CA2570920A1 - Piperidine derivatives as renin inhibitors - Google Patents
Piperidine derivatives as renin inhibitors Download PDFInfo
- Publication number
- CA2570920A1 CA2570920A1 CA002570920A CA2570920A CA2570920A1 CA 2570920 A1 CA2570920 A1 CA 2570920A1 CA 002570920 A CA002570920 A CA 002570920A CA 2570920 A CA2570920 A CA 2570920A CA 2570920 A1 CA2570920 A1 CA 2570920A1
- Authority
- CA
- Canada
- Prior art keywords
- alkoxy
- alkyl
- 6alkoxy
- 6alkyl
- hydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000002461 renin inhibitor Substances 0.000 title abstract description 7
- 229940086526 renin-inhibitors Drugs 0.000 title abstract description 6
- 150000003053 piperidines Chemical class 0.000 title abstract description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 171
- 238000000034 method Methods 0.000 claims abstract description 80
- 238000002360 preparation method Methods 0.000 claims abstract description 7
- 239000003814 drug Substances 0.000 claims abstract description 6
- -1 3-acetamidomethylpyrrolidinyl Chemical group 0.000 claims description 269
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 62
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 36
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 31
- 229910052736 halogen Inorganic materials 0.000 claims description 22
- 150000002367 halogens Chemical class 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 20
- 229920006395 saturated elastomer Polymers 0.000 claims description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 16
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 125000004076 pyridyl group Chemical group 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 13
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 11
- 239000001301 oxygen Substances 0.000 claims description 11
- 239000005864 Sulphur Substances 0.000 claims description 10
- 125000002252 acyl group Chemical group 0.000 claims description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims description 10
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 10
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- 125000002757 morpholinyl group Chemical group 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 claims description 8
- 125000001624 naphthyl group Chemical group 0.000 claims description 7
- 125000003386 piperidinyl group Chemical group 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000002971 oxazolyl group Chemical group 0.000 claims description 6
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 claims description 6
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 229940002612 prodrug Drugs 0.000 claims description 6
- 239000000651 prodrug Substances 0.000 claims description 6
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 6
- 125000004568 thiomorpholinyl group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 230000009471 action Effects 0.000 claims description 5
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 5
- 125000001041 indolyl group Chemical group 0.000 claims description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 5
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 206010019280 Heart failures Diseases 0.000 claims description 4
- 206010020772 Hypertension Diseases 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000005605 benzo group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000000532 dioxanyl group Chemical group 0.000 claims description 4
- 125000005879 dioxolanyl group Chemical group 0.000 claims description 4
- 125000005883 dithianyl group Chemical group 0.000 claims description 4
- 125000005411 dithiolanyl group Chemical group S1SC(CC1)* 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 4
- 125000004434 sulfur atom Chemical group 0.000 claims description 4
- 125000001425 triazolyl group Chemical group 0.000 claims description 4
- 125000006625 (C3-C8) cycloalkyloxy group Chemical class 0.000 claims description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- 208000010412 Glaucoma Diseases 0.000 claims description 3
- 208000001647 Renal Insufficiency Diseases 0.000 claims description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000000723 dihydrobenzofuranyl group Chemical group O1C(CC2=C1C=CC=C2)* 0.000 claims description 3
- 230000002526 effect on cardiovascular system Effects 0.000 claims description 3
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 3
- 201000006370 kidney failure Diseases 0.000 claims description 3
- 208000010125 myocardial infarction Diseases 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 230000002265 prevention Effects 0.000 claims description 3
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 125000004306 triazinyl group Chemical group 0.000 claims description 3
- 125000006590 (C2-C6) alkenylene group Chemical group 0.000 claims description 2
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 claims description 2
- 125000002152 1H-pyrrolizinyl group Chemical group C1(C=CN2C=CC=C12)* 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000005331 diazinyl group Chemical group N1=NC(=CC=C1)* 0.000 claims description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 2
- 230000002285 radioactive effect Effects 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 11
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 9
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims 6
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims 4
- 125000006652 (C3-C12) cycloalkyl group Chemical group 0.000 claims 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims 2
- 125000006621 (C3-C8) cycloalkyl-(C1-C6) alkyl group Chemical group 0.000 claims 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims 1
- 239000002552 dosage form Substances 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- 230000008569 process Effects 0.000 abstract description 7
- 229940079593 drug Drugs 0.000 abstract description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 91
- 239000000243 solution Substances 0.000 description 91
- DEQYTNZJHKPYEZ-UHFFFAOYSA-N ethyl acetate;heptane Chemical compound CCOC(C)=O.CCCCCCC DEQYTNZJHKPYEZ-UHFFFAOYSA-N 0.000 description 74
- 239000003921 oil Substances 0.000 description 71
- 235000019198 oils Nutrition 0.000 description 71
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 70
- 239000000203 mixture Substances 0.000 description 60
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 58
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 54
- 239000011541 reaction mixture Substances 0.000 description 54
- 238000003818 flash chromatography Methods 0.000 description 53
- 229910052681 coesite Inorganic materials 0.000 description 50
- 229910052906 cristobalite Inorganic materials 0.000 description 50
- 229910052682 stishovite Inorganic materials 0.000 description 50
- 229910052905 tridymite Inorganic materials 0.000 description 50
- 229910052938 sodium sulfate Inorganic materials 0.000 description 46
- 235000011152 sodium sulphate Nutrition 0.000 description 46
- 239000012267 brine Substances 0.000 description 42
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 41
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 38
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 35
- 238000001704 evaporation Methods 0.000 description 32
- 230000008020 evaporation Effects 0.000 description 32
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000012074 organic phase Substances 0.000 description 29
- 239000007858 starting material Substances 0.000 description 28
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 27
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 26
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 25
- 235000019439 ethyl acetate Nutrition 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 229910021529 ammonia Inorganic materials 0.000 description 19
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 17
- 235000017557 sodium bicarbonate Nutrition 0.000 description 17
- 239000007787 solid Substances 0.000 description 17
- 239000012230 colorless oil Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 15
- 150000003254 radicals Chemical class 0.000 description 13
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 238000007429 general method Methods 0.000 description 11
- 239000000126 substance Substances 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- IQOIMKMZQVCXMK-UHFFFAOYSA-N 6-(chloromethyl)-4-(3-methoxypropyl)-1,4-benzoxazin-3-one Chemical compound C1=C(CCl)C=C2N(CCCOC)C(=O)COC2=C1 IQOIMKMZQVCXMK-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- LFWGXIVKBPLQMD-UHFFFAOYSA-N benzyl 3-hydroxy-4-(4-hydroxyphenyl)-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C1=CC=C(O)C=C1 LFWGXIVKBPLQMD-UHFFFAOYSA-N 0.000 description 9
- OKOSFIZVPAFSGF-UHFFFAOYSA-N benzyl 3-hydroxy-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C1=CC=C(OC)C=C1 OKOSFIZVPAFSGF-UHFFFAOYSA-N 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 239000001993 wax Substances 0.000 description 8
- 101800000734 Angiotensin-1 Proteins 0.000 description 7
- 102400000344 Angiotensin-1 Human genes 0.000 description 7
- 235000019502 Orange oil Nutrition 0.000 description 7
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 239000010502 orange oil Substances 0.000 description 7
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 6
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 6
- 239000000377 silicon dioxide Substances 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium on carbon Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 108090000783 Renin Proteins 0.000 description 5
- 230000036772 blood pressure Effects 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000006260 foam Substances 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 4
- INXKVYFOWNAVMU-UHFFFAOYSA-N 2,5-difluorophenol Chemical compound OC1=CC(F)=CC=C1F INXKVYFOWNAVMU-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- 102000005862 Angiotensin II Human genes 0.000 description 4
- 101800000733 Angiotensin-2 Proteins 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 101000579218 Homo sapiens Renin Proteins 0.000 description 4
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 description 4
- 102100028255 Renin Human genes 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 229950006323 angiotensin ii Drugs 0.000 description 4
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 4
- 229920005862 polyol Polymers 0.000 description 4
- 150000003077 polyols Chemical class 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000007941 film coated tablet Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229960003883 furosemide Drugs 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000004524 naphthpyridyl group Chemical group C1(=CC=NC2=C1C1=CC=CC=C1C=C2)* 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- BIWOSRSKDCZIFM-UHFFFAOYSA-N piperidin-3-ol Chemical compound OC1CCCNC1 BIWOSRSKDCZIFM-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 3
- DGKGLCQTCLFVFM-SSDOTTSWSA-N (3r)-3-(2,5-difluorophenoxy)butan-1-ol Chemical compound OCC[C@@H](C)OC1=CC(F)=CC=C1F DGKGLCQTCLFVFM-SSDOTTSWSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- GRPVXZDDHARJSD-UHFFFAOYSA-N 1-(3-bromopropoxy)-2-chlorobenzene Chemical compound ClC1=CC=CC=C1OCCCBr GRPVXZDDHARJSD-UHFFFAOYSA-N 0.000 description 2
- YZSNQEGPANCTAL-UHFFFAOYSA-N 1-(3-fluorophenyl)pyrrolidin-3-ol Chemical compound C1C(O)CCN1C1=CC=CC(F)=C1 YZSNQEGPANCTAL-UHFFFAOYSA-N 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- CQMJEZQEVXQEJB-UHFFFAOYSA-N 1-hydroxy-1,3-dioxobenziodoxole Chemical compound C1=CC=C2I(O)(=O)OC(=O)C2=C1 CQMJEZQEVXQEJB-UHFFFAOYSA-N 0.000 description 2
- FJYVXYMRSUFESD-UHFFFAOYSA-N 2-(2,5-difluorophenoxy)ethanol Chemical compound OCCOC1=CC(F)=CC=C1F FJYVXYMRSUFESD-UHFFFAOYSA-N 0.000 description 2
- XVDMRLUZDUUXJV-UHFFFAOYSA-N 2-(3-bromopropoxy)-1,4-difluorobenzene Chemical compound FC1=CC=C(F)C(OCCCBr)=C1 XVDMRLUZDUUXJV-UHFFFAOYSA-N 0.000 description 2
- PJWBNHPIMROMAC-UHFFFAOYSA-N 2-[(2-chlorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC=C1Cl PJWBNHPIMROMAC-UHFFFAOYSA-N 0.000 description 2
- QNTPWFDJZDQATN-UHFFFAOYSA-N 2-[(3-fluorophenyl)methoxy]ethanol Chemical compound OCCOCC1=CC=CC(F)=C1 QNTPWFDJZDQATN-UHFFFAOYSA-N 0.000 description 2
- HPBQZTVKXNNOSF-UHFFFAOYSA-N 2-[methyl-(4-methylphenyl)sulfonylamino]ethyl 4-methylbenzenesulfonate Chemical compound C=1C=C(C)C=CC=1S(=O)(=O)N(C)CCOS(=O)(=O)C1=CC=C(C)C=C1 HPBQZTVKXNNOSF-UHFFFAOYSA-N 0.000 description 2
- NCRMNHSZPLHRRW-UHFFFAOYSA-N 2-iodoethoxy-tri(propan-2-yl)silane Chemical compound CC(C)[Si](C(C)C)(C(C)C)OCCI NCRMNHSZPLHRRW-UHFFFAOYSA-N 0.000 description 2
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 2
- GGBMJNNJKFAJNE-UHFFFAOYSA-N 3-(1-adamantyloxy)propan-1-ol Chemical compound C1C(C2)CC3CC2CC1(OCCCO)C3 GGBMJNNJKFAJNE-UHFFFAOYSA-N 0.000 description 2
- PPYVNZZBCCTEBD-UHFFFAOYSA-N 3-(2,5-difluorophenyl)propan-1-ol Chemical compound OCCCC1=CC(F)=CC=C1F PPYVNZZBCCTEBD-UHFFFAOYSA-N 0.000 description 2
- DURXQDAFKSWAES-UHFFFAOYSA-N 3-(2,5-difluorophenyl)propanoic acid Chemical compound OC(=O)CCC1=CC(F)=CC=C1F DURXQDAFKSWAES-UHFFFAOYSA-N 0.000 description 2
- XPQFHHJLXBYFTJ-UHFFFAOYSA-N 3-[(2-methoxyphenyl)methoxy]propan-1-ol Chemical compound COC1=CC=CC=C1COCCCO XPQFHHJLXBYFTJ-UHFFFAOYSA-N 0.000 description 2
- QLJFHNRYIWETNI-UHFFFAOYSA-N 4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-ol Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(S(=O)(=O)C=2C=CC(C)=CC=2)CC(O)C1C(C=C1)=CC=C1OC(C1)CCN1C1=CC=CC(F)=C1 QLJFHNRYIWETNI-UHFFFAOYSA-N 0.000 description 2
- AMKGKYQBASDDJB-UHFFFAOYSA-N 9$l^{2}-borabicyclo[3.3.1]nonane Chemical compound C1CCC2CCCC1[B]2 AMKGKYQBASDDJB-UHFFFAOYSA-N 0.000 description 2
- FEJUGLKDZJDVFY-UHFFFAOYSA-N 9-borabicyclo[3.3.1]nonane Substances C1CCC2CCCC1B2 FEJUGLKDZJDVFY-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- 108090001067 Angiotensinogen Proteins 0.000 description 2
- 102000004881 Angiotensinogen Human genes 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 241000288906 Primates Species 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- SKRUMKDWHDOJJK-UHFFFAOYSA-N [1-(1-phenylethyl)-4-(4-phenylmethoxyphenyl)-3,4-dihydro-2h-pyridin-3-yl]oxy-tri(propan-2-yl)silane Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CN(C(C)C=2C=CC=CC=2)C=CC1C(C=C1)=CC=C1OCC1=CC=CC=C1 SKRUMKDWHDOJJK-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- CKONHFXUQPXPKO-UHFFFAOYSA-N benzyl 3-hydroxy-4-(4-methoxycarbonylphenyl)-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=CC(C(=O)OC)=CC=C1C1C(O[Si](C(C)C)(C(C)C)C(C)C)CN(C(=O)OCC=2C=CC=CC=2)CC1O CKONHFXUQPXPKO-UHFFFAOYSA-N 0.000 description 2
- SBCFRADUTMIFQM-UHFFFAOYSA-N benzyl 3-hydroxy-4-(4-methoxyphenyl)-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=CC(OC)=CC=C1C1C(O[Si](C(C)C)(C(C)C)C(C)C)CN(C(=O)OCC=2C=CC=CC=2)CC1O SBCFRADUTMIFQM-UHFFFAOYSA-N 0.000 description 2
- JLGHLTMTCOXPNI-UHFFFAOYSA-N benzyl 3-hydroxy-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCCOCC1=CC=CC=C1OC JLGHLTMTCOXPNI-UHFFFAOYSA-N 0.000 description 2
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- KQIADDMXRMTWHZ-UHFFFAOYSA-N chloro-tri(propan-2-yl)silane Chemical compound CC(C)[Si](Cl)(C(C)C)C(C)C KQIADDMXRMTWHZ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- VBLMHICLHHGNIS-UHFFFAOYSA-N cyclopent-2-en-1-yl 2,2,2-trichloroethanimidate Chemical compound ClC(Cl)(Cl)C(=N)OC1CCC=C1 VBLMHICLHHGNIS-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 2
- SIPUZPBQZHNSDW-UHFFFAOYSA-N diisobutylaluminium hydride Substances CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- NVRGAUHJNWSEBT-ZETCQYMHSA-N ethyl (2s)-2-(2,5-difluorophenoxy)propanoate Chemical compound CCOC(=O)[C@H](C)OC1=CC(F)=CC=C1F NVRGAUHJNWSEBT-ZETCQYMHSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 2
- 241001515942 marmosets Species 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- 239000007940 sugar coated tablet Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- MOCQXKOZTASPJB-LURJTMIESA-N (2s)-2-(2,5-difluorophenoxy)propan-1-ol Chemical compound OC[C@H](C)OC1=CC(F)=CC=C1F MOCQXKOZTASPJB-LURJTMIESA-N 0.000 description 1
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 1
- QPMSJEFZULFYTB-PGMHMLKASA-N (3r)-pyrrolidin-3-ol;hydrochloride Chemical compound Cl.O[C@@H]1CCNC1 QPMSJEFZULFYTB-PGMHMLKASA-N 0.000 description 1
- METKIMKYRPQLGS-GFCCVEGCSA-N (R)-atenolol Chemical compound CC(C)NC[C@@H](O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-GFCCVEGCSA-N 0.000 description 1
- IWYDHOAUDWTVEP-SSDOTTSWSA-N (R)-mandelic acid Chemical compound OC(=O)[C@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-SSDOTTSWSA-N 0.000 description 1
- PUPZLCDOIYMWBV-BYPYZUCNSA-N (S)-butane-1,3-diol Chemical compound C[C@H](O)CCO PUPZLCDOIYMWBV-BYPYZUCNSA-N 0.000 description 1
- TWBNMYSKRDRHAT-RCWTXCDDSA-N (S)-timolol hemihydrate Chemical compound O.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 TWBNMYSKRDRHAT-RCWTXCDDSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- ILWJAOPQHOZXAN-UHFFFAOYSA-N 1,3-dithianyl Chemical group [CH]1SCCCS1 ILWJAOPQHOZXAN-UHFFFAOYSA-N 0.000 description 1
- FLOJNXXFMHCMMR-UHFFFAOYSA-N 1,3-dithiolanyl Chemical group [CH]1SCCS1 FLOJNXXFMHCMMR-UHFFFAOYSA-N 0.000 description 1
- PXMQPJHTROVISL-UHFFFAOYSA-N 1-(1-phenylethyl)-4-(4-phenylmethoxyphenyl)-3,4-dihydro-2h-pyridin-3-ol Chemical compound C=1C=CC=CC=1C(C)N(C=C1)CC(O)C1C(C=C1)=CC=C1OCC1=CC=CC=C1 PXMQPJHTROVISL-UHFFFAOYSA-N 0.000 description 1
- BJLJWRKPOCAYPY-UHFFFAOYSA-N 1-(1-phenylethyl)-4-(4-phenylmethoxyphenyl)-5-tri(propan-2-yl)silyloxypiperidin-3-ol Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CN(C(C)C=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCC1=CC=CC=C1 BJLJWRKPOCAYPY-UHFFFAOYSA-N 0.000 description 1
- WGVYCXYGPNNUQA-UHFFFAOYSA-N 1-(bromomethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CBr WGVYCXYGPNNUQA-UHFFFAOYSA-N 0.000 description 1
- SCBZBMXPJYMXRC-UHFFFAOYSA-N 1-(bromomethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CBr)=C1 SCBZBMXPJYMXRC-UHFFFAOYSA-N 0.000 description 1
- QDFKKJYEIFBEFC-UHFFFAOYSA-N 1-bromo-3-fluorobenzene Chemical compound FC1=CC=CC(Br)=C1 QDFKKJYEIFBEFC-UHFFFAOYSA-N 0.000 description 1
- BQLHMMQUVJCTAN-UHFFFAOYSA-N 1-chloro-3-methoxypropane Chemical compound COCCCCl BQLHMMQUVJCTAN-UHFFFAOYSA-N 0.000 description 1
- RJCGZNCCVKIBHO-UHFFFAOYSA-N 1-chloro-4-fluorobenzene Chemical compound FC1=CC=C(Cl)C=C1 RJCGZNCCVKIBHO-UHFFFAOYSA-N 0.000 description 1
- IVVNZDGDKPTYHK-JTQLQIEISA-N 1-cyano-2-[(2s)-3,3-dimethylbutan-2-yl]-3-pyridin-4-ylguanidine Chemical compound CC(C)(C)[C@H](C)N=C(NC#N)NC1=CC=NC=C1 IVVNZDGDKPTYHK-JTQLQIEISA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- JKIPXZABCHFCTD-UHFFFAOYSA-N 1-prop-2-enoxyadamantane Chemical compound C1C(C2)CC3CC2CC1(OCC=C)C3 JKIPXZABCHFCTD-UHFFFAOYSA-N 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- PWVXRBWBVGKKHP-UHFFFAOYSA-N 2-(2,5-difluorophenoxy)ethoxy-tri(propan-2-yl)silane Chemical compound CC(C)[Si](C(C)C)(C(C)C)OCCOC1=CC(F)=CC=C1F PWVXRBWBVGKKHP-UHFFFAOYSA-N 0.000 description 1
- SGTNSNPWRIOYBX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-UHFFFAOYSA-N 0.000 description 1
- VUXGDVWWLLCKPD-UHFFFAOYSA-N 2-[(2-methylphenyl)methoxy]ethanol Chemical compound CC1=CC=CC=C1COCCO VUXGDVWWLLCKPD-UHFFFAOYSA-N 0.000 description 1
- PRKWVSHZYDOZLP-UHFFFAOYSA-N 2-[(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3h-inden-5-yl)oxy]acetic acid Chemical compound C1C2=CC(OCC(O)=O)=C(Cl)C(Cl)=C2C(=O)C1(C)C1=CC=CC=C1 PRKWVSHZYDOZLP-UHFFFAOYSA-N 0.000 description 1
- JIVPVXMEBJLZRO-CQSZACIVSA-N 2-chloro-5-[(1r)-1-hydroxy-3-oxo-2h-isoindol-1-yl]benzenesulfonamide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC([C@@]2(O)C3=CC=CC=C3C(=O)N2)=C1 JIVPVXMEBJLZRO-CQSZACIVSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- TZXJJSAQSRHKCZ-UHFFFAOYSA-N 2-methoxyethyl 4-methylbenzenesulfonate Chemical compound COCCOS(=O)(=O)C1=CC=C(C)C=C1 TZXJJSAQSRHKCZ-UHFFFAOYSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- IRTLROCMFSDSNF-UHFFFAOYSA-N 2-phenyl-1h-pyrrole Chemical compound C1=CNC(C=2C=CC=CC=2)=C1 IRTLROCMFSDSNF-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- NMKSAYKQLCHXDK-UHFFFAOYSA-N 3,3-diphenyl-N-(1-phenylethyl)-1-propanamine Chemical compound C=1C=CC=CC=1C(C)NCCC(C=1C=CC=CC=1)C1=CC=CC=C1 NMKSAYKQLCHXDK-UHFFFAOYSA-N 0.000 description 1
- YEYSOEFOGRDVJM-UHFFFAOYSA-N 3-[(2-fluorophenyl)methoxy]propan-1-ol Chemical compound OCCCOCC1=CC=CC=C1F YEYSOEFOGRDVJM-UHFFFAOYSA-N 0.000 description 1
- PWVLLWHWAGTWEM-UHFFFAOYSA-N 3-[4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-1-(4-methylphenyl)sulfonylpiperidin-3-yl]oxypropanenitrile Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(S(=O)(=O)C=2C=CC(C)=CC=2)CC(OCCC#N)C1C(C=C1)=CC=C1OC(C1)CCN1C1=CC=CC(F)=C1 PWVLLWHWAGTWEM-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- AJKDUJRRWLQXHM-UHFFFAOYSA-N 3-bromocyclohexene Chemical compound BrC1CCCC=C1 AJKDUJRRWLQXHM-UHFFFAOYSA-N 0.000 description 1
- PWUCNIRAAUZWGV-UHFFFAOYSA-N 3-hydroxy-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(O)=O)CC(O)C1C1=CC=C(OC)C=C1 PWUCNIRAAUZWGV-UHFFFAOYSA-N 0.000 description 1
- UIAGMCDKSXEBJQ-IBGZPJMESA-N 3-o-(2-methoxyethyl) 5-o-propan-2-yl (4s)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate Chemical compound COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)[C@H]1C1=CC=CC([N+]([O-])=O)=C1 UIAGMCDKSXEBJQ-IBGZPJMESA-N 0.000 description 1
- SNKAAIQBOBROQQ-UHFFFAOYSA-N 4,7-dimethylbicyclo[2.2.1]heptane-7-carbonyl chloride Chemical compound C1CC2CCC1(C)C2(C)C(Cl)=O SNKAAIQBOBROQQ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- XHWBYYAUFKGLBF-UHFFFAOYSA-N 4-(4-hydroxyphenyl)-5-tri(propan-2-yl)silyloxypiperidin-3-ol Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CNCC(O)C1C1=CC=C(O)C=C1 XHWBYYAUFKGLBF-UHFFFAOYSA-N 0.000 description 1
- WRADZHPGPWVNCC-UHFFFAOYSA-N 4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylic acid Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(O)=O)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C(C=C1)=CC=C1OC(C1)CCN1C1=CC=CC(F)=C1 WRADZHPGPWVNCC-UHFFFAOYSA-N 0.000 description 1
- RWJKKARAQBPRFE-UHFFFAOYSA-N 4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CNCC(O)C1C(C=C1)=CC=C1OC(C1)CCN1C1=CC=CC(F)=C1 RWJKKARAQBPRFE-UHFFFAOYSA-N 0.000 description 1
- YZRITTZVRXWVRJ-UHFFFAOYSA-N 4-tri(propan-2-yl)silyloxybutan-2-ol Chemical compound CC(O)CCO[Si](C(C)C)(C(C)C)C(C)C YZRITTZVRXWVRJ-UHFFFAOYSA-N 0.000 description 1
- BJRYIEKWPBLDIF-UHFFFAOYSA-N 6-(hydroxymethyl)-4-(3-methoxypropyl)-1,4-benzoxazin-3-one Chemical compound C1=C(CO)C=C2N(CCCOC)C(=O)COC2=C1 BJRYIEKWPBLDIF-UHFFFAOYSA-N 0.000 description 1
- MJMAINZAZNHEJX-UHFFFAOYSA-N 6-(hydroxymethyl)-4h-1,4-benzoxazin-3-one Chemical compound O1CC(=O)NC2=CC(CO)=CC=C21 MJMAINZAZNHEJX-UHFFFAOYSA-N 0.000 description 1
- LLQHSBBZNDXTIV-UHFFFAOYSA-N 6-[5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazol-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC1CC(=NO1)C1=CC2=C(NC(O2)=O)C=C1 LLQHSBBZNDXTIV-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005541 ACE inhibitor Substances 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 208000009304 Acute Kidney Injury Diseases 0.000 description 1
- 241001436679 Adama Species 0.000 description 1
- QMMRCKSBBNJCMR-KMZPNFOHSA-N Angiotensin III Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(C)C)C1=CC=C(O)C=C1 QMMRCKSBBNJCMR-KMZPNFOHSA-N 0.000 description 1
- 101800000738 Angiotensin-3 Proteins 0.000 description 1
- 102400000348 Angiotensin-3 Human genes 0.000 description 1
- 108010064733 Angiotensins Proteins 0.000 description 1
- 102000015427 Angiotensins Human genes 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZTDURLACGLSHDF-ZOWNYOTGSA-N C(C)N(CC)CC.C(C)(C)[Si](OCC[C@H](C)O)(C(C)C)C(C)C Chemical compound C(C)N(CC)CC.C(C)(C)[Si](OCC[C@H](C)O)(C(C)C)C(C)C ZTDURLACGLSHDF-ZOWNYOTGSA-N 0.000 description 1
- WDQCVIHCDISOPQ-UHFFFAOYSA-N C(CCC)[Sn](CCCC)=O.CC1=C(COCCO)C=CC=C1 Chemical compound C(CCC)[Sn](CCCC)=O.CC1=C(COCCO)C=CC=C1 WDQCVIHCDISOPQ-UHFFFAOYSA-N 0.000 description 1
- 125000003320 C2-C6 alkenyloxy group Chemical group 0.000 description 1
- 229940127291 Calcium channel antagonist Drugs 0.000 description 1
- 241000288950 Callithrix jacchus Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- YASYEJJMZJALEJ-UHFFFAOYSA-N Citric acid monohydrate Chemical compound O.OC(=O)CC(O)(C(O)=O)CC(O)=O YASYEJJMZJALEJ-UHFFFAOYSA-N 0.000 description 1
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 108010061435 Enalapril Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- XQLWNAFCTODIRK-UHFFFAOYSA-N Gallopamil Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC(OC)=C(OC)C(OC)=C1 XQLWNAFCTODIRK-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- WDZVGELJXXEGPV-YIXHJXPBSA-N Guanabenz Chemical compound NC(N)=N\N=C\C1=C(Cl)C=CC=C1Cl WDZVGELJXXEGPV-YIXHJXPBSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 108010007859 Lisinopril Proteins 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- ZFMITUMMTDLWHR-UHFFFAOYSA-N Minoxidil Chemical compound NC1=[N+]([O-])C(N)=CC(N2CCCCC2)=N1 ZFMITUMMTDLWHR-UHFFFAOYSA-N 0.000 description 1
- 102000003729 Neprilysin Human genes 0.000 description 1
- 108090000028 Neprilysin Proteins 0.000 description 1
- ZBBHBTPTTSWHBA-UHFFFAOYSA-N Nicardipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN(C)CC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 ZBBHBTPTTSWHBA-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- QZVCTJOXCFMACW-UHFFFAOYSA-N Phenoxybenzamine Chemical compound C=1C=CC=CC=1CN(CCCl)C(C)COC1=CC=CC=C1 QZVCTJOXCFMACW-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 208000033626 Renal failure acute Diseases 0.000 description 1
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 1
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000219 Sympatholytic Substances 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 108010069102 Thromboxane-A synthase Proteins 0.000 description 1
- FNYLWPVRPXGIIP-UHFFFAOYSA-N Triamterene Chemical compound NC1=NC2=NC(N)=NC(N)=C2N=C1C1=CC=CC=C1 FNYLWPVRPXGIIP-UHFFFAOYSA-N 0.000 description 1
- 238000000441 X-ray spectroscopy Methods 0.000 description 1
- RVYIGWRXEXYWNJ-AWEZNQCLSA-N [(2s)-4-tri(propan-2-yl)silyloxybutan-2-yl] methanesulfonate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OCC[C@H](C)OS(C)(=O)=O RVYIGWRXEXYWNJ-AWEZNQCLSA-N 0.000 description 1
- MHBQMGZWLRUGSY-MRXNPFEDSA-N [(3r)-3-(2,5-difluorophenoxy)butoxy]-tri(propan-2-yl)silane Chemical compound CC(C)[Si](C(C)C)(C(C)C)OCC[C@@H](C)OC1=CC(F)=CC=C1F MHBQMGZWLRUGSY-MRXNPFEDSA-N 0.000 description 1
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- BZKPWHYZMXOIDC-UHFFFAOYSA-N acetazolamide Chemical compound CC(=O)NC1=NN=C(S(N)(=O)=O)S1 BZKPWHYZMXOIDC-UHFFFAOYSA-N 0.000 description 1
- 229960000571 acetazolamide Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 201000011040 acute kidney failure Diseases 0.000 description 1
- 208000012998 acute renal failure Diseases 0.000 description 1
- VLLNJDMHDJRNFK-UHFFFAOYSA-N adamantan-1-ol Chemical compound C1C(C2)CC3CC2CC1(O)C3 VLLNJDMHDJRNFK-UHFFFAOYSA-N 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 210000004100 adrenal gland Anatomy 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003418 alkyl amino alkoxy group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- XSDQTOBWRPYKKA-UHFFFAOYSA-N amiloride Chemical compound NC(=N)NC(=O)C1=NC(Cl)=C(N)N=C1N XSDQTOBWRPYKKA-UHFFFAOYSA-N 0.000 description 1
- 229960002576 amiloride Drugs 0.000 description 1
- RNLQIBCLLYYYFJ-UHFFFAOYSA-N amrinone Chemical compound N1C(=O)C(N)=CC(C=2C=CN=CC=2)=C1 RNLQIBCLLYYYFJ-UHFFFAOYSA-N 0.000 description 1
- 229960002105 amrinone Drugs 0.000 description 1
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000001705 anti-serotonergic effect Effects 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 210000002376 aorta thoracic Anatomy 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 229960002274 atenolol Drugs 0.000 description 1
- HYTACLVSJIFYBY-UHFFFAOYSA-N azane;dichloromethane;methanol Chemical compound N.OC.ClCCl HYTACLVSJIFYBY-UHFFFAOYSA-N 0.000 description 1
- YEESUBCSWGVPCE-UHFFFAOYSA-N azanylidyneoxidanium iron(2+) pentacyanide Chemical compound [Fe++].[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.N#[O+] YEESUBCSWGVPCE-UHFFFAOYSA-N 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- FYJJXENSONZJRG-UHFFFAOYSA-N bencyclane Chemical compound C=1C=CC=CC=1CC1(OCCCN(C)C)CCCCCC1 FYJJXENSONZJRG-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- NDTSRXAMMQDVSW-UHFFFAOYSA-N benzthiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(S(N2)(=O)=O)=C1N=C2CSCC1=CC=CC=C1 NDTSRXAMMQDVSW-UHFFFAOYSA-N 0.000 description 1
- 229960001541 benzthiazide Drugs 0.000 description 1
- CVYQISILOYYCHD-FZNHVUCASA-N benzyl (3r)-4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1([C@@H](O)CN(CC1OCC1=CC=C2OCCN(C2=C1)CCCOC)C(=O)OCC=1C=CC=CC=1)C(C=C1)=CC=C1OC(C1)CCN1C1=CC=CC(F)=C1 CVYQISILOYYCHD-FZNHVUCASA-N 0.000 description 1
- WMZPIXZDNQNPRX-UHFFFAOYSA-N benzyl 3-acetyloxy-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(OC(C)=O)C1C1=CC=C(OC)C=C1 WMZPIXZDNQNPRX-UHFFFAOYSA-N 0.000 description 1
- ZEUKKJKACBKAPC-UHFFFAOYSA-N benzyl 3-cyclohex-2-en-1-yloxy-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC(C1C=2C=CC(OC)=CC=2)CN(C(=O)OCC=2C=CC=CC=2)CC1OC1CCCC=C1 ZEUKKJKACBKAPC-UHFFFAOYSA-N 0.000 description 1
- XJYBUVCOMVMMCQ-UHFFFAOYSA-N benzyl 3-hydroxy-4-[4-(trifluoromethylsulfonyloxy)phenyl]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1 XJYBUVCOMVMMCQ-UHFFFAOYSA-N 0.000 description 1
- PGVNJTUGZLPZJU-UHFFFAOYSA-N benzyl 3-hydroxy-4-[4-(trifluoromethylsulfonyloxy)phenyl]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate N,N-diethylethanamine Chemical compound C(C)N(CC)CC.C(C1=CC=CC=C1)OC(=O)N1CC(C(C(C1)O[Si](C(C)C)(C(C)C)C(C)C)C1=CC=C(C=C1)OS(=O)(=O)C(F)(F)F)O PGVNJTUGZLPZJU-UHFFFAOYSA-N 0.000 description 1
- HNZGJQAMMXUKOX-UHFFFAOYSA-N benzyl 3-hydroxy-4-[4-[1-(2-methoxyacetyl)oxy-2-methylpropyl]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C1=CC=C(C(OC(=O)COC)C(C)C)C=C1 HNZGJQAMMXUKOX-UHFFFAOYSA-N 0.000 description 1
- WBIFAKUDOGPSPR-UHFFFAOYSA-N benzyl 3-hydroxy-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound COC1=CC=CC=C1COCCCOC1=CC=C(C2C(CN(CC2O)C(=O)OCC=2C=CC=CC=2)O[Si](C(C)C)(C(C)C)C(C)C)C=C1 WBIFAKUDOGPSPR-UHFFFAOYSA-N 0.000 description 1
- TWKWZWDKBOJQEG-UHFFFAOYSA-N benzyl 3-methoxy-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(OC)C1C1=CC=C(OC)C=C1 TWKWZWDKBOJQEG-UHFFFAOYSA-N 0.000 description 1
- SRKBGJNGHTYKLS-UHFFFAOYSA-N benzyl 3-methoxy-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(OC)C1C(C=C1)=CC=C1OCCCOCC1=CC=CC=C1OC SRKBGJNGHTYKLS-UHFFFAOYSA-N 0.000 description 1
- XQNRJNZDXGLSBD-UHFFFAOYSA-N benzyl 4-(4-formylphenyl)-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C1=CC=C(C=O)C=C1 XQNRJNZDXGLSBD-UHFFFAOYSA-N 0.000 description 1
- DGJVEIRXVBSJTI-UHFFFAOYSA-N benzyl 4-(4-methoxycarbonylphenyl)-3-[[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)C(=O)COC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C1=CC=C(C(=O)OC)C=C1 DGJVEIRXVBSJTI-UHFFFAOYSA-N 0.000 description 1
- DSWRXNZKHJDGFG-UHFFFAOYSA-N benzyl 4-(4-methoxyphenyl)-3-[[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)C(=O)COC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C1=CC=C(OC)C=C1 DSWRXNZKHJDGFG-UHFFFAOYSA-N 0.000 description 1
- LVURWYPFSYLJTB-UHFFFAOYSA-N benzyl 4-[4-(1-hydroxy-2-methylpropyl)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C1=CC=C(C(O)C(C)C)C=C1 LVURWYPFSYLJTB-UHFFFAOYSA-N 0.000 description 1
- XHVKGGUXZSCNGT-UHFFFAOYSA-N benzyl 4-[4-(chloromethyl)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C1=CC=C(CCl)C=C1 XHVKGGUXZSCNGT-UHFFFAOYSA-N 0.000 description 1
- DXJRYFKHDGHJJU-UHFFFAOYSA-N benzyl 4-[4-(hydroxymethyl)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C1=CC=C(CO)C=C1 DXJRYFKHDGHJJU-UHFFFAOYSA-N 0.000 description 1
- FTMVHFJLAUFGLI-UHFFFAOYSA-N benzyl 4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC(C1C=2C=CC(OC3CN(CC3)C=3C=C(F)C=CC=3)=CC=2)CN(C(=O)OCC=2C=CC=CC=2)CC1NC(=O)OCC1=CC=CC=C1 FTMVHFJLAUFGLI-UHFFFAOYSA-N 0.000 description 1
- CVYQISILOYYCHD-UHFFFAOYSA-N benzyl 4-[4-[1-(3-fluorophenyl)pyrrolidin-3-yl]oxyphenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OC(C1)CCN1C1=CC=CC(F)=C1 CVYQISILOYYCHD-UHFFFAOYSA-N 0.000 description 1
- ZXVBESGHWJVLPQ-UHFFFAOYSA-N benzyl 4-[4-[2-(2,5-difluorophenoxy)ethoxymethyl]phenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1COCCOC1=CC(F)=CC=C1F ZXVBESGHWJVLPQ-UHFFFAOYSA-N 0.000 description 1
- AWTTZCUXZLKMMP-UHFFFAOYSA-N benzyl 4-[4-[2-[(2-chlorophenyl)methoxy]ethoxy]phenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCOCC1=CC=CC=C1Cl AWTTZCUXZLKMMP-UHFFFAOYSA-N 0.000 description 1
- HBIXDPCWVUVBLU-UHFFFAOYSA-N benzyl 4-[4-[2-[(3-fluorophenyl)methoxy]ethoxy]phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-2-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1C(O[Si](C(C)C)(C(C)C)C(C)C)N(C(=O)OCC=2C=CC=CC=2)CCC1C(C=C1)=CC=C1OCCOCC1=CC=CC(F)=C1 HBIXDPCWVUVBLU-UHFFFAOYSA-N 0.000 description 1
- PWVAGWMWYVQIMH-UHFFFAOYSA-N benzyl 4-[4-[2-[(3-fluorophenyl)methoxy]ethoxy]phenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCOCC1=CC=CC(F)=C1 PWVAGWMWYVQIMH-UHFFFAOYSA-N 0.000 description 1
- ZSPUSLMVWMYDHZ-UHFFFAOYSA-N benzyl 4-[4-[2-[(3-fluorophenyl)methoxy]ethoxy]phenyl]-3-hydroxy-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCOCC1=CC=CC(F)=C1 ZSPUSLMVWMYDHZ-UHFFFAOYSA-N 0.000 description 1
- ZZAPHJXDKYDMKH-UHFFFAOYSA-N benzyl 4-[4-[3-(2,5-difluorophenoxy)propoxy]phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C(C=C1)=CC=C1OCCCOC1=CC(F)=CC=C1F ZZAPHJXDKYDMKH-UHFFFAOYSA-N 0.000 description 1
- FXOBWJQLZRHGGU-UHFFFAOYSA-N benzyl 4-[4-[3-(2,5-difluorophenoxy)propoxy]phenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCCOC1=CC(F)=CC=C1F FXOBWJQLZRHGGU-UHFFFAOYSA-N 0.000 description 1
- TZBFYRSIYOTDGG-UHFFFAOYSA-N benzyl 4-[4-[3-(2,5-difluorophenoxy)propoxy]phenyl]-3-hydroxy-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCCOC1=CC(F)=CC=C1F TZBFYRSIYOTDGG-UHFFFAOYSA-N 0.000 description 1
- HOQPRYWXFUIFEE-UHFFFAOYSA-N benzyl 4-[4-[3-(2,5-difluorophenyl)propoxymethyl]phenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1COCCCC1=CC(F)=CC=C1F HOQPRYWXFUIFEE-UHFFFAOYSA-N 0.000 description 1
- QYADONLAZBGUGU-UHFFFAOYSA-N benzyl 4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]-3-[[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)C(=O)COC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C(C=C1)=CC=C1OCCCOC1=CC=CC=C1Cl QYADONLAZBGUGU-UHFFFAOYSA-N 0.000 description 1
- MMQQNWCRQNYCDX-UHFFFAOYSA-N benzyl 4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCCOC1=CC=CC=C1Cl MMQQNWCRQNYCDX-UHFFFAOYSA-N 0.000 description 1
- STPWXMQPYBDSIE-UHFFFAOYSA-N benzyl 4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]-3-hydroxy-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCCOC1=CC=CC=C1Cl STPWXMQPYBDSIE-UHFFFAOYSA-N 0.000 description 1
- KFPVHBSMYOCHIM-UHFFFAOYSA-N benzyl 4-[4-[3-[(2-fluorophenyl)methoxy]propoxy]phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O[Si](C(C)C)(C(C)C)C(C)C)C1C(C=C1)=CC=C1OCCCOCC1=CC=CC=C1F KFPVHBSMYOCHIM-UHFFFAOYSA-N 0.000 description 1
- CKCLTIHKWPGDFA-UHFFFAOYSA-N benzyl 4-[4-[3-[(2-fluorophenyl)methoxy]propoxy]phenyl]-3-hydroxy-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCCOCC1=CC=CC=C1F CKCLTIHKWPGDFA-UHFFFAOYSA-N 0.000 description 1
- CPHBHGOONRVBHV-UHFFFAOYSA-N benzyl 4-[4-[3-[(2-fluorophenyl)methoxy]propoxy]phenyl]-3-hydroxy-5-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OC1CN(C(=O)OCC=2C=CC=CC=2)CC(O)C1C(C=C1)=CC=C1OCCCOCC1=CC=CC=C1F CPHBHGOONRVBHV-UHFFFAOYSA-N 0.000 description 1
- SFBOVEQCUFHUDQ-UHFFFAOYSA-N benzyl 4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-3-tri(propan-2-yl)silyloxypiperidine-1-carboxylate Chemical compound C1=C2N(CCCOC)CCOC2=CC=C1COC1(O[Si](C(C)C)(C(C)C)C(C)C)CN(C(=O)OCC=2C=CC=CC=2)CCC1C(C=C1)=CC=C1OCCCOCC1=CC=CC=C1OC SFBOVEQCUFHUDQ-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000003613 bile acid Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- MAEIEVLCKWDQJH-UHFFFAOYSA-N bumetanide Chemical compound CCCCNC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1OC1=CC=CC=C1 MAEIEVLCKWDQJH-UHFFFAOYSA-N 0.000 description 1
- 229960004064 bumetanide Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229960000830 captopril Drugs 0.000 description 1
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229960001222 carteolol Drugs 0.000 description 1
- LWAFSWPYPHEXKX-UHFFFAOYSA-N carteolol Chemical compound N1C(=O)CCC2=C1C=CC=C2OCC(O)CNC(C)(C)C LWAFSWPYPHEXKX-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- LNAMMBFJMYMQTO-FNEBRGMMSA-N chloroform;(1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].ClC(Cl)Cl.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 LNAMMBFJMYMQTO-FNEBRGMMSA-N 0.000 description 1
- 229960002155 chlorothiazide Drugs 0.000 description 1
- 229960001523 chlortalidone Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 208000020832 chronic kidney disease Diseases 0.000 description 1
- 208000022831 chronic renal failure syndrome Diseases 0.000 description 1
- HHHKFGXWKKUNCY-FHWLQOOXSA-N cilazapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H]1C(N2[C@@H](CCCN2CCC1)C(O)=O)=O)CC1=CC=CC=C1 HHHKFGXWKKUNCY-FHWLQOOXSA-N 0.000 description 1
- 229960005025 cilazapril Drugs 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229960002303 citric acid monohydrate Drugs 0.000 description 1
- 229960002896 clonidine Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 238000005828 desilylation reaction Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 description 1
- 229960004042 diazoxide Drugs 0.000 description 1
- HSUGRBWQSSZJOP-RTWAWAEBSA-N diltiazem Chemical compound C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CCN(C)C)C2=CC=CC=C2S1 HSUGRBWQSSZJOP-RTWAWAEBSA-N 0.000 description 1
- 229960004166 diltiazem Drugs 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- DWLVWMUCHSLGSU-UHFFFAOYSA-N dimethylcarbamic acid Chemical compound CN(C)C(O)=O DWLVWMUCHSLGSU-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229960000873 enalapril Drugs 0.000 description 1
- GBXSMTUPTTWBMN-XIRDDKMYSA-N enalapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 GBXSMTUPTTWBMN-XIRDDKMYSA-N 0.000 description 1
- 239000002792 enkephalinase inhibitor Substances 0.000 description 1
- AVOLMBLBETYQHX-UHFFFAOYSA-N etacrynic acid Chemical compound CCC(=C)C(=O)C1=CC=C(OCC(O)=O)C(Cl)=C1Cl AVOLMBLBETYQHX-UHFFFAOYSA-N 0.000 description 1
- 229960003199 etacrynic acid Drugs 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 229960002602 fendiline Drugs 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- UYGONJYYUKVHDD-UHFFFAOYSA-N flosequinan Chemical compound C1=C(F)C=C2N(C)C=C(S(C)=O)C(=O)C2=C1 UYGONJYYUKVHDD-UHFFFAOYSA-N 0.000 description 1
- 229960001606 flosequinan Drugs 0.000 description 1
- SMANXXCATUTDDT-QPJJXVBHSA-N flunarizine Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)N1CCN(C\C=C\C=2C=CC=CC=2)CC1 SMANXXCATUTDDT-QPJJXVBHSA-N 0.000 description 1
- 229960000326 flunarizine Drugs 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- LZLGHWHSUZVUFZ-HZPDHXFCSA-N folerogenin Chemical compound C1([C@@H]2[C@H](O)C(=O)C3=C(O)C=C(C=C3O2)OC)=CC=C(O)C=C1 LZLGHWHSUZVUFZ-HZPDHXFCSA-N 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 229960000457 gallopamil Drugs 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 229960004553 guanabenz Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 229960002474 hydralazine Drugs 0.000 description 1
- 229960002003 hydrochlorothiazide Drugs 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229950009607 indacrinone Drugs 0.000 description 1
- 239000008011 inorganic excipient Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FPCCSQOGAWCVBH-UHFFFAOYSA-N ketanserin Chemical compound C1=CC(F)=CC=C1C(=O)C1CCN(CCN2C(C3=CC=CC=C3NC2=O)=O)CC1 FPCCSQOGAWCVBH-UHFFFAOYSA-N 0.000 description 1
- 229960005417 ketanserin Drugs 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 229960002394 lisinopril Drugs 0.000 description 1
- RLAWWYSOJDYHDC-BZSNNMDCSA-N lisinopril Chemical compound C([C@H](N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(O)=O)C(O)=O)CC1=CC=CC=C1 RLAWWYSOJDYHDC-BZSNNMDCSA-N 0.000 description 1
- 235000014659 low sodium diet Nutrition 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- LVKCSZQWLOVUGB-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].C[CH-]C LVKCSZQWLOVUGB-UHFFFAOYSA-M 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- KDEAGVPWDUKUFI-UQKRIMTDSA-N methanesulfonyl chloride;[(2s)-4-tri(propan-2-yl)silyloxybutan-2-yl] methanesulfonate Chemical compound CS(Cl)(=O)=O.CS(=O)(=O)O[C@@H](C)CCO[Si](C(C)C)(C(C)C)C(C)C KDEAGVPWDUKUFI-UQKRIMTDSA-N 0.000 description 1
- WPGYGHFVLMZWHI-UHFFFAOYSA-N methyl 3-oxo-4h-1,4-benzoxazine-6-carboxylate Chemical compound O1CC(=O)NC2=CC(C(=O)OC)=CC=C21 WPGYGHFVLMZWHI-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- AQCHWTWZEMGIFD-UHFFFAOYSA-N metolazone Chemical compound CC1NC2=CC(Cl)=C(S(N)(=O)=O)C=C2C(=O)N1C1=CC=CC=C1C AQCHWTWZEMGIFD-UHFFFAOYSA-N 0.000 description 1
- 229960002817 metolazone Drugs 0.000 description 1
- 229960002237 metoprolol Drugs 0.000 description 1
- IUBSYMUCCVWXPE-UHFFFAOYSA-N metoprolol Chemical compound COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 IUBSYMUCCVWXPE-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960003632 minoxidil Drugs 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960004255 nadolol Drugs 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229960001783 nicardipine Drugs 0.000 description 1
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 description 1
- 229960001597 nifedipine Drugs 0.000 description 1
- 229960000715 nimodipine Drugs 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229960002460 nitroprusside Drugs 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000008012 organic excipient Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000813 peptide hormone Substances 0.000 description 1
- CYXKNKQEMFBLER-UHFFFAOYSA-N perhexiline Chemical compound C1CCCNC1CC(C1CCCCC1)C1CCCCC1 CYXKNKQEMFBLER-UHFFFAOYSA-N 0.000 description 1
- WXALHTONIYRUCO-UHFFFAOYSA-N peroxycyanic acid Chemical compound OOC#N WXALHTONIYRUCO-UHFFFAOYSA-N 0.000 description 1
- RLZZZVKAURTHCP-UHFFFAOYSA-N phenanthrene-3,4-diol Chemical compound C1=CC=C2C3=C(O)C(O)=CC=C3C=CC2=C1 RLZZZVKAURTHCP-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229960003418 phenoxybenzamine Drugs 0.000 description 1
- 229960001999 phentolamine Drugs 0.000 description 1
- MRBDMNSDAVCSSF-UHFFFAOYSA-N phentolamine Chemical compound C1=CC(C)=CC=C1N(C=1C=C(O)C=CC=1)CC1=NCCN1 MRBDMNSDAVCSSF-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 229960002310 pinacidil Drugs 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229960001289 prazosin Drugs 0.000 description 1
- IENZQIKPVFGBNW-UHFFFAOYSA-N prazosin Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CO1 IENZQIKPVFGBNW-UHFFFAOYSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 125000006410 propenylene group Chemical group 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960003712 propranolol Drugs 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000005554 pyridyloxy group Chemical group 0.000 description 1
- 125000005030 pyridylthio group Chemical group N1=C(C=CC=C1)S* 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 238000003127 radioimmunoassay Methods 0.000 description 1
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 description 1
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 1
- 229960003147 reserpine Drugs 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- BBMHARZCALWXSL-UHFFFAOYSA-M sodium dihydrogenphosphate monohydrate Chemical compound O.[Na+].OP(O)([O-])=O BBMHARZCALWXSL-UHFFFAOYSA-M 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- LXMSZDCAJNLERA-ZHYRCANASA-N spironolactone Chemical compound C([C@@H]1[C@]2(C)CC[C@@H]3[C@@]4(C)CCC(=O)C=C4C[C@H]([C@@H]13)SC(=O)C)C[C@@]21CCC(=O)O1 LXMSZDCAJNLERA-ZHYRCANASA-N 0.000 description 1
- 229960002256 spironolactone Drugs 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000000948 sympatholitic effect Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229960001693 terazosin Drugs 0.000 description 1
- VCKUSRYTPJJLNI-UHFFFAOYSA-N terazosin Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1CCCO1 VCKUSRYTPJJLNI-UHFFFAOYSA-N 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003396 thiol group Chemical class [H]S* 0.000 description 1
- 229960004605 timolol Drugs 0.000 description 1
- 229940110851 tolazine Drugs 0.000 description 1
- JIVZKJJQOZQXQB-UHFFFAOYSA-N tolazoline Chemical compound C=1C=CC=CC=1CC1=NCCN1 JIVZKJJQOZQXQB-UHFFFAOYSA-N 0.000 description 1
- 238000007070 tosylation reaction Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- LHJCZOXMCGQVDQ-UHFFFAOYSA-N tri(propan-2-yl)silyl trifluoromethanesulfonate Chemical compound CC(C)[Si](C(C)C)(C(C)C)OS(=O)(=O)C(F)(F)F LHJCZOXMCGQVDQ-UHFFFAOYSA-N 0.000 description 1
- 229960001288 triamterene Drugs 0.000 description 1
- SEDZOYHHAIAQIW-UHFFFAOYSA-N trimethylsilyl azide Chemical compound C[Si](C)(C)N=[N+]=[N-] SEDZOYHHAIAQIW-UHFFFAOYSA-N 0.000 description 1
- 208000019553 vascular disease Diseases 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 229960001722 verapamil Drugs 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/12—Drugs for disorders of the urinary system of the kidneys
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/06—Antiglaucoma agents or miotics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Urology & Nephrology (AREA)
- Ophthalmology & Optometry (AREA)
- Hospice & Palliative Care (AREA)
- Vascular Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1158/04 | 2004-07-09 | ||
| CH11582004 | 2004-07-09 | ||
| PCT/EP2005/053306 WO2006005741A2 (en) | 2004-07-09 | 2005-07-11 | Piperdine derivatives as renin inhibitors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2570920A1 true CA2570920A1 (en) | 2006-01-19 |
Family
ID=35448323
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002570920A Abandoned CA2570920A1 (en) | 2004-07-09 | 2005-07-11 | Piperidine derivatives as renin inhibitors |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US20080076766A1 (enExample) |
| EP (1) | EP1776359B1 (enExample) |
| JP (1) | JP4842262B2 (enExample) |
| CN (1) | CN101014594A (enExample) |
| AR (1) | AR053406A1 (enExample) |
| AT (1) | ATE521607T1 (enExample) |
| BR (1) | BRPI0513199A (enExample) |
| CA (1) | CA2570920A1 (enExample) |
| ES (1) | ES2372502T3 (enExample) |
| IL (1) | IL180242A0 (enExample) |
| PL (1) | PL1776359T3 (enExample) |
| PT (1) | PT1776359E (enExample) |
| TW (1) | TW200613274A (enExample) |
| WO (1) | WO2006005741A2 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2009135299A1 (en) * | 2008-05-05 | 2009-11-12 | Merck Frosst Canada Ltd. | 3, 4 - substituted piperidine derivatives as renin inhibitors |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE602005020314D1 (de) | 2004-08-25 | 2010-05-12 | Actelion Pharmaceuticals Ltd | Bicyclononen-derivate als renin-inhibitoren |
| GB0428526D0 (en) | 2004-12-30 | 2005-02-09 | Novartis Ag | Organic compounds |
| JP2008535825A (ja) * | 2005-03-31 | 2008-09-04 | シュペーデル・エクスペリメンタ・アーゲー | レニン阻害剤としての3,4,5−置換ピペリジン |
| TW200722424A (en) * | 2005-03-31 | 2007-06-16 | Speedel Experimenta Ag | Substituted piperidines |
| EP1707202A1 (de) * | 2005-03-31 | 2006-10-04 | Speedel Experimenta AG | Organische Verbindungen |
| GB0508992D0 (en) * | 2005-05-03 | 2005-06-08 | Novartis Ag | Organic compounds |
| GB0510810D0 (en) * | 2005-05-26 | 2005-06-29 | Novartis Ag | Organic compounds |
| MX2007014722A (es) | 2005-05-27 | 2008-02-15 | Actelion Pharmaceuticals Ltd | Nuevos derivados de amida de acido piperidin carboxilico. |
| GB0514203D0 (en) | 2005-07-11 | 2005-08-17 | Novartis Ag | Organic compounds |
| NZ569135A (en) | 2005-12-30 | 2011-08-26 | Novartis Ag | 3,5-Substituted piperidine compounds as renin inhibitors |
| TW200804359A (en) * | 2006-01-19 | 2008-01-16 | Speedel Experimenta Ag | Substituted 4-phenylpiperidines |
| EP1816122A3 (en) * | 2006-01-19 | 2007-09-19 | Speedel Experimenta AG | 3,4,5-substituted piperidines as therapeutic compounds |
| TW200821303A (en) * | 2006-08-08 | 2008-05-16 | Speedel Experimenta Ag | Organic compounds |
| EP1908761A1 (en) * | 2006-10-04 | 2008-04-09 | Speedel Experimenta AG | Organic compounds |
| EP1911758A1 (en) * | 2006-10-04 | 2008-04-16 | Speedel Experimenta AG | Phenyl piperidine derivatives for use as renin inhibitors |
| WO2008074450A2 (en) * | 2006-12-20 | 2008-06-26 | Nicox S.A. | Non-peptidic renin inhibitors nitroderivatives |
| TWI452044B (zh) | 2007-06-15 | 2014-09-11 | Mitsubishi Tanabe Pharma Corp | 嗎啉衍生物 |
| WO2009000811A1 (en) | 2007-06-25 | 2008-12-31 | Novartis Ag | N5-(2-ethoxyethyl)-n3-(2-pyridinyl)-3,5-piperidinedicarboxamide derivatives for use as renin inhibitors |
| TW200922596A (en) * | 2007-10-25 | 2009-06-01 | Speedel Experimenta Ag | 4,4-disubstituted piperidines |
| TW200932241A (en) * | 2007-12-05 | 2009-08-01 | Speedel Experimenta Ag | Organic compounds |
| WO2009098276A1 (en) * | 2008-02-08 | 2009-08-13 | Novartis Ag | Substituted piperidines as renin inhibitors |
| CA2714347A1 (en) | 2008-02-08 | 2009-08-13 | Novartis Ag | Substituted piperidines as renin inhibitors |
| WO2009106599A2 (en) * | 2008-02-29 | 2009-09-03 | Novartis Ag | Substituted piperidines as therapeutic compounds |
| WO2009127251A1 (en) * | 2008-04-16 | 2009-10-22 | Novartis Ag | Combinations comprising a renin inhibitor |
| CA2728476C (en) | 2008-06-19 | 2017-03-21 | Takeda Pharmaceutical Company Limited | Heterocyclic carboxamide compounds and their use in the prophylaxis or treatment of hypertension |
| EP2163245A1 (en) | 2008-09-10 | 2010-03-17 | Novartis Ag | Renin inhibitors for the treatment of psoriasis |
| EP2336105B9 (en) | 2008-09-19 | 2014-09-17 | Takeda Pharmaceutical Company Limited | Nitrogen-containing heterocyclic compound and use of same |
| CA2756780A1 (en) * | 2009-04-03 | 2010-10-07 | Merck Sharp & Dohme Corp. | Renin inhibitors |
| EP2384745A3 (en) * | 2010-05-05 | 2012-01-18 | Sanovel Ilac Sanayi ve Ticaret A.S. | Modified release pharmaceutical compositions of dexlansoprazole |
| US8563035B2 (en) | 2010-05-05 | 2013-10-22 | Sanovel Ilac Sanayi Ve Ticaret Anomin Sirketi | Oral tablet compositions of dexlansoprazole |
| EP2384746A3 (en) | 2010-05-05 | 2012-03-07 | Sanovel Ilac Sanayi ve Ticaret A.S. | Dual release oral tablet compositions of dexlansoprazole |
| US20250263413A1 (en) * | 2020-12-02 | 2025-08-21 | Qurient Co., Ltd. | Compounds having cyclin-dependent kinase(cdk)-inhibitory function |
| EP4493551A1 (en) | 2022-03-14 | 2025-01-22 | Slap Pharmaceuticals LLC | Multicyclic compounds |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1997009311A1 (de) * | 1995-09-07 | 1997-03-13 | F. Hoffmann-La Roche Ag | Neue 4-(oxyalkoxyphenyl)-3-oxy-piperidine zur behandlung von herz- und niereninsuffizienz |
| US6376672B1 (en) * | 1999-04-27 | 2002-04-23 | Hoffmann-La Roche Inc. | Naphthalenylmethoxypiperidines as renin inhibitors |
| US6197959B1 (en) * | 1999-04-27 | 2001-03-06 | Hoffmann-La Roche Inc. | Piperidine derivatives |
| JP2004534017A (ja) * | 2001-04-27 | 2004-11-11 | バーテックス ファーマシューティカルズ インコーポレイテッド | Baceのインヒビター |
| US20040204455A1 (en) * | 2003-04-10 | 2004-10-14 | Cody Wayne Livingston | Piperidine derivative rennin inhibitors |
-
2005
- 2005-07-08 AR ARP050102851A patent/AR053406A1/es not_active Application Discontinuation
- 2005-07-08 TW TW094123146A patent/TW200613274A/zh unknown
- 2005-07-11 JP JP2007519812A patent/JP4842262B2/ja not_active Expired - Fee Related
- 2005-07-11 CN CNA2005800227495A patent/CN101014594A/zh active Pending
- 2005-07-11 AT AT05761185T patent/ATE521607T1/de active
- 2005-07-11 PL PL05761185T patent/PL1776359T3/pl unknown
- 2005-07-11 CA CA002570920A patent/CA2570920A1/en not_active Abandoned
- 2005-07-11 BR BRPI0513199-5A patent/BRPI0513199A/pt not_active IP Right Cessation
- 2005-07-11 PT PT05761185T patent/PT1776359E/pt unknown
- 2005-07-11 WO PCT/EP2005/053306 patent/WO2006005741A2/en not_active Ceased
- 2005-07-11 EP EP05761185A patent/EP1776359B1/en not_active Expired - Lifetime
- 2005-07-11 ES ES05761185T patent/ES2372502T3/es not_active Expired - Lifetime
- 2005-07-11 US US11/631,777 patent/US20080076766A1/en not_active Abandoned
-
2006
- 2006-12-21 IL IL180242A patent/IL180242A0/en unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2009135299A1 (en) * | 2008-05-05 | 2009-11-12 | Merck Frosst Canada Ltd. | 3, 4 - substituted piperidine derivatives as renin inhibitors |
| EA020853B1 (ru) * | 2008-05-05 | 2015-02-27 | Мерк Кэнэда Инк. | 3,4-замещенные пиперидиновые производные в качестве ингибиторов ренина |
Also Published As
| Publication number | Publication date |
|---|---|
| HK1104037A1 (en) | 2008-01-04 |
| PL1776359T3 (pl) | 2012-01-31 |
| JP4842262B2 (ja) | 2011-12-21 |
| WO2006005741A3 (en) | 2006-07-06 |
| ES2372502T3 (es) | 2012-01-20 |
| US20080076766A1 (en) | 2008-03-27 |
| WO2006005741A2 (en) | 2006-01-19 |
| ATE521607T1 (de) | 2011-09-15 |
| IL180242A0 (en) | 2007-07-04 |
| EP1776359A2 (en) | 2007-04-25 |
| AR053406A1 (es) | 2007-05-09 |
| PT1776359E (pt) | 2011-12-15 |
| CN101014594A (zh) | 2007-08-08 |
| EP1776359B1 (en) | 2011-08-24 |
| JP2008505871A (ja) | 2008-02-28 |
| BRPI0513199A (pt) | 2008-04-29 |
| TW200613274A (en) | 2006-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2570920A1 (en) | Piperidine derivatives as renin inhibitors | |
| US7687495B2 (en) | Substituted piperidines | |
| US20120115859A1 (en) | 3,4,5-substituted piperidines as renin inhibitors | |
| EP2049514B1 (en) | Nitrate esters of piperidines | |
| EP1863802B1 (en) | Substituted piperidines as renin inhibitors | |
| BRPI0712430A2 (pt) | piperidinas 2,5-di-substitìdas. | |
| EP1934207B1 (en) | Substituted 4-phenyl piperidines for use as renin inhibitors | |
| EP1908761A1 (en) | Organic compounds | |
| EP1908762A2 (en) | Organic compounds | |
| EP1897879A2 (en) | 2,4,5 substituted piperidines as renin inhibitors | |
| HK1116163A (en) | 2,4,5 substituted piperidines as renin inhibitors | |
| HK1104037B (en) | Piperidine derivatives as renin inhibitors | |
| HK1119678B (en) | Substituted 4-phenyl piperidines for use as renin inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |
Effective date: 20130711 |