CA2565066A1 - Therapeutic compounds - Google Patents
Therapeutic compounds Download PDFInfo
- Publication number
- CA2565066A1 CA2565066A1 CA002565066A CA2565066A CA2565066A1 CA 2565066 A1 CA2565066 A1 CA 2565066A1 CA 002565066 A CA002565066 A CA 002565066A CA 2565066 A CA2565066 A CA 2565066A CA 2565066 A1 CA2565066 A1 CA 2565066A1
- Authority
- CA
- Canada
- Prior art keywords
- amino
- carbonyl
- chloro
- phenyl
- 6alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 200
- 230000001225 therapeutic effect Effects 0.000 title description 4
- 238000002560 therapeutic procedure Methods 0.000 claims abstract description 22
- 208000002193 Pain Diseases 0.000 claims abstract description 20
- 150000003839 salts Chemical class 0.000 claims abstract description 15
- 230000036407 pain Effects 0.000 claims abstract description 14
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 10
- -1 diastereomers Chemical class 0.000 claims description 230
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 192
- 238000000034 method Methods 0.000 claims description 112
- 239000007821 HATU Substances 0.000 claims description 48
- 229910052736 halogen Inorganic materials 0.000 claims description 48
- 150000002367 halogens Chemical class 0.000 claims description 48
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 27
- 125000000623 heterocyclic group Chemical group 0.000 claims description 27
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 26
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 22
- 238000011282 treatment Methods 0.000 claims description 20
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 16
- 239000003814 drug Substances 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 14
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 13
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 13
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 12
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 12
- 125000006620 amino-(C1-C6) alkyl group Chemical group 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 12
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 208000018522 Gastrointestinal disease Diseases 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000002883 imidazolyl group Chemical group 0.000 claims description 10
- 208000002551 irritable bowel syndrome Diseases 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 10
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 10
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 8
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 8
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 8
- 125000004076 pyridyl group Chemical group 0.000 claims description 8
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 8
- 241001465754 Metazoa Species 0.000 claims description 7
- 239000003153 chemical reaction reagent Substances 0.000 claims description 7
- 230000008878 coupling Effects 0.000 claims description 7
- 238000010168 coupling process Methods 0.000 claims description 7
- 238000005859 coupling reaction Methods 0.000 claims description 7
- 125000002757 morpholinyl group Chemical group 0.000 claims description 7
- 125000004193 piperazinyl group Chemical group 0.000 claims description 7
- 125000003386 piperidinyl group Chemical group 0.000 claims description 7
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 claims description 6
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 claims description 6
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 claims description 6
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 claims description 6
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 claims description 6
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 6
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 claims description 6
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 claims description 6
- 125000003725 azepanyl group Chemical group 0.000 claims description 6
- 208000035475 disorder Diseases 0.000 claims description 6
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 6
- 125000003965 isoxazolidinyl group Chemical group 0.000 claims description 6
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 6
- 125000002971 oxazolyl group Chemical group 0.000 claims description 6
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 6
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 6
- 125000000335 thiazolyl group Chemical group 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 claims description 5
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 claims description 5
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical group C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 claims description 5
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 claims description 5
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 5
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 5
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 5
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 5
- 125000004623 carbolinyl group Chemical group 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000002632 imidazolidinyl group Chemical group 0.000 claims description 5
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 5
- 125000001041 indolyl group Chemical group 0.000 claims description 5
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 5
- 125000003072 pyrazolidinyl group Chemical group 0.000 claims description 5
- 125000002755 pyrazolinyl group Chemical group 0.000 claims description 5
- 125000001422 pyrrolinyl group Chemical group 0.000 claims description 5
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 5
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 claims description 5
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 5
- 125000004568 thiomorpholinyl group Chemical group 0.000 claims description 5
- 125000004306 triazinyl group Chemical group 0.000 claims description 5
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 claims description 4
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 4
- 208000019901 Anxiety disease Diseases 0.000 claims description 4
- 208000018737 Parkinson disease Diseases 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 3
- 208000024827 Alzheimer disease Diseases 0.000 claims description 3
- 208000023105 Huntington disease Diseases 0.000 claims description 3
- 206010028980 Neoplasm Diseases 0.000 claims description 3
- 125000002393 azetidinyl group Chemical group 0.000 claims description 3
- 201000011510 cancer Diseases 0.000 claims description 3
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 201000006417 multiple sclerosis Diseases 0.000 claims description 3
- IZOYEAKDGDHLTC-UHFFFAOYSA-N n-[2-(cyclobutylmethylcarbamoyl)-3-methoxyphenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1CCC1 IZOYEAKDGDHLTC-UHFFFAOYSA-N 0.000 claims description 3
- WHLMZFIQWVRHPS-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-3-methoxyphenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1CCCCC1 WHLMZFIQWVRHPS-UHFFFAOYSA-N 0.000 claims description 3
- XMNFRSXOJXKDRG-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-3-methylphenyl]naphthalene-1-carboxamide Chemical compound CC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1CCCCC1 XMNFRSXOJXKDRG-UHFFFAOYSA-N 0.000 claims description 3
- SIIFPKJCFFEVIK-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-4,5-dimethoxyphenyl]naphthalene-1-carboxamide Chemical compound C1=C(OC)C(OC)=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1CCCCC1 SIIFPKJCFFEVIK-UHFFFAOYSA-N 0.000 claims description 3
- YSSQBBGOSSBBRV-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-4-fluorophenyl]naphthalene-1-carboxamide Chemical compound C=1C(F)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 YSSQBBGOSSBBRV-UHFFFAOYSA-N 0.000 claims description 3
- BVDHIUDRBFOWKP-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-4-methoxyphenyl]naphthalene-1-carboxamide Chemical compound C=1C(OC)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 BVDHIUDRBFOWKP-UHFFFAOYSA-N 0.000 claims description 3
- MKZLQLWIWLSUSJ-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-4-methylphenyl]naphthalene-1-carboxamide Chemical compound C=1C(C)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 MKZLQLWIWLSUSJ-UHFFFAOYSA-N 0.000 claims description 3
- BDGBGEOKAOLUJG-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-6-methoxyphenyl]naphthalene-1-carboxamide Chemical compound C=1C=CC2=CC=CC=C2C=1C(=O)NC=1C(OC)=CC=CC=1C(=O)NCC1CCCCC1 BDGBGEOKAOLUJG-UHFFFAOYSA-N 0.000 claims description 3
- HSEYZFCCYBVDJK-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-6-methylphenyl]naphthalene-1-carboxamide Chemical compound C=1C=CC2=CC=CC=C2C=1C(=O)NC=1C(C)=CC=CC=1C(=O)NCC1CCCCC1 HSEYZFCCYBVDJK-UHFFFAOYSA-N 0.000 claims description 3
- KNBNIDNUTXMPIG-UHFFFAOYSA-N n-[2-[4-(aminomethyl)piperidine-1-carbonyl]-4-chlorophenyl]naphthalene-1-carboxamide Chemical compound C1CC(CN)CCN1C(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 KNBNIDNUTXMPIG-UHFFFAOYSA-N 0.000 claims description 3
- RTCYEOIRYHLJHG-UHFFFAOYSA-N n-[2-chloro-6-(cyclohexylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C=CC2=CC=CC=C2C=1C(=O)NC=1C(Cl)=CC=CC=1C(=O)NCC1CCCCC1 RTCYEOIRYHLJHG-UHFFFAOYSA-N 0.000 claims description 3
- PCYJWWJDUJNNOA-UHFFFAOYSA-N n-[3-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound ClC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1CCCCC1 PCYJWWJDUJNNOA-UHFFFAOYSA-N 0.000 claims description 3
- OMLNXVPDAZXSMU-UHFFFAOYSA-N n-[4-acetamido-2-(cyclohexylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(NC(=O)C)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 OMLNXVPDAZXSMU-UHFFFAOYSA-N 0.000 claims description 3
- WRLRVCGOKCCUEU-UHFFFAOYSA-N n-[4-amino-2-(cyclohexylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(N)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 WRLRVCGOKCCUEU-UHFFFAOYSA-N 0.000 claims description 3
- QQJAWFLLGHFYLE-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]quinoline-8-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=NC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 QQJAWFLLGHFYLE-UHFFFAOYSA-N 0.000 claims description 3
- HUAWEPYSKBGPFS-UHFFFAOYSA-N n-[4-chloro-2-(oxan-4-ylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCOCC1 HUAWEPYSKBGPFS-UHFFFAOYSA-N 0.000 claims description 3
- ZJSNSGLNWCBWKB-UHFFFAOYSA-N n-[4-chloro-2-(piperidin-4-ylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCNCC1 ZJSNSGLNWCBWKB-UHFFFAOYSA-N 0.000 claims description 3
- HYMOUKKBDFYKSH-UHFFFAOYSA-N n-[5-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C=CC2=CC=CC=C2C=1C(=O)NC1=CC(Cl)=CC=C1C(=O)NCC1CCCCC1 HYMOUKKBDFYKSH-UHFFFAOYSA-N 0.000 claims description 3
- IDCYPWKEIDLPGI-UHFFFAOYSA-N tert-butyl 3-[[[2-methoxy-6-(naphthalene-1-carbonylamino)benzoyl]amino]methyl]morpholine-4-carboxylate Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1COCCN1C(=O)OC(C)(C)C IDCYPWKEIDLPGI-UHFFFAOYSA-N 0.000 claims description 3
- MVZGSGDGYQMJCF-UHFFFAOYSA-N 2-benzamido-5-chloro-n-(cyclohexylmethyl)benzamide Chemical compound C1CCCCC1CNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC=C1 MVZGSGDGYQMJCF-UHFFFAOYSA-N 0.000 claims description 2
- CFZDMYBYXHYQNE-UHFFFAOYSA-N 2-chloro-n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-3-(trifluoromethyl)benzamide Chemical compound FC(F)(F)C1=CC=CC(C(=O)NC=2C(=CC(Cl)=CC=2)C(=O)NCC2CCCCC2)=C1Cl CFZDMYBYXHYQNE-UHFFFAOYSA-N 0.000 claims description 2
- PZIFLRDSLOYAPY-UHFFFAOYSA-N 3-chloro-n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2-fluorobenzamide Chemical compound FC1=C(Cl)C=CC=C1C(=O)NC1=CC=C(Cl)C=C1C(=O)NCC1CCCCC1 PZIFLRDSLOYAPY-UHFFFAOYSA-N 0.000 claims description 2
- PNDNMMULBGQMPZ-UHFFFAOYSA-N 3-chloro-n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2-methylbenzamide Chemical compound CC1=C(Cl)C=CC=C1C(=O)NC1=CC=C(Cl)C=C1C(=O)NCC1CCCCC1 PNDNMMULBGQMPZ-UHFFFAOYSA-N 0.000 claims description 2
- TYGHOGZJYYBZNN-UHFFFAOYSA-N 6-chloro-n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2-fluoro-3-methylbenzamide Chemical compound CC1=CC=C(Cl)C(C(=O)NC=2C(=CC(Cl)=CC=2)C(=O)NCC2CCCCC2)=C1F TYGHOGZJYYBZNN-UHFFFAOYSA-N 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 2
- 230000036506 anxiety Effects 0.000 claims description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 2
- QQYVQKKYOICURV-UHFFFAOYSA-N n-[2-(1,4-dioxan-2-ylmethylcarbamoyl)-3-methoxyphenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1COCCO1 QQYVQKKYOICURV-UHFFFAOYSA-N 0.000 claims description 2
- FKUHOYJRFHRNAZ-UHFFFAOYSA-N n-[2-(1-azabicyclo[2.2.2]octan-3-ylcarbamoyl)-3-methoxyphenyl]naphthalene-1-carboxamide Chemical compound C1N(CC2)CCC2C1NC(=O)C1=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=CC=C1OC FKUHOYJRFHRNAZ-UHFFFAOYSA-N 0.000 claims description 2
- OHFLHRFVWHZHBU-UHFFFAOYSA-N n-[2-(2-hydroxybutylcarbamoyl)-3-methoxyphenyl]naphthalene-1-carboxamide Chemical compound C1=CC=C(OC)C(C(=O)NCC(O)CC)=C1NC(=O)C1=CC=CC2=CC=CC=C12 OHFLHRFVWHZHBU-UHFFFAOYSA-N 0.000 claims description 2
- HSCOCTYALWONPA-UHFFFAOYSA-N n-[2-(2-hydroxyethylcarbamoyl)-3-methoxyphenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCCO HSCOCTYALWONPA-UHFFFAOYSA-N 0.000 claims description 2
- JPJKXZBGBKPMSG-UHFFFAOYSA-N n-[2-(2-hydroxypropylcarbamoyl)-3-methoxyphenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC(C)O JPJKXZBGBKPMSG-UHFFFAOYSA-N 0.000 claims description 2
- XHWNUSKRIIMPTH-UHFFFAOYSA-N n-[2-(azepane-1-carbonyl)-4-chlorophenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)N1CCCCCC1 XHWNUSKRIIMPTH-UHFFFAOYSA-N 0.000 claims description 2
- NPCVKFLJKPPCMU-UHFFFAOYSA-N n-[2-(cyclobutylmethylcarbamoyl)-3-hydroxyphenyl]naphthalene-1-carboxamide Chemical compound OC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1CCC1 NPCVKFLJKPPCMU-UHFFFAOYSA-N 0.000 claims description 2
- KLQRIBBBVAOORZ-UHFFFAOYSA-N n-[2-(cyclobutylmethylcarbamoyl)-4-fluorophenyl]naphthalene-1-carboxamide Chemical compound C=1C(F)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCC1 KLQRIBBBVAOORZ-UHFFFAOYSA-N 0.000 claims description 2
- MMOSTLDFSOXWIW-UHFFFAOYSA-N n-[2-(cyclobutylmethylcarbamoyl)-4-methylphenyl]naphthalene-1-carboxamide Chemical compound C=1C(C)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCC1 MMOSTLDFSOXWIW-UHFFFAOYSA-N 0.000 claims description 2
- UTALPROXQXOCDD-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-3-hydroxyphenyl]naphthalene-1-carboxamide Chemical compound OC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1CCCCC1 UTALPROXQXOCDD-UHFFFAOYSA-N 0.000 claims description 2
- JHEZHHJECNJMIU-UHFFFAOYSA-N n-[2-[4-(2-aminoethyl)piperazine-1-carbonyl]-4-chlorophenyl]naphthalene-1-carboxamide Chemical compound C1CN(CCN)CCN1C(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 JHEZHHJECNJMIU-UHFFFAOYSA-N 0.000 claims description 2
- URAKSDAXLLUUEO-UHFFFAOYSA-N n-[3-chloro-2-(cyclobutylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound ClC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1CCC1 URAKSDAXLLUUEO-UHFFFAOYSA-N 0.000 claims description 2
- KGBXGNWXDAEVOB-UHFFFAOYSA-N n-[3-methoxy-2-(2-morpholin-4-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCCN1CCOCC1 KGBXGNWXDAEVOB-UHFFFAOYSA-N 0.000 claims description 2
- UJTACDGKFOXDEY-UHFFFAOYSA-N n-[3-methoxy-2-(2-piperidin-1-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCCN1CCCCC1 UJTACDGKFOXDEY-UHFFFAOYSA-N 0.000 claims description 2
- VBPKKBMZPVKVDR-UHFFFAOYSA-N n-[3-methoxy-2-(morpholin-3-ylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCC1COCCN1 VBPKKBMZPVKVDR-UHFFFAOYSA-N 0.000 claims description 2
- NFFQZIOZNCRDDH-UHFFFAOYSA-N n-[3-methoxy-2-(morpholin-4-ylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NN1CCOCC1 NFFQZIOZNCRDDH-UHFFFAOYSA-N 0.000 claims description 2
- BPNQWPYCUWNCRG-UHFFFAOYSA-N n-[3-methoxy-2-(oxan-4-ylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NC1CCOCC1 BPNQWPYCUWNCRG-UHFFFAOYSA-N 0.000 claims description 2
- IROHLCFSRMSJAT-UHFFFAOYSA-N n-[3-methoxy-2-(piperidin-1-ylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NN1CCCCC1 IROHLCFSRMSJAT-UHFFFAOYSA-N 0.000 claims description 2
- FCWTXHYBLHXKAK-UHFFFAOYSA-N n-[4-chloro-2-(1,3-dioxolan-2-ylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1OCCO1 FCWTXHYBLHXKAK-UHFFFAOYSA-N 0.000 claims description 2
- MKZZPQABCBCSIM-UHFFFAOYSA-N n-[4-chloro-2-(2-morpholin-4-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCCN1CCOCC1 MKZZPQABCBCSIM-UHFFFAOYSA-N 0.000 claims description 2
- WQGZWMYZQDKKAA-UHFFFAOYSA-N n-[4-chloro-2-(2-piperazin-1-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCCN1CCNCC1 WQGZWMYZQDKKAA-UHFFFAOYSA-N 0.000 claims description 2
- KEWKVDBIVBBOBW-UHFFFAOYSA-N n-[4-chloro-2-(2-pyridin-2-ylpyrrolidine-1-carbonyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)N1CCCC1C1=CC=CC=N1 KEWKVDBIVBBOBW-UHFFFAOYSA-N 0.000 claims description 2
- OHDZLJZGBJBDGE-UHFFFAOYSA-N n-[4-chloro-2-(3-hydroxypiperidine-1-carbonyl)phenyl]naphthalene-1-carboxamide Chemical compound C1C(O)CCCN1C(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 OHDZLJZGBJBDGE-UHFFFAOYSA-N 0.000 claims description 2
- FKRPKQRHBFOYIW-UHFFFAOYSA-N n-[4-chloro-2-(3-hydroxypyrrolidine-1-carbonyl)phenyl]naphthalene-1-carboxamide Chemical compound C1C(O)CCN1C(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 FKRPKQRHBFOYIW-UHFFFAOYSA-N 0.000 claims description 2
- IJOMMSUEMBQOII-UHFFFAOYSA-N n-[4-chloro-2-(3-morpholin-4-ylpropylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCCCN1CCOCC1 IJOMMSUEMBQOII-UHFFFAOYSA-N 0.000 claims description 2
- GDMIQBRTTLTTGA-UHFFFAOYSA-N n-[4-chloro-2-(4-ethylpiperazine-1-carbonyl)phenyl]naphthalene-1-carboxamide Chemical compound C1CN(CC)CCN1C(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 GDMIQBRTTLTTGA-UHFFFAOYSA-N 0.000 claims description 2
- YQHHOQATVRBNNA-UHFFFAOYSA-N n-[4-chloro-2-(cyclobutylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCC1 YQHHOQATVRBNNA-UHFFFAOYSA-N 0.000 claims description 2
- LQKNWNKKVWDJCC-UHFFFAOYSA-N n-[4-chloro-2-(cycloheptylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCCC1 LQKNWNKKVWDJCC-UHFFFAOYSA-N 0.000 claims description 2
- BEYSVLFECQNHKI-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NC1CCCCC1 BEYSVLFECQNHKI-UHFFFAOYSA-N 0.000 claims description 2
- WOWAESIGSJOIKO-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2,2-difluoro-1,3-benzodioxole-4-carboxamide Chemical compound C=12OC(F)(F)OC2=CC=CC=1C(=O)NC1=CC=C(Cl)C=C1C(=O)NCC1CCCCC1 WOWAESIGSJOIKO-UHFFFAOYSA-N 0.000 claims description 2
- QZWCOSZSCOFSPH-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2,3-difluorobenzamide Chemical compound FC1=CC=CC(C(=O)NC=2C(=CC(Cl)=CC=2)C(=O)NCC2CCCCC2)=C1F QZWCOSZSCOFSPH-UHFFFAOYSA-N 0.000 claims description 2
- BDIIXARJTOEPDH-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2,3-dimethoxybenzamide Chemical compound COC1=CC=CC(C(=O)NC=2C(=CC(Cl)=CC=2)C(=O)NCC2CCCCC2)=C1OC BDIIXARJTOEPDH-UHFFFAOYSA-N 0.000 claims description 2
- IYOHNFHUMZVDEP-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2,3-dimethylbenzamide Chemical compound CC1=CC=CC(C(=O)NC=2C(=CC(Cl)=CC=2)C(=O)NCC2CCCCC2)=C1C IYOHNFHUMZVDEP-UHFFFAOYSA-N 0.000 claims description 2
- WMWWQYOSEXQFNN-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2-fluoro-3-(trifluoromethyl)benzamide Chemical compound C1=CC=C(C(F)(F)F)C(F)=C1C(=O)NC1=CC=C(Cl)C=C1C(=O)NCC1CCCCC1 WMWWQYOSEXQFNN-UHFFFAOYSA-N 0.000 claims description 2
- BEFIQOQLXRFFAQ-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2-methoxynaphthalene-1-carboxamide Chemical compound COC1=CC=C2C=CC=CC2=C1C(=O)NC1=CC=C(Cl)C=C1C(=O)NCC1CCCCC1 BEFIQOQLXRFFAQ-UHFFFAOYSA-N 0.000 claims description 2
- HRCBMLULGQFKJJ-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2-methyl-3-(trifluoromethyl)benzamide Chemical compound C1=CC=C(C(F)(F)F)C(C)=C1C(=O)NC1=CC=C(Cl)C=C1C(=O)NCC1CCCCC1 HRCBMLULGQFKJJ-UHFFFAOYSA-N 0.000 claims description 2
- QJZXTXCTRQYXBJ-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-3,4-dihydro-2h-1,5-benzodioxepine-7-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C=C3OCCCOC3=CC=2)C=1C(=O)NCC1CCCCC1 QJZXTXCTRQYXBJ-UHFFFAOYSA-N 0.000 claims description 2
- OOOOSCJONKHGLT-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-3-fluoro-2-(trifluoromethyl)benzamide Chemical compound FC1=CC=CC(C(=O)NC=2C(=CC(Cl)=CC=2)C(=O)NCC2CCCCC2)=C1C(F)(F)F OOOOSCJONKHGLT-UHFFFAOYSA-N 0.000 claims description 2
- KZCGPWQWPMWTPK-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-6-fluoro-4h-1,3-benzodioxine-8-carboxamide Chemical compound C=1C(F)=CC=2COCOC=2C=1C(=O)NC1=CC=C(Cl)C=C1C(=O)NCC1CCCCC1 KZCGPWQWPMWTPK-UHFFFAOYSA-N 0.000 claims description 2
- PBUUEAUDWAENBD-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]cinnoline-4-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3N=NC=2)C=1C(=O)NCC1CCCCC1 PBUUEAUDWAENBD-UHFFFAOYSA-N 0.000 claims description 2
- TVDBFGDINXYQRG-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]isoquinoline-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CN=2)C=1C(=O)NCC1CCCCC1 TVDBFGDINXYQRG-UHFFFAOYSA-N 0.000 claims description 2
- VDWXJGNSAGJOMI-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]isoquinoline-5-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=NC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 VDWXJGNSAGJOMI-UHFFFAOYSA-N 0.000 claims description 2
- PAGJVMXPAPTXRG-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 PAGJVMXPAPTXRG-UHFFFAOYSA-N 0.000 claims description 2
- QUGXBRYPVIHWPQ-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]naphthalene-2-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C=C3C=CC=CC3=CC=2)C=1C(=O)NCC1CCCCC1 QUGXBRYPVIHWPQ-UHFFFAOYSA-N 0.000 claims description 2
- LWBXIIQJMAMAKH-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]pyrazine-2-carboxamide Chemical compound C1CCCCC1CNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CN=CC=N1 LWBXIIQJMAMAKH-UHFFFAOYSA-N 0.000 claims description 2
- JAQWBABXOVWHRF-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]pyridazine-3-carboxamide Chemical compound C1CCCCC1CNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CN=N1 JAQWBABXOVWHRF-UHFFFAOYSA-N 0.000 claims description 2
- DAVLSPYNAXLYPD-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]pyridine-2-carboxamide Chemical compound C1CCCCC1CNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC=N1 DAVLSPYNAXLYPD-UHFFFAOYSA-N 0.000 claims description 2
- LVKREXAQMVKFMK-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]pyridine-3-carboxamide Chemical compound C1CCCCC1CNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CN=C1 LVKREXAQMVKFMK-UHFFFAOYSA-N 0.000 claims description 2
- ZAOJADCWAXZQIU-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]pyridine-4-carboxamide Chemical compound C1CCCCC1CNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=NC=C1 ZAOJADCWAXZQIU-UHFFFAOYSA-N 0.000 claims description 2
- JTFYSAAAIGRLAL-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]quinoline-2-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2N=C3C=CC=CC3=CC=2)C=1C(=O)NCC1CCCCC1 JTFYSAAAIGRLAL-UHFFFAOYSA-N 0.000 claims description 2
- CEEJBSOWGKHUQH-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]quinoline-3-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C=C3C=CC=CC3=NC=2)C=1C(=O)NCC1CCCCC1 CEEJBSOWGKHUQH-UHFFFAOYSA-N 0.000 claims description 2
- FAKIZHXJBYKKSH-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]quinoline-4-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3N=CC=2)C=1C(=O)NCC1CCCCC1 FAKIZHXJBYKKSH-UHFFFAOYSA-N 0.000 claims description 2
- AXDURNBINSFZIM-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]quinoline-5-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CN=C3C=CC=2)C=1C(=O)NCC1CCCCC1 AXDURNBINSFZIM-UHFFFAOYSA-N 0.000 claims description 2
- QLXXTJZEOUGTKP-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]quinoxaline-2-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2N=C3C=CC=CC3=NC=2)C=1C(=O)NCC1CCCCC1 QLXXTJZEOUGTKP-UHFFFAOYSA-N 0.000 claims description 2
- XLBXEHXNDOLHQD-UHFFFAOYSA-N n-[4-chloro-2-(cyclopropylmethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CC1 XLBXEHXNDOLHQD-UHFFFAOYSA-N 0.000 claims description 2
- XOFFMMDGBQZYRI-UHFFFAOYSA-N n-[4-chloro-2-(morpholin-4-ylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NN1CCOCC1 XOFFMMDGBQZYRI-UHFFFAOYSA-N 0.000 claims description 2
- XMQKLLHZFIVNAH-UHFFFAOYSA-N n-[4-chloro-2-(pyrrolidine-1-carbonyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)N1CCCC1 XMQKLLHZFIVNAH-UHFFFAOYSA-N 0.000 claims description 2
- NDIZPHAXKZXKCK-UHFFFAOYSA-N n-[4-chloro-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]phenyl]naphthalene-1-carboxamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 NDIZPHAXKZXKCK-UHFFFAOYSA-N 0.000 claims description 2
- UZFJMINAIHUJJK-UHFFFAOYSA-N n-[4-chloro-2-[(2-hydroxycyclohexyl)carbamoyl]phenyl]naphthalene-1-carboxamide Chemical compound OC1CCCCC1NC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 UZFJMINAIHUJJK-UHFFFAOYSA-N 0.000 claims description 2
- SOTWXONBUSVBAO-UHFFFAOYSA-N n-[4-chloro-2-[1,3-dioxolan-2-ylmethyl(methyl)carbamoyl]phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)N(C)CC1OCCO1 SOTWXONBUSVBAO-UHFFFAOYSA-N 0.000 claims description 2
- GFMYMBUUFNFHEL-UHFFFAOYSA-N n-[4-chloro-2-[2-(1,3-dioxolan-2-yl)ethylcarbamoyl]phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCCC1OCCO1 GFMYMBUUFNFHEL-UHFFFAOYSA-N 0.000 claims description 2
- XLLUZDQJHOSZAM-UHFFFAOYSA-N n-[4-chloro-2-[2-(2-methoxyphenyl)pyrrolidine-1-carbonyl]phenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC=C1C1N(C(=O)C=2C(=CC=C(Cl)C=2)NC(=O)C=2C3=CC=CC=C3C=CC=2)CCC1 XLLUZDQJHOSZAM-UHFFFAOYSA-N 0.000 claims description 2
- CYGSFWLJQULVJU-UHFFFAOYSA-N n-[4-chloro-2-[2-(dimethylamino)ethylcarbamoyl]phenyl]naphthalene-1-carboxamide Chemical compound CN(C)CCNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 CYGSFWLJQULVJU-UHFFFAOYSA-N 0.000 claims description 2
- NIMVFBALQUASRZ-UHFFFAOYSA-N n-[4-chloro-2-[2-(oxan-4-yl)ethylcarbamoyl]phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCCC1CCOCC1 NIMVFBALQUASRZ-UHFFFAOYSA-N 0.000 claims description 2
- VFJXLEJIGCYAOC-UHFFFAOYSA-N n-[4-chloro-2-[2-(piperidin-1-ylmethyl)piperidine-1-carbonyl]phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)N1CCCCC1CN1CCCCC1 VFJXLEJIGCYAOC-UHFFFAOYSA-N 0.000 claims description 2
- UEPGQURQCBGYGW-UHFFFAOYSA-N n-[4-chloro-2-[3-(hydroxymethyl)piperidine-1-carbonyl]phenyl]naphthalene-1-carboxamide Chemical compound C1C(CO)CCCN1C(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 UEPGQURQCBGYGW-UHFFFAOYSA-N 0.000 claims description 2
- YFURKQZKTZRDOX-UHFFFAOYSA-N n-[4-chloro-2-[4-(2-morpholin-4-ylethyl)piperazine-1-carbonyl]phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)N(CC1)CCN1CCN1CCOCC1 YFURKQZKTZRDOX-UHFFFAOYSA-N 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000001425 triazolyl group Chemical group 0.000 claims description 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 16
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 13
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 9
- 125000006719 (C6-C10) aryl (C1-C6) alkyl group Chemical group 0.000 claims 6
- GLNBMOPLSLTYJS-UHFFFAOYSA-N n-[3-methoxy-2-(2-pyrrolidin-1-ylethylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound COC1=CC=CC(NC(=O)C=2C3=CC=CC=C3C=CC=2)=C1C(=O)NCCN1CCCC1 GLNBMOPLSLTYJS-UHFFFAOYSA-N 0.000 claims 1
- YYHALXAVQQDBIF-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-2,3-dihydro-1-benzofuran-7-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C=3OCCC=3C=CC=2)C=1C(=O)NCC1CCCCC1 YYHALXAVQQDBIF-UHFFFAOYSA-N 0.000 claims 1
- KNWNSHDWIDERSJ-UHFFFAOYSA-N n-[4-chloro-2-(oxan-4-ylcarbamoyl)phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NC1CCOCC1 KNWNSHDWIDERSJ-UHFFFAOYSA-N 0.000 claims 1
- KHIUNTRSHSSRMI-UHFFFAOYSA-N n-[4-chloro-2-[(2-hydroxycyclohexyl)methylcarbamoyl]phenyl]naphthalene-1-carboxamide Chemical compound OC1CCCCC1CNC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 KHIUNTRSHSSRMI-UHFFFAOYSA-N 0.000 claims 1
- DQSWOJDBYOULKG-UHFFFAOYSA-N n-[4-chloro-2-[[1-(hydroxymethyl)cyclopentyl]carbamoyl]phenyl]naphthalene-1-carboxamide Chemical compound C=1C(Cl)=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NC1(CO)CCCC1 DQSWOJDBYOULKG-UHFFFAOYSA-N 0.000 claims 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 81
- 101150041968 CDC13 gene Proteins 0.000 description 75
- 238000005160 1H NMR spectroscopy Methods 0.000 description 67
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 53
- CDGYHBAEMVRUNZ-UHFFFAOYSA-N 2-amino-5-chloro-n-(cyclohexylmethyl)benzamide Chemical compound NC1=CC=C(Cl)C=C1C(=O)NCC1CCCCC1 CDGYHBAEMVRUNZ-UHFFFAOYSA-N 0.000 description 31
- 229910001868 water Inorganic materials 0.000 description 30
- 238000004007 reversed phase HPLC Methods 0.000 description 26
- 238000005481 NMR spectroscopy Methods 0.000 description 25
- FGXWHZQLWMVKQL-UHFFFAOYSA-N 6-chloro-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC4=CC=C(C=C4C(=O)O3)Cl)=CC=CC2=C1 FGXWHZQLWMVKQL-UHFFFAOYSA-N 0.000 description 21
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 15
- 230000002265 prevention Effects 0.000 description 15
- OBDYYXILGYAUNX-UHFFFAOYSA-N 5-methoxy-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC=4C=CC=C(C=4C(=O)O3)OC)=CC=CC2=C1 OBDYYXILGYAUNX-UHFFFAOYSA-N 0.000 description 14
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 14
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 14
- 238000000746 purification Methods 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 13
- 239000004215 Carbon black (E152) Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 13
- 229930195733 hydrocarbon Natural products 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- 102000009132 CB1 Cannabinoid Receptor Human genes 0.000 description 12
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 11
- 239000002585 base Substances 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- IXHYCPSBZQXNCD-UHFFFAOYSA-N 5-chloro-2-(naphthalene-1-carbonylamino)benzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 IXHYCPSBZQXNCD-UHFFFAOYSA-N 0.000 description 10
- 108010073366 CB1 Cannabinoid Receptor Proteins 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- 125000001072 heteroaryl group Chemical group 0.000 description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- 101000875075 Homo sapiens Cannabinoid receptor 2 Proteins 0.000 description 8
- 239000000556 agonist Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 102000005962 receptors Human genes 0.000 description 7
- 108020003175 receptors Proteins 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 201000010099 disease Diseases 0.000 description 6
- 239000003446 ligand Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 125000006413 ring segment Chemical group 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 5
- 239000005557 antagonist Substances 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 210000003169 central nervous system Anatomy 0.000 description 5
- LQNHRNOPWKZUSN-UHFFFAOYSA-N cyclobutylmethanamine Chemical compound NCC1CCC1 LQNHRNOPWKZUSN-UHFFFAOYSA-N 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- 231100000673 dose–response relationship Toxicity 0.000 description 4
- 201000006549 dyspepsia Diseases 0.000 description 4
- 210000000111 lower esophageal sphincter Anatomy 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- FNKGCYCSGNIURF-UHFFFAOYSA-N 2-(naphthalene-1-carbonylamino)-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 FNKGCYCSGNIURF-UHFFFAOYSA-N 0.000 description 3
- GHDNVAKJUOKYMP-UHFFFAOYSA-N 5-acetamido-2-(naphthalene-1-carbonylamino)benzoic acid Chemical compound OC(=O)C1=CC(NC(=O)C)=CC=C1NC(=O)C1=CC=CC2=CC=CC=C12 GHDNVAKJUOKYMP-UHFFFAOYSA-N 0.000 description 3
- QDEKGUJDAILOCL-UHFFFAOYSA-N 5-chloro-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC=4C=CC=C(C=4C(=O)O3)Cl)=CC=CC2=C1 QDEKGUJDAILOCL-UHFFFAOYSA-N 0.000 description 3
- XTWJISCSYVFWDN-UHFFFAOYSA-N 6-fluoro-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC4=CC=C(C=C4C(=O)O3)F)=CC=CC2=C1 XTWJISCSYVFWDN-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 206010058019 Cancer Pain Diseases 0.000 description 3
- 208000000094 Chronic Pain Diseases 0.000 description 3
- 101000710899 Homo sapiens Cannabinoid receptor 1 Proteins 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- 208000005298 acute pain Diseases 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 208000021302 gastroesophageal reflux disease Diseases 0.000 description 3
- 102000056693 human CNR2 Human genes 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 208000004296 neuralgia Diseases 0.000 description 3
- 208000021722 neuropathic pain Diseases 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 125000004585 polycyclic heterocycle group Chemical group 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 208000011117 substance-related disease Diseases 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000001052 transient effect Effects 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- 208000009935 visceral pain Diseases 0.000 description 3
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical compound C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- LWUAMROXVQLJKA-UHFFFAOYSA-N 2-amino-3-chlorobenzoic acid Chemical compound NC1=C(Cl)C=CC=C1C(O)=O LWUAMROXVQLJKA-UHFFFAOYSA-N 0.000 description 2
- IFXKXCLVKQVVDI-UHFFFAOYSA-N 2-amino-5-chlorobenzoic acid Chemical compound NC1=CC=C(Cl)C=C1C(O)=O IFXKXCLVKQVVDI-UHFFFAOYSA-N 0.000 description 2
- QLLVGBISVAYICZ-UHFFFAOYSA-N 2-amino-n-(cyclohexylmethyl)-5-methoxybenzamide Chemical compound COC1=CC=C(N)C(C(=O)NCC2CCCCC2)=C1 QLLVGBISVAYICZ-UHFFFAOYSA-N 0.000 description 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 2
- VIFVWTDJNLTGHQ-UHFFFAOYSA-N 5-methyl-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC=4C=CC=C(C=4C(=O)O3)C)=CC=CC2=C1 VIFVWTDJNLTGHQ-UHFFFAOYSA-N 0.000 description 2
- KSKIJJFZSXVVLF-UHFFFAOYSA-N 6,7-dimethoxy-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC=4C=C(C(=CC=4C(=O)O3)OC)OC)=CC=CC2=C1 KSKIJJFZSXVVLF-UHFFFAOYSA-N 0.000 description 2
- XVSRGABNCQFYPA-UHFFFAOYSA-N 6-methyl-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC4=CC=C(C=C4C(=O)O3)C)=CC=CC2=C1 XVSRGABNCQFYPA-UHFFFAOYSA-N 0.000 description 2
- MMEWQCWUVSDFSE-UHFFFAOYSA-N 7-chloro-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC=4C(C(O3)=O)=CC=C(C=4)Cl)=CC=CC2=C1 MMEWQCWUVSDFSE-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- VEKYPCCLUGKOMU-UHFFFAOYSA-N 8-methoxy-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC4=C(C(O3)=O)C=CC=C4OC)=CC=CC2=C1 VEKYPCCLUGKOMU-UHFFFAOYSA-N 0.000 description 2
- HDQCXQQPYFNVQO-UHFFFAOYSA-N 8-methyl-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC4=C(C(O3)=O)C=CC=C4C)=CC=CC2=C1 HDQCXQQPYFNVQO-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- 206010002091 Anaesthesia Diseases 0.000 description 2
- 229910015845 BBr3 Inorganic materials 0.000 description 2
- 208000008035 Back Pain Diseases 0.000 description 2
- 108010073376 CB2 Cannabinoid Receptor Proteins 0.000 description 2
- 102000009135 CB2 Cannabinoid Receptor Human genes 0.000 description 2
- 102000018208 Cannabinoid Receptor Human genes 0.000 description 2
- 108050007331 Cannabinoid receptor Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 206010010774 Constipation Diseases 0.000 description 2
- 206010012735 Diarrhoea Diseases 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 201000008197 Laryngitis Diseases 0.000 description 2
- 208000019693 Lung disease Diseases 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 206010067171 Regurgitation Diseases 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 238000001949 anaesthesia Methods 0.000 description 2
- 230000003444 anaesthetic effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 239000012148 binding buffer Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- 206010013663 drug dependence Diseases 0.000 description 2
- 230000004064 dysfunction Effects 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- 206010016165 failure to thrive Diseases 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- MKQLBNJQQZRQJU-UHFFFAOYSA-N morpholin-4-amine Chemical compound NN1CCOCC1 MKQLBNJQQZRQJU-UHFFFAOYSA-N 0.000 description 2
- IHDXNBIDWKLQRG-UHFFFAOYSA-N n-[2-(cyclohexylmethylcarbamoyl)-4-nitrophenyl]naphthalene-1-carboxamide Chemical compound C=1C([N+](=O)[O-])=CC=C(NC(=O)C=2C3=CC=CC=C3C=CC=2)C=1C(=O)NCC1CCCCC1 IHDXNBIDWKLQRG-UHFFFAOYSA-N 0.000 description 2
- RWIVICVCHVMHMU-UHFFFAOYSA-N n-aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 2
- RMHJJUOPOWPRBP-UHFFFAOYSA-N naphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)N)=CC=CC2=C1 RMHJJUOPOWPRBP-UHFFFAOYSA-N 0.000 description 2
- AHVQYHFYQWKUKB-UHFFFAOYSA-N oxan-4-amine Chemical compound NC1CCOCC1 AHVQYHFYQWKUKB-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 239000011534 wash buffer Substances 0.000 description 2
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 1
- PDNZJLMPXLQDPL-UHFFFAOYSA-N (1-aminocyclopentyl)methanol Chemical compound OCC1(N)CCCC1 PDNZJLMPXLQDPL-UHFFFAOYSA-N 0.000 description 1
- UNRBEYYLYRXYCG-UHFFFAOYSA-N (1-ethylpyrrolidin-2-yl)methanamine Chemical compound CCN1CCCC1CN UNRBEYYLYRXYCG-UHFFFAOYSA-N 0.000 description 1
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical compound C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical compound C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 description 1
- YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical compound C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 1
- KTZQTRPPVKQPFO-UHFFFAOYSA-N 1,2-benzoxazole Chemical compound C1=CC=C2C=NOC2=C1 KTZQTRPPVKQPFO-UHFFFAOYSA-N 0.000 description 1
- AVGHIQUXSVAJBC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.1]heptane Chemical compound C1C2CCN1NC2 AVGHIQUXSVAJBC-UHFFFAOYSA-N 0.000 description 1
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical compound C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 description 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 description 1
- CZLMRJZAHXYRIX-UHFFFAOYSA-N 1,3-dioxepane Chemical compound C1CCOCOC1 CZLMRJZAHXYRIX-UHFFFAOYSA-N 0.000 description 1
- QXXRLUXAOFVOTE-UHFFFAOYSA-N 1,3-dioxolan-2-ylmethanamine Chemical compound NCC1OCCO1 QXXRLUXAOFVOTE-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 1
- PREOONMJIVUPMI-UHFFFAOYSA-N 1,4-dioxan-2-ylmethanamine Chemical compound NCC1COCCO1 PREOONMJIVUPMI-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- ZCCPVTVGEQLONB-UHFFFAOYSA-N 1-(1,3-dioxolan-2-yl)-n-methylmethanamine Chemical compound CNCC1OCCO1 ZCCPVTVGEQLONB-UHFFFAOYSA-N 0.000 description 1
- QYKGBJGIKHJGFR-UHFFFAOYSA-N 1-(piperidin-2-ylmethyl)piperidine Chemical compound C1CCCCN1CC1CCCCN1 QYKGBJGIKHJGFR-UHFFFAOYSA-N 0.000 description 1
- KODLUXHSIZOKTG-UHFFFAOYSA-N 1-aminobutan-2-ol Chemical compound CCC(O)CN KODLUXHSIZOKTG-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- REUAXQZIRFXQML-UHFFFAOYSA-N 1-azabicyclo[2.2.2]octan-3-amine Chemical compound C1CC2C(N)CN1CC2 REUAXQZIRFXQML-UHFFFAOYSA-N 0.000 description 1
- WGCYRFWNGRMRJA-UHFFFAOYSA-N 1-ethylpiperazine Chemical compound CCN1CCNCC1 WGCYRFWNGRMRJA-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- AAQTWLBJPNLKHT-UHFFFAOYSA-N 1H-perimidine Chemical compound N1C=NC2=CC=CC3=CC=CC1=C32 AAQTWLBJPNLKHT-UHFFFAOYSA-N 0.000 description 1
- URZQSPHXJREUFT-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-4-carbonyl chloride Chemical compound C1=CC(C(Cl)=O)=C2OC(F)(F)OC2=C1 URZQSPHXJREUFT-UHFFFAOYSA-N 0.000 description 1
- YHCUZRJTNSWYCY-UHFFFAOYSA-N 2,3,4,7-tetrahydro-1h-azepine Chemical compound C1CNCC=CC1 YHCUZRJTNSWYCY-UHFFFAOYSA-N 0.000 description 1
- CDCFERWURRNLLA-UHFFFAOYSA-N 2,3-difluorobenzoyl chloride Chemical compound FC1=CC=CC(C(Cl)=O)=C1F CDCFERWURRNLLA-UHFFFAOYSA-N 0.000 description 1
- UHXBMSNEECJPSX-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-7-carboxylic acid Chemical compound OC(=O)C1=CC=CC2=C1OCC2 UHXBMSNEECJPSX-UHFFFAOYSA-N 0.000 description 1
- OZIJESHLNXSUNE-UHFFFAOYSA-N 2,3-dihydrofuran;thiolane 1,1-dioxide Chemical compound C1CC=CO1.O=S1(=O)CCCC1 OZIJESHLNXSUNE-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- FODBVCSYJKNBLO-UHFFFAOYSA-N 2,3-dimethoxybenzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1OC FODBVCSYJKNBLO-UHFFFAOYSA-N 0.000 description 1
- WFNKMVDATNLZBX-UHFFFAOYSA-N 2,3-dimethylbenzoyl chloride Chemical compound CC1=CC=CC(C(Cl)=O)=C1C WFNKMVDATNLZBX-UHFFFAOYSA-N 0.000 description 1
- GSUPYHWEFVSXBA-UHFFFAOYSA-N 2,5-dihydrofuran;oxolane Chemical compound C1CCOC1.C1OCC=C1 GSUPYHWEFVSXBA-UHFFFAOYSA-N 0.000 description 1
- JNAQYWWCTUEVKR-UHFFFAOYSA-N 2-(1,3-dioxolan-2-yl)ethanamine Chemical compound NCCC1OCCO1 JNAQYWWCTUEVKR-UHFFFAOYSA-N 0.000 description 1
- DSRDQQWHCNKVAV-UHFFFAOYSA-N 2-(2-methoxyphenyl)pyrrolidine Chemical compound COC1=CC=CC=C1C1NCCC1 DSRDQQWHCNKVAV-UHFFFAOYSA-N 0.000 description 1
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 description 1
- JGKFBZBVCAWDFD-UHFFFAOYSA-N 2-(aminomethyl)cyclohexan-1-ol Chemical compound NCC1CCCCC1O JGKFBZBVCAWDFD-UHFFFAOYSA-N 0.000 description 1
- ACEBWSUQTFPCDG-UHFFFAOYSA-N 2-(cyclohexylmethyl)benzamide Chemical compound NC(=O)C1=CC=CC=C1CC1CCCCC1 ACEBWSUQTFPCDG-UHFFFAOYSA-N 0.000 description 1
- BZMADPOGYCRPAI-UHFFFAOYSA-N 2-(oxan-4-yl)ethanamine Chemical compound NCCC1CCOCC1 BZMADPOGYCRPAI-UHFFFAOYSA-N 0.000 description 1
- WNAJXPYVTFYEST-UHFFFAOYSA-N 2-Amino-3-methylbenzoate Chemical compound CC1=CC=CC(C(O)=O)=C1N WNAJXPYVTFYEST-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- HJVAVGOPTDJYOJ-UHFFFAOYSA-N 2-amino-4,5-dimethoxybenzoic acid Chemical compound COC1=CC(N)=C(C(O)=O)C=C1OC HJVAVGOPTDJYOJ-UHFFFAOYSA-N 0.000 description 1
- JYYLQSCZISREGY-UHFFFAOYSA-N 2-amino-4-chlorobenzoic acid Chemical compound NC1=CC(Cl)=CC=C1C(O)=O JYYLQSCZISREGY-UHFFFAOYSA-N 0.000 description 1
- NBUUUJWWOARGNW-UHFFFAOYSA-N 2-amino-5-methylbenzoic acid Chemical compound CC1=CC=C(N)C(C(O)=O)=C1 NBUUUJWWOARGNW-UHFFFAOYSA-N 0.000 description 1
- SZCPTRGBOVXVCA-UHFFFAOYSA-N 2-amino-6-chlorobenzoic acid Chemical compound NC1=CC=CC(Cl)=C1C(O)=O SZCPTRGBOVXVCA-UHFFFAOYSA-N 0.000 description 1
- DYZDIWNRWSNVPT-UHFFFAOYSA-N 2-amino-6-methoxybenzoic acid Chemical compound COC1=CC=CC(N)=C1C(O)=O DYZDIWNRWSNVPT-UHFFFAOYSA-N 0.000 description 1
- XHYVBIXKORFHFM-UHFFFAOYSA-N 2-amino-6-methylbenzoic acid Chemical compound CC1=CC=CC(N)=C1C(O)=O XHYVBIXKORFHFM-UHFFFAOYSA-N 0.000 description 1
- PQMCFTMVQORYJC-UHFFFAOYSA-N 2-aminocyclohexan-1-ol Chemical compound NC1CCCCC1O PQMCFTMVQORYJC-UHFFFAOYSA-N 0.000 description 1
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 description 1
- AXOAWWUSRZCGKS-UHFFFAOYSA-N 2-chloro-3-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC(C(F)(F)F)=C1Cl AXOAWWUSRZCGKS-UHFFFAOYSA-N 0.000 description 1
- RIKGRFSGIOOYEK-UHFFFAOYSA-N 2-fluoro-3-(trifluoromethyl)benzoyl chloride Chemical compound FC1=C(C(Cl)=O)C=CC=C1C(F)(F)F RIKGRFSGIOOYEK-UHFFFAOYSA-N 0.000 description 1
- OSTYZAHQVPMQHI-UHFFFAOYSA-N 2-methoxynaphthalene-1-carboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(OC)=CC=C21 OSTYZAHQVPMQHI-UHFFFAOYSA-N 0.000 description 1
- 125000004918 2-methyl-2-pentyl group Chemical group CC(C)(CCC)* 0.000 description 1
- SSCFPSMXIDAJDT-UHFFFAOYSA-N 2-methyl-3-(trifluoromethyl)benzoic acid Chemical compound CC1=C(C(O)=O)C=CC=C1C(F)(F)F SSCFPSMXIDAJDT-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- CJNRGSHEMCMUOE-UHFFFAOYSA-N 2-piperidin-1-ylethanamine Chemical compound NCCN1CCCCC1 CJNRGSHEMCMUOE-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- WRXNJTBODVGDRY-UHFFFAOYSA-N 2-pyrrolidin-1-ylethanamine Chemical compound NCCN1CCCC1 WRXNJTBODVGDRY-UHFFFAOYSA-N 0.000 description 1
- NDCZQFDBSPOUDF-UHFFFAOYSA-N 2-pyrrolidin-2-ylpyridine Chemical compound C1CCNC1C1=CC=CC=N1 NDCZQFDBSPOUDF-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- QLGLBMCIJBRBME-UHFFFAOYSA-N 2H-1,5-benzodioxepine-7-carbonyl chloride Chemical compound O1CC=COC2=C1C=CC(=C2)C(=O)Cl QLGLBMCIJBRBME-UHFFFAOYSA-N 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- VMUXSMXIQBNMGZ-UHFFFAOYSA-N 3,4-dihydrocoumarin Chemical compound C1=CC=C2OC(=O)CCC2=C1 VMUXSMXIQBNMGZ-UHFFFAOYSA-N 0.000 description 1
- VBYJOUAMJITBNL-UHFFFAOYSA-N 3-chloro-2-fluorobenzoyl chloride Chemical compound FC1=C(Cl)C=CC=C1C(Cl)=O VBYJOUAMJITBNL-UHFFFAOYSA-N 0.000 description 1
- HXGHMCLCSPQMOR-UHFFFAOYSA-N 3-chloro-2-methylbenzoic acid Chemical compound CC1=C(Cl)C=CC=C1C(O)=O HXGHMCLCSPQMOR-UHFFFAOYSA-N 0.000 description 1
- FHWMGBNKQOJFOJ-UHFFFAOYSA-N 3-fluoro-2-(trifluoromethyl)benzoyl chloride Chemical compound FC1=CC=CC(C(Cl)=O)=C1C(F)(F)F FHWMGBNKQOJFOJ-UHFFFAOYSA-N 0.000 description 1
- JPCISVSOTKMFPG-UHFFFAOYSA-N 3-methoxy-2-methylbenzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1C JPCISVSOTKMFPG-UHFFFAOYSA-N 0.000 description 1
- SXOPCLUOUFQBJV-UHFFFAOYSA-N 3-methoxyanthranilic acid Chemical compound COC1=CC=CC(C(O)=O)=C1N SXOPCLUOUFQBJV-UHFFFAOYSA-N 0.000 description 1
- 125000004919 3-methyl-2-pentyl group Chemical group CC(C(C)*)CC 0.000 description 1
- UIKUBYKUYUSRSM-UHFFFAOYSA-N 3-morpholinopropylamine Chemical compound NCCCN1CCOCC1 UIKUBYKUYUSRSM-UHFFFAOYSA-N 0.000 description 1
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 description 1
- BAKUAUDFCNFLBX-UHFFFAOYSA-N 4,7-dihydro-1,3-dioxepine Chemical compound C1OCC=CCO1 BAKUAUDFCNFLBX-UHFFFAOYSA-N 0.000 description 1
- SAJZEJMFAWZNCQ-UHFFFAOYSA-N 4-(2-piperazin-1-ylethyl)morpholine Chemical compound C1CNCCN1CCN1CCOCC1 SAJZEJMFAWZNCQ-UHFFFAOYSA-N 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- GSOHXJQXAKNJES-UHFFFAOYSA-N 5-acetamido-2-aminobenzoic acid Chemical compound CC(=O)NC1=CC=C(N)C(C(O)=O)=C1 GSOHXJQXAKNJES-UHFFFAOYSA-N 0.000 description 1
- FPQMGQZTBWIHDN-UHFFFAOYSA-N 5-fluoroanthranilic acid Chemical compound NC1=CC=C(F)C=C1C(O)=O FPQMGQZTBWIHDN-UHFFFAOYSA-N 0.000 description 1
- RUCHWTKMOWXHLU-UHFFFAOYSA-N 5-nitroanthranilic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(O)=O RUCHWTKMOWXHLU-UHFFFAOYSA-N 0.000 description 1
- MYQFJMYJVJRSGP-UHFFFAOYSA-N 6-chloro-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC(Cl)=CC=C21 MYQFJMYJVJRSGP-UHFFFAOYSA-N 0.000 description 1
- NWTPJKCARLIKFP-UHFFFAOYSA-N 6-chloro-2-fluoro-3-methylbenzoyl chloride Chemical compound CC1=CC=C(Cl)C(C(Cl)=O)=C1F NWTPJKCARLIKFP-UHFFFAOYSA-N 0.000 description 1
- YPWFNLSXQIGJCK-UHFFFAOYSA-N 7-oxabicyclo[2.2.1]heptane Chemical compound C1CC2CCC1O2 YPWFNLSXQIGJCK-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- PVHQMSIJCJNOGZ-UHFFFAOYSA-N 8-chloro-2-naphthalen-1-yl-3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(C3=NC4=C(C(O3)=O)C=CC=C4Cl)=CC=CC2=C1 PVHQMSIJCJNOGZ-UHFFFAOYSA-N 0.000 description 1
- PQJUJGAVDBINPI-UHFFFAOYSA-N 9H-thioxanthene Chemical compound C1=CC=C2CC3=CC=CC=C3SC2=C1 PQJUJGAVDBINPI-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- 208000004998 Abdominal Pain Diseases 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 208000000044 Amnesia Diseases 0.000 description 1
- 208000031091 Amnestic disease Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- 101710187010 Cannabinoid receptor 1 Proteins 0.000 description 1
- 102100033868 Cannabinoid receptor 1 Human genes 0.000 description 1
- 101710187022 Cannabinoid receptor 2 Proteins 0.000 description 1
- 102100036214 Cannabinoid receptor 2 Human genes 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 208000027932 Collagen disease Diseases 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 206010013654 Drug abuse Diseases 0.000 description 1
- 206010052804 Drug tolerance Diseases 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 208000011688 Generalised anxiety disease Diseases 0.000 description 1
- 241000167880 Hirundinidae Species 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 206010021118 Hypotonia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 206010061216 Infarction Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 102000018697 Membrane Proteins Human genes 0.000 description 1
- 108010052285 Membrane Proteins Proteins 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 208000019430 Motor disease Diseases 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 208000021384 Obsessive-Compulsive disease Diseases 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000023146 Pre-existing disease Diseases 0.000 description 1
- 206010037423 Pulmonary oedema Diseases 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 206010041250 Social phobia Diseases 0.000 description 1
- 208000020339 Spinal injury Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000006011 Stroke Diseases 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 208000030886 Traumatic Brain injury Diseases 0.000 description 1
- 206010046543 Urinary incontinence Diseases 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- IMUDHTPIFIBORV-UHFFFAOYSA-N aminoethylpiperazine Chemical compound NCCN1CCNCC1 IMUDHTPIFIBORV-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000006986 amnesia Effects 0.000 description 1
- 229940124326 anaesthetic agent Drugs 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000003502 anti-nociceptive effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 229940005530 anxiolytics Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 238000012925 biological evaluation Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001669 calcium Chemical class 0.000 description 1
- 229930003827 cannabinoid Natural products 0.000 description 1
- 239000003557 cannabinoid Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000005961 cardioprotection Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- ZKOMQFDQFTVPBZ-UHFFFAOYSA-N cinnoline-4-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CN=NC2=C1 ZKOMQFDQFTVPBZ-UHFFFAOYSA-N 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- CAOQEOHEZKVYOJ-UHFFFAOYSA-N cycloheptylmethanamine Chemical compound NCC1CCCCCC1 CAOQEOHEZKVYOJ-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 238000002059 diagnostic imaging Methods 0.000 description 1
- 238000012631 diagnostic technique Methods 0.000 description 1
- DMSHWWDRAYHEBS-UHFFFAOYSA-N dihydrocoumarin Natural products C1CC(=O)OC2=C1C=C(OC)C(OC)=C2 DMSHWWDRAYHEBS-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229960004242 dronabinol Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- JKFAIQOWCVVSKC-UHFFFAOYSA-N furazan Chemical compound C=1C=NON=1 JKFAIQOWCVVSKC-UHFFFAOYSA-N 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 208000029364 generalized anxiety disease Diseases 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- VIPHVHVAGBKHGR-UHFFFAOYSA-N hydron;pyridine-2-carbonyl chloride;chloride Chemical compound Cl.ClC(=O)C1=CC=CC=N1 VIPHVHVAGBKHGR-UHFFFAOYSA-N 0.000 description 1
- MSYBLBLAMDYKKZ-UHFFFAOYSA-N hydron;pyridine-3-carbonyl chloride;chloride Chemical compound Cl.ClC(=O)C1=CC=CN=C1 MSYBLBLAMDYKKZ-UHFFFAOYSA-N 0.000 description 1
- BNTRVUUJBGBGLZ-UHFFFAOYSA-N hydron;pyridine-4-carbonyl chloride;chloride Chemical compound Cl.ClC(=O)C1=CC=NC=C1 BNTRVUUJBGBGLZ-UHFFFAOYSA-N 0.000 description 1
- 239000003326 hypnotic agent Substances 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 210000000987 immune system Anatomy 0.000 description 1
- 239000002955 immunomodulating agent Substances 0.000 description 1
- 229940121354 immunomodulator Drugs 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 230000007574 infarction Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229940125425 inverse agonist Drugs 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- HEBMCVBCEDMUOF-UHFFFAOYSA-N isochromane Chemical compound C1=CC=C2COCCC2=C1 HEBMCVBCEDMUOF-UHFFFAOYSA-N 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XAAKCCMYRKZRAK-UHFFFAOYSA-N isoquinoline-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=NC=CC2=C1 XAAKCCMYRKZRAK-UHFFFAOYSA-N 0.000 description 1
- ZIPLFLRGHZAXSJ-UHFFFAOYSA-N isoquinoline-5-carboxylic acid Chemical compound N1=CC=C2C(C(=O)O)=CC=CC2=C1 ZIPLFLRGHZAXSJ-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 1
- 230000036640 muscle relaxation Effects 0.000 description 1
- PKKLYNIYLJPUHC-UHFFFAOYSA-N n-[4-chloro-2-(cyclohexylmethylcarbamoyl)phenyl]-3-methoxy-2-methylbenzamide Chemical compound COC1=CC=CC(C(=O)NC=2C(=CC(Cl)=CC=2)C(=O)NCC2CCCCC2)=C1C PKKLYNIYLJPUHC-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000000842 neuromuscular blocking agent Substances 0.000 description 1
- 229960002715 nicotine Drugs 0.000 description 1
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000009871 nonspecific binding Effects 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940005483 opioid analgesics Drugs 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- IPBPLHNLRKRLPJ-UHFFFAOYSA-N oxan-4-ylmethanamine Chemical compound NCC1CCOCC1 IPBPLHNLRKRLPJ-UHFFFAOYSA-N 0.000 description 1
- UHHKSVZZTYJVEG-UHFFFAOYSA-N oxepane Chemical compound C1CCCOCC1 UHHKSVZZTYJVEG-UHFFFAOYSA-N 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 208000019906 panic disease Diseases 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000004031 partial agonist Substances 0.000 description 1
- 230000007310 pathophysiology Effects 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 125000005327 perimidinyl group Chemical group N1C(=NC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- GJSGGHOYGKMUPT-UHFFFAOYSA-N phenoxathiine Chemical compound C1=CC=C2OC3=CC=CC=C3SC2=C1 GJSGGHOYGKMUPT-UHFFFAOYSA-N 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- BIWOSRSKDCZIFM-UHFFFAOYSA-N piperidin-3-ol Chemical compound OC1CCCNC1 BIWOSRSKDCZIFM-UHFFFAOYSA-N 0.000 description 1
- VUNPWIPIOOMCPT-UHFFFAOYSA-N piperidin-3-ylmethanol Chemical compound OCC1CCCNC1 VUNPWIPIOOMCPT-UHFFFAOYSA-N 0.000 description 1
- LTEKQAPRXFBRNN-UHFFFAOYSA-N piperidin-4-ylmethanamine Chemical compound NCC1CCNCC1 LTEKQAPRXFBRNN-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 238000002600 positron emission tomography Methods 0.000 description 1
- 208000028173 post-traumatic stress disease Diseases 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 206010036596 premature ejaculation Diseases 0.000 description 1
- 238000009117 preventive therapy Methods 0.000 description 1
- ALDITMKAAPLVJK-UHFFFAOYSA-N prop-1-ene;hydrate Chemical group O.CC=C ALDITMKAAPLVJK-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- CPNGPNLZQNNVQM-UHFFFAOYSA-N pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- NIPZZXUFJPQHNH-UHFFFAOYSA-N pyrazine-2-carboxylic acid Chemical compound OC(=O)C1=CN=CC=N1 NIPZZXUFJPQHNH-UHFFFAOYSA-N 0.000 description 1
- USPWKWBDZOARPV-UHFFFAOYSA-N pyrazolidine Chemical compound C1CNNC1 USPWKWBDZOARPV-UHFFFAOYSA-N 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- RUUOPSRRIKJHNH-UHFFFAOYSA-N pyridazine-3-carboxylic acid Chemical compound OC(=O)C1=CC=CN=N1 RUUOPSRRIKJHNH-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JHHZLHWJQPUNKB-UHFFFAOYSA-N pyrrolidin-3-ol Chemical compound OC1CCNC1 JHHZLHWJQPUNKB-UHFFFAOYSA-N 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- RAYMXZBXQCGRGX-UHFFFAOYSA-N quinoline-5-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=N1 RAYMXZBXQCGRGX-UHFFFAOYSA-N 0.000 description 1
- QRDZFPUVLYEQTA-UHFFFAOYSA-N quinoline-8-carboxylic acid Chemical compound C1=CN=C2C(C(=O)O)=CC=CC2=C1 QRDZFPUVLYEQTA-UHFFFAOYSA-N 0.000 description 1
- LJPZHJUSICYOIX-UHFFFAOYSA-N quinolizidine Chemical compound C1CCCC2CCCCN21 LJPZHJUSICYOIX-UHFFFAOYSA-N 0.000 description 1
- SOPDQKNXOCUBSR-UHFFFAOYSA-N quinoxaline-2-carbonyl chloride Chemical compound C1=CC=CC2=NC(C(=O)Cl)=CN=C21 SOPDQKNXOCUBSR-UHFFFAOYSA-N 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 210000002820 sympathetic nervous system Anatomy 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 235000007586 terpenes Nutrition 0.000 description 1
- IRSSIQNSBCQILH-UHFFFAOYSA-N tert-butyl 3-(aminomethyl)morpholine-4-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCOCC1CN IRSSIQNSBCQILH-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- XSROQCDVUIHRSI-UHFFFAOYSA-N thietane Chemical compound C1CSC1 XSROQCDVUIHRSI-UHFFFAOYSA-N 0.000 description 1
- 125000002053 thietanyl group Chemical group 0.000 description 1
- VOVUARRWDCVURC-UHFFFAOYSA-N thiirane Chemical compound C1CS1 VOVUARRWDCVURC-UHFFFAOYSA-N 0.000 description 1
- 125000001730 thiiranyl group Chemical group 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 125000005505 thiomorpholino group Chemical group 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- IBBLKSWSCDAPIF-UHFFFAOYSA-N thiopyran Chemical compound S1C=CC=C=C1 IBBLKSWSCDAPIF-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000009529 traumatic brain injury Effects 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- HQVHOQAKMCMIIM-UHFFFAOYSA-N win 55,212-2 Chemical compound C=12N3C(C)=C(C(=O)C=4C5=CC=CC=C5C=CC=4)C2=CC=CC=1OCC3CN1CCOCC1 HQVHOQAKMCMIIM-UHFFFAOYSA-N 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having nitrogen atoms of amino groups bound to the carbon skeleton of the acid part, further acylated
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P23/00—Anaesthetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
- A61P25/16—Anti-Parkinson drugs
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/22—Anxiolytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having carbon atoms of carboxamide groups, amino groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/26—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
- C07D217/16—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/26—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings condensed with carbocyclic rings or ring systems
- C07D237/28—Cinnolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/192—Radicals derived from carboxylic acids from aromatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/28—Nitrogen atoms
- C07D295/32—Nitrogen atoms acylated with carboxylic or carbonic acids, or their nitrogen or sulfur analogues
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/08—1,3-Dioxanes; Hydrogenated 1,3-dioxanes condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/12—1,4-Dioxanes; Hydrogenated 1,4-dioxanes not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D321/00—Heterocyclic compounds containing rings having two oxygen atoms as the only ring hetero atoms, not provided for by groups C07D317/00 - C07D319/00
- C07D321/02—Seven-membered rings
- C07D321/10—Seven-membered rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/04—Systems containing only non-condensed rings with a four-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/18—Systems containing only non-condensed rings with a ring being at least seven-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Neurology (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Pain & Pain Management (AREA)
- Psychology (AREA)
- Heart & Thoracic Surgery (AREA)
- Rheumatology (AREA)
- Cardiology (AREA)
- Hospice & Palliative Care (AREA)
- Psychiatry (AREA)
- Anesthesiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Hydrogenated Pyridines (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Quinoline Compounds (AREA)
- Furan Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE0401342A SE0401342D0 (sv) | 2004-05-25 | 2004-05-25 | Therapeutic compounds |
| SE0401342-1 | 2004-05-25 | ||
| PCT/SE2005/000754 WO2005115972A1 (en) | 2004-05-25 | 2005-05-20 | Therapeutic compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2565066A1 true CA2565066A1 (en) | 2005-12-08 |
Family
ID=32589801
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002565066A Abandoned CA2565066A1 (en) | 2004-05-25 | 2005-05-20 | Therapeutic compounds |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US20090018116A1 (OSRAM) |
| EP (1) | EP1756044A1 (OSRAM) |
| JP (1) | JP2008500337A (OSRAM) |
| CN (1) | CN1989100A (OSRAM) |
| AR (1) | AR049898A1 (OSRAM) |
| AU (1) | AU2005247835A1 (OSRAM) |
| BR (1) | BRPI0511532A (OSRAM) |
| CA (1) | CA2565066A1 (OSRAM) |
| IL (1) | IL179145A0 (OSRAM) |
| MX (1) | MXPA06013536A (OSRAM) |
| NO (1) | NO20065904L (OSRAM) |
| SE (1) | SE0401342D0 (OSRAM) |
| TW (1) | TW200539856A (OSRAM) |
| UY (1) | UY28922A1 (OSRAM) |
| WO (1) | WO2005115972A1 (OSRAM) |
| ZA (1) | ZA200609542B (OSRAM) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2645995T3 (es) | 2006-05-31 | 2017-12-11 | Abbvie Inc. | Compuestos como ligandos del receptor cannabinoide y sus usos |
| US8841334B2 (en) | 2006-05-31 | 2014-09-23 | Abbvie Inc. | Compounds as cannabinoid receptor ligands and uses thereof |
| US7875640B2 (en) | 2007-03-28 | 2011-01-25 | Abbott Laboratories | Compounds as cannabinoid receptor ligands |
| US7872033B2 (en) | 2007-04-17 | 2011-01-18 | Abbott Laboratories | Compounds as cannabinoid receptor ligands |
| CN101711253A (zh) | 2007-05-18 | 2010-05-19 | 雅培制药有限公司 | 用作大麻素受体配体的新化合物 |
| US8338623B2 (en) * | 2007-07-09 | 2012-12-25 | Abbvie Inc. | Compounds as cannabinoid receptor ligands |
| US9193713B2 (en) | 2007-10-12 | 2015-11-24 | Abbvie Inc. | Compounds as cannabinoid receptor ligands |
| BRPI0905681A2 (pt) * | 2008-01-08 | 2015-07-07 | Purdue Pharma Lp | "análogos da prolina como ligantes para receptores de canabinóide" |
| US8846730B2 (en) | 2008-09-08 | 2014-09-30 | Abbvie Inc. | Compounds as cannabinoid receptor ligands |
| GB2463318A (en) * | 2008-09-12 | 2010-03-17 | Syngenta Participations Ag | Preparation of anthranilamide derivatives containing a pyridinylpyrazole moiety |
| EP2428507B1 (en) | 2008-09-16 | 2015-10-21 | AbbVie Bahamas Ltd. | Cannabinoid receptor ligands |
| PA8854001A1 (es) | 2008-12-16 | 2010-07-27 | Abbott Lab | Compuestos novedosos como ligandos de receptores de canabinoides |
| BR112014032538A2 (pt) | 2012-06-26 | 2017-06-27 | Bayer Pharma AG | n-[4-(quinolin-4-ilóxi)ciclo-hexil(metil)] (hetero)arilcarboxamidas como antagonistas do receptor de andrógeno, produção e uso das mesmas como produtos medicinais |
| KR20140011780A (ko) * | 2012-07-19 | 2014-01-29 | 한미약품 주식회사 | 단백질 키나아제 저해활성을 갖는 이소퀴놀린-5-카복스아미드 유도체 |
| KR20150090219A (ko) * | 2012-12-06 | 2015-08-05 | 바루크 에스. 블럼버그 인스티튜트 | Hbv 감염에 대항하여 항바이러스 물질로써 기능화된 벤자미드 유도체들 |
| GB201313664D0 (en) * | 2013-07-31 | 2013-09-11 | Univ Cardiff | Bcl-3 inhibitors |
| EP3174602A2 (en) * | 2014-07-31 | 2017-06-07 | University College Cardiff Consultants Limited | Bcl-3 inhibitors |
| SG11201700777VA (en) | 2014-08-04 | 2017-02-27 | Nuevolution As | Optionally fused heterocyclyl-substituted derivatives of pyrimidine useful for the treatment of inflammatory, metabolic, oncologic and autoimmune diseases |
| US9732061B2 (en) | 2015-01-12 | 2017-08-15 | Janssen Pharmaceutica Nv | Cinnoline derivatives useful as CB-1 receptor inverse agonists |
| KR20180011843A (ko) | 2015-06-11 | 2018-02-02 | 바실리어 파마슈티카 인터내셔널 리미티드 | 유출-펌프 억제제 및 이의 치료적 용도 |
| AU2019232437A1 (en) | 2018-03-07 | 2020-10-08 | Bayer Aktiengesellschaft | Identification and use of ERK5 inhibitors |
| EP3972963A1 (en) | 2019-05-21 | 2022-03-30 | Bayer Aktiengesellschaft | Identification and use of kras inhibitors |
| US12187681B2 (en) | 2019-12-14 | 2025-01-07 | Shanghai East Hospital | Ion channel antagonists/blockers and uses thereof |
| EP4076661A1 (en) | 2019-12-20 | 2022-10-26 | Nuevolution A/S | Compounds active towards nuclear receptors |
| EP4076657A1 (en) | 2019-12-20 | 2022-10-26 | Nuevolution A/S | Compounds active towards nuclear receptors |
| WO2021152113A1 (en) | 2020-01-31 | 2021-08-05 | Bayer Aktiengesellschaft | Substituted 2,3-benzodiazepines derivatives |
| EP4126875A1 (en) | 2020-03-31 | 2023-02-08 | Nuevolution A/S | Compounds active towards nuclear receptors |
| WO2021198955A1 (en) | 2020-03-31 | 2021-10-07 | Nuevolution A/S | Compounds active towards nuclear receptors |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0054132B1 (de) * | 1980-12-12 | 1984-10-10 | Dr. Karl Thomae GmbH | Neue Pyrimidinone, ihre Herstellung und Arzneimittel mit einem Gehalt an diesen Stoffen |
| DE69026708T2 (de) * | 1989-10-20 | 1997-04-03 | Otsuka Pharma Co Ltd | Benzoheterozyklische verbindungen |
| DE19648793A1 (de) * | 1996-11-26 | 1998-05-28 | Basf Ag | Neue Benzamide und deren Anwendung |
| MY138097A (en) * | 2000-03-22 | 2009-04-30 | Du Pont | Insecticidal anthranilamides |
| DE60130771T2 (de) * | 2000-07-27 | 2008-07-17 | Eli Lilly And Co., Indianapolis | Substituierte heterocyclische amide |
| JP2005520171A (ja) * | 2001-04-10 | 2005-07-07 | トランス テック ファーマ,インコーポレイテッド | ドラッグディスカバリーに関する、プローブ、システム、および方法 |
| GB0222493D0 (en) * | 2002-09-27 | 2002-11-06 | Glaxo Group Ltd | Compounds |
| US20060089398A1 (en) * | 2003-03-19 | 2006-04-27 | Gang Liu | Isoxazole carboxamide derivatives as ghrelin receptor modulators |
-
2004
- 2004-05-25 SE SE0401342A patent/SE0401342D0/xx unknown
-
2005
- 2005-05-12 TW TW094115325A patent/TW200539856A/zh unknown
- 2005-05-20 JP JP2007514981A patent/JP2008500337A/ja not_active Abandoned
- 2005-05-20 US US11/569,295 patent/US20090018116A1/en not_active Abandoned
- 2005-05-20 WO PCT/SE2005/000754 patent/WO2005115972A1/en not_active Ceased
- 2005-05-20 MX MXPA06013536A patent/MXPA06013536A/es not_active Application Discontinuation
- 2005-05-20 EP EP05744339A patent/EP1756044A1/en not_active Withdrawn
- 2005-05-20 AU AU2005247835A patent/AU2005247835A1/en not_active Abandoned
- 2005-05-20 BR BRPI0511532-9A patent/BRPI0511532A/pt not_active Application Discontinuation
- 2005-05-20 CN CNA2005800246481A patent/CN1989100A/zh active Pending
- 2005-05-20 CA CA002565066A patent/CA2565066A1/en not_active Abandoned
- 2005-05-23 AR ARP050102118A patent/AR049898A1/es unknown
- 2005-05-25 UY UY28922A patent/UY28922A1/es unknown
-
2006
- 2006-11-09 IL IL179145A patent/IL179145A0/en unknown
- 2006-11-16 ZA ZA200609542A patent/ZA200609542B/xx unknown
- 2006-12-19 NO NO20065904A patent/NO20065904L/no not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| ZA200609542B (en) | 2008-09-25 |
| AR049898A1 (es) | 2006-09-13 |
| CN1989100A (zh) | 2007-06-27 |
| JP2008500337A (ja) | 2008-01-10 |
| UY28922A1 (es) | 2005-12-30 |
| AU2005247835A1 (en) | 2005-12-08 |
| EP1756044A1 (en) | 2007-02-28 |
| IL179145A0 (en) | 2007-03-08 |
| BRPI0511532A (pt) | 2008-01-02 |
| WO2005115972A1 (en) | 2005-12-08 |
| TW200539856A (en) | 2005-12-16 |
| MXPA06013536A (es) | 2007-01-26 |
| US20090018116A1 (en) | 2009-01-15 |
| SE0401342D0 (sv) | 2004-05-25 |
| NO20065904L (no) | 2007-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2565066A1 (en) | Therapeutic compounds | |
| US20090111865A1 (en) | Benzimidazole Derivatives, Compositions Containing Them, Preparation Thereof and Uses Thereof | |
| US8633235B2 (en) | Benzimidazole derivatives, compositions containing them, preparation thereof and uses thereof | |
| JP2008519833A (ja) | インダゾールスルホンアミド誘導体 | |
| US7517898B2 (en) | Benzimidazole derivatives, compositions containing them, preparation thereof and uses thereof | |
| EP2035409A1 (en) | Benzimidazole derivatives which are to be used as anatgonist for the cb1-receptor | |
| US7244850B2 (en) | Benzimidazole derivatives, compositions containing them, preparation thereof and uses thereof | |
| US20070219254A1 (en) | Therapeutic Compounds: Pyridine N-Oxide Scaffold | |
| EP1797074A1 (en) | Compounds, compositions containing them, preparation thereof and uses thereof iiii | |
| HK1089436B (en) | Benzimidazole derivatives, compositions containing them, preparation thereof and uses thereof | |
| KR20070022705A (ko) | 치료 화합물 | |
| MXPA05013052A (en) | Benzimidazole derivatives, compositions containing them, preparation thereof and uses thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |