CA1324456C - Catalyst compositions - Google Patents
Catalyst compositionsInfo
- Publication number
- CA1324456C CA1324456C CA000529757A CA529757A CA1324456C CA 1324456 C CA1324456 C CA 1324456C CA 000529757 A CA000529757 A CA 000529757A CA 529757 A CA529757 A CA 529757A CA 1324456 C CA1324456 C CA 1324456C
- Authority
- CA
- Canada
- Prior art keywords
- acid
- salt
- catalyst compositions
- catalyst
- carbon
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 41
- 239000000203 mixture Substances 0.000 title claims abstract description 23
- 239000002253 acid Substances 0.000 claims abstract description 33
- 150000003839 salts Chemical class 0.000 claims abstract description 19
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims abstract description 16
- 229910052723 transition metal Inorganic materials 0.000 claims abstract description 9
- 239000003446 ligand Substances 0.000 claims abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 7
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 5
- 229910052787 antimony Chemical group 0.000 claims abstract description 4
- 229910052785 arsenic Inorganic materials 0.000 claims abstract description 4
- -1 transition metal salt Chemical class 0.000 claims abstract description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims abstract description 3
- 239000011574 phosphorus Substances 0.000 claims abstract description 3
- 150000002941 palladium compounds Chemical class 0.000 claims abstract 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 40
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 27
- 229920001577 copolymer Polymers 0.000 claims description 24
- 229920001897 terpolymer Polymers 0.000 claims description 23
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 9
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- 150000003624 transition metals Chemical class 0.000 claims description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- 229910052802 copper Inorganic materials 0.000 claims description 5
- 239000010949 copper Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 claims description 3
- 229910052684 Cerium Inorganic materials 0.000 claims description 3
- 229910052776 Thorium Inorganic materials 0.000 claims description 3
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 229910052720 vanadium Inorganic materials 0.000 claims description 3
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052770 Uranium Inorganic materials 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- 150000002940 palladium Chemical class 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 2
- CRSBERNSMYQZNG-UHFFFAOYSA-N 1-dodecene Chemical compound CCCCCCCCCCC=C CRSBERNSMYQZNG-UHFFFAOYSA-N 0.000 claims 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims 1
- 229920005603 alternating copolymer Polymers 0.000 claims 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 claims 1
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 claims 1
- 229910052726 zirconium Inorganic materials 0.000 claims 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical group [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 abstract description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical group [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 abstract description 2
- 229910052799 carbon Inorganic materials 0.000 description 32
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 229910052763 palladium Inorganic materials 0.000 description 17
- 238000006116 polymerization reaction Methods 0.000 description 17
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 10
- 229920000642 polymer Polymers 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 8
- 230000035484 reaction time Effects 0.000 description 8
- 150000002739 metals Chemical class 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- 239000007788 liquid Substances 0.000 description 4
- 239000001294 propane Substances 0.000 description 4
- 235000013849 propane Nutrition 0.000 description 4
- 229910052768 actinide Inorganic materials 0.000 description 3
- 150000001255 actinides Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910052747 lanthanoid Inorganic materials 0.000 description 3
- 150000002602 lanthanoids Chemical class 0.000 description 3
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 229940005561 1,4-benzoquinone Drugs 0.000 description 2
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 2
- VTWDKFNVVLAELH-UHFFFAOYSA-N 2-methylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=CC(=O)C=CC1=O VTWDKFNVVLAELH-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 244000166490 Tetrameles nudiflora Species 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 2
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 1
- KSFNQTZBTVALRV-UHFFFAOYSA-N 2,3,5-trichlorocyclohexa-2,5-diene-1,4-dione Chemical compound ClC1=CC(=O)C(Cl)=C(Cl)C1=O KSFNQTZBTVALRV-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- NYQDCVLCJXRDSK-UHFFFAOYSA-N Bromofos Chemical compound COP(=S)(OC)OC1=CC(Cl)=C(Br)C=C1Cl NYQDCVLCJXRDSK-UHFFFAOYSA-N 0.000 description 1
- 229910052692 Dysprosium Inorganic materials 0.000 description 1
- 101001018064 Homo sapiens Lysosomal-trafficking regulator Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 102100033472 Lysosomal-trafficking regulator Human genes 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 241001307210 Pene Species 0.000 description 1
- 229910052777 Praseodymium Inorganic materials 0.000 description 1
- 101150057388 Reln gene Proteins 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- RRSCGNXXNRAXJC-UHFFFAOYSA-N bis(4-methylphenyl)phosphane Chemical compound C1=CC(C)=CC=C1PC1=CC=C(C)C=C1 RRSCGNXXNRAXJC-UHFFFAOYSA-N 0.000 description 1
- OZECDDHOAMNMQI-UHFFFAOYSA-H cerium(3+);trisulfate Chemical compound [Ce+3].[Ce+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O OZECDDHOAMNMQI-UHFFFAOYSA-H 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- PBWZKZYHONABLN-UHFFFAOYSA-N difluoroacetic acid Chemical compound OC(=O)C(F)F PBWZKZYHONABLN-UHFFFAOYSA-N 0.000 description 1
- KBQHZAAAGSGFKK-UHFFFAOYSA-N dysprosium atom Chemical compound [Dy] KBQHZAAAGSGFKK-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- BAQKJENAVQLANS-UHFFFAOYSA-N fenbutrazate Chemical compound C=1C=CC=CC=1C(CC)C(=O)OCCN(C1C)CCOC1C1=CC=CC=C1 BAQKJENAVQLANS-UHFFFAOYSA-N 0.000 description 1
- 229960002533 fenbutrazate Drugs 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- LHOWRPZTCLUDOI-UHFFFAOYSA-K iron(3+);triperchlorate Chemical compound [Fe+3].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O LHOWRPZTCLUDOI-UHFFFAOYSA-K 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- OHSVLFRHMCKCQY-UHFFFAOYSA-N lutetium atom Chemical compound [Lu] OHSVLFRHMCKCQY-UHFFFAOYSA-N 0.000 description 1
- ZLQBNKOPBDZKDP-UHFFFAOYSA-L nickel(2+);diperchlorate Chemical compound [Ni+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O ZLQBNKOPBDZKDP-UHFFFAOYSA-L 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- UUUGYDOQQLOJQA-UHFFFAOYSA-L vanadyl sulfate Chemical compound [V+2]=O.[O-]S([O-])(=O)=O UUUGYDOQQLOJQA-UHFFFAOYSA-L 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- ZXAUZSQITFJWPS-UHFFFAOYSA-J zirconium(4+);disulfate Chemical compound [Zr+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZXAUZSQITFJWPS-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J23/00—Catalysts comprising metals or metal oxides or hydroxides, not provided for in group B01J21/00
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G67/00—Macromolecular compounds obtained by reactions forming in the main chain of the macromolecule a linkage containing oxygen or oxygen and carbon, not provided for in groups C08G2/00 - C08G65/00
- C08G67/02—Copolymers of carbon monoxide and aliphatic unsaturated compounds
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/16—Catalysts comprising hydrides, coordination complexes or organic compounds containing coordination complexes
- B01J31/24—Phosphines, i.e. phosphorus bonded to only carbon atoms, or to both carbon and hydrogen atoms, including e.g. sp2-hybridised phosphorus compounds such as phosphabenzene, phosphole or anionic phospholide ligands
- B01J31/2404—Cyclic ligands, including e.g. non-condensed polycyclic ligands, the phosphine-P atom being a ring member or a substituent on the ring
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/16—Catalysts comprising hydrides, coordination complexes or organic compounds containing coordination complexes
- B01J31/24—Phosphines, i.e. phosphorus bonded to only carbon atoms, or to both carbon and hydrogen atoms, including e.g. sp2-hybridised phosphorus compounds such as phosphabenzene, phosphole or anionic phospholide ligands
- B01J31/2404—Cyclic ligands, including e.g. non-condensed polycyclic ligands, the phosphine-P atom being a ring member or a substituent on the ring
- B01J31/2409—Cyclic ligands, including e.g. non-condensed polycyclic ligands, the phosphine-P atom being a ring member or a substituent on the ring with more than one complexing phosphine-P atom
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2531/00—Additional information regarding catalytic systems classified in B01J31/00
- B01J2531/80—Complexes comprising metals of Group VIII as the central metal
- B01J2531/82—Metals of the platinum group
- B01J2531/824—Palladium
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/16—Catalysts comprising hydrides, coordination complexes or organic compounds containing coordination complexes
- B01J31/18—Catalysts comprising hydrides, coordination complexes or organic compounds containing coordination complexes containing nitrogen, phosphorus, arsenic or antimony as complexing atoms, e.g. in pyridine ligands, or in resonance therewith, e.g. in isocyanide ligands C=N-R or as complexed central atoms
- B01J31/1895—Catalysts comprising hydrides, coordination complexes or organic compounds containing coordination complexes containing nitrogen, phosphorus, arsenic or antimony as complexing atoms, e.g. in pyridine ligands, or in resonance therewith, e.g. in isocyanide ligands C=N-R or as complexed central atoms the ligands containing arsenic or antimony
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Inorganic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Polyethers (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Paper (AREA)
- Endoscopes (AREA)
- Glass Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL8600564 | 1986-03-05 | ||
| NL8600564 | 1986-03-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1324456C true CA1324456C (en) | 1993-11-16 |
Family
ID=19847665
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000529757A Expired - Fee Related CA1324456C (en) | 1986-03-05 | 1987-02-16 | Catalyst compositions |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US4824934A (h) |
| EP (1) | EP0235865B1 (h) |
| JP (1) | JPH0822913B2 (h) |
| KR (1) | KR870008616A (h) |
| CN (1) | CN1013374B (h) |
| AT (1) | ATE69454T1 (h) |
| AU (1) | AU590823B2 (h) |
| BR (1) | BR8700951A (h) |
| CA (1) | CA1324456C (h) |
| DE (1) | DE3774456D1 (h) |
| DK (1) | DK109787A (h) |
| ES (1) | ES2026519T3 (h) |
| FI (1) | FI870928A7 (h) |
| GR (1) | GR3003194T3 (h) |
| IL (1) | IL81972A0 (h) |
| IN (1) | IN168056B (h) |
| NO (1) | NO870876L (h) |
| NZ (1) | NZ219481A (h) |
| ZA (1) | ZA871519B (h) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE60363B1 (en) * | 1986-05-27 | 1994-07-13 | Shell Int Research | Process for the preparation of polymers |
| CA1305695C (en) * | 1986-08-22 | 1992-07-28 | Eit Drent | Catalyst compositions and process for olefin/co copolymerization |
| IN171627B (h) * | 1986-08-26 | 1992-11-28 | Shell Int Research | |
| US4841020A (en) * | 1986-11-27 | 1989-06-20 | Shell Oil Company | Catalytic polymerization of carbon monoxide with functional substituted ethylenically unsaturated monomer |
| US4806630A (en) * | 1986-12-01 | 1989-02-21 | Shell Oil Company | Catalytic polymerization of carbon monoxide and olefin, with organo nitro or organo nitrite compound additive |
| US4794165A (en) * | 1987-02-23 | 1988-12-27 | Shell Oil Company | Carbon monoxide/olefin polymerization with bidentate ligand containing |
| NL8702317A (nl) * | 1987-09-29 | 1989-04-17 | Shell Int Research | Katalysatorcomposities. |
| GB8723602D0 (en) * | 1987-10-08 | 1987-11-11 | British Petroleum Co Plc | Polyketones |
| AU2663988A (en) * | 1987-12-09 | 1989-06-15 | Shell Internationale Research Maatschappij B.V. | Polyketone polymer preparation |
| US4916208A (en) * | 1987-12-18 | 1990-04-10 | Shell Oil Company | Novel polymers |
| GB2214917A (en) * | 1988-02-16 | 1989-09-13 | Shell Int Research | Containers for liquid hydrocarbons made of co or so2 copolymer |
| DE68925883T2 (de) * | 1988-11-28 | 1996-09-12 | Shell Int Research | Polymere von Carbonmonoxid mit einem oder mehreren Alphaolefinen |
| US5061785A (en) * | 1989-03-29 | 1991-10-29 | Shell Oil Company | Polymerization of carbon monoxide/olefin with tertiary aliphatic monophosphine catalyst |
| GB8908870D0 (en) * | 1989-04-19 | 1989-06-07 | Shell Int Research | A process for the preparation of carbamates |
| GB8908869D0 (en) * | 1989-04-19 | 1989-06-07 | Shell Int Research | A process for the preparation of aromatic ureas |
| US5057599A (en) * | 1989-07-14 | 1991-10-15 | Shell Oil Company | Polymerization of carbon monoxide/olefin with aromatic tetradentate phosphorus ligand |
| US5215647A (en) * | 1990-07-25 | 1993-06-01 | Shell Oil Company | Oil compositions |
| TW215106B (h) * | 1990-09-25 | 1993-10-21 | Shell Internat Res Schappej B V | |
| US5270441A (en) * | 1990-10-10 | 1993-12-14 | Akzo Nv | Copolymer of carbon monoxide and propylene produced in water/ketone solvent |
| EP0557381A4 (en) * | 1990-10-10 | 1993-10-06 | Akzo N.V. | Copolymer of carbon monoxide and propylene and process for its formation |
| NL9002305A (nl) * | 1990-10-23 | 1992-05-18 | Shell Int Research | Werkwijze voor het ontparaffineren. |
| US5206342A (en) * | 1991-02-28 | 1993-04-27 | Shell Oil Company | Polymerization of carbon monoxide/non conjugated alkenyl benzene |
| US5352767A (en) * | 1992-01-08 | 1994-10-04 | University Of Massachusetts - Amherst | Alpha-olefin/carbon monoxide attenuating copolymers and improved catalyst and method for copolymerizing the same |
| US5644023A (en) * | 1992-04-21 | 1997-07-01 | Union Carbide Chemicals & Plastics Technology Corporation | Process for the manufacture of copolymers of ethylene and carbon monoxide |
| DE69303608T2 (de) * | 1992-06-26 | 1997-02-06 | Akzo Nobel Nv | Polyketongarn und verfahren zu ihrer herstellung |
| US5820806A (en) * | 1993-01-13 | 1998-10-13 | Akzo Nobel Nv | Process for the preparation of polyketone fibers |
| EP0614928B1 (en) * | 1993-03-12 | 2000-02-02 | Shell Internationale Researchmaatschappij B.V. | Process for the preparation of copolymers of carbon monoxide and ethylenically unsaturated compounds |
| GB9307702D0 (en) * | 1993-04-14 | 1993-06-02 | Shell Int Research | Preparation of co-polymers |
| GB9506378D0 (en) * | 1995-03-29 | 1995-05-17 | Bp Chem Int Ltd | Catalyst composition and use therefor |
| ZA964914B (en) * | 1995-06-12 | 1997-01-08 | Shell Int Research | Catalyst composition and process for the preparation of copolymers of carbon monoxide and an olefinically unsaturated compound |
| KR20010040916A (ko) | 1998-02-12 | 2001-05-15 | 스무크 제이. | 폴리케톤 섬유의 제조방법 |
| DE10335990A1 (de) * | 2003-08-01 | 2005-02-24 | Basf Ag | Verfahren zur Emulsionspolymerisation von Olefinen |
| SE527742C2 (sv) * | 2004-02-23 | 2006-05-30 | Sandvik Intellectual Property | Ferritiskt stål för högtemperaturtillämpningar, sätt att framställa detta, produkt och användning av stålet |
| CN105294638A (zh) * | 2015-10-30 | 2016-02-03 | 成都科创佳思科技有限公司 | 一种去氢α-拉帕醌的催化合成方法 |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2495286A (en) * | 1949-06-08 | 1950-01-24 | Du Pont | Interpolymers of carbon monoxide and method for preparing the same |
| GB1129551A (en) * | 1965-03-18 | 1968-10-09 | Ici Ltd | Process for the manufacture of urethanes |
| GB1081304A (en) * | 1965-03-23 | 1967-08-31 | Ici Ltd | Improvements in or relating to chemical compounds |
| US3694412A (en) * | 1971-03-04 | 1972-09-26 | Shell Oil Co | Process for preparing interpolymers of carbon monoxide in the presence of aryl phosphine-palladium halide complex |
| US3689460A (en) * | 1971-03-04 | 1972-09-05 | Shell Oil Co | Interpolymers of carbon monoxide and process for preparing same |
| US3780140A (en) * | 1971-08-06 | 1973-12-18 | Du Pont | Ethylene/carbon monoxide polymer compositions |
| US3914391A (en) * | 1973-03-26 | 1975-10-21 | Shell Oil Co | Preparation of HPd(CN){HD 3{B |
| US3835123A (en) * | 1973-03-26 | 1974-09-10 | Shell Oil Co | Process for preparing interpolymers of carbon monoxide and ethylenically unsaturated compounds |
| US4070532A (en) * | 1975-05-23 | 1978-01-24 | E. I. Du Pont De Nemours And Company | Ethylene carbon monoxide copolymers containing epoxy side groups |
| US3984388A (en) * | 1975-06-02 | 1976-10-05 | Shell Oil Company | Process to prepare polyketones |
| US4076911A (en) * | 1975-11-05 | 1978-02-28 | Union Oil Company Of California | Ethylene-carbon monoxide copolymers |
| GB2058074B (en) * | 1979-08-23 | 1983-10-12 | Secr Defence | Palladium complexes |
| DE3263566D1 (en) * | 1981-12-02 | 1985-06-20 | Shell Int Research | Preparation of carbamates using a palladium-containing catalyst |
| US4414409A (en) * | 1981-12-21 | 1983-11-08 | E. I. Du Pont De Nemours & Company | Palladium sulfonate catalyst systems for carbonylation of olefins |
| US4424317A (en) * | 1982-12-06 | 1984-01-03 | Standard Oil Company (Indiana) | Mannich condensation product of ethylene/propylene/carbonyl polymers |
| ATE49010T1 (de) * | 1983-04-06 | 1990-01-15 | Shell Int Research | Verfahren zur herstellung von polyketonen. |
| US4600614A (en) * | 1983-09-12 | 1986-07-15 | The Dow Chemical Company | High-frequency heatable plastics |
| EP0170311B1 (en) * | 1984-07-30 | 1989-02-01 | Shell Internationale Researchmaatschappij B.V. | Process for the dimerization of olefins |
| GB8428347D0 (en) * | 1984-11-09 | 1984-12-19 | Shell Int Research | Dimerization of olefins |
| NL8403035A (nl) * | 1984-10-05 | 1986-05-01 | Shell Int Research | Werkwijze ter bereiding van polyketonen. |
| GB8432042D0 (en) * | 1984-12-19 | 1985-01-30 | Shell Int Research | Preparation of dimerization products |
| DE3676800D1 (de) * | 1985-11-29 | 1991-02-14 | Shell Int Research | Katalysatorzusammensetzung und verfahren zur copolymerisation von ethen mit kohlenmonoxid. |
| JPH0246968A (ja) * | 1988-08-09 | 1990-02-16 | Furukawa Alum Co Ltd | ろう付耐食アルミニウム配管とその製造方法 |
| JPH0775042B2 (ja) * | 1990-06-13 | 1995-08-09 | シャープ株式会社 | 光磁気記録再生装置 |
-
1987
- 1987-02-16 IN IN132/DEL/87A patent/IN168056B/en unknown
- 1987-02-16 CA CA000529757A patent/CA1324456C/en not_active Expired - Fee Related
- 1987-02-25 AT AT87200330T patent/ATE69454T1/de not_active IP Right Cessation
- 1987-02-25 EP EP87200330A patent/EP0235865B1/en not_active Expired - Lifetime
- 1987-02-25 ES ES198787200330T patent/ES2026519T3/es not_active Expired - Lifetime
- 1987-02-25 DE DE8787200330T patent/DE3774456D1/de not_active Expired - Lifetime
- 1987-02-27 BR BR8700951A patent/BR8700951A/pt not_active IP Right Cessation
- 1987-03-03 CN CN87101643A patent/CN1013374B/zh not_active Expired
- 1987-03-03 ZA ZA871519A patent/ZA871519B/xx unknown
- 1987-03-03 KR KR870001858A patent/KR870008616A/ko not_active Withdrawn
- 1987-03-03 AU AU69646/87A patent/AU590823B2/en not_active Ceased
- 1987-03-03 NO NO870876A patent/NO870876L/no unknown
- 1987-03-03 NZ NZ219481A patent/NZ219481A/xx unknown
- 1987-03-03 FI FI870928A patent/FI870928A7/fi not_active Application Discontinuation
- 1987-03-03 DK DK109787A patent/DK109787A/da not_active Application Discontinuation
- 1987-03-03 JP JP62046952A patent/JPH0822913B2/ja not_active Expired - Lifetime
- 1987-03-05 US US07/021,948 patent/US4824934A/en not_active Expired - Lifetime
- 1987-03-23 IL IL81972A patent/IL81972A0/xx unknown
-
1988
- 1988-06-23 US US07/212,030 patent/US4859645A/en not_active Expired - Lifetime
-
1991
- 1991-11-25 GR GR91401813T patent/GR3003194T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU590823B2 (en) | 1989-11-16 |
| BR8700951A (pt) | 1987-12-29 |
| NZ219481A (en) | 1989-02-24 |
| FI870928A7 (fi) | 1987-09-06 |
| DK109787D0 (da) | 1987-03-03 |
| IN168056B (h) | 1991-01-26 |
| CN1013374B (zh) | 1991-07-31 |
| ZA871519B (en) | 1987-08-24 |
| JPH0822913B2 (ja) | 1996-03-06 |
| US4859645A (en) | 1989-08-22 |
| JPS62212433A (ja) | 1987-09-18 |
| DK109787A (da) | 1987-09-06 |
| AU6964687A (en) | 1987-09-10 |
| ES2026519T3 (es) | 1992-05-01 |
| EP0235865B1 (en) | 1991-11-13 |
| KR870008616A (ko) | 1987-10-19 |
| ATE69454T1 (de) | 1991-11-15 |
| NO870876D0 (no) | 1987-03-03 |
| EP0235865A3 (en) | 1988-01-27 |
| GR3003194T3 (en) | 1993-02-17 |
| DE3774456D1 (de) | 1991-12-19 |
| EP0235865A2 (en) | 1987-09-09 |
| FI870928A0 (fi) | 1987-03-03 |
| US4824934A (en) | 1989-04-25 |
| NO870876L (no) | 1987-09-07 |
| IL81972A0 (en) | 1987-10-20 |
| CN87101643A (zh) | 1987-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1324456C (en) | Catalyst compositions | |
| EP0239145B1 (en) | Catalyst compositions | |
| EP0248483B1 (en) | Process for the preparation of polymers | |
| EP0246674B1 (en) | Process for the preparation of polymers | |
| US4868282A (en) | Polyketone preparation from regulated quotient mixture of olefins | |
| US4960747A (en) | Catalyst composition containing diphosphines having heterocyclic substituents | |
| US4914183A (en) | Steady state preparation of high bulk density polymer of carbon monoxide and olefins | |
| US4740625A (en) | Catalyst compositions and a process for polymerizing carbon monoxide and olefins | |
| CA1314534C (en) | Catalyst compositions and olefin/co-copolymerization process | |
| EP0280380B1 (en) | Catalyst compositions and process for copolymerizing co with one or more olefinically unsaturated compounds | |
| CA1338576C (en) | Polyketone polymer preparation | |
| EP0262745B1 (en) | Polymer preparation | |
| CA2003917A1 (en) | Polymers of carbon monoxide with one or more alpha-olefins | |
| CA1338582C (en) | Process for the preparation of polymers | |
| CA2043513A1 (en) | Preparation of polymers of carbon monoxide with olefinically unsaturated compounds | |
| CA1315457C (en) | Catalyst compositions and olefin/co copolymerization process | |
| US4970294A (en) | α-olefin/carbon monoxide copolymers and catalyst and process for making | |
| AU646545B2 (en) | Catalyst compositions | |
| US5010171A (en) | Carbon monoxide/olefin polymerization with catalyst comprising p. bidentate ligand having non-hydrocarbyl substituent | |
| EP0322018A2 (en) | Polyketone polymer preparation | |
| CA2029788A1 (en) | Preparation of polymers of carbon monoxide with unsaturated compounds | |
| EP0506168A1 (en) | Catalyst compositions | |
| AU607023B2 (en) | Polyketone polymer preparation | |
| US5010170A (en) | Polymerization of carbon monoxide/olefin with at least one tetra aryl diphosphine ligand | |
| CA2055016A1 (en) | Preparation of polymers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |