CA1196325A - Catalysts for alkoxylation reactions - Google Patents
Catalysts for alkoxylation reactionsInfo
- Publication number
- CA1196325A CA1196325A CA000426264A CA426264A CA1196325A CA 1196325 A CA1196325 A CA 1196325A CA 000426264 A CA000426264 A CA 000426264A CA 426264 A CA426264 A CA 426264A CA 1196325 A CA1196325 A CA 1196325A
- Authority
- CA
- Canada
- Prior art keywords
- acid
- para
- group
- groups
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 60
- 238000006243 chemical reaction Methods 0.000 title claims abstract description 18
- 229910004014 SiF4 Inorganic materials 0.000 claims abstract description 45
- ABTOQLMXBSRXSM-UHFFFAOYSA-N silicon tetrafluoride Chemical compound F[Si](F)(F)F ABTOQLMXBSRXSM-UHFFFAOYSA-N 0.000 claims abstract description 45
- 229910052751 metal Inorganic materials 0.000 claims abstract description 34
- 239000002184 metal Substances 0.000 claims abstract description 34
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 29
- 239000000203 mixture Substances 0.000 claims abstract description 20
- 150000004703 alkoxides Chemical class 0.000 claims abstract description 18
- -1 zironium Chemical compound 0.000 claims description 45
- 125000004432 carbon atom Chemical group C* 0.000 claims description 44
- 238000000034 method Methods 0.000 claims description 35
- 239000000463 material Substances 0.000 claims description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 28
- 150000001408 amides Chemical class 0.000 claims description 28
- 229910052736 halogen Inorganic materials 0.000 claims description 25
- 150000002367 halogens Chemical group 0.000 claims description 25
- 125000003118 aryl group Chemical group 0.000 claims description 24
- 125000004122 cyclic group Chemical group 0.000 claims description 24
- 150000001298 alcohols Chemical class 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 22
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 22
- 125000002723 alicyclic group Chemical group 0.000 claims description 20
- 125000002015 acyclic group Chemical group 0.000 claims description 19
- 150000001412 amines Chemical class 0.000 claims description 18
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 17
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 claims description 15
- 238000009835 boiling Methods 0.000 claims description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 150000002431 hydrogen Chemical class 0.000 claims description 15
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 claims description 12
- 229910052782 aluminium Inorganic materials 0.000 claims description 12
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 claims description 11
- 150000001299 aldehydes Chemical class 0.000 claims description 10
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 9
- 229940093915 gynecological organic acid Drugs 0.000 claims description 9
- 150000002576 ketones Chemical class 0.000 claims description 9
- 150000007524 organic acids Chemical class 0.000 claims description 9
- 235000005985 organic acids Nutrition 0.000 claims description 9
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 claims description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 150000005846 sugar alcohols Polymers 0.000 claims description 8
- 239000010936 titanium Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical compound N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 claims description 7
- 239000003784 tall oil Substances 0.000 claims description 7
- DMNPDGLMNXDSPT-UHFFFAOYSA-N 2-methylheptadecan-1-ol Chemical compound CCCCCCCCCCCCCCCC(C)CO DMNPDGLMNXDSPT-UHFFFAOYSA-N 0.000 claims description 6
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 claims description 6
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 claims description 6
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 claims description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 6
- QOEHNLSDMADWEF-UHFFFAOYSA-N I-Dotriacontanol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO QOEHNLSDMADWEF-UHFFFAOYSA-N 0.000 claims description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 6
- SLINHMUFWFWBMU-UHFFFAOYSA-N Triisopropanolamine Chemical compound CC(O)CN(CC(C)O)CC(C)O SLINHMUFWFWBMU-UHFFFAOYSA-N 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 6
- 235000010323 ascorbic acid Nutrition 0.000 claims description 6
- 229960005070 ascorbic acid Drugs 0.000 claims description 6
- 239000011668 ascorbic acid Substances 0.000 claims description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 6
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 claims description 6
- IRHTZOCLLONTOC-UHFFFAOYSA-N hexacosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCO IRHTZOCLLONTOC-UHFFFAOYSA-N 0.000 claims description 6
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 claims description 6
- FVDRFBGMOWJEOR-UHFFFAOYSA-N hexadecan-2-ol Chemical compound CCCCCCCCCCCCCCC(C)O FVDRFBGMOWJEOR-UHFFFAOYSA-N 0.000 claims description 6
- SKGCQRZZTHOERR-UHFFFAOYSA-N hexatriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO SKGCQRZZTHOERR-UHFFFAOYSA-N 0.000 claims description 6
- CNNRPFQICPFDPO-UHFFFAOYSA-N octacosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCO CNNRPFQICPFDPO-UHFFFAOYSA-N 0.000 claims description 6
- OXGBCSQEKCRCHN-UHFFFAOYSA-N octadecan-2-ol Chemical compound CCCCCCCCCCCCCCCCC(C)O OXGBCSQEKCRCHN-UHFFFAOYSA-N 0.000 claims description 6
- NUJGJRNETVAIRJ-UHFFFAOYSA-N octanal Chemical compound CCCCCCCC=O NUJGJRNETVAIRJ-UHFFFAOYSA-N 0.000 claims description 6
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 claims description 6
- TYWMIZZBOVGFOV-UHFFFAOYSA-N tetracosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCO TYWMIZZBOVGFOV-UHFFFAOYSA-N 0.000 claims description 6
- FFAQYGTZIMVBFJ-UHFFFAOYSA-N tetradecan-7-ol Chemical compound CCCCCCCC(O)CCCCCC FFAQYGTZIMVBFJ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052719 titanium Inorganic materials 0.000 claims description 6
- REZQBEBOWJAQKS-UHFFFAOYSA-N triacontan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO REZQBEBOWJAQKS-UHFFFAOYSA-N 0.000 claims description 6
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 claims description 6
- XFRVVPUIAFSTFO-UHFFFAOYSA-N 1-Tridecanol Chemical compound CCCCCCCCCCCCCO XFRVVPUIAFSTFO-UHFFFAOYSA-N 0.000 claims description 5
- XULHFMYCBKQGEE-UHFFFAOYSA-N 2-hexyl-1-Decanol Chemical compound CCCCCCCCC(CO)CCCCCC XULHFMYCBKQGEE-UHFFFAOYSA-N 0.000 claims description 5
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 claims description 5
- 229960004909 aminosalicylic acid Drugs 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- LVTYICIALWPMFW-UHFFFAOYSA-N diisopropanolamine Chemical compound CC(O)CNCC(C)O LVTYICIALWPMFW-UHFFFAOYSA-N 0.000 claims description 5
- 229940043276 diisopropanolamine Drugs 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 claims description 5
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 4
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 4
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 4
- 229930195729 fatty acid Natural products 0.000 claims description 4
- 239000000194 fatty acid Substances 0.000 claims description 4
- 229910052735 hafnium Inorganic materials 0.000 claims description 4
- CFOUQYMFDDXZEG-UHFFFAOYSA-N octadecan-6-ol Chemical compound CCCCCCCCCCCCC(O)CCCCC CFOUQYMFDDXZEG-UHFFFAOYSA-N 0.000 claims description 4
- 239000000600 sorbitol Substances 0.000 claims description 4
- 239000003760 tallow Substances 0.000 claims description 4
- 229910000048 titanium hydride Inorganic materials 0.000 claims description 4
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 claims description 3
- BDGQTWOHKASHQU-MDZDMXLPSA-N (e)-dodec-3-en-1-ol Chemical compound CCCCCCCC\C=C\CCO BDGQTWOHKASHQU-MDZDMXLPSA-N 0.000 claims description 3
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 claims description 3
- LZDKZFUFMNSQCJ-UHFFFAOYSA-N 1,2-diethoxyethane Chemical compound CCOCCOCC LZDKZFUFMNSQCJ-UHFFFAOYSA-N 0.000 claims description 3
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 claims description 3
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 claims description 3
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 claims description 3
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 claims description 3
- 229960002666 1-octacosanol Drugs 0.000 claims description 3
- PRKWWWFQTPBHRO-UHFFFAOYSA-N 2,4,6,8-tetramethylnonan-1-ol Chemical compound CC(C)CC(C)CC(C)CC(C)CO PRKWWWFQTPBHRO-UHFFFAOYSA-N 0.000 claims description 3
- SPZKOUBIZRBFQY-UHFFFAOYSA-N 2,4,6-trimethylheptan-1-ol Chemical compound CC(C)CC(C)CC(C)CO SPZKOUBIZRBFQY-UHFFFAOYSA-N 0.000 claims description 3
- QNMCWJOEQBZQHB-UHFFFAOYSA-N 2-Hexyl-1-octanol Chemical compound CCCCCCC(CO)CCCCCC QNMCWJOEQBZQHB-UHFFFAOYSA-N 0.000 claims description 3
- XWHPLZAGPKZMPW-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]ethanol;n,n-dibutylbutan-1-amine Chemical compound OCCN(CCO)CCO.CCCCN(CCCC)CCCC XWHPLZAGPKZMPW-UHFFFAOYSA-N 0.000 claims description 3
- UMKNBNWWXLQQGU-UHFFFAOYSA-N 2-butyldodecan-1-ol Chemical compound CCCCCCCCCCC(CO)CCCC UMKNBNWWXLQQGU-UHFFFAOYSA-N 0.000 claims description 3
- FBQSHQAMBYZTLT-UHFFFAOYSA-N 2-butyltetradecan-1-ol Chemical compound CCCCCCCCCCCCC(CO)CCCC FBQSHQAMBYZTLT-UHFFFAOYSA-N 0.000 claims description 3
- CAYHVMBQBLYQMT-UHFFFAOYSA-N 2-decyltetradecan-1-ol Chemical compound CCCCCCCCCCCCC(CO)CCCCCCCCCC CAYHVMBQBLYQMT-UHFFFAOYSA-N 0.000 claims description 3
- DEMBLPGWNXUBIQ-UHFFFAOYSA-N 2-dodecylhexadecan-1-ol Chemical compound CCCCCCCCCCCCCCC(CO)CCCCCCCCCCCC DEMBLPGWNXUBIQ-UHFFFAOYSA-N 0.000 claims description 3
- GKYYOXXPFPRZOQ-UHFFFAOYSA-N 2-ethylhexadecan-1-ol Chemical compound CCCCCCCCCCCCCCC(CC)CO GKYYOXXPFPRZOQ-UHFFFAOYSA-N 0.000 claims description 3
- GCRNBOKNAJUCRT-UHFFFAOYSA-N 2-ethyltetradecan-1-ol Chemical compound CCCCCCCCCCCCC(CC)CO GCRNBOKNAJUCRT-UHFFFAOYSA-N 0.000 claims description 3
- RJCZAHGCMKCXGE-UHFFFAOYSA-N 2-heptyldecan-1-ol Chemical compound CCCCCCCCC(CO)CCCCCCC RJCZAHGCMKCXGE-UHFFFAOYSA-N 0.000 claims description 3
- JQJGGMZIMBGQQY-UHFFFAOYSA-N 2-hexadecylicosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCC(CO)CCCCCCCCCCCCCCCC JQJGGMZIMBGQQY-UHFFFAOYSA-N 0.000 claims description 3
- LOIMOHMWAXGSLR-UHFFFAOYSA-N 2-hexyldodecan-1-ol Chemical compound CCCCCCCCCCC(CO)CCCCCC LOIMOHMWAXGSLR-UHFFFAOYSA-N 0.000 claims description 3
- PMDBBJJQBQHUBY-UHFFFAOYSA-N 2-hexylnonan-1-ol Chemical compound CCCCCCCC(CO)CCCCCC PMDBBJJQBQHUBY-UHFFFAOYSA-N 0.000 claims description 3
- LMWMTSCFTPQVCJ-UHFFFAOYSA-N 2-methylphenol;phenol Chemical compound OC1=CC=CC=C1.CC1=CC=CC=C1O LMWMTSCFTPQVCJ-UHFFFAOYSA-N 0.000 claims description 3
- DWXTVLYIFYZGFY-UHFFFAOYSA-N 2-methyltridecan-2-ol Chemical compound CCCCCCCCCCCC(C)(C)O DWXTVLYIFYZGFY-UHFFFAOYSA-N 0.000 claims description 3
- YOZVHCUUMOCJNG-UHFFFAOYSA-N 2-methylundecan-3-ol Chemical compound CCCCCCCCC(O)C(C)C YOZVHCUUMOCJNG-UHFFFAOYSA-N 0.000 claims description 3
- VNMFTZUIEPELBZ-UHFFFAOYSA-N 2-methylundecan-4-ol Chemical compound CCCCCCCC(O)CC(C)C VNMFTZUIEPELBZ-UHFFFAOYSA-N 0.000 claims description 3
- SBRNGYIZARJJCF-UHFFFAOYSA-N 2-nonylphenol;2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O.CCCCCCCCCC1=CC=CC=C1O SBRNGYIZARJJCF-UHFFFAOYSA-N 0.000 claims description 3
- JYZLSYFPFQTNNO-UHFFFAOYSA-N 2-octyldecan-1-ol Chemical compound CCCCCCCCC(CO)CCCCCCCC JYZLSYFPFQTNNO-UHFFFAOYSA-N 0.000 claims description 3
- WURUHDXAJUDAIE-UHFFFAOYSA-N 2-pentylundecan-1-ol Chemical compound CCCCCCCCCC(CO)CCCCC WURUHDXAJUDAIE-UHFFFAOYSA-N 0.000 claims description 3
- HCILTAHXZXLTAS-UHFFFAOYSA-N 2-propylnonan-1-ol Chemical compound CCCCCCCC(CO)CCC HCILTAHXZXLTAS-UHFFFAOYSA-N 0.000 claims description 3
- DWBBAVPCVHRYCZ-UHFFFAOYSA-N 2-propyltridecan-1-ol Chemical compound CCCCCCCCCCCC(CO)CCC DWBBAVPCVHRYCZ-UHFFFAOYSA-N 0.000 claims description 3
- LUJMEECXHPYQOF-UHFFFAOYSA-N 3'-Hydroxyacetophenone Natural products CC(=O)C1=CC=CC(O)=C1 LUJMEECXHPYQOF-UHFFFAOYSA-N 0.000 claims description 3
- BJWCLZSMMGHWHE-UHFFFAOYSA-N 3,5,5,7,7-pentamethyloctan-1-ol Chemical compound OCCC(C)CC(C)(C)CC(C)(C)C BJWCLZSMMGHWHE-UHFFFAOYSA-N 0.000 claims description 3
- BODRLKRKPXBDBN-UHFFFAOYSA-N 3,5,5-Trimethyl-1-hexanol Chemical compound OCCC(C)CC(C)(C)C BODRLKRKPXBDBN-UHFFFAOYSA-N 0.000 claims description 3
- TYNDBPORVYOEKZ-UHFFFAOYSA-N 3,6-dimethyldodec-8-en-1-ol Chemical compound CCCC=CCC(C)CCC(C)CCO TYNDBPORVYOEKZ-UHFFFAOYSA-N 0.000 claims description 3
- ICTOQBVCUDARKR-UHFFFAOYSA-N 3-butylnonan-1-ol Chemical compound CCCCCCC(CCO)CCCC ICTOQBVCUDARKR-UHFFFAOYSA-N 0.000 claims description 3
- WARAZCRWTCEZOT-UHFFFAOYSA-N 3-chloro-2-methylaniline 3-chloro-4-methylaniline N,N-dimethyl-1-phenylmethanamine 2-methylpropan-2-amine Chemical compound ClC1=CC=CC(=C1C)N.ClC1=C(C=CC(=C1)N)C.C(C)(C)(C)N.C(C1=CC=CC=C1)N(C)C WARAZCRWTCEZOT-UHFFFAOYSA-N 0.000 claims description 3
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 claims description 3
- PKTQWMKRSGFEKN-UHFFFAOYSA-N 3-ethyldecan-3-ol Chemical compound CCCCCCCC(O)(CC)CC PKTQWMKRSGFEKN-UHFFFAOYSA-N 0.000 claims description 3
- WGDHJACBNBATDD-UHFFFAOYSA-N 3-hexylundecan-1-ol Chemical compound CCCCCCCCC(CCO)CCCCCC WGDHJACBNBATDD-UHFFFAOYSA-N 0.000 claims description 3
- JKESAZVCKXQWMI-UHFFFAOYSA-N 3-octyltridecan-1-ol Chemical compound CCCCCCCCCCC(CCO)CCCCCCCC JKESAZVCKXQWMI-UHFFFAOYSA-N 0.000 claims description 3
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 claims description 3
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 claims description 3
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 claims description 3
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 claims description 3
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 claims description 3
- RGMXLODMOJKQMZ-UHFFFAOYSA-N 4-ethyldecan-2-ol Chemical compound CCCCCCC(CC)CC(C)O RGMXLODMOJKQMZ-UHFFFAOYSA-N 0.000 claims description 3
- QRPAMESDMPYZPB-UHFFFAOYSA-N 4-methyltridecan-3-ol Chemical compound CCCCCCCCCC(C)C(O)CC QRPAMESDMPYZPB-UHFFFAOYSA-N 0.000 claims description 3
- YAZPEIAPZNVVRW-UHFFFAOYSA-N 4-methylundecan-2-ol Chemical compound CCCCCCCC(C)CC(C)O YAZPEIAPZNVVRW-UHFFFAOYSA-N 0.000 claims description 3
- ORJDSXJLQMPGJP-UHFFFAOYSA-N 4-methylundecan-4-ol Chemical compound CCCCCCCC(C)(O)CCC ORJDSXJLQMPGJP-UHFFFAOYSA-N 0.000 claims description 3
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 claims description 3
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 claims description 3
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 claims description 3
- RYTXMZPHCYIIFG-UHFFFAOYSA-N 5-methylundecan-2-ol Chemical compound CCCCCCC(C)CCC(C)O RYTXMZPHCYIIFG-UHFFFAOYSA-N 0.000 claims description 3
- 239000005725 8-Hydroxyquinoline Substances 0.000 claims description 3
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 claims description 3
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 claims description 3
- 239000005711 Benzoic acid Substances 0.000 claims description 3
- XEMVPSHCYKQUIU-UHFFFAOYSA-N C(C)(C)(C)C1=CC(=CC=C1O)C.C1(O)=CC=C(O)C=C1 Chemical compound C(C)(C)(C)C1=CC(=CC=C1O)C.C1(O)=CC=C(O)C=C1 XEMVPSHCYKQUIU-UHFFFAOYSA-N 0.000 claims description 3
- ZOFDDVUKXRAHOB-UHFFFAOYSA-N C(C=1C(N)=CC=CC1)(=O)OC.CNC1=CC=CC=C1.N1=C(C=C(C=C1)C)C Chemical compound C(C=1C(N)=CC=CC1)(=O)OC.CNC1=CC=CC=C1.N1=C(C=C(C=C1)C)C ZOFDDVUKXRAHOB-UHFFFAOYSA-N 0.000 claims description 3
- YBUFAQARMXMYCH-UHFFFAOYSA-N C(C=1C(O)=CC=CC1)(=O)N.NC1=C(C=CC=C1)O.NC1=C(C=CC(=C1)Cl)O.OC1=CC=C(C=O)C=C1.C(C=1C(O)=CC=CC1)=O.C(C=1C(O)=CC=CC1)(=O)OC1=CC=CC=C1 Chemical compound C(C=1C(O)=CC=CC1)(=O)N.NC1=C(C=CC=C1)O.NC1=C(C=CC(=C1)Cl)O.OC1=CC=C(C=O)C=C1.C(C=1C(O)=CC=CC1)=O.C(C=1C(O)=CC=CC1)(=O)OC1=CC=CC=C1 YBUFAQARMXMYCH-UHFFFAOYSA-N 0.000 claims description 3
- XFUSEPANQYJBMG-UHFFFAOYSA-N C(CC)(=O)O.C(CCC)(=O)O.C(C=1C(N)=CC=CC1)(=O)O Chemical compound C(CC)(=O)O.C(CCC)(=O)O.C(C=1C(N)=CC=CC1)(=O)O XFUSEPANQYJBMG-UHFFFAOYSA-N 0.000 claims description 3
- ZEGFMUJWOWBDRR-UHFFFAOYSA-N C(CCCCCCCC=C/CCCCCCCC)(=O)O.C(CCCCCCCCCCCCCCCCC)(=O)O.C(CCCCCCCCCCC)(=O)O.C(C)C(C(=O)O)CCCC.C(CCCCCC)(=O)O.C(CCCC)(=O)O.C(C)(=O)O.C(=O)O Chemical compound C(CCCCCCCC=C/CCCCCCCC)(=O)O.C(CCCCCCCCCCCCCCCCC)(=O)O.C(CCCCCCCCCCC)(=O)O.C(C)C(C(=O)O)CCCC.C(CCCCCC)(=O)O.C(CCCC)(=O)O.C(C)(=O)O.C(=O)O ZEGFMUJWOWBDRR-UHFFFAOYSA-N 0.000 claims description 3
- MJYHCEOTPKZFPV-UHFFFAOYSA-N C(CO)(=O)O.C(C(O)C)(=O)O.C(C(=C)CC(=O)O)(=O)O Chemical compound C(CO)(=O)O.C(C(O)C)(=O)O.C(C(=C)CC(=O)O)(=O)O MJYHCEOTPKZFPV-UHFFFAOYSA-N 0.000 claims description 3
- FONALAKQTMDRLO-UHFFFAOYSA-N C(O)CN.N1CCNCC1.C(C)(C)(CC(C)(C)C)N Chemical compound C(O)CN.N1CCNCC1.C(C)(C)(CC(C)(C)C)N FONALAKQTMDRLO-UHFFFAOYSA-N 0.000 claims description 3
- UTXUELONULEMLC-UHFFFAOYSA-N C1(=C(C=CC=C1)N)N.C(C)(C)(CC(C)(C)C)N.C1(CCCCC1)N.C(C=1C(N)=CC=CC1)(=O)O.NCC(=O)O.C1(=CC=CC=C1)N(C1=CC=CC=C1)C1=CC=CC=C1.C(CCCCCCCCCCCCCCC)N.C(C1=CC=CC=C1)N.NC1=CC=CC=C1 Chemical compound C1(=C(C=CC=C1)N)N.C(C)(C)(CC(C)(C)C)N.C1(CCCCC1)N.C(C=1C(N)=CC=CC1)(=O)O.NCC(=O)O.C1(=CC=CC=C1)N(C1=CC=CC=C1)C1=CC=CC=C1.C(CCCCCCCCCCCCCCC)N.C(C1=CC=CC=C1)N.NC1=CC=CC=C1 UTXUELONULEMLC-UHFFFAOYSA-N 0.000 claims description 3
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 claims description 3
- SFTXMEIGBXZRDS-UHFFFAOYSA-N ClC1=CC(=C(C=C1)O)[N+](=O)[O-].C(C=1C(O)=CC=CC1)(=O)OCC1=CC=CC=C1.C(C=1C(O)=CC=CC1)(=O)OC Chemical compound ClC1=CC(=C(C=C1)O)[N+](=O)[O-].C(C=1C(O)=CC=CC1)(=O)OCC1=CC=CC=C1.C(C=1C(O)=CC=CC1)(=O)OC SFTXMEIGBXZRDS-UHFFFAOYSA-N 0.000 claims description 3
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 claims description 3
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 3
- 229930195725 Mannitol Natural products 0.000 claims description 3
- 239000011837 N,N-methylenebisacrylamide Substances 0.000 claims description 3
- DRNXMXUDRLPTCY-UHFFFAOYSA-N NC(=O)C(=O)N.ClCC(=O)N.C(C)(=O)NC1=CC=C(C=C1)O Chemical compound NC(=O)C(=O)N.ClCC(=O)N.C(C)(=O)NC1=CC=C(C=C1)O DRNXMXUDRLPTCY-UHFFFAOYSA-N 0.000 claims description 3
- JROWPVSWTUCWAJ-UHFFFAOYSA-N NC1=C(C=CC=C1)O.NC(CO)(CO)CC.NC1=C(C=CC(=C1)Cl)O.C(C)(=O)NC1=CC=C(C=C1)O Chemical compound NC1=C(C=CC=C1)O.NC(CO)(CO)CC.NC1=C(C=CC(=C1)Cl)O.C(C)(=O)NC1=CC=C(C=C1)O JROWPVSWTUCWAJ-UHFFFAOYSA-N 0.000 claims description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 claims description 3
- BURLYCBZFZIDOO-UHFFFAOYSA-N [N+](=O)([O-])C1=C(C=CC(=C1)[N+](=O)[O-])O.C(C)(C)(CC)C1=C(C=CC(=C1)C(C)(C)CC)O Chemical compound [N+](=O)([O-])C1=C(C=CC(=C1)[N+](=O)[O-])O.C(C)(C)(CC)C1=C(C=CC(=C1)C(C)(C)CC)O BURLYCBZFZIDOO-UHFFFAOYSA-N 0.000 claims description 3
- KPPZZXBGPHXLKP-UHFFFAOYSA-N [N+](=O)([O-])C1=C(C=CC=C1)O.[N+](=O)([O-])C1=CC(=CC=C1O)C Chemical compound [N+](=O)([O-])C1=C(C=CC=C1)O.[N+](=O)([O-])C1=CC(=CC=C1O)C KPPZZXBGPHXLKP-UHFFFAOYSA-N 0.000 claims description 3
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims description 3
- AFFOWBKJYPZOBJ-UHFFFAOYSA-N benzamide formamide 2-hydroxybenzamide 3-oxo-N-phenylbutanamide N-phenylacetamide Chemical compound C(CC(=O)C)(=O)NC1=CC=CC=C1.C(C=1C(O)=CC=CC1)(=O)N.C(C)(=O)NC1=CC=CC=C1.C(C1=CC=CC=C1)(=O)N.C(=O)N AFFOWBKJYPZOBJ-UHFFFAOYSA-N 0.000 claims description 3
- JERCPDZTVRGVSH-UHFFFAOYSA-N benzene-1,2-diol;benzene-1,3-diol Chemical compound OC1=CC=CC(O)=C1.OC1=CC=CC=C1O JERCPDZTVRGVSH-UHFFFAOYSA-N 0.000 claims description 3
- 235000010233 benzoic acid Nutrition 0.000 claims description 3
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 229960000541 cetyl alcohol Drugs 0.000 claims description 3
- 229930016911 cinnamic acid Natural products 0.000 claims description 3
- 235000013985 cinnamic acid Nutrition 0.000 claims description 3
- 229960000735 docosanol Drugs 0.000 claims description 3
- XSWSEQPWKOWORN-UHFFFAOYSA-N dodecan-2-ol Chemical compound CCCCCCCCCCC(C)O XSWSEQPWKOWORN-UHFFFAOYSA-N 0.000 claims description 3
- OKDGZLITBCRLLJ-UHFFFAOYSA-N dodecan-3-ol Chemical compound CCCCCCCCCC(O)CC OKDGZLITBCRLLJ-UHFFFAOYSA-N 0.000 claims description 3
- ZGSIAHIBHSEKPB-UHFFFAOYSA-N dodecan-4-ol Chemical compound CCCCCCCCC(O)CCC ZGSIAHIBHSEKPB-UHFFFAOYSA-N 0.000 claims description 3
- AVERNHDYEFYHIV-UHFFFAOYSA-N dodecan-5-ol Chemical compound CCCCCCCC(O)CCCC AVERNHDYEFYHIV-UHFFFAOYSA-N 0.000 claims description 3
- LRBBIFXICMMTOW-UHFFFAOYSA-N dodecan-6-ol Chemical compound CCCCCCC(O)CCCCC LRBBIFXICMMTOW-UHFFFAOYSA-N 0.000 claims description 3
- HFJRKMMYBMWEAD-UHFFFAOYSA-N dodecanal Chemical compound CCCCCCCCCCCC=O HFJRKMMYBMWEAD-UHFFFAOYSA-N 0.000 claims description 3
- 150000004665 fatty acids Chemical class 0.000 claims description 3
- 125000000524 functional group Chemical group 0.000 claims description 3
- ACDUHTSVVVHMGU-UHFFFAOYSA-N hexadecan-3-ol Chemical compound CCCCCCCCCCCCCC(O)CC ACDUHTSVVVHMGU-UHFFFAOYSA-N 0.000 claims description 3
- JIMMILCKVYOFET-UHFFFAOYSA-N hexadecan-4-ol Chemical compound CCCCCCCCCCCCC(O)CCC JIMMILCKVYOFET-UHFFFAOYSA-N 0.000 claims description 3
- ADGQOCBSNYMAQS-UHFFFAOYSA-N hexadecan-6-ol Chemical compound CCCCCCCCCCC(O)CCCCC ADGQOCBSNYMAQS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052738 indium Inorganic materials 0.000 claims description 3
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 3
- 229940102253 isopropanolamine Drugs 0.000 claims description 3
- 229940089454 lauryl aldehyde Drugs 0.000 claims description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 3
- 239000011976 maleic acid Substances 0.000 claims description 3
- 239000001630 malic acid Substances 0.000 claims description 3
- 235000011090 malic acid Nutrition 0.000 claims description 3
- 239000000594 mannitol Substances 0.000 claims description 3
- 235000010355 mannitol Nutrition 0.000 claims description 3
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 claims description 3
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 claims description 3
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 claims description 3
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 claims description 3
- 229960002216 methylparaben Drugs 0.000 claims description 3
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 claims description 3
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 claims description 3
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 claims description 3
- WDUMAPVMFPPSOU-UHFFFAOYSA-N octadecan-3-ol Chemical compound CCCCCCCCCCCCCCCC(O)CC WDUMAPVMFPPSOU-UHFFFAOYSA-N 0.000 claims description 3
- IIMNMDYAGLBIOT-UHFFFAOYSA-N octadecan-4-ol Chemical compound CCCCCCCCCCCCCCC(O)CCC IIMNMDYAGLBIOT-UHFFFAOYSA-N 0.000 claims description 3
- QANCZOOABLPKBN-UHFFFAOYSA-N octadecan-5-ol Chemical compound CCCCCCCCCCCCCC(O)CCCC QANCZOOABLPKBN-UHFFFAOYSA-N 0.000 claims description 3
- SSLLZDIAWKBKLB-UHFFFAOYSA-N octadecan-8-ol Chemical compound CCCCCCCCCCC(O)CCCCCCC SSLLZDIAWKBKLB-UHFFFAOYSA-N 0.000 claims description 3
- URMHMMMIVAECEM-UHFFFAOYSA-N octadecan-9-ol Chemical compound CCCCCCCCCC(O)CCCCCCCC URMHMMMIVAECEM-UHFFFAOYSA-N 0.000 claims description 3
- 235000010292 orthophenyl phenol Nutrition 0.000 claims description 3
- 239000004306 orthophenyl phenol Substances 0.000 claims description 3
- 229960003540 oxyquinoline Drugs 0.000 claims description 3
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 claims description 3
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 claims description 3
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 claims description 3
- QXSAKPUBHTZHKW-UHFFFAOYSA-N para-hydroxybenzamide Natural products NC(=O)C1=CC=C(O)C=C1 QXSAKPUBHTZHKW-UHFFFAOYSA-N 0.000 claims description 3
- 229940090668 parachlorophenol Drugs 0.000 claims description 3
- 150000003141 primary amines Chemical class 0.000 claims description 3
- 229940079877 pyrogallol Drugs 0.000 claims description 3
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 claims description 3
- WBHHMMIMDMUBKC-XLNAKTSKSA-N ricinelaidic acid Chemical compound CCCCCC[C@@H](O)C\C=C\CCCCCCCC(O)=O WBHHMMIMDMUBKC-XLNAKTSKSA-N 0.000 claims description 3
- 229960003656 ricinoleic acid Drugs 0.000 claims description 3
- FEUQNCSVHBHROZ-UHFFFAOYSA-N ricinoleic acid Natural products CCCCCCC(O[Si](C)(C)C)CC=CCCCCCCCC(=O)OC FEUQNCSVHBHROZ-UHFFFAOYSA-N 0.000 claims description 3
- 229960004889 salicylic acid Drugs 0.000 claims description 3
- 150000003335 secondary amines Chemical class 0.000 claims description 3
- 125000003107 substituted aryl group Chemical group 0.000 claims description 3
- KUCOHFSKRZZVRO-UHFFFAOYSA-N terephthalaldehyde Chemical compound O=CC1=CC=C(C=O)C=C1 KUCOHFSKRZZVRO-UHFFFAOYSA-N 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- BRGJIIMZXMWMCC-UHFFFAOYSA-N tetradecan-2-ol Chemical compound CCCCCCCCCCCCC(C)O BRGJIIMZXMWMCC-UHFFFAOYSA-N 0.000 claims description 3
- CIZOCKPOEXXEHB-UHFFFAOYSA-N tetradecan-3-ol Chemical compound CCCCCCCCCCCC(O)CC CIZOCKPOEXXEHB-UHFFFAOYSA-N 0.000 claims description 3
- HRDGAIGDKJXHIU-UHFFFAOYSA-N tetradecan-4-ol Chemical compound CCCCCCCCCCC(O)CCC HRDGAIGDKJXHIU-UHFFFAOYSA-N 0.000 claims description 3
- UCEOYIRETCABER-UHFFFAOYSA-N tetradecan-5-ol Chemical compound CCCCCCCCCC(O)CCCC UCEOYIRETCABER-UHFFFAOYSA-N 0.000 claims description 3
- KATMMOGJSFLTOP-UHFFFAOYSA-N tetradecan-6-ol Chemical compound CCCCCCCCC(O)CCCCC KATMMOGJSFLTOP-UHFFFAOYSA-N 0.000 claims description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 3
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 claims description 3
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 claims description 2
- PTTPXKJBFFKCEK-UHFFFAOYSA-N 2-Methyl-4-heptanone Chemical compound CC(C)CC(=O)CC(C)C PTTPXKJBFFKCEK-UHFFFAOYSA-N 0.000 claims description 2
- FGZXHVORLPLICA-UHFFFAOYSA-N 2-methylundecan-1-ol Chemical compound CCCCCCCCCC(C)CO FGZXHVORLPLICA-UHFFFAOYSA-N 0.000 claims description 2
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 claims description 2
- DQAVXBYHGUFYEA-UHFFFAOYSA-N 3-hexyltridecan-1-ol Chemical compound CCCCCCCCCCC(CCO)CCCCCC DQAVXBYHGUFYEA-UHFFFAOYSA-N 0.000 claims description 2
- AVVIXYGTFQBADW-UHFFFAOYSA-N 3-methylundecan-3-ol Chemical compound CCCCCCCCC(C)(O)CC AVVIXYGTFQBADW-UHFFFAOYSA-N 0.000 claims description 2
- OTLNPYWUJOZPPA-UHFFFAOYSA-N 4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-N 0.000 claims description 2
- JVTGRWVUXQZXLP-UHFFFAOYSA-N C(C)(C)(C1=CC=C(C=C1)O)C1=CC=C(C=C1)O.C1=C(C=CC2=CC=CC=C12)O Chemical compound C(C)(C)(C1=CC=C(C=C1)O)C1=CC=C(C=C1)O.C1=C(C=CC2=CC=CC=C12)O JVTGRWVUXQZXLP-UHFFFAOYSA-N 0.000 claims description 2
- TUJXTLGKPSTAEI-PLOUOMFKSA-N C(CC(=O)C)(=O)O.C(CCCCCCCC)(=O)O.C(\C=C\C)(=O)O.C(CCCCCCCCC=C)(=O)O.ClC1=C(OCC(=O)O)C=C(C(=C1)Cl)Cl.ClC(C(=O)O)(Cl)Cl.C(C(O)C(O)C(=O)O)(=O)O Chemical compound C(CC(=O)C)(=O)O.C(CCCCCCCC)(=O)O.C(\C=C\C)(=O)O.C(CCCCCCCCC=C)(=O)O.ClC1=C(OCC(=O)O)C=C(C(=C1)Cl)Cl.ClC(C(=O)O)(Cl)Cl.C(C(O)C(O)C(=O)O)(=O)O TUJXTLGKPSTAEI-PLOUOMFKSA-N 0.000 claims description 2
- QTHGWWIAPQJHQA-UHFFFAOYSA-N C1(=CC=CC=C1)NC1=CC=CC2=CC=CC=C12.N(CC(=O)O)(CC(=O)O)CC(=O)O Chemical compound C1(=CC=CC=C1)NC1=CC=CC2=CC=CC=C12.N(CC(=O)O)(CC(=O)O)CC(=O)O QTHGWWIAPQJHQA-UHFFFAOYSA-N 0.000 claims description 2
- RCARPSMIWXMQRB-UHFFFAOYSA-N CCCCCC(=O)CC.CC1(C)C2CCC1(C)C(=O)C2 Chemical compound CCCCCC(=O)CC.CC1(C)C2CCC1(C)C(=O)C2 RCARPSMIWXMQRB-UHFFFAOYSA-N 0.000 claims description 2
- AUCNWRAWDNNDKN-UHFFFAOYSA-N butane-1,4-diol ethane-1,2-diol hexane-1,6-diol propane-1,2-diol Chemical compound OCCO.CC(O)CO.OCCCCO.OCCCCCCO AUCNWRAWDNNDKN-UHFFFAOYSA-N 0.000 claims description 2
- DWHYOXYJRGUQEP-UHFFFAOYSA-N carbanide zirconium(4+) Chemical compound [CH3-].[CH3-].[CH3-].[CH3-].[Zr+4] DWHYOXYJRGUQEP-UHFFFAOYSA-N 0.000 claims description 2
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims description 2
- SFFVATKALSIZGN-UHFFFAOYSA-N hexadecan-7-ol Chemical compound CCCCCCCCCC(O)CCCCCC SFFVATKALSIZGN-UHFFFAOYSA-N 0.000 claims description 2
- OLVNUMHZZANJCG-UHFFFAOYSA-N hexadecan-8-ol Chemical compound CCCCCCCCC(O)CCCCCCC OLVNUMHZZANJCG-UHFFFAOYSA-N 0.000 claims description 2
- 229940088644 n,n-dimethylacrylamide Drugs 0.000 claims description 2
- YLGYACDQVQQZSW-UHFFFAOYSA-N n,n-dimethylprop-2-enamide Chemical compound CN(C)C(=O)C=C YLGYACDQVQQZSW-UHFFFAOYSA-N 0.000 claims description 2
- 125000005608 naphthenic acid group Chemical group 0.000 claims description 2
- UVPGECJLXBGLDW-UHFFFAOYSA-N octadecan-7-ol Chemical compound CCCCCCCCCCCC(O)CCCCCC UVPGECJLXBGLDW-UHFFFAOYSA-N 0.000 claims description 2
- 229940055577 oleyl alcohol Drugs 0.000 claims description 2
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 claims description 2
- 150000002989 phenols Chemical class 0.000 claims description 2
- 229910052716 thallium Inorganic materials 0.000 claims description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 2
- XCZXGTMEAKBVPV-UHFFFAOYSA-N trimethylgallium Chemical compound C[Ga](C)C XCZXGTMEAKBVPV-UHFFFAOYSA-N 0.000 claims description 2
- VYRLPDUIQPFWPC-UHFFFAOYSA-N trimethylthallane Chemical compound C[Tl](C)C VYRLPDUIQPFWPC-UHFFFAOYSA-N 0.000 claims description 2
- CNWZYDSEVLFSMS-UHFFFAOYSA-N tripropylalumane Chemical compound CCC[Al](CCC)CCC CNWZYDSEVLFSMS-UHFFFAOYSA-N 0.000 claims description 2
- QNVRIHYSUZMSGM-UHFFFAOYSA-N hexan-2-ol Chemical compound CCCCC(C)O QNVRIHYSUZMSGM-UHFFFAOYSA-N 0.000 claims 8
- ZWRUINPWMLAQRD-UHFFFAOYSA-N nonan-1-ol Chemical compound CCCCCCCCCO ZWRUINPWMLAQRD-UHFFFAOYSA-N 0.000 claims 8
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims 6
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 claims 6
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 6
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims 5
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 claims 4
- BBMCTIGTTCKYKF-UHFFFAOYSA-N 1-heptanol Chemical compound CCCCCCCO BBMCTIGTTCKYKF-UHFFFAOYSA-N 0.000 claims 4
- QNVRIHYSUZMSGM-LURJTMIESA-N 2-Hexanol Natural products CCCC[C@H](C)O QNVRIHYSUZMSGM-LURJTMIESA-N 0.000 claims 4
- CETWDUZRCINIHU-UHFFFAOYSA-N 2-heptanol Chemical compound CCCCCC(C)O CETWDUZRCINIHU-UHFFFAOYSA-N 0.000 claims 4
- ZBQXOOAHEIPFSM-UHFFFAOYSA-N 2-methylpentadecan-1-ol Chemical compound CCCCCCCCCCCCCC(C)CO ZBQXOOAHEIPFSM-UHFFFAOYSA-N 0.000 claims 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 claims 4
- KSMVZQYAVGTKIV-UHFFFAOYSA-N decanal Chemical compound CCCCCCCCCC=O KSMVZQYAVGTKIV-UHFFFAOYSA-N 0.000 claims 4
- SRXOCFMDUSFFAK-UHFFFAOYSA-N dimethyl peroxide Chemical compound COOC SRXOCFMDUSFFAK-UHFFFAOYSA-N 0.000 claims 4
- NOPFSRXAKWQILS-UHFFFAOYSA-N docosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCO NOPFSRXAKWQILS-UHFFFAOYSA-N 0.000 claims 4
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 claims 4
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 claims 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 claims 4
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 claims 4
- BTFJIXJJCSYFAL-UHFFFAOYSA-N icosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCO BTFJIXJJCSYFAL-UHFFFAOYSA-N 0.000 claims 4
- QQZOPKMRPOGIEB-UHFFFAOYSA-N n-butyl methyl ketone Natural products CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 claims 4
- XGFDHKJUZCCPKQ-UHFFFAOYSA-N nonadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCO XGFDHKJUZCCPKQ-UHFFFAOYSA-N 0.000 claims 4
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 claims 4
- SJWFXCIHNDVPSH-UHFFFAOYSA-N octan-2-ol Chemical compound CCCCCCC(C)O SJWFXCIHNDVPSH-UHFFFAOYSA-N 0.000 claims 4
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 claims 4
- REIUXOLGHVXAEO-UHFFFAOYSA-N pentadecan-1-ol Chemical compound CCCCCCCCCCCCCCCO REIUXOLGHVXAEO-UHFFFAOYSA-N 0.000 claims 4
- JYVLIDXNZAXMDK-UHFFFAOYSA-N pentan-2-ol Chemical compound CCCC(C)O JYVLIDXNZAXMDK-UHFFFAOYSA-N 0.000 claims 4
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 claims 4
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 claims 4
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 claims 2
- 229910019349 (C2H5O)4Ti Inorganic materials 0.000 claims 2
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 claims 2
- MFQSIMJLMIESPR-UHFFFAOYSA-N 2,4,6,8-tetramethylnonan-2-ol Chemical compound CC(C)CC(C)CC(C)CC(C)(C)O MFQSIMJLMIESPR-UHFFFAOYSA-N 0.000 claims 2
- XULHFMYCBKQGEE-MRXNPFEDSA-N 2-Hexyl-1-decanol Natural products CCCCCCCC[C@H](CO)CCCCCC XULHFMYCBKQGEE-MRXNPFEDSA-N 0.000 claims 2
- YEGNTQBFSQBGJT-UHFFFAOYSA-N 2-heptylundecan-1-ol Chemical compound CCCCCCCCCC(CO)CCCCCCC YEGNTQBFSQBGJT-UHFFFAOYSA-N 0.000 claims 2
- CEBKHWWANWSNTI-UHFFFAOYSA-N 2-methylbut-3-yn-2-ol Chemical compound CC(C)(O)C#C CEBKHWWANWSNTI-UHFFFAOYSA-N 0.000 claims 2
- ROKOPEMRIKPNDG-UHFFFAOYSA-N 2-propylpentadecan-1-ol Chemical compound CCCCCCCCCCCCCC(CO)CCC ROKOPEMRIKPNDG-UHFFFAOYSA-N 0.000 claims 2
- RTXVDAJGIYOHFY-UHFFFAOYSA-N 2-tetradecyloctadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCC(CO)CCCCCCCCCCCCCC RTXVDAJGIYOHFY-UHFFFAOYSA-N 0.000 claims 2
- VMLWZTNSQDTBRE-UHFFFAOYSA-N 3-butylundecan-1-ol Chemical compound CCCCCCCCC(CCO)CCCC VMLWZTNSQDTBRE-UHFFFAOYSA-N 0.000 claims 2
- IRFVXTHHHPLIOE-UHFFFAOYSA-N 3-ethyldodecan-3-ol Chemical compound CCCCCCCCCC(O)(CC)CC IRFVXTHHHPLIOE-UHFFFAOYSA-N 0.000 claims 2
- KPNPVQMWGFMMJE-UHFFFAOYSA-N 3-methyltridecan-3-ol Chemical compound CCCCCCCCCCC(C)(O)CC KPNPVQMWGFMMJE-UHFFFAOYSA-N 0.000 claims 2
- FRUVLUDRNSFGAF-UHFFFAOYSA-N 3-methylundecan-2-ol Chemical compound CCCCCCCCC(C)C(C)O FRUVLUDRNSFGAF-UHFFFAOYSA-N 0.000 claims 2
- KTCRBFONKNVHBW-UHFFFAOYSA-N 4,5,6,6-tetramethylcyclohexa-2,4-dien-1-amine Chemical group CC1=C(C)C(C)(C)C(N)C=C1 KTCRBFONKNVHBW-UHFFFAOYSA-N 0.000 claims 2
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 claims 2
- PYKGAFRXDYOISX-UHFFFAOYSA-N 4-ethyldecan-3-ol Chemical compound CCCCCCC(CC)C(O)CC PYKGAFRXDYOISX-UHFFFAOYSA-N 0.000 claims 2
- CUUQUEAUUPYEKK-UHFFFAOYSA-N 4-ethyloct-1-yn-3-ol Chemical compound CCCCC(CC)C(O)C#C CUUQUEAUUPYEKK-UHFFFAOYSA-N 0.000 claims 2
- FOSFLDAPDNOWOV-UHFFFAOYSA-N 4-methyltridecan-4-ol Chemical compound CCCCCCCCCC(C)(O)CCC FOSFLDAPDNOWOV-UHFFFAOYSA-N 0.000 claims 2
- IISBACLAFKSPIT-UHFFFAOYSA-N Bisphenol A Natural products C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims 2
- IQPKOGKBCLMOCB-UHFFFAOYSA-N C(C)N(C1=CC=CC=C1)CC.C(C)N(C1=CC(=CC=C1)C)CC.C(C)N(CCO)CC.N(CCO)CCO.C1(CCCCC1)NC1CCCCC1.ClC=1C=C(N)C=CC1Cl.ClC1=C(N)C=C(C=C1)Cl.C(CCC)NCCCC.C1(CCCCC1)N.ClC1=CC(=C(N)C=C1)[N+](=O)[O-] Chemical compound C(C)N(C1=CC=CC=C1)CC.C(C)N(C1=CC(=CC=C1)C)CC.C(C)N(CCO)CC.N(CCO)CCO.C1(CCCCC1)NC1CCCCC1.ClC=1C=C(N)C=CC1Cl.ClC1=C(N)C=C(C=C1)Cl.C(CCC)NCCCC.C1(CCCCC1)N.ClC1=CC(=C(N)C=C1)[N+](=O)[O-] IQPKOGKBCLMOCB-UHFFFAOYSA-N 0.000 claims 2
- XTBHXYXVZHVFPA-UHFFFAOYSA-N C(C)NC1=CC=CC=C1.C(C)NC=1C(=CC=CC1)C.C(C)NC1=CC=CC2=CC=CC=C12.C(C)NCCO.C(C)OC(C1=CC=C(C=C1)N)=O.C1(=CC=CC=C1)NC1=CC=CC=C1.[N+](=O)([O-])C1=C(N)C=CC(=C1)[N+](=O)[O-].CN(C1=CC=CC=C1)C.CN(CCO)C Chemical compound C(C)NC1=CC=CC=C1.C(C)NC=1C(=CC=CC1)C.C(C)NC1=CC=CC2=CC=CC=C12.C(C)NCCO.C(C)OC(C1=CC=C(C=C1)N)=O.C1(=CC=CC=C1)NC1=CC=CC=C1.[N+](=O)([O-])C1=C(N)C=CC(=C1)[N+](=O)[O-].CN(C1=CC=CC=C1)C.CN(CCO)C XTBHXYXVZHVFPA-UHFFFAOYSA-N 0.000 claims 2
- QIZQFWWQKNTHOI-UHFFFAOYSA-N C(C=1C(O)=CC=CC1)=O.C(=O)(O)C1=C(C=O)C=CC=C1 Chemical compound C(C=1C(O)=CC=CC1)=O.C(=O)(O)C1=C(C=O)C=CC=C1 QIZQFWWQKNTHOI-UHFFFAOYSA-N 0.000 claims 2
- OMYHKJYDEITUED-UHFFFAOYSA-N C1(=CC=CC=C1)CC(=O)O.C(C(=O)O)(C)CC.C(CCCCCCCCCCCCCCC)(=O)O.C(CCCCCCCCCCCCC)(=O)O.C(C(=O)O)(=O)O.C(C(=C)C)(=O)O Chemical compound C1(=CC=CC=C1)CC(=O)O.C(C(=O)O)(C)CC.C(CCCCCCCCCCCCCCC)(=O)O.C(CCCCCCCCCCCCC)(=O)O.C(C(=O)O)(=O)O.C(C(=C)C)(=O)O OMYHKJYDEITUED-UHFFFAOYSA-N 0.000 claims 2
- QQOVQDICYOAISH-UHFFFAOYSA-N CCCCCCCCCCCCCCCCCCN.CCCCCCCCCCCCN.CCCCCCCCCCN.CCCCCCCCN.CCN(CC)C(C1=CC=CC=C1C)=O.CC(N(C)C)=O.CN(C)C=O.C=CC(N)=O.O=C(C1=CC=CC=C11)NC1=O Chemical compound CCCCCCCCCCCCCCCCCCN.CCCCCCCCCCCCN.CCCCCCCCCCN.CCCCCCCCN.CCN(CC)C(C1=CC=CC=C1C)=O.CC(N(C)C)=O.CN(C)C=O.C=CC(N)=O.O=C(C1=CC=CC=C11)NC1=O QQOVQDICYOAISH-UHFFFAOYSA-N 0.000 claims 2
- VMXQAEFINYAGCT-UHFFFAOYSA-N COC1=C(C=O)C=C(C=C1)OC.C(CC(=O)C)(=O)O.C1(=CC=CC=C1)CC=O.NC1=CC=C(C=O)C=C1 Chemical compound COC1=C(C=O)C=C(C=C1)OC.C(CC(=O)C)(=O)O.C1(=CC=CC=C1)CC=O.NC1=CC=C(C=O)C=C1 VMXQAEFINYAGCT-UHFFFAOYSA-N 0.000 claims 2
- ILDCINHAYUISKW-UHFFFAOYSA-N ClC1=C(C=CC=C1)O.CC1=C(C(=CC=C1)C)O.CC1=C(C=C(C=C1)C)O.CC1=C(C=CC(=C1)C)O Chemical compound ClC1=C(C=CC=C1)O.CC1=C(C(=CC=C1)C)O.CC1=C(C=C(C=C1)C)O.CC1=C(C=CC(=C1)C)O ILDCINHAYUISKW-UHFFFAOYSA-N 0.000 claims 2
- GLERCXAMGMXXLL-UHFFFAOYSA-N ClC1=C(OCC(=O)O)C=CC(=C1)Cl.ClC1=C(C(=O)O)C=CC=C1.ClCC(=O)O Chemical compound ClC1=C(OCC(=O)O)C=CC(=C1)Cl.ClC1=C(C(=O)O)C=CC=C1.ClCC(=O)O GLERCXAMGMXXLL-UHFFFAOYSA-N 0.000 claims 2
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 claims 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims 2
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims 2
- YPDYAWKSCULELZ-LVOIGFPFSA-N NCC(=O)O.C(C=C)(=O)O.C(CC(O)(C(=O)O)CC(=O)O)(=O)O.C(\C=C\C(=O)O)(=O)O.C(CCCCCCCC(=O)O)(=O)O.C(CCCCC(=O)O)(=O)O Chemical compound NCC(=O)O.C(C=C)(=O)O.C(CC(O)(C(=O)O)CC(=O)O)(=O)O.C(\C=C\C(=O)O)(=O)O.C(CCCCCCCC(=O)O)(=O)O.C(CCCCC(=O)O)(=O)O YPDYAWKSCULELZ-LVOIGFPFSA-N 0.000 claims 2
- BIVRQOKPJPYPAV-UHFFFAOYSA-N OCC(C)(CO)C.C(O)C(C)(CO)CO.C(O)C(CC)(CO)CO.OCC(CO)(COCC(CO)(COCC(CO)(CO)CO)CO)CO.OCC(CO)(COCC(CO)(CO)CO)CO.OCC(CO)(CO)CO Chemical compound OCC(C)(CO)C.C(O)C(C)(CO)CO.C(O)C(CC)(CO)CO.OCC(CO)(COCC(CO)(COCC(CO)(CO)CO)CO)CO.OCC(CO)(COCC(CO)(CO)CO)CO.OCC(CO)(CO)CO BIVRQOKPJPYPAV-UHFFFAOYSA-N 0.000 claims 2
- FAVYKMFINCUDIY-UHFFFAOYSA-N OCC=1C=C(C=O)OC1CO.OCC1=C(C=CC=C1)CO.OCC(C(=O)O)(C)CO.C(O)C1CCC(CC1)CO Chemical compound OCC=1C=C(C=O)OC1CO.OCC1=C(C=CC=C1)CO.OCC(C(=O)O)(C)CO.C(O)C1CCC(CC1)CO FAVYKMFINCUDIY-UHFFFAOYSA-N 0.000 claims 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 claims 2
- AXMVYSVVTMKQSL-UHFFFAOYSA-N UNPD142122 Natural products OC1=CC=C(C=CC=O)C=C1O AXMVYSVVTMKQSL-UHFFFAOYSA-N 0.000 claims 2
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 claims 2
- 229940117916 cinnamic aldehyde Drugs 0.000 claims 2
- 235000019256 formaldehyde Nutrition 0.000 claims 2
- 229910052733 gallium Inorganic materials 0.000 claims 2
- HNDLTSNUZCYNRL-UHFFFAOYSA-N hexadecan-5-ol Chemical compound CCCCCCCCCCCC(O)CCCC HNDLTSNUZCYNRL-UHFFFAOYSA-N 0.000 claims 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 claims 2
- 229960002510 mandelic acid Drugs 0.000 claims 2
- 229940100630 metacresol Drugs 0.000 claims 2
- QXLPXWSKPNOQLE-UHFFFAOYSA-N methylpentynol Chemical compound CCC(C)(O)C#C QXLPXWSKPNOQLE-UHFFFAOYSA-N 0.000 claims 2
- TVZIWRMELPWPPR-UHFFFAOYSA-N n-(2-methylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1C TVZIWRMELPWPPR-UHFFFAOYSA-N 0.000 claims 2
- ZOCHHNOQQHDWHG-UHFFFAOYSA-N n-hexan-3-ol Natural products CCCC(O)CC ZOCHHNOQQHDWHG-UHFFFAOYSA-N 0.000 claims 2
- 150000003140 primary amides Chemical class 0.000 claims 2
- 150000003334 secondary amides Chemical class 0.000 claims 2
- 150000003511 tertiary amides Chemical class 0.000 claims 2
- SQAINHDHICKHLX-UHFFFAOYSA-N 1-naphthaldehyde Chemical compound C1=CC=C2C(C=O)=CC=CC2=C1 SQAINHDHICKHLX-UHFFFAOYSA-N 0.000 claims 1
- AIYORQABWYEUNC-UHFFFAOYSA-N 2-acetyloxybenzoic acid benzaldehyde 2-chlorobenzaldehyde pentane-2,4-dione 1-phenylethanone undecan-2-one Chemical compound ClC1=C(C=O)C=CC=C1.C(C)(=O)OC=1C(C(=O)O)=CC=CC1.CC(CC(C)=O)=O.C(C)(=O)C1=CC=CC=C1.CC(CCCCCCCCC)=O.C(C1=CC=CC=C1)=O AIYORQABWYEUNC-UHFFFAOYSA-N 0.000 claims 1
- 229910015900 BF3 Inorganic materials 0.000 claims 1
- BXUFZJFHXPDJIT-UHFFFAOYSA-N C(C)(C)(C1=CC=C(C=C1)O)C1=CC=C(C=C1)O.C1=C(C=CC2=CC=CC=C12)O.C1(=CC=CC2=CC=CC=C12)O Chemical compound C(C)(C)(C1=CC=C(C=C1)O)C1=CC=C(C=C1)O.C1=C(C=CC2=CC=CC=C12)O.C1(=CC=CC2=CC=CC=C12)O BXUFZJFHXPDJIT-UHFFFAOYSA-N 0.000 claims 1
- WNAULFKCWWKURE-UHFFFAOYSA-N C12(C(=O)CC(CC1)C2(C)C)C.C(CCCC)C(=O)CC.C(C)OC(CC(=O)C)=O.C(C(C)C)C(=O)CC(C)C Chemical compound C12(C(=O)CC(CC1)C2(C)C)C.C(CCCC)C(=O)CC.C(C)OC(CC(=O)C)=O.C(C(C)C)C(=O)CC(C)C WNAULFKCWWKURE-UHFFFAOYSA-N 0.000 claims 1
- GWYZXTUKHASJJX-UHFFFAOYSA-N COCCOCCO.C(CCC)OCCOCCO.C(COCCO)O.C(CC(C)O)O Chemical compound COCCOCCO.C(CCC)OCCOCCO.C(COCCO)O.C(CC(C)O)O GWYZXTUKHASJJX-UHFFFAOYSA-N 0.000 claims 1
- PXPAZRIUJBLQHP-UHFFFAOYSA-N COCCOCCO.C(CCC)OCCOCCO.C(COCCO)O.C(CC(C)O)O.C(CCCCCCCCCO)O.C(CCCCCO)O.C(CCCO)O.C(C(C)O)O.C(CO)O Chemical compound COCCOCCO.C(CCC)OCCOCCO.C(COCCO)O.C(CC(C)O)O.C(CCCCCCCCCO)O.C(CCCCCO)O.C(CCCO)O.C(C(C)O)O.C(CO)O PXPAZRIUJBLQHP-UHFFFAOYSA-N 0.000 claims 1
- XQVWYOYUZDUNRW-UHFFFAOYSA-N N-Phenyl-1-naphthylamine Chemical compound C=1C=CC2=CC=CC=C2C=1NC1=CC=CC=C1 XQVWYOYUZDUNRW-UHFFFAOYSA-N 0.000 claims 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical class CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims 1
- IBEFSUTVZWZJEL-UHFFFAOYSA-N trimethylindium Chemical compound C[In](C)C IBEFSUTVZWZJEL-UHFFFAOYSA-N 0.000 claims 1
- 238000009826 distribution Methods 0.000 abstract description 16
- 239000011368 organic material Substances 0.000 abstract description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 26
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003599 detergent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminum fluoride Inorganic materials F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000005234 alkyl aluminium group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000007046 ethoxylation reaction Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BKIMMITUMNQMOS-UHFFFAOYSA-N nonane Chemical compound CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- YGKOYVNJPRSSRX-UHFFFAOYSA-M (4-dodecylphenyl)methyl-trimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCCCC1=CC=C(C[N+](C)(C)C)C=C1 YGKOYVNJPRSSRX-UHFFFAOYSA-M 0.000 description 1
- 229940058015 1,3-butylene glycol Drugs 0.000 description 1
- ZGDHFIZSGGNKDC-UHFFFAOYSA-N 1-butoxybutane 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO.C(CCC)OCCCC ZGDHFIZSGGNKDC-UHFFFAOYSA-N 0.000 description 1
- IRPGOXJVTQTAAN-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanal Chemical compound FC(F)(F)C(F)(F)C=O IRPGOXJVTQTAAN-UHFFFAOYSA-N 0.000 description 1
- LXOFYPKXCSULTL-UHFFFAOYSA-N 2,4,7,9-tetramethyldec-5-yne-4,7-diol Chemical compound CC(C)CC(C)(O)C#CC(C)(O)CC(C)C LXOFYPKXCSULTL-UHFFFAOYSA-N 0.000 description 1
- GRURITPDZPDSJS-UHFFFAOYSA-N 2,4-dimethylphenol;2,5-dimethylphenol Chemical compound CC1=CC=C(O)C(C)=C1.CC1=CC=C(C)C(O)=C1 GRURITPDZPDSJS-UHFFFAOYSA-N 0.000 description 1
- AFUKNJHPZAVHGQ-UHFFFAOYSA-N 2,5-dimethoxy-Benzaldehyde Chemical compound COC1=CC=C(OC)C(C=O)=C1 AFUKNJHPZAVHGQ-UHFFFAOYSA-N 0.000 description 1
- SBAZXXVUILTVKK-UHFFFAOYSA-N 2-Ethyl-1-dodecanol Chemical compound CCCCCCCCCCC(CC)CO SBAZXXVUILTVKK-UHFFFAOYSA-N 0.000 description 1
- TXBCBTDQIULDIA-UHFFFAOYSA-N 2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)CO TXBCBTDQIULDIA-UHFFFAOYSA-N 0.000 description 1
- PTJWCLYPVFJWMP-UHFFFAOYSA-N 2-[[3-hydroxy-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)COCC(CO)(CO)CO PTJWCLYPVFJWMP-UHFFFAOYSA-N 0.000 description 1
- FAOVRYZLXQUFRR-UHFFFAOYSA-N 2-butyldecan-1-ol Chemical compound CCCCCCCCC(CO)CCCC FAOVRYZLXQUFRR-UHFFFAOYSA-N 0.000 description 1
- YLQGFOSNRNDJDV-UHFFFAOYSA-N 2-methyltridecan-1-ol Chemical compound CCCCCCCCCCCC(C)CO YLQGFOSNRNDJDV-UHFFFAOYSA-N 0.000 description 1
- WQUNVSNKFICLRQ-UHFFFAOYSA-N 2-methylundecan-2-ol Chemical compound CCCCCCCCCC(C)(C)O WQUNVSNKFICLRQ-UHFFFAOYSA-N 0.000 description 1
- DHMRGSATSWRQFT-UHFFFAOYSA-N 2-pentylnonan-1-ol Chemical compound CCCCCCCC(CO)CCCCC DHMRGSATSWRQFT-UHFFFAOYSA-N 0.000 description 1
- IKGAYTGZQLWJLI-UHFFFAOYSA-N 2-propylundecan-1-ol Chemical compound CCCCCCCCCC(CO)CCC IKGAYTGZQLWJLI-UHFFFAOYSA-N 0.000 description 1
- HSZCMYAAKQLDBV-UHFFFAOYSA-N 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoic acid [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound CC(CO)(CO)C(O)=O.OCC1CCC(CO)CC1 HSZCMYAAKQLDBV-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NOIWNFOEPXELHZ-UHFFFAOYSA-N C(C=1C(O)=CC=CC1)=O.C(=O)(O)C1=CC=C(C=O)C=C1.C(=O)(O)C1=C(C=O)C=CC=C1 Chemical compound C(C=1C(O)=CC=CC1)=O.C(=O)(O)C1=CC=C(C=O)C=C1.C(=O)(O)C1=C(C=O)C=CC=C1 NOIWNFOEPXELHZ-UHFFFAOYSA-N 0.000 description 1
- SBJBSGBWUDCLEU-UHFFFAOYSA-N CC(CC(C)=O)=O.C(C)(=O)C1=CC=CC=C1 Chemical compound CC(CC(C)=O)=O.C(C)(=O)C1=CC=CC=C1 SBJBSGBWUDCLEU-UHFFFAOYSA-N 0.000 description 1
- WTEFWSXMMWTOGH-UHFFFAOYSA-N CCCCCCCCCCCCCCCCCCN.CCCCCCCCCCCCN.CCCCCCCCCCN Chemical compound CCCCCCCCCCCCCCCCCCN.CCCCCCCCCCCCN.CCCCCCCCCCN WTEFWSXMMWTOGH-UHFFFAOYSA-N 0.000 description 1
- FMIBEAUIDFPGBM-UHFFFAOYSA-N CC[Ti](C)(C)CC Chemical compound CC[Ti](C)(C)CC FMIBEAUIDFPGBM-UHFFFAOYSA-N 0.000 description 1
- CUSNEPHYICFXDL-UHFFFAOYSA-N CN(C1=CC=CC=C1)C.CN(CCO)C Chemical compound CN(C1=CC=CC=C1)C.CN(CCO)C CUSNEPHYICFXDL-UHFFFAOYSA-N 0.000 description 1
- MSDSSYPVFCFCQV-UHFFFAOYSA-N ClC1=C(C(=O)O)C=CC=C1.ClCC(=O)O Chemical compound ClC1=C(C(=O)O)C=CC=C1.ClCC(=O)O MSDSSYPVFCFCQV-UHFFFAOYSA-N 0.000 description 1
- 241000518994 Conta Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- IBLDWBNTGGTKQC-UHFFFAOYSA-N NCC(=O)O.C(C=C)(=O)O.C(CC(O)(C(=O)O)CC(=O)O)(=O)O.C(C=CC(=O)O)(=O)O Chemical compound NCC(=O)O.C(C=C)(=O)O.C(CC(O)(C(=O)O)CC(=O)O)(=O)O.C(C=CC(=O)O)(=O)O IBLDWBNTGGTKQC-UHFFFAOYSA-N 0.000 description 1
- HOWQNEGMGJPWSN-UHFFFAOYSA-N OCC(C)(CO)C.C(O)C(C)(CO)CO.C(O)C(CC)(CO)CO Chemical compound OCC(C)(CO)C.C(O)C(C)(CO)CO.C(O)C(CC)(CO)CO HOWQNEGMGJPWSN-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical class CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- ITHZDDVSAWDQPZ-UHFFFAOYSA-L barium acetate Chemical class [Ba+2].CC([O-])=O.CC([O-])=O ITHZDDVSAWDQPZ-UHFFFAOYSA-L 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 235000019437 butane-1,3-diol Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- HSNQNPCNYIJJHT-ZCXUNETKSA-N cis-octadec-9-ene Chemical compound CCCCCCCC\C=C/CCCCCCCC HSNQNPCNYIJJHT-ZCXUNETKSA-N 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 239000011538 cleaning material Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- MPVXINJRXRIDDB-VCDGYCQFSA-N dodecanoic acid;(2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCCCCCC(O)=O MPVXINJRXRIDDB-VCDGYCQFSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000005108 dry cleaning Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- FIDOKWKZNVJFDX-UHFFFAOYSA-N ethene;2-(2-hydroxyethoxy)ethanol Chemical group C=C.C=C.OCCOCCO FIDOKWKZNVJFDX-UHFFFAOYSA-N 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002314 glycerols Chemical class 0.000 description 1
- ZOSANKFEJAIWND-UHFFFAOYSA-N hexanedioic acid;nonanedioic acid Chemical compound OC(=O)CCCCC(O)=O.OC(=O)CCCCCCCC(O)=O ZOSANKFEJAIWND-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 238000005555 metalworking Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 235000019645 odor Nutrition 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229920005547 polycyclic aromatic hydrocarbon Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 150000003752 zinc compounds Chemical class 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/02—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring
- C08G65/26—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds
- C08G65/2642—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds characterised by the catalyst used
- C08G65/269—Mixed catalyst systems, i.e. containing more than one reactive component or catalysts formed in-situ
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J27/00—Catalysts comprising the elements or compounds of halogens, sulfur, selenium, tellurium, phosphorus or nitrogen; Catalysts comprising carbon compounds
- B01J27/06—Halogens; Compounds thereof
- B01J27/08—Halides
- B01J27/12—Fluorides
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/02—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides
- B01J31/12—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides containing organo-metallic compounds or metal hydrides
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J31/00—Catalysts comprising hydrides, coordination complexes or organic compounds
- B01J31/02—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides
- B01J31/12—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides containing organo-metallic compounds or metal hydrides
- B01J31/14—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides containing organo-metallic compounds or metal hydrides of aluminium or boron
- B01J31/143—Catalysts comprising hydrides, coordination complexes or organic compounds containing organic compounds or metal hydrides containing organo-metallic compounds or metal hydrides of aluminium or boron of aluminium
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/02—Preparation of ethers from oxiranes
- C07C41/03—Preparation of ethers from oxiranes by reaction of oxirane rings with hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/347—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups
- C07C51/367—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups by introduction of functional groups containing oxygen only in singly bound form
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/02—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring
- C08G65/04—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers only
- C08G65/06—Cyclic ethers having no atoms other than carbon and hydrogen outside the ring
- C08G65/08—Saturated oxiranes
- C08G65/10—Saturated oxiranes characterised by the catalysts used
- C08G65/12—Saturated oxiranes characterised by the catalysts used containing organo-metallic compounds or metal hydrides
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/02—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring
- C08G65/26—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds
- C08G65/2642—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds characterised by the catalyst used
- C08G65/2645—Metals or compounds thereof, e.g. salts
- C08G65/2654—Aluminium or boron; Compounds thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Medicinal Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Materials Engineering (AREA)
- Polymers & Plastics (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/414,216 US4483941A (en) | 1982-09-02 | 1982-09-02 | Catalysts for alkoxylation reactions |
| US414,216 | 1982-09-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1196325A true CA1196325A (en) | 1985-11-05 |
Family
ID=23640474
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000426264A Expired CA1196325A (en) | 1982-09-02 | 1983-04-20 | Catalysts for alkoxylation reactions |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4483941A (enEXAMPLES) |
| EP (1) | EP0105080B1 (enEXAMPLES) |
| JP (1) | JPS5949846A (enEXAMPLES) |
| CA (1) | CA1196325A (enEXAMPLES) |
| DE (2) | DE3372281D1 (enEXAMPLES) |
| NO (1) | NO159488C (enEXAMPLES) |
| PH (1) | PH20064A (enEXAMPLES) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1985000365A1 (en) * | 1983-07-05 | 1985-01-31 | Union Carbide Corporation | Alkoxylation using calcium catalysts and products therefrom |
| US4490561A (en) * | 1983-10-13 | 1984-12-25 | Conoco Inc. | Method for alkoxylating fluorinated alcohols |
| US4665236A (en) * | 1984-10-29 | 1987-05-12 | Shell Oil Company | Alkoxylation process using bimetallic oxo catalyst |
| US4722978A (en) * | 1985-08-30 | 1988-02-02 | The B. F. Goodrich Company | Allyl terminated macromolecular monomers of polyethers |
| US5118650A (en) * | 1988-09-30 | 1992-06-02 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation using modified group iiib metal-containing bimetallic or polymetallic catalysts |
| US5114900A (en) * | 1988-09-30 | 1992-05-19 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation using modified calcium-containing bimetallic or polymetallic catalysts |
| US5120697A (en) * | 1988-09-30 | 1992-06-09 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation using modified calcium-containing catalysts |
| US5210325A (en) * | 1990-04-23 | 1993-05-11 | Shell Oil Company | Alkoxylation process catalyzed by supported rare earth elements |
| US5208199A (en) * | 1990-04-23 | 1993-05-04 | Shell Oil Company | Catalyst of rare earth and phosphorus-containing xerogels for alkoxylation process |
| US5635585A (en) * | 1992-10-21 | 1997-06-03 | E. I. Du Pont De Nemours And Company | Polymerization of, and depolymerization to, cyclic ethers using selected metal compound catalysts |
| US5478920A (en) * | 1993-07-16 | 1995-12-26 | E. I. Du Pont De Nemours And Company | Cyclic ether polymerization using silicon compound accelerators |
| US5608116A (en) * | 1994-06-21 | 1997-03-04 | E. I. Du Pont De Nemours And Company | Process for the alkoxylation of fluorinated alcohols |
| US5698631A (en) * | 1996-05-30 | 1997-12-16 | Uniroyal Chemical Company, Inc. | Epoxy resin compositions for encapsulating signal transmission devices |
| US6235300B1 (en) | 1999-01-19 | 2001-05-22 | Amway Corporation | Plant protecting adjuvant containing topped or peaked alcohol alkoxylates and conventional alcohol alkoxylates |
| US6593500B2 (en) | 2001-01-19 | 2003-07-15 | Rhodia, Inc. | Process for alkoxylation with a boron-containing catalyst |
| AU2005286666B2 (en) | 2004-09-23 | 2011-05-19 | Akzo Nobel N.V. | Alkoxylated alkylamines / alkyl ether amines with peaked distribution |
| JP4541827B2 (ja) * | 2004-10-18 | 2010-09-08 | 第一工業製薬株式会社 | アルキレンオキサイド付加物の製造方法 |
| US20070060770A1 (en) * | 2005-09-01 | 2007-03-15 | Matheson Kenneth L | Process for preparing alkoxylation catalyst and alkoxylation process |
| SG170758A1 (en) * | 2006-03-23 | 2011-05-30 | Akzo Nobel Nv | Alkoxylated alkylamines or alkyl ether amines with peaked distribution |
| US8946486B2 (en) | 2007-12-03 | 2015-02-03 | Tyco Fire & Security Gmbh | Method of forming alkoxylated fluoroalcohols |
| KR20110133586A (ko) * | 2009-03-04 | 2011-12-13 | 다우 글로벌 테크놀로지스 엘엘씨 | 트리메틸올프로판 옥타데카에톡실레이트를 기본으로 하는 글리시딜에테르를 함유하는 열경화성 조성물 |
| SA111320501B1 (ar) | 2010-06-04 | 2014-08-11 | Dow Global Technologies Llc | إذابة مواد خافضة للتوتر السطحي في ثاني أكسيد كربون فوق حرج لاستعادة زيت محسن |
| SA111320500B1 (ar) | 2010-06-04 | 2015-06-17 | داو جلوبال تكنولوجيز ال ال سي | معلقات لاستعادة محسنة للزيت |
| US10604614B2 (en) | 2017-09-22 | 2020-03-31 | Hexion Inc. | Compositions and methods to produce alkoxylated triazine-arylhydroxy-aldehyde condensates |
| US10435503B2 (en) | 2017-09-22 | 2019-10-08 | Hexion Inc. | Compositions for polyurethane applications |
| US10640475B2 (en) | 2017-09-22 | 2020-05-05 | Hexion Inc. | Compositions and methods to produce alkoxylated triazine-arlhydroxy-aldehyde condensates |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3244646A (en) * | 1962-01-04 | 1966-04-05 | Socony Mobil Oil Co Inc | Polymerization of epoxides using as catalyst a metal alkoxide-phosphorous acid reaction product |
| GB1056730A (en) * | 1964-08-25 | 1967-01-25 | Nippon Oil Co Ltd | Process for polymerizing isobutylene and catalyst composition therefor |
| US3597502A (en) * | 1968-09-11 | 1971-08-03 | Dow Chemical Co | Bf3 complexes with phosphonates |
| US3719636A (en) * | 1970-04-09 | 1973-03-06 | Olin Corp | Method for the preparation of biodegradable glycidol surfactants |
| JPS4915053B1 (enEXAMPLES) * | 1970-12-29 | 1974-04-12 | ||
| US3860622A (en) * | 1973-06-04 | 1975-01-14 | Ventron Corp | Organotitanate-borate complexes |
| CA1187107A (en) * | 1978-05-17 | 1985-05-14 | Loren L. Barber, Jr. | Colorless hydroxyl-terminated poly (chloroalkylene ethers) |
-
1982
- 1982-09-02 US US06/414,216 patent/US4483941A/en not_active Expired - Fee Related
-
1983
- 1983-04-20 CA CA000426264A patent/CA1196325A/en not_active Expired
- 1983-04-27 NO NO831498A patent/NO159488C/no unknown
- 1983-05-02 DE DE8383104324T patent/DE3372281D1/de not_active Expired
- 1983-05-02 DE DE198383104324T patent/DE105080T1/de active Pending
- 1983-05-02 EP EP83104324A patent/EP0105080B1/en not_active Expired
- 1983-05-13 JP JP58083973A patent/JPS5949846A/ja active Granted
- 1983-08-31 PH PH29478A patent/PH20064A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0105080B1 (en) | 1987-07-01 |
| JPH0353974B2 (enEXAMPLES) | 1991-08-16 |
| NO159488B (no) | 1988-09-26 |
| NO159488C (no) | 1989-01-04 |
| PH20064A (en) | 1986-09-18 |
| JPS5949846A (ja) | 1984-03-22 |
| EP0105080A3 (en) | 1984-06-20 |
| US4483941A (en) | 1984-11-20 |
| NO831498L (no) | 1984-03-03 |
| DE105080T1 (de) | 1984-12-06 |
| DE3372281D1 (en) | 1987-08-06 |
| EP0105080A2 (en) | 1984-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1196325A (en) | Catalysts for alkoxylation reactions | |
| EP0104309B1 (en) | Catalysts for alkoxylation reactions | |
| US4568774A (en) | Catalysts for alkoxylation reactions | |
| EP0095562B1 (en) | Catalysts for alkoxylation reactions | |
| EP0133715B1 (en) | Alkoxylation using calcium catalysts and products therefrom | |
| US2847477A (en) | Certificate of correction | |
| EP0092256B1 (en) | Process for preparing nonionic surfactants by an oxyalkylation with calcium and/or strontium catalysts | |
| US4223164A (en) | Ethoxylation with strontium bases | |
| EP0026544B1 (en) | Process for preparing basic salts of barium | |
| JPS5933022B2 (ja) | 反応性水素化合物のオキシアルキル化用触媒の製造方法 | |
| US4540828A (en) | Catalysts for alkoxylation reactions | |
| EP0046947A1 (en) | Strontium and barium containing alkoxylation systems | |
| EP1358142B1 (en) | Process for alkoxylation with a boron-containing catalyst | |
| JP4399110B2 (ja) | オキシアルキル化アミン又はアルコールの製法 | |
| US4593142A (en) | Methods of alkoxylation | |
| EP0034648A2 (en) | A method for the alkoxylation of alkanols in the presence of strontium-containing catalysts and promoters | |
| US4376868A (en) | Alkoxylation of cresylic acids | |
| EP0034650A1 (en) | A method for alkoxylation of alkanols | |
| EP0049358A1 (en) | Strontium and barium containing alkoxylation systems for unsaturated alcohols | |
| EP0033760A1 (en) | A method for the alkoxylation of alkanols | |
| JPH02135144A (ja) | アルコキシル化触媒 | |
| MXPA00003761A (es) | Metodo de etoxilacion usando descarga de fase de vapor de oxido de etileno | |
| JPH03229644A (ja) | 改質した3b族金属含有バイメタル又はポリメタル触媒を使用するアルコキシル化方法 | |
| GB996689A (en) | Manufacture of linear polyesters | |
| JPS61293508A (ja) | 消泡剤組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |