CA1163218A - Liquid enzymatic detergent composition - Google Patents
Liquid enzymatic detergent compositionInfo
- Publication number
- CA1163218A CA1163218A CA000380898A CA380898A CA1163218A CA 1163218 A CA1163218 A CA 1163218A CA 000380898 A CA000380898 A CA 000380898A CA 380898 A CA380898 A CA 380898A CA 1163218 A CA1163218 A CA 1163218A
- Authority
- CA
- Canada
- Prior art keywords
- cross
- weight
- polyol
- composition
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 59
- 239000003599 detergent Substances 0.000 title claims abstract description 33
- 239000007788 liquid Substances 0.000 title claims abstract description 29
- 230000002255 enzymatic effect Effects 0.000 title claims abstract description 17
- 229920005862 polyol Polymers 0.000 claims abstract description 18
- 150000003077 polyols Chemical class 0.000 claims abstract description 18
- 229920006037 cross link polymer Polymers 0.000 claims abstract description 10
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000004327 boric acid Substances 0.000 claims abstract description 8
- 102000004190 Enzymes Human genes 0.000 claims description 24
- 108090000790 Enzymes Proteins 0.000 claims description 24
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 24
- 229920000642 polymer Polymers 0.000 claims description 11
- 229910021538 borax Inorganic materials 0.000 claims description 9
- 239000004328 sodium tetraborate Substances 0.000 claims description 9
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 claims description 4
- 229930006000 Sucrose Natural products 0.000 claims description 4
- 239000005720 sucrose Substances 0.000 claims description 4
- 239000012736 aqueous medium Substances 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- 229920000058 polyacrylate Polymers 0.000 claims 2
- 239000011149 active material Substances 0.000 claims 1
- 229940088598 enzyme Drugs 0.000 description 23
- 239000000463 material Substances 0.000 description 10
- 108010056079 Subtilisins Proteins 0.000 description 8
- 102000005158 Subtilisins Human genes 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- -1 alkali metal borates Chemical class 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- JVTIXNMXDLQEJE-UHFFFAOYSA-N 2-decanoyloxypropyl decanoate 2-octanoyloxypropyl octanoate Chemical compound C(CCCCCCC)(=O)OCC(C)OC(CCCCCCC)=O.C(=O)(CCCCCCCCC)OCC(C)OC(=O)CCCCCCCCC JVTIXNMXDLQEJE-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 125000000129 anionic group Chemical group 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 235000019832 sodium triphosphate Nutrition 0.000 description 5
- 108091005804 Peptidases Proteins 0.000 description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 4
- 239000004365 Protease Substances 0.000 description 4
- 230000001580 bacterial effect Effects 0.000 description 4
- 229940117927 ethylene oxide Drugs 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 239000000271 synthetic detergent Substances 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 102000035195 Peptidases Human genes 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 230000002538 fungal effect Effects 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 108010003855 mesentericopeptidase Proteins 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000010457 zeolite Substances 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- 241000194108 Bacillus licheniformis Species 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical group NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 229940025131 amylases Drugs 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 230000002797 proteolythic effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 229920003169 water-soluble polymer Polymers 0.000 description 2
- SSYDTHANSGMJTP-ZXZARUISSA-N (3s,4r)-oxolane-3,4-diol Chemical compound O[C@H]1COC[C@H]1O SSYDTHANSGMJTP-ZXZARUISSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 229910011255 B2O3 Inorganic materials 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 108010059892 Cellulase Proteins 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- BCKXLBQYZLBQEK-KVVVOXFISA-M Sodium oleate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC([O-])=O BCKXLBQYZLBQEK-KVVVOXFISA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 230000003625 amylolytic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229940106157 cellulase Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 230000001461 cytolytic effect Effects 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229940093476 ethylene glycol Drugs 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 229960002163 hydrogen peroxide Drugs 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N monopropylene glycol Natural products CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000005494 tarnishing Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT68042A/80 | 1980-07-02 | ||
| IT68042/80A IT1129814B (it) | 1980-07-02 | 1980-07-02 | Composizione detergente enzimatica liquida |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1163218A true CA1163218A (en) | 1984-03-06 |
Family
ID=11307403
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000380898A Expired CA1163218A (en) | 1980-07-02 | 1981-06-30 | Liquid enzymatic detergent composition |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS604874B2 (enExample) |
| AR (1) | AR223618A1 (enExample) |
| AU (1) | AU537950B2 (enExample) |
| BR (1) | BR8104171A (enExample) |
| CA (1) | CA1163218A (enExample) |
| DE (1) | DE3125533C2 (enExample) |
| FR (1) | FR2486095A1 (enExample) |
| GB (1) | GB2079305B (enExample) |
| IT (1) | IT1129814B (enExample) |
| MY (1) | MY8600451A (enExample) |
| NL (1) | NL8103169A (enExample) |
| NZ (1) | NZ197531A (enExample) |
| PH (1) | PH18505A (enExample) |
| ZA (1) | ZA814462B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3264685D1 (en) | 1981-11-13 | 1985-08-14 | Unilever Nv | Enzymatic liquid cleaning composition |
| US4462922A (en) * | 1981-11-19 | 1984-07-31 | Lever Brothers Company | Enzymatic liquid detergent composition |
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
| GB8311314D0 (en) * | 1983-04-26 | 1983-06-02 | Unilever Plc | Aqueous enzyme-containing compositions |
| NZ208156A (en) * | 1983-05-31 | 1986-11-12 | Colgate Palmolive Co | Built single-phase liquid detergent compositions containing stabilised enzymes |
| US4652394A (en) * | 1983-05-31 | 1987-03-24 | Colgate Palmolive Co. | Built single phase liquid anionic detergent compositions containing stabilized enzymes |
| NZ208157A (en) * | 1983-05-31 | 1986-11-12 | Colgate Palmolive Co | Built single-phase liquid detergent compositions containing stabilised enzymes |
| US4537706A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid to stabilize enzymes |
| US4537707A (en) * | 1984-05-14 | 1985-08-27 | The Procter & Gamble Company | Liquid detergents containing boric acid and formate to stabilize enzymes |
| US4842769A (en) * | 1985-07-26 | 1989-06-27 | Colgate-Palmolive Co. | Stabilized fabric softening built detergent composition containing enzymes |
| NZ216791A (en) * | 1985-07-26 | 1988-07-28 | Colgate Palmolive Co | Stabilised, built, enzyme-containing liquid detergents |
| SE468518B (sv) * | 1985-07-26 | 1993-02-01 | Colgate Palmolive Co | Stabiliserad textilmjukgoerande enzyminnehaallande foerstaerkt flytande detergentkomposition och dess anvaendning vid tvaett av textilier |
| US4900475A (en) * | 1985-07-26 | 1990-02-13 | Colgate-Palmolive Co. | Stabilized built liquid detergent composition containing enzyme |
| US5004557A (en) * | 1985-08-16 | 1991-04-02 | The B. F. Goodrich Company | Aqueous laundry detergent compositions containing acrylic acid polymers |
| US4670179A (en) * | 1986-05-29 | 1987-06-02 | Colgate Palmolive Company | Stabilized built single phase liquid detergent composition containing enzymes |
| US4842767A (en) * | 1986-09-10 | 1989-06-27 | Colgate-Palmolive Company | Heavy duty built aqueous liquid detergent composition containing stabilized enzymes |
| US4842758A (en) * | 1986-10-31 | 1989-06-27 | Colgate-Palmolive Company | Stabilized enzyme system for use in aqueous liquid built detergent compositions |
| GB8728610D0 (en) * | 1987-12-08 | 1988-01-13 | Donnell A O | Cleaning liquids |
| US4959179A (en) * | 1989-01-30 | 1990-09-25 | Lever Brothers Company | Stabilized enzymes liquid detergent composition containing lipase and protease |
| US5089163A (en) * | 1989-01-30 | 1992-02-18 | Lever Brothers Company, Division Of Conopco, Inc. | Enzymatic liquid detergent composition |
| DE3942617A1 (de) * | 1989-12-22 | 1991-06-27 | Henkel Kgaa | Stabilisatoren fuer waessrige fluessigwaschmittel |
| DE4034840A1 (de) * | 1990-11-02 | 1992-05-07 | Henkel Kgaa | Enzymatisches fluessigwaschmittel |
| JPH0775620B2 (ja) * | 1991-04-08 | 1995-08-16 | トーメー産業株式会社 | 含水性コンタクトレンズ用液剤組成物及び含水性コンタクトレンズの洗浄方法 |
| AU2014892A (en) * | 1991-04-30 | 1992-12-21 | Procter & Gamble Company, The | Liquid detergents with an aryl boronic acid |
| WO1993011215A1 (en) * | 1991-12-04 | 1993-06-10 | The Procter & Gamble Company | Liquid laundry detergents with citric acid, cellulase, and boric-diol complex to inhibit proteolytic enzyme |
| JPH06122896A (ja) * | 1992-03-31 | 1994-05-06 | Shiseido Co Ltd | 洗浄剤組成物 |
| US5442100A (en) * | 1992-08-14 | 1995-08-15 | The Procter & Gamble Company | β-aminoalkyl and β-N-peptidylaminoalkyl boronic acids |
| WO1994024240A1 (en) * | 1993-04-08 | 1994-10-27 | The Procter & Gamble Company | Secondary (2,3) alkyl sulfate surfactants in stable enzyme-containing detergent compositions |
| ZA943640B (en) * | 1993-06-07 | 1995-01-26 | Buckman Labor Inc | Synergistically stabilized liquid enzymatic compositions |
| LT3962B (en) | 1993-12-21 | 1996-05-27 | Albright & Wilson | Funcional fluids |
| US5604190A (en) * | 1995-06-07 | 1997-02-18 | Alcon Laboratories, Inc. | Stable liquid enzyme compositions and methods of use in contact lens cleaning and disinfecting systems |
| US5723421A (en) * | 1995-06-07 | 1998-03-03 | Alcon Laboratories, Inc. | Stable liquid enzyme compositions and methods of use in contact lens cleaning and disinfecting systems |
| DE60034592T2 (de) * | 1999-10-21 | 2007-12-27 | Daiso Co., Ltd. | Vernetzungsmittel auf basis einer polyallyletherverbindung |
| WO2015200208A1 (en) * | 2014-06-24 | 2015-12-30 | 3M Innovative Properties Company | Low foaming multi enzymatic cleaner |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3781212A (en) * | 1972-10-27 | 1973-12-25 | Townsend & Townsend | Aerosol enzyme detergents stabilized with carbon dioxide |
| GB1590445A (en) * | 1976-11-01 | 1981-06-03 | Unilever Ltd | Enzymatic liquid composition |
-
1980
- 1980-07-02 IT IT68042/80A patent/IT1129814B/it active
-
1981
- 1981-06-25 NZ NZ197531A patent/NZ197531A/xx unknown
- 1981-06-25 PH PH25817A patent/PH18505A/en unknown
- 1981-06-29 DE DE3125533A patent/DE3125533C2/de not_active Expired
- 1981-06-30 CA CA000380898A patent/CA1163218A/en not_active Expired
- 1981-06-30 AU AU72379/81A patent/AU537950B2/en not_active Expired
- 1981-06-30 BR BR8104171A patent/BR8104171A/pt not_active IP Right Cessation
- 1981-06-30 AR AR285926A patent/AR223618A1/es active
- 1981-06-30 GB GB8120184A patent/GB2079305B/en not_active Expired
- 1981-07-01 ZA ZA814462A patent/ZA814462B/xx unknown
- 1981-07-01 JP JP56103097A patent/JPS604874B2/ja not_active Expired
- 1981-07-01 FR FR8112984A patent/FR2486095A1/fr active Granted
- 1981-07-01 NL NL8103169A patent/NL8103169A/nl not_active Application Discontinuation
-
1986
- 1986-12-30 MY MY451/86A patent/MY8600451A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS604874B2 (ja) | 1985-02-07 |
| NZ197531A (en) | 1983-12-16 |
| BR8104171A (pt) | 1982-03-16 |
| AU537950B2 (en) | 1984-07-19 |
| IT1129814B (it) | 1986-06-11 |
| FR2486095A1 (fr) | 1982-01-08 |
| MY8600451A (en) | 1986-12-31 |
| DE3125533A1 (de) | 1982-06-09 |
| AR223618A1 (es) | 1981-08-31 |
| IT8068042A0 (it) | 1980-07-02 |
| GB2079305A (en) | 1982-01-20 |
| JPS5740599A (en) | 1982-03-06 |
| NL8103169A (nl) | 1982-02-01 |
| PH18505A (en) | 1985-08-02 |
| ZA814462B (en) | 1983-02-23 |
| AU7237981A (en) | 1982-01-07 |
| GB2079305B (en) | 1984-02-08 |
| FR2486095B1 (enExample) | 1983-11-04 |
| DE3125533C2 (de) | 1985-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1163218A (en) | Liquid enzymatic detergent composition | |
| US4462922A (en) | Enzymatic liquid detergent composition | |
| EP0080748B1 (en) | Enzymatic liquid cleaning composition | |
| US4532064A (en) | Aqueous enzyme-containing compositions with improved stability | |
| US4261868A (en) | Stabilized enzymatic liquid detergent composition containing a polyalkanolamine and a boron compound | |
| CA1092036A (en) | Enzymatic liquid detergent compositions | |
| US5551990A (en) | Enzymatic dishwashing and rinsing composition | |
| CA1335969C (en) | Enzymatic dishwashing composition containing lipolytic enzyme and bleaching agent | |
| CA1092037A (en) | Enzymatic liquid detergent composition | |
| US5501820A (en) | Aqueous enzymatic detergent compositions | |
| AU772325B2 (en) | Laundry detergent composition containing high level of protease enzyme |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |