CA1141769A - Diglycidyl ethers of di-secondary alcohols, their preparation, and curable compositions containing them - Google Patents
Diglycidyl ethers of di-secondary alcohols, their preparation, and curable compositions containing themInfo
- Publication number
- CA1141769A CA1141769A CA000353939A CA353939A CA1141769A CA 1141769 A CA1141769 A CA 1141769A CA 000353939 A CA000353939 A CA 000353939A CA 353939 A CA353939 A CA 353939A CA 1141769 A CA1141769 A CA 1141769A
- Authority
- CA
- Canada
- Prior art keywords
- bis
- phenyl
- groups
- group
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title abstract description 36
- 238000002360 preparation method Methods 0.000 title abstract description 4
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 title description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 37
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 36
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 17
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims abstract description 16
- 239000000460 chlorine Substances 0.000 claims abstract description 12
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 12
- 125000001246 bromo group Chemical group Br* 0.000 claims abstract description 9
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 7
- 125000001326 naphthylalkyl group Chemical group 0.000 claims abstract description 7
- 125000004957 naphthylene group Chemical group 0.000 claims abstract description 7
- 125000003884 phenylalkyl group Chemical group 0.000 claims abstract description 7
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims abstract description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 5
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims abstract 4
- 125000003375 sulfoxide group Chemical group 0.000 claims abstract 4
- 125000004434 sulfur atom Chemical group 0.000 claims abstract 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 70
- 239000001294 propane Substances 0.000 claims description 39
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 27
- 150000001875 compounds Chemical class 0.000 claims description 15
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- MCKQXNPRSOIXQL-UHFFFAOYSA-N 2-[[1-[3-[2-(oxiran-2-ylmethoxy)-3-phenoxypropoxy]phenoxy]-3-phenoxypropan-2-yl]oxymethyl]oxirane Chemical compound C=1C=CC(OCC(COC=2C=CC=CC=2)OCC2OC2)=CC=1OCC(OCC1OC1)COC1=CC=CC=C1 MCKQXNPRSOIXQL-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- IFPLSXZTBSXJQZ-UHFFFAOYSA-N 2-[[1-[4-[2-[4-[2-(oxiran-2-ylmethoxy)-3-phenylmethoxypropoxy]phenyl]propan-2-yl]phenoxy]-3-phenylmethoxypropan-2-yl]oxymethyl]oxirane Chemical compound C=1C=C(OCC(COCC=2C=CC=CC=2)OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC(OCC1OC1)COCC1=CC=CC=C1 IFPLSXZTBSXJQZ-UHFFFAOYSA-N 0.000 claims description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 3
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims description 2
- BHOCCFATQZYDHC-UHFFFAOYSA-N 2-[[1-butoxy-3-[2,6-dibromo-4-[2-[3,5-dibromo-4-[3-butoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane Chemical compound C1OC1COC(COCCCC)COC(C(=C1)Br)=C(Br)C=C1C(C)(C)C(C=C1Br)=CC(Br)=C1OCC(COCCCC)OCC1CO1 BHOCCFATQZYDHC-UHFFFAOYSA-N 0.000 claims description 2
- GCJKKUPRDZJPRO-UHFFFAOYSA-N 2-[[1-butoxy-3-[4-[4-[3-butoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]sulfonylphenoxy]propan-2-yl]oxymethyl]oxirane Chemical compound C1OC1COC(COCCCC)COC(C=C1)=CC=C1S(=O)(=O)C(C=C1)=CC=C1OCC(COCCCC)OCC1CO1 GCJKKUPRDZJPRO-UHFFFAOYSA-N 0.000 claims description 2
- JJHCXRKJSBDYNQ-UHFFFAOYSA-N 2-[[1-methoxy-3-[4-[2-[4-[3-methoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane Chemical compound C1OC1COC(COC)COC(C=C1)=CC=C1C(C)(C)C(C=C1)=CC=C1OCC(COC)OCC1CO1 JJHCXRKJSBDYNQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 3
- 229910052794 bromium Inorganic materials 0.000 claims 3
- 125000005843 halogen group Chemical group 0.000 claims 3
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 claims 1
- PHYJWOUKDVFRAL-UHFFFAOYSA-N 2-[[1-[4-[2-[4-[2-(oxiran-2-ylmethoxy)-3-phenoxypropoxy]phenyl]propan-2-yl]phenoxy]-3-phenoxypropan-2-yl]oxymethyl]oxirane Chemical compound C=1C=C(OCC(COC=2C=CC=CC=2)OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC(OCC1OC1)COC1=CC=CC=C1 PHYJWOUKDVFRAL-UHFFFAOYSA-N 0.000 claims 1
- DTRFNPOIISUREJ-UHFFFAOYSA-N 2-[[1-[4-[2-[4-[2-(oxiran-2-ylmethoxy)-3-tetradecoxypropoxy]phenyl]propan-2-yl]phenoxy]-3-tetradecoxypropan-2-yl]oxymethyl]oxirane Chemical compound C1OC1COC(COCCCCCCCCCCCCCC)COC(C=C1)=CC=C1C(C)(C)C(C=C1)=CC=C1OCC(COCCCCCCCCCCCCCC)OCC1CO1 DTRFNPOIISUREJ-UHFFFAOYSA-N 0.000 claims 1
- QFOCDEKERPXYGS-UHFFFAOYSA-N 2-[[1-butoxy-3-[4-[[4-[3-butoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]methyl]phenoxy]propan-2-yl]oxymethyl]oxirane Chemical compound C1OC1COC(COCCCC)COC(C=C1)=CC=C1CC(C=C1)=CC=C1OCC(COCCCC)OCC1CO1 QFOCDEKERPXYGS-UHFFFAOYSA-N 0.000 claims 1
- DPANLPCMGUPBLX-UHFFFAOYSA-N 2-[[1-cyclohexyloxy-3-[4-[2-[4-[3-cyclohexyloxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane Chemical compound C=1C=C(OCC(COC2CCCCC2)OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC(OCC1OC1)COC1CCCCC1 DPANLPCMGUPBLX-UHFFFAOYSA-N 0.000 claims 1
- TXFDBTFCAAVPEM-UHFFFAOYSA-N 2-[[1-dodecoxy-3-[4-[2-[4-[3-dodecoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane Chemical compound C1OC1COC(COCCCCCCCCCCCC)COC(C=C1)=CC=C1C(C)(C)C(C=C1)=CC=C1OCC(COCCCCCCCCCCCC)OCC1CO1 TXFDBTFCAAVPEM-UHFFFAOYSA-N 0.000 claims 1
- DUDWKBZRVKEYMR-UHFFFAOYSA-N 2-[[1-ethoxy-3-[4-[2-[4-[3-ethoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane Chemical compound C1OC1COC(COCC)COC(C=C1)=CC=C1C(C)(C)C(C=C1)=CC=C1OCC(COCC)OCC1CO1 DUDWKBZRVKEYMR-UHFFFAOYSA-N 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- -1 p-(3-butoxy-2-glycidyloxypropyloxy)phenyl Chemical group 0.000 abstract description 36
- 239000011347 resin Substances 0.000 abstract description 18
- 229920005989 resin Polymers 0.000 abstract description 18
- 229920000647 polyepoxide Polymers 0.000 abstract description 16
- 238000005266 casting Methods 0.000 abstract description 11
- 150000002170 ethers Chemical class 0.000 abstract description 8
- OGJYOKDCDJTEGM-UHFFFAOYSA-N 2-[[1-butoxy-3-[4-[2-[4-[3-butoxy-2-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propan-2-yl]oxymethyl]oxirane Chemical compound C1OC1COC(COCCCC)COC(C=C1)=CC=C1C(C)(C)C(C=C1)=CC=C1OCC(COCCCC)OCC1CO1 OGJYOKDCDJTEGM-UHFFFAOYSA-N 0.000 abstract description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 2
- 229910052760 oxygen Inorganic materials 0.000 abstract description 2
- 239000001301 oxygen Substances 0.000 abstract description 2
- 150000003457 sulfones Chemical class 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- 150000002118 epoxides Chemical group 0.000 description 37
- 238000006243 chemical reaction Methods 0.000 description 34
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 28
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 22
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 18
- 239000003795 chemical substances by application Substances 0.000 description 14
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 14
- 238000000034 method Methods 0.000 description 14
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 8
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 7
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 229910015900 BF3 Inorganic materials 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- 239000003513 alkali Substances 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 description 5
- YSUQLAYJZDEMOT-UHFFFAOYSA-N 2-(butoxymethyl)oxirane Chemical compound CCCCOCC1CO1 YSUQLAYJZDEMOT-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 150000002009 diols Chemical class 0.000 description 5
- 230000009477 glass transition Effects 0.000 description 5
- 150000003512 tertiary amines Chemical class 0.000 description 5
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 4
- 238000007033 dehydrochlorination reaction Methods 0.000 description 4
- 239000003822 epoxy resin Substances 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000001174 sulfone group Chemical group 0.000 description 3
- MUTGBJKUEZFXGO-OLQVQODUSA-N (3as,7ar)-3a,4,5,6,7,7a-hexahydro-2-benzofuran-1,3-dione Chemical compound C1CCC[C@@H]2C(=O)OC(=O)[C@@H]21 MUTGBJKUEZFXGO-OLQVQODUSA-N 0.000 description 2
- HQUOZDDIEHXVSF-UHFFFAOYSA-N 1-[3-(2-hydroxy-3-phenoxypropoxy)phenoxy]-3-phenoxypropan-2-ol Chemical compound C=1C=CC(OCC(O)COC=2C=CC=CC=2)=CC=1OCC(O)COC1=CC=CC=C1 HQUOZDDIEHXVSF-UHFFFAOYSA-N 0.000 description 2
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 2
- AHDSRXYHVZECER-UHFFFAOYSA-N 2,4,6-tris[(dimethylamino)methyl]phenol Chemical compound CN(C)CC1=CC(CN(C)C)=C(O)C(CN(C)C)=C1 AHDSRXYHVZECER-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZCUJYXPAKHMBAZ-UHFFFAOYSA-N 2-phenyl-1h-imidazole Chemical compound C1=CNC(C=2C=CC=CC=2)=N1 ZCUJYXPAKHMBAZ-UHFFFAOYSA-N 0.000 description 2
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000010426 asphalt Substances 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000006735 epoxidation reaction Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000011968 lewis acid catalyst Substances 0.000 description 2
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 229920003986 novolac Polymers 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- KMOUUZVZFBCRAM-OLQVQODUSA-N (3as,7ar)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione Chemical compound C1C=CC[C@@H]2C(=O)OC(=O)[C@@H]21 KMOUUZVZFBCRAM-OLQVQODUSA-N 0.000 description 1
- OYHQOLUKZRVURQ-NTGFUMLPSA-N (9Z,12Z)-9,10,12,13-tetratritiooctadeca-9,12-dienoic acid Chemical compound C(CCCCCCC\C(=C(/C\C(=C(/CCCCC)\[3H])\[3H])\[3H])\[3H])(=O)O OYHQOLUKZRVURQ-NTGFUMLPSA-N 0.000 description 1
- OUPZKGBUJRBPGC-UHFFFAOYSA-N 1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione Chemical compound O=C1N(CC2OC2)C(=O)N(CC2OC2)C(=O)N1CC1CO1 OUPZKGBUJRBPGC-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- PWJPGBBBMWDUKX-UHFFFAOYSA-N 1-(2-hydroxy-3-phenoxypropoxy)-3-phenoxypropan-2-ol Chemical compound C=1C=CC=CC=1OCC(O)COCC(O)COC1=CC=CC=C1 PWJPGBBBMWDUKX-UHFFFAOYSA-N 0.000 description 1
- JWSPABHKHYFIMI-UHFFFAOYSA-N 1-[4-[2-[4-(2-hydroxy-3-phenylmethoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-phenylmethoxypropan-2-ol Chemical compound C=1C=C(OCC(O)COCC=2C=CC=CC=2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC(O)COCC1=CC=CC=C1 JWSPABHKHYFIMI-UHFFFAOYSA-N 0.000 description 1
- HCSYLCJOGXBJLH-UHFFFAOYSA-N 1-[4-[2-[4-(2-hydroxy-3-prop-2-enoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-prop-2-enoxypropan-2-ol Chemical compound C=1C=C(OCC(O)COCC=C)C=CC=1C(C)(C)C1=CC=C(OCC(O)COCC=C)C=C1 HCSYLCJOGXBJLH-UHFFFAOYSA-N 0.000 description 1
- BHCXYIHQXYBLRT-UHFFFAOYSA-N 1-butoxy-3-[2,6-dibromo-4-[2-[3,5-dibromo-4-(3-butoxy-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol Chemical compound C1=C(Br)C(OCC(O)COCCCC)=C(Br)C=C1C(C)(C)C1=CC(Br)=C(OCC(O)COCCCC)C(Br)=C1 BHCXYIHQXYBLRT-UHFFFAOYSA-N 0.000 description 1
- WUWDPQVODDJMQE-UHFFFAOYSA-N 1-butoxy-3-[4-[2-[4-(3-butoxy-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol Chemical compound C1=CC(OCC(O)COCCCC)=CC=C1C(C)(C)C1=CC=C(OCC(O)COCCCC)C=C1 WUWDPQVODDJMQE-UHFFFAOYSA-N 0.000 description 1
- ZDBXJYIDVCHJPA-UHFFFAOYSA-N 1-butoxy-3-[4-[4-(3-butoxy-2-hydroxypropoxy)phenyl]sulfonylphenoxy]propan-2-ol Chemical compound C1=CC(OCC(O)COCCCC)=CC=C1S(=O)(=O)C1=CC=C(OCC(O)COCCCC)C=C1 ZDBXJYIDVCHJPA-UHFFFAOYSA-N 0.000 description 1
- NQFUZLUXEWDQLG-UHFFFAOYSA-N 1-butoxy-3-[4-[[4-(3-butoxy-2-hydroxypropoxy)phenyl]methyl]phenoxy]propan-2-ol Chemical compound C1=CC(OCC(O)COCCCC)=CC=C1CC1=CC=C(OCC(O)COCCCC)C=C1 NQFUZLUXEWDQLG-UHFFFAOYSA-N 0.000 description 1
- FCQCWWOZZCDXDP-UHFFFAOYSA-N 1-dodecoxy-3-[4-[2-[4-(3-dodecoxy-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol Chemical compound C1=CC(OCC(O)COCCCCCCCCCCCC)=CC=C1C(C)(C)C1=CC=C(OCC(O)COCCCCCCCCCCCC)C=C1 FCQCWWOZZCDXDP-UHFFFAOYSA-N 0.000 description 1
- JFTWQOMLWRPTQL-UHFFFAOYSA-N 2,3,3-trimethylhexane-1,6-diamine Chemical compound NCC(C)C(C)(C)CCCN JFTWQOMLWRPTQL-UHFFFAOYSA-N 0.000 description 1
- WHQOKFZWSDOTQP-UHFFFAOYSA-N 2,3-dihydroxypropyl 4-aminobenzoate Chemical compound NC1=CC=C(C(=O)OCC(O)CO)C=C1 WHQOKFZWSDOTQP-UHFFFAOYSA-N 0.000 description 1
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 description 1
- AYHLPQOWRMPEKH-UHFFFAOYSA-N 2-(6-methylheptoxymethyl)oxirane Chemical compound CC(C)CCCCCOCC1CO1 AYHLPQOWRMPEKH-UHFFFAOYSA-N 0.000 description 1
- MMTOSBCMFDNOIY-UHFFFAOYSA-N 2-(chloromethyl)-3-methyloxirane Chemical compound CC1OC1CCl MMTOSBCMFDNOIY-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- VMSIYTPWZLSMOH-UHFFFAOYSA-N 2-(dodecoxymethyl)oxirane Chemical compound CCCCCCCCCCCCOCC1CO1 VMSIYTPWZLSMOH-UHFFFAOYSA-N 0.000 description 1
- VJRVYLRYHDIJAX-UHFFFAOYSA-N 2-(prop-1-en-2-yloxymethyl)oxirane Chemical group CC(=C)OCC1CO1 VJRVYLRYHDIJAX-UHFFFAOYSA-N 0.000 description 1
- NVKSMKFBUGBIGE-UHFFFAOYSA-N 2-(tetradecoxymethyl)oxirane Chemical compound CCCCCCCCCCCCCCOCC1CO1 NVKSMKFBUGBIGE-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical compound CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 1
- RNLHGQLZWXBQNY-UHFFFAOYSA-N 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine Chemical compound CC1(C)CC(N)CC(C)(CN)C1 RNLHGQLZWXBQNY-UHFFFAOYSA-N 0.000 description 1
- WPTUDAOQIXOMIQ-UHFFFAOYSA-N 3-(hydroxymethyl)pentane-2,4-diol Chemical compound CC(O)C(CO)C(C)O WPTUDAOQIXOMIQ-UHFFFAOYSA-N 0.000 description 1
- WVRNUXJQQFPNMN-VAWYXSNFSA-N 3-[(e)-dodec-1-enyl]oxolane-2,5-dione Chemical compound CCCCCCCCCC\C=C\C1CC(=O)OC1=O WVRNUXJQQFPNMN-VAWYXSNFSA-N 0.000 description 1
- ORTUYCUWCKNIND-UHFFFAOYSA-N 3-[2-(2-aminoethylamino)ethylamino]propanenitrile Chemical compound NCCNCCNCCC#N ORTUYCUWCKNIND-UHFFFAOYSA-N 0.000 description 1
- SSZWWUDQMAHNAQ-UHFFFAOYSA-N 3-chloropropane-1,2-diol Chemical compound OCC(O)CCl SSZWWUDQMAHNAQ-UHFFFAOYSA-N 0.000 description 1
- ZRYCRPNCXLQHPN-UHFFFAOYSA-N 3-hydroxy-2-methylbenzaldehyde Chemical compound CC1=C(O)C=CC=C1C=O ZRYCRPNCXLQHPN-UHFFFAOYSA-N 0.000 description 1
- FGQUIQAGZLBOGL-UHFFFAOYSA-N 3-non-1-enyloxolane-2,5-dione Chemical compound CCCCCCCC=CC1CC(=O)OC1=O FGQUIQAGZLBOGL-UHFFFAOYSA-N 0.000 description 1
- BDBZTOMUANOKRT-UHFFFAOYSA-N 4-[2-(4-aminocyclohexyl)propan-2-yl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1C(C)(C)C1CCC(N)CC1 BDBZTOMUANOKRT-UHFFFAOYSA-N 0.000 description 1
- CDBAMNGURPMUTG-UHFFFAOYSA-N 4-[2-(4-hydroxycyclohexyl)propan-2-yl]cyclohexan-1-ol Chemical compound C1CC(O)CCC1C(C)(C)C1CCC(O)CC1 CDBAMNGURPMUTG-UHFFFAOYSA-N 0.000 description 1
- YIROYDNZEPTFOL-UHFFFAOYSA-N 5,5-Dimethylhydantoin Chemical compound CC1(C)NC(=O)NC1=O YIROYDNZEPTFOL-UHFFFAOYSA-N 0.000 description 1
- SVLTVRFYVWMEQN-UHFFFAOYSA-N 5-methylcyclohex-3-ene-1,2-dicarboxylic acid Chemical compound CC1CC(C(O)=O)C(C(O)=O)C=C1 SVLTVRFYVWMEQN-UHFFFAOYSA-N 0.000 description 1
- RBHIUNHSNSQJNG-UHFFFAOYSA-N 6-methyl-3-(2-methyloxiran-2-yl)-7-oxabicyclo[4.1.0]heptane Chemical compound C1CC2(C)OC2CC1C1(C)CO1 RBHIUNHSNSQJNG-UHFFFAOYSA-N 0.000 description 1
- RREANTFLPGEWEN-MBLPBCRHSA-N 7-[4-[[(3z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-fluoro-2-oxoindol-1-yl]methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(=NC(\N=C/3C4=CC(F)=CC=C4N(CN4CCN(CC4)C=4C(=CC=5C(=O)C(C(O)=O)=CN(C=5C=4)C4CC4)F)C\3=O)=NC=2)N)=C1 RREANTFLPGEWEN-MBLPBCRHSA-N 0.000 description 1
- YXALYBMHAYZKAP-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]heptan-4-ylmethyl 7-oxabicyclo[4.1.0]heptane-4-carboxylate Chemical compound C1CC2OC2CC1C(=O)OCC1CC2OC2CC1 YXALYBMHAYZKAP-UHFFFAOYSA-N 0.000 description 1
- KNDQHSIWLOJIGP-UHFFFAOYSA-N 826-62-0 Chemical compound C1C2C3C(=O)OC(=O)C3C1C=C2 KNDQHSIWLOJIGP-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- LCFVJGUPQDGYKZ-UHFFFAOYSA-N Bisphenol A diglycidyl ether Chemical compound C=1C=C(OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC1CO1 LCFVJGUPQDGYKZ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- ALQSHHUCVQOPAS-UHFFFAOYSA-N Pentane-1,5-diol Chemical compound OCCCCCO ALQSHHUCVQOPAS-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical group CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 1
- 229920001079 Thiokol (polymer) Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 1
- SEQAMYJUOBIYPB-UHFFFAOYSA-N [4-(hydroxymethyl)-7-oxabicyclo[4.1.0]heptan-4-yl]methanol Chemical compound C1C(CO)(CO)CCC2OC21 SEQAMYJUOBIYPB-UHFFFAOYSA-N 0.000 description 1
- NIYNIOYNNFXGFN-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol;7-oxabicyclo[4.1.0]heptane-4-carboxylic acid Chemical compound OCC1CCC(CO)CC1.C1C(C(=O)O)CCC2OC21.C1C(C(=O)O)CCC2OC21 NIYNIOYNNFXGFN-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229920003180 amino resin Polymers 0.000 description 1
- IMUDHTPIFIBORV-UHFFFAOYSA-N aminoethylpiperazine Chemical compound NCCN1CCNCC1 IMUDHTPIFIBORV-UHFFFAOYSA-N 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 208000027697 autoimmune lymphoproliferative syndrome due to CTLA4 haploinsuffiency Diseases 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- VKONPUDBRVKQLM-UHFFFAOYSA-N cyclohexane-1,4-diol Chemical compound OC1CCC(O)CC1 VKONPUDBRVKQLM-UHFFFAOYSA-N 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- BQQUFAMSJAKLNB-UHFFFAOYSA-N dicyclopentadiene diepoxide Chemical compound C12C(C3OC33)CC3C2CC2C1O2 BQQUFAMSJAKLNB-UHFFFAOYSA-N 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- JDVIRCVIXCMTPU-UHFFFAOYSA-N ethanamine;trifluoroborane Chemical compound CCN.FB(F)F JDVIRCVIXCMTPU-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- DYDNPESBYVVLBO-UHFFFAOYSA-N formanilide Chemical compound O=CNC1=CC=CC=C1 DYDNPESBYVVLBO-UHFFFAOYSA-N 0.000 description 1
- ANSXAPJVJOKRDJ-UHFFFAOYSA-N furo[3,4-f][2]benzofuran-1,3,5,7-tetrone Chemical compound C1=C2C(=O)OC(=O)C2=CC2=C1C(=O)OC2=O ANSXAPJVJOKRDJ-UHFFFAOYSA-N 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- FLBJFXNAEMSXGL-UHFFFAOYSA-N het anhydride Chemical compound O=C1OC(=O)C2C1C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl FLBJFXNAEMSXGL-UHFFFAOYSA-N 0.000 description 1
- WJSATVJYSKVUGV-UHFFFAOYSA-N hexane-1,3,5-triol Chemical compound CC(O)CC(O)CCO WJSATVJYSKVUGV-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 150000001469 hydantoins Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- YMNRJYYHNXITFZ-UHFFFAOYSA-L magnesium;2,2,2-trichloroacetate Chemical compound [Mg+2].[O-]C(=O)C(Cl)(Cl)Cl.[O-]C(=O)C(Cl)(Cl)Cl YMNRJYYHNXITFZ-UHFFFAOYSA-L 0.000 description 1
- OJOZHRCRUJKPIJ-UHFFFAOYSA-N magnesium;2,2,2-trifluoroacetic acid Chemical compound [Mg].OC(=O)C(F)(F)F OJOZHRCRUJKPIJ-UHFFFAOYSA-N 0.000 description 1
- MIVBAHRSNUNMPP-UHFFFAOYSA-N manganese(2+);dinitrate Chemical compound [Mn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MIVBAHRSNUNMPP-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001960 metal nitrate Inorganic materials 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- UDGSVBYJWHOHNN-UHFFFAOYSA-N n',n'-diethylethane-1,2-diamine Chemical compound CCN(CC)CCN UDGSVBYJWHOHNN-UHFFFAOYSA-N 0.000 description 1
- QOHMWDJIBGVPIF-UHFFFAOYSA-N n',n'-diethylpropane-1,3-diamine Chemical compound CCN(CC)CCCN QOHMWDJIBGVPIF-UHFFFAOYSA-N 0.000 description 1
- ZQJDKPPZEMPWFK-UHFFFAOYSA-N n,n-dipentylpentan-1-amine;phenol Chemical compound OC1=CC=CC=C1.CCCCCN(CCCCC)CCCCC ZQJDKPPZEMPWFK-UHFFFAOYSA-N 0.000 description 1
- AGVKXDPPPSLISR-UHFFFAOYSA-N n-ethylcyclohexanamine Chemical compound CCNC1CCCCC1 AGVKXDPPPSLISR-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- PLYIPBIZXSTXCW-UHFFFAOYSA-N octanoic acid;tin Chemical compound [Sn].CCCCCCCC(O)=O PLYIPBIZXSTXCW-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical compound C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920002587 poly(1,3-butadiene) polymer Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920006295 polythiol Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- NARVIWMVBMUEOG-UHFFFAOYSA-N prop-1-en-2-ol Chemical group CC(O)=C NARVIWMVBMUEOG-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 101150041594 soti gene Proteins 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229940066528 trichloroacetate Drugs 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 229940113165 trimethylolpropane Drugs 0.000 description 1
- UMMDBKGUDMBUSR-UHFFFAOYSA-M tris-decyl(methyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCC[N+](C)(CCCCCCCCCC)CCCCCCCCCC UMMDBKGUDMBUSR-UHFFFAOYSA-M 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 239000010456 wollastonite Substances 0.000 description 1
- 229910052882 wollastonite Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/24—Ethers with hydroxy compounds containing no oxirane rings with polyhydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/02—Polycondensates containing more than one epoxy group per molecule
- C08G59/04—Polycondensates containing more than one epoxy group per molecule of polyhydroxy compounds with epihalohydrins or precursors thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/02—Polycondensates containing more than one epoxy group per molecule
- C08G59/04—Polycondensates containing more than one epoxy group per molecule of polyhydroxy compounds with epihalohydrins or precursors thereof
- C08G59/06—Polycondensates containing more than one epoxy group per molecule of polyhydroxy compounds with epihalohydrins or precursors thereof of polyhydric phenols
- C08G59/066—Polycondensates containing more than one epoxy group per molecule of polyhydroxy compounds with epihalohydrins or precursors thereof of polyhydric phenols with chain extension or advancing agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Epoxy Resins (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7920990 | 1979-06-15 | ||
| GB7920990 | 1979-06-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1141769A true CA1141769A (en) | 1983-02-22 |
Family
ID=10505890
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000353939A Expired CA1141769A (en) | 1979-06-15 | 1980-06-13 | Diglycidyl ethers of di-secondary alcohols, their preparation, and curable compositions containing them |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4284574A (enExample) |
| EP (1) | EP0022073B1 (enExample) |
| JP (1) | JPS565472A (enExample) |
| CA (1) | CA1141769A (enExample) |
| DE (1) | DE3070050D1 (enExample) |
| ES (1) | ES492455A0 (enExample) |
| NO (1) | NO157174C (enExample) |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2522649B1 (enExample) * | 1982-03-03 | 1987-07-10 | Commissariat Energie Atomique | |
| JPS5966467A (ja) * | 1982-10-08 | 1984-04-14 | Toyo Tire & Rubber Co Ltd | 耐弗酸性ライニング組成物 |
| AU571499B2 (en) * | 1983-04-01 | 1988-04-21 | Dow Chemical Company, The | Preparing epoxy resins |
| DE3402247A1 (de) * | 1984-01-24 | 1985-07-25 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von epoxidharzen |
| EP0166696B1 (de) * | 1984-06-29 | 1989-07-19 | Ciba-Geigy Ag | Zusätze für Schmierstoffe |
| DE3573778D1 (en) * | 1984-06-29 | 1989-11-23 | Ciba Geigy Ag | Process for the preparation of glycidyl thioethers |
| US4623701A (en) | 1985-07-10 | 1986-11-18 | The Dow Chemical Company | Multifunctional epoxy resins |
| US4737553A (en) * | 1986-09-29 | 1988-04-12 | Ciba-Geigy Corporation | Advanced resins from diglycidyl ethers of di-secondary alcohols and dihydric phenols |
| US4857567A (en) * | 1987-07-24 | 1989-08-15 | Basf Corporation, Inmont Division | Flexible aryl alkyl epoxy resins, their amine resin derivatives and their use in electrodeposition coatings |
| US4845172A (en) * | 1987-08-19 | 1989-07-04 | Ciba-Geigy Corporation | Co-advanced resins from copolymers of polyethers of polyhydric phenols and diglycidyl ethers of di-secondary alcohols |
| DE3883892T2 (de) * | 1987-08-19 | 1994-01-20 | Ciba Geigy | Kettenverlängerte Epoxydharze auf der Basis von Polyglycidyläthern von polyhydrischen Phenolen und Diglycidyläthern von disekundären Alkoholen. |
| US4800222A (en) * | 1987-08-24 | 1989-01-24 | Texaco Inc. | Accelerator for curing epoxy resins comprising piperazine, triethanolamine and tris(dimethylaminomethyl)phenol |
| US5008334A (en) * | 1989-02-28 | 1991-04-16 | Basf Corporation | Resins of epoxy/aromatic diol copolymer and block copolymer of epoxy/aromatic diol copolymer and a epoxy-capped polybutadiene (co)polymer |
| JPH0333122A (ja) * | 1989-06-30 | 1991-02-13 | Sumitomo Bakelite Co Ltd | エポキシ樹脂組成物 |
| JPH03227317A (ja) * | 1990-01-31 | 1991-10-08 | Somar Corp | 液状エポキシ樹脂組成物 |
| US5128491A (en) * | 1991-07-30 | 1992-07-07 | Ciba-Geigy Corporation | Process for the preparation of glycidyl ethers of di-secondary alcohols with high monomer content |
| US5117010A (en) * | 1991-08-15 | 1992-05-26 | Ciba-Geigy Corporation | Process for the preparation of addition products of epoxides and alcohols |
| JP3376610B2 (ja) * | 1991-09-24 | 2003-02-10 | 日本曹達株式会社 | 2−プロパノール化合物及びそれを用いた記録材料 |
| GB9125116D0 (en) * | 1991-11-23 | 1992-01-22 | Ciba Geigy Ag | Chemical process |
| GB9200566D0 (en) * | 1992-01-11 | 1992-03-11 | Ciba Geigy | Compounds |
| TW311923B (enExample) | 1992-01-27 | 1997-08-01 | Ciba Sc Holding Ag | |
| US5239093A (en) * | 1992-06-12 | 1993-08-24 | Ciba-Geigy Corporation | Process for the preparation of addition products of epoxides and alcohols |
| US5426139A (en) * | 1994-05-25 | 1995-06-20 | The Dow Chemical Company | Graft copolymer coating compositions |
| EP0764635B1 (en) * | 1994-06-06 | 2002-03-27 | Nippon Soda Co., Ltd. | Diphenyl sulfone derivative and recording material prepared therefrom |
| US5414046A (en) | 1994-06-17 | 1995-05-09 | General Electric Company | Flame retardant polymer compositions comprising thermally stable resins |
| BR9711180A (pt) * | 1996-08-06 | 1999-08-17 | Ciba Sc Holding Ag | Eteres poliglicidilicos de alcoois secund rios |
| US7241504B2 (en) * | 2003-01-17 | 2007-07-10 | The United States Of America As Represented By The Secretary Of The Navy | Diols formed by ring-opening of epoxies |
| CA2521615A1 (en) * | 2003-04-08 | 2004-10-21 | Nippon Kayaku Kabushiki Kaisha | Liquid crystal sealing agent and liquid crystalline display cell using the same |
| EP1627867B1 (en) * | 2003-05-23 | 2016-01-20 | Mitsui Chemicals, Inc. | (meth)acrylic ester compound and use thereof |
| US7592067B2 (en) * | 2003-09-22 | 2009-09-22 | Hexion Specialty Chemicals, Inc. | Epoxy resin compositions, processes utilizing same and articles made therefrom |
| DE102004056398A1 (de) * | 2004-11-23 | 2006-05-24 | Bayer Materialscience Ag | Hydrolysestabile, hydrophobe, lösemittelfreie Polyole |
| JP2006265111A (ja) * | 2005-03-22 | 2006-10-05 | Sumitomo Chemical Co Ltd | エポキシ化合物およびエポキシ樹脂硬化物 |
| JP5344789B2 (ja) * | 2006-12-28 | 2013-11-20 | 新日鉄住金化学株式会社 | 新規エポキシ樹脂、該エポキシ樹脂を必須成分とするエポキシ樹脂組成物及び該エポキシ樹脂を必須成分とする硬化物 |
| JP4947732B2 (ja) * | 2008-05-21 | 2012-06-06 | 日本化薬株式会社 | 高屈折率を有するビフェノール骨格含有エポキシ樹脂、樹脂組成物及びその硬化物 |
| MX2010014372A (es) | 2008-07-02 | 2011-06-20 | British Columbia Cancer Agency | Agentes terapeuticos derivados de eter diglicidico y métodos para su uso. |
| US9388112B2 (en) | 2010-01-06 | 2016-07-12 | The University Of British Columbia | Bisphenol derivatives and their use as androgen receptor activity modulators |
| EP2621993B1 (en) | 2010-09-30 | 2014-09-03 | Dow Global Technologies LLC | Coating compositions |
| ES2569179T3 (es) * | 2010-09-30 | 2016-05-09 | Blue Cube Ip Llc | Composiciones termoestables y artículos termoendurecidos a partir de las mismas |
| WO2012044443A1 (en) | 2010-09-30 | 2012-04-05 | Dow Global Technologies Llc | Epoxy resin compositions |
| CN103140531B (zh) | 2010-09-30 | 2016-05-04 | 蓝立方知识产权有限责任公司 | 制备环氧树脂的方法 |
| BR112013006993A2 (pt) * | 2010-09-30 | 2019-09-24 | Dow Global Technologies Llc | adubo de resina epóxi, processo para preparar um adubo de resina epóxi, composição de resina epóxi curável, processo para preparar uma composição de resina epóxi curável , produto termofixo parcialmente curado (estágio-b), processo para curar parcialmente (estágio-b) em uma composição de resina curável, produto termofixo curado, processo para curar uma composição de resina epóxi e artigo |
| EP2693875A4 (en) * | 2011-04-08 | 2014-10-22 | British Columbia Cancer Agency | BISPHENOL COMPOUNDS AND METHOD FOR THEIR USE |
| KR20140048893A (ko) | 2011-07-01 | 2014-04-24 | 다우 글로벌 테크놀로지스 엘엘씨 | 하이브리드 에폭시 수지 부가생성물 |
| CN103184022B (zh) * | 2011-12-30 | 2017-09-19 | 汉高股份有限及两合公司 | 用于硅片制备中的暂时性粘合用粘合剂组合物 |
| US9365510B2 (en) | 2012-04-16 | 2016-06-14 | British Columbia Cancer Agency Branch | Aziridine bisphenol ethers and related compounds and methods for their use |
| WO2014042491A1 (ko) * | 2012-09-17 | 2014-03-20 | 한국생산기술연구원 | 알콕시실릴기를 갖는 에폭시 화합물, 이의 제조 방법, 이를 포함하는 조성물, 경화물 및 이의 용도 |
| EP2994451A4 (en) | 2013-05-10 | 2016-10-05 | British Columbia Cancer Agency | ESTER DERIVATIVES OF ANDROGEN RECEPTOR MODULATORS AND METHOD FOR THEIR USE |
| US9375496B2 (en) | 2013-09-09 | 2016-06-28 | British Columbia Cancer Agency Branch | Halogenated compounds for cancer imaging and treatment and methods for their use |
| AU2016206412B2 (en) | 2015-01-13 | 2020-10-08 | British Columbia Cancer Agency Branch | Heterocyclic compounds for cancer imaging and treatment and methods for their use |
| WO2016141458A1 (en) | 2015-03-12 | 2016-09-15 | British Columbia Cancer Agency Branch | Bisphenol ether derivatives and methods for using the same |
| US20170298033A1 (en) | 2016-04-15 | 2017-10-19 | The University Of British Columbia | Bisphenol derivatives and their use as androgen receptor activity modulators |
| EP3548541B1 (en) * | 2016-12-02 | 2022-05-18 | 3M Innovative Properties Company | Dual cure monomers |
| US11485713B2 (en) | 2018-05-25 | 2022-11-01 | Essa Pharma, Inc. | Androgen receptor modulators and methods for their use |
| EP3594258A1 (en) | 2018-07-09 | 2020-01-15 | Allnex Belgium, S.A. | Radiation curable composition |
| WO2020081999A1 (en) | 2018-10-18 | 2020-04-23 | Essa Pharma, Inc. | Androgen receptor modulators and methods for their use |
| WO2020198712A1 (en) | 2019-03-28 | 2020-10-01 | Essa Pharma, Inc. | Pharmaceutical compositions and combinations comprising inhibitors of the androgen receptor and uses thereof |
| JP7375347B2 (ja) * | 2019-06-28 | 2023-11-08 | Dic株式会社 | エポキシ化合物、組成物、硬化物及び積層体 |
| KR102232340B1 (ko) | 2019-11-15 | 2021-03-26 | 한국생산기술연구원 | 알콕시실릴기를 갖는 에폭시 수지의 조성물 및 이의 복합체 |
| CA3174422A1 (en) | 2020-04-17 | 2021-10-21 | Essa Pharma, Inc. | Solid forms of an n-terminal domain androgen receptor inhibitor and uses thereof |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3033821A (en) * | 1958-10-24 | 1962-05-08 | Devoe & Raynolds Co | Production of diglycidyl ethers |
| NL246301A (enExample) * | 1958-12-12 | |||
| GB1056385A (en) * | 1963-02-20 | 1967-01-25 | Devoe & Raynolds Co | Improvements in aliphatic hydroxyl-containing monoglycidyl ethers of dihydric phenols |
| US3374204A (en) * | 1963-05-17 | 1968-03-19 | Celanese Coatings Co | Process for preparing high molecular weight polyhydroxy-polyether resins |
| US3477990A (en) * | 1967-12-07 | 1969-11-11 | Shell Oil Co | Process for reacting a phenol with an epoxy compound and resulting products |
| BE759274A (fr) * | 1969-11-24 | 1971-05-24 | Ciba Geigy Ag | Nouveaux ethers glycidyliques, procede pour leur preparation etleur application |
| CH545778A (enExample) * | 1971-03-26 | 1974-02-15 | ||
| CH546234A (de) * | 1971-05-18 | 1974-02-28 | Ciba Geigy Ag | Verfahren zur herstellung von methylolglycidylaethern mehrwertiger phenolaether. |
| GB1512814A (en) * | 1975-08-13 | 1978-06-01 | Ciba Geigy Ag | Epoxide resins |
| GB1588047A (en) * | 1977-09-09 | 1981-04-15 | Ciba Geigy Ag | Acid esters of trimellitic acid and their use as hardeners for epoxide resins |
-
1980
- 1980-06-02 US US06/155,693 patent/US4284574A/en not_active Expired - Lifetime
- 1980-06-11 DE DE8080810192T patent/DE3070050D1/de not_active Expired
- 1980-06-11 EP EP80810192A patent/EP0022073B1/de not_active Expired
- 1980-06-13 NO NO801768A patent/NO157174C/no unknown
- 1980-06-13 JP JP8006980A patent/JPS565472A/ja active Granted
- 1980-06-13 CA CA000353939A patent/CA1141769A/en not_active Expired
- 1980-06-14 ES ES492455A patent/ES492455A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| NO801768L (no) | 1980-12-16 |
| ES8104266A1 (es) | 1981-04-16 |
| EP0022073B1 (de) | 1985-01-30 |
| ES492455A0 (es) | 1981-04-16 |
| DE3070050D1 (en) | 1985-03-14 |
| US4284574A (en) | 1981-08-18 |
| JPH0154347B2 (enExample) | 1989-11-17 |
| JPS565472A (en) | 1981-01-20 |
| EP0022073A1 (de) | 1981-01-07 |
| NO157174B (no) | 1987-10-26 |
| NO157174C (no) | 1988-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1141769A (en) | Diglycidyl ethers of di-secondary alcohols, their preparation, and curable compositions containing them | |
| CA1280434C (en) | Multifunctional epoxide resins | |
| US3629263A (en) | Diglycidyl ethers | |
| US5668227A (en) | Cyclohexyl-group-containing glycidyl ethers | |
| US5510428A (en) | Compositions, epoxized compositions, a heat curable resin composition, an epoxy resin composition, radically polymerized compositions, a curable resin composition and a polymer having epoxy groups | |
| US4677170A (en) | Polyepoxides and the use thereof | |
| US4417033A (en) | Diglycidyl ether of dimethanol cyclohexane and reaction products thereof | |
| US3779949A (en) | New adducts, containing epoxide groups, from polyepoxide compounds and binuclear n-heterocyclic compounds | |
| CA1296015C (en) | 2,6-disubstituted 4-epoxyporpylphenyl glycidyl ethers and the use thereof | |
| US3793248A (en) | Adducts,containing epoxide groups,from polyepoxide compounds and binuclear n-heterocyclic compounds | |
| US4801660A (en) | Compositions comprising an epoxy resin and mercaptan-containing polyphenols | |
| US3948916A (en) | Diglycidyl compounds of N-heterocyclic compounds | |
| US3925407A (en) | Triglycidyl compounds and their use | |
| EP0552864B1 (en) | Polyglycidyl ethers and their use | |
| US4549008A (en) | Novel tetraglycidyl ethers | |
| US4672101A (en) | Polyepoxy aromatic hydantoins | |
| KR910004902B1 (ko) | 에폭시드기를 함유하는 페놀 에테르 | |
| US4879414A (en) | Polythiols and use as epoxy resin curing agents | |
| US3726895A (en) | Diglycidyl derivatives of compounds containing two n-heterocyclic rings | |
| US3686174A (en) | Certain diglycidyl esters of n-heterocyclic compounds | |
| US3714198A (en) | Polyglycidyl esters | |
| US4209608A (en) | Adducts containing epoxide groups, from hydantoin polyepoxide and binuclear hydantoin compounds | |
| US3799894A (en) | Adducts,containing epoxide groups,from polyepoxide compounds and binuclear n-heterocyclic compounds | |
| US3920683A (en) | Diglycidyloxyalkyl compounds | |
| EP0595530A1 (en) | Epoxide resins derived from polycyclic phenols |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |