CA1233481A - Preparation of alkali metal and alkaline earth metal salts of acyloxybenzenesulfonic acids - Google Patents
Preparation of alkali metal and alkaline earth metal salts of acyloxybenzenesulfonic acidsInfo
- Publication number
- CA1233481A CA1233481A CA000465665A CA465665A CA1233481A CA 1233481 A CA1233481 A CA 1233481A CA 000465665 A CA000465665 A CA 000465665A CA 465665 A CA465665 A CA 465665A CA 1233481 A CA1233481 A CA 1233481A
- Authority
- CA
- Canada
- Prior art keywords
- acid
- alkaline earth
- alkali metal
- earth metal
- neutralization
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002253 acid Substances 0.000 title claims abstract description 30
- 150000003839 salts Chemical class 0.000 title claims abstract description 16
- 150000001340 alkali metals Chemical class 0.000 title claims abstract description 11
- 229910052783 alkali metal Inorganic materials 0.000 title claims abstract description 8
- 229910052784 alkaline earth metal Chemical class 0.000 title claims abstract description 8
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000007513 acids Chemical class 0.000 title abstract description 13
- 150000001342 alkaline earth metals Chemical class 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 20
- -1 alkaline earth metal salts Chemical class 0.000 claims abstract description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 16
- 239000007864 aqueous solution Substances 0.000 claims abstract description 12
- 238000006386 neutralization reaction Methods 0.000 claims abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims abstract description 4
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims abstract description 4
- 238000002156 mixing Methods 0.000 claims abstract description 4
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 4
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 3
- 150000002367 halogens Chemical class 0.000 claims abstract description 3
- 239000007788 liquid Substances 0.000 claims abstract description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 3
- 235000013350 formula milk Nutrition 0.000 claims description 7
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 239000011976 maleic acid Substances 0.000 claims description 3
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 3
- 229940095064 tartrate Drugs 0.000 claims description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 3
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- 239000008139 complexing agent Substances 0.000 claims description 2
- 229910001385 heavy metal Inorganic materials 0.000 claims description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 159000000000 sodium salts Chemical class 0.000 description 8
- 238000001694 spray drying Methods 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 5
- 235000019799 monosodium phosphate Nutrition 0.000 description 5
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 5
- 229940083608 sodium hydroxide Drugs 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- TWDUKWCXYKWSKZ-UHFFFAOYSA-N 2-(7-methyloctanoyloxy)benzenesulfonic acid Chemical compound CC(C)CCCCCC(=O)OC1=CC=CC=C1S(O)(=O)=O TWDUKWCXYKWSKZ-UHFFFAOYSA-N 0.000 description 2
- URDCARMUOSMFFI-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid Chemical compound OCCN(CC(O)=O)CCN(CC(O)=O)CC(O)=O URDCARMUOSMFFI-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000306 component Substances 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 235000019524 disodium tartrate Nutrition 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229940098895 maleic acid Drugs 0.000 description 2
- 229940044652 phenolsulfonate Drugs 0.000 description 2
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 2
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 2
- 239000001433 sodium tartrate Substances 0.000 description 2
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PCWITQSPDHVTKN-UHFFFAOYSA-N 4-acetyloxybenzenesulfonic acid Chemical class CC(=O)OC1=CC=C(S(O)(=O)=O)C=C1 PCWITQSPDHVTKN-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 1
- MOOSBPSAZDOBSN-UHFFFAOYSA-N acetic acid;azane Chemical compound N.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O MOOSBPSAZDOBSN-UHFFFAOYSA-N 0.000 description 1
- 229940022682 acetone Drugs 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000002036 drum drying Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 229940087596 sodium phenolsulfonate Drugs 0.000 description 1
- NKAAEMMYHLFEFN-ZVGUSBNCSA-M sodium;(2r,3r)-2,3,4-trihydroxy-4-oxobutanoate Chemical compound [Na+].OC(=O)[C@H](O)[C@@H](O)C([O-])=O NKAAEMMYHLFEFN-ZVGUSBNCSA-M 0.000 description 1
- BLXAGSNYHSQSRC-UHFFFAOYSA-M sodium;2-hydroxybenzenesulfonate Chemical compound [Na+].OC1=CC=CC=C1S([O-])(=O)=O BLXAGSNYHSQSRC-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3337921.1 | 1983-10-19 | ||
| DE19833337921 DE3337921A1 (de) | 1983-10-19 | 1983-10-19 | Verfahren zur herstellung von alkali- und erdalkalisalzen von acyloxibenzolfulfonsaeuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1233481A true CA1233481A (en) | 1988-03-01 |
Family
ID=6212171
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000465665A Expired CA1233481A (en) | 1983-10-19 | 1984-10-17 | Preparation of alkali metal and alkaline earth metal salts of acyloxybenzenesulfonic acids |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4588531A (https=) |
| EP (1) | EP0140251B2 (https=) |
| JP (1) | JPS60104056A (https=) |
| AT (1) | ATE20344T1 (https=) |
| CA (1) | CA1233481A (https=) |
| DE (2) | DE3337921A1 (https=) |
| ES (1) | ES536867A0 (https=) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4692279A (en) * | 1985-04-15 | 1987-09-08 | Stepan Company | Preparation of acyloxy benzene sulfonate |
| DE3524052A1 (de) * | 1985-07-05 | 1987-01-08 | Hoechst Ag | Verfahren zur herstellung von acyloxybenzolsulfonsaeuren und deren salzen |
| GB8523962D0 (en) * | 1985-09-28 | 1985-10-30 | Interox Chemicals Ltd | Preparation of sulphophenyl esters |
| DE3538143A1 (de) * | 1985-10-26 | 1987-04-30 | Hoechst Ag | Verfahren zur herstellung von acyloxibenzolsulfonsaeuren und deren salzen |
| GB8531392D0 (en) * | 1985-12-20 | 1986-02-05 | Unilever Plc | Sulphonated aromated esters |
| US4735740A (en) * | 1986-10-03 | 1988-04-05 | The Clorox Company | Diperoxyacid precursors and method |
| US5050330A (en) * | 1990-05-17 | 1991-09-24 | Pilgrim Archery Products, Inc. | Gun rest |
| US5153341A (en) * | 1991-03-25 | 1992-10-06 | E. I. Du Pont De Nemours And Company | Process for preparing benzenesulfonate salts |
| SK278834B6 (sk) * | 1992-01-17 | 1998-03-04 | Unilever Nv | Časticová bieliaca detergentná zmes |
| CZ280593B6 (cs) * | 1992-01-17 | 1996-02-14 | Unilever Nv | Částicové detergenční směsi |
| US5850086A (en) * | 1996-06-21 | 1998-12-15 | Regents Of The University Of Minnesota | Iron complexes for bleach activation and stereospecific oxidation |
| DE19956862A1 (de) * | 1999-11-25 | 2001-06-21 | Axiva Gmbh | Verfahren zur Gewinnung und Reinigung substituierter Benzolsulfonate |
| GB0011527D0 (en) | 2000-05-12 | 2000-06-28 | Unilever Plc | Bleach catalyst and composition and method for bleaching a substrate |
| GB0106285D0 (en) | 2001-03-14 | 2001-05-02 | Unilever Plc | Air bleaching catalysts with moderating agent |
| WO2002072746A1 (en) | 2001-03-14 | 2002-09-19 | Unilever Plc | Bleaching catalysts with unsaturated surfactant and antioxidants |
| GB0205276D0 (en) * | 2002-03-06 | 2002-04-17 | Unilever Plc | Bleaching composition |
| US6790981B2 (en) | 2002-12-13 | 2004-09-14 | Clariant Finance (Bvi) Limited | Process for the preparation of acyloxybenzenesulfonates |
| DE102007026216A1 (de) * | 2007-06-05 | 2008-12-11 | Clariant International Ltd. | Feste Partikel von hydrophoben Bleichaktivatoren |
| DE102008013606A1 (de) * | 2008-03-11 | 2009-09-17 | Clariant International Ltd. | Verfahren zur Herstellung fester Erdalkalimetallsalze sekundärer Paraffinsulfonsäuren |
| US8492324B2 (en) | 2008-04-09 | 2013-07-23 | Basf Se | Use of metal hydrazide complex compounds as oxidation catalysts |
| WO2012000846A1 (en) | 2010-06-28 | 2012-01-05 | Basf Se | Metal free bleaching composition |
| CN103328455B (zh) | 2010-12-13 | 2016-02-24 | 巴斯夫欧洲公司 | 漂白催化剂 |
| WO2017076771A1 (en) | 2015-11-03 | 2017-05-11 | Basf Se | Bleach catalysts |
| EP3176157A1 (en) | 2015-12-01 | 2017-06-07 | Basf Se | Bleach catalysts |
| WO2017182295A1 (en) | 2016-04-18 | 2017-10-26 | Basf Se | Liquid cleaning compositions |
| WO2017186480A1 (en) | 2016-04-26 | 2017-11-02 | Basf Se | Metal free bleaching composition |
| EP3372663A1 (en) | 2017-03-10 | 2018-09-12 | Basf Se | Bleach catalysts |
| WO2024175401A1 (en) | 2023-02-21 | 2024-08-29 | Basf Se | Modified alkoxylated polyalkylene imines or modified alkoxylated polyamines |
| WO2024175409A1 (en) | 2023-02-21 | 2024-08-29 | Basf Se | Modified hyperbranched alkoxylated polyalkylene imines |
| CN120731240A (zh) | 2023-02-21 | 2025-09-30 | 巴斯夫欧洲公司 | 改性的烷氧基化聚亚烷基亚胺或改性的烷氧基化多胺 |
| WO2024188713A1 (en) | 2023-03-13 | 2024-09-19 | Basf Se | Alkoxylated nitrogen containing polymers and their use |
| MX2025013215A (es) | 2023-05-05 | 2025-12-01 | Basf Se | Propoxilatos de poliol biodegradables, su preparacion, usos y composiciones que los comprenden |
| CN121335969A (zh) | 2023-06-13 | 2026-01-13 | 巴斯夫欧洲公司 | 包含edds和酶的稳定的清洁组合物及其用途 |
| WO2025125117A1 (en) | 2023-12-15 | 2025-06-19 | Basf Se | Biodegradable propoxylated ethylenediamines, their preparation, uses, and compositions comprising them |
| WO2025131888A1 (en) | 2023-12-19 | 2025-06-26 | Basf Se | Modified alkoxylated polyalkylene imines or modified alkoxylated polyamines |
| WO2025180874A1 (en) | 2024-02-27 | 2025-09-04 | Basf Se | Substituted 1,3-dioxolane sulfates and their use |
| WO2025195856A1 (en) | 2024-03-19 | 2025-09-25 | Basf Se | Compositions of guerbet alkyl sulfates and their use |
| WO2025202032A1 (en) | 2024-03-26 | 2025-10-02 | Basf Se | Biodegradable alkoxylated polyols, their preparation, uses, and compositions comprising them |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE859451C (de) * | 1943-09-21 | 1952-12-15 | Boehme Fettchemie G M B H | Verfahren zur Neutralisation von Sulfonierungsprodukten |
| US2716126A (en) * | 1950-05-27 | 1955-08-23 | Petrolite Corp | Certain ester acids and certain ester salts of sulfoaromatic fatty acids, and method of making same |
| GB864798A (en) * | 1958-03-20 | 1961-04-06 | Unilever Ltd | Bleaching processes and compositions |
| US3394155A (en) * | 1964-05-22 | 1968-07-23 | Lever Brothers Ltd | Preparation of surface-active agents |
| US3503888A (en) * | 1965-02-16 | 1970-03-31 | Dow Chemical Co | Synthetic detergent bar |
| US3636016A (en) * | 1969-05-28 | 1972-01-18 | Continental Oil Co | Surface active agents |
| US3775445A (en) * | 1972-01-14 | 1973-11-27 | Continental Oil Co | Surface active agents |
| GB1519351A (en) * | 1975-01-29 | 1978-07-26 | Unilever Ltd | Preparation of acetoxy arylene sulphonates |
| DE3066202D1 (en) * | 1979-11-03 | 1984-02-23 | Procter & Gamble | Granular laundry compositions |
-
1983
- 1983-10-19 DE DE19833337921 patent/DE3337921A1/de not_active Withdrawn
-
1984
- 1984-10-12 DE DE8484112279T patent/DE3460224D1/de not_active Expired
- 1984-10-12 AT AT84112279T patent/ATE20344T1/de not_active IP Right Cessation
- 1984-10-12 EP EP84112279A patent/EP0140251B2/de not_active Expired
- 1984-10-17 CA CA000465665A patent/CA1233481A/en not_active Expired
- 1984-10-18 US US06/662,048 patent/US4588531A/en not_active Expired - Fee Related
- 1984-10-18 ES ES536867A patent/ES536867A0/es active Granted
- 1984-10-19 JP JP59218794A patent/JPS60104056A/ja active Granted
-
1986
- 1986-04-02 US US06/847,196 patent/US4693848A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0140251B1 (de) | 1986-06-11 |
| JPH0437827B2 (https=) | 1992-06-22 |
| EP0140251A2 (de) | 1985-05-08 |
| ATE20344T1 (de) | 1986-06-15 |
| ES8506268A1 (es) | 1985-07-01 |
| JPS60104056A (ja) | 1985-06-08 |
| US4588531A (en) | 1986-05-13 |
| DE3337921A1 (de) | 1985-05-02 |
| EP0140251B2 (de) | 1989-09-06 |
| EP0140251A3 (https=) | 1985-07-03 |
| ES536867A0 (es) | 1985-07-01 |
| DE3460224D1 (en) | 1986-07-17 |
| US4693848A (en) | 1987-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1233481A (en) | Preparation of alkali metal and alkaline earth metal salts of acyloxybenzenesulfonic acids | |
| US5523434A (en) | Synthesis of bleach activators | |
| CA1313673C (en) | Preparation of serine-n,n-diacetic acid and derivatives as complexing agents and detergents containing same | |
| US4827014A (en) | 2-Hydroxy-3-aminopropionic-n,n-diacetic acid and derivatives thereof, preparation thereof, and detergents containing same | |
| US4308147A (en) | Composition and treating aqueous solutions with N-carboxy alkyl amino alkane polyphosphonic acids and their alkali metal salts | |
| CA1273353A (en) | Preparation of acyloxy benzene sulfonate | |
| CA1253171A (en) | Preparation of acyloxybenzenesulfonic acids and their alkali metal and alkaline earth metal salts | |
| US2664437A (en) | O-(2-chloro-4-nitrophenyl) o,o dimethyl thiophosphate | |
| US5112530A (en) | Use of 2-hydroxy-3-aminopropionic acid derivatives as complexing agents, bleach stabilizers and builders in detergent compositions | |
| US4705649A (en) | Preparation of acyloxybenzenesulfonic acids and their alkali metal and alkaline earth metal salts | |
| US3031501A (en) | Preparation of 2, 5-diarylamino-tereph-thalic acid and salts thereof | |
| US5100588A (en) | Process for the preparation of acyloxybenzenesulfonic acids and their salts | |
| KR100920319B1 (ko) | 라디칼 중합성 화합물의 금속염의 제조방법 | |
| US5030381A (en) | Process for the preparation of stabilized aliphatic diperoxydicarboxylic acids | |
| CA1106843A (en) | N-carboxy-alkane-aminoalkane-diphosphonic acids, n- carboxy-alkane-azacycloalkane-diphosphonic acids and n-carboxy-alkane-aminoaryl-alkane-diphosphonic acids and process for theirproduction | |
| SU638253A3 (ru) | Способ получени диамидов дикарбоновых кислот | |
| KR880002623B1 (ko) | 하이드록시-아미노-아릴설폰산의 선택적 아실화 방법 | |
| JPS63166852A (ja) | エステル基を含有するn−置換アクリルアミド | |
| RU2149157C1 (ru) | Способ получения очищенной 2,4-дихлорфеноксиуксусной кислоты | |
| JPS6168462A (ja) | 3‐(アシル)アミノ‐4‐アルコキシフエニル‐β‐ヒドロキシエチルスルホン(‐硫酸エステル)の製法 | |
| RU1825783C (ru) | Способ получени @ -цианкоричной кислоты | |
| SU1293178A1 (ru) | Способ получени 2-хлор-5- @ -(2,4-ди-трет-амилфенокси)-бутироиламино @ -анилида @ -(1-бензилгидантоинил-3)-пивалоилуксусной кислоты | |
| US4877901A (en) | Process for synthesizing N,N'-dithiobis(sulfonamides) | |
| CA2099096A1 (en) | Process for preparing granular esters | |
| SU1120671A1 (ru) | Амино-3-(5-дезокси-5-аденозил)тиопропилфосфониста кислота дл ингибировани процесса биометилировани |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |