CA1337522C - Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof - Google Patents
Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereofInfo
- Publication number
- CA1337522C CA1337522C CA000272430A CA272430A CA1337522C CA 1337522 C CA1337522 C CA 1337522C CA 000272430 A CA000272430 A CA 000272430A CA 272430 A CA272430 A CA 272430A CA 1337522 C CA1337522 C CA 1337522C
- Authority
- CA
- Canada
- Prior art keywords
- formula
- group
- amino
- compound
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- -1 3,7-disubstituted-3-cephem-4-carboxylic acid compounds Chemical class 0.000 title claims abstract description 494
- 238000000034 method Methods 0.000 title claims description 164
- 230000008569 process Effects 0.000 title claims description 144
- 238000002360 preparation method Methods 0.000 title claims description 55
- 150000001875 compounds Chemical class 0.000 claims abstract description 309
- 150000003839 salts Chemical class 0.000 claims abstract description 204
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 145
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 134
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 70
- 150000002367 halogens Chemical group 0.000 claims abstract description 69
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 65
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 58
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 50
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 50
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 37
- 239000001257 hydrogen Substances 0.000 claims abstract description 36
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 34
- 125000001424 substituent group Chemical group 0.000 claims abstract description 34
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 24
- 125000005042 acyloxymethyl group Chemical group 0.000 claims abstract description 21
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims abstract description 21
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 20
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims abstract description 19
- 125000004442 acylamino group Chemical group 0.000 claims abstract description 18
- 238000006243 chemical reaction Methods 0.000 claims description 132
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 121
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 99
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 78
- 239000002253 acid Substances 0.000 claims description 77
- 125000003342 alkenyl group Chemical group 0.000 claims description 48
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 48
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 35
- 125000006239 protecting group Chemical group 0.000 claims description 35
- 125000002252 acyl group Chemical group 0.000 claims description 31
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 31
- 238000003379 elimination reaction Methods 0.000 claims description 30
- 230000007062 hydrolysis Effects 0.000 claims description 29
- 238000006460 hydrolysis reaction Methods 0.000 claims description 29
- 239000003795 chemical substances by application Substances 0.000 claims description 28
- 239000002585 base Substances 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- 125000003118 aryl group Chemical group 0.000 claims description 25
- 229910052783 alkali metal Inorganic materials 0.000 claims description 24
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 23
- 125000003277 amino group Chemical group 0.000 claims description 19
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 17
- 125000005110 aryl thio group Chemical group 0.000 claims description 17
- 125000004104 aryloxy group Chemical group 0.000 claims description 17
- 125000000623 heterocyclic group Chemical group 0.000 claims description 16
- 125000004414 alkyl thio group Chemical group 0.000 claims description 15
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical group [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 claims description 11
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 9
- 125000001589 carboacyl group Chemical group 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 8
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 230000007935 neutral effect Effects 0.000 claims description 8
- 125000001544 thienyl group Chemical group 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 6
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 claims description 5
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 5
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 5
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 5
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 claims description 4
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 4
- 239000012948 isocyanate Substances 0.000 claims description 4
- 230000001590 oxidative effect Effects 0.000 claims description 4
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 4
- DDLWWOLZXHAVNY-PVQCJRHBSA-N (6R)-3-(carbamoyloxymethyl)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C1=CC(=CC=C1)O DDLWWOLZXHAVNY-PVQCJRHBSA-N 0.000 claims description 3
- QDDMXPSXDJRLNO-LESKNEHBSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C=1N=C(SC=1)N QDDMXPSXDJRLNO-LESKNEHBSA-N 0.000 claims description 3
- DSBFHCFBFBNGPS-LRHAYUFXSA-N (6R)-7-[[2-(3-carbamoyloxyphenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=CC=C1)OC(N)=O DSBFHCFBFBNGPS-LRHAYUFXSA-N 0.000 claims description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 239000003456 ion exchange resin Substances 0.000 claims description 3
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 3
- 150000002540 isothiocyanates Chemical class 0.000 claims description 3
- 125000001425 triazolyl group Chemical group 0.000 claims description 3
- HKFQKFMKQDZYJH-PVQCJRHBSA-N (6R)-3-(carbamoyloxymethyl)-7-[[2-(3-chloro-4-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C1=CC(=C(C=C1)O)Cl HKFQKFMKQDZYJH-PVQCJRHBSA-N 0.000 claims description 2
- LSSBHOQSJVWGJN-LESKNEHBSA-N (6R)-3-(carbamoyloxymethyl)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C=1N=C(SC=1)NC(C(F)(F)F)=O LSSBHOQSJVWGJN-LESKNEHBSA-N 0.000 claims description 2
- YSFVFWQKYKNZLS-LESKNEHBSA-N (6R)-3-formyl-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)C=O)C(=O)O)C1=O)C=1N=C(SC=1)NC(C(F)(F)F)=O YSFVFWQKYKNZLS-LESKNEHBSA-N 0.000 claims description 2
- HJJDBAOLQAWBMH-WCRCJTMVSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC=C(N=1)C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)=NOC HJJDBAOLQAWBMH-WCRCJTMVSA-N 0.000 claims description 2
- NZIYUPNWNHTHLH-WCRCJTMVSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C=1N=C(SC=1)N NZIYUPNWNHTHLH-WCRCJTMVSA-N 0.000 claims description 2
- VIGCKDLYZDIDJJ-LRHAYUFXSA-N (6R)-7-[[2-(3-carbamoyloxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C1=CC(=CC=C1)OC(N)=O VIGCKDLYZDIDJJ-LRHAYUFXSA-N 0.000 claims description 2
- AGWWTUWTOBEQFE-UHFFFAOYSA-N 4-methyl-1h-1,2,4-triazole-5-thione Chemical compound CN1C=NN=C1S AGWWTUWTOBEQFE-UHFFFAOYSA-N 0.000 claims description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims 15
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims 8
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 claims 7
- 229930186147 Cephalosporin Natural products 0.000 claims 5
- 229940124587 cephalosporin Drugs 0.000 claims 5
- 150000001780 cephalosporins Chemical class 0.000 claims 5
- 150000001242 acetic acid derivatives Chemical class 0.000 claims 4
- ILROLYQPRYHHFG-UHFFFAOYSA-N 1-$l^{1}-oxidanylprop-2-en-1-one Chemical group [O]C(=O)C=C ILROLYQPRYHHFG-UHFFFAOYSA-N 0.000 claims 3
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 claims 3
- 150000002513 isocyanates Chemical class 0.000 claims 3
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims 3
- 125000001477 organic nitrogen group Chemical group 0.000 claims 3
- 238000010561 standard procedure Methods 0.000 claims 3
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 claims 2
- 150000003951 lactams Chemical class 0.000 claims 2
- XBIICAOWAWDGEI-LNUXAPHWSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)(O)CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C=1N=C(SC=1)N XBIICAOWAWDGEI-LNUXAPHWSA-N 0.000 claims 1
- ILVAWHVUNZGZTN-LRHAYUFXSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-cyclopentyloxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1(CCCC1)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)N ILVAWHVUNZGZTN-LRHAYUFXSA-N 0.000 claims 1
- FAPNNRBIDHHACF-PVQCJRHBSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-cyclopentyloxyiminoacetyl]amino]-8-oxo-3-(2H-tetrazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1(CCCC1)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2)C(=O)O)C1=O)C=1N=C(SC=1)N FAPNNRBIDHHACF-PVQCJRHBSA-N 0.000 claims 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000006627 ethoxycarbonylamino group Chemical group 0.000 claims 1
- 244000052616 bacterial pathogen Species 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 424
- 241000786363 Rhampholeon spectrum Species 0.000 description 407
- 239000000203 mixture Substances 0.000 description 247
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 176
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 168
- 239000000243 solution Substances 0.000 description 158
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 145
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 130
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 121
- 239000007864 aqueous solution Substances 0.000 description 117
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 105
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 96
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 96
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 86
- 239000002904 solvent Substances 0.000 description 86
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 85
- 229960000443 hydrochloric acid Drugs 0.000 description 82
- 235000011167 hydrochloric acid Nutrition 0.000 description 82
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 75
- 238000003756 stirring Methods 0.000 description 72
- 238000001816 cooling Methods 0.000 description 69
- 239000010410 layer Substances 0.000 description 64
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 63
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 55
- 239000011541 reaction mixture Substances 0.000 description 55
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 48
- 235000019341 magnesium sulphate Nutrition 0.000 description 48
- 230000002829 reductive effect Effects 0.000 description 48
- 239000000284 extract Substances 0.000 description 44
- 238000001914 filtration Methods 0.000 description 44
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 42
- 235000017557 sodium bicarbonate Nutrition 0.000 description 42
- 239000013078 crystal Substances 0.000 description 41
- 239000011780 sodium chloride Substances 0.000 description 37
- 239000000843 powder Substances 0.000 description 36
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 34
- 239000000706 filtrate Substances 0.000 description 34
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 30
- 235000011054 acetic acid Nutrition 0.000 description 29
- 229920006395 saturated elastomer Polymers 0.000 description 29
- 239000003921 oil Substances 0.000 description 28
- 239000000725 suspension Substances 0.000 description 28
- NYBWUHOMYZZKOR-UHFFFAOYSA-N tes-adt Chemical class C1=C2C(C#C[Si](CC)(CC)CC)=C(C=C3C(SC=C3)=C3)C3=C(C#C[Si](CC)(CC)CC)C2=CC2=C1SC=C2 NYBWUHOMYZZKOR-UHFFFAOYSA-N 0.000 description 28
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 26
- 239000007858 starting material Substances 0.000 description 25
- 239000002244 precipitate Substances 0.000 description 23
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 22
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 21
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 20
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 20
- 230000001376 precipitating effect Effects 0.000 description 20
- 150000002148 esters Chemical class 0.000 description 19
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 18
- 230000000875 corresponding effect Effects 0.000 description 17
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 16
- 238000004440 column chromatography Methods 0.000 description 15
- 239000002198 insoluble material Substances 0.000 description 15
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 15
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 13
- 238000007796 conventional method Methods 0.000 description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 230000002411 adverse Effects 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 12
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- VGIJLQLDEHZKNU-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=CC(O)=C1 VGIJLQLDEHZKNU-UHFFFAOYSA-N 0.000 description 11
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 11
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 11
- 241000699670 Mus sp. Species 0.000 description 11
- 150000001721 carbon Chemical group 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- 229940086542 triethylamine Drugs 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 10
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 description 10
- 150000007530 organic bases Chemical class 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 235000011181 potassium carbonates Nutrition 0.000 description 10
- 238000001228 spectrum Methods 0.000 description 10
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 9
- 230000008030 elimination Effects 0.000 description 9
- 235000019253 formic acid Nutrition 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 9
- 150000007529 inorganic bases Chemical class 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 8
- 230000000844 anti-bacterial effect Effects 0.000 description 8
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 150000007522 mineralic acids Chemical class 0.000 description 8
- 150000007524 organic acids Chemical class 0.000 description 8
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 8
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 8
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 8
- 238000010792 warming Methods 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 7
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 7
- POBMBNPEUPDXRS-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(N)=N1 POBMBNPEUPDXRS-UHFFFAOYSA-N 0.000 description 7
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 7
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- NLARCUDOUOQRPB-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(N)=N1 NLARCUDOUOQRPB-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 6
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 235000017281 sodium acetate Nutrition 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 125000005270 trialkylamine group Chemical group 0.000 description 6
- RVBOFXPFJHCIBC-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 RVBOFXPFJHCIBC-UHFFFAOYSA-N 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 5
- 125000005907 alkyl ester group Chemical group 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 229910001873 dinitrogen Inorganic materials 0.000 description 5
- BTEPYCPXBCCSDL-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetate Chemical compound CCOC(=O)C(=NO)C1=CSC(N)=N1 BTEPYCPXBCCSDL-UHFFFAOYSA-N 0.000 description 5
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 5
- 239000012046 mixed solvent Substances 0.000 description 5
- 238000005185 salting out Methods 0.000 description 5
- 239000001632 sodium acetate Substances 0.000 description 5
- XINQFOMFQFGGCQ-UHFFFAOYSA-L (2-dodecoxy-2-oxoethyl)-[6-[(2-dodecoxy-2-oxoethyl)-dimethylazaniumyl]hexyl]-dimethylazanium;dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCCCCOC(=O)C[N+](C)(C)CCCCCC[N+](C)(C)CC(=O)OCCCCCCCCCCCC XINQFOMFQFGGCQ-UHFFFAOYSA-L 0.000 description 4
- RTRCVCSWKHSZJC-LNUXAPHWSA-N (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C=1N=C(SC=1)NC=O RTRCVCSWKHSZJC-LNUXAPHWSA-N 0.000 description 4
- HGZZXAIQRPGHLO-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=C(O)C(Cl)=C1 HGZZXAIQRPGHLO-UHFFFAOYSA-N 0.000 description 4
- NBDYDHVCTKPDRI-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=CC(O)=C1 NBDYDHVCTKPDRI-UHFFFAOYSA-N 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 4
- 150000008041 alkali metal carbonates Chemical class 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 4
- NWVPUDXLGUWDPK-UHFFFAOYSA-N ethyl 2-hydroxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetate Chemical compound CCOC(=O)C(=NO)C1=CSC(C)=N1 NWVPUDXLGUWDPK-UHFFFAOYSA-N 0.000 description 4
- JZWIECIMQZFZBA-UHFFFAOYSA-N ethyl 2-methoxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(C)=N1 JZWIECIMQZFZBA-UHFFFAOYSA-N 0.000 description 4
- LULLGGWIEBUSRX-UHFFFAOYSA-N ethyl 4-bromo-2-methoxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NOC)C(=O)CBr LULLGGWIEBUSRX-UHFFFAOYSA-N 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 4
- XIQUJVRFXPBMHS-UHFFFAOYSA-N hydron;o-prop-2-enylhydroxylamine;chloride Chemical compound Cl.NOCC=C XIQUJVRFXPBMHS-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- DUPFUKBMWBUFJO-UHFFFAOYSA-N methyl 2-methoxyimino-2-(3-methoxyphenyl)acetate Chemical compound CON=C(C(=O)OC)C1=CC=CC(OC)=C1 DUPFUKBMWBUFJO-UHFFFAOYSA-N 0.000 description 4
- 239000012452 mother liquor Substances 0.000 description 4
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 4
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- 239000003223 protective agent Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- GRNOZCCBOFGDCL-UHFFFAOYSA-N 2,2,2-trichloroacetyl isocyanate Chemical compound ClC(Cl)(Cl)C(=O)N=C=O GRNOZCCBOFGDCL-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- LLKKDHSXDQIHKK-UHFFFAOYSA-N 2-methoxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetic acid Chemical compound CON=C(C(O)=O)C1=CSC(C)=N1 LLKKDHSXDQIHKK-UHFFFAOYSA-N 0.000 description 3
- SRXBNGGXTMGKLV-UHFFFAOYSA-N 2-methoxyimino-2-(3-methyl-2-methylsulfonylimino-1,3-thiazol-4-yl)acetic acid Chemical compound CON=C(C(O)=O)C1=CSC(=NS(C)(=O)=O)N1C SRXBNGGXTMGKLV-UHFFFAOYSA-N 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 150000004703 alkoxides Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000005587 bubbling Effects 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- HASOOENYFDJEAK-UHFFFAOYSA-N ethyl 2-methoxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(C(C)=O)=NOC HASOOENYFDJEAK-UHFFFAOYSA-N 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 159000000003 magnesium salts Chemical class 0.000 description 3
- SPUACDWLOLSOQO-UHFFFAOYSA-M methoxyazanium;chloride Chemical compound [Cl-].CO[NH3+] SPUACDWLOLSOQO-UHFFFAOYSA-M 0.000 description 3
- UPUSOGVFGJXYSC-UHFFFAOYSA-N methyl 2-(3-hydroxyphenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=CC(O)=C1 UPUSOGVFGJXYSC-UHFFFAOYSA-N 0.000 description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 230000036961 partial effect Effects 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 230000002633 protecting effect Effects 0.000 description 3
- 239000011369 resultant mixture Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 3
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- FUJHOWWZSJQUCM-XCWJXAQQSA-N (6R)-7-[[2-(3-acetyloxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C1=CC(=CC=C1)OC(C)=O FUJHOWWZSJQUCM-XCWJXAQQSA-N 0.000 description 2
- KDFVCYIRODYRNU-LRHAYUFXSA-N (6R)-7-[[2-(4-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC=C(C=C1)O KDFVCYIRODYRNU-LRHAYUFXSA-N 0.000 description 2
- ZRRPQGVLWZVEOH-LEQGEALCSA-N (6R)-7-[[2-[(4-bromo-3-hydroxyphenyl)methoxyimino]-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC=1C=C(CON=C(C(=O)NC2[C@@H]3N(C(=C(CS3)CSC3=NN=NN3C)C(=O)O)C2=O)C2=CC=C(C=C2)O)C=CC=1Br ZRRPQGVLWZVEOH-LEQGEALCSA-N 0.000 description 2
- WFXQGXREICDMFM-JOPIAHFSSA-N (6R)-7-[[2-methoxyimino-2-(3-methyl-2-methylsulfonylimino-1,3-thiazol-4-yl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N(C(SC=1)=NS(=O)(=O)C)C WFXQGXREICDMFM-JOPIAHFSSA-N 0.000 description 2
- ZJIANJKJAAXAOC-HWZXHQHMSA-N (6r)-7-amino-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(N)=O)=C(C(O)=O)N2C(=O)C(N)[C@H]21 ZJIANJKJAAXAOC-HWZXHQHMSA-N 0.000 description 2
- QSRIABDFMFXWHM-HWZXHQHMSA-N (6r)-7-amino-8-oxo-3-[(2,2,2-trichloroacetyl)carbamoyloxymethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)NC(=O)C(Cl)(Cl)Cl)=C(C(O)=O)N2C(=O)C(N)[C@H]21 QSRIABDFMFXWHM-HWZXHQHMSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- OWAYAUWRTXNQPN-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetic acid Chemical compound S1C(N)=NC(C(=NOCC=2C=CC=CC=2)C(O)=O)=C1 OWAYAUWRTXNQPN-UHFFFAOYSA-N 0.000 description 2
- CSHYAUNGRMGGFY-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-(1,2-oxazol-3-ylmethoxyimino)acetic acid Chemical compound C=1SC(NC=O)=NC=1C(C(=O)O)=NOCC=1C=CON=1 CSHYAUNGRMGGFY-UHFFFAOYSA-N 0.000 description 2
- CXCZRUGGNCKBNP-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-(methylsulfanylmethoxyimino)acetic acid Chemical compound CSCON=C(C(O)=O)C1=CSC(NC=O)=N1 CXCZRUGGNCKBNP-UHFFFAOYSA-N 0.000 description 2
- NRRJNSWNWIDHOX-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC=O)=N1 NRRJNSWNWIDHOX-UHFFFAOYSA-N 0.000 description 2
- ZGDJADIWALELKK-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxyiminoacetic acid Chemical compound CC(C)(C)OC(=O)C(C)ON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 ZGDJADIWALELKK-UHFFFAOYSA-N 0.000 description 2
- MDLNSYPSBFFRQV-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 MDLNSYPSBFFRQV-UHFFFAOYSA-N 0.000 description 2
- JOZCNWTTZMKMKP-UHFFFAOYSA-N 2-(3-nitro-4-phenylmethoxyphenyl)-2-oxoacetic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)C(=O)O)=CC=C1OCC1=CC=CC=C1 JOZCNWTTZMKMKP-UHFFFAOYSA-N 0.000 description 2
- PIXZHKBEUCNVFL-UHFFFAOYSA-N 2-(4-hydroxy-3-nitrophenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(O)C([N+]([O-])=O)=C1 PIXZHKBEUCNVFL-UHFFFAOYSA-N 0.000 description 2
- WGAHPPCMFJHWPP-UHFFFAOYSA-N 2-(4-hydroxy-3-nitrophenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=C(O)C([N+]([O-])=O)=C1 WGAHPPCMFJHWPP-UHFFFAOYSA-N 0.000 description 2
- RWFVZMKKWDZXTC-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(O)C=C1 RWFVZMKKWDZXTC-UHFFFAOYSA-N 0.000 description 2
- OKXSLIQEAFUVDG-UHFFFAOYSA-N 2-[2-(2-methylbutan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]-2-oxoacetic acid Chemical compound CCC(C)(C)OC(=O)N=C1NC(C(=O)C(O)=O)=CS1 OKXSLIQEAFUVDG-UHFFFAOYSA-N 0.000 description 2
- ZQBSVRDSLDHQON-UHFFFAOYSA-N 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]-2-oxoacetic acid Chemical compound CS(=O)(=O)NC1=NC(C(=O)C(O)=O)=CS1 ZQBSVRDSLDHQON-UHFFFAOYSA-N 0.000 description 2
- YNTPIKSPJIQDTM-UHFFFAOYSA-N 2-hydroxyimino-2-(3-hydroxyphenyl)acetic acid Chemical compound ON=C(C(O)=O)C1=CC=CC(O)=C1 YNTPIKSPJIQDTM-UHFFFAOYSA-N 0.000 description 2
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 2
- CSKICGDLPJACCN-UHFFFAOYSA-N 2-methoxyimino-2-(3-methoxyphenyl)acetic acid Chemical compound CON=C(C(O)=O)C1=CC=CC(OC)=C1 CSKICGDLPJACCN-UHFFFAOYSA-N 0.000 description 2
- XJAINPOVVPZLBI-UHFFFAOYSA-N 2-methylbutan-2-yl carbonochloridate Chemical compound CCC(C)(C)OC(Cl)=O XJAINPOVVPZLBI-UHFFFAOYSA-N 0.000 description 2
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- PEUIDFFZNZQFPP-UHFFFAOYSA-N CS(=O)(=O)NC1=NC(C(=NO)C(O)=O)=CS1 Chemical compound CS(=O)(=O)NC1=NC(C(=NO)C(O)=O)=CS1 PEUIDFFZNZQFPP-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 208000035473 Communicable disease Diseases 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 239000003810 Jones reagent Substances 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 239000008351 acetate buffer Substances 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229940117975 chromium trioxide Drugs 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 2
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 2
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- GXLJWOPAYCCAGM-UHFFFAOYSA-N ethyl 2-(2-formamido-1,3-thiazol-4-yl)-2-(methylsulfanylmethoxyimino)acetate Chemical compound CSCON=C(C(=O)OCC)C1=CSC(NC=O)=N1 GXLJWOPAYCCAGM-UHFFFAOYSA-N 0.000 description 2
- XSMFAYHFIJWZLH-UHFFFAOYSA-N ethyl 2-(2-formamido-1,3-thiazol-4-yl)-2-hydroxyiminoacetate Chemical compound CCOC(=O)C(=NO)C1=CSC(NC=O)=N1 XSMFAYHFIJWZLH-UHFFFAOYSA-N 0.000 description 2
- FNZGLUZYTZFOCC-UHFFFAOYSA-N ethyl 2-[2-(2-methylbutan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]acetate Chemical compound CCOC(=O)CC1=CSC(=NC(=O)OC(C)(C)CC)N1 FNZGLUZYTZFOCC-UHFFFAOYSA-N 0.000 description 2
- TWOSWYTYJIGDMK-UHFFFAOYSA-N ethyl 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=CSC(NS(C)(=O)=O)=N1 TWOSWYTYJIGDMK-UHFFFAOYSA-N 0.000 description 2
- IACSYDRIOYGJNH-UHFFFAOYSA-N ethyl 2-hydroxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NO)C(C)=O IACSYDRIOYGJNH-UHFFFAOYSA-N 0.000 description 2
- QQTHNMBPRSXIHX-UHFFFAOYSA-N ethyl 4-chloro-2-methoxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NOC)C(=O)CCl QQTHNMBPRSXIHX-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- UYCSHWSMVPQQLC-UHFFFAOYSA-N methyl 2-(3-chloro-4-hydroxyphenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=C(O)C(Cl)=C1 UYCSHWSMVPQQLC-UHFFFAOYSA-N 0.000 description 2
- XUVLJLAYKCZYNW-UHFFFAOYSA-N methyl 2-(3-chloro-4-methoxyphenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=C(OC)C(Cl)=C1 XUVLJLAYKCZYNW-UHFFFAOYSA-N 0.000 description 2
- RORQKPVCWZXGLK-UHFFFAOYSA-N methyl 2-(4-hydroxy-3-nitrophenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=C(O)C([N+]([O-])=O)=C1 RORQKPVCWZXGLK-UHFFFAOYSA-N 0.000 description 2
- KFETZKZNJICLJB-UHFFFAOYSA-N methyl 2-(4-hydroxyphenyl)-2-methoxyiminoacetate Chemical compound CON=C(C(=O)OC)C1=CC=C(O)C=C1 KFETZKZNJICLJB-UHFFFAOYSA-N 0.000 description 2
- 230000009935 nitrosation Effects 0.000 description 2
- 238000007034 nitrosation reaction Methods 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- KXFJZKUFXHWWAJ-UHFFFAOYSA-N p-hydroxybenzoylformic acid Natural products OC(=O)C(=O)C1=CC=C(O)C=C1 KXFJZKUFXHWWAJ-UHFFFAOYSA-N 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 2
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 229920001567 vinyl ester resin Polymers 0.000 description 2
- XJRIDJAGAYGJCK-UHFFFAOYSA-N (1-acetyl-5-bromoindol-3-yl) acetate Chemical compound C1=C(Br)C=C2C(OC(=O)C)=CN(C(C)=O)C2=C1 XJRIDJAGAYGJCK-UHFFFAOYSA-N 0.000 description 1
- OGNVQLDIPUXYDH-ZPKKHLQPSA-N (2R,3R,4S)-3-(2-methylpropanoylamino)-4-(4-phenyltriazol-1-yl)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid Chemical compound CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(O)=O)=C[C@@H]1N1N=NC(C=2C=CC=CC=2)=C1 OGNVQLDIPUXYDH-ZPKKHLQPSA-N 0.000 description 1
- FLPXGOKWVSECBG-PVQCJRHBSA-N (6R)-3-(hydroxymethyl)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CO)C(=O)O)C1=O)C1=CC(=CC=C1)O FLPXGOKWVSECBG-PVQCJRHBSA-N 0.000 description 1
- IXDRKYDLUJLBSZ-FLGXBNSWSA-N (6R)-7-[[2-(1-carboxyethoxyimino)-2-(3-chloro-4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(=O)(O)C(C)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)Cl IXDRKYDLUJLBSZ-FLGXBNSWSA-N 0.000 description 1
- SDRAZXKCTYAZCN-JOPIAHFSSA-N (6R)-7-[[2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)NC(C)=O SDRAZXKCTYAZCN-JOPIAHFSSA-N 0.000 description 1
- JMDGFSNUIRDAGR-SXMPBOCKSA-N (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrochloride Chemical compound Cl.CON=C(C(=O)NC1[C@H]2SCC(CSc3nncs3)=C(N2C1=O)C(O)=O)c1csc(N)n1 JMDGFSNUIRDAGR-SXMPBOCKSA-N 0.000 description 1
- ATLGCITWPNPOLQ-XPKAQORNSA-N (6R)-7-[[2-(3-acetyloxyphenyl)-2-methoxyiminoacetyl]amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)O)C1=O)C1=CC(=CC=C1)OC(C)=O ATLGCITWPNPOLQ-XPKAQORNSA-N 0.000 description 1
- SMADMIRXJWEEFP-XPKAQORNSA-N (6R)-7-[[2-(3-chloro-4-hydroxyphenyl)-2-ethoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C)ON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)Cl SMADMIRXJWEEFP-XPKAQORNSA-N 0.000 description 1
- HXAJFXZLXPUJTD-LRHAYUFXSA-N (6R)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=CN2)C(=O)O)C1=O)C1=CC(=CC=C1)O HXAJFXZLXPUJTD-LRHAYUFXSA-N 0.000 description 1
- OFEYSCBDBPNVFO-LRHAYUFXSA-N (6R)-7-[[2-(4-hydroxy-3-nitrophenyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C1=CC(=C(C=C1)O)[N+](=O)[O-] OFEYSCBDBPNVFO-LRHAYUFXSA-N 0.000 description 1
- KYSRACREASUUDK-LNUXAPHWSA-N (6R)-7-[[2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)NS(=O)(=O)C KYSRACREASUUDK-LNUXAPHWSA-N 0.000 description 1
- TXNAJCBFBZZSKF-XPKAQORNSA-N (6R)-7-[[2-[3-(methanesulfonamido)phenyl]-2-methoxyiminoacetyl]amino]-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2SC=NN=2)C(=O)O)C1=O)C1=CC(=CC=C1)NS(=O)(=O)C TXNAJCBFBZZSKF-XPKAQORNSA-N 0.000 description 1
- FDPNKRIRUWISAG-WCRCJTMVSA-N (6R)-7-[[2-methoxyimino-2-(2-oxo-3H-1,3-thiazol-4-yl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1NC(SC=1)=O FDPNKRIRUWISAG-WCRCJTMVSA-N 0.000 description 1
- AFLBKDZOKBSNFH-WCRCJTMVSA-N (6R)-7-[[2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)O)C1=O)C=1N=C(SC=1)NC(C(F)(F)F)=O AFLBKDZOKBSNFH-WCRCJTMVSA-N 0.000 description 1
- LPITUXJVTFNPSQ-SSDOTTSWSA-N (6R)-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(=NN=C1)SCC=1CS[C@H]2N(C=1C(=O)O)C(C2)=O LPITUXJVTFNPSQ-SSDOTTSWSA-N 0.000 description 1
- FHYWAOQGXIZAAF-LESKNEHBSA-N (6r)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]12)CC(CO)=C(C(O)=O)N1C(=O)C2NC(=O)C(=NOC)C1=CSC(N)=N1 FHYWAOQGXIZAAF-LESKNEHBSA-N 0.000 description 1
- XUTQHTOXGKVJPN-XCGJVMPOSA-N (6r)-7-amino-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 XUTQHTOXGKVJPN-XCGJVMPOSA-N 0.000 description 1
- NSMXQKNUPPXBRG-SECBINFHSA-N (R)-lisofylline Chemical group O=C1N(CCCC[C@H](O)C)C(=O)N(C)C2=C1N(C)C=N2 NSMXQKNUPPXBRG-SECBINFHSA-N 0.000 description 1
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- GMTSPBYBJKGPJF-UHFFFAOYSA-N 1-(3-chloro-4-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC=C(O)C(Cl)=C1 GMTSPBYBJKGPJF-UHFFFAOYSA-N 0.000 description 1
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 1
- ORLCYMQZIPSODD-UHFFFAOYSA-N 1-chloro-2-[chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene Chemical compound ClC1=CC=CC=C1OP(Cl)(=O)OCC(Cl)(Cl)Cl ORLCYMQZIPSODD-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- FZNBZZPMDCQZOP-UHFFFAOYSA-N 2-(2-acetamido-1,3-thiazol-4-yl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC(C)=O)=N1 FZNBZZPMDCQZOP-UHFFFAOYSA-N 0.000 description 1
- SMBPOHCWIZSRNG-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-[(3,4-dichlorophenyl)methoxyimino]acetic acid Chemical compound S1C(N)=NC(C(=NOCC=2C=C(Cl)C(Cl)=CC=2)C(O)=O)=C1 SMBPOHCWIZSRNG-UHFFFAOYSA-N 0.000 description 1
- URGSBEYHHRKMJL-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetic acid Chemical compound NC1=NC(C(=NO)C(O)=O)=CS1 URGSBEYHHRKMJL-UHFFFAOYSA-N 0.000 description 1
- MCSWUKXFFGUOQE-UHFFFAOYSA-N 2-(2-amino-1,3-thiazol-4-yl)-N-(3,11-dioxo-10-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undec-1(8)-en-4-yl)-2-methoxyiminoacetamide Chemical compound C12SCC(COC3=O)=C3N2C(=O)C1NC(=O)C(=NOC)C1=CSC(N)=N1 MCSWUKXFFGUOQE-UHFFFAOYSA-N 0.000 description 1
- VZRKYOWOWILIHD-UHFFFAOYSA-N 2-(2-ethoxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound CCOC(=O)CON=C(C(O)=O)C1=CSC(NC=O)=N1 VZRKYOWOWILIHD-UHFFFAOYSA-N 0.000 description 1
- NVWXEXVCKNOEDD-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-(2-formyloxyethoxyimino)acetic acid Chemical compound O=COCCON=C(C(=O)O)C1=CSC(NC=O)=N1 NVWXEXVCKNOEDD-UHFFFAOYSA-N 0.000 description 1
- FXBKGCHYFXIGCY-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-(3-phenylprop-2-enoxyimino)acetic acid Chemical compound C=1SC(NC=O)=NC=1C(C(=O)O)=NOCC=CC1=CC=CC=C1 FXBKGCHYFXIGCY-UHFFFAOYSA-N 0.000 description 1
- VGOYZRAMGMTTOP-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetic acid Chemical compound CC(C)(C)OC(=O)CON=C(C(O)=O)C1=CSC(NC=O)=N1 VGOYZRAMGMTTOP-UHFFFAOYSA-N 0.000 description 1
- YPRCHXOLEWTKCX-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-hexoxyiminoacetic acid Chemical compound CCCCCCON=C(C(O)=O)C1=CSC(NC=O)=N1 YPRCHXOLEWTKCX-UHFFFAOYSA-N 0.000 description 1
- JPJMIBGVCGNFQD-UHFFFAOYSA-N 2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CSC(NC=O)=N1 JPJMIBGVCGNFQD-UHFFFAOYSA-N 0.000 description 1
- DFSKPEQQIRYPNI-UHFFFAOYSA-N 2-(3-acetyloxyphenyl)-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=CC(OC(C)=O)=C1 DFSKPEQQIRYPNI-UHFFFAOYSA-N 0.000 description 1
- OSTTZPDIXFQGII-UHFFFAOYSA-N 2-(3-chloro-4-hydroxyphenyl)-2-ethoxyiminoacetic acid Chemical compound CCON=C(C(O)=O)C1=CC=C(O)C(Cl)=C1 OSTTZPDIXFQGII-UHFFFAOYSA-N 0.000 description 1
- GOIYEFHSLYIQBZ-UHFFFAOYSA-N 2-(3-chloro-4-methoxyphenyl)-2-oxoacetic acid Chemical compound COC1=CC=C(C(=O)C(O)=O)C=C1Cl GOIYEFHSLYIQBZ-UHFFFAOYSA-N 0.000 description 1
- MSKLUHOSYJHLTI-UHFFFAOYSA-N 2-(3-chloro-4-phenylmethoxyphenyl)-2-oxoacetic acid Chemical compound ClC1=CC(C(=O)C(=O)O)=CC=C1OCC1=CC=CC=C1 MSKLUHOSYJHLTI-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- ZSNWPDBYHWYIHA-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-2-(phenylsulfanylmethoxyimino)acetic acid Chemical compound C=1C=CC(O)=CC=1C(C(=O)O)=NOCSC1=CC=CC=C1 ZSNWPDBYHWYIHA-UHFFFAOYSA-N 0.000 description 1
- CGXXIWFTHWCOPO-UHFFFAOYSA-N 2-(3-methoxyphenyl)-2-oxoacetic acid Chemical compound COC1=CC=CC(C(=O)C(O)=O)=C1 CGXXIWFTHWCOPO-UHFFFAOYSA-N 0.000 description 1
- XMRVWQYRKHBXRR-UHFFFAOYSA-N 2-(3-phenylprop-2-enoxy)isoindole-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1OCC=CC1=CC=CC=C1 XMRVWQYRKHBXRR-UHFFFAOYSA-N 0.000 description 1
- OBSLHZALFRUSRW-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-2-(thiophen-2-ylmethoxyimino)acetic acid Chemical compound C=1C=C(O)C=CC=1C(C(=O)O)=NOCC1=CC=CS1 OBSLHZALFRUSRW-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- MISWDSAGDGDWCC-UHFFFAOYSA-N 2-[(3,4-dichlorophenyl)methoxyimino]-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetic acid Chemical compound C=1SC(NC(=O)C(F)(F)F)=NC=1C(C(=O)O)=NOCC1=CC=C(Cl)C(Cl)=C1 MISWDSAGDGDWCC-UHFFFAOYSA-N 0.000 description 1
- ABWSHWSJDKGYQN-UHFFFAOYSA-N 2-[3-(methanesulfonamido)phenyl]-2-oxoacetic acid Chemical compound CS(=O)(=O)NC1=CC=CC(C(=O)C(O)=O)=C1 ABWSHWSJDKGYQN-UHFFFAOYSA-N 0.000 description 1
- OBWCANOTHOUKMT-UHFFFAOYSA-N 2-[4-(dimethylamino)phenyl]-2-methoxyiminoacetic acid Chemical compound CON=C(C(O)=O)C1=CC=C(N(C)C)C=C1 OBWCANOTHOUKMT-UHFFFAOYSA-N 0.000 description 1
- BGIZWGFKUMPOAV-UHFFFAOYSA-N 2-amino-1,3-thiazol-4-ol Chemical compound NC1=NC(O)=CS1 BGIZWGFKUMPOAV-UHFFFAOYSA-N 0.000 description 1
- MARXMDRWROUXMD-UHFFFAOYSA-N 2-bromoisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(Br)C(=O)C2=C1 MARXMDRWROUXMD-UHFFFAOYSA-N 0.000 description 1
- ILLHORFDXDLILE-UHFFFAOYSA-N 2-bromopropanoyl bromide Chemical compound CC(Br)C(Br)=O ILLHORFDXDLILE-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- NVIASKNPYJLAOX-UHFFFAOYSA-N 2-butoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound CCCCON=C(C(O)=O)C1=CSC(NC=O)=N1 NVIASKNPYJLAOX-UHFFFAOYSA-N 0.000 description 1
- RVBUZBPJAGZHSQ-UHFFFAOYSA-N 2-chlorobutanoic acid Chemical compound CCC(Cl)C(O)=O RVBUZBPJAGZHSQ-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- WZPOBANFTJLEHD-UHFFFAOYSA-N 2-ethoxyimino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid Chemical compound CCON=C(C(O)=O)C1=CSC(NC=O)=N1 WZPOBANFTJLEHD-UHFFFAOYSA-N 0.000 description 1
- IYFYSCODANBBNP-UHFFFAOYSA-N 2-ethoxyimino-2-(3-methoxyphenyl)acetic acid Chemical compound CCON=C(C(O)=O)C1=CC=CC(OC)=C1 IYFYSCODANBBNP-UHFFFAOYSA-N 0.000 description 1
- MDEKEOFWAHRGNU-UHFFFAOYSA-N 2-methoxyimino-2-[2-[(2,2,2-trifluoroacetyl)amino]-1,3-thiazol-4-yl]acetic acid Chemical compound CON=C(C(O)=O)C1=CSC(NC(=O)C(F)(F)F)=N1 MDEKEOFWAHRGNU-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- SDXAWLJRERMRKF-UHFFFAOYSA-N 3,5-dimethyl-1h-pyrazole Chemical compound CC=1C=C(C)NN=1 SDXAWLJRERMRKF-UHFFFAOYSA-N 0.000 description 1
- CZWWCTHQXBMHDA-UHFFFAOYSA-N 3h-1,3-thiazol-2-one Chemical class OC1=NC=CS1 CZWWCTHQXBMHDA-UHFFFAOYSA-N 0.000 description 1
- LRDIEHDJWYRVPT-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 LRDIEHDJWYRVPT-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- MWQWZNFAWAWDQB-UHFFFAOYSA-N 5-(aminooxymethyl)-2-bromophenol;phosphoric acid Chemical compound OP(O)(O)=O.NOCC1=CC=C(Br)C(O)=C1 MWQWZNFAWAWDQB-UHFFFAOYSA-N 0.000 description 1
- SCCXADHXVLCUPI-UHFFFAOYSA-N 5h-1,3-thiazol-2-one Chemical class O=C1SCC=N1 SCCXADHXVLCUPI-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 150000004006 C-nitroso compounds Chemical class 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- BCKMVXJFGYGQHP-UHFFFAOYSA-N COC(C1=CSC(=NS(=O)(=O)C)N1C=N)C(=O)OC Chemical compound COC(C1=CSC(=NS(=O)(=O)C)N1C=N)C(=O)OC BCKMVXJFGYGQHP-UHFFFAOYSA-N 0.000 description 1
- QPYMDAVYNSNZLM-NEIGUCDHSA-M CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)[O-])C1=O)C=1N(C(SC=1)=NS(=O)(=O)C)C.[Na+] Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2C)C(=O)[O-])C1=O)C=1N(C(SC=1)=NS(=O)(=O)C)C.[Na+] QPYMDAVYNSNZLM-NEIGUCDHSA-M 0.000 description 1
- DPEJTJDQRKNSBB-UHFFFAOYSA-N ClC(Cl)(Cl)C(=O)NC(=O)OC(=O)C(=NOC)C1=CC=CC(OC(=O)NC(=O)C(Cl)(Cl)Cl)=C1 Chemical compound ClC(Cl)(Cl)C(=O)NC(=O)OC(=O)C(=NOC)C1=CC=CC(OC(=O)NC(=O)C(Cl)(Cl)Cl)=C1 DPEJTJDQRKNSBB-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 101100096703 Drosophila melanogaster mtSSB gene Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000271915 Hydrophis Species 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 101100238304 Mus musculus Morc1 gene Proteins 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- QPVLVIKHRDTAKZ-UHFFFAOYSA-N N12C(=O)C=C2SCC2=C1C(=O)OC2 Chemical compound N12C(=O)C=C2SCC2=C1C(=O)OC2 QPVLVIKHRDTAKZ-UHFFFAOYSA-N 0.000 description 1
- 229910017912 NH2OH Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ATPFRGQBOVFFQM-WJIDAKASSA-N [(1s,3r,7r,8r,8as)-3-(hydroxymethyl)-8-[2-[(2r,4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate Chemical compound C([C@@H]1[C@H](C)C=CC2=C[C@H](CO)C[C@@H]([C@@H]12)OC(=O)C(C)(C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 ATPFRGQBOVFFQM-WJIDAKASSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- KQNKJJBFUFKYFX-UHFFFAOYSA-N acetic acid;trihydrate Chemical compound O.O.O.CC(O)=O KQNKJJBFUFKYFX-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 1
- NVYVHAPFRUEAJN-UHFFFAOYSA-N anisole;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.COC1=CC=CC=C1 NVYVHAPFRUEAJN-UHFFFAOYSA-N 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- JWMLCCRPDOIBAV-UHFFFAOYSA-N chloro(methylsulfanyl)methane Chemical compound CSCCl JWMLCCRPDOIBAV-UHFFFAOYSA-N 0.000 description 1
- RXFZQWIYCJKAMJ-UHFFFAOYSA-N chloromethylidene(dimethyl)azanium Chemical compound C[N+](C)=CCl RXFZQWIYCJKAMJ-UHFFFAOYSA-N 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000002592 cumenyl group Chemical group C1(=C(C=CC=C1)*)C(C)C 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- MKXZASYAUGDDCJ-QNNIAVNKSA-N deudextromethorphan Chemical compound C([C@@H]12)CCC[C@]11CCN(C([2H])([2H])[2H])[C@H]2CC2=CC=C(OC([2H])([2H])[2H])C=C21 MKXZASYAUGDDCJ-QNNIAVNKSA-N 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical compound [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- LMSUWEYUSUOYHF-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-[(3,4-dichlorophenyl)methoxyimino]acetate Chemical compound C=1SC(N)=NC=1C(C(=O)OCC)=NOCC1=CC=C(Cl)C(Cl)=C1 LMSUWEYUSUOYHF-UHFFFAOYSA-N 0.000 description 1
- XNVRKLCQBZTGNA-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=CSC(N)=N1 XNVRKLCQBZTGNA-UHFFFAOYSA-N 0.000 description 1
- CSAITDDAMOOJCF-UHFFFAOYSA-N ethyl 2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(NC=O)=N1 CSAITDDAMOOJCF-UHFFFAOYSA-N 0.000 description 1
- VJNVIPBXFCGLJH-UHFFFAOYSA-N ethyl 2-[2-(2-methylbutan-2-yloxycarbonylamino)-1,3-thiazol-4-yl]-2-oxoacetate Chemical compound CCOC(=O)C(=O)C1=CSC(NC(=O)OC(C)(C)CC)=N1 VJNVIPBXFCGLJH-UHFFFAOYSA-N 0.000 description 1
- CFIKUJFTFRBHTI-UHFFFAOYSA-N ethyl 2-[2-(ethoxycarbonylamino)-1,3-thiazol-4-yl]-2-methoxyiminoacetate Chemical compound CCOC(=O)NC1=NC(C(=NOC)C(=O)OCC)=CS1 CFIKUJFTFRBHTI-UHFFFAOYSA-N 0.000 description 1
- LRVKRWBZGGSQIP-UHFFFAOYSA-N ethyl 2-[2-(methanesulfonamido)-1,3-thiazol-4-yl]acetate Chemical compound CCOC(=O)CC1=CSC(NS(C)(=O)=O)=N1 LRVKRWBZGGSQIP-UHFFFAOYSA-N 0.000 description 1
- ZDUDYELVFBGZKP-UHFFFAOYSA-N ethyl 2-methoxyimino-2-(2-oxo-3h-1,3-thiazol-4-yl)acetate Chemical compound CCOC(=O)C(=NOC)C1=CSC(=O)N1 ZDUDYELVFBGZKP-UHFFFAOYSA-N 0.000 description 1
- YRMWFEHGTIMEPD-UHFFFAOYSA-N ethyl 4-bromo-2-hydroxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NO)C(=O)CBr YRMWFEHGTIMEPD-UHFFFAOYSA-N 0.000 description 1
- OUXPLJZJAGSZPI-UHFFFAOYSA-N ethyl 4-chloro-2-[(3,4-dichlorophenyl)methoxyimino]-3-oxobutanoate Chemical compound CCOC(=O)C(C(=O)CCl)=NOCC1=CC=C(Cl)C(Cl)=C1 OUXPLJZJAGSZPI-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004993 haloalkoxycarbonyl group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 description 1
- 239000004137 magnesium phosphate Substances 0.000 description 1
- 229960002261 magnesium phosphate Drugs 0.000 description 1
- 229910000157 magnesium phosphate Inorganic materials 0.000 description 1
- 235000010994 magnesium phosphates Nutrition 0.000 description 1
- OHZZTXYKLXZFSZ-UHFFFAOYSA-I manganese(3+) 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methylpyridin-4-ylidene)porphyrin-22-ide pentachloride Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+3].C1=CN(C)C=CC1=C1C(C=C2)=NC2=C(C=2C=C[N+](C)=CC=2)C([N-]2)=CC=C2C(C=2C=C[N+](C)=CC=2)=C(C=C2)N=C2C(C=2C=C[N+](C)=CC=2)=C2N=C1C=C2 OHZZTXYKLXZFSZ-UHFFFAOYSA-I 0.000 description 1
- 229910001463 metal phosphate Inorganic materials 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- YZNJBWGIACRNIT-UHFFFAOYSA-N methyl 2-methoxyimino-2-(3-methyl-2-methylsulfonylimino-1,3-thiazol-4-yl)acetate Chemical compound CON=C(C(=O)OC)C1=CSC(=NS(C)(=O)=O)N1C YZNJBWGIACRNIT-UHFFFAOYSA-N 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 244000000010 microbial pathogen Species 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical group CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- PWZUZQNZVZKCBI-UHFFFAOYSA-N o-ethyl carbamothioate Chemical compound CCOC(N)=S PWZUZQNZVZKCBI-UHFFFAOYSA-N 0.000 description 1
- NUXCOKIYARRTDC-UHFFFAOYSA-N o-ethylhydroxylamine;hydron;chloride Chemical compound Cl.CCON NUXCOKIYARRTDC-UHFFFAOYSA-N 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 125000003431 oxalo group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- PAVLRKXGMXXRRM-LWPABBACSA-M sodium (6R)-3-(carbamoyloxymethyl)-7-[[2-(3-hydroxyphenyl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound CON=C(C(=O)NC1[C@@H]2N(C(=C(CS2)COC(N)=O)C(=O)[O-])C1=O)C1=CC(=CC=C1)O.[Na+] PAVLRKXGMXXRRM-LWPABBACSA-M 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- QRPUJGHNWVVHLZ-GUNDQUCTSA-M sodium;(6r)-7-amino-3-(hydroxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [Na+].S1CC(CO)=C(C([O-])=O)N2C(=O)C(N)[C@H]21 QRPUJGHNWVVHLZ-GUNDQUCTSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- MXJGKTHZWIGRJG-UHFFFAOYSA-N tert-butyl 2-aminooxyacetate Chemical compound CC(C)(C)OC(=O)CON MXJGKTHZWIGRJG-UHFFFAOYSA-N 0.000 description 1
- CZJIOLXNSPBYNA-UHFFFAOYSA-N tert-butyl 2-aminooxypropanoate Chemical compound NOC(C)C(=O)OC(C)(C)C CZJIOLXNSPBYNA-UHFFFAOYSA-N 0.000 description 1
- CVAWKJKISIPBOD-UHFFFAOYSA-N tert-butyl 2-bromopropanoate Chemical compound CC(Br)C(=O)OC(C)(C)C CVAWKJKISIPBOD-UHFFFAOYSA-N 0.000 description 1
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 239000001974 tryptic soy broth Substances 0.000 description 1
- 108010050327 trypticase-soy broth Proteins 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/587—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with aliphatic hydrocarbon radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms, said aliphatic radicals being substituted in the alpha-position to the ring by a hetero atom, e.g. with m >= 0, Z being a singly or a doubly bound hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB14916/76A GB1576625A (en) | 1976-04-12 | 1976-04-12 | Syn isomer 3,7 disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof |
| GBS.N.14916/76 | 1976-04-12 | ||
| GB2349076 | 1976-06-07 | ||
| GBS.N.23490/76 | 1976-06-07 | ||
| JP51125826A JPS5941995B2 (ja) | 1976-04-12 | 1976-10-19 | 3,7−ジ置換−3−セフエム−4−カルボン酸化合物およびその塩類およびそれらの製造方法 |
| JPS.N.125826/1976 | 1976-10-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1337522C true CA1337522C (en) | 1995-11-07 |
Family
ID=27257189
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000272430A Expired - Lifetime CA1337522C (en) | 1976-04-12 | 1977-02-23 | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof |
Country Status (13)
| Country | Link |
|---|---|
| AR (2) | AR227864A1 (enExample) |
| AT (1) | AT358728B (enExample) |
| CA (1) | CA1337522C (enExample) |
| CH (2) | CH638532A5 (enExample) |
| DE (1) | DE2707565A1 (enExample) |
| DK (1) | DK162391C (enExample) |
| ES (7) | ES457191A1 (enExample) |
| FR (1) | FR2348219A1 (enExample) |
| HU (1) | HU177441B (enExample) |
| IE (1) | IE45597B1 (enExample) |
| MX (1) | MX4985E (enExample) |
| NL (1) | NL191259C (enExample) |
| SE (2) | SE443981B (enExample) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3192167A (en) * | 1962-09-20 | 1965-06-29 | Ogawa Abiko | Low pressure liquid vaporizer which is electrically heated |
| BE878514A (fr) * | 1978-09-04 | 1980-02-29 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 3-cephem-4-carboxylique a disubstitution en positions 3 et 7, nouveaux produits ainsi obtenus et leur utilisation pour leur activite antibacterienne |
| GR63088B (en) * | 1976-04-14 | 1979-08-09 | Takeda Chemical Industries Ltd | Preparation process of novel cephalosporins |
| FR2381053A1 (fr) * | 1977-02-18 | 1978-09-15 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-thiadiazolyl thiomethyl 7-aminothiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2399418A1 (fr) * | 1977-03-14 | 1979-03-02 | Fujisawa Pharmaceutical Co | Procede de preparation d'acides iminoacetiques et nouveaux produits ainsi obtenus, utilises pour la synthese d'acides cepham- ou cephem-carboxyliques |
| PH17188A (en) | 1977-03-14 | 1984-06-14 | Fujisawa Pharmaceutical Co | New cephem and cepham compounds and their pharmaceutical compositions and method of use |
| SE439312B (sv) * | 1977-03-25 | 1985-06-10 | Roussel Uclaf | Sett att framstella nya oximderivat av 3-acetoximetyl-7-aminotiazolylacetamido cefalosporansyra |
| DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| JPS5498795A (en) * | 1978-01-13 | 1979-08-03 | Takeda Chem Ind Ltd | Cephalosporin derivative and its preparation |
| FR2553770B2 (fr) * | 1978-03-31 | 1986-03-14 | Roussel Uclaf | Nouveaux produits derives de l'acide 2(2-amino thiazol-4-yl) 2-alcoxy-imino acetique substitues sur l'oxime et leur procede de preparation |
| FR2432521A1 (fr) * | 1978-03-31 | 1980-02-29 | Roussel Uclaf | Nouvelles oximes o-substituees derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2421907A1 (fr) * | 1978-04-07 | 1979-11-02 | Roussel Uclaf | Nouvelles cephalosporines derivees de l'acide 7-/2-(2-amino 4-thiazolyl)2-(carboxymethoxyimino/acetamido 3-substitue cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2438051A2 (fr) * | 1978-10-05 | 1980-04-30 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-azidomethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| MC1259A1 (fr) | 1978-05-30 | 1980-01-14 | Hoffmann La Roche | Derives acyles |
| US4284631A (en) * | 1978-07-31 | 1981-08-18 | Fujisawa Pharmaceutical Co., Ltd. | 7-Substituted cephem compounds and pharmaceutical antibacterial compositions containing them |
| FR2453161A1 (fr) * | 1978-08-31 | 1980-10-31 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide thiazolylacetique et nouveaux produits ainsi obtenus |
| US4341775A (en) * | 1978-09-11 | 1982-07-27 | Fujisawa Pharmaceutical Co., Ltd. | Cephem compounds |
| DE2965943D1 (en) * | 1978-10-17 | 1983-08-25 | Fujisawa Pharmaceutical Co | Cepham compounds, pharmaceutical compositions containing them and processes for the preparation thereof and of known cephem compounds |
| DE2945248A1 (de) * | 1978-11-13 | 1980-05-22 | Fujisawa Pharmaceutical Co | Cephem-verbindungen, verfahren zu ihrer herstellung und sie enthaltende antibakterielle pharmazeutische mittel |
| FR2448543A1 (fr) * | 1979-02-09 | 1980-09-05 | Roussel Uclaf | Nouvelles oximes o-substituees par un radical comportant un ammonium quaternaire et derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2461713A1 (fr) * | 1979-07-19 | 1981-02-06 | Roussel Uclaf | Nouvelles alcoyloximes substituees derivees de l'acide 7-(2-amino 4-thiazolyl) acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| FR2462439A1 (fr) * | 1979-07-26 | 1981-02-13 | Roussel Uclaf | Nouveau procede de preparation de produits derives de l'acide 7-/(2-aryl) 2-hydroxyimino acetamido/cephalosporanique |
| IL61458A0 (en) * | 1979-12-07 | 1980-12-31 | Erba Farmitalia | N-substituted thiazolyl derivatives of oximino-substituted cephalosporins, their preparation and pharmalceutical compositions containing them |
| FR2506307A1 (fr) * | 1981-05-22 | 1982-11-26 | Roussel Uclaf | Nouveaux derives substitues de l'acide 2-(2-amino 4-thiazolyl) 2-hydroxyimino acetique et leur procede de preparation |
| US4426528A (en) * | 1982-04-01 | 1984-01-17 | Eli Lilly And Company | Purification of syn-(2-aminothiazol-4-yl)methoxyimino)acetic acid |
| FR2532936A1 (fr) * | 1982-09-13 | 1984-03-16 | Roussel Uclaf | Nouveaux derives de l'acide 2-amino-thiazolyl-4-yl acetique comportant une fonction oxime substituee et leur procede de preparation |
| GB8324152D0 (en) * | 1983-09-09 | 1983-10-12 | Glaxo Group Ltd | Chemical process |
| IT8448798A0 (it) * | 1983-09-12 | 1984-09-05 | Biochemie Gmbh | Procedimento per la preparazione di antibiotici del tipo cefalosporina |
| GB2161476B (en) * | 1984-05-25 | 1988-01-27 | Toyama Chemical Co Ltd | 2-aminothiazolyl-2-methoxyimino acetamides and their use in preparing cephalosporins |
| EP0241901B1 (en) * | 1986-04-14 | 1994-08-24 | Banyu Pharmaceutical Co., Ltd. | Cephalosporin derivatives, processes for their preparation and antibacterial agents |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1399086A (en) * | 1971-05-14 | 1975-06-25 | Glaxo Lab Ltd | Cephalosporin compounds |
| NZ176206A (en) * | 1973-12-25 | 1978-03-06 | Takeda Chemical Industries Ltd | Cephalosporins |
| DK154939C (da) * | 1974-12-19 | 1989-06-12 | Takeda Chemical Industries Ltd | Analogifremgangsmaade til fremstilling af thiazolylacetamido-cephemforbindelser eller farmaceutisk acceptable salte eller estere deraf |
| FI66005C (fi) * | 1975-02-04 | 1984-08-10 | Fujisawa Pharmaceutical Co | Foerfarande foer framstaellning av antibakteriellt verkande 7-alfa alfa-disubstituerad-acetamido)-3-substituerad-3-cefe m--karboxylsyras syn-isomer |
| FR2346014A1 (fr) * | 1976-01-23 | 1977-10-28 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| DE2760123C2 (de) * | 1976-01-23 | 1986-04-30 | Roussel-Uclaf, Paris | 7-Aminothiazolyl-syn-oxyiminoacetamidocephalosporansäuren, ihre Herstellung und sie enthaltende pharmazeutische Zusammensetzungen |
| SE440655B (sv) * | 1976-01-23 | 1985-08-12 | Roussel Uclaf | Sett att framstella nya oximderivat av 7-amino-tiazolyl-acetamido-cefalosporansyra |
| FR2345153A1 (fr) * | 1976-03-25 | 1977-10-21 | Roussel Uclaf | Nouvelles alcoyloximes derivees de l'acide 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| GR63088B (en) * | 1976-04-14 | 1979-08-09 | Takeda Chemical Industries Ltd | Preparation process of novel cephalosporins |
-
1977
- 1977-02-21 DK DK075077A patent/DK162391C/da active
- 1977-02-22 DE DE19772707565 patent/DE2707565A1/de active Granted
- 1977-02-22 SE SE7701964A patent/SE443981B/xx not_active IP Right Cessation
- 1977-02-23 CA CA000272430A patent/CA1337522C/en not_active Expired - Lifetime
- 1977-02-25 CH CH244777A patent/CH638532A5/de not_active IP Right Cessation
- 1977-02-28 HU HU77FU348A patent/HU177441B/hu unknown
- 1977-03-01 IE IE440/77A patent/IE45597B1/en not_active IP Right Cessation
- 1977-03-02 AT AT138477A patent/AT358728B/de not_active IP Right Cessation
- 1977-03-10 FR FR7707173A patent/FR2348219A1/fr active Granted
- 1977-03-25 ES ES457191A patent/ES457191A1/es not_active Expired
- 1977-04-11 MX MX775624U patent/MX4985E/es unknown
- 1977-04-12 NL NL7703969A patent/NL191259C/xx not_active IP Right Cessation
- 1977-04-20 AR AR257178A patent/AR227864A1/es active
-
1978
- 1978-03-27 AR AR271541A patent/AR223143A1/es active
- 1978-04-12 ES ES468719A patent/ES468719A1/es not_active Expired
-
1979
- 1979-02-15 ES ES477741A patent/ES477741A1/es not_active Expired
- 1979-10-16 ES ES485064A patent/ES485064A1/es not_active Expired
- 1979-10-16 ES ES485062A patent/ES485062A1/es not_active Expired
- 1979-10-16 ES ES485061A patent/ES485061A1/es not_active Expired
- 1979-10-16 ES ES485063A patent/ES485063A1/es not_active Expired
-
1983
- 1983-07-26 CH CH409583A patent/CH643557A5/de not_active IP Right Cessation
- 1983-08-17 SE SE8304465A patent/SE457351B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH643557A5 (en) | 1984-06-15 |
| DK75077A (da) | 1977-10-13 |
| SE8304465D0 (sv) | 1983-08-17 |
| FR2348219A1 (fr) | 1977-11-10 |
| ES477741A1 (es) | 1980-04-01 |
| ES485062A1 (es) | 1980-06-16 |
| CH638532A5 (de) | 1983-09-30 |
| AT358728B (de) | 1980-09-25 |
| HU177441B (en) | 1981-10-28 |
| DE2707565A1 (de) | 1978-02-23 |
| ES485061A1 (es) | 1980-06-16 |
| IE45597L (en) | 1977-10-12 |
| SE7701964L (sv) | 1977-10-13 |
| DK162391C (da) | 1992-03-09 |
| ES485063A1 (es) | 1980-06-16 |
| ATA138477A (de) | 1980-02-15 |
| ES468719A1 (es) | 1979-10-16 |
| MX4985E (es) | 1983-01-31 |
| DK162391B (da) | 1991-10-21 |
| NL7703969A (nl) | 1977-10-14 |
| NL191259B (nl) | 1994-11-16 |
| SE457351B (sv) | 1988-12-19 |
| AR227864A1 (es) | 1982-12-30 |
| ES485064A1 (es) | 1980-10-01 |
| SE443981B (sv) | 1986-03-17 |
| ES457191A1 (es) | 1978-08-16 |
| FR2348219B1 (enExample) | 1982-12-03 |
| AR223143A1 (es) | 1981-07-31 |
| NL191259C (nl) | 1995-04-18 |
| DE2707565C2 (enExample) | 1988-06-30 |
| IE45597B1 (en) | 1982-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1337522C (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| US4544653A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| CA1308708C (en) | Cephalosporins | |
| US4263291A (en) | 3,7-Disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| GB1576625A (en) | Syn isomer 3,7 disubstituted 3 cephem 4 carboxylic acid compounds and processes for the preparation thereof | |
| US4447429A (en) | 7-[2-Alkoxyimino-2-(5-amino-1,2,4-thiadiazol-3-yl)acetamido]-3-cephems | |
| EP0055465B1 (en) | 7-acylaminocephalosporanic acid derivatives and processes for the preparation thereof | |
| US4288436A (en) | 3,7-Disubstituted-3-cephem-4-carboxylic acid compounds | |
| CA1088049A (en) | 3-substituted-7-substituted alkanamido-3-cephem-4- carboxylic acid compounds and processes for preparation thereof | |
| EP0047491B1 (en) | New cephem compounds and processes for preparation thereof | |
| US4499088A (en) | Cephem compounds | |
| US4304770A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| EP0025199B1 (en) | Cephem compounds, processes for their preparation and pharmaceutical compositions containing them | |
| EP0008442B1 (en) | 2-lower alkyl-7-substituted-2 or 3-cephem-4-carboxylic acid compounds, processes for their preparation and pharmaceutical compositions containing them | |
| US4331664A (en) | Syn isomer of 7-[2-cyclo(lower) alkoxyimino-2-(2-amino-or substituted aminothiazol-4-yl)acetamido]-3-lower alkanoyloxymethyl or heterocyclicthiomethyl-3-cephem-4-carboxylic acid compounds | |
| US4804752A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| US5079369A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds and processes for the preparation thereof | |
| JPS6361954B2 (enExample) | ||
| US4364943A (en) | Syn-isomer of 7-[2-alkoxyimino-2-(2-amino-alkanoylamino-or haloalkanoylamino-thiazol-4-yl) acetamids]-3-[hexanoyl-, or phenylalkanoyl-oxymethyl or benzothiazolylthiomethyl]-3-cephem-4-carboxylic acid | |
| US4871860A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-caroxylic acid compounds and processes for the preparation thereof | |
| US4493833A (en) | Syn-isomer of 3,7-disubstituted-3-cephem-4-carboxylic acid compounds | |
| US4431643A (en) | Syn-isomer of 3-substituted-7-[2-cyclopentyloxyimino-2-(2-aminothiazol-4-yl)-acetamido]-3 | |
| US4350694A (en) | Cephalosporin analogues and antimicrobial compositions | |
| US4468515A (en) | 2-Substituted oxyimino-2-(5-amino-1,2,4-thiadiazol-3-yl)acetic acids | |
| US4567275A (en) | Cephem and cepham compounds and processes for preparation thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |