CA2071375C - Heterocyclic derivatives - Google Patents
Heterocyclic derivatives Download PDFInfo
- Publication number
- CA2071375C CA2071375C CA002071375A CA2071375A CA2071375C CA 2071375 C CA2071375 C CA 2071375C CA 002071375 A CA002071375 A CA 002071375A CA 2071375 A CA2071375 A CA 2071375A CA 2071375 C CA2071375 C CA 2071375C
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- compound
- salt
- isobutylphenyl
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 125000000623 heterocyclic group Chemical group 0.000 title claims abstract description 16
- 150000001875 compounds Chemical class 0.000 claims abstract description 158
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 148
- 150000003839 salts Chemical class 0.000 claims abstract description 137
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 48
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 42
- 239000001257 hydrogen Substances 0.000 claims abstract description 40
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 claims abstract description 34
- 125000001424 substituent group Chemical group 0.000 claims abstract description 34
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 33
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 27
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 27
- 125000006239 protecting group Chemical group 0.000 claims abstract description 26
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 17
- 150000002367 halogens Chemical class 0.000 claims abstract description 17
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 15
- 125000004450 alkenylene group Chemical group 0.000 claims abstract description 14
- 125000003118 aryl group Chemical group 0.000 claims abstract description 10
- 201000010099 disease Diseases 0.000 claims abstract description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 5
- 230000001404 mediated effect Effects 0.000 claims abstract description 4
- 230000003405 preventing effect Effects 0.000 claims abstract description 3
- -1 cyano, carboxy Chemical group 0.000 claims description 262
- 239000002253 acid Substances 0.000 claims description 24
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 21
- 238000003379 elimination reaction Methods 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 claims description 18
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 14
- 125000004423 acyloxy group Chemical group 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 8
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 claims description 6
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 claims description 6
- 229940123934 Reductase inhibitor Drugs 0.000 claims description 5
- GKYAYEXUMQIPRX-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]pentoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CCCC)C1=CC=C(CC(C)C)C=C1 GKYAYEXUMQIPRX-UHFFFAOYSA-N 0.000 claims description 4
- NJQWAJAXGQVRTG-UHFFFAOYSA-N 4-[3-[3-[bis[4-(2-methylpropyl)phenyl]methoxy]benzoyl]indolizin-1-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1C(C=1C=CC(CC(C)C)=CC=1)OC1=CC=CC(C(=O)C=2N3C=CC=CC3=C(CCCC(O)=O)C=2)=C1 NJQWAJAXGQVRTG-UHFFFAOYSA-N 0.000 claims description 4
- BMFKFCCKXFQCIB-UHFFFAOYSA-N 4-[3-[3-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]indolizin-1-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1C(C=1C=CC(CC(C)C)=CC=1)NC1=CC=CC(C(=O)C=2N3C=CC=CC3=C(CCCC(O)=O)C=2)=C1 BMFKFCCKXFQCIB-UHFFFAOYSA-N 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- MVPWJFWMEIXDQW-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CCC)C1=CC=C(CC(C)C)C=C1 MVPWJFWMEIXDQW-UHFFFAOYSA-N 0.000 claims description 3
- ZCCYKTMCDKTMKL-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]propoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CC)C1=CC=C(CC(C)C)C=C1 ZCCYKTMCDKTMKL-UHFFFAOYSA-N 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 5
- 235000010290 biphenyl Nutrition 0.000 claims 2
- 239000004305 biphenyl Substances 0.000 claims 2
- 125000006267 biphenyl group Chemical group 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims 2
- GGAKVTRZBWWBOV-UHFFFAOYSA-N 4-[1-[4-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1C(C=1C=CC(CC(C)C)=CC=1)NC1=CC=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=C1 GGAKVTRZBWWBOV-UHFFFAOYSA-N 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 103
- 238000000034 method Methods 0.000 abstract description 51
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 6
- 201000004384 Alopecia Diseases 0.000 abstract description 5
- 206010036976 Prostatism Diseases 0.000 abstract description 3
- 231100000360 alopecia Toxicity 0.000 abstract description 3
- 208000020154 Acnes Diseases 0.000 abstract description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 187
- 101150041968 CDC13 gene Proteins 0.000 description 185
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 184
- 239000000203 mixture Substances 0.000 description 116
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 88
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 84
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 79
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 74
- 238000006243 chemical reaction Methods 0.000 description 72
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 64
- 239000000243 solution Substances 0.000 description 63
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 59
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 55
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 48
- 239000002904 solvent Substances 0.000 description 41
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 37
- 229960003390 magnesium sulfate Drugs 0.000 description 37
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 37
- 235000019341 magnesium sulphate Nutrition 0.000 description 37
- 239000012044 organic layer Substances 0.000 description 37
- 239000000741 silica gel Substances 0.000 description 35
- 229910002027 silica gel Inorganic materials 0.000 description 35
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 34
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000012267 brine Substances 0.000 description 33
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 33
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 32
- 239000003921 oil Substances 0.000 description 28
- 235000019198 oils Nutrition 0.000 description 28
- 125000004538 indolizin-3-yl group Chemical group C=1C=C(N2C=CC=CC12)* 0.000 description 26
- 229920002554 vinyl polymer Polymers 0.000 description 25
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 23
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 23
- 150000002148 esters Chemical group 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 13
- 239000000843 powder Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 12
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 12
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 229960003604 testosterone Drugs 0.000 description 12
- 230000008030 elimination Effects 0.000 description 11
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 125000005907 alkyl ester group Chemical group 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 9
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 229910052783 alkali metal Inorganic materials 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000005711 Benzoic acid Substances 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 235000010233 benzoic acid Nutrition 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- 235000011054 acetic acid Nutrition 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 125000004247 indolizin-1-yl group Chemical group [H]C1=C([H])C(*)=C2C([H])=C([H])C([H])=C([H])N12 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 150000007530 organic bases Chemical class 0.000 description 5
- 230000001681 protective effect Effects 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 4
- 229920000388 Polyphosphate Polymers 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 230000002411 adverse Effects 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- HEQKXMBBXJGHFT-UHFFFAOYSA-N ethyl 4-indolizin-3-ylbutanoate Chemical compound C1=CC=CN2C(CCCC(=O)OCC)=CC=C21 HEQKXMBBXJGHFT-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- 239000001205 polyphosphate Substances 0.000 description 4
- 235000011176 polyphosphates Nutrition 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000010792 warming Methods 0.000 description 4
- SYMCOBUELYUSNB-UHFFFAOYSA-N 2-ethoxy-1-[4-(2-methylpropyl)phenyl]ethanone Chemical compound CCOCC(=O)C1=CC=C(CC(C)C)C=C1 SYMCOBUELYUSNB-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 206010000496 acne Diseases 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 3
- SNJUYCKZFCNJKC-UHFFFAOYSA-N ethyl 4-[1-(3-aminobenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=CC(N)=C1 SNJUYCKZFCNJKC-UHFFFAOYSA-N 0.000 description 3
- ZPHCJLJYBWLSLI-UHFFFAOYSA-N ethyl 4-[1-(4-hydroxybenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=C(O)C=C1 ZPHCJLJYBWLSLI-UHFFFAOYSA-N 0.000 description 3
- KVQBORSFTZBCLM-XIFFEERXSA-N ethyl 4-[1-[4-[(1s)-1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C1([C@@H](OC=2C=CC(=CC=2)C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)CCC)=CC=C(CC(C)C)C=C1 KVQBORSFTZBCLM-XIFFEERXSA-N 0.000 description 3
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 230000011514 reflex Effects 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- CGEOYYBCLBIBLG-UHFFFAOYSA-N (4-carbonochloridoylphenyl) acetate Chemical compound CC(=O)OC1=CC=C(C(Cl)=O)C=C1 CGEOYYBCLBIBLG-UHFFFAOYSA-N 0.000 description 2
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 2
- FGYSDVLPRLHZDA-ORCRQEGFSA-N (e)-5-pyridin-2-ylpent-4-enoic acid Chemical compound OC(=O)CC\C=C\C1=CC=CC=N1 FGYSDVLPRLHZDA-ORCRQEGFSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 2
- GGFQGSUQOGVNBQ-UHFFFAOYSA-N 1-(1-bromohexyl)-4-(2-methylpropyl)benzene Chemical compound CCCCCC(Br)C1=CC=C(CC(C)C)C=C1 GGFQGSUQOGVNBQ-UHFFFAOYSA-N 0.000 description 2
- RFDOTTUPKXBZMV-UHFFFAOYSA-N 1-(4-bromo-2-fluorophenyl)pentan-1-ol Chemical compound CCCCC(O)C1=CC=C(Br)C=C1F RFDOTTUPKXBZMV-UHFFFAOYSA-N 0.000 description 2
- CNTIGFJUJRTFJJ-UHFFFAOYSA-N 1-[2-methoxy-4-(2-methylprop-1-enyl)phenyl]pentan-1-one Chemical compound CCCCC(=O)C1=CC=C(C=C(C)C)C=C1OC CNTIGFJUJRTFJJ-UHFFFAOYSA-N 0.000 description 2
- LAVGKFCZSBAMFX-UHFFFAOYSA-N 1-[4-(2-methylpropyl)phenyl]but-3-en-1-one Chemical compound CC(C)CC1=CC=C(C(=O)CC=C)C=C1 LAVGKFCZSBAMFX-UHFFFAOYSA-N 0.000 description 2
- KDEULVTVIMZDPX-UHFFFAOYSA-N 1-[4-(2-methylpropyl)phenyl]butan-1-one Chemical compound CCCC(=O)C1=CC=C(CC(C)C)C=C1 KDEULVTVIMZDPX-UHFFFAOYSA-N 0.000 description 2
- DGNYSNMYAQGDJL-UHFFFAOYSA-N 1-[4-(2-methylpropyl)phenyl]hexan-1-one Chemical compound CCCCCC(=O)C1=CC=C(CC(C)C)C=C1 DGNYSNMYAQGDJL-UHFFFAOYSA-N 0.000 description 2
- YSIJIZJIBMUQFC-UHFFFAOYSA-N 1-[chloro-[4-(2-methylpropyl)phenyl]methyl]-4-(2-methylpropyl)benzene Chemical compound C1=CC(CC(C)C)=CC=C1C(Cl)C1=CC=C(CC(C)C)C=C1 YSIJIZJIBMUQFC-UHFFFAOYSA-N 0.000 description 2
- COZUFZRDPHJJNC-UHFFFAOYSA-N 2-[3-[3-(4-ethoxy-4-oxobutyl)indolizine-1-carbonyl]anilino]propanoic acid Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=CC(NC(C)C(O)=O)=C1 COZUFZRDPHJJNC-UHFFFAOYSA-N 0.000 description 2
- AVZBOAGCVKEESJ-UHFFFAOYSA-O 2-ethyl-1,2-benzoxazol-2-ium-7-ol Chemical class C1=CC(O)=C2O[N+](CC)=CC2=C1 AVZBOAGCVKEESJ-UHFFFAOYSA-O 0.000 description 2
- PQDLCSVNFABPQN-UHFFFAOYSA-N 2-methoxy-4-(2-methylprop-1-enyl)benzoic acid Chemical compound COC1=CC(C=C(C)C)=CC=C1C(O)=O PQDLCSVNFABPQN-UHFFFAOYSA-N 0.000 description 2
- NSHAOELVDPKZIC-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonic acid;hydroxide Chemical compound [OH-].O1[N+](CC)=CC=C1C1=CC=CC(S(O)(=O)=O)=C1 NSHAOELVDPKZIC-UHFFFAOYSA-N 0.000 description 2
- ROSPTOARLKNIPP-UHFFFAOYSA-N 4,4,4-trifluoro-1-[4-(2-methylpropyl)phenyl]butan-1-one Chemical compound CC(C)CC1=CC=C(C(=O)CCC(F)(F)F)C=C1 ROSPTOARLKNIPP-UHFFFAOYSA-N 0.000 description 2
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 2
- IWPFQZYKVVFMBC-UHFFFAOYSA-N 4-(cyclopropylmethyl)benzaldehyde Chemical compound C1=CC(C=O)=CC=C1CC1CC1 IWPFQZYKVVFMBC-UHFFFAOYSA-N 0.000 description 2
- PMFQQGJTABEXPO-UHFFFAOYSA-N 4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1C(C=1C=CC(CC(C)C)=CC=1)NC1=CC=CC(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)=C1 PMFQQGJTABEXPO-UHFFFAOYSA-N 0.000 description 2
- 208000002874 Acne Vulgaris Diseases 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 206010020112 Hirsutism Diseases 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- VQFAIAKCILWQPZ-UHFFFAOYSA-N bromoacetone Chemical compound CC(=O)CBr VQFAIAKCILWQPZ-UHFFFAOYSA-N 0.000 description 2
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 235000015165 citric acid Nutrition 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- VHJLVAABSRFDPM-QWWZWVQMSA-N dithiothreitol Chemical compound SC[C@@H](O)[C@H](O)CS VHJLVAABSRFDPM-QWWZWVQMSA-N 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- PTOXUAMDHMWALH-XVNBXDOJSA-N ethyl (e)-5-pyridin-2-ylpent-4-enoate Chemical compound CCOC(=O)CC\C=C\C1=CC=CC=N1 PTOXUAMDHMWALH-XVNBXDOJSA-N 0.000 description 2
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 2
- XGGUNYRLABZGPN-UHFFFAOYSA-N ethyl 4-[1-(4-acetyloxybenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=C(OC(C)=O)C=C1 XGGUNYRLABZGPN-UHFFFAOYSA-N 0.000 description 2
- OXIYRCXUMVDSKL-UHFFFAOYSA-N ethyl 4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=1)=CC=CC=1NC(C=1C=CC(CC(C)C)=CC=1)C1=CC=C(CC(C)C)C=C1 OXIYRCXUMVDSKL-UHFFFAOYSA-N 0.000 description 2
- KVQBORSFTZBCLM-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)C=CC=1OC(CCC)C1=CC=C(CC(C)C)C=C1 KVQBORSFTZBCLM-UHFFFAOYSA-N 0.000 description 2
- KWHYBEZVDYQQDP-UHFFFAOYSA-N ethyl 4-[3-(4-hydroxybenzoyl)indolizin-1-yl]butanoate Chemical compound N12C=CC=CC2=C(CCCC(=O)OCC)C=C1C(=O)C1=CC=C(O)C=C1 KWHYBEZVDYQQDP-UHFFFAOYSA-N 0.000 description 2
- IDCRKEOLEBPVPR-UHFFFAOYSA-N ethyl 4-[3-[3-[1-[4-(2-methylpropyl)phenyl]hexylamino]benzoyl]indolizin-1-yl]butanoate Chemical compound C=1C=CC(C(=O)C=2N3C=CC=CC3=C(CCCC(=O)OCC)C=2)=CC=1NC(CCCCC)C1=CC=C(CC(C)C)C=C1 IDCRKEOLEBPVPR-UHFFFAOYSA-N 0.000 description 2
- VLJZZWIWNDLKKP-UHFFFAOYSA-N ethyl 4-indolizin-3-yl-4-oxobutanoate Chemical compound C1=CC=CN2C(C(=O)CCC(=O)OCC)=CC=C21 VLJZZWIWNDLKKP-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 2
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 2
- KXUHSQYYJYAXGZ-UHFFFAOYSA-N isobutylbenzene Chemical compound CC(C)CC1=CC=CC=C1 KXUHSQYYJYAXGZ-UHFFFAOYSA-N 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229940091250 magnesium supplement Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- YURSEOBUXRDTPQ-UHFFFAOYSA-N methyl 2-methoxy-4-(2-methylprop-1-enyl)benzoate Chemical compound COC(=O)C1=CC=C(C=C(C)C)C=C1OC YURSEOBUXRDTPQ-UHFFFAOYSA-N 0.000 description 2
- LHNVKRSDQCCHEK-UHFFFAOYSA-N methyl 2-methoxy-4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C=C1OC LHNVKRSDQCCHEK-UHFFFAOYSA-N 0.000 description 2
- UXSNXOMMJXTFEG-UHFFFAOYSA-N methyl 4-(bromomethyl)-3-methoxybenzoate Chemical compound COC(=O)C1=CC=C(CBr)C(OC)=C1 UXSNXOMMJXTFEG-UHFFFAOYSA-N 0.000 description 2
- ATWMFTGQTJYBCT-UHFFFAOYSA-N methyl 4-(diethoxyphosphorylmethyl)-2-methoxybenzoate Chemical compound CCOP(=O)(OCC)CC1=CC=C(C(=O)OC)C(OC)=C1 ATWMFTGQTJYBCT-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000012046 mixed solvent Substances 0.000 description 2
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 2
- 235000019796 monopotassium phosphate Nutrition 0.000 description 2
- UHAAFJWANJYDIS-UHFFFAOYSA-N n,n'-diethylmethanediimine Chemical compound CCN=C=NCC UHAAFJWANJYDIS-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 2
- 229910000105 potassium hydride Inorganic materials 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 2
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 210000002307 prostate Anatomy 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 229910000162 sodium phosphate Inorganic materials 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- OQFITNTXYYDXLY-AWEZNQCLSA-N (1r)-2-ethoxy-1-[4-(2-methylpropyl)phenyl]ethanol Chemical compound CCOC[C@H](O)C1=CC=C(CC(C)C)C=C1 OQFITNTXYYDXLY-AWEZNQCLSA-N 0.000 description 1
- OQFITNTXYYDXLY-CQSZACIVSA-N (1s)-2-ethoxy-1-[4-(2-methylpropyl)phenyl]ethanol Chemical compound CCOC[C@@H](O)C1=CC=C(CC(C)C)C=C1 OQFITNTXYYDXLY-CQSZACIVSA-N 0.000 description 1
- OEFJWLNWTABDRW-UHFFFAOYSA-M (3-methoxycarbonylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].COC(=O)C1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 OEFJWLNWTABDRW-UHFFFAOYSA-M 0.000 description 1
- QGONKBBBEQPLDY-UHFFFAOYSA-M (4-bromo-2-fluorophenyl)methyl-triphenylphosphanium;bromide Chemical compound [Br-].FC1=CC(Br)=CC=C1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 QGONKBBBEQPLDY-UHFFFAOYSA-M 0.000 description 1
- VGRXAHXMIDCTNV-UHFFFAOYSA-N (6-chlorobenzotriazol-1-yl) 4-chlorobenzenesulfonate Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)ON1C2=CC(Cl)=CC=C2N=N1 VGRXAHXMIDCTNV-UHFFFAOYSA-N 0.000 description 1
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 description 1
- 125000006529 (C3-C6) alkyl group Chemical group 0.000 description 1
- MAUMSNABMVEOGP-UHFFFAOYSA-N (methyl-$l^{2}-azanyl)methane Chemical compound C[N]C MAUMSNABMVEOGP-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- MASDFXZJIDNRTR-UHFFFAOYSA-N 1,3-bis(trimethylsilyl)urea Chemical compound C[Si](C)(C)NC(=O)N[Si](C)(C)C MASDFXZJIDNRTR-UHFFFAOYSA-N 0.000 description 1
- JLLGMLODKYNBKJ-UHFFFAOYSA-N 1-(1-bromopropyl)-4-(2-methylpropyl)benzene Chemical compound CCC(Br)C1=CC=C(CC(C)C)C=C1 JLLGMLODKYNBKJ-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- HTWWCTXRYSFBOQ-UHFFFAOYSA-N 1-[2-methoxy-4-(2-methylpropyl)phenyl]pentan-1-ol Chemical compound CCCCC(O)C1=CC=C(CC(C)C)C=C1OC HTWWCTXRYSFBOQ-UHFFFAOYSA-N 0.000 description 1
- ODWLKBUYETXVEX-UHFFFAOYSA-N 1-[3-fluoro-4-(2-methylprop-1-enyl)phenyl]pentan-1-ol Chemical compound CCCCC(O)C1=CC=C(C=C(C)C)C(F)=C1 ODWLKBUYETXVEX-UHFFFAOYSA-N 0.000 description 1
- PKPNMEAGYJFGFK-UHFFFAOYSA-N 1-[3-methoxy-4-(2-methylpropyl)phenyl]pentan-1-ol Chemical compound CCCCC(O)C1=CC=C(CC(C)C)C(OC)=C1 PKPNMEAGYJFGFK-UHFFFAOYSA-N 0.000 description 1
- KEAGRYYGYWZVPC-UHFFFAOYSA-N 1-[4-(2-methylpropyl)phenyl]ethanone Chemical compound CC(C)CC1=CC=C(C(C)=O)C=C1 KEAGRYYGYWZVPC-UHFFFAOYSA-N 0.000 description 1
- FCCZZWAYLSPWPP-UHFFFAOYSA-N 1-[bromo(phenyl)methyl]-4-(2-methylpropyl)benzene Chemical compound C1=CC(CC(C)C)=CC=C1C(Br)C1=CC=CC=C1 FCCZZWAYLSPWPP-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- ORLCYMQZIPSODD-UHFFFAOYSA-N 1-chloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(=O)OCC(Cl)(Cl)Cl ORLCYMQZIPSODD-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NVKAWKQGWWIWPM-ABEVXSGRSA-N 17-β-hydroxy-5-α-Androstan-3-one Chemical compound C1C(=O)CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CC[C@H]21 NVKAWKQGWWIWPM-ABEVXSGRSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- UIJPWDSKPZLJAN-UHFFFAOYSA-N 2-(1,4-dioxan-2-yl)ethanol Chemical compound OCCC1COCCO1 UIJPWDSKPZLJAN-UHFFFAOYSA-N 0.000 description 1
