CA1242721A - Trans-6-¬2-substituted pyrrol-1-yl)alkyl|-pyran -2- one inhibitors of cholesterol synthesis - Google Patents
Trans-6-¬2-substituted pyrrol-1-yl)alkyl|-pyran -2- one inhibitors of cholesterol synthesisInfo
- Publication number
- CA1242721A CA1242721A CA000489315A CA489315A CA1242721A CA 1242721 A CA1242721 A CA 1242721A CA 000489315 A CA000489315 A CA 000489315A CA 489315 A CA489315 A CA 489315A CA 1242721 A CA1242721 A CA 1242721A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- alkyl
- phenyl
- hydroxy
- trans
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000217 alkyl group Chemical group 0.000 title claims abstract description 65
- 125000001462 1-pyrrolyl group Chemical class [*]N1C([H])=C([H])C([H])=C1[H] 0.000 title claims 2
- 239000003112 inhibitor Substances 0.000 title abstract description 6
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 title description 23
- 230000015572 biosynthetic process Effects 0.000 title description 11
- 235000012000 cholesterol Nutrition 0.000 title description 9
- 238000003786 synthesis reaction Methods 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 87
- 238000000034 method Methods 0.000 claims abstract description 63
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 7
- 239000003529 anticholesteremic agent Substances 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 94
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 69
- -1 4-pyridinyl Chemical group 0.000 claims description 54
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 52
- 239000001257 hydrogen Substances 0.000 claims description 38
- 229910052739 hydrogen Inorganic materials 0.000 claims description 38
- WMHRYMDGHQIARA-UHFFFAOYSA-N 4-hydroxyoxan-2-one Chemical compound OC1CCOC(=O)C1 WMHRYMDGHQIARA-UHFFFAOYSA-N 0.000 claims description 36
- 239000000460 chlorine Chemical group 0.000 claims description 36
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 33
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 30
- 229910052801 chlorine Inorganic materials 0.000 claims description 29
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 23
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 18
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 18
- 229910052794 bromium Inorganic materials 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 14
- 125000004423 acyloxy group Chemical group 0.000 claims description 13
- 239000011737 fluorine Substances 0.000 claims description 13
- 229910052731 fluorine Inorganic materials 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 12
- 125000001153 fluoro group Chemical group F* 0.000 claims description 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000002596 lactones Chemical group 0.000 claims description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 5
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 5
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 claims description 5
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 4
- 239000012279 sodium borohydride Substances 0.000 claims description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 claims description 2
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 230000000871 hypocholesterolemic effect Effects 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims 3
- 125000001589 carboacyl group Chemical group 0.000 claims 3
- MVCRJKMSDFMOAD-ROUUACIJSA-N (4s,6s)-4-hydroxy-6-[2-(2-methyl-5-naphthalen-1-ylpyrrol-1-yl)ethyl]oxan-2-one Chemical compound CC1=CC=C(C=2C3=CC=CC=C3C=CC=2)N1CC[C@H]1C[C@H](O)CC(=O)O1 MVCRJKMSDFMOAD-ROUUACIJSA-N 0.000 claims 1
- NYSJCZLVRXRHGX-HOTGVXAUSA-N (4s,6s)-4-hydroxy-6-[2-[2-(2-methoxyphenyl)-5-propan-2-ylpyrrol-1-yl]ethyl]oxan-2-one Chemical compound COC1=CC=CC=C1C1=CC=C(C(C)C)N1CC[C@@H]1OC(=O)C[C@@H](O)C1 NYSJCZLVRXRHGX-HOTGVXAUSA-N 0.000 claims 1
- IRDQZFYIZOXVEG-XQLZCYBYSA-N (4s,6s)-6-[2-[2-(4-fluorophenyl)-5-(1-methylcyclohexa-2,4-dien-1-yl)pyrrol-1-yl]propyl]-4-hydroxyoxan-2-one Chemical compound C=1C=C(F)C=CC=1C1=CC=C(C2(C)C=CC=CC2)N1C(C)C[C@H]1C[C@H](O)CC(=O)O1 IRDQZFYIZOXVEG-XQLZCYBYSA-N 0.000 claims 1
- YXISEZLIKDLBHD-IRXDYDNUSA-N (4s,6s)-6-[2-[2-cyclopropyl-5-(4-fluorophenyl)pyrrol-1-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound O1C(=O)C[C@@H](O)C[C@@H]1CCN1C(C=2C=CC(F)=CC=2)=CC=C1C1CC1 YXISEZLIKDLBHD-IRXDYDNUSA-N 0.000 claims 1
- PMSBINLIZBHCDF-IRXDYDNUSA-N (4s,6s)-6-[2-[2-tert-butyl-5-(4-fluorophenyl)pyrrol-1-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound C([C@@H]1OC(=O)C[C@@H](O)C1)CN1C(C(C)(C)C)=CC=C1C1=CC=C(F)C=C1 PMSBINLIZBHCDF-IRXDYDNUSA-N 0.000 claims 1
- SOWQURNDNUWYOW-GJZGRUSLSA-N (4s,6s)-6-[2-[3,4-dichloro-2-(4-fluorophenyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound C([C@@H]1OC(=O)C[C@@H](O)C1)CN1C(C(C)C)=C(Cl)C(Cl)=C1C1=CC=C(F)C=C1 SOWQURNDNUWYOW-GJZGRUSLSA-N 0.000 claims 1
- UVRRDSHLWNNMFF-IRXDYDNUSA-N dimethyl 2-(4-fluorophenyl)-1-[2-[(2s,4s)-4-hydroxy-6-oxooxan-2-yl]ethyl]-5-propan-2-ylpyrrole-3,4-dicarboxylate Chemical compound C=1C=C(F)C=CC=1C1=C(C(=O)OC)C(C(=O)OC)=C(C(C)C)N1CC[C@H]1C[C@H](O)CC(=O)O1 UVRRDSHLWNNMFF-IRXDYDNUSA-N 0.000 claims 1
- 102100029077 3-hydroxy-3-methylglutaryl-coenzyme A reductase Human genes 0.000 abstract description 8
- 102000004190 Enzymes Human genes 0.000 abstract description 5
- 108090000790 Enzymes Proteins 0.000 abstract description 5
- 108090000895 Hydroxymethylglutaryl CoA Reductases Proteins 0.000 abstract description 5
- 239000003524 antilipemic agent Substances 0.000 abstract description 5
- 230000000055 hyoplipidemic effect Effects 0.000 abstract description 4
- 101710158485 3-hydroxy-3-methylglutaryl-coenzyme A reductase Proteins 0.000 abstract description 3
- 230000003389 potentiating effect Effects 0.000 abstract description 3
- 150000001261 hydroxy acids Chemical class 0.000 abstract description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 56
- 239000000243 solution Substances 0.000 description 46
- 238000002360 preparation method Methods 0.000 description 39
- 238000006243 chemical reaction Methods 0.000 description 38
- 229910001868 water Inorganic materials 0.000 description 28
- 239000000203 mixture Substances 0.000 description 23
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 17
- 239000012267 brine Substances 0.000 description 16
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 16
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- 238000006467 substitution reaction Methods 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 11
- 101150041968 CDC13 gene Proteins 0.000 description 10
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 10
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 150000002500 ions Chemical class 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- HDQOQFCURUKAJI-UHFFFAOYSA-N 1-(4-fluorophenyl)prop-2-en-1-one Chemical compound FC1=CC=C(C(=O)C=C)C=C1 HDQOQFCURUKAJI-UHFFFAOYSA-N 0.000 description 8
- 239000012259 ether extract Substances 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 150000003233 pyrroles Chemical class 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- 150000001299 aldehydes Chemical class 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 125000005594 diketone group Chemical group 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 229940093499 ethyl acetate Drugs 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 4
- VGMFHMLQOYWYHN-UHFFFAOYSA-N Compactin Natural products OCC1OC(OC2C(O)C(O)C(CO)OC2Oc3cc(O)c4C(=O)C(=COc4c3)c5ccc(O)c(O)c5)C(O)C(O)C1O VGMFHMLQOYWYHN-UHFFFAOYSA-N 0.000 description 4
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- AJLFOPYRIVGYMJ-UHFFFAOYSA-N SJ000287055 Natural products C12C(OC(=O)C(C)CC)CCC=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 AJLFOPYRIVGYMJ-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000012280 lithium aluminium hydride Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- AJLFOPYRIVGYMJ-INTXDZFKSA-N mevastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=CCC[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 AJLFOPYRIVGYMJ-INTXDZFKSA-N 0.000 description 4
- BOZILQFLQYBIIY-UHFFFAOYSA-N mevastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CCC=C21 BOZILQFLQYBIIY-UHFFFAOYSA-N 0.000 description 4
- UCUUFSAXZMGPGH-UHFFFAOYSA-N penta-1,4-dien-3-one Chemical class C=CC(=O)C=C UCUUFSAXZMGPGH-UHFFFAOYSA-N 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- 239000004474 valine Substances 0.000 description 4
- CABVTRNMFUVUDM-VRHQGPGLSA-N (3S)-3-hydroxy-3-methylglutaryl-CoA Chemical compound O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C[C@@](O)(CC(O)=O)C)O[C@H]1N1C2=NC=NC(N)=C2N=C1 CABVTRNMFUVUDM-VRHQGPGLSA-N 0.000 description 3
- WYAWZJWKVWBATK-UHFFFAOYSA-N 1-(4-fluorophenyl)-5-methylhexane-1,4-dione Chemical compound CC(C)C(=O)CCC(=O)C1=CC=C(F)C=C1 WYAWZJWKVWBATK-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 229910004373 HOAc Inorganic materials 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 108010028554 LDL Cholesterol Proteins 0.000 description 3
- JYVXNLLUYHCIIH-ZCFIWIBFSA-N R-mevalonolactone, (-)- Chemical compound C[C@@]1(O)CCOC(=O)C1 JYVXNLLUYHCIIH-ZCFIWIBFSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 3
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 3
- 125000005587 carbonate group Chemical group 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- GCSJLQSCSDMKTP-UHFFFAOYSA-N ethenyl(trimethyl)silane Chemical compound C[Si](C)(C)C=C GCSJLQSCSDMKTP-UHFFFAOYSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- CMHHITPYCHHOGT-UHFFFAOYSA-N tributylborane Chemical compound CCCCB(CCCC)CCCC CMHHITPYCHHOGT-UHFFFAOYSA-N 0.000 description 3
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Substances CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 3
- JYVXNLLUYHCIIH-UHFFFAOYSA-N (+/-)-mevalonolactone Natural products CC1(O)CCOC(=O)C1 JYVXNLLUYHCIIH-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 2
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 2
- SNOYUTZWILESAI-UHFFFAOYSA-N 4-methylpent-1-en-3-one Chemical compound CC(C)C(=O)C=C SNOYUTZWILESAI-UHFFFAOYSA-N 0.000 description 2
- ISDBWOPVZKNQDW-UHFFFAOYSA-N 4-phenylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1=CC=CC=C1 ISDBWOPVZKNQDW-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- NYKDZMRSDIPACT-UHFFFAOYSA-N [2-(hydroxymethyl)-1h-pyrrol-3-yl]methanol Chemical compound OCC=1C=CNC=1CO NYKDZMRSDIPACT-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- SURLGNKAQXKNSP-DBLYXWCISA-N chlorin Chemical compound C\1=C/2\N/C(=C\C3=N/C(=C\C=4NC(/C=C\5/C=CC/1=N/5)=CC=4)/C=C3)/CC\2 SURLGNKAQXKNSP-DBLYXWCISA-N 0.000 description 2
- 229940110456 cocoa butter Drugs 0.000 description 2
- 235000019868 cocoa butter Nutrition 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- KVFDZFBHBWTVID-UHFFFAOYSA-N cyclohexanecarbaldehyde Chemical compound O=CC1CCCCC1 KVFDZFBHBWTVID-UHFFFAOYSA-N 0.000 description 2
- VHILMKFSCRWWIJ-UHFFFAOYSA-N dimethyl acetylenedicarboxylate Chemical group COC(=O)C#CC(=O)OC VHILMKFSCRWWIJ-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- OTTZHAVKAVGASB-UHFFFAOYSA-N hept-2-ene Chemical compound CCCCC=CC OTTZHAVKAVGASB-UHFFFAOYSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229940057061 mevalonolactone Drugs 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 229930014626 natural product Natural products 0.000 description 2
- WTEVQBCEXWBHNA-YFHOEESVSA-N neral Chemical compound CC(C)=CCC\C(C)=C/C=O WTEVQBCEXWBHNA-YFHOEESVSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000008279 sol Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- YAGSCRJOPNSMPV-PMACEKPBSA-N (4s,6s)-4-hydroxy-6-[2-(2-methyl-5-naphthalen-2-ylpyrrol-1-yl)ethyl]oxan-2-one Chemical compound CC1=CC=C(C=2C=C3C=CC=CC3=CC=2)N1CC[C@H]1C[C@H](O)CC(=O)O1 YAGSCRJOPNSMPV-PMACEKPBSA-N 0.000 description 1
- GRYRYCIEQRBDRS-HOTGVXAUSA-N (4s,6s)-4-hydroxy-6-[2-(2-methyl-5-phenylpyrrol-1-yl)ethyl]oxan-2-one Chemical compound C([C@@H]1OC(=O)C[C@@H](O)C1)CN1C(C)=CC=C1C1=CC=CC=C1 GRYRYCIEQRBDRS-HOTGVXAUSA-N 0.000 description 1
- YLZQZLZZYQZWQY-ROUUACIJSA-N (4s,6s)-6-[2-[1-(4-fluorophenyl)-3-methyl-4,5,6,7-tetrahydroisoindol-2-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound C([C@@H]1OC(=O)C[C@@H](O)C1)CN1C(C)=C2CCCCC2=C1C1=CC=C(F)C=C1 YLZQZLZZYQZWQY-ROUUACIJSA-N 0.000 description 1
- VGXGUJPBOIYJRO-HOTGVXAUSA-N (4s,6s)-6-[2-[2-(2,6-dimethoxyphenyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound COC1=CC=CC(OC)=C1C1=CC=C(C(C)C)N1CC[C@@H]1OC(=O)C[C@@H](O)C1 VGXGUJPBOIYJRO-HOTGVXAUSA-N 0.000 description 1
- IHNCWQSEFKFQIZ-KZWYQTIJSA-N (4s,6s)-6-[2-[2-(5-bicyclo[2.2.1]hept-2-enyl)-5-methylpyrrol-1-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound CC1=CC=C(C2C3CC(C=C3)C2)N1CC[C@H]1C[C@H](O)CC(=O)O1 IHNCWQSEFKFQIZ-KZWYQTIJSA-N 0.000 description 1
- CQLCSKXQNGSOLY-PMACEKPBSA-N (4s,6s)-6-[2-[2-cyclohexyl-5-(4-fluorophenyl)pyrrol-1-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound O1C(=O)C[C@@H](O)C[C@@H]1CCN1C(C=2C=CC(F)=CC=2)=CC=C1C1CCCCC1 CQLCSKXQNGSOLY-PMACEKPBSA-N 0.000 description 1
- WBIKEFHDVYIQGO-OALUTQOASA-N (4s,6s)-6-[2-[3,4-diacetyl-2-(4-fluorophenyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound C([C@@H]1OC(=O)C[C@@H](O)C1)CN1C(C(C)C)=C(C(C)=O)C(C(C)=O)=C1C1=CC=C(F)C=C1 WBIKEFHDVYIQGO-OALUTQOASA-N 0.000 description 1
- MDCJGIDGBYXKMS-OALUTQOASA-N (4s,6s)-6-[2-[3,4-diethyl-2-(4-fluorophenyl)-5-propan-2-ylpyrrol-1-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound C([C@@H]1OC(=O)C[C@@H](O)C1)CN1C(C(C)C)=C(CC)C(CC)=C1C1=CC=C(F)C=C1 MDCJGIDGBYXKMS-OALUTQOASA-N 0.000 description 1
- VEUQVFKZVHFXTK-IRXDYDNUSA-N (4s,6s)-6-[2-[6-(4-fluorophenyl)-4-propan-2-yl-2,3-dihydro-1h-pyrrolo[3,4-c]pyrrol-5-yl]ethyl]-4-hydroxyoxan-2-one Chemical compound C([C@@H]1OC(=O)C[C@@H](O)C1)CN1C(C(C)C)=C2CNCC2=C1C1=CC=C(F)C=C1 VEUQVFKZVHFXTK-IRXDYDNUSA-N 0.000 description 1
- KJTLQQUUPVSXIM-ZCFIWIBFSA-N (R)-mevalonic acid Chemical class OCC[C@](O)(C)CC(O)=O KJTLQQUUPVSXIM-ZCFIWIBFSA-N 0.000 description 1
- CDMBNXFQNKVZEM-UHFFFAOYSA-N 1h-pyrrole-3,4-dicarbonitrile Chemical compound N#CC1=CNC=C1C#N CDMBNXFQNKVZEM-UHFFFAOYSA-N 0.000 description 1
- HLLGFGBLKOIZOM-UHFFFAOYSA-N 2,2-diphenylacetaldehyde Chemical compound C=1C=CC=CC=1C(C=O)C1=CC=CC=C1 HLLGFGBLKOIZOM-UHFFFAOYSA-N 0.000 description 1
- QURKKPVVCGDOTK-UHFFFAOYSA-M 2-(4-benzyl-3-methyl-1,3-thiazol-3-ium-2-yl)ethanol;chloride Chemical compound [Cl-].S1C(CCO)=[N+](C)C(CC=2C=CC=CC=2)=C1 QURKKPVVCGDOTK-UHFFFAOYSA-M 0.000 description 1
- OMLDWSRJTBENQB-UHFFFAOYSA-N 2-(4-fluorophenyl)-5-propan-2-yl-1H-pyrrole-3,4-dicarboxylic acid Chemical compound CC(C)C1=C(C(=C(N1)C2=CC=C(C=C2)F)C(=O)O)C(=O)O OMLDWSRJTBENQB-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- BKMMTJMQCTUHRP-UHFFFAOYSA-N 2-aminopropan-1-ol Chemical compound CC(N)CO BKMMTJMQCTUHRP-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- PJKVFARRVXDXAD-UHFFFAOYSA-N 2-naphthaldehyde Chemical compound C1=CC=CC2=CC(C=O)=CC=C21 PJKVFARRVXDXAD-UHFFFAOYSA-N 0.000 description 1
- MKGKLVLUMZIALP-UHFFFAOYSA-N 3-[2-(4-fluorophenyl)-5-(trifluoromethyl)pyrrol-1-yl]propanenitrile Chemical class C1=CC(F)=CC=C1C1=CC=C(C(F)(F)F)N1CCC#N MKGKLVLUMZIALP-UHFFFAOYSA-N 0.000 description 1
- MUOKXXOKLLKNIE-UHFFFAOYSA-N 4,4-dimethylpent-1-en-3-one Chemical compound CC(C)(C)C(=O)C=C MUOKXXOKLLKNIE-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- LQRPPQSASPIQAR-UHFFFAOYSA-N C(CC(=O)C)(=O)OC.[Na].[Li] Chemical compound C(CC(=O)C)(=O)OC.[Na].[Li] LQRPPQSASPIQAR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920001268 Cholestyramine Polymers 0.000 description 1
- WTEVQBCEXWBHNA-UHFFFAOYSA-N Citral Natural products CC(C)=CCCC(C)=CC=O WTEVQBCEXWBHNA-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229910010199 LiAl Inorganic materials 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000022563 Rema Species 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241000610375 Sparisoma viride Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930182558 Sterol Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical group C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- AJIBZRIAUXVGQJ-UHFFFAOYSA-N bicyclo[2.2.1]hept-2-ene-5-carbaldehyde Chemical compound C1C2C(C=O)CC1C=C2 AJIBZRIAUXVGQJ-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- YKPUWZUDDOIDPM-SOFGYWHQSA-N capsaicin Chemical compound COC1=CC(CNC(=O)CCCC\C=C\C(C)C)=CC=C1O YKPUWZUDDOIDPM-SOFGYWHQSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229940106135 cellulose Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- WTEVQBCEXWBHNA-JXMROGBWSA-N citral A Natural products CC(C)=CCC\C(C)=C\C=O WTEVQBCEXWBHNA-JXMROGBWSA-N 0.000 description 1
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- SMBQBQBNOXIFSF-UHFFFAOYSA-N dilithium Chemical compound [Li][Li] SMBQBQBNOXIFSF-UHFFFAOYSA-N 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical compound [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical class CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 239000002035 hexane extract Substances 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- KJTLQQUUPVSXIM-UHFFFAOYSA-N mevalonic acid Chemical compound OCCC(O)(C)CC(O)=O KJTLQQUUPVSXIM-UHFFFAOYSA-N 0.000 description 1
- ASBIGRMSMVGJFG-UHFFFAOYSA-N n-(2,2-dimethyloxan-4-yl)-3-(4-fluorophenyl)-3-(furan-2-yl)propanamide Chemical compound C1COC(C)(C)CC1NC(=O)CC(C=1C=CC(F)=CC=1)C1=CC=CO1 ASBIGRMSMVGJFG-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- ALDITMKAAPLVJK-UHFFFAOYSA-N prop-1-ene;hydrate Chemical group O.CC=C ALDITMKAAPLVJK-UHFFFAOYSA-N 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Substances CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003432 sterols Chemical class 0.000 description 1
- 235000003702 sterols Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- FGTJJHCZWOVVNH-UHFFFAOYSA-N tert-butyl-[tert-butyl(dimethyl)silyl]oxy-dimethylsilane Chemical class CC(C)(C)[Si](C)(C)O[Si](C)(C)C(C)(C)C FGTJJHCZWOVVNH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- QXTIBZLKQPJVII-UHFFFAOYSA-N triethylsilicon Chemical compound CC[Si](CC)CC QXTIBZLKQPJVII-UHFFFAOYSA-N 0.000 description 1
- UORVGPXVDQYIDP-UHFFFAOYSA-N trihydridoboron Substances B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65379884A | 1984-09-24 | 1984-09-24 | |
| US653,798 | 1984-09-24 | ||
| US679,676 | 1984-12-10 | ||
| US06/679,676 US4647576A (en) | 1984-09-24 | 1984-12-10 | Trans-6-[2-(substitutedpyrrol-1-yl)alkyl]-pyran-2-one inhibitors of cholesterol synthesis |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1242721A true CA1242721A (en) | 1988-10-04 |
Family
ID=27096596
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000489315A Expired CA1242721A (en) | 1984-09-24 | 1985-08-23 | Trans-6-¬2-substituted pyrrol-1-yl)alkyl|-pyran -2- one inhibitors of cholesterol synthesis |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4647576A (enExample) |
| EP (1) | EP0179559A3 (enExample) |
| KR (2) | KR890001449B1 (enExample) |
| AU (1) | AU573027B2 (enExample) |
| CA (1) | CA1242721A (enExample) |
| DK (1) | DK430485A (enExample) |
| ES (1) | ES8701756A1 (enExample) |
| FI (1) | FI853632A7 (enExample) |
| GR (1) | GR852297B (enExample) |
| NO (1) | NO853725L (enExample) |
| NZ (1) | NZ213252A (enExample) |
| PT (1) | PT81179B (enExample) |
Families Citing this family (188)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5354772A (en) * | 1982-11-22 | 1994-10-11 | Sandoz Pharm. Corp. | Indole analogs of mevalonolactone and derivatives thereof |
| US5001255A (en) * | 1984-12-04 | 1991-03-19 | Sandoz Pharm. Corp. | Idene analogs of mevalonolactone and derivatives thereof |
| US4973704A (en) * | 1985-10-25 | 1990-11-27 | Sandoz Pharm. Corp. | Pyrrolyl intermediates in the synthesis of pyrrole analogs of mevalonolactone and derivatives thereof |
| US4851427A (en) * | 1985-10-25 | 1989-07-25 | Sandoz Pharm. Corp. | Pyrrole analogs of mevalonolactone, derivatives thereof and pharmaceutical use |
| US4681893A (en) * | 1986-05-30 | 1987-07-21 | Warner-Lambert Company | Trans-6-[2-(3- or 4-carboxamido-substituted pyrrol-1-yl)alkyl]-4-hydroxypyran-2-one inhibitors of cholesterol synthesis |
| US4735958A (en) * | 1986-12-22 | 1988-04-05 | Warner-Lambert Company | Trans-6-[2-[2-(substituted-phenyl)-3- (or 4-) heteroaryl-5-substituted-1H-pyrrol-1-yl]-ethyl]tetrahydro-4-hydroxy-2H-pyran-2-one inhibitors of cholesterol biosynthesis |
| US4789682A (en) * | 1987-03-17 | 1988-12-06 | Merck & Co., Inc. | Antihypercholesterolemic compounds |
| NO881411L (no) * | 1987-04-14 | 1988-10-17 | Bayer Ag | Substituerte pyrroler. |
| US5091378A (en) * | 1987-05-22 | 1992-02-25 | E. R. Squibb & Sons, Inc. | Phosphorus-containing HMG-CoA reductase inhibitors, new intermediates and method |
| US4775681A (en) * | 1987-06-18 | 1988-10-04 | Warner-Lambert Company | Method of treating fungal infections with trans-6-[2-substitutedpyrrol-1-yl)alkyl]-4-hydroxypyran-2-ones |
| DE3722806A1 (de) * | 1987-07-10 | 1989-01-19 | Hoechst Ag | 7-(1h-pyrrol-3-yl)-substituierte 3,5-dihydroxy-hept-6-ensaeuren, 7-(1h-pyrrol-3-yl)-substituierte 3,5-dihydroxy-heptansaeuren, ihre entsprechenden (delta)-lactone und salze, verfahren zu ihrer herstellung ihre verwendung als arzneimittel, pharmazeutische praeparate und zwischenprodukte |
| DE3722809A1 (de) * | 1987-07-10 | 1989-01-19 | Hoechst Ag | 3-desmethyl-4-fluor-mevalonsaeurederivate, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen, ihre verwendung und zwischenprodukte |
| DE3817808A1 (de) * | 1987-07-21 | 1989-02-02 | Bayer Ag | Verfahren zur herstellung von 2-substituierten pyrrolen |
| US5010098A (en) * | 1987-07-29 | 1991-04-23 | American Cyanamid Company | Arylpyrrole insecticidal acaricidal and nematicidal agents and methods for the preparation thereof |
| US5455263A (en) * | 1987-07-29 | 1995-10-03 | American Cyanamid Company | Methods for the control and the protection of warm-blooded animals against infestation and infection by helminths, acarids and arthropod endo- and ectoparasites |
| JP2569746B2 (ja) * | 1987-08-20 | 1997-01-08 | 日産化学工業株式会社 | キノリン系メバロノラクトン類 |
| CA1336714C (en) * | 1987-08-20 | 1995-08-15 | Yoshihiro Fujikawa | Quinoline type mevalonolactone inhibitors of cholesterol biosynthesis |
| US5185328A (en) * | 1987-08-20 | 1993-02-09 | Nissan Chemical Industries Ltd. | Quinoline type mevalonolactones useful for treating hyperlipidemia, hyperlipoproteinemia or atherosclerosis |
| US4906624A (en) * | 1987-09-08 | 1990-03-06 | Warner-Lambert Company | 6-(((Substituted)pyridin-3-yl)alkyl)-and alkenyl)-tetrahydro-4-hydroxypyran-2-one inhibitors of cholesterol biosynthesis |
| US4997837A (en) * | 1987-09-08 | 1991-03-05 | Warner-Lambert Company | 6-(((substituted)pyridin-3-yl)alkyl)-and alkenyl)-tetrahydro-4-hydroxypyran-2-one inhibitors of cholesterol biosynthesis |
| GB8728314D0 (en) * | 1987-12-03 | 1988-01-06 | May & Baker Ltd | New compositions of matter |
| US4761419A (en) * | 1987-12-07 | 1988-08-02 | Warner-Lambert Company | 6-(((substituted)quinolinyl)ethyl)-and ethenyl)tetrahydro-4-hydroxypyran-2-one inhibitors of cholesterol biosynthesis |
| US4868185A (en) * | 1987-12-10 | 1989-09-19 | Warner-Lambert Company | 6-[[Substituted)pyrimidinyl)ethyl]- and ethenyl]tetrahydro-4-hydroxypyran-2-one inhibitors of cholesterol biosynthesis |
| DE3800785A1 (de) * | 1988-01-09 | 1989-07-20 | Hoechst Ag | Substituierte 7-(pyridazin-5-yl)-3,5-dihydroxyheptan(en)- saeuren, ihre entsprechenden (delta)-lactone bzw. derivate, verfahren zu ihrer herstellung, ihre verwendung als arzneimittel, pharmazeutische praeparate und zwischenprodukte |
| US4822799A (en) * | 1988-01-27 | 1989-04-18 | Sandoz Pharm. Corp. | Pyrazolopyridine analogs of mevalonolactone and derivatives thereof useful for inhibiting cholesterol biosynthesis in mammals |
| FI890393A7 (fi) * | 1988-01-27 | 1989-07-28 | May & Baker Ltd | Foerfarande foer framstaellning av isokinoliner. |
| US5097045A (en) * | 1989-02-01 | 1992-03-17 | Warner-Lambert Company | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis |
| US5216174A (en) * | 1988-02-22 | 1993-06-01 | Warner-Lambert Co. | Process for trans-6-[12-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis |
| US5003080A (en) * | 1988-02-22 | 1991-03-26 | Warner-Lambert Company | Process for trans-6-(2-(substituted-pyrrol-1-yl)alkyl)pryan-2-one inhibitors of cholesterol synthesis |
| US5245047A (en) * | 1988-02-22 | 1993-09-14 | Warner-Lambert Company | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis |
| US5124482A (en) * | 1988-02-22 | 1992-06-23 | Warner-Lambert Company | Process for trans-6-(2-substituted-pyrrol-1-yl)alkyl)pyran-2-one inhibitors of cholesterol synthesis |
| US5149837A (en) * | 1988-02-22 | 1992-09-22 | Warner-Lambert Company | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis |
| IT1226726B (it) * | 1988-07-29 | 1991-02-05 | Zambon Spa | Composti attivi come inibitori della biosintesi del colesterolo. |
| US5196440A (en) * | 1988-07-29 | 1993-03-23 | Zambon Group S.P.A. | Compounds active as inhibitors of the cholesterol biosynthesis |
| US5506219A (en) * | 1988-08-29 | 1996-04-09 | E. R. Squibb & Sons, Inc. | Pyridine anchors for HMG-CoA reductase inhibitors |
| DE3832570A1 (de) * | 1988-09-24 | 1990-03-29 | Hoechst Ag | 7-substituierte derivate der 3,5-dihydroxyhept-6-insaeure, verfahren zur ihrer herstellung, ihre verwendung als arzneimittel, sowie zwischenprodukte |
| NL8902441A (nl) * | 1988-10-03 | 1990-05-01 | Glaxo Group Ltd | Chemische verbinding. |
| US4957940A (en) * | 1988-12-21 | 1990-09-18 | Warner-Lambert Company | Bicyclo heptane and bicyclo octane substituted inhibitors of cholesterol synthesis |
| US4906657A (en) * | 1988-12-21 | 1990-03-06 | Warner-Lambert Company | Bicyclo heptane and bicyclo octane substituted inhibitors of cholesterol synthesis |
| FI94339C (fi) | 1989-07-21 | 1995-08-25 | Warner Lambert Co | Menetelmä farmaseuttisesti käyttökelpoisen /R-(R*,R*)/-2-(4-fluorifenyyli)- , -dihydroksi-5-(1-metyylietyyli)-3-fenyyli-4-/(fenyyliamino)karbonyyli/-1H-pyrroli-1-heptaanihapon ja sen farmaseuttisesti hyväksyttävien suolojen valmistamiseksi |
| IE903606A1 (en) * | 1989-10-10 | 1991-04-24 | Glaxo Group Ltd | Chemical compounds |
| IT1237792B (it) * | 1989-12-21 | 1993-06-17 | Zambon Spa | Composti attivi come inibitori dell'enzima hmg-coa reduttasi |
| US5248793A (en) * | 1990-10-17 | 1993-09-28 | Warner-Lambert Company | Process for the synthesis of (4R-cis)-1,1-dimethylethyl 6-iodomethyl or 6-(phenyl-substituted)sulfonyloxymethyl-2,2-dimethyl-1,3-dioxane-4-acetate |
| US5103024A (en) * | 1990-10-17 | 1992-04-07 | Warner-Lambert Company | Process for the synthesis of (4r-cis)-1,1-dimethylethyl 6-cyanomethyl-2,2-dimethyl-1,3-dioxane-4-acetate |
| US5155251A (en) * | 1991-10-11 | 1992-10-13 | Warner-Lambert Company | Process for the synthesis of (5R)-1,1-dimethylethyl-6-cyano-5-hydroxy-3-oxo-hexanoate |
| US5449789A (en) * | 1992-11-30 | 1995-09-12 | American Cyanamid Company | Debrominative chlorination of pyrroles |
| DE4243279A1 (de) * | 1992-12-21 | 1994-06-23 | Bayer Ag | Substituierte Triole |
| US5298627A (en) * | 1993-03-03 | 1994-03-29 | Warner-Lambert Company | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis |
| US20010006644A1 (en) | 1997-07-31 | 2001-07-05 | David J. Bova | Combinations of hmg-coa reductase inhibitors and nicotinic acid and methods for treating hyperlipidemia once a day at night |
| US6177121B1 (en) | 1997-09-29 | 2001-01-23 | Purdue Research Foundation | Composition and method for producing low cholesterol eggs |
| US8679534B2 (en) * | 1997-12-12 | 2014-03-25 | Andrx Labs, Llc | HMG-CoA reductase inhibitor extended release formulation |
| US8293277B2 (en) * | 1998-10-01 | 2012-10-23 | Alkermes Pharma Ireland Limited | Controlled-release nanoparticulate compositions |
| US20080213378A1 (en) * | 1998-10-01 | 2008-09-04 | Elan Pharma International, Ltd. | Nanoparticulate statin formulations and novel statin combinations |
| US6472421B1 (en) * | 1998-11-13 | 2002-10-29 | Nymox Corporation | Methods for treating, preventing, and reducing the risk of the onset of alzheimer's disease using an HMG CoA reductase inhibitor |
| EP1284729A4 (en) * | 2000-04-13 | 2007-12-19 | Mayo Foundation | A- (BETA) -42 DECREASING MEDICINAL PRODUCTS |
| DE10030375A1 (de) * | 2000-06-21 | 2002-01-03 | Bayer Ag | Verwendung von MTP-Inhibitoren zur Senkung von ppTRL |
| JO2654B1 (en) * | 2000-09-04 | 2012-06-17 | شركة جانسين فارماسوتيكا ان. في | Multiple aryl caroxa amides are useful as lipid - lowering agents |
| US7276249B2 (en) * | 2002-05-24 | 2007-10-02 | Elan Pharma International, Ltd. | Nanoparticulate fibrate formulations |
| US20030224058A1 (en) * | 2002-05-24 | 2003-12-04 | Elan Pharma International, Ltd. | Nanoparticulate fibrate formulations |
| US20080241070A1 (en) * | 2000-09-21 | 2008-10-02 | Elan Pharma International Ltd. | Fenofibrate dosage forms |
| JO2409B1 (en) | 2000-11-21 | 2007-06-17 | شركة جانسين فارماسوتيكا ان. في | Second-phenyl carboxy amides are useful as lipid-lowering agents |
| US6982251B2 (en) | 2000-12-20 | 2006-01-03 | Schering Corporation | Substituted 2-azetidinones useful as hypocholesterolemic agents |
| DE60212801T2 (de) | 2001-01-26 | 2007-02-01 | Schering Corp. | Verwendung azetidinone-substituierter verbindungen zur behandlung der sitosterolhämie |
| HUP0303915A3 (en) | 2001-01-26 | 2012-12-28 | Merck Sharp & Dohme | Combinations of peroxisome proliferator-activated receptor (ppar) activator(s) and sterol absorption inhibitor(s) and treatments for vascular indications |
| US7071181B2 (en) | 2001-01-26 | 2006-07-04 | Schering Corporation | Methods and therapeutic combinations for the treatment of diabetes using sterol absorption inhibitors |
| JO2390B1 (en) * | 2001-04-06 | 2007-06-17 | شركة جانسين فارماسوتيكا ان. في | Diphenylcarboxamides act as lipid-lowering agents |
| AU2002254567B2 (en) | 2001-04-11 | 2007-10-11 | Bristol-Myers Squibb Company | Amino acid complexes of C-aryl glucosides for treatment of diabetes and method |
| KR100575919B1 (ko) * | 2001-06-28 | 2006-05-02 | 화이자 프로덕츠 인코포레이티드 | 미소체 트리글리세라이드 전달 단백질(mtp) 및/또는아포지방단백질 b(apo b)분비의 억제제로서의트리아미드-치환된 인돌, 벤조푸란 및 벤조티오펜 |
| GB0116212D0 (en) * | 2001-07-03 | 2001-08-29 | Avecia Ltd | Process |
| US7053080B2 (en) | 2001-09-21 | 2006-05-30 | Schering Corporation | Methods and therapeutic combinations for the treatment of obesity using sterol absorption inhibitors |
| ATE345793T1 (de) | 2001-09-21 | 2006-12-15 | Schering Corp | Behandlung von xanthom mittels azetidinon- derivate als hemmer der sterol absorption |
| US7056906B2 (en) | 2001-09-21 | 2006-06-06 | Schering Corporation | Combinations of hormone replacement therapy composition(s) and sterol absorption inhibitor(s) and treatments for vascular conditions in post-menopausal women |
| US7238671B2 (en) * | 2001-10-18 | 2007-07-03 | Bristol-Myers Squibb Company | Human glucagon-like-peptide-1 mimics and their use in the treatment of diabetes and related conditions |
| US7238670B2 (en) * | 2001-10-18 | 2007-07-03 | Bristol-Myers Squibb Company | Human glucagon-like-peptide-1 mimics and their use in the treatment of diabetes and related conditions |
| US6806381B2 (en) * | 2001-11-02 | 2004-10-19 | Bristol-Myers Squibb Company | Process for the preparation of aniline-derived thyroid receptor ligands |
| US6984645B2 (en) * | 2001-11-16 | 2006-01-10 | Bristol-Myers Squibb Company | Dual inhibitors of adipocyte fatty acid binding protein and keratinocyte fatty acid binding protein |
| US6831102B2 (en) * | 2001-12-07 | 2004-12-14 | Bristol-Myers Squibb Company | Phenyl naphthol ligands for thyroid hormone receptor |
| US6747048B2 (en) | 2002-05-08 | 2004-06-08 | Bristol-Myers Squibb Company | Pyridine-based thyroid receptor ligands |
| US7057046B2 (en) * | 2002-05-20 | 2006-06-06 | Bristol-Myers Squibb Company | Lactam glycogen phosphorylase inhibitors and method of use |
| US20070264348A1 (en) * | 2002-05-24 | 2007-11-15 | Elan Pharma International, Ltd. | Nanoparticulate fibrate formulations |
| CA2488498A1 (en) * | 2002-06-10 | 2003-12-18 | Elan Pharma International Limited | Nanoparticulate polycosanol formulations and novel polycosanol combinations |
| UA79300C2 (en) * | 2002-08-12 | 2007-06-11 | Janssen Pharmaceutica Nv | N-aryl piperidine substituted biphenylcarboxamides as inhibitors of apolipoprotein b secretion |
| US20060019269A1 (en) * | 2002-10-17 | 2006-01-26 | Decode Genetics, Inc. | Susceptibility gene for myocardial infarction, stroke, and PAOD, methods of treatment |
| US20080293750A1 (en) * | 2002-10-17 | 2008-11-27 | Anna Helgadottir | Susceptibility Gene for Myocardial Infarction, Stroke, Paod and Methods of Treatment |
| EP1553937B1 (en) * | 2002-10-23 | 2010-06-02 | Bristol-Myers Squibb Company | Glycinenitrile-based inhibitors of dipeptidyl peptidase iv |
| US7560449B2 (en) | 2002-11-06 | 2009-07-14 | Schering Corporation | Methods and therapeutic combinations for the treatment of demyelination |
| US7098235B2 (en) * | 2002-11-14 | 2006-08-29 | Bristol-Myers Squibb Co. | Triglyceride and triglyceride-like prodrugs of glycogen phosphorylase inhibiting compounds |
| ATE407670T1 (de) | 2002-12-20 | 2008-09-15 | Pfizer Prod Inc | Dosierungsform enthaltend einen cetp-hemmer und einen hmg-coa reduktase hemmer |
| US20040132771A1 (en) * | 2002-12-20 | 2004-07-08 | Pfizer Inc | Compositions of choleseteryl ester transfer protein inhibitors and HMG-CoA reductase inhibitors |
| EP1587783A4 (en) * | 2003-01-24 | 2006-11-08 | Bristol Myers Squibb Co | CYCLOALKYL-CONTAINING ANILID LIGANDS FOR THE THYROID RECEPTOR |
| TW200504021A (en) * | 2003-01-24 | 2005-02-01 | Bristol Myers Squibb Co | Substituted anilide ligands for the thyroid receptor |
| WO2004071431A2 (en) * | 2003-02-05 | 2004-08-26 | Myriad Genetics, Inc. | Method and composition for treating neurodegenerative disorders |
| US7459442B2 (en) | 2003-03-07 | 2008-12-02 | Schering Corporation | Substituted azetidinone compounds, processes for preparing the same, formulations and uses thereof |
| CN1756756A (zh) | 2003-03-07 | 2006-04-05 | 先灵公司 | 取代的2-吖丁啶酮化合物、其制剂及其治疗高胆甾醇血症的用途 |
| US7235543B2 (en) | 2003-03-07 | 2007-06-26 | Schering Corporation | Substituted azetidinone compounds, processes for preparing the same, formulations and uses thereof |
| CN1756755A (zh) | 2003-03-07 | 2006-04-05 | 先灵公司 | 取代的2-吖丁啶酮化合物、其制剂及其治疗高胆甾醇血症的用途 |
| US7557143B2 (en) * | 2003-04-18 | 2009-07-07 | Bristol-Myers Squibb Company | Thyroid receptor ligands |
| US20050182125A1 (en) * | 2003-05-16 | 2005-08-18 | Ambit Biosciences Corporation | Pyrrole compounds and uses thereof |
| US20040248972A1 (en) * | 2003-05-16 | 2004-12-09 | Ambit Biosciences Corporation | Compounds and uses thereof |
| JP2007516227A (ja) * | 2003-05-16 | 2007-06-21 | アンビット バイオサイエンシス コーポレーション | ピロール化合物およびその使用 |
| US7459474B2 (en) * | 2003-06-11 | 2008-12-02 | Bristol-Myers Squibb Company | Modulators of the glucocorticoid receptor and method |
| AU2004311577A1 (en) * | 2003-07-11 | 2005-07-21 | Myriad Genetics, Inc. | Pharmaceutical methods, dosing regimes and dosage forms for the treatment of Alzheimer's disease |
| US6995183B2 (en) * | 2003-08-01 | 2006-02-07 | Bristol Myers Squibb Company | Adamantylglycine-based inhibitors of dipeptidyl peptidase IV and methods |
| US20050171207A1 (en) * | 2003-09-26 | 2005-08-04 | Myriad Genetics, Incorporated | Method and composition for combination treatment of neurodegenerative disorders |
| RU2422450C2 (ru) | 2003-11-19 | 2011-06-27 | Метабазис Терапеутикс, Инк. | Новые фосфорсодержащие тиромиметики |
| EP1559419A1 (en) * | 2004-01-23 | 2005-08-03 | Fournier Laboratories Ireland Limited | Pharmaceutical formulations comprising metformin and a fibrate, and processes for their obtention |
| US20100216863A1 (en) * | 2004-01-30 | 2010-08-26 | Decode Genetics Ehf. | Susceptibility Gene for Myocardial Infarction, Stroke, and PAOD; Methods of Treatment |
| US8158362B2 (en) * | 2005-03-30 | 2012-04-17 | Decode Genetics Ehf. | Methods of diagnosing susceptibility to myocardial infarction and screening for an LTA4H haplotype |
| DK1725234T4 (en) | 2004-03-05 | 2016-05-09 | Univ Pennsylvania | METHODS OF TREATING DISEASES OR DISEASES CONNECTED WITH HYPERLIPIDEMIA AND HYPERCOLESTEROLYMIA WITH MINIMIZATION OF SIDE EFFECTS |
| US20070293538A1 (en) * | 2004-04-13 | 2007-12-20 | Myriad Genetics, Incorporated | Pharmaceutical Composition And Methods For Treating Neurodegenerative Disorders |
| MXPA06012165A (es) * | 2004-04-29 | 2007-01-17 | Keystone Retaining Wall System | Chapas para muros, muros de contencion y similares. |
| US7145040B2 (en) * | 2004-07-02 | 2006-12-05 | Bristol-Myers Squibb Co. | Process for the preparation of amino acids useful in the preparation of peptide receptor modulators |
| US7534763B2 (en) | 2004-07-02 | 2009-05-19 | Bristol-Myers Squibb Company | Sustained release GLP-1 receptor modulators |
| TW200611704A (en) * | 2004-07-02 | 2006-04-16 | Bristol Myers Squibb Co | Human glucagon-like-peptide-1 modulators and their use in the treatment of diabetes and related conditions |
| CA2618985A1 (en) * | 2004-08-11 | 2006-02-23 | Myriad Genetics, Inc. | Pharmaceutical composition and method for treating neurodegenerative disorders |
| WO2006020850A2 (en) * | 2004-08-11 | 2006-02-23 | Myriad Genetics, Inc. | Pharmaceutical composition and method for treating neurodegenerative disorders |
| WO2006020852A2 (en) * | 2004-08-11 | 2006-02-23 | Myriad Genetics, Inc. | Pharmaceutical composition and method for treating neurodegenerative disorders |
| AR051446A1 (es) * | 2004-09-23 | 2007-01-17 | Bristol Myers Squibb Co | Glucosidos de c-arilo como inhibidores selectivos de transportadores de glucosa (sglt2) |
| US7517991B2 (en) * | 2004-10-12 | 2009-04-14 | Bristol-Myers Squibb Company | N-sulfonylpiperidine cannabinoid receptor 1 antagonists |
| US7589088B2 (en) * | 2004-12-29 | 2009-09-15 | Bristol-Myers Squibb Company | Pyrimidine-based inhibitors of dipeptidyl peptidase IV and methods |
| US7635699B2 (en) * | 2004-12-29 | 2009-12-22 | Bristol-Myers Squibb Company | Azolopyrimidine-based inhibitors of dipeptidyl peptidase IV and methods |
| US7220859B2 (en) | 2005-01-12 | 2007-05-22 | Bristol-Myers Squibb Company | Bicyclic heterocycles as cannabinoid receptor modulators |
| US7314882B2 (en) * | 2005-01-12 | 2008-01-01 | Bristol-Myers Squibb Company | Bicyclic heterocycles as cannabinoid receptor modulators |
| WO2006076597A1 (en) * | 2005-01-12 | 2006-07-20 | Bristol-Myers Squibb Company | Bicyclic heterocycles as cannabinoid receptor modulators |
| US20060160850A1 (en) * | 2005-01-18 | 2006-07-20 | Chongqing Sun | Bicyclic heterocycles as cannabinoid receptor modulators |
| WO2006113261A2 (en) | 2005-04-14 | 2006-10-26 | Bristol-Myers Squibb Company | Inhibitors of 11-beta hydroxysteroid dehydrogenase type i |
| US7521557B2 (en) | 2005-05-20 | 2009-04-21 | Bristol-Myers Squibb Company | Pyrrolopyridine-based inhibitors of dipeptidyl peptidase IV and methods |
| TW200716679A (en) * | 2005-05-26 | 2007-05-01 | Bristol Myers Squibb Co | N-terminally modified GLP-1 receptor modulators |
| US7452892B2 (en) * | 2005-06-17 | 2008-11-18 | Bristol-Myers Squibb Company | Triazolopyrimidine cannabinoid receptor 1 antagonists |
| TW200726765A (en) * | 2005-06-17 | 2007-07-16 | Bristol Myers Squibb Co | Triazolopyridine cannabinoid receptor 1 antagonists |
| US20060287342A1 (en) * | 2005-06-17 | 2006-12-21 | Mikkilineni Amarendra B | Triazolopyrimidine heterocycles as cannabinoid receptor modulators |
| US7317012B2 (en) * | 2005-06-17 | 2008-01-08 | Bristol-Myers Squibb Company | Bicyclic heterocycles as cannabinoind-1 receptor modulators |
| US7632837B2 (en) * | 2005-06-17 | 2009-12-15 | Bristol-Myers Squibb Company | Bicyclic heterocycles as cannabinoid-1 receptor modulators |
| US7629342B2 (en) * | 2005-06-17 | 2009-12-08 | Bristol-Myers Squibb Company | Azabicyclic heterocycles as cannabinoid receptor modulators |
| US20070015832A1 (en) * | 2005-07-14 | 2007-01-18 | Myriad Genetics, Incorporated | Methods of treating overactive bladder and urinary incontinence |
| KR20080039876A (ko) * | 2005-07-22 | 2008-05-07 | 미리어드 제네틱스, 인크. | 높은 약물 충진 제형 및 투여형 |
| WO2007035395A2 (en) * | 2005-09-16 | 2007-03-29 | Virginia Commonwealth University Intellectual Property Foundation | Therapeutic compositions comprising chorionic gonadotropins and hmg coa reductase inhibitors |
| CA2626422A1 (en) * | 2005-10-18 | 2007-04-26 | Aegerion Pharmaceuticals | Methods for treating disorders associated with hyperlipidemia in a mammal |
| AR056155A1 (es) * | 2005-10-26 | 2007-09-19 | Bristol Myers Squibb Co | Antagonistas del receptor 1 de la hormona de concentracion de melanina no basica |
| EP2487154B1 (en) | 2005-10-31 | 2013-10-16 | Bristol-Myers Squibb Company | Pyrrolidinyl beta-amino amide-based inhibitors of dipeptidyl peptidase IV and methods |
| US7592461B2 (en) | 2005-12-21 | 2009-09-22 | Bristol-Myers Squibb Company | Indane modulators of glucocorticoid receptor, AP-1, and/or NF-κB activity and use thereof |
| EP1976873A2 (en) * | 2006-01-11 | 2008-10-08 | Brystol-Myers Squibb Company | Human glucagon-like-peptide-1 modulators and their use in the treatment of diabetes and related conditions |
| US7553836B2 (en) * | 2006-02-06 | 2009-06-30 | Bristol-Myers Squibb Company | Melanin concentrating hormone receptor-1 antagonists |
| US20090069275A1 (en) * | 2006-02-17 | 2009-03-12 | Rocca Jose G | Low flush niacin formulation |
| US8367112B2 (en) * | 2006-02-28 | 2013-02-05 | Alkermes Pharma Ireland Limited | Nanoparticulate carverdilol formulations |
| US20070238770A1 (en) * | 2006-04-05 | 2007-10-11 | Bristol-Myers Squibb Company | Process for preparing novel crystalline forms of peliglitazar, novel stable forms produced therein and formulations |
| EP2019679B1 (en) | 2006-05-23 | 2018-06-20 | Theracos, Inc. | Glucose transport inhibitors and methods of use |
| EP2021014A1 (en) * | 2006-05-26 | 2009-02-11 | Brystol-Myers Squibb Company | Sustained release glp-1 receptor modulators |
| US7919598B2 (en) | 2006-06-28 | 2011-04-05 | Bristol-Myers Squibb Company | Crystal structures of SGLT2 inhibitors and processes for preparing same |
| US20080044326A1 (en) * | 2006-07-04 | 2008-02-21 | Esencia Co., Ltd. | Sterilizer for baby products |
| US7795291B2 (en) | 2006-07-07 | 2010-09-14 | Bristol-Myers Squibb Company | Substituted acid derivatives useful as anti-atherosclerotic, anti-dyslipidemic, anti-diabetic and anti-obesity agents and method |
| US20080033045A1 (en) * | 2006-07-07 | 2008-02-07 | Myriad Genetics, Incorporated | Treatment of psychiatric disorders |
| WO2008057862A2 (en) | 2006-11-01 | 2008-05-15 | Bristol-Myers Squibb Company | MODULATORS OF GLUCOCORTICOID RECEPTOR, AP-1, AND/OR NF-ϰB ACTIVITY AND USE THEREOF |
| AU2007338625A1 (en) * | 2006-12-21 | 2008-07-03 | Aegerion Pharmaceuticals, Inc. | Methods for treating obesity with a combination comprising a MTP inhibitor and a cholesterol absorption inhibitor |
| MX2009009126A (es) * | 2007-03-01 | 2009-10-28 | Concourse Health Sciences Llc | Isomeros de niacinato de inositol y usos de los mismos. |
| AR065809A1 (es) | 2007-03-22 | 2009-07-01 | Bristol Myers Squibb Co | Formulaciones farmaceuticas que contienen un inhibidor sglt2 |
| PE20090696A1 (es) | 2007-04-20 | 2009-06-20 | Bristol Myers Squibb Co | Formas cristalinas de saxagliptina y procesos para preparar las mismas |
| EP2147008A2 (en) * | 2007-05-18 | 2010-01-27 | Bristol-Myers Squibb Company | Crystal structures of sglt2 inhibitors and processes for preparing same |
| EP2166843A4 (en) | 2007-06-01 | 2010-08-11 | Univ Princeton | TREATMENT OF VIRUS INFECTIONS BY MODULATION OF HOST CELL METABOLISMS |
| US20090011994A1 (en) * | 2007-07-06 | 2009-01-08 | Bristol-Myers Squibb Company | Non-basic melanin concentrating hormone receptor-1 antagonists and methods |
| JP2010534722A (ja) * | 2007-07-27 | 2010-11-11 | ブリストル−マイヤーズ スクイブ カンパニー | 新規グルコキナーゼ活性化薬およびその使用方法 |
| PT2187742T (pt) | 2007-08-23 | 2018-01-04 | Theracos Sub Llc | Derivados de (2s,3r,4r,5s,6r)-2-(4-cloro-3-benzilfenil)-6-(hidroximetil)tetrahidro-2h-piran-3,4,5-triol para utilização no tratamento da diabetes |
| MX2010003117A (es) * | 2007-09-20 | 2010-04-01 | Irm Llc | Compuestos y composiciones como moduladores de la actividad de gpr119. |
| PE20091928A1 (es) * | 2008-05-29 | 2009-12-31 | Bristol Myers Squibb Co | Tienopirimidinas hidroxisustituidas como antagonistas de receptor-1 de hormona concentradora de melanina no basicos |
| TWI523652B (zh) | 2008-07-15 | 2016-03-01 | 泰瑞克公司 | 氘化苄基苯衍生物及使用方法 |
| US20120046364A1 (en) | 2009-02-10 | 2012-02-23 | Metabasis Therapeutics, Inc. | Novel Sulfonic Acid-Containing Thyromimetics, and Methods for Their Use |
| EA201101231A1 (ru) | 2009-03-27 | 2012-06-29 | Бристол-Майерс Сквибб Компани | Способы предотвращения или снижения риска смертности |
| WO2011014520A2 (en) | 2009-07-29 | 2011-02-03 | Irm Llc | Compounds and compositions as modulators of gpr119 activity |
| IN2012DN02471A (enExample) | 2009-10-09 | 2015-08-21 | Irm Llc | |
| CN102740839B (zh) | 2009-11-13 | 2015-05-06 | 阿斯利康(瑞典)有限公司 | 立即释放片剂 |
| BR112012011726A2 (pt) | 2009-11-13 | 2020-05-19 | Bristol-Myers Squibb Company | comprimidos de duas camadas, seu uso, e suas combinações farmacêuticas |
| MX2012005425A (es) | 2009-11-13 | 2012-06-14 | Astrazeneca Uk Ltd | Formulaciones de metformina de masa reducida. |
| US8394858B2 (en) | 2009-12-03 | 2013-03-12 | Novartis Ag | Cyclohexane derivatives and uses thereof |
| TWI562775B (en) | 2010-03-02 | 2016-12-21 | Lexicon Pharmaceuticals Inc | Methods of using inhibitors of sodium-glucose cotransporters 1 and 2 |
| WO2011130459A1 (en) | 2010-04-14 | 2011-10-20 | Bristol-Myers Squibb Company | Novel glucokinase activators and methods of using same |
| WO2011153712A1 (en) | 2010-06-12 | 2011-12-15 | Theracos, Inc. | Crystalline form of benzylbenzene sglt2 inhibitor |
| WO2012006398A2 (en) | 2010-07-09 | 2012-01-12 | Bhv Pharma, Inc. | Combination immediate/delayed release delivery system for short half-life pharmaceuticals including remogliflozin |
| US8697739B2 (en) | 2010-07-29 | 2014-04-15 | Novartis Ag | Bicyclic acetyl-CoA carboxylase inhibitors and uses thereof |
| TWI631963B (zh) | 2011-01-05 | 2018-08-11 | 雷西肯製藥股份有限公司 | 包含鈉-葡萄糖共同輸送體1與2之抑制劑的組合物與應用方法 |
| WO2014052619A1 (en) | 2012-09-27 | 2014-04-03 | Irm Llc | Piperidine derivatives and compositions as modulators of gpr119 activity |
| EP3489226B1 (en) | 2012-11-20 | 2021-02-17 | Lexicon Pharmaceuticals, Inc. | Inhibitors of sodium glucose cotransporter 1 |
| US9593113B2 (en) | 2013-08-22 | 2017-03-14 | Bristol-Myers Squibb Company | Imide and acylurea derivatives as modulators of the glucocorticoid receptor |
| CN104356118B (zh) * | 2014-10-17 | 2017-03-22 | 上海应用技术学院 | 多取代吡咯类他汀内酯脱水化合物及其用途 |
| CN107667116A (zh) | 2015-04-30 | 2018-02-06 | 哈佛学院院长及董事 | 治疗代谢病症的抗‑ap2 抗体及抗原结合剂 |
| MY210508A (en) | 2018-07-19 | 2025-09-28 | Astrazeneca Ab | Methods of treating hfpef employing dapagliflozin and compositions comprising the same |
| EP3856714A1 (en) | 2018-09-26 | 2021-08-04 | Lexicon Pharmaceuticals, Inc. | Crystalline forms of n-(1 -((2-(dimethylamino)ethyl)amino)-2-m ethyl-1 -oopropan-2-yl)-4-(4-(2-methyl-5- (2s,3r,4r,5s,6r)-3,4,5-trihydroxy-6-(methylthio)tetrahydro-2h-pyran-2-yl)benzyl) phenl)butanamide and methods of their synthesis |
| EP4188372A1 (en) | 2020-07-29 | 2023-06-07 | Amryt Pharmaceuticals Inc. | Lomitapide for use in methods of treating hyperlipidemia and hypercholesterolemia in pediatric patients |
| WO2025147589A1 (en) | 2024-01-05 | 2025-07-10 | Osanni Bio, Inc. | Implants, compositions, and methods for treating retinal diseases and disorders |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5612114B2 (enExample) * | 1974-06-07 | 1981-03-18 | ||
| JPS53147073A (en) * | 1977-05-24 | 1978-12-21 | Sankyo Co Ltd | Mevalonolactone derivatives |
| US4219560A (en) * | 1978-04-17 | 1980-08-26 | Sandoz, Inc. | Piperidine and pyrrolidine alcohols |
| JPS5559140A (en) * | 1978-10-30 | 1980-05-02 | Sankyo Co Ltd | 3,5-dihydroxypentanoic alkyl ester derivative, its preparation and remedy for hyperlipemia containing the same as the effective component |
| JPS5559180A (en) * | 1978-10-30 | 1980-05-02 | Sankyo Co Ltd | 4-hydroxy-2-pyrone ring compound, its preparation, and remedy for hyperlipemia comprising it as active constituent |
| DE2909779A1 (de) * | 1979-03-13 | 1980-09-18 | Thomae Gmbh Dr K | Neue indolderivate, deren herstellung und deren verwendung als arzneimittel |
| IL60751A (en) * | 1979-08-17 | 1985-04-30 | Merck & Co Inc | 6-(2'-((substituted phenyl)ethyl and-ethenyl)-4-hydroxy-tetrahydro-2h-pyran-2-one derivatives,their preparation and pharmaceutical compositions containing them |
| US4351844A (en) * | 1980-02-04 | 1982-09-28 | Merck & Co., Inc. | Hypocholesterolemic hydrogenation products and process of preparation |
| US4308378A (en) * | 1980-09-02 | 1981-12-29 | Merck & Co., Inc. | Cis/trans isomerization of 6-(substituted-aryl-ethenyl)-3,4,5,6-tetrahydro-4-hydroxy-2H-pyran-2-ones |
| US4375425A (en) * | 1980-12-08 | 1983-03-01 | Texaco Inc. | Catalyst for the production of a hydrogen-rich gas |
| US4440927A (en) * | 1981-06-19 | 1984-04-03 | Merck & Co., Inc. | Process for preparing inhibitors of 3-hydroxy-3-methylglutaryl coenzyme A reductase via a chiral synthon |
| EP0068038B1 (en) * | 1981-06-29 | 1985-09-25 | Merck & Co. Inc. | (+)-(4r,6s)-(e)-6-(2-(4'-fluoro-3,3',5-trimethyl-(1,1'-biphenyl)-2-yl)ethenyl)-3,4,5,6-tetrahydro-4-hydroxy-2h-pyran-2-one, a process for preparing and a pharmaceutical composition containing the same |
| US4376863A (en) * | 1981-08-21 | 1983-03-15 | Merck & Co., Inc. | Hypocholesterolemic fermentation products |
| AU9133682A (en) * | 1981-12-23 | 1983-06-30 | Akira Endo | Dihydro- and tetrahydromonacolin l- and their salts and esters |
| HUT48208A (en) * | 1985-10-25 | 1989-05-29 | Sandoz Ag | Process for producing heterocyclic analogues of mevalolactone derivatives and pharmaceutical compositions comprising such compounds |
-
1984
- 1984-12-10 US US06/679,676 patent/US4647576A/en not_active Expired - Fee Related
-
1985
- 1985-02-04 KR KR858501374D patent/KR890001449B1/ko not_active Expired
- 1985-08-23 CA CA000489315A patent/CA1242721A/en not_active Expired
- 1985-08-27 NZ NZ213252A patent/NZ213252A/en unknown
- 1985-08-29 AU AU46867/85A patent/AU573027B2/en not_active Ceased
- 1985-09-09 EP EP85306382A patent/EP0179559A3/en not_active Withdrawn
- 1985-09-17 ES ES547055A patent/ES8701756A1/es not_active Expired
- 1985-09-20 GR GR852297A patent/GR852297B/el unknown
- 1985-09-20 FI FI853632A patent/FI853632A7/fi not_active Application Discontinuation
- 1985-09-23 NO NO853725A patent/NO853725L/no unknown
- 1985-09-23 KR KR1019850006950A patent/KR890001050B1/ko not_active Expired
- 1985-09-23 DK DK430485A patent/DK430485A/da not_active Application Discontinuation
- 1985-09-24 PT PT81179A patent/PT81179B/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI853632L (fi) | 1986-03-25 |
| ES547055A0 (es) | 1986-12-01 |
| EP0179559A3 (en) | 1987-07-01 |
| DK430485D0 (da) | 1985-09-23 |
| ES8701756A1 (es) | 1986-12-01 |
| PT81179A (en) | 1985-10-01 |
| FI853632A0 (fi) | 1985-09-20 |
| US4647576A (en) | 1987-03-03 |
| DK430485A (da) | 1986-03-25 |
| KR890001449B1 (en) | 1989-05-03 |
| EP0179559A2 (en) | 1986-04-30 |
| KR890001050B1 (ko) | 1989-04-22 |
| KR860002503A (ko) | 1986-04-26 |
| NZ213252A (en) | 1988-03-30 |
| AU4686785A (en) | 1986-04-10 |
| PT81179B (en) | 1987-02-13 |
| AU573027B2 (en) | 1988-05-26 |
| NO853725L (no) | 1986-03-25 |
| FI853632A7 (fi) | 1986-03-25 |
| GR852297B (enExample) | 1986-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1242721A (en) | Trans-6-¬2-substituted pyrrol-1-yl)alkyl|-pyran -2- one inhibitors of cholesterol synthesis | |
| US5003080A (en) | Process for trans-6-(2-(substituted-pyrrol-1-yl)alkyl)pryan-2-one inhibitors of cholesterol synthesis | |
| US5280126A (en) | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis | |
| US5216174A (en) | Process for trans-6-[12-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis | |
| US5149837A (en) | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis | |
| US5097045A (en) | Process for trans-6-[2-(substituted-pyrrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis | |
| EP0247633B1 (en) | Trans-6-[2-(3- or 4-Carboxamido-substituted pyrrol-1-yl)-alkyl]-4-hydroxypyran-2-one inhibitors of cholesterol synthesis | |
| JP3316661B2 (ja) | 〔(ヒドロキシフェニルアミノ)カルボニル〕ピロール | |
| FI93007B (fi) | Menetelmä terapeuttisesti käyttökelpoisten substituoitujen pyridiinien valmistamiseksi sekä menetelmässä käyttökelpoiset välituotteet | |
| US4929620A (en) | 5-pyrimidinyl-3,5-dihydroxy-6-heptenoic acid compounds useful as inhibitors of cholesterol biosynthesis | |
| CA1286671C (en) | Trans-6- 2-heteroaryl-3,5-disubstituted)pyrazol-4-yl)- ethyl) - or ethenyl) tetrahydro-4-hydroxypyran- 2-one inhibitors of cholesterol biosynthesis | |
| HK1000732B (en) | Improved process for trans-6-[2-(substituted-pyrol-1-yl)alkyl]pyran-2-one inhibitors of cholesterol synthesis | |
| CA2338305A1 (en) | Imidazole compounds | |
| US5102893A (en) | Trans-6-(2-(n-heteroaryl-3,5-disubstituted)pyrazol-4-yl)-ethyl- or ethenyl)tetrahydro-4-hydroxypyran-2-one inhibitors of cholesterol biosynthesis | |
| US4957971A (en) | Trans-6-(2-(N-heteroaryl-3,5-disubstituted)pyrazol-4-yl)-ethyl)-or ethenyl)tetrahydro-4-hydroxypyran-2-one inhibitors of cholesterol biosynthesis | |
| US4868185A (en) | 6-[[Substituted)pyrimidinyl)ethyl]- and ethenyl]tetrahydro-4-hydroxypyran-2-one inhibitors of cholesterol biosynthesis | |
| EP2319843A1 (en) | Substituted pyrrole derivatives and their use as HMG-CO inhibitors | |
| KR970011462B1 (ko) | 콜레스테롤 합성 억제제인 트란스-6-[2-(치환 피롤-1-일)알킬]피란-2-온의 개량된 제조 방법 | |
| JPS6178787A (ja) | コレステロール合成のトランス‐6‐〔2‐(置換ピロール‐1‐イル)アルキル〕‐ピラン‐2‐オン阻止剤 | |
| AU3349689A (en) | Improved process for trans-6-(2-(substituted-pyrrol-1-yl) alkyl)pyran-2-one inhibitors of cholesterol synthesis | |
| HK1154854A (en) | Substituted pyrrole derivatives and their use as hmg-co inhibitors | |
| AU4799699A (en) | Imidazole compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |