80
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 78
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 72
- 238000006243 chemical reaction Methods 0.000 description 66
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 62
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 56
- 239000000047 product Substances 0.000 description 47
- 239000012267 brine Substances 0.000 description 46
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 46
- 238000003818 flash chromatography Methods 0.000 description 42
- 235000017557 sodium bicarbonate Nutrition 0.000 description 41
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 41
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 36
- 239000012074 organic phase Substances 0.000 description 34
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 230000015572 biosynthetic process Effects 0.000 description 32
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- 239000000725 suspension Substances 0.000 description 30
- 239000007858 starting material Substances 0.000 description 29
- 208000035475 disorder Diseases 0.000 description 28
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 28
- 235000019341 magnesium sulphate Nutrition 0.000 description 28
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 28
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 27
- 238000010992 reflux Methods 0.000 description 26
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 25
- 238000003786 synthesis reaction Methods 0.000 description 24
- 239000000706 filtrate Substances 0.000 description 22
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- 229910052796 boron Inorganic materials 0.000 description 20
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 20
- 239000007832 Na2SO4 Substances 0.000 description 19
- 150000002148 esters Chemical class 0.000 description 19
- 229910052938 sodium sulfate Inorganic materials 0.000 description 19
- 235000011152 sodium sulphate Nutrition 0.000 description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- 238000002953 preparative HPLC Methods 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 17
- 238000001816 cooling Methods 0.000 description 17
- 238000001914 filtration Methods 0.000 description 17
- 239000003921 oil Substances 0.000 description 16
- 235000019198 oils Nutrition 0.000 description 16
- 230000002829 reductive effect Effects 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- 238000004587 chromatography analysis Methods 0.000 description 15
- 239000002002 slurry Substances 0.000 description 15
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 15
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 14
- 238000000746 purification Methods 0.000 description 14
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 14
- 239000000543 intermediate Substances 0.000 description 13
- 239000012044 organic layer Substances 0.000 description 13
- PCLAZAJARAIGGD-UHFFFAOYSA-N 5-methylsulfanyl-1,3,4-thiadiazol-2-amine Chemical compound CSC1=NN=C(N)S1 PCLAZAJARAIGGD-UHFFFAOYSA-N 0.000 description 12
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 125000004429 atom Chemical group 0.000 description 12
- 125000005605 benzo group Chemical group 0.000 description 12
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 12
- UVNXNSUKKOLFBM-UHFFFAOYSA-N imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=CSC2=NC=CN21 UVNXNSUKKOLFBM-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 239000012071 phase Substances 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 10
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 10
- 241000282414 Homo sapiens Species 0.000 description 10
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 10
- 239000008346 aqueous phase Substances 0.000 description 10
- 238000009833 condensation Methods 0.000 description 10
- 230000005494 condensation Effects 0.000 description 10
- 238000010828 elution Methods 0.000 description 10
- 239000000499 gel Substances 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- GLYQQFBHCFPEEU-UHFFFAOYSA-N 5-bromo-1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=C(Br)S1 GLYQQFBHCFPEEU-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 229910000024 caesium carbonate Inorganic materials 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 239000012065 filter cake Substances 0.000 description 9
- 125000001188 haloalkyl group Chemical group 0.000 description 9
- 229910052698 phosphorus Inorganic materials 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000007821 HATU Substances 0.000 description 8
- 125000002947 alkylene group Chemical group 0.000 description 8
- 238000001035 drying Methods 0.000 description 8
- 238000007429 general method Methods 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 7
- LJVDARVSEIAXKH-UHFFFAOYSA-N 1-(4,6-dimethoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC(OC)=C2C=C(C(C)=O)OC2=C1 LJVDARVSEIAXKH-UHFFFAOYSA-N 0.000 description 7
- 150000002500 ions Chemical class 0.000 description 7
- 125000002950 monocyclic group Chemical group 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- NWHKKDLPTKZXQK-UHFFFAOYSA-N 1,2-dioxin-4-one Chemical compound O=C1COOC=C1 NWHKKDLPTKZXQK-UHFFFAOYSA-N 0.000 description 6
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 6
- APNURAWEOILOJP-UHFFFAOYSA-N 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazol-6-ol Chemical compound C1=C(O)C=C2OC(C3=CN4N=C(SC4=N3)SC)=NC2=C1 APNURAWEOILOJP-UHFFFAOYSA-N 0.000 description 6
- SXIWONMBBPYIGN-UHFFFAOYSA-N 6-[5-bromo-4-(methoxymethoxy)-1-benzofuran-2-yl]-2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazole Chemical compound COCOc1c(Br)ccc2oc(cc12)-c1cn2nc(SC)sc2n1 SXIWONMBBPYIGN-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 6
- 108091006629 SLC13A2 Proteins 0.000 description 6
- 108090000190 Thrombin Proteins 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 239000013058 crude material Substances 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 150000002576 ketones Chemical class 0.000 description 6
- 235000015320 potassium carbonate Nutrition 0.000 description 6
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- 150000003457 sulfones Chemical class 0.000 description 6
- 150000003573 thiols Chemical class 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 6
- 239000003643 water by type Substances 0.000 description 6
- DNYJUUSAYDJKAF-UHFFFAOYSA-N 2-amino-4-(trifluoromethoxy)phenol Chemical compound NC1=CC(OC(F)(F)F)=CC=C1O DNYJUUSAYDJKAF-UHFFFAOYSA-N 0.000 description 5
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 5
- FNQAEUBXLFDRKW-UHFFFAOYSA-N 2-nitro-4-(trifluoromethoxy)phenol Chemical compound OC1=CC=C(OC(F)(F)F)C=C1[N+]([O-])=O FNQAEUBXLFDRKW-UHFFFAOYSA-N 0.000 description 5
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 5
- 208000007536 Thrombosis Diseases 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 229940127218 antiplatelet drug Drugs 0.000 description 5
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 5
- 125000002619 bicyclic group Chemical group 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 235000011089 carbon dioxide Nutrition 0.000 description 5
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- OAMZXMDZZWGPMH-UHFFFAOYSA-N ethyl acetate;toluene Chemical compound CCOC(C)=O.CC1=CC=CC=C1 OAMZXMDZZWGPMH-UHFFFAOYSA-N 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 125000001624 naphthyl group Chemical group 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 230000002441 reversible effect Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 150000003462 sulfoxides Chemical class 0.000 description 5
- 239000006188 syrup Substances 0.000 description 5
- 235000020357 syrup Nutrition 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- 238000001665 trituration Methods 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical class NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 description 4
- LQQKDSXCDXHLLF-UHFFFAOYSA-N 1,3-dibromopropan-2-one Chemical compound BrCC(=O)CBr LQQKDSXCDXHLLF-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- IVXXMVYYCIITOP-UHFFFAOYSA-N 1-(6-methoxy-4-phenylmethoxy-1-benzofuran-2-yl)ethanone Chemical compound C=12C=C(C(C)=O)OC2=CC(OC)=CC=1OCC1=CC=CC=C1 IVXXMVYYCIITOP-UHFFFAOYSA-N 0.000 description 4
- HMQDKHYZAQBSHA-UHFFFAOYSA-N 2-(2-methoxyimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-4-ol Chemical compound C1=CC=C2OC(C3=CN4N=C(SC4=N3)OC)=CC2=C1O HMQDKHYZAQBSHA-UHFFFAOYSA-N 0.000 description 4
- BVVADHWOBXKOBE-UHFFFAOYSA-N 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-4-ol Chemical compound C1=CC=C2OC(C3=CN4N=C(SC4=N3)SC)=CC2=C1O BVVADHWOBXKOBE-UHFFFAOYSA-N 0.000 description 4
- ZVEBWNWBDVYZTH-UHFFFAOYSA-N 2-(2-methylsulfonylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzothiazole Chemical compound C1=CC=C2SC(C3=CN4N=C(SC4=N3)S(=O)(=O)C)=NC2=C1 ZVEBWNWBDVYZTH-UHFFFAOYSA-N 0.000 description 4
- WZUODJNEIXSNEU-UHFFFAOYSA-N 2-Hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(O)=C1 WZUODJNEIXSNEU-UHFFFAOYSA-N 0.000 description 4
- TUBMMSDANPXJLA-UHFFFAOYSA-N 2-bromo-1-(5-chloro-6-methoxy-1-benzofuran-2-yl)ethanone Chemical compound C1=C(Cl)C(OC)=CC2=C1C=C(C(=O)CBr)O2 TUBMMSDANPXJLA-UHFFFAOYSA-N 0.000 description 4
- RSNYAHAEAIMVQM-UHFFFAOYSA-N 2-bromo-1-[4-(methoxymethoxy)-1-benzofuran-2-yl]ethanone Chemical compound COCOC1=CC=CC2=C1C=C(C(=O)CBr)O2 RSNYAHAEAIMVQM-UHFFFAOYSA-N 0.000 description 4
- OBDXMNPHNNSQGU-UHFFFAOYSA-N 2-bromo-6-(5-chloro-6-methoxy-1-benzofuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole Chemical compound C1=C(Cl)C(OC)=CC2=C1C=C(C=1N=C3SC(Br)=NN3C=1)O2 OBDXMNPHNNSQGU-UHFFFAOYSA-N 0.000 description 4
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- URDJRGDXIXBMLP-UHFFFAOYSA-N 5-(1,1-difluoroethyl)-1,3,4-thiadiazol-2-amine Chemical compound CC(F)(F)C1=NN=C(N)S1 URDJRGDXIXBMLP-UHFFFAOYSA-N 0.000 description 4
- OEGSQIOYOVYWHF-UHFFFAOYSA-N 5-(1-fluoroethyl)-1,3,4-thiadiazol-2-amine Chemical compound CC(F)C1=NN=C(N)S1 OEGSQIOYOVYWHF-UHFFFAOYSA-N 0.000 description 4
- XUYVSAMSJCSGNW-UHFFFAOYSA-N 6-methoxy-2-(2-methoxyimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-4-ol Chemical compound C1=C(OC)C=C2OC(C3=CN4N=C(SC4=N3)OC)=CC2=C1O XUYVSAMSJCSGNW-UHFFFAOYSA-N 0.000 description 4
- 208000004476 Acute Coronary Syndrome Diseases 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical class CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 229910003827 NRaRb Inorganic materials 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 102000002020 Protease-activated receptors Human genes 0.000 description 4
- 108050009310 Protease-activated receptors Proteins 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 206010047249 Venous thrombosis Diseases 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 125000005236 alkanoylamino group Chemical group 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 239000000538 analytical sample Substances 0.000 description 4
- 239000003146 anticoagulant agent Substances 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 4
- 150000003935 benzaldehydes Chemical class 0.000 description 4
- 239000012455 biphasic mixture Substances 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- AMBPCLUHIVATGB-UHFFFAOYSA-N ethyl 2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylate Chemical compound N1=C(SC)SC2=NC(C(=O)OCC)=CN21 AMBPCLUHIVATGB-UHFFFAOYSA-N 0.000 description 4
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 4
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 4
- USEQRCSKKPBJEY-UHFFFAOYSA-N imidazo[2,1-b][1,3,4]thiadiazole-6-carboxamide Chemical compound N1=CSC2=NC(C(=O)N)=CN21 USEQRCSKKPBJEY-UHFFFAOYSA-N 0.000 description 4
- 125000005647 linker group Chemical group 0.000 description 4
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 4
- YKUCHDXIBAQWSF-UHFFFAOYSA-N methyl 3-hydroxybenzoate Chemical compound COC(=O)C1=CC=CC(O)=C1 YKUCHDXIBAQWSF-UHFFFAOYSA-N 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 239000003039 volatile agent Substances 0.000 description 4
- VVHLRXBWCJUTGG-UHFFFAOYSA-N 1-benzofuran-6-carboxamide Chemical compound NC(=O)C1=CC=C2C=COC2=C1 VVHLRXBWCJUTGG-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- SLZSRLCQAGKEPI-UHFFFAOYSA-N 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazole Chemical compound C1=CC=C2OC(C3=CN4N=C(SC4=N3)SC)=NC2=C1 SLZSRLCQAGKEPI-UHFFFAOYSA-N 0.000 description 3
- KHDWCLJSBRRCMN-UHFFFAOYSA-N 2-amino-5-methoxybenzene-1,3-diol Chemical compound COC1=CC(O)=C(N)C(O)=C1 KHDWCLJSBRRCMN-UHFFFAOYSA-N 0.000 description 3
- MSKKMTVOTKUCGI-UHFFFAOYSA-N 2-bromo-1-(4-chlorofuro[3,2-c]pyridin-2-yl)ethanone Chemical compound ClC1=NC=CC2=C1C=C(C(=O)CBr)O2 MSKKMTVOTKUCGI-UHFFFAOYSA-N 0.000 description 3
- IVCLADNOMPGVJV-UHFFFAOYSA-N 2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid Chemical compound C1=C(C(O)=O)N=C2SC(SC)=NN21 IVCLADNOMPGVJV-UHFFFAOYSA-N 0.000 description 3
- WZUOZXFYRZFFEW-UHFFFAOYSA-N 4-fluoro-3-methoxyphenol Chemical compound COC1=CC(O)=CC=C1F WZUOZXFYRZFFEW-UHFFFAOYSA-N 0.000 description 3
- UXNKAYGYEOGTFB-UHFFFAOYSA-N 5-(1,1,2,2-tetrafluoroethyl)-1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=C(C(F)(F)C(F)F)S1 UXNKAYGYEOGTFB-UHFFFAOYSA-N 0.000 description 3
- LKEWQRLFCBIXAZ-UHFFFAOYSA-N 5-[chloro(difluoro)methyl]-1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=C(C(F)(F)Cl)S1 LKEWQRLFCBIXAZ-UHFFFAOYSA-N 0.000 description 3
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 206010002388 Angina unstable Diseases 0.000 description 3
- 206010003178 Arterial thrombosis Diseases 0.000 description 3
- 208000032843 Hemorrhage Diseases 0.000 description 3
- 101001098529 Homo sapiens Proteinase-activated receptor 1 Proteins 0.000 description 3
- 101000713169 Homo sapiens Solute carrier family 52, riboflavin transporter, member 2 Proteins 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- NFHFRUOZVGFOOS-UHFFFAOYSA-N Pd(PPh3)4 Substances [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 3
- 102100037136 Proteinase-activated receptor 1 Human genes 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 3
- 208000006011 Stroke Diseases 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 208000032109 Transient ischaemic attack Diseases 0.000 description 3
- 208000007814 Unstable Angina Diseases 0.000 description 3
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000004450 alkenylene group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 208000034158 bleeding Diseases 0.000 description 3
- 230000000740 bleeding effect Effects 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical compound C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- VICYTAYPKBLQFB-UHFFFAOYSA-N ethyl 3-bromo-2-oxopropanoate Chemical compound CCOC(=O)C(=O)CBr VICYTAYPKBLQFB-UHFFFAOYSA-N 0.000 description 3
- 125000004438 haloalkoxy group Chemical group 0.000 description 3
- 201000004332 intermediate coronary syndrome Diseases 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 238000003760 magnetic stirring Methods 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 208000010125 myocardial infarction Diseases 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- BEZDDPMMPIDMGJ-UHFFFAOYSA-N pentamethylbenzene Chemical compound CC1=CC(C)=C(C)C(C)=C1C BEZDDPMMPIDMGJ-UHFFFAOYSA-N 0.000 description 3
- 239000000106 platelet aggregation inhibitor Substances 0.000 description 3
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229910052701 rubidium Inorganic materials 0.000 description 3
- 230000011664 signaling Effects 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 201000010875 transient cerebral ischemia Diseases 0.000 description 3
- OKKJLVBELUTLKV-FIBGUPNXSA-N trideuteriomethanol Chemical compound [2H]C([2H])([2H])O OKKJLVBELUTLKV-FIBGUPNXSA-N 0.000 description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 3
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 3
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 2
- HOBFSNNENNQQIU-SNVBAGLBSA-N (2r)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetic acid Chemical compound CC(C)(C)OC(=O)N[C@@H](C(O)=O)C1=CC=CC=C1 HOBFSNNENNQQIU-SNVBAGLBSA-N 0.000 description 2
- YKOBLHQALWQKTC-UHFFFAOYSA-N (3-fluorophenyl)thiourea Chemical compound NC(=S)NC1=CC=CC(F)=C1 YKOBLHQALWQKTC-UHFFFAOYSA-N 0.000 description 2
- TYRPHHUJSDCXEE-ONEGZZNKSA-N (e)-3-(furan-2-yl)prop-2-enoyl azide Chemical compound [N-]=[N+]=NC(=O)\C=C\C1=CC=CO1 TYRPHHUJSDCXEE-ONEGZZNKSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 2
- KKVHSAJPSSICAL-UHFFFAOYSA-N 1-(4,6-dihydroxy-1-benzofuran-2-yl)ethanone Chemical compound C1=C(O)C=C2OC(C(=O)C)=CC2=C1O KKVHSAJPSSICAL-UHFFFAOYSA-N 0.000 description 2
- WYWCCBXVKPYSIF-UHFFFAOYSA-N 1-(4-chlorofuro[3,2-c]pyridin-2-yl)ethanone Chemical compound N1=CC=C2OC(C(=O)C)=CC2=C1Cl WYWCCBXVKPYSIF-UHFFFAOYSA-N 0.000 description 2
- PIPIDZNKJXBEJT-UHFFFAOYSA-N 1-(4-methoxy-1,3-benzothiazol-2-yl)ethanone Chemical compound COC1=CC=CC2=C1N=C(C(C)=O)S2 PIPIDZNKJXBEJT-UHFFFAOYSA-N 0.000 description 2
- UPWQUEPUCGYGBD-UHFFFAOYSA-N 1-(4-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=CC2=C1C=C(C(C)=O)O2 UPWQUEPUCGYGBD-UHFFFAOYSA-N 0.000 description 2
- YOAGUQNUCLGKKI-UHFFFAOYSA-N 1-(5-chloro-6-methoxy-1-benzofuran-2-yl)ethanone Chemical compound C1=C(Cl)C(OC)=CC2=C1C=C(C(C)=O)O2 YOAGUQNUCLGKKI-UHFFFAOYSA-N 0.000 description 2
- URONTMDMSCMUCO-UHFFFAOYSA-N 1-(5-methoxy-7-phenylmethoxy-1-benzofuran-2-yl)ethanone Chemical compound C=12OC(C(C)=O)=CC2=CC(OC)=CC=1OCC1=CC=CC=C1 URONTMDMSCMUCO-UHFFFAOYSA-N 0.000 description 2
- KBUQRUOKPLKHRP-UHFFFAOYSA-N 1-(6,7-dimethoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=C2C=C(C(C)=O)OC2=C1OC KBUQRUOKPLKHRP-UHFFFAOYSA-N 0.000 description 2
- MUUMFANQVPWPFY-UHFFFAOYSA-N 1-(7-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=CC2=C1OC(C(C)=O)=C2 MUUMFANQVPWPFY-UHFFFAOYSA-N 0.000 description 2
- CFBCZETZIPZOGW-UHFFFAOYSA-N 1-benzofuran-4-ol Chemical compound OC1=CC=CC2=C1C=CO2 CFBCZETZIPZOGW-UHFFFAOYSA-N 0.000 description 2
- DFPYXQYWILNVAU-UHFFFAOYSA-N 1-hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1.C1=CC=C2N(O)N=NC2=C1 DFPYXQYWILNVAU-UHFFFAOYSA-N 0.000 description 2
- JNWCFPDCGFPJSO-UHFFFAOYSA-N 2-(1,1-difluoroethyl)-n-(2-hydroxy-6-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carboxamide Chemical compound CC1=CC=CC(O)=C1NC(=O)C1=CN(N=C(S2)C(C)(F)F)C2=N1 JNWCFPDCGFPJSO-UHFFFAOYSA-N 0.000 description 2
- GTDQPOAWYGZRKX-UHFFFAOYSA-N 2-(1,1-difluoroethyl)-n-(2-hydroxy-6-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carboxamide Chemical compound N1=C2SC(C(F)(F)C)=NN2C=C1C(=O)NC1=C(O)C=CC=C1[N+]([O-])=O GTDQPOAWYGZRKX-UHFFFAOYSA-N 0.000 description 2
- UYRWBSJZHKKPRR-UHFFFAOYSA-N 2-(1,1-difluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carbonyl chloride Chemical compound C1=C(C(Cl)=O)N=C2SC(C(F)(F)C)=NN21 UYRWBSJZHKKPRR-UHFFFAOYSA-N 0.000 description 2
- VBFCUDINXBXWES-UHFFFAOYSA-N 2-(2-ethylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-7-ol Chemical compound C1=CC(O)=C2OC(C3=CN4N=C(SC4=N3)CC)=CC2=C1 VBFCUDINXBXWES-UHFFFAOYSA-N 0.000 description 2
- NQEPWAFGKZPZIX-UHFFFAOYSA-N 2-(2-methoxyimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazole Chemical compound C1=CC=C2OC(C3=CN4N=C(SC4=N3)OC)=NC2=C1 NQEPWAFGKZPZIX-UHFFFAOYSA-N 0.000 description 2
- OUHLIKNUGLDDEP-UHFFFAOYSA-N 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazol-4-amine Chemical compound C1=CC=C2OC(C3=CN4N=C(SC4=N3)SC)=NC2=C1N OUHLIKNUGLDDEP-UHFFFAOYSA-N 0.000 description 2
- XDQKMIQNDCGJKD-UHFFFAOYSA-N 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazol-4-ol Chemical compound C1=CC=C2OC(C3=CN4N=C(SC4=N3)SC)=NC2=C1O XDQKMIQNDCGJKD-UHFFFAOYSA-N 0.000 description 2
- ZSLMDXAIWGWRHX-UHFFFAOYSA-N 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-4-carboxylic acid Chemical compound C1=CC=C2OC(C3=CN4N=C(SC4=N3)SC)=CC2=C1C(O)=O ZSLMDXAIWGWRHX-UHFFFAOYSA-N 0.000 description 2
- ADKYFFRLMMKTEJ-UHFFFAOYSA-N 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-6-phenylmethoxy-1,3-benzoxazole Chemical compound N1=C2SC(SC)=NN2C=C1C(OC1=C2)=NC1=CC=C2OCC1=CC=CC=C1 ADKYFFRLMMKTEJ-UHFFFAOYSA-N 0.000 description 2
- LRKZHWDRXLESSU-UHFFFAOYSA-N 2-(2-methylsulfonylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazole Chemical compound C1=CC=C2OC(C3=CN4N=C(SC4=N3)S(=O)(=O)C)=NC2=C1 LRKZHWDRXLESSU-UHFFFAOYSA-N 0.000 description 2
- HZKDYRZVVJOBSO-UHFFFAOYSA-N 2-[2-(1-fluoroethyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]-1,3-benzothiazole Chemical compound C1=CC=C2SC(C3=CN4N=C(SC4=N3)C(F)C)=NC2=C1 HZKDYRZVVJOBSO-UHFFFAOYSA-N 0.000 description 2
- TUADYTFWZPZZTP-UHFFFAOYSA-N 2-amino-4-methoxyphenol Chemical compound COC1=CC=C(O)C(N)=C1 TUADYTFWZPZZTP-UHFFFAOYSA-N 0.000 description 2
- QXTRPGAMVIONMK-UHFFFAOYSA-N 2-amino-5-ethyl-1,3,4-thiadiazole Chemical compound CCC1=NN=C(N)S1 QXTRPGAMVIONMK-UHFFFAOYSA-N 0.000 description 2
- MDIAVSZFIQWYST-UHFFFAOYSA-N 2-amino-6-fluorophenol Chemical compound NC1=CC=CC(F)=C1O MDIAVSZFIQWYST-UHFFFAOYSA-N 0.000 description 2
- ZMXYNJXDULEQCK-UHFFFAOYSA-N 2-amino-p-cresol Chemical compound CC1=CC=C(O)C(N)=C1 ZMXYNJXDULEQCK-UHFFFAOYSA-N 0.000 description 2
- PGGLQLMOSVRDGZ-UHFFFAOYSA-N 2-bromo-1-(4,6-dimethoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC(OC)=C2C=C(C(=O)CBr)OC2=C1 PGGLQLMOSVRDGZ-UHFFFAOYSA-N 0.000 description 2
- SYXGFVBMXZHUEE-UHFFFAOYSA-N 2-bromo-1-(4-methoxy-1,3-benzothiazol-2-yl)ethanone Chemical compound COC1=CC=CC2=C1N=C(C(=O)CBr)S2 SYXGFVBMXZHUEE-UHFFFAOYSA-N 0.000 description 2
- PKEYYBJCHLXORM-UHFFFAOYSA-N 2-bromo-1-(4-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=CC2=C1C=C(C(=O)CBr)O2 PKEYYBJCHLXORM-UHFFFAOYSA-N 0.000 description 2
- FYZXCQKIPFSJCQ-UHFFFAOYSA-N 2-bromo-1-(6,7-dimethoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=C2C=C(C(=O)CBr)OC2=C1OC FYZXCQKIPFSJCQ-UHFFFAOYSA-N 0.000 description 2
- BMEWKFJUOJVBPO-UHFFFAOYSA-N 2-bromo-1-(7-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC=CC2=C1OC(C(=O)CBr)=C2 BMEWKFJUOJVBPO-UHFFFAOYSA-N 0.000 description 2
- NFROOVCUQSYKFX-UHFFFAOYSA-N 2-bromo-n-(2,6-dihydroxy-4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carboxamide Chemical compound OC1=CC(OC)=CC(O)=C1NC(=O)C1=CN(N=C(Br)S2)C2=N1 NFROOVCUQSYKFX-UHFFFAOYSA-N 0.000 description 2
- LUPNYBVYDCUZGL-UHFFFAOYSA-N 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carbonyl chloride Chemical compound N1=C(Br)SC2=NC(C(=O)Cl)=CN21 LUPNYBVYDCUZGL-UHFFFAOYSA-N 0.000 description 2
- WIJRPAZEAZYPEQ-UHFFFAOYSA-N 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid Chemical compound N1=C(Br)SC2=NC(C(=O)O)=CN21 WIJRPAZEAZYPEQ-UHFFFAOYSA-N 0.000 description 2
- KUMAMLWGLKXTCA-UHFFFAOYSA-N 2-ethyl-6-(7-methoxy-1-benzofuran-2-yl)imidazo[2,1-b][1,3,4]thiadiazole Chemical compound C1=CC(OC)=C2OC(C3=CN4N=C(SC4=N3)CC)=CC2=C1 KUMAMLWGLKXTCA-UHFFFAOYSA-N 0.000 description 2
- SVVNEEADTVEIMO-UHFFFAOYSA-N 2-hydroxy-4-methoxy-6-phenylmethoxybenzaldehyde Chemical compound COC1=CC(O)=C(C=O)C(OCC=2C=CC=CC=2)=C1 SVVNEEADTVEIMO-UHFFFAOYSA-N 0.000 description 2
- LTBXMZAULXZVSK-UHFFFAOYSA-N 2-hydroxy-6-(2-methoxyethoxy)benzaldehyde Chemical compound COCCOC1=CC=CC(O)=C1C=O LTBXMZAULXZVSK-UHFFFAOYSA-N 0.000 description 2
- SENWBWHBBQOPAQ-UHFFFAOYSA-N 2-methoxyimidazo[2,1-b][1,3,4]thiadiazole-6-carbonyl chloride Chemical compound C1=C(C(Cl)=O)N=C2SC(OC)=NN21 SENWBWHBBQOPAQ-UHFFFAOYSA-N 0.000 description 2
- PIVAAHHDLQLGGY-UHFFFAOYSA-N 2-methoxyimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid Chemical compound C1=C(C(O)=O)N=C2SC(OC)=NN21 PIVAAHHDLQLGGY-UHFFFAOYSA-N 0.000 description 2
- RDKGZQJHOBVLIG-UHFFFAOYSA-N 2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazole-6-carbonyl chloride Chemical compound C1=C(C(Cl)=O)N=C2SC(SC)=NN21 RDKGZQJHOBVLIG-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 2
- NWDHTEIVMDYWQJ-UHFFFAOYSA-N 3-fluoro-2-hydroxybenzaldehyde Chemical compound OC1=C(F)C=CC=C1C=O NWDHTEIVMDYWQJ-UHFFFAOYSA-N 0.000 description 2
- HUACNYNNCGOIQB-UHFFFAOYSA-N 4-chloro-2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)furo[3,2-c]pyridine Chemical compound N1=CC=C2OC(C3=CN4N=C(SC4=N3)SC)=CC2=C1Cl HUACNYNNCGOIQB-UHFFFAOYSA-N 0.000 description 2
- OPFFYLJLHPZSEO-UHFFFAOYSA-N 4-chlorofuro[3,2-c]pyridine Chemical compound ClC1=NC=CC2=C1C=CO2 OPFFYLJLHPZSEO-UHFFFAOYSA-N 0.000 description 2
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- XQPAPBLJJLIQGV-UHFFFAOYSA-N 4-methoxy-1,3-benzothiazole Chemical compound COC1=CC=CC2=C1N=CS2 XQPAPBLJJLIQGV-UHFFFAOYSA-N 0.000 description 2
- ZZMHVBPSRKMWLT-UHFFFAOYSA-N 5-chloro-2-hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC(O)=C(C=O)C=C1Cl ZZMHVBPSRKMWLT-UHFFFAOYSA-N 0.000 description 2
- RTVJRZMNNIHDFJ-UHFFFAOYSA-N 5-fluoro-2-hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC(O)=C(C=O)C=C1F RTVJRZMNNIHDFJ-UHFFFAOYSA-N 0.000 description 2
- DRHLSQJZTGPDMP-UHFFFAOYSA-N 5-methoxy-1,3,4-thiadiazol-2-amine Chemical compound COC1=NN=C(N)S1 DRHLSQJZTGPDMP-UHFFFAOYSA-N 0.000 description 2
- AMMJPEQDMSDGQL-UHFFFAOYSA-N 5-methoxy-2-(2-methoxyimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-7-ol Chemical compound COC1=CC(O)=C2OC(C3=CN4N=C(SC4=N3)OC)=CC2=C1 AMMJPEQDMSDGQL-UHFFFAOYSA-N 0.000 description 2
- FUELYBCVVDMRMT-UHFFFAOYSA-N 5-methoxy-2-nitrobenzene-1,3-diol Chemical compound COC1=CC(O)=C([N+]([O-])=O)C(O)=C1 FUELYBCVVDMRMT-UHFFFAOYSA-N 0.000 description 2
- FYNCIYHECMWXPK-UHFFFAOYSA-N 5h-furo[3,2-c]pyridin-4-one Chemical compound O=C1NC=CC2=C1C=CO2 FYNCIYHECMWXPK-UHFFFAOYSA-N 0.000 description 2
- CXDBSYVQJLPZJE-UHFFFAOYSA-N 6-methoxy-2-(2-methoxyimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-4-phenylmethoxy-1,3-benzoxazole Chemical compound N1=C2SC(OC)=NN2C=C1C(OC1=CC(OC)=C2)=NC1=C2OCC1=CC=CC=C1 CXDBSYVQJLPZJE-UHFFFAOYSA-N 0.000 description 2
- ALPFTSOQNABTFV-UHFFFAOYSA-N 6-methoxy-2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazol-4-ol Chemical compound COC1=CC(O)=C2N=C(C=3N=C4SC(SC)=NN4C=3)OC2=C1 ALPFTSOQNABTFV-UHFFFAOYSA-N 0.000 description 2
- OORVSRYPVKKNEE-UHFFFAOYSA-N 6-methoxy-2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazole Chemical compound COC1=CC=C2N=C(C=3N=C4SC(SC)=NN4C=3)OC2=C1 OORVSRYPVKKNEE-UHFFFAOYSA-N 0.000 description 2
- VGENDFLHNFJIGW-UHFFFAOYSA-N 6-methyl-4-(trifluoromethyl)furo[2,3-b]pyridine-2-carboxylic acid Chemical compound CC1=CC(C(F)(F)F)=C2C=C(C(O)=O)OC2=N1 VGENDFLHNFJIGW-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- 206010003658 Atrial Fibrillation Diseases 0.000 description 2
- 239000005552 B01AC04 - Clopidogrel Substances 0.000 description 2
- 229910015845 BBr3 Inorganic materials 0.000 description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 2
- 101100401100 Caenorhabditis elegans mes-1 gene Proteins 0.000 description 2
- 206010008088 Cerebral artery embolism Diseases 0.000 description 2
- 206010008092 Cerebral artery thrombosis Diseases 0.000 description 2
- 206010051055 Deep vein thrombosis Diseases 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 208000005189 Embolism Diseases 0.000 description 2
- 206010014513 Embolism arterial Diseases 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910004373 HOAc Inorganic materials 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 241000282567 Macaca fascicularis Species 0.000 description 2
- UAGJVSRUFNSIHR-UHFFFAOYSA-N Methyl levulinate Chemical compound COC(=O)CCC(C)=O UAGJVSRUFNSIHR-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 2
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 2
- 208000000770 Non-ST Elevated Myocardial Infarction Diseases 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 208000005764 Peripheral Arterial Disease Diseases 0.000 description 2
- 208000030831 Peripheral arterial occlusive disease Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 229940123645 Protease-activated receptor-4 antagonist Drugs 0.000 description 2
- 208000010378 Pulmonary Embolism Diseases 0.000 description 2
- 208000006117 ST-elevation myocardial infarction Diseases 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 208000007718 Stable Angina Diseases 0.000 description 2
- 239000005864 Sulphur Substances 0.000 description 2
- 229940122388 Thrombin inhibitor Drugs 0.000 description 2
- 108010000499 Thromboplastin Proteins 0.000 description 2
- 102000002262 Thromboplastin Human genes 0.000 description 2
- HYKOSRYWIURWQI-UHFFFAOYSA-N [2-(trifluoromethoxy)phenyl]thiourea Chemical compound NC(=S)NC1=CC=CC=C1OC(F)(F)F HYKOSRYWIURWQI-UHFFFAOYSA-N 0.000 description 2
- CKUAXEQHGKSLHN-UHFFFAOYSA-N [C].[N] Chemical group [C].[N] CKUAXEQHGKSLHN-UHFFFAOYSA-N 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000004419 alkynylene group Chemical group 0.000 description 2
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 230000002785 anti-thrombosis Effects 0.000 description 2
- 229940127219 anticoagulant drug Drugs 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical class BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- GKTWGGQPFAXNFI-HNNXBMFYSA-N clopidogrel Chemical compound C1([C@H](N2CC=3C=CSC=3CC2)C(=O)OC)=CC=CC=C1Cl GKTWGGQPFAXNFI-HNNXBMFYSA-N 0.000 description 2
- 229960003009 clopidogrel Drugs 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 2
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 2
- 231100000673 dose–response relationship Toxicity 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- OXGWNKVGDKPFGH-UHFFFAOYSA-N ethyl 2-(1,1-difluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carboxylate Chemical compound N1=C(C(C)(F)F)SC2=NC(C(=O)OCC)=CN21 OXGWNKVGDKPFGH-UHFFFAOYSA-N 0.000 description 2
- CULJNUPGWIINQJ-UHFFFAOYSA-N ethyl 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylate Chemical compound N1=C(Br)SC2=NC(C(=O)OCC)=CN21 CULJNUPGWIINQJ-UHFFFAOYSA-N 0.000 description 2
- HLKYLRBQFQLDQA-UHFFFAOYSA-N ethyl 2-ethylimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylate Chemical compound N1=C(CC)SC2=NC(C(=O)OCC)=CN21 HLKYLRBQFQLDQA-UHFFFAOYSA-N 0.000 description 2
- QDTJAUMUNBVNQS-UHFFFAOYSA-N ethyl 2-methoxyimidazo[2,1-b][1,3,4]thiadiazole-6-carboxylate Chemical compound N1=C(OC)SC2=NC(C(=O)OCC)=CN21 QDTJAUMUNBVNQS-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- RLBRZMUOZZGMQL-UHFFFAOYSA-N furo[2,3-b]pyridine-2-carboxamide Chemical compound NC(=O)c1cc2cccnc2o1 RLBRZMUOZZGMQL-UHFFFAOYSA-N 0.000 description 2
- YRTCKZIKGWZNCU-UHFFFAOYSA-N furo[3,2-b]pyridine Chemical compound C1=CC=C2OC=CC2=N1 YRTCKZIKGWZNCU-UHFFFAOYSA-N 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000007943 implant Substances 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 201000010849 intracranial embolism Diseases 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- 229940127215 low-molecular weight heparin Drugs 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 229940120152 methyl 3-hydroxybenzoate Drugs 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000003607 modifier Substances 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- 239000004570 mortar (masonry) Substances 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- VZUPDKQVALWPCE-UHFFFAOYSA-N n-methoxythiadiazol-4-amine Chemical compound CONC1=CSN=N1 VZUPDKQVALWPCE-UHFFFAOYSA-N 0.000 description 2
- 239000012038 nucleophile Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 2
- 230000010118 platelet activation Effects 0.000 description 2
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 2
- 238000004007 reversed phase HPLC Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 238000000527 sonication Methods 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 238000002560 therapeutic procedure Methods 0.000 description 2
- DENPQNAWGQXKCU-UHFFFAOYSA-N thiophene-2-carboxamide Chemical compound NC(=O)C1=CC=CS1 DENPQNAWGQXKCU-UHFFFAOYSA-N 0.000 description 2
- 239000003868 thrombin inhibitor Substances 0.000 description 2
- 201000005060 thrombophlebitis Diseases 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- 229960005044 vorapaxar Drugs 0.000 description 2
- ZBGXUVOIWDMMJE-QHNZEKIYSA-N vorapaxar Chemical compound C(/[C@@H]1[C@H]2[C@H](C(O[C@@H]2C)=O)C[C@H]2[C@H]1CC[C@H](C2)NC(=O)OCC)=C\C(N=C1)=CC=C1C1=CC=CC(F)=C1 ZBGXUVOIWDMMJE-QHNZEKIYSA-N 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RRKODOZNUZCUBN-CCAGOZQPSA-N (1z,3z)-cycloocta-1,3-diene Chemical compound C1CC\C=C/C=C\C1 RRKODOZNUZCUBN-CCAGOZQPSA-N 0.000 description 1
- GVVCHDNSTMEUCS-MUGJNUQGSA-N (2s,5s)-1-[2-[(2s,5s)-2,5-diethylphospholan-1-yl]phenyl]-2,5-diethylphospholane Chemical compound CC[C@H]1CC[C@H](CC)P1C1=CC=CC=C1P1[C@@H](CC)CC[C@@H]1CC GVVCHDNSTMEUCS-MUGJNUQGSA-N 0.000 description 1
- AFKLSWIRJUJWKY-UHFFFAOYSA-N (3-phenylmethoxyphenyl)methanol Chemical compound OCC1=CC=CC(OCC=2C=CC=CC=2)=C1 AFKLSWIRJUJWKY-UHFFFAOYSA-N 0.000 description 1
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 description 1
- ZCJLOOJRNPHKAV-ONEGZZNKSA-N (e)-3-(furan-2-yl)prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC=CO1 ZCJLOOJRNPHKAV-ONEGZZNKSA-N 0.000 description 1
- STKREJOKFJJZNL-UHFFFAOYSA-N 1,1,1-trifluoropentane-2,3-dione Chemical compound CCC(=O)C(=O)C(F)(F)F STKREJOKFJJZNL-UHFFFAOYSA-N 0.000 description 1
- 125000006002 1,1-difluoroethyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- ODRZAZBEQWAOGU-UHFFFAOYSA-N 1,4-dioxin-2-one Chemical compound O=C1COC=CO1 ODRZAZBEQWAOGU-UHFFFAOYSA-N 0.000 description 1
- FSNGFFWICFYWQC-UHFFFAOYSA-N 1-(2-chloroethyl)pyrrolidine;hydron;chloride Chemical compound Cl.ClCCN1CCCC1 FSNGFFWICFYWQC-UHFFFAOYSA-N 0.000 description 1
- ZNTXLOUGKPYDPS-UHFFFAOYSA-N 1-(7-hydroxy-5-methoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC(O)=C2OC(C(C)=O)=CC2=C1 ZNTXLOUGKPYDPS-UHFFFAOYSA-N 0.000 description 1
- ITJWNXBZSFIJTP-UHFFFAOYSA-N 1-(bromomethyl)-3-phenylmethoxybenzene Chemical compound BrCC1=CC=CC(OCC=2C=CC=CC=2)=C1 ITJWNXBZSFIJTP-UHFFFAOYSA-N 0.000 description 1
- XDIWVQMOOOJHEH-UHFFFAOYSA-N 1-[4-(methoxymethoxy)-1-benzofuran-2-yl]ethanone Chemical compound COCOC1=CC=CC2=C1C=C(C(C)=O)O2 XDIWVQMOOOJHEH-UHFFFAOYSA-N 0.000 description 1
- BBUZMYNKLWUQGD-UHFFFAOYSA-N 1-bromopyrrolidine-2,5-dione;oxolane Chemical compound C1CCOC1.BrN1C(=O)CCC1=O BBUZMYNKLWUQGD-UHFFFAOYSA-N 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- PMWGIVRHUIAIII-UHFFFAOYSA-N 2,2-difluoropropanoic acid Chemical compound CC(F)(F)C(O)=O PMWGIVRHUIAIII-UHFFFAOYSA-N 0.000 description 1
- UIEPHJGHOSEFRG-UHFFFAOYSA-N 2-(1,1-difluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carbonyl chloride hydrobromide Chemical compound Br.CC(F)(F)c1nn2cc(nc2s1)C(Cl)=O UIEPHJGHOSEFRG-UHFFFAOYSA-N 0.000 description 1
- WNODHJJUSXVFTB-UHFFFAOYSA-N 2-(1,1-difluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid Chemical compound C1=C(C(O)=O)N=C2SC(C(F)(F)C)=NN21 WNODHJJUSXVFTB-UHFFFAOYSA-N 0.000 description 1
- LEWOZGMAXXCWCN-UHFFFAOYSA-N 2-(1,1-difluoroethyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carboxylic acid;hydrobromide Chemical compound Br.C1=C(C(O)=O)N=C2SC(C(F)(F)C)=NN21 LEWOZGMAXXCWCN-UHFFFAOYSA-N 0.000 description 1
- BQMUKADQEJFADT-UHFFFAOYSA-N 2-(2-methoxyimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-4-[(3-phenylmethoxyphenyl)methoxy]-1-benzofuran-6-ol Chemical compound N1=C2SC(OC)=NN2C=C1C(OC1=CC(O)=C2)=CC1=C2OCC(C=1)=CC=CC=1OCC1=CC=CC=C1 BQMUKADQEJFADT-UHFFFAOYSA-N 0.000 description 1
- XPXGJBYKGDZFQK-UHFFFAOYSA-N 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2OC(C3=CN4N=C(SC4=N3)SC)=CC2=C1 XPXGJBYKGDZFQK-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 1
- ZFCOUBUSGHLCDT-UHFFFAOYSA-N 2-(trifluoromethoxy)aniline Chemical compound NC1=CC=CC=C1OC(F)(F)F ZFCOUBUSGHLCDT-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- YEFVWEZGNNYERZ-UHFFFAOYSA-N 2-[2-(1,1-difluoroethyl)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]-1,3-benzothiazole Chemical compound C1=CC=C2SC(C3=CN4N=C(SC4=N3)C(F)(F)C)=NC2=C1 YEFVWEZGNNYERZ-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- 125000005273 2-acetoxybenzoic acid group Chemical group 0.000 description 1
- MLONYBFKXHEPCD-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(N)(CO)CO.OCC(N)(CO)CO MLONYBFKXHEPCD-UHFFFAOYSA-N 0.000 description 1
- FEDLEBCVFZMHBP-UHFFFAOYSA-N 2-amino-3-methylphenol Chemical compound CC1=CC=CC(O)=C1N FEDLEBCVFZMHBP-UHFFFAOYSA-N 0.000 description 1
- KUCWUAFNGCMZDB-UHFFFAOYSA-N 2-amino-3-nitrophenol Chemical compound NC1=C(O)C=CC=C1[N+]([O-])=O KUCWUAFNGCMZDB-UHFFFAOYSA-N 0.000 description 1
- JEPCLNGRAIMPQV-UHFFFAOYSA-N 2-aminobenzene-1,3-diol Chemical compound NC1=C(O)C=CC=C1O JEPCLNGRAIMPQV-UHFFFAOYSA-N 0.000 description 1
- TUTAENHNIFTQRD-UHFFFAOYSA-N 2-bromo-1-(7-bromo-4,6-dimethoxy-1-benzofuran-2-yl)ethanone Chemical compound COC1=CC(OC)=C2C=C(C(=O)CBr)OC2=C1Br TUTAENHNIFTQRD-UHFFFAOYSA-N 0.000 description 1
- JMOOUBFNEFPQAN-UHFFFAOYSA-N 2-bromo-1-(7-ethoxy-1-benzofuran-2-yl)ethanone Chemical compound CCOC1=CC=CC2=C1OC(C(=O)CBr)=C2 JMOOUBFNEFPQAN-UHFFFAOYSA-N 0.000 description 1
- BHQSQSNOQJTFTE-UHFFFAOYSA-N 2-bromo-6-(5-chloro-6-methoxy-1-benzofuran-2-yl)-2,3-dihydroimidazo[2,1-b][1,3,4]thiadiazole Chemical compound BrC1NN2C(S1)=NC(=C2)C=2OC1=C(C2)C=C(C(=C1)OC)Cl BHQSQSNOQJTFTE-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- OAWAZQITIZDJRB-UHFFFAOYSA-N 2-chloro-2,2-difluoroacetic acid Chemical compound OC(=O)C(F)(F)Cl OAWAZQITIZDJRB-UHFFFAOYSA-N 0.000 description 1
- GPIQOFWTZXXOOV-UHFFFAOYSA-N 2-chloro-4,6-dimethoxy-1,3,5-triazine Chemical compound COC1=NC(Cl)=NC(OC)=N1 GPIQOFWTZXXOOV-UHFFFAOYSA-N 0.000 description 1
- DTPNCXQEYIABGF-UHFFFAOYSA-N 2-ethyl-n-(2-hydroxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole-6-carboxamide Chemical compound N1=C2SC(CC)=NN2C=C1C(=O)NC1=CC=CC=C1O DTPNCXQEYIABGF-UHFFFAOYSA-N 0.000 description 1
- GGDYAKVUZMZKRV-UHFFFAOYSA-N 2-fluoroethanol Chemical compound OCCF GGDYAKVUZMZKRV-UHFFFAOYSA-N 0.000 description 1
- HFHFGHLXUCOHLN-UHFFFAOYSA-N 2-fluorophenol Chemical compound OC1=CC=CC=C1F HFHFGHLXUCOHLN-UHFFFAOYSA-N 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- UIOMNPYQUBMBOJ-UHFFFAOYSA-N 2-hydroxy-3,4-dimethoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(O)=C1OC UIOMNPYQUBMBOJ-UHFFFAOYSA-N 0.000 description 1
- XIKGRPKDQDFXLF-UHFFFAOYSA-N 2-hydroxy-3,4-dimethoxybenzaldehyde Natural products COC1=CC(O)=C(C=O)C=C1OC XIKGRPKDQDFXLF-UHFFFAOYSA-N 0.000 description 1
- FQRQWPNYJOFDLO-UHFFFAOYSA-N 2-hydroxy-4,6-dimethoxybenzaldehyde Chemical compound COC1=CC(O)=C(C=O)C(OC)=C1 FQRQWPNYJOFDLO-UHFFFAOYSA-N 0.000 description 1
- GSHNZOVUGRZEON-UHFFFAOYSA-N 2-hydroxy-6-(methoxymethoxy)benzaldehyde Chemical compound COCOC1=CC=CC(O)=C1C=O GSHNZOVUGRZEON-UHFFFAOYSA-N 0.000 description 1
- DZJPDDVDKXHRLF-UHFFFAOYSA-N 2-hydroxy-6-methoxybenzaldehyde Chemical compound COC1=CC=CC(O)=C1C=O DZJPDDVDKXHRLF-UHFFFAOYSA-N 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- ZLCPKMIJYMHZMJ-UHFFFAOYSA-N 2-nitrobenzene-1,3-diol Chemical compound OC1=CC=CC(O)=C1[N+]([O-])=O ZLCPKMIJYMHZMJ-UHFFFAOYSA-N 0.000 description 1
- 125000006088 2-oxoazepinyl group Chemical group 0.000 description 1
- 125000004638 2-oxopiperazinyl group Chemical group O=C1N(CCNC1)* 0.000 description 1
- 125000006087 2-oxopyrrolodinyl group Chemical group 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- UZGLOGCJCWBBIV-UHFFFAOYSA-N 3-(chloromethyl)pyridin-1-ium;chloride Chemical compound Cl.ClCC1=CC=CN=C1 UZGLOGCJCWBBIV-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- QZVQQUVWFIZUBQ-UHFFFAOYSA-N 3-fluoroaniline Chemical compound NC1=CC=CC(F)=C1 QZVQQUVWFIZUBQ-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- YSURRMGJTOKALN-UHFFFAOYSA-N 4-(trifluoromethoxy)-1,3-benzothiazol-2-amine Chemical compound C1=CC=C2SC(N)=NC2=C1OC(F)(F)F YSURRMGJTOKALN-UHFFFAOYSA-N 0.000 description 1
- XUJFOSLZQITUOI-UHFFFAOYSA-N 4-(trifluoromethoxy)aniline Chemical compound NC1=CC=C(OC(F)(F)F)C=C1 XUJFOSLZQITUOI-UHFFFAOYSA-N 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- NMBXYMWWAULDAY-UHFFFAOYSA-N 4-chloro-2-(2-methoxyimidazo[2,1-b][1,3,4]thiadiazol-6-yl)furo[3,2-c]pyridine Chemical compound N1=CC=C2OC(C3=CN4N=C(SC4=N3)OC)=CC2=C1Cl NMBXYMWWAULDAY-UHFFFAOYSA-N 0.000 description 1
- NALVGTOMKSKFFV-UHFFFAOYSA-N 4-fluoro-3-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1F NALVGTOMKSKFFV-UHFFFAOYSA-N 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- YEBCRAVYUWNFQT-UHFFFAOYSA-N 4-methoxy-1,3-benzothiazol-2-amine Chemical compound COC1=CC=CC2=C1N=C(N)S2 YEBCRAVYUWNFQT-UHFFFAOYSA-N 0.000 description 1
- WZBZHHVVXJFVGP-UHFFFAOYSA-N 4-methoxy-2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzothiazole Chemical compound COC1=CC=CC2=C1N=C(C=1N=C3SC(SC)=NN3C=1)S2 WZBZHHVVXJFVGP-UHFFFAOYSA-N 0.000 description 1
- YBUGOACXDPDUIR-UHFFFAOYSA-N 4-methoxy-2-nitrophenol Chemical compound COC1=CC=C(O)C([N+]([O-])=O)=C1 YBUGOACXDPDUIR-UHFFFAOYSA-N 0.000 description 1
- 125000003119 4-methyl-3-pentenyl group Chemical group [H]\C(=C(/C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- OHSSWZLKWHLYFP-UHFFFAOYSA-N 5-bromo-2-hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC(O)=C(C=O)C=C1Br OHSSWZLKWHLYFP-UHFFFAOYSA-N 0.000 description 1
- XFJBGINZIMNZBW-CRAIPNDOSA-N 5-chloro-2-[4-[(1r,2s)-2-[2-(5-methylsulfonylpyridin-2-yl)oxyethyl]cyclopropyl]piperidin-1-yl]pyrimidine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OCC[C@H]1[C@@H](C2CCN(CC2)C=2N=CC(Cl)=CN=2)C1 XFJBGINZIMNZBW-CRAIPNDOSA-N 0.000 description 1
- MORIZURVDKRFGW-UHFFFAOYSA-N 5-fluoro-2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzothiazole Chemical compound FC1=CC=C2SC(C3=CN4N=C(SC4=N3)SC)=NC2=C1 MORIZURVDKRFGW-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- GBULSPRXEFXSIW-UHFFFAOYSA-N 6-(2-fluoroethoxy)-2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzoxazole Chemical compound C1=C(OCCF)C=C2OC(C3=CN4N=C(SC4=N3)SC)=NC2=C1 GBULSPRXEFXSIW-UHFFFAOYSA-N 0.000 description 1
- LPWHLHODPBVAFE-UHFFFAOYSA-N 6-fluoro-2-(2-methoxyimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1,3-benzothiazole Chemical compound C1=C(F)C=C2SC(C3=CN4N=C(SC4=N3)OC)=NC2=C1 LPWHLHODPBVAFE-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 201000011244 Acrocallosal syndrome Diseases 0.000 description 1
- QNZCBYKSOIHPEH-UHFFFAOYSA-N Apixaban Chemical compound C1=CC(OC)=CC=C1N1C(C(=O)N(CC2)C=3C=CC(=CC=3)N3C(CCCC3)=O)=C2C(C(N)=O)=N1 QNZCBYKSOIHPEH-UHFFFAOYSA-N 0.000 description 1
- 200000000007 Arterial disease Diseases 0.000 description 1
- QWKAUGRRIXBIPO-UHFFFAOYSA-N Atopaxar Chemical compound N=C1C=2C(F)=C(OCC)C(OCC)=CC=2CN1CC(=O)C(C=C(C=1OC)C(C)(C)C)=CC=1N1CCOCC1 QWKAUGRRIXBIPO-UHFFFAOYSA-N 0.000 description 1
- 239000005465 B01AC22 - Prasugrel Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 101100512899 Caenorhabditis elegans mes-3 gene Proteins 0.000 description 1
- 101100512901 Caenorhabditis elegans mes-4 gene Proteins 0.000 description 1
- 101100352919 Caenorhabditis elegans ppm-2 gene Proteins 0.000 description 1
- 206010007688 Carotid artery thrombosis Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000614261 Citrus hongheensis Species 0.000 description 1
- 108020004635 Complementary DNA Proteins 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241001480079 Corymbia calophylla Species 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 101100512902 Drosophila melanogaster Mes-4 gene Proteins 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- PXRROZVNOOEPPZ-UHFFFAOYSA-N Flupropanate Chemical compound OC(=O)C(F)(F)C(F)F PXRROZVNOOEPPZ-UHFFFAOYSA-N 0.000 description 1
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 1
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 101150026303 HEX1 gene Proteins 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 239000004284 Heptyl p-hydroxybenzoate Substances 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 235000006552 Liquidambar styraciflua Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910020667 PBr3 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229940098892 Protease-activated receptor-1 antagonist Drugs 0.000 description 1
- 206010037437 Pulmonary thrombosis Diseases 0.000 description 1
- FTALBRSUTCGOEG-UHFFFAOYSA-N Riluzole Chemical compound C1=C(OC(F)(F)F)C=C2SC(N)=NC2=C1 FTALBRSUTCGOEG-UHFFFAOYSA-N 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- 229910007991 Si-N Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910006294 Si—N Inorganic materials 0.000 description 1
- 206010042434 Sudden death Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 101000712605 Theromyzon tessulatum Theromin Proteins 0.000 description 1
- 102000003790 Thrombin receptors Human genes 0.000 description 1
- 108090000166 Thrombin receptors Proteins 0.000 description 1
- 208000001435 Thromboembolism Diseases 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 206010053648 Vascular occlusion Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 1
- RAFKCLFWELPONH-UHFFFAOYSA-N acetonitrile;dichloromethane Chemical compound CC#N.ClCCl RAFKCLFWELPONH-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 208000019905 acrocephalosyndactyly Diseases 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 206010051895 acute chest syndrome Diseases 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- NMPVEAUIHMEAQP-UHFFFAOYSA-N alpha-bromo-acetaldehyde Natural products BrCC=O NMPVEAUIHMEAQP-UHFFFAOYSA-N 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 229950003476 aminothiazole Drugs 0.000 description 1
- XKMRRTOUMJRJIA-UHFFFAOYSA-N ammonia nh3 Chemical compound N.N XKMRRTOUMJRJIA-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 229940127090 anticoagulant agent Drugs 0.000 description 1
- 238000013176 antiplatelet therapy Methods 0.000 description 1
- 229960004676 antithrombotic agent Drugs 0.000 description 1
- 229960003886 apixaban Drugs 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000005325 aryloxy aryl group Chemical group 0.000 description 1
- 230000007214 atherothrombosis Effects 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229950007648 atopaxar Drugs 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 150000001602 bicycloalkyls Chemical group 0.000 description 1
- 239000012867 bioactive agent Substances 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical group 0.000 description 1
- 230000007211 cardiovascular event Effects 0.000 description 1
- BJDCWCLMFKKGEE-CMDXXVQNSA-N chembl252518 Chemical compound C([C@@](OO1)(C)O2)C[C@H]3[C@H](C)CC[C@@H]4[C@@]31[C@@H]2O[C@H](O)[C@@H]4C BJDCWCLMFKKGEE-CMDXXVQNSA-N 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 101150018621 cra gene Proteins 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- XSYZCZPCBXYQTE-UHFFFAOYSA-N cyclodecylcyclodecane Chemical compound C1CCCCCCCCC1C1CCCCCCCCC1 XSYZCZPCBXYQTE-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 229960003850 dabigatran Drugs 0.000 description 1
- YBSJFWOBGCMAKL-UHFFFAOYSA-N dabigatran Chemical group N=1C2=CC(C(=O)N(CCC(O)=O)C=3N=CC=CC=3)=CC=C2N(C)C=1CNC1=CC=C(C(N)=N)C=C1 YBSJFWOBGCMAKL-UHFFFAOYSA-N 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- JMRYOSQOYJBDOI-UHFFFAOYSA-N dilithium;di(propan-2-yl)azanide Chemical compound [Li+].CC(C)[N-]C(C)C.CC(C)N([Li])C(C)C JMRYOSQOYJBDOI-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- UZZWBUYVTBPQIV-UHFFFAOYSA-N dme dimethoxyethane Chemical compound COCCOC.COCCOC UZZWBUYVTBPQIV-UHFFFAOYSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- HDVRLUFGYQYLFJ-UHFFFAOYSA-N flamenol Chemical compound COC1=CC(O)=CC(O)=C1 HDVRLUFGYQYLFJ-UHFFFAOYSA-N 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 125000003709 fluoroalkyl group Chemical group 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- PTCGDEVVHUXTMP-UHFFFAOYSA-N flutolanil Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C(F)(F)F)=C1 PTCGDEVVHUXTMP-UHFFFAOYSA-N 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000006343 heptafluoro propyl group Chemical group 0.000 description 1
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- YUWFEBAXEOLKSG-UHFFFAOYSA-N hexamethylbenzene Chemical compound CC1=C(C)C(C)=C(C)C(C)=C1C YUWFEBAXEOLKSG-UHFFFAOYSA-N 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000004896 high resolution mass spectrometry Methods 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- 150000004680 hydrogen peroxides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N hydroxymaleic acid group Chemical group O/C(/C(=O)O)=C/C(=O)O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- SYJRVVFAAIUVDH-UHFFFAOYSA-N ipa isopropanol Chemical compound CC(C)O.CC(C)O SYJRVVFAAIUVDH-UHFFFAOYSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000003971 isoxazolinyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- MWBHYGFCYWPSCI-UHFFFAOYSA-N methyl 2-(2-bromoacetyl)-1-benzofuran-4-carboxylate Chemical compound COC(=O)C1=CC=CC2=C1C=C(C(=O)CBr)O2 MWBHYGFCYWPSCI-UHFFFAOYSA-N 0.000 description 1
- VVAWBYIUCVEGOO-UHFFFAOYSA-N methyl 2-(2-bromoacetyl)-1-benzofuran-6-carboxylate Chemical compound COC(=O)C1=CC=C2C=C(C(=O)CBr)OC2=C1 VVAWBYIUCVEGOO-UHFFFAOYSA-N 0.000 description 1
- VVLRUCFIAPVNLD-UHFFFAOYSA-N methyl 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-4-carboxylate Chemical compound COC(=O)C1=CC=CC2=C1C=C(C=1N=C3SC(SC)=NN3C=1)O2 VVLRUCFIAPVNLD-UHFFFAOYSA-N 0.000 description 1
- NMZMBCSPYKEXLL-UHFFFAOYSA-N methyl 2-(2-methylsulfanylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)-1-benzofuran-6-carboxylate Chemical compound COC(=O)C1=CC=C2C=C(C=3N=C4SC(SC)=NN4C=3)OC2=C1 NMZMBCSPYKEXLL-UHFFFAOYSA-N 0.000 description 1
- HCQUYIDTEHMXQS-UHFFFAOYSA-N methyl 2-methyl-1,3-oxazole-5-carboxylate Chemical compound COC(=O)C1=CN=C(C)O1 HCQUYIDTEHMXQS-UHFFFAOYSA-N 0.000 description 1
- KLKQGSISBRVCTK-UHFFFAOYSA-N methyl 5-aminofuran-2-carboxylate Chemical compound COC(=O)C1=CC=C(N)O1 KLKQGSISBRVCTK-UHFFFAOYSA-N 0.000 description 1
- LSIRXJFLKDBZMD-UHFFFAOYSA-N methyl 6-methyl-4-(trifluoromethyl)furo[2,3-b]pyridine-2-carboxylate Chemical compound C1=C(C)N=C2OC(C(=O)OC)=CC2=C1C(F)(F)F LSIRXJFLKDBZMD-UHFFFAOYSA-N 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- ADAMEOZKZQRNKP-UHFFFAOYSA-N n'-propylmethanediimine Chemical compound CCCN=C=N ADAMEOZKZQRNKP-UHFFFAOYSA-N 0.000 description 1
- PEECTLLHENGOKU-UHFFFAOYSA-N n,n-dimethylpyridin-4-amine Chemical compound CN(C)C1=CC=NC=C1.CN(C)C1=CC=NC=C1 PEECTLLHENGOKU-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- PSACHCMMPFMFAJ-UHFFFAOYSA-N nmm n-methylmorpholine Chemical compound CN1CCOCC1.CN1CCOCC1 PSACHCMMPFMFAJ-UHFFFAOYSA-N 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- LYKMMUBOEFYJQG-UHFFFAOYSA-N piperoxan Chemical compound C1OC2=CC=CC=C2OC1CN1CCCCC1 LYKMMUBOEFYJQG-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- LBKJNHPKYFYCLL-UHFFFAOYSA-N potassium;trimethyl(oxido)silane Chemical compound [K+].C[Si](C)(C)[O-] LBKJNHPKYFYCLL-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- DTGLZDAWLRGWQN-UHFFFAOYSA-N prasugrel Chemical compound C1CC=2SC(OC(=O)C)=CC=2CN1C(C=1C(=CC=CC=1)F)C(=O)C1CC1 DTGLZDAWLRGWQN-UHFFFAOYSA-N 0.000 description 1
- 229960004197 prasugrel Drugs 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000004224 protection Effects 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 230000006337 proteolytic cleavage Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 150000004728 pyruvic acid derivatives Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000000700 radioactive tracer Substances 0.000 description 1
- 230000000306 recurrent effect Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229960001148 rivaroxaban Drugs 0.000 description 1
- KGFYHTZWPPHNLQ-AWEZNQCLSA-N rivaroxaban Chemical compound S1C(Cl)=CC=C1C(=O)NC[C@@H]1OC(=O)N(C=2C=CC(=CC=2)N2C(COCC2)=O)C1 KGFYHTZWPPHNLQ-AWEZNQCLSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- WGRULTCAYDOGQK-UHFFFAOYSA-M sodium;sodium;hydroxide Chemical compound [OH-].[Na].[Na+] WGRULTCAYDOGQK-UHFFFAOYSA-M 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 125000005017 substituted alkenyl group Chemical group 0.000 description 1
- 125000004426 substituted alkynyl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- BFFLLBPMZCIGRM-MRVPVSSYSA-N tert-butyl (2r)-2-(hydroxymethyl)pyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@@H]1CO BFFLLBPMZCIGRM-MRVPVSSYSA-N 0.000 description 1
- BFFLLBPMZCIGRM-QMMMGPOBSA-N tert-butyl (2s)-2-(hydroxymethyl)pyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC[C@H]1CO BFFLLBPMZCIGRM-QMMMGPOBSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000006092 tetrahydro-1,1-dioxothienyl group Chemical group 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- PHCBRBWANGJMHS-UHFFFAOYSA-J tetrasodium;disulfate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O PHCBRBWANGJMHS-UHFFFAOYSA-J 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 125000006090 thiamorpholinyl sulfone group Chemical group 0.000 description 1
- 125000006089 thiamorpholinyl sulfoxide group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- 125000005403 thiohaloalkoxy group Chemical group 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- OEKWJQXRCDYSHL-FNOIDJSQSA-N ticagrelor Chemical compound C1([C@@H]2C[C@H]2NC=2N=C(N=C3N([C@H]4[C@@H]([C@H](O)[C@@H](OCCO)C4)O)N=NC3=2)SCCC)=CC=C(F)C(F)=C1 OEKWJQXRCDYSHL-FNOIDJSQSA-N 0.000 description 1
- 229960002528 ticagrelor Drugs 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- AHZJKOKFZJYCLG-UHFFFAOYSA-K trifluoromethanesulfonate;ytterbium(3+) Chemical compound [Yb+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F AHZJKOKFZJYCLG-UHFFFAOYSA-K 0.000 description 1
- 125000004385 trihaloalkyl group Chemical group 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 1
- 235000019798 tripotassium phosphate Nutrition 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 208000021331 vascular occlusion disease Diseases 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- PJVWKTKQMONHTI-UHFFFAOYSA-N warfarin Chemical compound OC=1C2=CC=CC=C2OC(=O)C=1C(CC(=O)C)C1=CC=CC=C1 PJVWKTKQMONHTI-UHFFFAOYSA-N 0.000 description 1
- 229960005080 warfarin Drugs 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/433—Thidiazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/4353—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems
- A61K31/4355—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom ortho- or peri-condensed with heterocyclic ring systems the heterocyclic ring system containing a five-membered ring having oxygen as a ring hetero atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/4439—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. omeprazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/535—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one oxygen as the ring hetero atoms, e.g. 1,2-oxazines
- A61K31/5375—1,4-Oxazines, e.g. morpholine
- A61K31/5377—1,4-Oxazines, e.g. morpholine not condensed and containing further heterocyclic rings, e.g. timolol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Epidemiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201261638591P | 2012-04-26 | 2012-04-26 | |
| US61/638,591 | 2012-04-26 | ||
| PCT/US2013/037892 WO2013163244A1 (en) | 2012-04-26 | 2013-04-24 | Imidazothiadiazole derivatives as protease activated receptor 4 (par4) inhibitors for treating platelet aggregation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2871637A1 true CA2871637A1 (en) | 2013-10-31 |
Family
ID=48225152
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2871637A Abandoned CA2871637A1 (en) | 2012-04-26 | 2013-04-24 | Imidazothiadiazole derivatives as protease activated receptor 4 (par4) inhibitors for treating platelet aggregation |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US9862730B2 (enExample) |
| EP (1) | EP2847200B1 (enExample) |
| JP (1) | JP6181744B2 (enExample) |
| KR (1) | KR20150003767A (enExample) |
| CN (1) | CN104540835B (enExample) |
| AU (1) | AU2013251683A1 (enExample) |
| BR (1) | BR112014026493A2 (enExample) |
| CA (1) | CA2871637A1 (enExample) |
| EA (1) | EA201491967A1 (enExample) |
| ES (1) | ES2625029T3 (enExample) |
| IL (1) | IL235140A0 (enExample) |
| MX (1) | MX2014012454A (enExample) |
| SG (1) | SG11201406759YA (enExample) |
| WO (1) | WO2013163244A1 (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SI3243826T1 (sl) | 2012-04-26 | 2020-03-31 | Bristol-Myers Squibb Company | Derivati imidazotiadiazola in imidazopirazina kot proteazno aktivirani receptor 4 (PAR4) inhibitorji za zdravljenje agregacije trombocitov |
| MX2014012741A (es) | 2012-04-26 | 2015-04-13 | Bristol Myers Squibb Co | Derivados de imidazotiadiazol e imidazopirazina como inhibidores del receptor 4 activado de proteasa (par4) para tratamiento de agregacion plaquetaria. |
| US9617279B1 (en) | 2014-06-24 | 2017-04-11 | Bristol-Myers Squibb Company | Imidazooxadiazole compounds |
| US9598419B1 (en) | 2014-06-24 | 2017-03-21 | Universite De Montreal | Imidazotriazine and imidazodiazine compounds |
| EP4006016A3 (en) * | 2014-08-29 | 2022-11-16 | CHDI Foundation, Inc. | Probes for imaging huntingtin protein |
| WO2016125621A1 (ja) * | 2015-02-03 | 2016-08-11 | 住友化学株式会社 | ベンゾイミダゾール化合物及びその有害節足動物防除用途 |
| WO2016125622A1 (ja) * | 2015-02-03 | 2016-08-11 | 住友化学株式会社 | ベンゾオキサゾール化合物及びその有害節足動物防除用途 |
| US10214544B2 (en) | 2015-02-26 | 2019-02-26 | Universite De Montreal | Imidazopyridazine and imidazothiadiazole compounds |
| WO2016138199A1 (en) | 2015-02-26 | 2016-09-01 | Bristol-Myers Squibb Company | Benzothiazole and benzothiophne compounds |
| US9789087B2 (en) | 2015-08-03 | 2017-10-17 | Thomas Jefferson University | PAR4 inhibitor therapy for patients with PAR4 polymorphism |
| CN108283000B (zh) | 2015-09-23 | 2021-04-13 | 凯瑞康宁生物工程(武汉)有限公司 | γ-羟基丁酸的前药及其组合物和用途 |
| WO2017066863A1 (en) | 2015-10-19 | 2017-04-27 | Universite De Montreal | Heterocyclic compounds as inhibitors of platelet aggregation |
| US20190119300A1 (en) * | 2016-04-18 | 2019-04-25 | Vanderbilt University | Substituted and fused 6-membered protease activated receptor 4 (par-4) antagonists |
| US20190315774A1 (en) | 2016-07-14 | 2019-10-17 | Bristol-Myers Squibb Company | Tricyclic heteroaryl-substituted quinoline and azaquinoline compounds as par4 inhibitors |
| KR102494647B1 (ko) | 2016-07-14 | 2023-01-31 | 브리스톨-마이어스 스큅 컴퍼니 | 비시클릭 헤테로아릴 치환된 화합물 |
| WO2018013774A1 (en) | 2016-07-14 | 2018-01-18 | Bristol-Myers Squibb Company | Bicyclic heteroaryl substituted compounds |
| US10815224B2 (en) | 2016-07-14 | 2020-10-27 | Bristol-Myers Squibb Company | Monocyclic heteroaryl substituted compounds |
| AU2017406159B2 (en) | 2017-03-30 | 2020-05-21 | XWPharma Ltd. | Bicyclic heteroaryl derivatives and preparation and uses thereof |
| FI3681911T3 (fi) | 2017-09-11 | 2024-12-30 | Univ Monash | Ihmisen trombiinireseptori PAR4:ään sitoutuvia proteiineja |
| CN111094300B (zh) * | 2018-01-31 | 2022-09-16 | 江苏恒瑞医药股份有限公司 | 苯并杂芳基类衍生物、其制备方法及其在医药上的应用 |
| CN110218218B (zh) * | 2018-03-01 | 2022-04-08 | 江苏恒瑞医药股份有限公司 | 苯并呋喃类衍生物、其制备方法及其在医药上的应用 |
| CN112074523B (zh) * | 2018-05-16 | 2022-08-09 | 深圳信立泰药业股份有限公司 | 作为用于治疗血小板聚集的蛋白酶激活受体4(par4)抑制剂的化合物 |
| CN112074522B (zh) * | 2018-05-16 | 2022-08-26 | 深圳信立泰药业股份有限公司 | 作为用于治疗血小板聚集的蛋白酶激活受体4(par4)抑制剂的化合物 |
| WO2019218956A1 (zh) * | 2018-05-16 | 2019-11-21 | 深圳信立泰药业股份有限公司 | 作为用于治疗血小板聚集的蛋白酶激活受体4(par4)抑制剂的化合物 |
| CN110627817B (zh) * | 2018-06-25 | 2022-03-29 | 中国药科大学 | 咪唑并环类par4拮抗剂及其医药用途 |
| WO2020062251A1 (en) | 2018-09-30 | 2020-04-02 | Xw Laboratories, Inc. | Compounds as neuronal histamine receptor-3 antagonists and uses thereof |
| JP7458406B2 (ja) | 2018-12-21 | 2024-03-29 | セルジーン コーポレーション | Ripk2のチエノピリジン阻害剤 |
| CN111349105B (zh) * | 2018-12-24 | 2023-04-07 | 江苏恒瑞医药股份有限公司 | 苯并呋喃类衍生物、其制备方法及其在医药上的应用 |
| CN111362970A (zh) * | 2018-12-25 | 2020-07-03 | 天津药物研究院有限公司 | 苯并呋喃类衍生物及其制备方法和用途 |
| CN110407697A (zh) * | 2019-08-28 | 2019-11-05 | 上海毕得医药科技有限公司 | 一种4-甲酰基-3-羟基苯甲酸甲酯的合成方法 |
| KR20250159079A (ko) | 2019-12-20 | 2025-11-07 | 엑스더블유파마 리미티드 | 4-발레릴옥시부티르산의 합성 방법 |
| WO2021257886A1 (en) | 2020-06-18 | 2021-12-23 | XWPharma Ltd. | Controlled release granulations of water-soluble active pharmaceutical ingredients |
| CA3183185A1 (en) | 2020-06-18 | 2021-12-23 | Jia-Ning Xiang | Pharmaceutical granulations of water-soluble active pharmaceutical ingredients |
| US11896573B2 (en) | 2020-07-24 | 2024-02-13 | XWPharma Ltd. | Pharmaceutical compositions and pharmacokinetics of a gamma-hydroxybutyric acid derivative |
| WO2022076466A1 (en) | 2020-10-05 | 2022-04-14 | XWPharma Ltd. | Modified release compositions of a gamma-hydroxybutyric acid derivative |
| EP4588471A3 (en) | 2021-03-19 | 2025-09-24 | XWPharma Ltd. | Pharmacokinetics of combined release formulations of a gamma-hydroxybutyric acid derivative |
| CN113150005B (zh) * | 2021-04-09 | 2022-08-30 | 中国药科大学 | 喹喔啉类化合物、制备方法及其在医药上的应用 |
| CN115521282B (zh) * | 2022-08-23 | 2023-10-27 | 大理大学 | 一种香豆素化合物E-Suberenol的合成工艺 |
| CN115636742B (zh) * | 2022-11-11 | 2024-04-09 | 江西亚太科技发展有限公司 | 一种重结晶的方法 |
Family Cites Families (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2823686A1 (de) * | 1978-05-31 | 1979-12-06 | Bayer Ag | Imidazo eckige klammer auf 2.1-b eckige klammer zu eckige klammer auf 1.3.4 eckige klammer zu -thiadiazole |
| US4444770A (en) | 1980-05-29 | 1984-04-24 | Bayer Aktiengesellschaft | New imidazoazole-alkenoic acid amide compounds, intermediate products for their production, their production, and their medicinal use |
| DE3020421A1 (de) | 1980-05-29 | 1981-12-10 | Bayer Ag, 5090 Leverkusen | Imidazoazolalkensaeureamide, neue zwischenprodukte zu ihrer herstellung, ihre herstellung und ihre verwendung in arzneimitteln |
| DE3446778A1 (de) | 1984-12-21 | 1986-07-03 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazoderivate, ihre herstellung und diese verbindungen enthaltende arzneimittel |
| US4925849A (en) | 1987-06-15 | 1990-05-15 | Fujisawa Pharmaceutical Company, Ltd. | Pharmaceutically useful pyrazolopyridines |
| GB8901423D0 (en) | 1989-01-23 | 1989-03-15 | Fujisawa Pharmaceutical Co | Pyrazolopyridine compound and processes for preparation thereof |
| ATE211384T1 (de) | 1991-01-29 | 2002-01-15 | Fujisawa Pharmaceutical Co | Verwendung von adenosinantagonisten zur vorbeugung und behandlung von pankreatitis und ulcera |
| JP2928079B2 (ja) | 1994-02-14 | 1999-07-28 | 永信薬品工業股▲ふん▼有限公司 | 1−(置換ベンジル)−3−(置換アリール)縮合ピラゾール類、その製造法及びその用途 |
| WO1999046232A1 (en) | 1998-03-10 | 1999-09-16 | Ono Pharmaceutical Co., Ltd. | Carboxylic acid derivatives and drugs containing the same as the active ingredient |
| IL149010A0 (en) | 1999-10-08 | 2002-11-10 | Gruenenthal Chemie | Bicyclic imidazo-5-yl-amine derivatives |
| DE19948434A1 (de) | 1999-10-08 | 2001-06-07 | Gruenenthal Gmbh | Substanzbibliothek enthaltend bicyclische Imidazo-5-amine und/oder bicyclische Imidazo-3-amine |
| DE10019714A1 (de) | 2000-04-20 | 2002-01-10 | Gruenenthal Gmbh | Salze von bicyclischen, N-acylierten Imidazo-3-aminen und Imidazo-5-aminen |
| US6387942B2 (en) | 2000-06-19 | 2002-05-14 | Yung Shin Pharmaceutical Ind. Co. Ltd | Method of treating disorders related to protease-activated receptors-induced cell activation |
| EP1442028A4 (en) | 2001-11-06 | 2009-11-04 | Bristol Myers Squibb Co | SUBSTITUTED ACID DERIVATIVES, WHICH APPRECIATE AS ANTIDIBILICS AND AGENTS AGAINST OBESITAS, AND METHODS |
| CA2364985A1 (en) | 2001-12-14 | 2003-06-14 | John W. Gillard | Imidazo(2,1-b)thiadiazole sulfonamides |
| KR101064077B1 (ko) | 2003-01-10 | 2011-09-08 | 이데미쓰 고산 가부시키가이샤 | 질소-함유 헤테로환 유도체 및 이를 이용한 유기 전기발광소자 |
| US20070112043A1 (en) | 2003-06-13 | 2007-05-17 | Jaquith James B | Acylated and non-acylated imidazo[2,1-b]-1,3,4,-thiadiazole-2-sulfonamides, and uses thereof |
| US20060135571A1 (en) | 2003-06-13 | 2006-06-22 | Jaquith James B | Imidazo(2,1-b)-1,3,4-thiadiazole sulfoxides and sulfones |
| CA2545711A1 (en) | 2003-11-13 | 2005-06-02 | Ambit Biosciences Corporation | Urea derivatives as kinase modulators |
| CA2555263A1 (en) | 2004-02-12 | 2005-09-01 | Neurogen Corporation | Imidazo-pyridazines, triazolo-pyridazines and related benzodiazepine receptor ligands |
| EP1893245A4 (en) | 2005-06-24 | 2009-06-24 | Univ Pennsylvania | RADIOMARQUE PEGYLATION OF LIGANDS FOR USE AS IMAGING AGENTS |
| CN101272784A (zh) | 2005-09-29 | 2008-09-24 | 塞诺菲-安万特股份有限公司 | 苯基-和吡啶基-1,2,4-噁二唑酮衍生物、它们的制备方法和它们作为药物的用途 |
| NL2000397C2 (nl) | 2006-01-05 | 2007-10-30 | Pfizer Prod Inc | Bicyclische heteroarylverbindingen als PDE10 inhibitoren. |
| AU2007225208A1 (en) | 2006-03-14 | 2007-09-20 | Amgen Inc. | Bicyclic carboxylic acid derivatives useful for treating metabolic disorders |
| EP2012782A1 (en) | 2006-04-13 | 2009-01-14 | Aegera Therapeutics Inc. | USE OF IMIDAZO[2,1-b)]-1,3,4-THIADIAZOLE-2-SULFONAMIDE COMPOUNDS TO TREAT NEUROPATHIC PAIN |
| DE102006054757A1 (de) | 2006-11-21 | 2008-05-29 | Bayer Healthcare Ag | Neue aza-bicyclische Verbindungen und ihre Verwendung |
| US7638541B2 (en) | 2006-12-28 | 2009-12-29 | Metabolex Inc. | 5-ethyl-2-{4-[4-(4-tetrazol-1-yl-phenoxymethyl)-thiazol-2-yl]-piperidin-1-yl}-pyrimidine |
| EP1964841A1 (en) | 2007-02-28 | 2008-09-03 | sanofi-aventis | Imidazo[1,2-a]azine and their use as pharmaceuticals |
| JP2010526836A (ja) | 2007-05-10 | 2010-08-05 | ジーイー・ヘルスケア・リミテッド | カンナビノイドCB2レセプターに対して活性を有するイミダゾール(1,2−a)ピリジン及び関連化合物 |
| WO2009017954A1 (en) | 2007-08-01 | 2009-02-05 | Phenomix Corporation | Inhibitors of jak2 kinase |
| EA201000201A1 (ru) | 2007-08-10 | 2010-12-30 | ГЛАКСОСМИТКЛАЙН ЭлЭлСи | Азотсодержащие бициклические химические вещества для лечения вирусных инфекций |
| WO2009027733A1 (en) | 2007-08-24 | 2009-03-05 | Astrazeneca Ab | (2-pyridin-3-ylimidazo[1,2-b]pyridazin-6-yl) urea derivatives as antibacterial agents |
| GB0718735D0 (en) | 2007-09-25 | 2007-11-07 | Prolysis Ltd | Antibacterial agents |
| AU2008340182A1 (en) | 2007-12-21 | 2009-07-02 | The University Of Sydney | Translocator protein ligands |
| AU2009231906A1 (en) | 2008-03-31 | 2009-10-08 | Metabolex, Inc. | Oxymethylene aryl compounds and uses thereof |
| EP2318415B1 (en) | 2008-07-15 | 2013-02-20 | Sanofi | Oxazolopyrimidines as edg-1 receptor agonists |
| WO2010036629A2 (en) | 2008-09-26 | 2010-04-01 | National Health Research Institutes | Fused multicyclic compounds as protein kinase inhibitors |
| RU2505540C2 (ru) | 2008-12-23 | 2014-01-27 | Эббви Инк. | Антивирусные соединения |
| FR2948521B1 (fr) | 2009-07-21 | 2012-01-27 | Dxo Labs | Procede d'estimation d'un defaut d'un systeme de capture d'images et systemes associes |
| CA2782601C (en) * | 2009-12-18 | 2015-07-21 | Mitsubishi Tanabe Pharma Corporation | Novel antiplatelet agent |
| CN102372701A (zh) | 2010-08-10 | 2012-03-14 | 江苏恒瑞医药股份有限公司 | 氮杂双环己烷类衍生物、其制备方法及其在医药上的应用 |
| SG187795A1 (en) | 2010-08-11 | 2013-03-28 | Millennium Pharm Inc | Heteroaryls and uses thereof |
| KR20140054295A (ko) | 2011-08-22 | 2014-05-08 | 머크 샤프 앤드 돔 코포레이션 | Bace 억제제로서의 2-스피로-치환된 이미노티아진 및 그의 모노- 및 디옥시드, 조성물 및 그의 용도 |
| SI3243826T1 (sl) * | 2012-04-26 | 2020-03-31 | Bristol-Myers Squibb Company | Derivati imidazotiadiazola in imidazopirazina kot proteazno aktivirani receptor 4 (PAR4) inhibitorji za zdravljenje agregacije trombocitov |
| MX2014012741A (es) * | 2012-04-26 | 2015-04-13 | Bristol Myers Squibb Co | Derivados de imidazotiadiazol e imidazopirazina como inhibidores del receptor 4 activado de proteasa (par4) para tratamiento de agregacion plaquetaria. |
| EP2875029B8 (en) | 2012-07-18 | 2021-12-15 | University of Notre Dame du Lac | 5,5-heteroaromatic anti-infective compounds |
-
2013
- 2013-04-24 US US14/396,807 patent/US9862730B2/en active Active
- 2013-04-24 WO PCT/US2013/037892 patent/WO2013163244A1/en not_active Ceased
- 2013-04-24 SG SG11201406759YA patent/SG11201406759YA/en unknown
- 2013-04-24 EP EP13719361.1A patent/EP2847200B1/en active Active
- 2013-04-24 KR KR20147030173A patent/KR20150003767A/ko not_active Withdrawn
- 2013-04-24 MX MX2014012454A patent/MX2014012454A/es unknown
- 2013-04-24 JP JP2015509094A patent/JP6181744B2/ja active Active
- 2013-04-24 BR BR112014026493A patent/BR112014026493A2/pt not_active IP Right Cessation
- 2013-04-24 CA CA2871637A patent/CA2871637A1/en not_active Abandoned
- 2013-04-24 CN CN201380033512.1A patent/CN104540835B/zh active Active
- 2013-04-24 EA EA201491967A patent/EA201491967A1/ru unknown
- 2013-04-24 ES ES13719361.1T patent/ES2625029T3/es active Active
- 2013-04-24 AU AU2013251683A patent/AU2013251683A1/en not_active Abandoned
-
2014
- 2014-10-19 IL IL235140A patent/IL235140A0/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL235140A0 (en) | 2014-12-31 |
| KR20150003767A (ko) | 2015-01-09 |
| EP2847200A1 (en) | 2015-03-18 |
| MX2014012454A (es) | 2015-03-13 |
| JP6181744B2 (ja) | 2017-08-16 |
| CN104540835B (zh) | 2017-08-08 |
| WO2013163244A8 (en) | 2014-04-03 |
| ES2625029T3 (es) | 2017-07-18 |
| WO2013163244A1 (en) | 2013-10-31 |
| BR112014026493A2 (pt) | 2017-06-27 |
| CN104540835A (zh) | 2015-04-22 |
| US9862730B2 (en) | 2018-01-09 |
| AU2013251683A1 (en) | 2014-12-18 |
| JP2015518004A (ja) | 2015-06-25 |
| EA201491967A1 (ru) | 2015-03-31 |
| EP2847200B1 (en) | 2017-03-29 |
| SG11201406759YA (en) | 2014-11-27 |
| US20150133446A1 (en) | 2015-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2847200B1 (en) | Imidazothiadiazole derivatives as protease activated receptor 4 (par4) inhibitors for treating platelet aggregation | |
| US12084452B2 (en) | Imidazothiadiazole and imidazopyrazine derivatives as protease activated receptor 4 (PAR4) inhibitors for treating platelet aggregation | |
| US9518064B2 (en) | Imidazothiadiazole and imidazopyridazine derivatives as protease activated receptor 4 (PAR4) inhibitors for treating platelet aggregation | |
| KR102494647B1 (ko) | 비시클릭 헤테로아릴 치환된 화합물 | |
| KR102492715B1 (ko) | 모노시클릭 헤테로아릴 치환된 화합물 | |
| EP3262052A1 (en) | Benzothiazole and benzothiophne compounds | |
| HK1203953B (en) | Imidazothiadiazole and imidazopyrazine derivatives as protease activated receptor 4 (par4) inhibitors for treating platelet aggregation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |
Effective date: 20180424 |