- AMOYMEBHYUTMKJ-UHFFFAOYSA-N 2-(2-phenylethoxy)ethylbenzene Chemical compound C=1C=CC=CC=1CCOCCC1=CC=CC=C1 AMOYMEBHYUTMKJ-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- UYQSIDYOZYVSHA-UHFFFAOYSA-N 2-[3-[3-(4-ethoxy-4-oxobutyl)indolizine-1-carbonyl]anilino]acetic acid Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=CC(NCC(O)=O)=C1 UYQSIDYOZYVSHA-UHFFFAOYSA-N 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- JEKKKWNKTZNFMK-UHFFFAOYSA-N 2-methoxy-4-(2-methylprop-1-enyl)benzoyl chloride Chemical compound COC1=CC(C=C(C)C)=CC=C1C(Cl)=O JEKKKWNKTZNFMK-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- FGLBSLMDCBOPQK-UHFFFAOYSA-N 2-nitropropane Chemical compound CC(C)[N+]([O-])=O FGLBSLMDCBOPQK-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- MDQHTWMXYBVSHU-UHFFFAOYSA-N 2-trimethylsilylacetamide Chemical compound C[Si](C)(C)CC(N)=O MDQHTWMXYBVSHU-UHFFFAOYSA-N 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- KWZQORSVCNLHBB-UHFFFAOYSA-N 3-carboxypropyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCC(=O)O)C1=CC=CC=C1 KWZQORSVCNLHBB-UHFFFAOYSA-N 0.000 description 1
- VCNLGFCMYJEJSU-UHFFFAOYSA-N 3-methoxy-4-(2-methylprop-1-enyl)benzoic acid Chemical compound COC1=CC(C(O)=O)=CC=C1C=C(C)C VCNLGFCMYJEJSU-UHFFFAOYSA-N 0.000 description 1
- WTUCTMYLCMVYEX-UHFFFAOYSA-N 4,4,4-trifluorobutanoic acid Chemical compound OC(=O)CCC(F)(F)F WTUCTMYLCMVYEX-UHFFFAOYSA-N 0.000 description 1
- LXPWGAZYJHUWPM-UHFFFAOYSA-N 4-(2-methylpropyl)benzaldehyde Chemical compound CC(C)CC1=CC=C(C=O)C=C1 LXPWGAZYJHUWPM-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- POQSSQXKZKHNGX-UHFFFAOYSA-N 4-[1-[3-[1-[4-(2-methylpropyl)phenyl]butylamino]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=CC(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)=CC=1NC(CCC)C1=CC=C(CC(C)C)C=C1 POQSSQXKZKHNGX-UHFFFAOYSA-N 0.000 description 1
- RMRJHJLRSRVUPI-UHFFFAOYSA-N 4-[1-[3-[1-[4-(2-methylpropyl)phenyl]hexylamino]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=CC(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)=CC=1NC(CCCCC)C1=CC=C(CC(C)C)C=C1 RMRJHJLRSRVUPI-UHFFFAOYSA-N 0.000 description 1
- OBGBEJZLARNKHV-UHFFFAOYSA-N 4-[1-[3-[[1-(heptylamino)-1-oxopropan-2-yl]amino]benzoyl]indolizin-3-yl]butanoic acid Chemical compound CCCCCCCNC(=O)C(C)NC1=CC=CC(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)=C1 OBGBEJZLARNKHV-UHFFFAOYSA-N 0.000 description 1
- OWQHKIYKWUAUBE-UHFFFAOYSA-N 4-[1-[3-[[2-(heptylamino)-1-[4-(2-methylpropyl)phenyl]-2-oxoethyl]amino]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=CC(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)=CC=1NC(C(=O)NCCCCCCC)C1=CC=C(CC(C)C)C=C1 OWQHKIYKWUAUBE-UHFFFAOYSA-N 0.000 description 1
- JNMOLYXLPVFVMF-UHFFFAOYSA-N 4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1C(C=1C=CC(CC(C)C)=CC=1)OC1=CC=CC(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)=C1 JNMOLYXLPVFVMF-UHFFFAOYSA-N 0.000 description 1
- VHQMBCVZOCULJD-UHFFFAOYSA-N 4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]indolizin-3-yl]butanoic acid;hydrochloride Chemical compound Cl.C1=CC(CC(C)C)=CC=C1C(C=1C=CC(CC(C)C)=CC=1)NC1=CC=CC(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)=C1 VHQMBCVZOCULJD-UHFFFAOYSA-N 0.000 description 1
- FQSKRQMGYCLUOO-UHFFFAOYSA-N 4-[1-[3-[n-benzyl-4-(2-methylpropyl)anilino]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1N(C=1C=C(C=CC=1)C(=O)C1=C2C=CC=CN2C(CCCC(O)=O)=C1)CC1=CC=CC=C1 FQSKRQMGYCLUOO-UHFFFAOYSA-N 0.000 description 1
- MVPWJFWMEIXDQW-HKBQPEDESA-N 4-[1-[4-[(1s)-1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C1([C@@H](OC=2C=CC(=CC=2)C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)CCC)=CC=C(CC(C)C)C=C1 MVPWJFWMEIXDQW-HKBQPEDESA-N 0.000 description 1
- QUWSICUGKTXKHD-UHFFFAOYSA-N 4-[1-[4-[1-[2-fluoro-4-(1-hydroxy-2-methylpropyl)phenyl]pentoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CCCC)C1=CC=C(C(O)C(C)C)C=C1F QUWSICUGKTXKHD-UHFFFAOYSA-N 0.000 description 1
- WZKWKVJJRYFTGN-UHFFFAOYSA-N 4-[1-[4-[1-[2-methoxy-4-(2-methylpropyl)phenyl]pentoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CCCC)C1=CC=C(CC(C)C)C=C1OC WZKWKVJJRYFTGN-UHFFFAOYSA-N 0.000 description 1
- KBIZLKXYBPDLFI-UHFFFAOYSA-N 4-[1-[4-[1-[3-methoxy-4-(2-methylpropyl)phenyl]pentoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CCCC)C1=CC=C(CC(C)C)C(OC)=C1 KBIZLKXYBPDLFI-UHFFFAOYSA-N 0.000 description 1
- PSIAZIPDJUZHSH-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]but-2-ynoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(C#CC)C1=CC=C(CC(C)C)C=C1 PSIAZIPDJUZHSH-UHFFFAOYSA-N 0.000 description 1
- CDPAFYZXVNZODQ-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]but-3-enoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1C(CC=C)OC1=CC=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=C1 CDPAFYZXVNZODQ-UHFFFAOYSA-N 0.000 description 1
- WCBUHVCHUNJEIT-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]heptoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CCCCCC)C1=CC=C(CC(C)C)C=C1 WCBUHVCHUNJEIT-UHFFFAOYSA-N 0.000 description 1
- QRHOYNPATQWBLJ-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]hexoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CCCCC)C1=CC=C(CC(C)C)C=C1 QRHOYNPATQWBLJ-UHFFFAOYSA-N 0.000 description 1
- SEKQHCXYSBGARC-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]octoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=CC=1OC(CCCCCCC)C1=CC=C(CC(C)C)C=C1 SEKQHCXYSBGARC-UHFFFAOYSA-N 0.000 description 1
- QAFULCQPAAEGIW-UHFFFAOYSA-N 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]pent-4-enoxy]benzoyl]indolizin-3-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1C(CCC=C)OC1=CC=C(C(=O)C2=C3C=CC=CN3C(CCCC(O)=O)=C2)C=C1 QAFULCQPAAEGIW-UHFFFAOYSA-N 0.000 description 1
- FCSTWGBXIVBRGN-UHFFFAOYSA-N 4-[3-[3-[1-[4-(2-methylpropyl)phenyl]hexylamino]benzoyl]indolizin-1-yl]butanoic acid Chemical compound C=1C=CC(C(=O)C=2N3C=CC=CC3=C(CCCC(O)=O)C=2)=CC=1NC(CCCCC)C1=CC=C(CC(C)C)C=C1 FCSTWGBXIVBRGN-UHFFFAOYSA-N 0.000 description 1
- NLPOIUQIFVMBDD-UHFFFAOYSA-N 4-[3-[3-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]-2-methylindolizin-1-yl]butanoic acid Chemical compound C1=CC(CC(C)C)=CC=C1C(C=1C=CC(CC(C)C)=CC=1)NC1=CC=CC(C(=O)C=2N3C=CC=CC3=C(CCCC(O)=O)C=2C)=C1 NLPOIUQIFVMBDD-UHFFFAOYSA-N 0.000 description 1
- ZUUOSXZOHDFOMW-UHFFFAOYSA-N 4-[3-[4-[1-[4-(2-methylpropyl)phenyl]hexoxy]benzoyl]indolizin-1-yl]butanoic acid Chemical compound C=1C=C(C(=O)C=2N3C=CC=CC3=C(CCCC(O)=O)C=2)C=CC=1OC(CCCCC)C1=CC=C(CC(C)C)C=C1 ZUUOSXZOHDFOMW-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- XMHNLZXYPAULDF-UHFFFAOYSA-N 4-bromo-1-(bromomethyl)-2-fluorobenzene Chemical compound FC1=CC(Br)=CC=C1CBr XMHNLZXYPAULDF-UHFFFAOYSA-N 0.000 description 1
- JMCVOEQGNFKGDP-UHFFFAOYSA-N 4-bromo-2-fluoro-1-(2-methylprop-1-enyl)benzene Chemical compound CC(C)=CC1=CC=C(Br)C=C1F JMCVOEQGNFKGDP-UHFFFAOYSA-N 0.000 description 1
- GDAQIXFWRJEUPY-UHFFFAOYSA-N 4-bromo-2-fluoro-1-[1-(methoxymethoxy)pentyl]benzene Chemical compound CCCCC(OCOC)C1=CC=C(Br)C=C1F GDAQIXFWRJEUPY-UHFFFAOYSA-N 0.000 description 1
- UPCARQPLANFGQJ-UHFFFAOYSA-N 4-bromo-2-fluorobenzaldehyde Chemical compound FC1=CC(Br)=CC=C1C=O UPCARQPLANFGQJ-UHFFFAOYSA-N 0.000 description 1
- HXXOPVULXOEHTK-UHFFFAOYSA-N 4-methyl-1,3-dioxol-2-one Chemical compound CC1=COC(=O)O1 HXXOPVULXOEHTK-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- NJESAXZANHETJV-UHFFFAOYSA-N 4-methylsalicylic acid Chemical compound CC1=CC=C(C(O)=O)C(O)=C1 NJESAXZANHETJV-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229910000497 Amalgam Inorganic materials 0.000 description 1
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 1
- 101100226769 Caenorhabditis elegans fax-1 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- WJYIASZWHGOTOU-UHFFFAOYSA-N Heptylamine Chemical compound CCCCCCCN WJYIASZWHGOTOU-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 229910017711 NHRa Inorganic materials 0.000 description 1
- 101100281518 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) fox-2 gene Proteins 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000004403 Prostatic Hyperplasia Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000005764 Theobroma cacao ssp. cacao Nutrition 0.000 description 1
- 235000005767 Theobroma cacao ssp. sphaerocarpum Nutrition 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021623 Tin(IV) bromide Inorganic materials 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 229910001115 Zinc-copper couple Inorganic materials 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- TVHOJKBPUMCFQT-UHFFFAOYSA-N [1-[3-fluoro-4-(1-hydroxypentyl)phenyl]-2-methylpropyl] acetate Chemical compound CCCCC(O)C1=CC=C(C(OC(C)=O)C(C)C)C=C1F TVHOJKBPUMCFQT-UHFFFAOYSA-N 0.000 description 1
- FBZKYQRHMRQALG-UHFFFAOYSA-N [1-[3-fluoro-4-[1-(methoxymethoxy)pentyl]phenyl]-2-methylpropyl] acetate Chemical compound CCCCC(OCOC)C1=CC=C(C(OC(C)=O)C(C)C)C=C1F FBZKYQRHMRQALG-UHFFFAOYSA-N 0.000 description 1
- YBQSHGZGWSUGJX-UHFFFAOYSA-N [4-(2-methylpropyl)phenyl]-phenylmethanone Chemical compound C1=CC(CC(C)C)=CC=C1C(=O)C1=CC=CC=C1 YBQSHGZGWSUGJX-UHFFFAOYSA-N 0.000 description 1
- OWEDCFLMKHNPMB-UHFFFAOYSA-M [Br-].CC(C)=CC1=CC=C([Mg+])C=C1F Chemical compound [Br-].CC(C)=CC1=CC=C([Mg+])C=C1F OWEDCFLMKHNPMB-UHFFFAOYSA-M 0.000 description 1
- XJLXINKUBYWONI-DQQFMEOOSA-N [[(2r,3r,4r,5r)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2s,3r,4s,5s)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate Chemical compound NC(=O)C1=CC=C[N+]([C@@H]2[C@H]([C@@H](O)[C@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](OP(O)(O)=O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 XJLXINKUBYWONI-DQQFMEOOSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910000316 alkaline earth metal phosphate Inorganic materials 0.000 description 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 1
- 125000004947 alkyl aryl amino group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 206010068168 androgenetic alopecia Diseases 0.000 description 1
- 201000002996 androgenic alopecia Diseases 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000001046 cacaotero Nutrition 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical class [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- PSEHHVRCDVOTID-VMAIWCPRSA-N chloro-bis[(1r,3r,4s,5r)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane Chemical compound C([C@H]([C@@H]1C)B(Cl)[C@H]2[C@H](C)[C@]3(C[C@@](C2)(C3(C)C)[H])[H])[C@@]2([H])C(C)(C)[C@]1([H])C2 PSEHHVRCDVOTID-VMAIWCPRSA-N 0.000 description 1
- PSEHHVRCDVOTID-NAVXHOJHSA-N chloro-bis[(1s,3s,4r,5s)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane Chemical compound C([C@@H]([C@H]1C)B(Cl)[C@@H]2[C@@H](C)[C@@]3(C[C@](C2)(C3(C)C)[H])[H])[C@]2([H])C(C)(C)[C@@]1([H])C2 PSEHHVRCDVOTID-NAVXHOJHSA-N 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- LRCIYVMVWAMTKX-UHFFFAOYSA-L chromium(ii) acetate Chemical compound [Cr+2].CC([O-])=O.CC([O-])=O LRCIYVMVWAMTKX-UHFFFAOYSA-L 0.000 description 1
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 description 1
- 229940109126 chromous chloride Drugs 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- TVZPLCNGKSPOJA-UHFFFAOYSA-N copper zinc Chemical compound [Cu].[Zn] TVZPLCNGKSPOJA-UHFFFAOYSA-N 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- WACQKHWOTAEEFS-UHFFFAOYSA-N cyclohexane;ethyl acetate Chemical compound CCOC(C)=O.C1CCCCC1 WACQKHWOTAEEFS-UHFFFAOYSA-N 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- GUGXBRGATQTAFP-UHFFFAOYSA-N cyclopropylmethylbenzene Chemical compound C=1C=CC=CC=1CC1CC1 GUGXBRGATQTAFP-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- GRTGGSXWHGKRSB-UHFFFAOYSA-N dichloromethyl methyl ether Chemical compound COC(Cl)Cl GRTGGSXWHGKRSB-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000001085 differential centrifugation Methods 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- JHZPYCVNHYXFKB-UHFFFAOYSA-N ethyl 4-(2-methylindolizin-1-yl)butanoate Chemical compound C1=CC=CC2=C(CCCC(=O)OCC)C(C)=CN21 JHZPYCVNHYXFKB-UHFFFAOYSA-N 0.000 description 1
- RAJQOOZQCJFBBB-UHFFFAOYSA-N ethyl 4-(2-methylindolizin-3-yl)butanoate Chemical compound C1=CC=CN2C(CCCC(=O)OCC)=C(C)C=C21 RAJQOOZQCJFBBB-UHFFFAOYSA-N 0.000 description 1
- DJNGWBWPJAQKEE-UHFFFAOYSA-N ethyl 4-[1-(3-aminobenzoyl)-2-methylindolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=C(C)C=1C(=O)C1=CC=CC(N)=C1 DJNGWBWPJAQKEE-UHFFFAOYSA-N 0.000 description 1
- XRLHZEXGTWZZGG-UHFFFAOYSA-N ethyl 4-[1-(3-hydroxybenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=CC(O)=C1 XRLHZEXGTWZZGG-UHFFFAOYSA-N 0.000 description 1
- OZXCMCZBKKONRU-UHFFFAOYSA-N ethyl 4-[1-(3-methoxybenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=CC(OC)=C1 OZXCMCZBKKONRU-UHFFFAOYSA-N 0.000 description 1
- WLEZLARBFOHVNZ-UHFFFAOYSA-N ethyl 4-[1-(3-nitrobenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=CC([N+]([O-])=O)=C1 WLEZLARBFOHVNZ-UHFFFAOYSA-N 0.000 description 1
- RDBSCQBRSUYCGS-UHFFFAOYSA-N ethyl 4-[1-(4-aminobenzoyl)-2-methylindolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=C(C)C=1C(=O)C1=CC=C(N)C=C1 RDBSCQBRSUYCGS-UHFFFAOYSA-N 0.000 description 1
- YVLQCPZPXASSOZ-UHFFFAOYSA-N ethyl 4-[1-(4-aminobenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=C(N)C=C1 YVLQCPZPXASSOZ-UHFFFAOYSA-N 0.000 description 1
- QDPKEHJGFWTLJU-UHFFFAOYSA-N ethyl 4-[1-(4-methoxybenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C1=CC=C(OC)C=C1 QDPKEHJGFWTLJU-UHFFFAOYSA-N 0.000 description 1
- IBBRWWGUVCSBGW-UHFFFAOYSA-N ethyl 4-[1-[3-[(2-oxo-2-phenylmethoxyethyl)amino]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=1)=CC=CC=1NCC(=O)OCC1=CC=CC=C1 IBBRWWGUVCSBGW-UHFFFAOYSA-N 0.000 description 1
- ZPLXNXKHESMTDK-UHFFFAOYSA-N ethyl 4-[1-[3-[1-[4-(2-methylpropyl)phenyl]hexylamino]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=CC(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)=CC=1NC(CCCCC)C1=CC=C(CC(C)C)C=C1 ZPLXNXKHESMTDK-UHFFFAOYSA-N 0.000 description 1
- QUZSDMQADJKPGV-UHFFFAOYSA-N ethyl 4-[1-[3-[1-[4-(2-methylpropyl)phenyl]propoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=1)=CC=CC=1OC(CC)C1=CC=C(CC(C)C)C=C1 QUZSDMQADJKPGV-UHFFFAOYSA-N 0.000 description 1
- QFXBZRHJKURXRR-UHFFFAOYSA-N ethyl 4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=1)=CC=CC=1OC(C=1C=CC(CC(C)C)=CC=1)C1=CC=C(CC(C)C)C=C1 QFXBZRHJKURXRR-UHFFFAOYSA-N 0.000 description 1
- BZGOIWIXQDPETK-UHFFFAOYSA-N ethyl 4-[1-[3-[n-benzyl-4-(2-methylpropyl)anilino]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=1)=CC=CC=1N(C=1C=CC(CC(C)C)=CC=1)CC1=CC=CC=C1 BZGOIWIXQDPETK-UHFFFAOYSA-N 0.000 description 1
- KVQBORSFTZBCLM-MGBGTMOVSA-N ethyl 4-[1-[4-[(1r)-1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C1([C@H](OC=2C=CC(=CC=2)C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)CCC)=CC=C(CC(C)C)C=C1 KVQBORSFTZBCLM-MGBGTMOVSA-N 0.000 description 1
- WNQOLSUFXWESCR-XIFFEERXSA-N ethyl 4-[1-[4-[(1r)-2-ethoxy-1-[4-(2-methylpropyl)phenyl]ethoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C1([C@@H](OC=2C=CC(=CC=2)C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)COCC)=CC=C(CC(C)C)C=C1 WNQOLSUFXWESCR-XIFFEERXSA-N 0.000 description 1
- MPAUTOGYWSJFJU-XIFFEERXSA-N ethyl 4-[1-[4-[(1s)-1-[4-(2-methylpropyl)phenyl]but-3-enoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C1([C@H](CC=C)OC2=CC=C(C=C2)C(=O)C=2C=C(N3C=CC=CC3=2)CCCC(=O)OCC)=CC=C(CC(C)C)C=C1 MPAUTOGYWSJFJU-XIFFEERXSA-N 0.000 description 1
- FGBHRNPXQSNAOZ-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[2-methoxy-4-(2-methylpropyl)phenyl]pentoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)C=CC=1OC(CCCC)C1=CC=C(CC(C)C)C=C1OC FGBHRNPXQSNAOZ-UHFFFAOYSA-N 0.000 description 1
- WPFYSHSARHGJOX-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[3-fluoro-4-(2-methylpropyl)phenyl]pentoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)C=CC=1OC(CCCC)C1=CC=C(CC(C)C)C(F)=C1 WPFYSHSARHGJOX-UHFFFAOYSA-N 0.000 description 1
- HEYIJZLOYDBUSF-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[3-methoxy-4-(2-methylpropyl)phenyl]pentoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)C=CC=1OC(CCCC)C1=CC=C(CC(C)C)C(OC)=C1 HEYIJZLOYDBUSF-UHFFFAOYSA-N 0.000 description 1
- GIHISJNMFXYYEP-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(1-acetyloxy-2-methylpropyl)-2-fluorophenyl]pentoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)C=CC=1OC(CCCC)C1=CC=C(C(OC(C)=O)C(C)C)C=C1F GIHISJNMFXYYEP-UHFFFAOYSA-N 0.000 description 1
- UIBLTNARRCDPJG-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]but-2-ynoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=C1)=CC=C1OC(C#CC)C1=CC=C(CC(C)C)C=C1 UIBLTNARRCDPJG-UHFFFAOYSA-N 0.000 description 1
- MPAUTOGYWSJFJU-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]but-3-enoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=C1)=CC=C1OC(CC=C)C1=CC=C(CC(C)C)C=C1 MPAUTOGYWSJFJU-UHFFFAOYSA-N 0.000 description 1
- CWRHLWFLAKOEBS-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]heptoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)C=CC=1OC(CCCCCC)C1=CC=C(CC(C)C)C=C1 CWRHLWFLAKOEBS-UHFFFAOYSA-N 0.000 description 1
- QPXSIOWWDMKHCC-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]hexoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)C=CC=1OC(CCCCC)C1=CC=C(CC(C)C)C=C1 QPXSIOWWDMKHCC-UHFFFAOYSA-N 0.000 description 1
- WTVYKUPKJHCKIQ-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]pent-4-enoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=C1)=CC=C1OC(CCC=C)C1=CC=C(CC(C)C)C=C1 WTVYKUPKJHCKIQ-UHFFFAOYSA-N 0.000 description 1
- WPHCLHAJLSRZEX-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]pentoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=1C=C(C(=O)C2=C3C=CC=CN3C(CCCC(=O)OCC)=C2)C=CC=1OC(CCCC)C1=CC=C(CC(C)C)C=C1 WPHCLHAJLSRZEX-UHFFFAOYSA-N 0.000 description 1
- GZQDXVYTCMHARY-UHFFFAOYSA-N ethyl 4-[1-[4-[1-[4-(2-methylpropyl)phenyl]propoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=C1)=CC=C1OC(CC)C1=CC=C(CC(C)C)C=C1 GZQDXVYTCMHARY-UHFFFAOYSA-N 0.000 description 1
- UTGCWDJGPMVYJR-UHFFFAOYSA-N ethyl 4-[1-[4-[4,4,4-trifluoro-1-[4-(2-methylpropyl)phenyl]butoxy]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=C1)=CC=C1OC(CCC(F)(F)F)C1=CC=C(CC(C)C)C=C1 UTGCWDJGPMVYJR-UHFFFAOYSA-N 0.000 description 1
- PPHJHKOSHVHMAC-UHFFFAOYSA-N ethyl 4-[1-[4-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]-2-methylindolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=C(C)C=1C(=O)C(C=C1)=CC=C1NC(C=1C=CC(CC(C)C)=CC=1)C1=CC=C(CC(C)C)C=C1 PPHJHKOSHVHMAC-UHFFFAOYSA-N 0.000 description 1
- ZCZRUDPZWZDSOC-UHFFFAOYSA-N ethyl 4-[1-[4-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=CC=1C(=O)C(C=C1)=CC=C1NC(C=1C=CC(CC(C)C)=CC=1)C1=CC=C(CC(C)C)C=C1 ZCZRUDPZWZDSOC-UHFFFAOYSA-N 0.000 description 1
- NOSQBYIVSGNKPI-UHFFFAOYSA-N ethyl 4-[2-methyl-1-(3-nitrobenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=C(C)C=1C(=O)C1=CC=CC([N+]([O-])=O)=C1 NOSQBYIVSGNKPI-UHFFFAOYSA-N 0.000 description 1
- DFMXVPMPBUUNSL-UHFFFAOYSA-N ethyl 4-[2-methyl-1-(4-nitrobenzoyl)indolizin-3-yl]butanoate Chemical compound C=12C=CC=CN2C(CCCC(=O)OCC)=C(C)C=1C(=O)C1=CC=C([N+]([O-])=O)C=C1 DFMXVPMPBUUNSL-UHFFFAOYSA-N 0.000 description 1
- AKSIIHWUCQRZAJ-UHFFFAOYSA-N ethyl 4-[2-methyl-3-(4-nitrobenzoyl)indolizin-1-yl]butanoate Chemical compound N12C=CC=CC2=C(CCCC(=O)OCC)C(C)=C1C(=O)C1=CC=C([N+]([O-])=O)C=C1 AKSIIHWUCQRZAJ-UHFFFAOYSA-N 0.000 description 1
- PZARCESDXQTGPI-UHFFFAOYSA-N ethyl 4-[3-(3-aminobenzoyl)-2-methylindolizin-1-yl]butanoate Chemical compound N12C=CC=CC2=C(CCCC(=O)OCC)C(C)=C1C(=O)C1=CC=CC(N)=C1 PZARCESDXQTGPI-UHFFFAOYSA-N 0.000 description 1
- DOEVGXAZMLJJHI-UHFFFAOYSA-N ethyl 4-[3-(3-aminobenzoyl)indolizin-1-yl]butanoate Chemical compound N12C=CC=CC2=C(CCCC(=O)OCC)C=C1C(=O)C1=CC=CC(N)=C1 DOEVGXAZMLJJHI-UHFFFAOYSA-N 0.000 description 1
- DKLUCRJLEOUTAX-UHFFFAOYSA-N ethyl 4-[3-(3-hydroxybenzoyl)indolizin-1-yl]butanoate Chemical compound N12C=CC=CC2=C(CCCC(=O)OCC)C=C1C(=O)C1=CC=CC(O)=C1 DKLUCRJLEOUTAX-UHFFFAOYSA-N 0.000 description 1
- UURIOKDRQQTMJQ-UHFFFAOYSA-N ethyl 4-[3-(4-aminobenzoyl)-2-methylindolizin-1-yl]butanoate Chemical compound N12C=CC=CC2=C(CCCC(=O)OCC)C(C)=C1C(=O)C1=CC=C(N)C=C1 UURIOKDRQQTMJQ-UHFFFAOYSA-N 0.000 description 1
- VHUMWVOFHQNLRS-UHFFFAOYSA-N ethyl 4-[3-[4-[1-[4-(2-methylpropyl)phenyl]hexoxy]benzoyl]indolizin-1-yl]butanoate Chemical compound C=1C=C(C(=O)C=2N3C=CC=CC3=C(CCCC(=O)OCC)C=2)C=CC=1OC(CCCCC)C1=CC=C(CC(C)C)C=C1 VHUMWVOFHQNLRS-UHFFFAOYSA-N 0.000 description 1
- HQQNHZRCDTUQON-UHFFFAOYSA-N ethyl 4-[3-[4-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]indolizin-1-yl]butanoate Chemical compound N12C=CC=CC2=C(CCCC(=O)OCC)C=C1C(=O)C(C=C1)=CC=C1NC(C=1C=CC(CC(C)C)=CC=1)C1=CC=C(CC(C)C)C=C1 HQQNHZRCDTUQON-UHFFFAOYSA-N 0.000 description 1
- FYLUYSKYLCWQCD-UHFFFAOYSA-N ethyl 4-indolizin-1-yl-4-oxobutanoate Chemical compound C1=CC=CC2=C(C(=O)CCC(=O)OCC)C=CN21 FYLUYSKYLCWQCD-UHFFFAOYSA-N 0.000 description 1
- NUNYSIJLUHMKAT-UHFFFAOYSA-N ethyl 4-indolizin-1-ylbutanoate Chemical compound C1=CC=CC2=C(CCCC(=O)OCC)C=CN21 NUNYSIJLUHMKAT-UHFFFAOYSA-N 0.000 description 1
- DVOPEILSPUBYLM-UHFFFAOYSA-N ethyl 5-pyridin-2-ylpentanoate Chemical compound CCOC(=O)CCCCC1=CC=CC=N1 DVOPEILSPUBYLM-UHFFFAOYSA-N 0.000 description 1
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000003106 haloaryl group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical class O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- 201000010066 hyperandrogenism Diseases 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- JYJVVHFRSFVEJM-UHFFFAOYSA-N iodosobenzene Chemical compound O=IC1=CC=CC=C1 JYJVVHFRSFVEJM-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000015122 lemonade Nutrition 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 description 1
- 239000004137 magnesium phosphate Substances 0.000 description 1
- 229910000157 magnesium phosphate Inorganic materials 0.000 description 1
- 229960002261 magnesium phosphate Drugs 0.000 description 1
- 235000010994 magnesium phosphates Nutrition 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- LWLPYZUDBNFNAH-UHFFFAOYSA-M magnesium;butane;bromide Chemical compound [Mg+2].[Br-].CCC[CH2-] LWLPYZUDBNFNAH-UHFFFAOYSA-M 0.000 description 1
- DQEUYIQDSMINEY-UHFFFAOYSA-M magnesium;prop-1-ene;bromide Chemical compound [Mg+2].[Br-].[CH2-]C=C DQEUYIQDSMINEY-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000003863 metallic catalyst Substances 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- ASIFSMGTQQYZPW-UHFFFAOYSA-N methyl 3-methoxy-4-(2-methylprop-1-enyl)benzoate Chemical compound COC(=O)C1=CC=C(C=C(C)C)C(OC)=C1 ASIFSMGTQQYZPW-UHFFFAOYSA-N 0.000 description 1
- LLEXCSBUSVRBCA-UHFFFAOYSA-N methyl 3-methoxy-4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C(OC)=C1 LLEXCSBUSVRBCA-UHFFFAOYSA-N 0.000 description 1
- DCXFLSHDURQRML-UHFFFAOYSA-N methyl 4-(bromomethyl)-2-methoxybenzoate Chemical compound COC(=O)C1=CC=C(CBr)C=C1OC DCXFLSHDURQRML-UHFFFAOYSA-N 0.000 description 1
- STRLWTVZXMRWIX-UHFFFAOYSA-N methyl 4-(diethoxyphosphorylmethyl)-3-methoxybenzoate Chemical compound CCOP(=O)(OCC)CC1=CC=C(C(=O)OC)C=C1OC STRLWTVZXMRWIX-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical class C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- SWVGZFQJXVPIKM-UHFFFAOYSA-N n,n-bis(methylamino)propan-1-amine Chemical compound CCCN(NC)NC SWVGZFQJXVPIKM-UHFFFAOYSA-N 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- JVHPKYBRJQNPAT-UHFFFAOYSA-N n-cyclohexyl-2,2-diphenylethenimine Chemical compound C1CCCCC1N=C=C(C=1C=CC=CC=1)C1=CC=CC=C1 JVHPKYBRJQNPAT-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N pentanal Chemical compound CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- 125000004346 phenylpentyl group Chemical group C1(=CC=CC=C1)CCCCC* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000006410 propenylene group Chemical group 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 201000004240 prostatic hypertrophy Diseases 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- IOKVYBXALADYML-UHFFFAOYSA-M sodium;4-[1-[3-[bis[4-(2-methylpropyl)phenyl]methylamino]benzoyl]indolizin-3-yl]butanoate Chemical compound [Na+].C1=CC(CC(C)C)=CC=C1C(C=1C=CC(CC(C)C)=CC=1)NC1=CC=CC(C(=O)C2=C3C=CC=CN3C(CCCC([O-])=O)=C2)=C1 IOKVYBXALADYML-UHFFFAOYSA-M 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005934 tert-pentyloxycarbonyl group Chemical group 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- LTSUHJWLSNQKIP-UHFFFAOYSA-J tin(iv) bromide Chemical compound Br[Sn](Br)(Br)Br LTSUHJWLSNQKIP-UHFFFAOYSA-J 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- UBZYKBZMAMTNKW-UHFFFAOYSA-J titanium tetrabromide Chemical compound Br[Ti](Br)(Br)Br UBZYKBZMAMTNKW-UHFFFAOYSA-J 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- XKGLSKVNOSHTAD-UHFFFAOYSA-N valerophenone Chemical compound CCCCC(=O)C1=CC=CC=C1 XKGLSKVNOSHTAD-UHFFFAOYSA-N 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/02—Drugs for disorders of the urinary system of urine or of the urinary tract, e.g. urine acidifiers
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Reproductive Health (AREA)
- Urology & Nephrology (AREA)
- Endocrinology (AREA)
- Dermatology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Indole Compounds (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919113027A GB9113027D0 (en) | 1991-06-17 | 1991-06-17 | Indolizine derivatives |
| GB9113027.8 | 1991-06-17 | ||
| GB9120764.7 | 1991-09-30 | ||
| GB919120764A GB9120764D0 (en) | 1991-09-30 | 1991-09-30 | Heterocyclic derivatives |
| GB9124345.1 | 1991-11-15 | ||
| GB919124345A GB9124345D0 (en) | 1991-11-15 | 1991-11-15 | Heterocyclic derivatives |
| GB929203809A GB9203809D0 (en) | 1992-02-21 | 1992-02-21 | Heterocyclic derivatives |
| GB9203809.0 | 1992-02-21 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2071375A1 CA2071375A1 (en) | 1992-12-18 |
| CA2071375C true CA2071375C (en) | 2003-02-11 |
Family
ID=27450702
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002071375A Expired - Fee Related CA2071375C (en) | 1991-06-17 | 1992-06-16 | Heterocyclic derivatives |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US5334716A (oth) |
| EP (1) | EP0519353B1 (oth) |
| JP (1) | JP2663794B2 (oth) |
| KR (1) | KR100244879B1 (oth) |
| CN (1) | CN1042226C (oth) |
| AT (1) | ATE195521T1 (oth) |
| AU (1) | AU656197B2 (oth) |
| CA (1) | CA2071375C (oth) |
| DE (1) | DE69231350T2 (oth) |
| DK (1) | DK0519353T3 (oth) |
| ES (1) | ES2149160T3 (oth) |
| GR (1) | GR3034429T3 (oth) |
| HU (2) | HUT61544A (oth) |
| IE (1) | IE921805A1 (oth) |
| MX (1) | MX9202901A (oth) |
| PT (1) | PT519353E (oth) |
| TW (1) | TW203050B (oth) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9318790D0 (en) * | 1993-09-10 | 1993-10-27 | Fujisawa Pharmaceutical Co | Heterocyclic derivatives |
| US6214876B1 (en) | 1994-07-21 | 2001-04-10 | Eli Lilly And Company | Indene-1-acetamide sPLA2 inhibitors |
| US5543417A (en) * | 1994-10-21 | 1996-08-06 | Merck & Co., Inc. | Combination method of treating acne using 4-AZA-5α-cholestan-ones and 4-AZA-5α-androstan-ones as selective 5α-reductase inhibitors with anti-bacterial, keratolytic, or anti-inflammatory agents |
| WO2003020311A1 (fr) * | 2001-08-28 | 2003-03-13 | Fujisawa Pharmaceutical Co., Ltd. | Remedes contre les maladies de la peau |
| CN1678314A (zh) * | 2002-08-27 | 2005-10-05 | 默克专利有限公司 | 作为raf-激酶抑制剂的甘氨酸酰胺衍生物 |
| EP1543875A1 (en) * | 2003-12-04 | 2005-06-22 | Boehringer Ingelheim Pharma GmbH & Co. KG | Novel metathesis ruthenium catalyst |
| FR2893616B1 (fr) * | 2005-11-23 | 2008-01-04 | Sanofi Aventis Sa | Nouveaux derives d'indolizine, leur procede de preparation et les compositions therapeutiques les comprenant |
| CN101486710B (zh) * | 2009-02-11 | 2011-04-06 | 中国科学院上海有机化学研究所 | 一种合成3-卤代中氮茚类化合物的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1268424A (en) * | 1969-10-04 | 1972-03-29 | Beecham Group Ltd | Indolizine derivatives |
| US3806513A (en) * | 1969-10-04 | 1974-04-23 | Beecham Group Ltd | Alpha-substituted indolizine propionic acid and its salts |
| US4205074A (en) * | 1977-05-16 | 1980-05-27 | Hokuriku Pharmaceutical Co., Ltd. | Anti-spasmodic substituted quinolizidine and indolizidine compounds |
| US4935240A (en) * | 1987-06-04 | 1990-06-19 | Ono Pharmaceutical Co., Ltd. | Benzoylaminophenoxybutanoic acid derivatives |
| GB9011335D0 (en) * | 1990-05-21 | 1990-07-11 | Fujisawa Pharmaceutical Co | Indolebutyric acid derivatives and process for preparation thereof |
-
1992
- 1992-06-02 US US07/892,453 patent/US5334716A/en not_active Expired - Fee Related
- 1992-06-12 TW TW081104603A patent/TW203050B/zh active
- 1992-06-13 ES ES92109968T patent/ES2149160T3/es not_active Expired - Lifetime
- 1992-06-13 EP EP92109968A patent/EP0519353B1/en not_active Expired - Lifetime
- 1992-06-13 AT AT92109968T patent/ATE195521T1/de not_active IP Right Cessation
- 1992-06-13 DE DE69231350T patent/DE69231350T2/de not_active Expired - Fee Related
- 1992-06-13 PT PT92109968T patent/PT519353E/pt unknown
- 1992-06-13 DK DK92109968T patent/DK0519353T3/da active
- 1992-06-15 HU HU929201993A patent/HUT61544A/hu unknown
- 1992-06-15 KR KR1019920010367A patent/KR100244879B1/ko not_active Expired - Fee Related
- 1992-06-16 CA CA002071375A patent/CA2071375C/en not_active Expired - Fee Related
- 1992-06-16 JP JP4157074A patent/JP2663794B2/ja not_active Expired - Fee Related
- 1992-06-16 CN CN92104790A patent/CN1042226C/zh not_active Expired - Fee Related
- 1992-06-16 MX MX9202901A patent/MX9202901A/es not_active IP Right Cessation
- 1992-06-16 AU AU18270/92A patent/AU656197B2/en not_active Ceased
- 1992-07-01 IE IE180592A patent/IE921805A1/en not_active Application Discontinuation
-
1995
- 1995-06-22 HU HU95P/P00394P patent/HU211621A9/hu unknown
-
2000
- 2000-09-18 GR GR20000402118T patent/GR3034429T3/el not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU656197B2 (en) | 1995-01-27 |
| EP0519353A3 (en) | 1993-04-14 |
| EP0519353A2 (en) | 1992-12-23 |
| CN1067893A (zh) | 1993-01-13 |
| CN1042226C (zh) | 1999-02-24 |
| JP2663794B2 (ja) | 1997-10-15 |
| CA2071375A1 (en) | 1992-12-18 |
| DE69231350T2 (de) | 2001-01-04 |
| MX9202901A (es) | 1993-05-01 |
| PT519353E (pt) | 2000-12-29 |
| DK0519353T3 (da) | 2000-09-18 |
| HU211621A9 (en) | 1995-12-28 |
| US5334716A (en) | 1994-08-02 |
| DE69231350D1 (de) | 2000-09-21 |
| EP0519353B1 (en) | 2000-08-16 |
| JPH05178856A (ja) | 1993-07-20 |
| HU9201993D0 (en) | 1992-09-28 |
| HUT61544A (en) | 1993-01-28 |
| TW203050B (oth) | 1993-04-01 |
| KR930000513A (ko) | 1993-01-15 |
| KR100244879B1 (ko) | 2000-03-02 |
| IE921805A1 (en) | 1992-12-30 |
| AU1827092A (en) | 1992-12-24 |
| GR3034429T3 (en) | 2000-12-29 |
| ATE195521T1 (de) | 2000-09-15 |
| ES2149160T3 (es) | 2000-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0482539B1 (en) | Peptide compounds, processes for preparation thereof and pharmaceutical composition comprising the same | |
| CA2180730C (en) | Substituted 3-arylidene-7-azaoxindole compounds and process for their preparation | |
| EP0458207B1 (en) | Indole derivatives | |
| PL176451B1 (pl) | Pochodne indolu, środek farmaceutyczny zawierający pochodne indolu i sposób wytwarzania pochodnych indolu | |
| WO1993013099A1 (en) | ARYL KETONES AS TESTOSTERONE 5α-REDUCTASE INHIBITORS | |
| NO874904L (no) | Fremgangsmaate for fremstilling av nye imidazopyridin-forbindelser. | |
| NO171913B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive tricykliske forbindelser | |
| US5530019A (en) | Indole derivatives useful as testosterone 5α-reductase inhibitors | |
| CA2071375C (en) | Heterocyclic derivatives | |
| EP0314280B1 (en) | Process for the preparation of fused pyridine compounds | |
| EP0600084A1 (en) | Indole derivatives | |
| US5312829A (en) | Indole derivatives | |
| EP0717742B1 (en) | Process for the preparation of indolizine derivatives | |
| HU197565B (en) | Process for producing substituted indoles and pharmaceuticals comprising same | |
| US5212320A (en) | Indole derivatives and their use for testosterone 5-alpha-reductase-mediated diseases | |
| RU2120942C1 (ru) | ПРОИЗВОДНЫЕ ИНДОЛИЗИНА, СПОСОБ ИХ ПОЛУЧЕНИЯ, ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ, СПОСОБ ИНГИБИРОВАНИЯ ТЕСТОСТЕРОН 5α-РЕДУКТАЗЫ | |
| WO1993016996A1 (en) | Indole derivatives as testosterone-5-alpha-reductase inhibitors | |
| WO1993005019A1 (en) | Indole derivatives as 5-alpha-reductase inhibitor | |
| AU707750B2 (en) | Substituted 1-indolylpropyl-4-phenethylpiperazine derivatives | |
| WO1994018168A1 (en) | Indole derivatives as 5-alpha-reductase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |