CA2494848A1 - Urea derivatives as kinase inhibitors - Google Patents
Urea derivatives as kinase inhibitors Download PDFInfo
- Publication number
- CA2494848A1 CA2494848A1 CA002494848A CA2494848A CA2494848A1 CA 2494848 A1 CA2494848 A1 CA 2494848A1 CA 002494848 A CA002494848 A CA 002494848A CA 2494848 A CA2494848 A CA 2494848A CA 2494848 A1 CA2494848 A1 CA 2494848A1
- Authority
- CA
- Canada
- Prior art keywords
- cyano
- pyrazinyl
- urea
- phenyl
- chloro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 229940043355 kinase inhibitor Drugs 0.000 title description 2
- 239000003757 phosphotransferase inhibitor Substances 0.000 title description 2
- 150000003672 ureas Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 153
- 238000000034 method Methods 0.000 claims abstract description 25
- 102000001253 Protein Kinase Human genes 0.000 claims abstract description 8
- 108060006633 protein kinase Proteins 0.000 claims abstract description 8
- 230000002401 inhibitory effect Effects 0.000 claims abstract description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 124
- 125000000217 alkyl group Chemical group 0.000 claims description 75
- 239000004202 carbamide Substances 0.000 claims description 63
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 40
- -1 amino, carboxy Chemical group 0.000 claims description 33
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 29
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 239000001257 hydrogen Substances 0.000 claims description 27
- 125000000623 heterocyclic group Chemical group 0.000 claims description 23
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 21
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 21
- 125000003118 aryl group Chemical group 0.000 claims description 20
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 17
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 17
- 125000003342 alkenyl group Chemical group 0.000 claims description 16
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 14
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- 125000001072 heteroaryl group Chemical group 0.000 claims description 13
- 125000004686 alkyl sulfanyl alkyl group Chemical group 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- 125000001188 haloalkyl group Chemical group 0.000 claims description 9
- 206010028980 Neoplasm Diseases 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 6
- 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 claims description 5
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 claims description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 4
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 4
- 201000011510 cancer Diseases 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims description 3
- PVAQILHDQHGVSP-UHFFFAOYSA-N 1-(5-chloro-2-cyclohex-2-en-1-yloxyphenyl)-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1N=C(C#N)C=NC=1NC(=O)NC1=CC(Cl)=CC=C1OC1CCCC=C1 PVAQILHDQHGVSP-UHFFFAOYSA-N 0.000 claims description 2
- SECWPIJSHYOZKM-UHFFFAOYSA-N 1-[5-chloro-2-(1-ethoxypropan-2-yloxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound CCOCC(C)OC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 SECWPIJSHYOZKM-UHFFFAOYSA-N 0.000 claims description 2
- FHKIBVIDIBQHBF-UHFFFAOYSA-N 1-[5-chloro-2-(1-methoxypropan-2-yloxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COCC(C)OC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 FHKIBVIDIBQHBF-UHFFFAOYSA-N 0.000 claims description 2
- LXKNXVQJYTVJID-UHFFFAOYSA-N 1-[5-chloro-2-(2-ethoxyethoxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound CCOCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 LXKNXVQJYTVJID-UHFFFAOYSA-N 0.000 claims description 2
- QUQIALMRPMENGJ-UHFFFAOYSA-N 1-[5-chloro-2-(2-propan-2-yloxyethoxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound CC(C)OCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 QUQIALMRPMENGJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 3
- 101100244083 Arabidopsis thaliana PKL gene Proteins 0.000 claims 2
- SWAAOLKRNXQREI-UHFFFAOYSA-N 1-(5-chloro-2-pent-3-ynoxyphenyl)-3-(5-cyanopyrazin-2-yl)urea Chemical compound CC#CCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 SWAAOLKRNXQREI-UHFFFAOYSA-N 0.000 claims 1
- BMZFLFKIZNBUFB-UHFFFAOYSA-N 1-(5-chloro-2-phenacyloxyphenyl)-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1N=C(C#N)C=NC=1NC(=O)NC1=CC(Cl)=CC=C1OCC(=O)C1=CC=CC=C1 BMZFLFKIZNBUFB-UHFFFAOYSA-N 0.000 claims 1
- LYRRMGQXNDNVPS-UHFFFAOYSA-N 1-[2-(3-aminopropoxy)-5-chlorophenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound NCCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 LYRRMGQXNDNVPS-UHFFFAOYSA-N 0.000 claims 1
- XYCSIMKFHRSWBS-UHFFFAOYSA-N 1-[2-[2-(4-bromophenoxy)ethoxy]-5-chlorophenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1N=C(C#N)C=NC=1NC(=O)NC1=CC(Cl)=CC=C1OCCOC1=CC=C(Br)C=C1 XYCSIMKFHRSWBS-UHFFFAOYSA-N 0.000 claims 1
- CWTLRICITVFRIL-RFHHWMCGSA-N 1-[2-[[(1s,4s)-3-bicyclo[2.2.1]heptanyl]methoxy]-5-chlorophenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C1([C@@]2([H])CC[C@@](C2)(C1)[H])COC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 CWTLRICITVFRIL-RFHHWMCGSA-N 0.000 claims 1
- UOVQGCMOPSZGOP-UHFFFAOYSA-N 1-[2-[benzyl(2-hydroxyethyl)amino]-5-bromophenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C=C(Br)C=C(NC(=O)NC=2N=CC(=NC=2)C#N)C=1N(CCO)CC1=CC=CC=C1 UOVQGCMOPSZGOP-UHFFFAOYSA-N 0.000 claims 1
- NSHVATFCXCSIAN-UHFFFAOYSA-N 1-[2-[benzyl(2-hydroxyethyl)amino]-5-chlorophenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C=C(Cl)C=C(NC(=O)NC=2N=CC(=NC=2)C#N)C=1N(CCO)CC1=CC=CC=C1 NSHVATFCXCSIAN-UHFFFAOYSA-N 0.000 claims 1
- FKQHZPMKUJQFBQ-UHFFFAOYSA-N 1-[2-[bis(2-methoxyethyl)amino]-5-bromophenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CCOC)C1=CC=C(Br)C=C1NC(=O)NC1=CN=C(C#N)C=N1 FKQHZPMKUJQFBQ-UHFFFAOYSA-N 0.000 claims 1
- NGJURHJPIBNKHP-UHFFFAOYSA-N 1-[2-[bis(2-methoxyethyl)amino]-5-chlorophenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CCOC)C1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 NGJURHJPIBNKHP-UHFFFAOYSA-N 0.000 claims 1
- ULABCUBILRGHSL-UHFFFAOYSA-N 1-[2-[bis(2-methoxyethyl)amino]-5-cyanophenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CCOC)C1=CC=C(C#N)C=C1NC(=O)NC1=CN=C(C#N)C=N1 ULABCUBILRGHSL-UHFFFAOYSA-N 0.000 claims 1
- YFTMNKQWOWZYPP-UHFFFAOYSA-N 1-[5-bromo-2-[(2-hydroxy-2-phenylethyl)-methylamino]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C=C(Br)C=C(NC(=O)NC=2N=CC(=NC=2)C#N)C=1N(C)CC(O)C1=CC=CC=C1 YFTMNKQWOWZYPP-UHFFFAOYSA-N 0.000 claims 1
- QXWXEJMOZMDALO-UHFFFAOYSA-N 1-[5-bromo-2-[ethyl(2-methoxyethyl)amino]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CC)C1=CC=C(Br)C=C1NC(=O)NC1=CN=C(C#N)C=N1 QXWXEJMOZMDALO-UHFFFAOYSA-N 0.000 claims 1
- BNNJQBBPHHAJAK-UHFFFAOYSA-N 1-[5-chloro-2-(2-chloro-1-methoxyethoxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COC(CCl)OC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 BNNJQBBPHHAJAK-UHFFFAOYSA-N 0.000 claims 1
- JBNRXWLOFSXQPH-UHFFFAOYSA-N 1-[5-chloro-2-(2-cyclohexylethoxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1N=C(C#N)C=NC=1NC(=O)NC1=CC(Cl)=CC=C1OCCC1CCCCC1 JBNRXWLOFSXQPH-UHFFFAOYSA-N 0.000 claims 1
- MWFYFELKCFAENX-UHFFFAOYSA-N 1-[5-chloro-2-(2-methoxyethoxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 MWFYFELKCFAENX-UHFFFAOYSA-N 0.000 claims 1
- ATMLVTOWEJMISI-UHFFFAOYSA-N 1-[5-chloro-2-(2-methylsulfanylethoxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound CSCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 ATMLVTOWEJMISI-UHFFFAOYSA-N 0.000 claims 1
- NHLKQOYABMYRNX-UHFFFAOYSA-N 1-[5-chloro-2-(3-methoxy-3-methylbutoxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COC(C)(C)CCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 NHLKQOYABMYRNX-UHFFFAOYSA-N 0.000 claims 1
- WHSYXEUKLZRABI-UHFFFAOYSA-N 1-[5-chloro-2-(cyclopropylmethoxy)phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1N=C(C#N)C=NC=1NC(=O)NC1=CC(Cl)=CC=C1OCC1CC1 WHSYXEUKLZRABI-UHFFFAOYSA-N 0.000 claims 1
- SMZDIRCVFZTJOH-UHFFFAOYSA-N 1-[5-chloro-2-[(1-methylcyclopropyl)methoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C=C(Cl)C=C(NC(=O)NC=2N=CC(=NC=2)C#N)C=1OCC1(C)CC1 SMZDIRCVFZTJOH-UHFFFAOYSA-N 0.000 claims 1
- QTKDJHMPFMGJMG-OLZOCXBDSA-N 1-[5-chloro-2-[(1s,3r)-3-hydroxycyclopentyl]oxyphenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C1[C@H](O)CC[C@@H]1OC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 QTKDJHMPFMGJMG-OLZOCXBDSA-N 0.000 claims 1
- XDROTNZAWWKOTD-UHFFFAOYSA-N 1-[5-chloro-2-[(2-hydroxy-2-phenylethyl)-methylamino]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C=C(Cl)C=C(NC(=O)NC=2N=CC(=NC=2)C#N)C=1N(C)CC(O)C1=CC=CC=C1 XDROTNZAWWKOTD-UHFFFAOYSA-N 0.000 claims 1
- WZDAKTSKZFOPJB-UHFFFAOYSA-N 1-[5-chloro-2-[(2-methylcyclopropyl)methoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound CC1CC1COC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 WZDAKTSKZFOPJB-UHFFFAOYSA-N 0.000 claims 1
- OPWDDEKZLIKNPN-LLVKDONJSA-N 1-[5-chloro-2-[(2r)-2,3-dihydroxypropoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound OC[C@@H](O)COC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 OPWDDEKZLIKNPN-LLVKDONJSA-N 0.000 claims 1
- OPWDDEKZLIKNPN-NSHDSACASA-N 1-[5-chloro-2-[(2s)-2,3-dihydroxypropoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound OC[C@H](O)COC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 OPWDDEKZLIKNPN-NSHDSACASA-N 0.000 claims 1
- URMCAXGZEZUWEG-QXMXGUDHSA-N 1-[5-chloro-2-[(3s,4r)-3,4-dihydroxycyclopentyl]oxyphenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C1[C@@H](O)[C@@H](O)CC1OC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 URMCAXGZEZUWEG-QXMXGUDHSA-N 0.000 claims 1
- IODANOYNIPFWFE-UHFFFAOYSA-N 1-[5-chloro-2-[1-(dimethylamino)propan-2-yloxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound CN(C)CC(C)OC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 IODANOYNIPFWFE-UHFFFAOYSA-N 0.000 claims 1
- RRIUNYNGHUZZFO-UHFFFAOYSA-N 1-[5-chloro-2-[2-(2-methoxyethoxy)ethoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COCCOCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 RRIUNYNGHUZZFO-UHFFFAOYSA-N 0.000 claims 1
- WABCAIVLMXJPIS-UHFFFAOYSA-N 1-[5-chloro-2-[2-(n-ethyl-3-methylanilino)ethoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C=CC(C)=CC=1N(CC)CCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 WABCAIVLMXJPIS-UHFFFAOYSA-N 0.000 claims 1
- OEMOGAOWNWNMAR-UHFFFAOYSA-N 1-[5-chloro-2-[2-[3-(6-methylpyridin-2-yl)propoxy]ethoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound CC1=CC=CC(CCCOCCOC=2C(=CC(Cl)=CC=2)NC(=O)NC=2N=CC(=NC=2)C#N)=N1 OEMOGAOWNWNMAR-UHFFFAOYSA-N 0.000 claims 1
- IALGTMKWTOGLGC-UHFFFAOYSA-N 1-[5-chloro-2-[2-[n-(2-cyanoethyl)anilino]ethoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1N=C(C#N)C=NC=1NC(=O)NC1=CC(Cl)=CC=C1OCCN(CCC#N)C1=CC=CC=C1 IALGTMKWTOGLGC-UHFFFAOYSA-N 0.000 claims 1
- GBSMMFHITBMOIH-UHFFFAOYSA-N 1-[5-chloro-2-[3-(dimethylamino)propoxy]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound CN(C)CCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 GBSMMFHITBMOIH-UHFFFAOYSA-N 0.000 claims 1
- FWFZPSCKCHHLCM-UHFFFAOYSA-N 1-[5-chloro-2-[ethyl(2-methoxyethyl)amino]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CC)C1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 FWFZPSCKCHHLCM-UHFFFAOYSA-N 0.000 claims 1
- BDCPPOFQGALGOU-UHFFFAOYSA-N 1-[5-cyano-2-[(2-hydroxy-2-phenylethyl)-methylamino]phenyl]-3-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C=C(C#N)C=C(NC(=O)NC=2N=CC(=NC=2)C#N)C=1N(C)CC(O)C1=CC=CC=C1 BDCPPOFQGALGOU-UHFFFAOYSA-N 0.000 claims 1
- UQHOXOXVMZRAHT-UHFFFAOYSA-N ethyl 2-[[4-chloro-2-[(5-cyanopyrazin-2-yl)carbamoylamino]phenoxy]methyl]cyclopropane-1-carboxylate Chemical compound CCOC(=O)C1CC1COC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 UQHOXOXVMZRAHT-UHFFFAOYSA-N 0.000 claims 1
- UMSJTLJUVVWWKE-UHFFFAOYSA-N ethyl 6-[4-chloro-2-[(5-cyanopyrazin-2-yl)carbamoylamino]phenoxy]hexanoate Chemical compound CCOC(=O)CCCCCOC1=CC=C(Cl)C=C1NC(=O)NC1=CN=C(C#N)C=N1 UMSJTLJUVVWWKE-UHFFFAOYSA-N 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 32
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 90
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- 239000000047 product Substances 0.000 description 60
- 238000005160 1H NMR spectroscopy Methods 0.000 description 49
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 36
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 23
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 22
- 239000012141 concentrate Substances 0.000 description 21
- 235000008504 concentrate Nutrition 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 14
- 125000002950 monocyclic group Chemical group 0.000 description 14
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 125000005843 halogen group Chemical group 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- 150000002431 hydrogen Chemical class 0.000 description 11
- 239000002904 solvent Substances 0.000 description 10
- IBZKBSXREAQDTO-UHFFFAOYSA-N 2-methoxy-n-(2-methoxyethyl)ethanamine Chemical compound COCCNCCOC IBZKBSXREAQDTO-UHFFFAOYSA-N 0.000 description 9
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 9
- 238000003818 flash chromatography Methods 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 8
- 125000004414 alkyl thio group Chemical group 0.000 description 8
- 125000002619 bicyclic group Chemical group 0.000 description 8
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- 101150006084 CHKB gene Proteins 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 7
- 125000004966 cyanoalkyl group Chemical group 0.000 description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- 125000004971 nitroalkyl group Chemical group 0.000 description 7
- 108091000080 Phosphotransferase Proteins 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 125000004438 haloalkoxy group Chemical group 0.000 description 6
- 125000004430 oxygen atom Chemical group O* 0.000 description 6
- 102000020233 phosphotransferase Human genes 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000002953 preparative HPLC Methods 0.000 description 6
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 125000004122 cyclic group Chemical group 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 125000004043 oxo group Chemical group O=* 0.000 description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 101150041968 CDC13 gene Proteins 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000007900 aqueous suspension Substances 0.000 description 4
- 125000005129 aryl carbonyl group Chemical group 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 239000000651 prodrug Substances 0.000 description 4
- 229940002612 prodrug Drugs 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 239000002953 phosphate buffered saline Substances 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 3
- 125000003373 pyrazinyl group Chemical group 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 230000019491 signal transduction Effects 0.000 description 3
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- LGYBVIBBIQQZCD-UHFFFAOYSA-N 1-[5-chloro-2-(cyclopropylmethoxy)phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C(Cl)=CC=C(OCC2CC2)C=1N(C(=O)N)C1=CN=C(C#N)C=N1 LGYBVIBBIQQZCD-UHFFFAOYSA-N 0.000 description 2
- ARXJGSRGQADJSQ-UHFFFAOYSA-N 1-methoxypropan-2-ol Chemical group COCC(C)O ARXJGSRGQADJSQ-UHFFFAOYSA-N 0.000 description 2
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical group COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 2
- XNIOWJUQPMKCIJ-UHFFFAOYSA-N 2-(benzylamino)ethanol Chemical group OCCNCC1=CC=CC=C1 XNIOWJUQPMKCIJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- ZCTYHONEGJTYQV-UHFFFAOYSA-N N-methylphenylethanolamine Chemical group CNCC(O)C1=CC=CC=C1 ZCTYHONEGJTYQV-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000005163 aryl sulfanyl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- OGBUMNBNEWYMNJ-UHFFFAOYSA-N batilol Chemical class CCCCCCCCCCCCCCCCCCOCC(O)CO OGBUMNBNEWYMNJ-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 235000012241 calcium silicate Nutrition 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 230000005754 cellular signaling Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 230000003463 hyperproliferative effect Effects 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- 230000007794 irritation Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 2
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000004530 micro-emulsion Substances 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- ASUAYTHWZCLXAN-UHFFFAOYSA-N prenol Chemical group CC(C)=CCO ASUAYTHWZCLXAN-UHFFFAOYSA-N 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 210000000664 rectum Anatomy 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- LSPHULWDVZXLIL-UHFFFAOYSA-N (+/-)-Camphoric acid Chemical compound CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- PIZQWRXTMGASCZ-UHFFFAOYSA-N (1-methylcyclopropyl)methanol Chemical group OCC1(C)CC1 PIZQWRXTMGASCZ-UHFFFAOYSA-N 0.000 description 1
- SHEINYPABNPRPM-UHFFFAOYSA-N (2-methylcyclopropyl)methanol Chemical group CC1CC1CO SHEINYPABNPRPM-UHFFFAOYSA-N 0.000 description 1
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- LCFFREMLXLZNHE-GBOLQPHISA-N (e)-2-[(3r)-3-[4-amino-3-(2-fluoro-4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enenitrile Chemical compound C12=C(N)N=CN=C2N([C@@H]2CCCN(C2)C(=O)C(/C#N)=C/C(C)(C)N2CCN(CC2)C2COC2)N=C1C(C(=C1)F)=CC=C1OC1=CC=CC=C1 LCFFREMLXLZNHE-GBOLQPHISA-N 0.000 description 1
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- JYKWWTFCYMVMGK-UHFFFAOYSA-N 1-(5-chloro-2-cyclohex-2-en-1-yloxyphenyl)-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C(Cl)=CC=C(OC2C=CCCC2)C=1N(C(=O)N)C1=CN=C(C#N)C=N1 JYKWWTFCYMVMGK-UHFFFAOYSA-N 0.000 description 1
- JBNZMVLUAJWPKD-UHFFFAOYSA-N 1-(5-chloro-2-cyclopent-3-en-1-yloxyphenyl)-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C(Cl)=CC=C(OC2CC=CC2)C=1N(C(=O)N)C1=CN=C(C#N)C=N1 JBNZMVLUAJWPKD-UHFFFAOYSA-N 0.000 description 1
- OMLAHYKKMSSXMU-UHFFFAOYSA-N 1-(5-chloro-2-phenacyloxyphenyl)-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C(Cl)=CC=C(OCC(=O)C=2C=CC=CC=2)C=1N(C(=O)N)C1=CN=C(C#N)C=N1 OMLAHYKKMSSXMU-UHFFFAOYSA-N 0.000 description 1
- NCXUNZWLEYGQAH-UHFFFAOYSA-N 1-(dimethylamino)propan-2-ol Chemical group CC(O)CN(C)C NCXUNZWLEYGQAH-UHFFFAOYSA-N 0.000 description 1
- OPGOSXQGXKQILZ-UHFFFAOYSA-N 1-[2-(3-aminopropoxy)-5-chlorophenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound NCCCOC1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 OPGOSXQGXKQILZ-UHFFFAOYSA-N 0.000 description 1
- FNUJMWZFEZQNMH-UHFFFAOYSA-N 1-[2-(methylamino)phenyl]ethanol Chemical group CNC1=CC=CC=C1C(C)O FNUJMWZFEZQNMH-UHFFFAOYSA-N 0.000 description 1
- LDKRZEGYPASYBN-RFHHWMCGSA-N 1-[2-[[(1S,4S)-2-bicyclo[2.2.1]heptanyl]methoxy]-5-chlorophenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound [C@H]12C(C[C@@H](CC1)C2)COC1=C(C=C(C=C1)Cl)N(C(=O)N)C1=NC=C(N=C1)C#N LDKRZEGYPASYBN-RFHHWMCGSA-N 0.000 description 1
- DYFGRICIHAKJKH-UHFFFAOYSA-N 1-[2-[bis(2-methoxyethyl)amino]-5-bromophenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CCOC)C1=CC=C(Br)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 DYFGRICIHAKJKH-UHFFFAOYSA-N 0.000 description 1
- PGKDQSFLWPOSEE-UHFFFAOYSA-N 1-[2-[bis(2-methoxyethyl)amino]-5-chlorophenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CCOC)C1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 PGKDQSFLWPOSEE-UHFFFAOYSA-N 0.000 description 1
- USBWFIXGVISNEH-UHFFFAOYSA-N 1-[2-[bis(2-methoxyethyl)amino]-5-cyanophenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CCOC)C1=CC=C(C#N)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 USBWFIXGVISNEH-UHFFFAOYSA-N 0.000 description 1
- ZAOQVWPAPJIBMY-UHFFFAOYSA-N 1-[5-bromo-2-[ethyl(2-methoxyethyl)amino]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CC)C1=CC=C(Br)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 ZAOQVWPAPJIBMY-UHFFFAOYSA-N 0.000 description 1
- BSDOSXOZZIOXKX-UHFFFAOYSA-N 1-[5-chloro-2-(2-chloro-1-methoxyethoxy)phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COC(CCl)OC1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 BSDOSXOZZIOXKX-UHFFFAOYSA-N 0.000 description 1
- UXASQCBZJOTPCS-UHFFFAOYSA-N 1-[5-chloro-2-(2-cyclohexylethoxy)phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C(Cl)=CC=C(OCCC2CCCCC2)C=1N(C(=O)N)C1=CN=C(C#N)C=N1 UXASQCBZJOTPCS-UHFFFAOYSA-N 0.000 description 1
- WGVALDVQXPNWLO-UHFFFAOYSA-N 1-[5-chloro-2-(2-methoxyethoxy)phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COCCOC1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 WGVALDVQXPNWLO-UHFFFAOYSA-N 0.000 description 1
- RESXRWWZBJZHLW-UHFFFAOYSA-N 1-[5-chloro-2-(3-methoxy-3-methylbutoxy)phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COC(C)(C)CCOC1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 RESXRWWZBJZHLW-UHFFFAOYSA-N 0.000 description 1
- HLFYIVJMACMSPN-UHFFFAOYSA-N 1-[5-chloro-2-(3-methylbut-2-enoxy)phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound CC(C)=CCOC1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 HLFYIVJMACMSPN-UHFFFAOYSA-N 0.000 description 1
- WQCNFBRATUZDMR-OLZOCXBDSA-N 1-[5-chloro-2-[(1S,3R)-3-hydroxycyclopentyl]oxyphenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound NC(=O)N(c1cnc(cn1)C#N)c1cc(Cl)ccc1O[C@H]1CC[C@@H](O)C1 WQCNFBRATUZDMR-OLZOCXBDSA-N 0.000 description 1
- OEKKTAGGMDXISO-UHFFFAOYSA-N 1-[5-chloro-2-[(2-hydroxy-2-phenylethyl)-methylamino]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C=C(Cl)C=C(N(C(N)=O)C=2N=CC(=NC=2)C#N)C=1N(C)CC(O)C1=CC=CC=C1 OEKKTAGGMDXISO-UHFFFAOYSA-N 0.000 description 1
- SAUDYRQEIFZDBO-UHFFFAOYSA-N 1-[5-chloro-2-[(2-methylcyclopropyl)methoxy]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound CC1CC1COC1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 SAUDYRQEIFZDBO-UHFFFAOYSA-N 0.000 description 1
- UWUCQUQHFUANPU-LLVKDONJSA-N 1-[5-chloro-2-[(2r)-2,3-dihydroxypropoxy]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C(Cl)=CC=C(OC[C@H](O)CO)C=1N(C(=O)N)C1=CN=C(C#N)C=N1 UWUCQUQHFUANPU-LLVKDONJSA-N 0.000 description 1
- UWUCQUQHFUANPU-NSHDSACASA-N 1-[5-chloro-2-[(2s)-2,3-dihydroxypropoxy]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C(Cl)=CC=C(OC[C@@H](O)CO)C=1N(C(=O)N)C1=CN=C(C#N)C=N1 UWUCQUQHFUANPU-NSHDSACASA-N 0.000 description 1
- HHDCXLMZIUTRQM-UHFFFAOYSA-N 1-[5-chloro-2-[1-(dimethylamino)propan-2-yloxy]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound CN(C)CC(C)OC1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 HHDCXLMZIUTRQM-UHFFFAOYSA-N 0.000 description 1
- NLVFGPIUVUSTMI-UHFFFAOYSA-N 1-[5-chloro-2-[2-(2-methoxyethoxy)ethoxy]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COCCOCCOC1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 NLVFGPIUVUSTMI-UHFFFAOYSA-N 0.000 description 1
- PUIKEVSMUSLGKL-UHFFFAOYSA-N 1-[5-chloro-2-[2-[3-(6-methylpyridin-2-yl)propoxy]ethoxy]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound CC1=CC=CC(CCCOCCOC=2C(=CC(Cl)=CC=2)N(C(N)=O)C=2N=CC(=NC=2)C#N)=N1 PUIKEVSMUSLGKL-UHFFFAOYSA-N 0.000 description 1
- JMTLTYNJIZVSMT-UHFFFAOYSA-N 1-[5-chloro-2-[2-[n-(2-cyanoethyl)anilino]ethoxy]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound C=1C(Cl)=CC=C(OCCN(CCC#N)C=2C=CC=CC=2)C=1N(C(=O)N)C1=CN=C(C#N)C=N1 JMTLTYNJIZVSMT-UHFFFAOYSA-N 0.000 description 1
- AKJQYUNIQRFLBO-UHFFFAOYSA-N 1-[5-chloro-2-[ethyl(2-methoxyethyl)amino]phenyl]-1-(5-cyanopyrazin-2-yl)urea Chemical compound COCCN(CC)C1=CC=C(Cl)C=C1N(C(N)=O)C1=CN=C(C#N)C=N1 AKJQYUNIQRFLBO-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical class CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- JOLQKTGDSGKSKJ-UHFFFAOYSA-N 1-ethoxypropan-2-ol Chemical group CCOCC(C)O JOLQKTGDSGKSKJ-UHFFFAOYSA-N 0.000 description 1
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- LXFQSRIDYRFTJW-UHFFFAOYSA-M 2,4,6-trimethylbenzenesulfonate Chemical compound CC1=CC(C)=C(S([O-])(=O)=O)C(C)=C1 LXFQSRIDYRFTJW-UHFFFAOYSA-M 0.000 description 1
- QYIOGYCRGNHDNK-UHFFFAOYSA-N 2-(4-bromophenoxy)ethanol Chemical group OCCOC1=CC=C(Br)C=C1 QYIOGYCRGNHDNK-UHFFFAOYSA-N 0.000 description 1
- KRNUKKZDGDAWBF-UHFFFAOYSA-N 2-(n-ethyl-n-m-toluidino)ethanol Chemical group OCCN(CC)C1=CC=CC(C)=C1 KRNUKKZDGDAWBF-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical group COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- OIUHSFKEXYXWSD-UHFFFAOYSA-N 2-[3-(6-methylpyridin-2-yl)propoxy]ethanol Chemical group CC1=CC=CC(CCCOCCO)=N1 OIUHSFKEXYXWSD-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- SWFNPENEBHAHEB-UHFFFAOYSA-N 2-amino-4-chlorophenol Chemical compound NC1=CC(Cl)=CC=C1O SWFNPENEBHAHEB-UHFFFAOYSA-N 0.000 description 1
- WDKOEMMQZYRXJH-UHFFFAOYSA-N 2-chloro-1-methoxyethanol Chemical group COC(O)CCl WDKOEMMQZYRXJH-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- QJQZRLXDLORINA-UHFFFAOYSA-N 2-cyclohexylethanol Chemical group OCCC1CCCCC1 QJQZRLXDLORINA-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical group CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- WBBPRCNXBQTYLF-UHFFFAOYSA-N 2-methylthioethanol Chemical group CSCCO WBBPRCNXBQTYLF-UHFFFAOYSA-N 0.000 description 1
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical class BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- HCGFUIQPSOCUHI-UHFFFAOYSA-N 2-propan-2-yloxyethanol Chemical group CC(C)OCCO HCGFUIQPSOCUHI-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- ZZSAMVCYMMWTDV-UHFFFAOYSA-N 3-(4-chloro-2-nitrophenoxy)cyclopentan-1-ol Chemical compound C1C(O)CCC1OC1=CC=C(Cl)C=C1[N+]([O-])=O ZZSAMVCYMMWTDV-UHFFFAOYSA-N 0.000 description 1
- PYSGFFTXMUWEOT-UHFFFAOYSA-N 3-(dimethylamino)propan-1-ol Chemical group CN(C)CCCO PYSGFFTXMUWEOT-UHFFFAOYSA-N 0.000 description 1
- NSPPRYXGGYQMPY-UHFFFAOYSA-N 3-Methylbuten-2-ol-1 Natural products CC(C)C(O)=C NSPPRYXGGYQMPY-UHFFFAOYSA-N 0.000 description 1
- WZJJWQVBLSPALW-UHFFFAOYSA-N 3-[n-(2-hydroxyethyl)anilino]propanenitrile Chemical group N#CCCN(CCO)C1=CC=CC=C1 WZJJWQVBLSPALW-UHFFFAOYSA-N 0.000 description 1
- MFKRHJVUCZRDTF-UHFFFAOYSA-N 3-methoxy-3-methylbutan-1-ol Chemical group COC(C)(C)CCO MFKRHJVUCZRDTF-UHFFFAOYSA-N 0.000 description 1
- UQEANKGXXSENNF-UHFFFAOYSA-N 4-bromo-1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Br)=CC=C1F UQEANKGXXSENNF-UHFFFAOYSA-N 0.000 description 1
- UVPJTYMAETXTQV-UHFFFAOYSA-N 4-bromo-1-n,1-n-bis(2-methoxyethyl)benzene-1,2-diamine Chemical compound COCCN(CCOC)C1=CC=C(Br)C=C1N UVPJTYMAETXTQV-UHFFFAOYSA-N 0.000 description 1
- KEQYHLAQICGTQJ-UHFFFAOYSA-N 4-chloro-1-cyclopent-3-en-1-yloxy-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1OC1CC=CC1 KEQYHLAQICGTQJ-UHFFFAOYSA-N 0.000 description 1
- DIAWBHLTWNWYGR-UHFFFAOYSA-N 4-chloro-1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1F DIAWBHLTWNWYGR-UHFFFAOYSA-N 0.000 description 1
- UAPHOOFVPLXPES-UHFFFAOYSA-N 4-chloro-1-n,1-n-bis(2-methoxyethyl)benzene-1,2-diamine Chemical compound COCCN(CCOC)C1=CC=C(Cl)C=C1N UAPHOOFVPLXPES-UHFFFAOYSA-N 0.000 description 1
- NWSIFTLPLKCTSX-UHFFFAOYSA-N 4-chloro-2-nitrophenol Chemical compound OC1=CC=C(Cl)C=C1[N+]([O-])=O NWSIFTLPLKCTSX-UHFFFAOYSA-N 0.000 description 1
- LKOWKPGBAZVHOF-UHFFFAOYSA-N 4-fluoro-3-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(C#N)=CC=C1F LKOWKPGBAZVHOF-UHFFFAOYSA-N 0.000 description 1
- KRRTXVSBTPCDOS-UHFFFAOYSA-N 5-bromopyrazin-2-amine Chemical compound NC1=CN=C(Br)C=N1 KRRTXVSBTPCDOS-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- AMKGKYQBASDDJB-UHFFFAOYSA-N 9$l^{2}-borabicyclo[3.3.1]nonane Chemical compound C1CCC2CCCC1[B]2 AMKGKYQBASDDJB-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- FEJUGLKDZJDVFY-UHFFFAOYSA-N 9-borabicyclo[3.3.1]nonane Substances C1CCC2CCCC1B2 FEJUGLKDZJDVFY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 206010003571 Astrocytoma Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 101100220616 Caenorhabditis elegans chk-2 gene Proteins 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- 208000006332 Choriocarcinoma Diseases 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 102000013701 Cyclin-Dependent Kinase 4 Human genes 0.000 description 1
- 108010025464 Cyclin-Dependent Kinase 4 Proteins 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010061818 Disease progression Diseases 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 108091008794 FGF receptors Proteins 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 206010018338 Glioma Diseases 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Polymers OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 239000007995 HEPES buffer Substances 0.000 description 1
- 208000002250 Hematologic Neoplasms Diseases 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 101000692455 Homo sapiens Platelet-derived growth factor receptor beta Proteins 0.000 description 1
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 description 1
- 206010062767 Hypophysitis Diseases 0.000 description 1
- 208000028257 Joubert syndrome with oculorenal defect Diseases 0.000 description 1
- 208000007766 Kaposi sarcoma Diseases 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 206010025323 Lymphomas Diseases 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 1
- 229910003827 NRaRb Inorganic materials 0.000 description 1
- 208000034176 Neoplasms, Germ Cell and Embryonal Diseases 0.000 description 1
- 206010029260 Neuroblastoma Diseases 0.000 description 1
- 208000005890 Neuroma Diseases 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 208000007452 Plasmacytoma Diseases 0.000 description 1
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920000954 Polyglycolide Polymers 0.000 description 1
- 229920001710 Polyorthoester Polymers 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 102000052575 Proto-Oncogene Human genes 0.000 description 1
- 108700020978 Proto-Oncogene Proteins 0.000 description 1
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 description 1
- 201000000582 Retinoblastoma Diseases 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 102000001332 SRC Human genes 0.000 description 1
- 108060006706 SRC Proteins 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 208000031673 T-Cell Cutaneous Lymphoma Diseases 0.000 description 1
- 208000000389 T-cell leukemia Diseases 0.000 description 1
- 208000028530 T-cell lymphoblastic leukemia/lymphoma Diseases 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 239000013504 Triton X-100 Substances 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 108091008605 VEGF receptors Proteins 0.000 description 1
- 102100033177 Vascular endothelial growth factor receptor 2 Human genes 0.000 description 1
- RNVYQYLELCKWAN-RXMQYKEDSA-N [(4r)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol Chemical group CC1(C)OC[C@@H](CO)O1 RNVYQYLELCKWAN-RXMQYKEDSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 230000001919 adrenal effect Effects 0.000 description 1
- 210000004100 adrenal gland Anatomy 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 125000000539 amino acid group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 229940045988 antineoplastic drug protein kinase inhibitors Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 210000000013 bile duct Anatomy 0.000 description 1
- 229920002988 biodegradable polymer Polymers 0.000 description 1
- 239000004621 biodegradable polymer Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 101150073031 cdk2 gene Proteins 0.000 description 1
- 230000006369 cell cycle progression Effects 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 210000003679 cervix uteri Anatomy 0.000 description 1
- 101150113535 chek1 gene Proteins 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000005827 chlorofluoro hydrocarbons Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 201000007241 cutaneous T cell lymphoma Diseases 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical group OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 230000003831 deregulation Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001070 dihydroindolyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000004655 dihydropyridinyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- UBHZUDXTHNMNLD-UHFFFAOYSA-N dimethylsilane Chemical compound C[SiH2]C UBHZUDXTHNMNLD-UHFFFAOYSA-N 0.000 description 1
- GAFRWLVTHPVQGK-UHFFFAOYSA-N dipentyl sulfate Chemical class CCCCCOS(=O)(=O)OCCCCC GAFRWLVTHPVQGK-UHFFFAOYSA-N 0.000 description 1
- 230000005750 disease progression Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 210000003372 endocrine gland Anatomy 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 238000007824 enzymatic assay Methods 0.000 description 1
- 102000052116 epidermal growth factor receptor activity proteins Human genes 0.000 description 1
- 108700015053 epidermal growth factor receptor activity proteins Proteins 0.000 description 1
- 210000003238 esophagus Anatomy 0.000 description 1
- AOQBVPPEXCRXAW-UHFFFAOYSA-N ethyl 2-(hydroxymethyl)cyclopropane-1-carboxylate Chemical group CCOC(=O)C1CC1CO AOQBVPPEXCRXAW-UHFFFAOYSA-N 0.000 description 1
- HYXRUZUPCFVWAH-UHFFFAOYSA-N ethyl 6-hydroxyhexanoate Chemical group CCOC(=O)CCCCCO HYXRUZUPCFVWAH-UHFFFAOYSA-N 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 210000001508 eye Anatomy 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 210000005002 female reproductive tract Anatomy 0.000 description 1
- 102000052178 fibroblast growth factor receptor activity proteins Human genes 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 208000024386 fungal infectious disease Diseases 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 210000000232 gallbladder Anatomy 0.000 description 1
- 208000003884 gestational trophoblastic disease Diseases 0.000 description 1
- 208000005017 glioblastoma Diseases 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 201000011066 hemangioma Diseases 0.000 description 1
- 230000009033 hematopoietic malignancy Effects 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 210000003026 hypopharynx Anatomy 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 229940102213 injectable suspension Drugs 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 210000005001 male reproductive tract Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 210000002418 meninge Anatomy 0.000 description 1
- 206010027191 meningioma Diseases 0.000 description 1
- 208000037843 metastatic solid tumor Diseases 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 201000005962 mycosis fungoides Diseases 0.000 description 1
- 201000005987 myeloid sarcoma Diseases 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YNTOKMNHRPSGFU-UHFFFAOYSA-N n-Propyl carbamate Chemical compound CCCOC(N)=O YNTOKMNHRPSGFU-UHFFFAOYSA-N 0.000 description 1
- YOHYSYJDKVYCJI-UHFFFAOYSA-N n-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide Chemical compound FC(F)(F)C1=CC=CC(NC=2N=CN=C(NC=3C=C(NC(=O)C4CC4)C=CC=3)C=2)=C1 YOHYSYJDKVYCJI-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 230000014399 negative regulation of angiogenesis Effects 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 208000007538 neurilemmoma Diseases 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 231100000344 non-irritating Toxicity 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 210000003300 oropharynx Anatomy 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 229940127084 other anti-cancer agent Drugs 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- FMDUIXVUAMELIC-UHFFFAOYSA-N phenyl n-(5-cyanopyrazin-2-yl)carbamate Chemical compound C=1C=CC=CC=1OC(=O)NC1=CN=C(C#N)C=N1 FMDUIXVUAMELIC-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 210000003635 pituitary gland Anatomy 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920002704 polyhistidine Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 208000025638 primary cutaneous T-cell non-Hodgkin lymphoma Diseases 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000003909 protein kinase inhibitor Substances 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- XFTQRUTUGRCSGO-UHFFFAOYSA-N pyrazin-2-amine Chemical compound NC1=CN=CC=N1 XFTQRUTUGRCSGO-UHFFFAOYSA-N 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000001959 radiotherapy Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000022983 regulation of cell cycle Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000028617 response to DNA damage stimulus Effects 0.000 description 1
- 102200043753 rs104893640 Human genes 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 210000001625 seminal vesicle Anatomy 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 210000004872 soft tissue Anatomy 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000019130 spindle checkpoint Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- QKSQWQOAUQFORH-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonylimino]carbamate Chemical compound CC(C)(C)OC(=O)N=NC(=O)OC(C)(C)C QKSQWQOAUQFORH-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 210000001685 thyroid gland Anatomy 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 239000006208 topical dosage form Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- 229940066528 trichloroacetate Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
- 210000003741 urothelium Anatomy 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 210000001215 vagina Anatomy 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 201000010653 vesiculitis Diseases 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
- 235000014692 zinc oxide Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/20—Nitrogen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10/218,121 | 2002-08-13 | ||
| US10/218,121 US20040034038A1 (en) | 2002-08-13 | 2002-08-13 | Urea kinase inhibitors |
| PCT/US2003/024474 WO2004014876A1 (en) | 2002-08-13 | 2003-08-05 | Urea derivatives as kinase inhibitors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2494848A1 true CA2494848A1 (en) | 2004-02-19 |
Family
ID=31714498
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002494848A Abandoned CA2494848A1 (en) | 2002-08-13 | 2003-08-05 | Urea derivatives as kinase inhibitors |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US20040034038A1 (https=) |
| EP (1) | EP1534692A1 (https=) |
| JP (1) | JP2006500353A (https=) |
| CA (1) | CA2494848A1 (https=) |
| MX (1) | MXPA05001724A (https=) |
| WO (1) | WO2004014876A1 (https=) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2005072733A1 (en) * | 2004-01-20 | 2005-08-11 | Millennium Pharmaceuticals, Inc. | Dyarylurea compounds as chk-1 inhibitors |
| GB0512324D0 (en) * | 2005-06-16 | 2005-07-27 | Novartis Ag | Organic compounds |
| MX2007000265A (es) * | 2004-07-02 | 2007-07-20 | Icos Corp | Compuestos utiles para inhibir chk1. |
| HRP20100678T1 (hr) | 2005-03-29 | 2011-02-28 | Icos Corporation | Derivati heteroariluree korisni kao inhibitori chk1 |
| GEP20105074B (en) * | 2005-12-21 | 2010-09-10 | Novartis Ag | Pyrimidinyl aryl urea derivatives being fgf inhibitors |
| HU227696B1 (en) * | 2006-04-13 | 2011-12-28 | Egyt Gyogyszervegyeszeti Gyar | Zinc salt of rosuvastatin, process for its preparation and pharmaceutical compositions containing it |
| JP2010510222A (ja) * | 2006-11-17 | 2010-04-02 | シェーリング コーポレイション | 増殖性障害に対する併用療法 |
| US8314108B2 (en) | 2008-12-17 | 2012-11-20 | Eli Lilly And Company | 5-(5-(2-(3-aminopropoxy)-6-methoxyphenyl)-1H-pyrazol-3-ylamino)pyrazine-2-carbonitrile, pharmaceutically acceptable salts thereof, or solvate of salts |
| PA8850801A1 (es) | 2008-12-17 | 2010-07-27 | Lilly Co Eli | Compuestos útiles para inhibir chk1 |
| GB201008005D0 (en) | 2010-05-13 | 2010-06-30 | Sentinel Oncology Ltd | Pharmaceutical compounds |
| EP2970114B1 (en) * | 2013-03-15 | 2019-05-15 | Bristol-Myers Squibb Company | Ido inhibitors |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1213022C (zh) * | 1997-12-22 | 2005-08-03 | 拜尔有限公司 | 用对称和不对称的取代二苯脲抑制raf激酶 |
| EP1140840B1 (en) * | 1999-01-13 | 2006-03-22 | Bayer Pharmaceuticals Corp. | -g(v)-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| KR20020084116A (ko) * | 2000-02-07 | 2002-11-04 | 애보트 게엠베하 운트 콤파니 카게 | 2-벤조티아졸릴 우레아 유도체 및 이의 단백질 키나제억제제로서의 용도 |
| UA76977C2 (en) * | 2001-03-02 | 2006-10-16 | Icos Corp | Aryl- and heteroaryl substituted chk1 inhibitors and their use as radiosensitizers and chemosensitizers |
-
2002
- 2002-08-13 US US10/218,121 patent/US20040034038A1/en not_active Abandoned
-
2003
- 2003-08-05 MX MXPA05001724A patent/MXPA05001724A/es unknown
- 2003-08-05 EP EP03784917A patent/EP1534692A1/en not_active Withdrawn
- 2003-08-05 WO PCT/US2003/024474 patent/WO2004014876A1/en not_active Ceased
- 2003-08-05 CA CA002494848A patent/CA2494848A1/en not_active Abandoned
- 2003-08-05 JP JP2004527753A patent/JP2006500353A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| WO2004014876A1 (en) | 2004-02-19 |
| JP2006500353A (ja) | 2006-01-05 |
| US20040034038A1 (en) | 2004-02-19 |
| EP1534692A1 (en) | 2005-06-01 |
| MXPA05001724A (es) | 2005-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR102469161B1 (ko) | Rho-관련 단백질 키나아제 억제제, Rho-관련 단백질 키나아제 억제제를 함유하는 약학 조성물, 제조 방법 및 약학 조성물의 용도 | |
| KR100814599B1 (ko) | 신경퇴행성 장애 치료용 이미다졸 화합물 | |
| RU2125051C1 (ru) | Производные дифенила, производное фенилпиперазина и способ лечения | |
| KR910002583B1 (ko) | 피페라진 유도체 또는 이의 염, 이의 제조방법 및 활성 성분으로서 이를 함유하는 약제학적 조성물 | |
| CN111285882B (zh) | 稠环化合物、包含其的药物组合物及其制备方法和用途 | |
| US11560366B2 (en) | Bicyclo[1.1.1]pentane inhibitors of dual leucine zipper (DLK) kinase for the treatment of disease | |
| JP2010531851A (ja) | 新規化合物 | |
| CN115141215A (zh) | Kras g12d蛋白抑制剂和其用途 | |
| CN114409656B (zh) | Pim激酶抑制剂 | |
| WO2017202390A1 (zh) | 作为fgfr4抑制剂的杂环化合物 | |
| CN107835810A (zh) | 作为hdac1/2抑制剂的哌啶衍生物 | |
| WO2016169421A1 (zh) | 咪唑并异吲哚类衍生物、其制备方法及其在医药上的应用 | |
| CA2494848A1 (en) | Urea derivatives as kinase inhibitors | |
| HU220765B1 (hu) | Eljárás N-szulfonil-indolin-származékok és e vegyületeket tartalmazó gyógyászati készítmények előállítására | |
| AU2016345244B2 (en) | Pyrrolidine derivatives | |
| EP3325452B1 (en) | Substituted hydrophobic benzene sulfonamide thiazole compounds for use in treating cancer | |
| KR20210151105A (ko) | 피라졸일-아미노-피리미디닐 유도체의 벤제테르 및 아닐린, 이의 조성물 및 방법 | |
| US20030119839A1 (en) | Protein kinase inhibitors | |
| NO180195B (no) | Analogifremgangsmåte ved fremstilling av heksahydroazepinderivater | |
| US7056925B2 (en) | Urea kinase inhibitors | |
| US20050096324A1 (en) | Macrocyclic kinase inhibitors | |
| CN111902401B (zh) | 受体抑制剂、包含其的药物组合物及其用途 | |
| CN115551496A (zh) | Stat抑制性化合物和组合物 | |
| WO2006018955A1 (ja) | イソインドール誘導体の製造方法 | |
| US6797825B2 (en) | Protein kinase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |