CA2332957A1 - Substituted 1-(4-aminophenyl)pyrazoles and their use as anti-inflammatory agents - Google Patents
Substituted 1-(4-aminophenyl)pyrazoles and their use as anti-inflammatory agents Download PDFInfo
- Publication number
- CA2332957A1 CA2332957A1 CA002332957A CA2332957A CA2332957A1 CA 2332957 A1 CA2332957 A1 CA 2332957A1 CA 002332957 A CA002332957 A CA 002332957A CA 2332957 A CA2332957 A CA 2332957A CA 2332957 A1 CA2332957 A1 CA 2332957A1
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- phenyl
- nhc
- pyrazole
- optionally substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- CSFIQHZIFKIQNO-UHFFFAOYSA-N 4-pyrazol-1-ylaniline Chemical class C1=CC(N)=CC=C1N1N=CC=C1 CSFIQHZIFKIQNO-UHFFFAOYSA-N 0.000 title abstract description 11
- 229940121363 anti-inflammatory agent Drugs 0.000 title 1
- 239000002260 anti-inflammatory agent Substances 0.000 title 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 56
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 213
- -1 3,5-dimethyl-4-isoxazolyl Chemical group 0.000 claims description 181
- 238000000034 method Methods 0.000 claims description 111
- 125000000217 alkyl group Chemical group 0.000 claims description 101
- 150000001875 compounds Chemical class 0.000 claims description 95
- 229910052736 halogen Inorganic materials 0.000 claims description 53
- 125000000623 heterocyclic group Chemical group 0.000 claims description 50
- 150000002367 halogens Chemical class 0.000 claims description 41
- 125000003342 alkenyl group Chemical group 0.000 claims description 40
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 39
- 239000002904 solvent Substances 0.000 claims description 35
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 33
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 32
- 125000003545 alkoxy group Chemical group 0.000 claims description 31
- 125000003118 aryl group Chemical group 0.000 claims description 31
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical group CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 30
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 27
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 25
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 108010002350 Interleukin-2 Proteins 0.000 claims description 18
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 16
- 125000004414 alkyl thio group Chemical group 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 15
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 14
- 125000004452 carbocyclyl group Chemical group 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- 125000004687 alkyl sulfinyl alkyl group Chemical group 0.000 claims description 12
- 125000000304 alkynyl group Chemical group 0.000 claims description 12
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 11
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 11
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 11
- 125000001624 naphthyl group Chemical group 0.000 claims description 11
- 125000004076 pyridyl group Chemical group 0.000 claims description 11
- 125000003282 alkyl amino group Chemical group 0.000 claims description 10
- 238000011282 treatment Methods 0.000 claims description 10
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 9
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 9
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 150000001336 alkenes Chemical class 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000006217 methyl sulfide group Chemical group [H]C([H])([H])S* 0.000 claims description 7
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 6
- WEGYGNROSJDEIW-UHFFFAOYSA-N 3-Acetylpyridine Chemical compound CC(=O)C1=CC=CN=C1 WEGYGNROSJDEIW-UHFFFAOYSA-N 0.000 claims description 6
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 6
- 239000002671 adjuvant Substances 0.000 claims description 6
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 6
- 125000004688 alkyl sulfonyl alkyl group Chemical group 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 6
- 150000002576 ketones Chemical class 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 201000010099 disease Diseases 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 4
- 125000001041 indolyl group Chemical group 0.000 claims description 4
- 208000027866 inflammatory disease Diseases 0.000 claims description 4
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- LQNUZADURLCDLV-IDEBNGHGSA-N nitrobenzene Chemical group [O-][N+](=O)[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 LQNUZADURLCDLV-IDEBNGHGSA-N 0.000 claims description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 4
- 229920002554 vinyl polymer Chemical group 0.000 claims description 4
- YMJLEPMVGQBLHL-UHFFFAOYSA-N 1h-pyrazole-5-carbonitrile Chemical compound N#CC1=CC=NN1 YMJLEPMVGQBLHL-UHFFFAOYSA-N 0.000 claims description 3
- JXHIYXDHBLFZDW-UHFFFAOYSA-N 2-(4-nitrophenyl)-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1C(C#N)=CC(C=2C=NC=CC=2)=N1 JXHIYXDHBLFZDW-UHFFFAOYSA-N 0.000 claims description 3
- LTDYIDRPEYYIRH-UHFFFAOYSA-N 4-(5-ethyl-3-pyridin-3-ylpyrazol-1-yl)-n-[(2-methylphenyl)methyl]aniline Chemical compound CCC1=CC(C=2C=NC=CC=2)=NN1C(C=C1)=CC=C1NCC1=CC=CC=C1C LTDYIDRPEYYIRH-UHFFFAOYSA-N 0.000 claims description 3
- 208000023275 Autoimmune disease Diseases 0.000 claims description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- LSEFCHWGJNHZNT-UHFFFAOYSA-M methyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C)C1=CC=CC=C1 LSEFCHWGJNHZNT-UHFFFAOYSA-M 0.000 claims description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- CRAWFJBJQNWWJG-UHFFFAOYSA-N 2-[4-[(2,6-dimethylphenyl)methylamino]phenyl]-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound CC1=CC=CC(C)=C1CNC1=CC=C(N2C(=CC(=N2)C=2C=NC=CC=2)C#N)C=C1 CRAWFJBJQNWWJG-UHFFFAOYSA-N 0.000 claims description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- CDMNFVCQZPYYDK-UHFFFAOYSA-N 4-(3-cyanopropoxy)-n-[4-(5-cyano-3-pyridin-3-ylpyrazol-1-yl)phenyl]benzamide Chemical compound C=1C=C(OCCCC#N)C=CC=1C(=O)NC(C=C1)=CC=C1N(C(=C1)C#N)N=C1C1=CC=CN=C1 CDMNFVCQZPYYDK-UHFFFAOYSA-N 0.000 claims description 2
- YFSFKZHKICGCJW-UHFFFAOYSA-N 4-(5-ethyl-3-pyridin-3-ylpyrazol-1-yl)-n-[(2-fluoro-6-methylphenyl)methyl]aniline Chemical compound CCC1=CC(C=2C=NC=CC=2)=NN1C(C=C1)=CC=C1NCC1=C(C)C=CC=C1F YFSFKZHKICGCJW-UHFFFAOYSA-N 0.000 claims description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 2
- 238000007239 Wittig reaction Methods 0.000 claims description 2
- 239000000908 ammonium hydroxide Substances 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 claims description 2
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 claims description 2
- JQEQGNBYJGTFOJ-UHFFFAOYSA-N n-[(2-chloro-6-fluorophenyl)methyl]-4-(5-ethyl-3-pyridin-3-ylpyrazol-1-yl)aniline Chemical compound CCC1=CC(C=2C=NC=CC=2)=NN1C(C=C1)=CC=C1NCC1=C(F)C=CC=C1Cl JQEQGNBYJGTFOJ-UHFFFAOYSA-N 0.000 claims description 2
- CCAFHMPMIJBDRP-UHFFFAOYSA-N n-[4-(5-ethyl-3-pyridin-3-ylpyrazol-1-yl)phenyl]pyridine-3-carboxamide Chemical compound CCC1=CC(C=2C=NC=CC=2)=NN1C(C=C1)=CC=C1NC(=O)C1=CC=CN=C1 CCAFHMPMIJBDRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000007800 oxidant agent Substances 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 16
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 11
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims 10
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 7
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 5
- 229910006074 SO2NH2 Inorganic materials 0.000 claims 5
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 5
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims 4
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims 4
- 229910052801 chlorine Inorganic materials 0.000 claims 3
- 150000001450 anions Chemical class 0.000 claims 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 125000006704 (C5-C6) cycloalkyl group Chemical group 0.000 claims 1
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 claims 1
- 125000006023 1-pentenyl group Chemical group 0.000 claims 1
- BNYCHCAYYYRJSH-UHFFFAOYSA-N 1h-pyrazole-5-carboxamide Chemical compound NC(=O)C1=CC=NN1 BNYCHCAYYYRJSH-UHFFFAOYSA-N 0.000 claims 1
- AHXBNAYSJKHAGO-UHFFFAOYSA-N 2-(4-nitrophenyl)-5-pyridin-3-ylpyrazole-3-carboxamide Chemical compound NC(=O)C1=CC(C=2C=NC=CC=2)=NN1C1=CC=C([N+]([O-])=O)C=C1 AHXBNAYSJKHAGO-UHFFFAOYSA-N 0.000 claims 1
- QXNNYGMALSHKPJ-UHFFFAOYSA-N 2-(4-nitrophenyl)-5-pyridin-3-ylpyrazole-3-carboxylic acid Chemical compound OC(=O)C1=CC(C=2C=NC=CC=2)=NN1C1=CC=C([N+]([O-])=O)C=C1 QXNNYGMALSHKPJ-UHFFFAOYSA-N 0.000 claims 1
- SLJXCMIFADRNKB-UHFFFAOYSA-N 2-[4-(2,3-dihydro-1h-inden-2-ylmethylamino)phenyl]-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound N=1N(C=2C=CC(NCC3CC4=CC=CC=C4C3)=CC=2)C(C#N)=CC=1C1=CC=CN=C1 SLJXCMIFADRNKB-UHFFFAOYSA-N 0.000 claims 1
- PSEZMBBKILHUCM-UHFFFAOYSA-N 2-[4-[(2-chloro-6-fluorophenyl)methylamino]phenyl]-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound FC1=CC=CC(Cl)=C1CNC1=CC=C(N2C(=CC(=N2)C=2C=NC=CC=2)C#N)C=C1 PSEZMBBKILHUCM-UHFFFAOYSA-N 0.000 claims 1
- ZOGGQKGBANGTGS-UHFFFAOYSA-N 2-[4-[(2-chloro-6-methylphenyl)methylamino]phenyl]-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound CC1=CC=CC(Cl)=C1CNC1=CC=C(N2C(=CC(=N2)C=2C=NC=CC=2)C#N)C=C1 ZOGGQKGBANGTGS-UHFFFAOYSA-N 0.000 claims 1
- IXTRJAVUVRRCJD-UHFFFAOYSA-N 2-[4-[[4-(3-cyanopropoxy)phenyl]methylamino]phenyl]-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound C1=CC(OCCCC#N)=CC=C1CNC1=CC=C(N2C(=CC(=N2)C=2C=NC=CC=2)C#N)C=C1 IXTRJAVUVRRCJD-UHFFFAOYSA-N 0.000 claims 1
- UYXLWWLCBGJCJT-UHFFFAOYSA-N 2-[4-[[6-(3-cyanopropoxy)pyridin-3-yl]methylamino]phenyl]-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound C1=NC(OCCCC#N)=CC=C1CNC1=CC=C(N2C(=CC(=N2)C=2C=NC=CC=2)C#N)C=C1 UYXLWWLCBGJCJT-UHFFFAOYSA-N 0.000 claims 1
- OFLPRFPWBSBDCP-UHFFFAOYSA-N 2-[4-[[6-[3-(1,3-dioxolan-2-yl)propoxy]pyridin-3-yl]methylamino]phenyl]-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound N#CC1=CC(C=2C=NC=CC=2)=NN1C(C=C1)=CC=C1NCC(C=N1)=CC=C1OCCCC1OCCO1 OFLPRFPWBSBDCP-UHFFFAOYSA-N 0.000 claims 1
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 claims 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims 1
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 150000003857 carboxamides Chemical class 0.000 claims 1
- 239000012024 dehydrating agents Substances 0.000 claims 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- ZADSMLIXHMTDJK-UHFFFAOYSA-N ethyl 2,4-dioxo-4-pyridin-3-ylbutanoate Chemical compound CCOC(=O)C(=O)CC(=O)C1=CC=CN=C1 ZADSMLIXHMTDJK-UHFFFAOYSA-N 0.000 claims 1
- LBCFPECTPJNANE-UHFFFAOYSA-N ethyl 2-(4-nitrophenyl)-5-pyridin-3-ylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C=2C=NC=CC=2)=NN1C1=CC=C([N+]([O-])=O)C=C1 LBCFPECTPJNANE-UHFFFAOYSA-N 0.000 claims 1
- PHRDPBKZRMDSTI-UHFFFAOYSA-N ethyl 3-pyridin-3-yl-1h-pyrazole-5-carboxylate Chemical compound N1C(C(=O)OCC)=CC(C=2C=NC=CC=2)=N1 PHRDPBKZRMDSTI-UHFFFAOYSA-N 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- 125000004129 indan-1-yl group Chemical group [H]C1=C([H])C([H])=C2C(=C1[H])C([H])([H])C([H])([H])C2([H])* 0.000 claims 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 1
- KRXOZGYPZZPATG-UHFFFAOYSA-N n-(2,3-dihydro-1h-inden-2-ylmethyl)-4-(5-ethyl-3-pyridin-3-ylpyrazol-1-yl)aniline Chemical compound N=1N(C=2C=CC(NCC3CC4=CC=CC=C4C3)=CC=2)C(CC)=CC=1C1=CC=CN=C1 KRXOZGYPZZPATG-UHFFFAOYSA-N 0.000 claims 1
- UJGKTASTKBAIDG-UHFFFAOYSA-N n-[4-(5-cyano-3-pyridin-3-ylpyrazol-1-yl)phenyl]-4-[3-(1,3-dioxolan-2-yl)propoxy]benzamide Chemical compound C=1C=C(OCCCC2OCCO2)C=CC=1C(=O)NC(C=C1)=CC=C1N(C(=C1)C#N)N=C1C1=CC=CN=C1 UJGKTASTKBAIDG-UHFFFAOYSA-N 0.000 claims 1
- ROIPYAZETGHHCJ-UHFFFAOYSA-N n-[4-(5-ethyl-3-pyridin-3-ylpyrazol-1-yl)phenyl]-1-methylindole-2-carboxamide Chemical compound N=1N(C=2C=CC(NC(=O)C=3N(C4=CC=CC=C4C=3)C)=CC=2)C(CC)=CC=1C1=CC=CN=C1 ROIPYAZETGHHCJ-UHFFFAOYSA-N 0.000 claims 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims 1
- 230000004073 interleukin-2 production Effects 0.000 abstract description 12
- 210000001744 T-lymphocyte Anatomy 0.000 abstract description 9
- 125000003226 pyrazolyl group Chemical group 0.000 abstract description 5
- 125000003277 amino group Chemical group 0.000 abstract description 2
- 150000003217 pyrazoles Chemical class 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 134
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 114
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 93
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 86
- 239000000203 mixture Substances 0.000 description 81
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 74
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 65
- 239000000243 solution Substances 0.000 description 64
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 53
- 235000019439 ethyl acetate Nutrition 0.000 description 51
- 230000015572 biosynthetic process Effects 0.000 description 46
- 238000003786 synthesis reaction Methods 0.000 description 45
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 43
- 239000007787 solid Substances 0.000 description 39
- 239000011541 reaction mixture Substances 0.000 description 38
- 238000005481 NMR spectroscopy Methods 0.000 description 31
- 239000000741 silica gel Substances 0.000 description 31
- 229910002027 silica gel Inorganic materials 0.000 description 31
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 30
- 238000006243 chemical reaction Methods 0.000 description 29
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 28
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 25
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 20
- 238000004587 chromatography analysis Methods 0.000 description 20
- 239000012267 brine Substances 0.000 description 19
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 19
- 125000004432 carbon atom Chemical group C* 0.000 description 18
- 239000000047 product Substances 0.000 description 17
- 229960000583 acetic acid Drugs 0.000 description 16
- 125000005843 halogen group Chemical group 0.000 description 16
- 102000000588 Interleukin-2 Human genes 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- 210000004027 cell Anatomy 0.000 description 15
- 238000001914 filtration Methods 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 15
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 15
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 14
- 239000012074 organic phase Substances 0.000 description 14
- 239000003039 volatile agent Substances 0.000 description 14
- 241000699670 Mus sp. Species 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 101150041968 CDC13 gene Proteins 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- 150000003254 radicals Chemical class 0.000 description 12
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 11
- 229910052786 argon Inorganic materials 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 10
- 229910004373 HOAc Inorganic materials 0.000 description 9
- 201000007224 Myeloproliferative neoplasm Diseases 0.000 description 9
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 9
- 238000000746 purification Methods 0.000 description 9
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 8
- 239000005909 Kieselgur Substances 0.000 description 8
- 238000003556 assay Methods 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 230000001404 mediated effect Effects 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- TVTAXBFJIFVOAL-UHFFFAOYSA-N 2-(4-aminophenyl)-5-pyridin-3-ylpyrazole-3-carbonitrile Chemical compound C1=CC(N)=CC=C1N1C(C#N)=CC(C=2C=NC=CC=2)=N1 TVTAXBFJIFVOAL-UHFFFAOYSA-N 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 230000028993 immune response Effects 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 125000004353 pyrazol-1-yl group Chemical group [H]C1=NN(*)C([H])=C1[H] 0.000 description 7
- 125000000714 pyrimidinyl group Chemical group 0.000 description 7
- 125000000168 pyrrolyl group Chemical group 0.000 description 7
- 239000012265 solid product Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 6
- XOXBUERZFCPKDR-UHFFFAOYSA-N 4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]aniline Chemical compound C1=CC(N)=CC=C1N1C(C(F)(F)F)=CC(C(F)(F)F)=N1 XOXBUERZFCPKDR-UHFFFAOYSA-N 0.000 description 6
- KMVPXBDOWDXXEN-UHFFFAOYSA-N 4-nitrophenylhydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=C1 KMVPXBDOWDXXEN-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 6
- 208000035475 disorder Diseases 0.000 description 6
- 239000002552 dosage form Substances 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 6
- 230000004044 response Effects 0.000 description 6
- 239000002002 slurry Substances 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- NFHFRUOZVGFOOS-UHFFFAOYSA-N Pd(PPh3)4 Substances [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 208000026278 immune system disease Diseases 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- SZTUSBCUIPAIOU-UHFFFAOYSA-N 4-(5-ethyl-3-pyridin-3-ylpyrazol-1-yl)aniline Chemical compound CCC1=CC(C=2C=NC=CC=2)=NN1C1=CC=C(N)C=C1 SZTUSBCUIPAIOU-UHFFFAOYSA-N 0.000 description 4
- CQPGDDAKTTWVDD-UHFFFAOYSA-N 4-bromobutanenitrile Chemical compound BrCCCC#N CQPGDDAKTTWVDD-UHFFFAOYSA-N 0.000 description 4
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000001345 alkine derivatives Chemical class 0.000 description 4
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 4
- 230000003110 anti-inflammatory effect Effects 0.000 description 4
- 239000012300 argon atmosphere Substances 0.000 description 4
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 4
- 125000001246 bromo group Chemical group Br* 0.000 description 4
- 229910002091 carbon monoxide Inorganic materials 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 125000001072 heteroaryl group Chemical group 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 150000002828 nitro derivatives Chemical class 0.000 description 4
- 210000000056 organ Anatomy 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 125000003373 pyrazinyl group Chemical group 0.000 description 4
- 125000002098 pyridazinyl group Chemical group 0.000 description 4
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- KPTYDOSQASSERS-UHFFFAOYSA-N 2,3-dihydro-1h-indene-2-carbaldehyde Chemical compound C1=CC=C2CC(C=O)CC2=C1 KPTYDOSQASSERS-UHFFFAOYSA-N 0.000 description 3
- ZBPUNVFDQXYNDY-UHFFFAOYSA-N 2-(3-chloropropyl)-1,3-dioxolane Chemical compound ClCCCC1OCCO1 ZBPUNVFDQXYNDY-UHFFFAOYSA-N 0.000 description 3
- NOIXNOMHHWGUTG-UHFFFAOYSA-N 2-[[4-[4-pyridin-4-yl-1-(2,2,2-trifluoroethyl)pyrazol-3-yl]phenoxy]methyl]quinoline Chemical compound C=1C=C(OCC=2N=C3C=CC=CC3=CC=2)C=CC=1C1=NN(CC(F)(F)F)C=C1C1=CC=NC=C1 NOIXNOMHHWGUTG-UHFFFAOYSA-N 0.000 description 3
- OACPOWYLLGHGCR-UHFFFAOYSA-N 2-chloro-6-fluorobenzaldehyde Chemical compound FC1=CC=CC(Cl)=C1C=O OACPOWYLLGHGCR-UHFFFAOYSA-N 0.000 description 3
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 3
- YRHDAZUZHQCSCS-UHFFFAOYSA-N 4-nitro-5-phenyl-1h-pyrazole Chemical class C1=NNC(C=2C=CC=CC=2)=C1[N+](=O)[O-] YRHDAZUZHQCSCS-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 108060001084 Luciferase Proteins 0.000 description 3
- 239000005089 Luciferase Substances 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 3
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 3
- 244000309464 bull Species 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000005119 centrifugation Methods 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 125000002883 imidazolyl group Chemical group 0.000 description 3
- 230000036039 immunity Effects 0.000 description 3
- 239000003018 immunosuppressive agent Substances 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- PGHMRUGBZOYCAA-ADZNBVRBSA-N ionomycin Chemical compound O1[C@H](C[C@H](O)[C@H](C)[C@H](O)[C@H](C)/C=C/C[C@@H](C)C[C@@H](C)C(/O)=C/C(=O)[C@@H](C)C[C@@H](C)C[C@@H](CCC(O)=O)C)CC[C@@]1(C)[C@@H]1O[C@](C)([C@@H](C)O)CC1 PGHMRUGBZOYCAA-ADZNBVRBSA-N 0.000 description 3
- PGHMRUGBZOYCAA-UHFFFAOYSA-N ionomycin Natural products O1C(CC(O)C(C)C(O)C(C)C=CCC(C)CC(C)C(O)=CC(=O)C(C)CC(C)CC(CCC(O)=O)C)CCC1(C)C1OC(C)(C(C)O)CC1 PGHMRUGBZOYCAA-UHFFFAOYSA-N 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 210000001165 lymph node Anatomy 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 3
- 239000011593 sulfur Chemical group 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- WITJPWVRBHYRBR-UHFFFAOYSA-N 1-(4-isocyanatophenyl)-3,5-bis(trifluoromethyl)pyrazole Chemical compound N1=C(C(F)(F)F)C=C(C(F)(F)F)N1C1=CC=C(N=C=O)C=C1 WITJPWVRBHYRBR-UHFFFAOYSA-N 0.000 description 2
- QOJQBWSZHCKOLL-UHFFFAOYSA-N 2,6-dimethylbenzaldehyde Chemical compound CC1=CC=CC(C)=C1C=O QOJQBWSZHCKOLL-UHFFFAOYSA-N 0.000 description 2
- QSACPWSIIRFHHR-UHFFFAOYSA-N 2,6-dimethylbenzonitrile Chemical compound CC1=CC=CC(C)=C1C#N QSACPWSIIRFHHR-UHFFFAOYSA-N 0.000 description 2
- ZPCMLRNJGYFKQJ-UHFFFAOYSA-N 2-(4-aminophenyl)-n,n-dimethyl-5-(trifluoromethyl)pyrazol-3-amine Chemical compound CN(C)C1=CC(C(F)(F)F)=NN1C1=CC=C(N)C=C1 ZPCMLRNJGYFKQJ-UHFFFAOYSA-N 0.000 description 2
- ZWRMUTFJPRNFSB-UHFFFAOYSA-N 2-(4-nitrophenyl)-5-(trifluoromethyl)-4h-pyrazol-3-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1C(=O)CC(C(F)(F)F)=N1 ZWRMUTFJPRNFSB-UHFFFAOYSA-N 0.000 description 2
- CCYFXIJPJFSTSU-UHFFFAOYSA-N 2-chloro-6-methylbenzaldehyde Chemical compound CC1=CC=CC(Cl)=C1C=O CCYFXIJPJFSTSU-UHFFFAOYSA-N 0.000 description 2
- WQWQHJNUHQEGTN-UHFFFAOYSA-N 2-chloro-6-methylbenzonitrile Chemical compound CC1=CC=CC(Cl)=C1C#N WQWQHJNUHQEGTN-UHFFFAOYSA-N 0.000 description 2
- NWPNXBQSRGKSJB-UHFFFAOYSA-N 2-methylbenzonitrile Chemical compound CC1=CC=CC=C1C#N NWPNXBQSRGKSJB-UHFFFAOYSA-N 0.000 description 2
- XTJWRRBQYYIQSD-UHFFFAOYSA-N 3-(5-ethyl-1h-pyrazol-3-yl)pyridine Chemical compound N1C(CC)=CC(C=2C=NC=CC=2)=N1 XTJWRRBQYYIQSD-UHFFFAOYSA-N 0.000 description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- IWSHUAKEYWOPMA-UHFFFAOYSA-N 4-(3-cyanopropoxy)benzoic acid Chemical compound OC(=O)C1=CC=C(OCCCC#N)C=C1 IWSHUAKEYWOPMA-UHFFFAOYSA-N 0.000 description 2
- LSWGJXMKXJHUEF-UHFFFAOYSA-N 4-[3-tert-butyl-5-(trifluoromethyl)pyrazol-1-yl]aniline Chemical compound N1=C(C(C)(C)C)C=C(C(F)(F)F)N1C1=CC=C(N)C=C1 LSWGJXMKXJHUEF-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 2
- YLYPTGYHGCWJGN-UHFFFAOYSA-N 5-phenyl-1h-pyrazol-4-amine Chemical class C1=NNC(C=2C=CC=CC=2)=C1N YLYPTGYHGCWJGN-UHFFFAOYSA-N 0.000 description 2
- WVQSWOBETMRYCD-UHFFFAOYSA-N 5-tert-butyl-2-(4-nitrophenyl)pyrazol-3-amine Chemical compound N1=C(C(C)(C)C)C=C(N)N1C1=CC=C([N+]([O-])=O)C=C1 WVQSWOBETMRYCD-UHFFFAOYSA-N 0.000 description 2
- CGMCBEIBFJNDAI-UHFFFAOYSA-N 6-(3-cyanopropoxy)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=C(OCCCC#N)N=C1 CGMCBEIBFJNDAI-UHFFFAOYSA-N 0.000 description 2
- 206010003497 Asphyxia Diseases 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 206010048396 Bone marrow transplant rejection Diseases 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 206010052779 Transplant rejections Diseases 0.000 description 2
- SZPWXAOBLNYOHY-UHFFFAOYSA-N [C]1=CC=NC2=CC=CC=C12 Chemical group [C]1=CC=NC2=CC=CC=C12 SZPWXAOBLNYOHY-UHFFFAOYSA-N 0.000 description 2
- ZBIKORITPGTTGI-UHFFFAOYSA-N [acetyloxy(phenyl)-$l^{3}-iodanyl] acetate Chemical compound CC(=O)OI(OC(C)=O)C1=CC=CC=C1 ZBIKORITPGTTGI-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 230000000735 allogeneic effect Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 239000006285 cell suspension Substances 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- OCJKUQIPRNZDTK-UHFFFAOYSA-N ethyl 4,4,4-trifluoro-3-oxobutanoate Chemical compound CCOC(=O)CC(=O)C(F)(F)F OCJKUQIPRNZDTK-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 208000024908 graft versus host disease Diseases 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 230000001506 immunosuppresive effect Effects 0.000 description 2
- 229940125721 immunosuppressive agent Drugs 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- 210000001872 metatarsal bone Anatomy 0.000 description 2
- LZYJBGBIUKDAEE-UHFFFAOYSA-N methyl 6-(3-cyanopropoxy)pyridine-3-carboxylate Chemical compound COC(=O)C1=CC=C(OCCCC#N)N=C1 LZYJBGBIUKDAEE-UHFFFAOYSA-N 0.000 description 2
- JTVVPKLHKMKWNN-UHFFFAOYSA-N methyl 6-oxo-1h-pyridine-3-carboxylate Chemical compound COC(=O)C=1C=CC(=O)NC=1 JTVVPKLHKMKWNN-UHFFFAOYSA-N 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- XMWFMEYDRNJSOO-UHFFFAOYSA-N morpholine-4-carbonyl chloride Chemical compound ClC(=O)N1CCOCC1 XMWFMEYDRNJSOO-UHFFFAOYSA-N 0.000 description 2
- QMTFERJBABKASC-UHFFFAOYSA-N n,n-dimethyl-5-(trifluoromethyl)-1h-pyrazol-3-amine Chemical compound CN(C)C1=CC(C(F)(F)F)=NN1 QMTFERJBABKASC-UHFFFAOYSA-N 0.000 description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 235000005152 nicotinamide Nutrition 0.000 description 2
- 239000011570 nicotinamide Substances 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- UQPUONNXJVWHRM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UQPUONNXJVWHRM-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000011514 reflex Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- WRIKHQLVHPKCJU-UHFFFAOYSA-N sodium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([Na])[Si](C)(C)C WRIKHQLVHPKCJU-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000009901 transfer hydrogenation reaction Methods 0.000 description 2
- 238000003828 vacuum filtration Methods 0.000 description 2
- LSPHULWDVZXLIL-UHFFFAOYSA-N (+/-)-Camphoric acid Chemical compound CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- XJEVHMGJSYVQBQ-SECBINFHSA-N (1r)-2,3-dihydro-1h-inden-1-amine Chemical compound C1=CC=C2[C@H](N)CCC2=C1 XJEVHMGJSYVQBQ-SECBINFHSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 1
- CTCVHBQKCDDASK-UHFFFAOYSA-N 1-[4-(ethylamino)phenyl]-5-(4-methylsulfonylphenyl)pyrazole-3-carbonitrile Chemical compound C1=CC(NCC)=CC=C1N1C(C=2C=CC(=CC=2)S(C)(=O)=O)=CC(C#N)=N1 CTCVHBQKCDDASK-UHFFFAOYSA-N 0.000 description 1
- VWJDPHUFKPDZRR-UHFFFAOYSA-N 1-[4-(methylamino)phenyl]-5-(4-methylsulfonylphenyl)pyrazole-3-carbonitrile Chemical compound C1=CC(NC)=CC=C1N1C(C=2C=CC(=CC=2)S(C)(=O)=O)=CC(C#N)=N1 VWJDPHUFKPDZRR-UHFFFAOYSA-N 0.000 description 1
- NHIWBMIJRGSENZ-UHFFFAOYSA-N 1-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3-propylurea Chemical compound C1=CC(NC(=O)NCCC)=CC=C1N1C(C(F)(F)F)=CC(C(F)(F)F)=N1 NHIWBMIJRGSENZ-UHFFFAOYSA-N 0.000 description 1
- PZDBQRPBQAPVNX-UHFFFAOYSA-N 1-[5-ethyl-1-(4-nitrophenyl)pyrazol-3-yl]ethanone Chemical compound CCC1=CC(C(C)=O)=NN1C1=CC=C([N+]([O-])=O)C=C1 PZDBQRPBQAPVNX-UHFFFAOYSA-N 0.000 description 1
- AITNMTXHTIIIBB-UHFFFAOYSA-N 1-bromo-4-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1 AITNMTXHTIIIBB-UHFFFAOYSA-N 0.000 description 1
- MAHAMBLNIDMREX-UHFFFAOYSA-N 1-methylindole-2-carboxylic acid Chemical compound C1=CC=C2N(C)C(C(O)=O)=CC2=C1 MAHAMBLNIDMREX-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- NFKAWBGFIMBUMB-UHFFFAOYSA-N 1-phenylpentan-2-one Chemical compound CCCC(=O)CC1=CC=CC=C1 NFKAWBGFIMBUMB-UHFFFAOYSA-N 0.000 description 1
- 150000002397 1-phenylpyrazoles Chemical class 0.000 description 1
- UEMKAOFOZJXHIS-UHFFFAOYSA-N 1-pyridin-3-ylpent-1-yn-3-one Chemical compound CCC(=O)C#CC1=CC=CN=C1 UEMKAOFOZJXHIS-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical class NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- XUDCMQBOWOLYCF-UHFFFAOYSA-N 2,3-dihydro-1h-indene-2-carboxylic acid Chemical compound C1=CC=C2CC(C(=O)O)CC2=C1 XUDCMQBOWOLYCF-UHFFFAOYSA-N 0.000 description 1
- CEGGECULKVTYMM-UHFFFAOYSA-N 2,6-dimethylheptane-3,5-dione Chemical compound CC(C)C(=O)CC(=O)C(C)C CEGGECULKVTYMM-UHFFFAOYSA-N 0.000 description 1
- SURCGQGDUADKBL-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-5-nitrobenzo[de]isoquinoline-1,3-dione Chemical class [O-][N+](=O)C1=CC(C(N(NCCO)C2=O)=O)=C3C2=CC=CC3=C1 SURCGQGDUADKBL-UHFFFAOYSA-N 0.000 description 1
- KHSGWFHWPGEDOT-UHFFFAOYSA-N 2-(4-aminophenyl)-5-tert-butyl-n,n-dimethylpyrazol-3-amine Chemical compound CN(C)C1=CC(C(C)(C)C)=NN1C1=CC=C(N)C=C1 KHSGWFHWPGEDOT-UHFFFAOYSA-N 0.000 description 1
- UEYQJQVBUVAELZ-UHFFFAOYSA-N 2-Hydroxynicotinic acid Chemical compound OC(=O)C1=CC=CN=C1O UEYQJQVBUVAELZ-UHFFFAOYSA-N 0.000 description 1
- QUBBFJIZJXNBEU-UHFFFAOYSA-N 2-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]anilino]pyridine-4-carbonitrile Chemical compound N1=C(C(F)(F)F)C=C(C(F)(F)F)N1C(C=C1)=CC=C1NC1=CC(C#N)=CC=N1 QUBBFJIZJXNBEU-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- QRXBTPFMCTXCRD-UHFFFAOYSA-N 2-chloropyridine-4-carbonitrile Chemical compound ClC1=CC(C#N)=CC=N1 QRXBTPFMCTXCRD-UHFFFAOYSA-N 0.000 description 1
- UCSKOUQDVWADGZ-UHFFFAOYSA-N 2-fluoro-6-methylbenzonitrile Chemical compound CC1=CC=CC(F)=C1C#N UCSKOUQDVWADGZ-UHFFFAOYSA-N 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- GWGSFUDLOBNEDT-UHFFFAOYSA-N 3-(3-methylsulfanyl-1h-pyrazol-5-yl)pyridine Chemical compound N1C(SC)=CC(C=2C=NC=CC=2)=N1 GWGSFUDLOBNEDT-UHFFFAOYSA-N 0.000 description 1
- YAYVDFVZHXEZRF-UHFFFAOYSA-N 3-[1-(4-bromophenyl)-5-ethylpyrazol-3-yl]pyridine Chemical compound CCC1=CC(C=2C=NC=CC=2)=NN1C1=CC=C(Br)C=C1 YAYVDFVZHXEZRF-UHFFFAOYSA-N 0.000 description 1
- UMLYYMQLKUFWIO-UHFFFAOYSA-N 3-[5-ethyl-1-(4-nitrophenyl)pyrazol-3-yl]pyridine Chemical compound CCC1=CC(C=2C=NC=CC=2)=NN1C1=CC=C([N+]([O-])=O)C=C1 UMLYYMQLKUFWIO-UHFFFAOYSA-N 0.000 description 1
- SOKYKEOHGUIFRO-UHFFFAOYSA-N 3-[5-methylsulfanyl-1-(4-nitrophenyl)pyrazol-3-yl]pyridine Chemical compound CSC1=CC(C=2C=NC=CC=2)=NN1C1=CC=C([N+]([O-])=O)C=C1 SOKYKEOHGUIFRO-UHFFFAOYSA-N 0.000 description 1
- NYPYPOZNGOXYSU-UHFFFAOYSA-N 3-bromopyridine Chemical compound BrC1=CC=CN=C1 NYPYPOZNGOXYSU-UHFFFAOYSA-N 0.000 description 1
- INWUFXPCLZRSBH-UHFFFAOYSA-N 3-chloro-1,2-benzoxazole Chemical compound C1=CC=C2C(Cl)=NOC2=C1 INWUFXPCLZRSBH-UHFFFAOYSA-N 0.000 description 1
- ZRPLANDPDWYOMZ-UHFFFAOYSA-N 3-cyclopentylpropionic acid Chemical compound OC(=O)CCC1CCCC1 ZRPLANDPDWYOMZ-UHFFFAOYSA-N 0.000 description 1
- UVXBXCORKOSKSH-UHFFFAOYSA-N 3-ethyl-5-(oxan-2-yloxymethyl)-1h-pyrazole Chemical compound N1C(CC)=CC(COC2OCCCC2)=N1 UVXBXCORKOSKSH-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- NNSURSMOVRLOEN-UHFFFAOYSA-N 4-(3,5-dimethylpyrazol-1-yl)-n-[(4-methoxyphenyl)methyl]aniline Chemical compound C1=CC(OC)=CC=C1CNC1=CC=C(N2C(=CC(C)=N2)C)C=C1 NNSURSMOVRLOEN-UHFFFAOYSA-N 0.000 description 1
- HPTBHYRQTGKYDA-UHFFFAOYSA-N 4-(3,5-dimethylpyrazol-1-yl)-n-[(4-nitrophenyl)methyl]aniline Chemical compound N1=C(C)C=C(C)N1C(C=C1)=CC=C1NCC1=CC=C([N+]([O-])=O)C=C1 HPTBHYRQTGKYDA-UHFFFAOYSA-N 0.000 description 1
- JHDAQYMKAWGVRY-UHFFFAOYSA-N 4-(3,5-dimethylpyrazol-1-yl)-n-methylbenzamide Chemical compound C1=CC(C(=O)NC)=CC=C1N1C(C)=CC(C)=N1 JHDAQYMKAWGVRY-UHFFFAOYSA-N 0.000 description 1
- DSNHEBBJKUPQSL-UHFFFAOYSA-N 4-(4-formylphenoxy)-2-methylbutanenitrile Chemical compound N#CC(C)CCOC1=CC=C(C=O)C=C1 DSNHEBBJKUPQSL-UHFFFAOYSA-N 0.000 description 1
- WZAXRPNMHBEQRQ-UHFFFAOYSA-N 4-(4-formylphenoxy)butanenitrile Chemical compound O=CC1=CC=C(OCCCC#N)C=C1 WZAXRPNMHBEQRQ-UHFFFAOYSA-N 0.000 description 1
- JHHQBUUQIVWRBM-UHFFFAOYSA-N 4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]-n-(1-phenylethyl)aniline Chemical compound C=1C=CC=CC=1C(C)NC(C=C1)=CC=C1N1N=C(C(F)(F)F)C=C1C(F)(F)F JHHQBUUQIVWRBM-UHFFFAOYSA-N 0.000 description 1
- XMEJOZQITKBXBC-UHFFFAOYSA-N 4-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-n-methylaniline Chemical compound C1=CC(NC)=CC=C1N1C(C=2C=CC(=CC=2)S(C)(=O)=O)=CC(C(F)F)=N1 XMEJOZQITKBXBC-UHFFFAOYSA-N 0.000 description 1
- RROQKYJSGZRYBP-UHFFFAOYSA-N 4-[5-chloro-3-(trifluoromethyl)pyrazol-1-yl]aniline Chemical compound C1=CC(N)=CC=C1N1C(Cl)=CC(C(F)(F)F)=N1 RROQKYJSGZRYBP-UHFFFAOYSA-N 0.000 description 1
- ZJFUSLGMGSYTRY-UHFFFAOYSA-N 4-bromo-5-phenyl-1h-pyrazole Chemical compound C1=NNC(C=2C=CC=CC=2)=C1Br ZJFUSLGMGSYTRY-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- BZXPLADBSZWDIH-FZSMXKCYSA-N 4-methylbenzenesulfonic acid;(3r)-oxolan-3-amine Chemical compound N[C@@H]1CCOC1.CC1=CC=C(S(O)(=O)=O)C=C1 BZXPLADBSZWDIH-FZSMXKCYSA-N 0.000 description 1
- 125000004487 4-tetrahydropyranyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- MCQFYSVKFNTDKV-UHFFFAOYSA-N 5,5-dimethyl-3-oxohexanenitrile Chemical compound CC(C)(C)CC(=O)CC#N MCQFYSVKFNTDKV-UHFFFAOYSA-N 0.000 description 1
- QLOITWHQEGTZGZ-UHFFFAOYSA-N 5-(4-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)pyrazole Chemical compound C1=CC(OC)=CC=C1C1=CC(C)=NN1C1=CC=C([N+]([O-])=O)C=C1 QLOITWHQEGTZGZ-UHFFFAOYSA-N 0.000 description 1
- FSBRKZMSECKELY-UHFFFAOYSA-N 5-aminonaphthalen-2-ol Chemical compound OC1=CC=C2C(N)=CC=CC2=C1 FSBRKZMSECKELY-UHFFFAOYSA-N 0.000 description 1
- MBXMGFQSKCYQQZ-UHFFFAOYSA-N 5-bromo-3-methyl-1-(4-nitrophenyl)pyrazole Chemical compound N1=C(C)C=C(Br)N1C1=CC=C([N+]([O-])=O)C=C1 MBXMGFQSKCYQQZ-UHFFFAOYSA-N 0.000 description 1
- UDNADZHHGZSQSV-UHFFFAOYSA-N 5-chloro-1-(4-nitrophenyl)-3-(trifluoromethyl)pyrazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1C(Cl)=CC(C(F)(F)F)=N1 UDNADZHHGZSQSV-UHFFFAOYSA-N 0.000 description 1
- LWALYRNMYZJWFN-UHFFFAOYSA-N 5-ethenyl-3-methyl-1-(4-nitrophenyl)pyrazole Chemical compound N1=C(C)C=C(C=C)N1C1=CC=C([N+]([O-])=O)C=C1 LWALYRNMYZJWFN-UHFFFAOYSA-N 0.000 description 1
- IENAMGDFEYXOSY-UHFFFAOYSA-N 5-ethyl-3-phenyl-1h-pyrazole Chemical compound N1C(CC)=CC(C=2C=CC=CC=2)=N1 IENAMGDFEYXOSY-UHFFFAOYSA-N 0.000 description 1
- CVEDCNVEFNTPDU-UHFFFAOYSA-N 5-iodonaphthalen-2-ol Chemical compound IC1=CC=CC2=CC(O)=CC=C21 CVEDCNVEFNTPDU-UHFFFAOYSA-N 0.000 description 1
- IEMRMWPZIPGEMV-UHFFFAOYSA-N 6-(3-cyanopropoxy)-n-[4-(5-cyano-3-pyridin-3-ylpyrazol-1-yl)phenyl]pyridine-3-carboxamide Chemical compound C=1C=C(OCCCC#N)N=CC=1C(=O)NC(C=C1)=CC=C1N(C(=C1)C#N)N=C1C1=CC=CN=C1 IEMRMWPZIPGEMV-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 102000004506 Blood Proteins Human genes 0.000 description 1
- 108010017384 Blood Proteins Proteins 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 206010009900 Colitis ulcerative Diseases 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 208000011231 Crohn disease Diseases 0.000 description 1
- 229930105110 Cyclosporin A Natural products 0.000 description 1
- PMATZTZNYRCHOR-CGLBZJNRSA-N Cyclosporin A Chemical compound CC[C@@H]1NC(=O)[C@H]([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C1=O PMATZTZNYRCHOR-CGLBZJNRSA-N 0.000 description 1
- 108010036949 Cyclosporine Proteins 0.000 description 1
- 102000004127 Cytokines Human genes 0.000 description 1
- 108090000695 Cytokines Proteins 0.000 description 1
- 206010012442 Dermatitis contact Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 238000008157 ELISA kit Methods 0.000 description 1
- 229920001917 Ficoll Polymers 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 208000009329 Graft vs Host Disease Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 206010062016 Immunosuppression Diseases 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- DYDCUQKUCUHJBH-REOHCLBHSA-N L-Cycloserine Chemical compound N[C@H]1CONC1=O DYDCUQKUCUHJBH-REOHCLBHSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 229910017974 NH40H Inorganic materials 0.000 description 1
- 229930193140 Neomycin Natural products 0.000 description 1
- 108700026244 Open Reading Frames Proteins 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 102100038280 Prostaglandin G/H synthase 2 Human genes 0.000 description 1
- 108050003267 Prostaglandin G/H synthase 2 Proteins 0.000 description 1
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 1
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 108700008625 Reporter Genes Proteins 0.000 description 1
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 1
- 238000000692 Student's t-test Methods 0.000 description 1
- 230000024932 T cell mediated immunity Effects 0.000 description 1
- 230000006052 T cell proliferation Effects 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 108700009124 Transcription Initiation Site Proteins 0.000 description 1
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 1
- 201000006704 Ulcerative Colitis Diseases 0.000 description 1
- DXNQJQHAAPYODO-UHFFFAOYSA-N [5-ethyl-1-(4-nitrophenyl)pyrazol-3-yl]methanol Chemical compound CCC1=CC(CO)=NN1C1=CC=C([N+]([O-])=O)C=C1 DXNQJQHAAPYODO-UHFFFAOYSA-N 0.000 description 1
- RAFKCLFWELPONH-UHFFFAOYSA-N acetonitrile;dichloromethane Chemical compound CC#N.ClCCl RAFKCLFWELPONH-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 208000038016 acute inflammation Diseases 0.000 description 1
- 230000006022 acute inflammation Effects 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000003305 autocrine Effects 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 229960000074 biopharmaceutical Drugs 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000007894 caplet Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 208000037976 chronic inflammation Diseases 0.000 description 1
- 230000006020 chronic inflammation Effects 0.000 description 1
- 229960001265 ciclosporin Drugs 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 208000010247 contact dermatitis Diseases 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- PMHQVHHXPFUNSP-UHFFFAOYSA-M copper(1+);methylsulfanylmethane;bromide Chemical compound Br[Cu].CSC PMHQVHHXPFUNSP-UHFFFAOYSA-M 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000006880 cross-coupling reaction Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000004145 cyclopenten-1-yl group Chemical group [H]C1=C(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- VSYVGQPPDYJSSX-UHFFFAOYSA-N diethyl oxalate;hydrazine;hydrate Chemical compound O.NN.CCOC(=O)C(=O)OCC VSYVGQPPDYJSSX-UHFFFAOYSA-N 0.000 description 1
- 125000005046 dihydronaphthyl group Chemical group 0.000 description 1
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- 238000004520 electroporation Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- BADWIIDKTXQYLW-UHFFFAOYSA-N ethenylstannane Chemical class [SnH3]C=C BADWIIDKTXQYLW-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- JUHMHPOXZAYYJP-UHFFFAOYSA-N ethyl 5-amino-1-(4-methylphenyl)sulfonylpyrazole-4-carboxylate Chemical class NC1=C(C(=O)OCC)C=NN1S(=O)(=O)C1=CC=C(C)C=C1 JUHMHPOXZAYYJP-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- KZGWPHUWNWRTEP-UHFFFAOYSA-N ethynyl-tri(propan-2-yl)silane Chemical group CC(C)[Si](C#C)(C(C)C)C(C)C KZGWPHUWNWRTEP-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000003862 glucocorticoid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- UONLQSKINPCMDF-UHFFFAOYSA-N hepta-1,6-diyn-4-one Chemical compound C#CCC(=O)CC#C UONLQSKINPCMDF-UHFFFAOYSA-N 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- XJYNBZQTAZDMHZ-UHFFFAOYSA-N imidacrine Chemical compound O.Cl.Cl.O=C1C2=CC(O)=CC=C2N2C=NC3=CC=C(NCCN(CC)CC)C1=C32 XJYNBZQTAZDMHZ-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 230000002519 immonomodulatory effect Effects 0.000 description 1
- 230000036737 immune function Effects 0.000 description 1
- 229960003444 immunosuppressant agent Drugs 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 238000003670 luciferase enzyme activity assay Methods 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 206010025135 lupus erythematosus Diseases 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 239000012139 lysis buffer Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- MIKKOBKEXMRYFQ-WZTVWXICSA-N meglumine amidotrizoate Chemical compound C[NH2+]C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CC(=O)NC1=C(I)C(NC(C)=O)=C(I)C(C([O-])=O)=C1I MIKKOBKEXMRYFQ-WZTVWXICSA-N 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 210000005087 mononuclear cell Anatomy 0.000 description 1
- STUHQDIOZQUPGP-UHFFFAOYSA-N morpholin-4-ium-4-carboxylate Chemical compound OC(=O)N1CCOCC1 STUHQDIOZQUPGP-UHFFFAOYSA-N 0.000 description 1
- 125000001064 morpholinomethyl group Chemical group [H]C([H])(*)N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 201000006417 multiple sclerosis Diseases 0.000 description 1
- LLKOZMHYQAXSJG-UHFFFAOYSA-N n,n-dimethyl-1-(1h-pyrazol-5-yl)methanamine Chemical compound CN(C)CC=1C=CNN=1 LLKOZMHYQAXSJG-UHFFFAOYSA-N 0.000 description 1
- ILBIXZPOMJFOJP-UHFFFAOYSA-N n,n-dimethylprop-2-yn-1-amine Chemical compound CN(C)CC#C ILBIXZPOMJFOJP-UHFFFAOYSA-N 0.000 description 1
- IGCOGQZYAPWSGX-UHFFFAOYSA-N n-(4-hydrazinylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(NN)C=C1 IGCOGQZYAPWSGX-UHFFFAOYSA-N 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- FKLZILLEUUBDAU-UHFFFAOYSA-N n-[4-(3-methyl-5-phenylpyrazol-1-yl)phenyl]benzamide Chemical compound C=1C=C(NC(=O)C=2C=CC=CC=2)C=CC=1N1N=C(C)C=C1C1=CC=CC=C1 FKLZILLEUUBDAU-UHFFFAOYSA-N 0.000 description 1
- LAHVQXKWWOOVLX-UHFFFAOYSA-N n-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide Chemical compound CC1=NOC(C)=C1C(=O)NC1=CC=C(N2C(=CC(=N2)C(F)(F)F)C(F)(F)F)C=C1 LAHVQXKWWOOVLX-UHFFFAOYSA-N 0.000 description 1
- YXIFDERYVOQAKL-UHFFFAOYSA-N n-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-4-chlorobenzamide Chemical compound N1=C(C(F)(F)F)C=C(C(F)(F)F)N1C(C=C1)=CC=C1NC(=O)C1=CC=C(Cl)C=C1 YXIFDERYVOQAKL-UHFFFAOYSA-N 0.000 description 1
- XPRZIORDEVHURQ-UHFFFAOYSA-N n-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-4-methylthiadiazole-5-carboxamide Chemical compound N1=NSC(C(=O)NC=2C=CC(=CC=2)N2C(=CC(=N2)C(F)(F)F)C(F)(F)F)=C1C XPRZIORDEVHURQ-UHFFFAOYSA-N 0.000 description 1
- MFPXFWCKQDWXMQ-UHFFFAOYSA-N n-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]cyclohexanecarboxamide Chemical compound N1=C(C(F)(F)F)C=C(C(F)(F)F)N1C(C=C1)=CC=C1NC(=O)C1CCCCC1 MFPXFWCKQDWXMQ-UHFFFAOYSA-N 0.000 description 1
- LGROKZMEHJZWDU-UHFFFAOYSA-N n-amino-n-phenylnitramide Chemical compound [O-][N+](=O)N(N)C1=CC=CC=C1 LGROKZMEHJZWDU-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WOSYVNFSMPUBJB-UHFFFAOYSA-N n-methoxy-n-methyl-2,3-dihydro-1h-indene-2-carboxamide Chemical compound C1=CC=C2CC(C(=O)N(C)OC)CC2=C1 WOSYVNFSMPUBJB-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 1
- 229960004927 neomycin Drugs 0.000 description 1
- 229960003966 nicotinamide Drugs 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N o-phenylene-diaceto-nitrile Natural products N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- UXPOJVLZTPGWFX-UHFFFAOYSA-N pentafluoroethyl iodide Chemical compound FC(F)(F)C(F)(F)I UXPOJVLZTPGWFX-UHFFFAOYSA-N 0.000 description 1
- 210000005259 peripheral blood Anatomy 0.000 description 1
- 239000011886 peripheral blood Substances 0.000 description 1
- 210000005105 peripheral blood lymphocyte Anatomy 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229940038531 phenylhydrazine hydrochloride Drugs 0.000 description 1
- JOVOSQBPPZZESK-UHFFFAOYSA-N phenylhydrazine hydrochloride Chemical compound Cl.NNC1=CC=CC=C1 JOVOSQBPPZZESK-UHFFFAOYSA-N 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 230000029279 positive regulation of transcription, DNA-dependent Effects 0.000 description 1
- 231100000683 possible toxicity Toxicity 0.000 description 1
- DAPIMSMZSXHIOD-UHFFFAOYSA-N potassium;2-methylpropan-2-olate;methylsulfinylmethane Chemical compound [K+].CS(C)=O.CC(C)(C)[O-] DAPIMSMZSXHIOD-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000004497 pyrazol-5-yl group Chemical group N1N=CC=C1* 0.000 description 1
- BGUWFUQJCDRPTL-UHFFFAOYSA-N pyridine-4-carbaldehyde Chemical compound O=CC1=CC=NC=C1 BGUWFUQJCDRPTL-UHFFFAOYSA-N 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 230000019908 regulation of T cell activation Effects 0.000 description 1
- 230000035456 regulation of T cell proliferation Effects 0.000 description 1
- 238000003757 reverse transcription PCR Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940037128 systemic glucocorticoids Drugs 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 1
- 125000006090 thiamorpholinyl sulfone group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- QIWRFOJWQSSRJZ-UHFFFAOYSA-N tributyl(ethenyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C=C QIWRFOJWQSSRJZ-UHFFFAOYSA-N 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US8815498P | 1998-06-05 | 1998-06-05 | |
| US60/088,154 | 1998-06-05 | ||
| PCT/US1999/012295 WO1999062885A1 (en) | 1998-06-05 | 1999-06-03 | Substituted 1-(4-aminophenyl)pyrazoles and their use as anti-inflammatory agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2332957A1 true CA2332957A1 (en) | 1999-12-09 |
Family
ID=22209668
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002332957A Abandoned CA2332957A1 (en) | 1998-06-05 | 1999-06-03 | Substituted 1-(4-aminophenyl)pyrazoles and their use as anti-inflammatory agents |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US6506747B1 (enExample) |
| JP (1) | JP2002516909A (enExample) |
| AU (1) | AU4229999A (enExample) |
| CA (1) | CA2332957A1 (enExample) |
| WO (1) | WO1999062885A1 (enExample) |
Families Citing this family (88)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU751139B2 (en) | 1997-10-13 | 2002-08-08 | Astellas Pharma Inc. | Amide derivative |
| AU1317000A (en) * | 1998-10-20 | 2000-05-08 | Boehringer Ingelheim Pharmaceuticals, Inc. | Method of treating immunological disorders mediated by t-lymphocytes |
| EP1466906A1 (en) * | 1999-03-12 | 2004-10-13 | Boehringer Ingelheim Pharmaceuticals Inc. | Heterocyclic urea and related compounds useful as anti-inflammatory agents |
| HUP0202248A3 (en) * | 1999-03-12 | 2006-06-28 | Boehringer Ingelheim Pharma | Compounds useful as anti-inflammatory agents |
| AU2004200240B2 (en) * | 1999-03-12 | 2007-04-26 | Boehringer Ingelheim Pharmaceuticals Inc. | Compounds useful as anti-inflammatory agents |
| EP1690854A1 (en) * | 1999-03-12 | 2006-08-16 | Boehringer Ingelheim Pharmaceuticals, Inc. | Heterocyclic urea and related compounds useful as anti-inflammatory agents |
| GB0001930D0 (en) * | 2000-01-27 | 2000-03-22 | Novartis Ag | Organic compounds |
| US6451820B1 (en) | 2000-03-23 | 2002-09-17 | Boehringer Ingelheim Pharmaceuticals, Inc. | Substituted 1-(4-aminophenly)triazoles and their use as anti-inflammatory agents |
| WO2001072714A2 (en) * | 2000-03-24 | 2001-10-04 | Euro-Celtique S.A. | Aryl substituted pyrazoles, triazoles and tetrazoles as sodium channel blocker |
| AU2006225221B2 (en) * | 2000-03-24 | 2008-11-20 | Euro-Celtique S.A. | Aryl substituted pyrazoles, triazoles and tetrazoles, and the use thereof |
| WO2002053544A1 (en) * | 2000-12-29 | 2002-07-11 | Darwin Discovery Ltd. | Pharmaceutical uses and synthesis of nicotinanilide-n-oxides |
| US20030134836A1 (en) | 2001-01-12 | 2003-07-17 | Amgen Inc. | Substituted arylamine derivatives and methods of use |
| US7102009B2 (en) | 2001-01-12 | 2006-09-05 | Amgen Inc. | Substituted amine derivatives and methods of use |
| US6995162B2 (en) * | 2001-01-12 | 2006-02-07 | Amgen Inc. | Substituted alkylamine derivatives and methods of use |
| US6878714B2 (en) * | 2001-01-12 | 2005-04-12 | Amgen Inc. | Substituted alkylamine derivatives and methods of use |
| US7105682B2 (en) * | 2001-01-12 | 2006-09-12 | Amgen Inc. | Substituted amine derivatives and methods of use |
| US6864255B2 (en) | 2001-04-11 | 2005-03-08 | Amgen Inc. | Substituted triazinyl amide derivatives and methods of use |
| MXPA03011681A (es) * | 2001-06-29 | 2004-03-19 | Boehringer Ingelheim Pharma | Uso de inhibidores de epoxido hidrolasa soluble, para tratar enfermedades relacionadas con la enfermedad cardiovascular. |
| US6825184B2 (en) | 2001-10-18 | 2004-11-30 | Boehringer Ingelheim Pharmaceuticals, Inc. | 1,4-Disubstituted benzo-fused urea compounds |
| NZ535603A (en) * | 2002-03-20 | 2007-10-26 | Metabolex Inc | Substituted phenylacetic acids |
| GB0215775D0 (en) * | 2002-07-06 | 2002-08-14 | Astex Technology Ltd | Pharmaceutical compounds |
| US7307088B2 (en) | 2002-07-09 | 2007-12-11 | Amgen Inc. | Substituted anthranilic amide derivatives and methods of use |
| WO2004020433A1 (ja) * | 2002-08-27 | 2004-03-11 | Yamanouchi Pharmaceutical Co., Ltd. | 新規結晶 |
| WO2004050632A1 (en) * | 2002-12-02 | 2004-06-17 | Fujisawa Pharmaceutical Co., Ltd. | Pyrazole derivatives useful as cox-i inhibitors |
| US7491827B2 (en) | 2002-12-23 | 2009-02-17 | Millennium Pharmaceuticals, Inc. | Aryl sulfonamides useful as inhibitors of chemokine receptor activity |
| AU2003303483A1 (en) | 2002-12-23 | 2004-07-22 | Millennium Pharmaceuticals, Inc. | Ccr8 inhibitors |
| TW200510311A (en) | 2002-12-23 | 2005-03-16 | Millennium Pharm Inc | CCr8 inhibitors |
| US7199259B2 (en) * | 2003-06-20 | 2007-04-03 | Metabolex, Inc. | Resolution of α-(phenoxy)phenylacetic acid derivatives |
| WO2005046683A1 (en) * | 2003-10-07 | 2005-05-26 | Renovis, Inc. | Amide derivatives as ion-channel ligands and pharmaceutical compositions and methods of using the same |
| AU2005223738B2 (en) * | 2004-03-09 | 2011-08-11 | Boehringer Ingelheim Pharmaceuticals, Inc. | 3-'4-heterocyclyl -1,2,3,-triazol-1-yl-n-aryl-benzamides as inhibitors of the cytokines production for the treatment of chronic inflammatory diseases |
| WO2005091752A2 (en) * | 2004-03-25 | 2005-10-06 | Synta Pharmaceuticals Corp. | Acrylonitrile derivatives for inflammation and immune-related uses |
| US7485657B2 (en) * | 2004-05-12 | 2009-02-03 | Boehringer Ingelheim Pharmaceuticals, Inc. | Anti-cytokine heterocyclic compounds |
| WO2005115384A2 (en) * | 2004-05-25 | 2005-12-08 | Metabolex, Inc. | Bicyclic, substituted triazoles as modulators of ppar and methods of their preparation |
| EP1751120A4 (en) * | 2004-05-25 | 2010-05-05 | Metabolex Inc | SUBSTITUTED TRIAZOLE AS PPAR MODULATORS AND MANUFACTURING METHOD THEREFOR |
| WO2006062984A2 (en) * | 2004-12-07 | 2006-06-15 | Locus Pharmaceuticals, Inc. | Inhibitors of protein kinases |
| WO2006062982A2 (en) * | 2004-12-07 | 2006-06-15 | Locus Pharmaceuticals, Inc. | Urea inhibitors of map kinases |
| EP1863756A1 (en) * | 2005-03-24 | 2007-12-12 | Janssen Pharmaceutica N.V. | Biaryl derived amide modulators of vanilloid vr1 receptor |
| NZ564916A (en) * | 2005-06-27 | 2011-03-31 | Exelixis Inc | Imidazole based LXR modulators |
| CA2615494C (en) | 2005-07-15 | 2011-08-09 | Jsr Corporation | Nitrogen-containing aromatic compounds, and production process, polymers and proton conductive membranes of the compounds |
| SG172738A1 (en) * | 2005-07-29 | 2011-07-28 | 4Sc Ag | Novel heterocyclic nf-kb inhibitors |
| US7714131B2 (en) * | 2005-09-23 | 2010-05-11 | Metabolex, Inc. | Process for the stereoselective preparation of (−)-halofenate and derivatives thereof |
| US8247556B2 (en) | 2005-10-21 | 2012-08-21 | Amgen Inc. | Method for preparing 6-substituted-7-aza-indoles |
| EP1960367A2 (en) * | 2005-12-05 | 2008-08-27 | Boehringer Ingelheim International GmbH | Substituted pyrazole compounds useful as soluble epoxide hydrolase inhibitors |
| WO2007081690A2 (en) * | 2006-01-04 | 2007-07-19 | Locus Pharmaceuticals, Inc. | Inhibitors of protein kinases |
| US8084473B2 (en) | 2007-04-24 | 2011-12-27 | Solvay Pharmaceuticals B.V. | Heterocyclic compounds with affinity to muscarinic receptors |
| AU2008240704A1 (en) * | 2007-04-24 | 2008-10-30 | Solvay Pharmaceuticals B.V. | Heterocyclic compounds with affinity to muscarinic receptors |
| EP2725023A1 (de) | 2008-06-13 | 2014-04-30 | Bayer CropScience AG | Neue heteroaromatische Amide als Schädlingsbekämpfungsmittel |
| WO2010048559A2 (en) * | 2008-10-24 | 2010-04-29 | Calcimedica Inc. | Phenylpyrazole inhibitors of store operated calcium release |
| CA2743609A1 (en) * | 2008-11-19 | 2010-05-27 | Schering Corporation | Inhibitors of diacylglycerol acyltransferase |
| EP3725775A1 (en) | 2009-02-17 | 2020-10-21 | Syntrix Biosystems, Inc. | Pyridine- and pyrimidinecarboxamides as cxcr2 modulators |
| WO2011009551A1 (de) * | 2009-07-23 | 2011-01-27 | Bayer Cropscience Ag | Verfahren zum herstellen von aryl-substituierten pyrazolen |
| JP2013503834A (ja) | 2009-09-04 | 2013-02-04 | ビーエーエスエフ ソシエタス・ヨーロピア | 1−フェニルピラゾールの製造方法 |
| US8377970B2 (en) * | 2009-10-08 | 2013-02-19 | Rhizen Pharmaceuticals Sa | Modulators of calcium release-activated calcium channel |
| US8993612B2 (en) | 2009-10-08 | 2015-03-31 | Rhizen Pharmaceuticals Sa | Modulators of calcium release-activated calcium channel and methods for treatment of non-small cell lung cancer |
| EP2533642A4 (en) * | 2010-02-11 | 2013-08-07 | Univ Vanderbilt | BENZOOXAZOLE AND AZABENOX OXAZOLE AS ALLOSTERIC MGLUR4 POTENTRANS AND COMPOSITIONS AND METHODS OF TREATING NEUROLOGICAL DYSFUNCTIONS |
| US10703722B2 (en) | 2010-04-27 | 2020-07-07 | Calcimedica, Inc. | Compounds that modulate intracellular calcium |
| US8754219B2 (en) | 2010-04-27 | 2014-06-17 | Calcimedica, Inc. | Compounds that modulate intracellular calcium |
| HUE029570T2 (en) | 2010-04-27 | 2017-03-28 | Calcimedica Inc | Intracellular calcium modifying compounds |
| WO2012007500A2 (de) | 2010-07-15 | 2012-01-19 | Bayer Cropscience Ag | Neue heterocyclische verbindungen als schädlingsbekämpfungsmittel |
| EP2608672B1 (en) | 2010-08-23 | 2020-12-16 | Syntrix Biosystems, Inc. | Aminopyridine- and aminopyrimidinecarboxamides as cxcr2 modulators |
| CN114591311A (zh) | 2010-08-27 | 2022-06-07 | 钙医学公司 | 调节细胞内钙的化合物 |
| WO2012170931A2 (en) | 2011-06-10 | 2012-12-13 | Calcimedica, Inc. | Compounds that modulate intracellular calcium |
| US9856240B2 (en) | 2011-10-19 | 2018-01-02 | Calcimedica, Inc. | Compounds that modulate intracellular calcium |
| AU2013255441B2 (en) | 2012-05-02 | 2017-11-09 | Lupin Limited | Substituted pyrazole compounds as CRAC modulators |
| CA2880542C (en) * | 2012-07-30 | 2018-01-02 | The Ohio State University | Antibacterial protein kinase inhibitors |
| US9512116B2 (en) | 2012-10-12 | 2016-12-06 | Calcimedica, Inc. | Compounds that modulate intracellular calcium |
| KR20160072155A (ko) | 2013-10-17 | 2016-06-22 | 다우 아그로사이언시즈 엘엘씨 | 살충성 화합물의 제조 방법 |
| CN105636441B (zh) | 2013-10-17 | 2018-06-15 | 美国陶氏益农公司 | 制备杀虫化合物的方法 |
| JP6487426B2 (ja) | 2013-10-17 | 2019-03-20 | ダウ アグロサイエンシィズ エルエルシー | 有害生物防除化合物の調製法 |
| MX2016004940A (es) | 2013-10-17 | 2016-06-28 | Dow Agrosciences Llc | Proceso para la preparacion de compuestos plaguicidas. |
| CN105636443A (zh) | 2013-10-17 | 2016-06-01 | 美国陶氏益农公司 | 制备杀虫化合物的方法 |
| US9085564B2 (en) | 2013-10-17 | 2015-07-21 | Dow Agrosciences Llc | Processes for the preparation of pesticidal compounds |
| JP2016535010A (ja) | 2013-10-17 | 2016-11-10 | ダウ アグロサイエンシィズ エルエルシー | 有害生物防除性化合物の製造方法 |
| US9745317B2 (en) * | 2014-04-28 | 2017-08-29 | Pfizer Inc. | Heterocyclic compounds and their use as dopamine D1 ligands |
| BR112017000418A2 (pt) | 2014-07-31 | 2017-11-07 | Dow Agrosciences Llc | processo para a preparação de 3-(3-cloro-1h-pirazol-1-il)piridina |
| JP2017523163A (ja) | 2014-07-31 | 2017-08-17 | ダウ アグロサイエンシィズ エルエルシー | 3−(3−クロロ−1h−ピラゾール−1−イル)ピリジンの製造方法 |
| US9249122B1 (en) | 2014-07-31 | 2016-02-02 | Dow Agrosciences Llc | Process for the preparation of 3-(3-chloro-1H-pyrazol-1-yl)pyridine |
| US9024031B1 (en) | 2014-08-19 | 2015-05-05 | Dow Agrosciences Llc | Process for the preparation of 3-(3-chloro-1H-pyrazol-1-yl)pyridine |
| EP3191455A4 (en) | 2014-09-12 | 2018-01-24 | Dow AgroSciences LLC | Process for the preparation of 3-(3-chloro-1h-pyrazol-1-yl)pyridine |
| CN114712513A (zh) | 2015-02-27 | 2022-07-08 | 钙医学公司 | 胰腺炎治疗 |
| CA2995094A1 (en) | 2015-08-07 | 2017-02-16 | Calcimedica, Inc. | Use of crac channel inhibitors for the treatment of stroke and traumatic brain injury |
| CN105820104B (zh) * | 2016-03-10 | 2018-12-11 | 温州医科大学 | 一种具有抗炎作用的吲哚-2-酰胺类化合物及其在制备抗炎药物中的应用 |
| KR101894004B1 (ko) | 2016-03-17 | 2018-08-31 | 연세대학교 산학협력단 | NamPT 억제용 신규 화합물 및 이를 포함하는 조성물 |
| WO2018125815A1 (en) | 2016-12-29 | 2018-07-05 | Dow Agrosciences Llc | Processes for the preparation of pesticidal compounds |
| WO2018125817A1 (en) | 2016-12-29 | 2018-07-05 | Dow Agrosciences Llc | Processes for the preparation of pesticidal compounds |
| WO2018175324A1 (en) | 2017-03-20 | 2018-09-27 | The Broad Institute, Inc. | Compounds and methods for regulating insulin secretion |
| KR102426016B1 (ko) * | 2020-01-07 | 2022-08-01 | 한국과학기술연구원 | 신규한 1-페닐-1h-피라졸 유도체 및 이의 용도 |
| IL319776A (en) | 2022-10-03 | 2025-05-01 | Gliapharm Sa | Lactate-enhancing compounds and their uses |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0242322B1 (en) * | 1986-03-18 | 1992-12-16 | Sandoz Ag | Phenylureas |
| US5242940A (en) * | 1987-05-29 | 1993-09-07 | Ortho Pharmaceutical Corporation | Pharmacologically active N-1 and C-5 heterocyclic pyrazoles and method for synthesizing the same |
| PH27357A (en) * | 1989-09-22 | 1993-06-21 | Fujisawa Pharmaceutical Co | Pyrazole derivatives and pharmaceutical compositions comprising the same |
| KR100263429B1 (ko) * | 1994-06-06 | 2000-08-01 | 디. 제이. 우드 | 코르티코트로핀-방출 인자(crf) 길항 활성을 갖는 치환된 피라졸 |
| FR2732967B1 (fr) * | 1995-04-11 | 1997-07-04 | Sanofi Sa | 1-phenylpyrazole-3-carboxamides substitues, actifs sur la neurotensine, leur preparation, les compositions pharmaceutiques en contenant |
| GB9520584D0 (en) * | 1995-10-09 | 1995-12-13 | Fujisawa Pharmaceutical Co | Pyrazole derivatives,processes for preparation thereof and pharmaceutical composition comprising the same |
| GB9608435D0 (en) * | 1996-04-24 | 1996-06-26 | Celltech Therapeutics Ltd | Chemical compounds |
| AU751139B2 (en) * | 1997-10-13 | 2002-08-08 | Astellas Pharma Inc. | Amide derivative |
| JP4385414B2 (ja) * | 1997-10-13 | 2009-12-16 | アステラス製薬株式会社 | アミド若しくはアミン誘導体 |
-
1999
- 1999-06-03 CA CA002332957A patent/CA2332957A1/en not_active Abandoned
- 1999-06-03 AU AU42299/99A patent/AU4229999A/en not_active Abandoned
- 1999-06-03 US US09/324,933 patent/US6506747B1/en not_active Expired - Lifetime
- 1999-06-03 WO PCT/US1999/012295 patent/WO1999062885A1/en not_active Ceased
- 1999-06-03 JP JP2000552097A patent/JP2002516909A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| AU4229999A (en) | 1999-12-20 |
| WO1999062885A1 (en) | 1999-12-09 |
| US6506747B1 (en) | 2003-01-14 |
| JP2002516909A (ja) | 2002-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6506747B1 (en) | Substituted 1-(4-aminophenyl)pyrazoles and their use as anti-inflammatory agents | |
| EP1024138B1 (en) | Pyrazole derivatives | |
| KR101750965B1 (ko) | 칼슘 방출-활성화 칼슘 통로의 조정제로서의 피라졸 유도체 | |
| DE69610822T2 (de) | Indolderivate als 5-ht rezeptorantagoniste | |
| CA2672521C (en) | Pyrazole derivatives as protein kinase inhibitors | |
| AU597696B2 (en) | Benzimidazole derivatives | |
| EP2468717B1 (en) | Heterocyclic Amide Compounds Useful as Kinase Inhibitors | |
| IE68857B1 (en) | Pyrazole derivatives processes for preparation thereof and pharmaceutical composition comprising the same | |
| SK10102003A3 (sk) | Acylované indanylamíny, farmaceutická kompozícia s ich obsahom, spôsob syntézy a ich použitie ako liečivá | |
| MXPA05001334A (es) | Acidos tienil-hidroxamicos sustituidos como inhibidores de la desacetilasa de histona. | |
| WO2006126695A1 (ja) | ピラゾール化合物及びそれらピラゾール化合物を含んでなる糖尿病治療薬 | |
| MX2011000738A (es) | 3,4-diarilpirazoles como inhibidoers de proteina cinasa. | |
| AU2006209712B2 (en) | IGF-1R inhibitor | |
| KR20210114972A (ko) | 치환된 피롤리딘 아마이드 iii | |
| JP2000513386A (ja) | Cox−2阻害物質としてのインドール化合物 | |
| CA2722811A1 (en) | Pyrazole compounds as ccr1 antagonists | |
| WO1999051580A1 (en) | Pyrazole inhibitors of cytokine production | |
| WO2006071940A2 (en) | Enzyme modulators and treatments | |
| SK12832001A3 (sk) | Protizápalové látky, spôsob ich výroby, farmaceutický prostriedok s ich obsahom a ich použitie | |
| MX2011011800A (es) | Derivados de carboxamida y urea aromaticas sustituidas como ligandos del receptor de vanilloides. | |
| Yonetoku et al. | Novel potent and selective calcium-release-activated calcium (CRAC) channel inhibitors. Part 2: Synthesis and inhibitory activity of aryl-3-trifluoromethylpyrazoles | |
| WO2007037543A9 (ja) | ビアリールアミド誘導体 | |
| US6627647B1 (en) | Substituted 1-(4-aminophenyl)imidazoles and their use as anti-inflammatory agents | |
| JPH11240832A (ja) | アミド若しくはアミン誘導体 | |
| US6451820B1 (en) | Substituted 1-(4-aminophenly)triazoles and their use as anti-inflammatory agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Dead |