CA1125697A - Electrolysis of hydrogen halide in cell with catalytic electrodes bonded to membrane - Google Patents
Electrolysis of hydrogen halide in cell with catalytic electrodes bonded to membraneInfo
- Publication number
- CA1125697A CA1125697A CA315,521A CA315521A CA1125697A CA 1125697 A CA1125697 A CA 1125697A CA 315521 A CA315521 A CA 315521A CA 1125697 A CA1125697 A CA 1125697A
- Authority
- CA
- Canada
- Prior art keywords
- membrane
- reduced
- oxides
- anode
- bonded
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000012528 membrane Substances 0.000 title claims abstract description 51
- 238000005868 electrolysis reaction Methods 0.000 title claims abstract description 28
- 230000003197 catalytic effect Effects 0.000 title claims abstract description 18
- 229910000039 hydrogen halide Inorganic materials 0.000 title abstract description 3
- 239000012433 hydrogen halide Substances 0.000 title abstract description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims abstract description 82
- 239000000460 chlorine Substances 0.000 claims abstract description 38
- -1 platinum group metals Chemical class 0.000 claims abstract description 36
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 35
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 35
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 22
- 239000001257 hydrogen Substances 0.000 claims abstract description 22
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 14
- 239000000243 solution Substances 0.000 claims abstract description 9
- 239000003014 ion exchange membrane Substances 0.000 claims abstract description 5
- 239000007864 aqueous solution Substances 0.000 claims abstract description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 28
- 229910002804 graphite Inorganic materials 0.000 claims description 27
- 239000010439 graphite Substances 0.000 claims description 27
- 229910052707 ruthenium Inorganic materials 0.000 claims description 26
- 229910052741 iridium Inorganic materials 0.000 claims description 24
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 22
- 229910052719 titanium Inorganic materials 0.000 claims description 22
- 239000010936 titanium Substances 0.000 claims description 22
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 21
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 18
- 230000008569 process Effects 0.000 claims description 16
- 229910052715 tantalum Inorganic materials 0.000 claims description 12
- 150000001768 cations Chemical class 0.000 claims description 9
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 9
- 238000005342 ion exchange Methods 0.000 claims description 7
- 229910044991 metal oxide Inorganic materials 0.000 claims description 7
- 229910052758 niobium Inorganic materials 0.000 claims description 7
- 239000010955 niobium Substances 0.000 claims description 7
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 5
- 229910002056 binary alloy Inorganic materials 0.000 claims 1
- 239000011530 conductive current collector Substances 0.000 claims 1
- 238000010924 continuous production Methods 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 abstract description 21
- 239000002184 metal Substances 0.000 abstract description 21
- 229910052736 halogen Inorganic materials 0.000 abstract description 8
- 150000002367 halogens Chemical class 0.000 abstract description 8
- 239000007787 solid Substances 0.000 abstract description 7
- 239000005518 polymer electrolyte Substances 0.000 abstract description 6
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical group FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 abstract description 2
- 210000004379 membrane Anatomy 0.000 description 39
- 239000000203 mixture Substances 0.000 description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 12
- 239000007789 gas Substances 0.000 description 12
- 239000001301 oxygen Substances 0.000 description 12
- 229910052760 oxygen Inorganic materials 0.000 description 12
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 12
- 239000004809 Teflon Substances 0.000 description 10
- 229920006362 Teflon® Polymers 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 7
- 229910045601 alloy Inorganic materials 0.000 description 7
- 239000000956 alloy Substances 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 150000002500 ions Chemical class 0.000 description 7
- 230000008901 benefit Effects 0.000 description 6
- 239000003792 electrolyte Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910052697 platinum Inorganic materials 0.000 description 6
- 230000032258 transport Effects 0.000 description 6
- 238000005341 cation exchange Methods 0.000 description 5
- 229910000510 noble metal Inorganic materials 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 230000001965 increasing effect Effects 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- 229910002058 ternary alloy Inorganic materials 0.000 description 3
- 229920002943 EPDM rubber Polymers 0.000 description 2
- 229920000557 Nafion® Polymers 0.000 description 2
- 229910002835 Pt–Ir Inorganic materials 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- ROZSPJBPUVWBHW-UHFFFAOYSA-N [Ru]=O Chemical class [Ru]=O ROZSPJBPUVWBHW-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000003729 cation exchange resin Substances 0.000 description 2
- 229940023913 cation exchange resins Drugs 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- HTXDPTMKBJXEOW-UHFFFAOYSA-N dioxoiridium Chemical compound O=[Ir]=O HTXDPTMKBJXEOW-UHFFFAOYSA-N 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 229910052735 hafnium Inorganic materials 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000037427 ion transport Effects 0.000 description 2
- 229910000457 iridium oxide Inorganic materials 0.000 description 2
- CJTCBBYSPFAVFL-UHFFFAOYSA-N iridium ruthenium Chemical compound [Ru].[Ir] CJTCBBYSPFAVFL-UHFFFAOYSA-N 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102000003939 Membrane transport proteins Human genes 0.000 description 1
- 108090000301 Membrane transport proteins Proteins 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229910002845 Pt–Ni Inorganic materials 0.000 description 1
- 229910002848 Pt–Ru Inorganic materials 0.000 description 1
- 229910018885 Pt—Au Inorganic materials 0.000 description 1
- 229910018879 Pt—Pd Inorganic materials 0.000 description 1
- 229910019897 RuOx Inorganic materials 0.000 description 1
- 229910003087 TiOx Inorganic materials 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- HJPBEXZMTWFZHY-UHFFFAOYSA-N [Ti].[Ru].[Ir] Chemical compound [Ti].[Ru].[Ir] HJPBEXZMTWFZHY-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000005275 alloying Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000002900 effect on cell Effects 0.000 description 1
- 238000003487 electrochemical reaction Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 230000000887 hydrating effect Effects 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 230000009061 membrane transport Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920005597 polymer membrane Polymers 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- CMIQNFUKBYANIP-UHFFFAOYSA-N ruthenium tantalum Chemical compound [Ru].[Ta] CMIQNFUKBYANIP-UHFFFAOYSA-N 0.000 description 1
- DPGAAOUOSQHIJH-UHFFFAOYSA-N ruthenium titanium Chemical compound [Ti].[Ru] DPGAAOUOSQHIJH-UHFFFAOYSA-N 0.000 description 1
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 1
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- OEIMLTQPLAGXMX-UHFFFAOYSA-I tantalum(v) chloride Chemical compound Cl[Ta](Cl)(Cl)(Cl)Cl OEIMLTQPLAGXMX-UHFFFAOYSA-I 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- HLLICFJUWSZHRJ-UHFFFAOYSA-N tioxidazole Chemical compound CCCOC1=CC=C2N=C(NC(=O)OC)SC2=C1 HLLICFJUWSZHRJ-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- DANYXEHCMQHDNX-UHFFFAOYSA-K trichloroiridium Chemical compound Cl[Ir](Cl)Cl DANYXEHCMQHDNX-UHFFFAOYSA-K 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
- C25B1/26—Chlorine; Compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
- C25B1/46—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis in diaphragm cells
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
- C25B11/051—Electrodes formed of electrocatalysts on a substrate or carrier
- C25B11/073—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material
- C25B11/091—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds
- C25B11/095—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds at least one of the compounds being organic
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B9/00—Cells or assemblies of cells; Constructional parts of cells; Assemblies of constructional parts, e.g. electrode-diaphragm assemblies; Process-related cell features
- C25B9/17—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof
- C25B9/19—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof with diaphragms
- C25B9/23—Cells comprising dimensionally-stable non-movable electrodes; Assemblies of constructional parts thereof with diaphragms comprising ion-exchange membranes in or on which electrode material is embedded
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US85894277A | 1977-12-09 | 1977-12-09 | |
| US858,942 | 1977-12-09 | ||
| US05/922,287 US4210501A (en) | 1977-12-09 | 1978-07-06 | Generation of halogens by electrolysis of hydrogen halides in a cell having catalytic electrodes bonded to a solid polymer electrolyte |
| US922,287 | 1986-10-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1125697A true CA1125697A (en) | 1982-06-15 |
Family
ID=27127488
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA315,521A Expired CA1125697A (en) | 1977-12-09 | 1978-10-31 | Electrolysis of hydrogen halide in cell with catalytic electrodes bonded to membrane |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4210501A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5495996A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1125697A (cg-RX-API-DMAC10.html) |
| DD (1) | DD143932A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2844499C2 (cg-RX-API-DMAC10.html) |
| ES (2) | ES475786A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2411248A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2009792B (cg-RX-API-DMAC10.html) |
| IN (1) | IN150899B (cg-RX-API-DMAC10.html) |
| IT (1) | IT1104585B (cg-RX-API-DMAC10.html) |
| MX (1) | MX148462A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7811996A (cg-RX-API-DMAC10.html) |
| PL (1) | PL117326B1 (cg-RX-API-DMAC10.html) |
| SE (1) | SE7812641L (cg-RX-API-DMAC10.html) |
Families Citing this family (72)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2007260B (en) * | 1977-09-22 | 1982-02-24 | Kanegafuchi Chemical Ind | Method of electrolysis of alkai metal chloride |
| IT1118243B (it) * | 1978-07-27 | 1986-02-24 | Elche Ltd | Cella di elettrolisi monopolare |
| US4356068A (en) * | 1979-02-23 | 1982-10-26 | Ppg Industries, Inc. | Permionic membrane |
| US4323435A (en) * | 1979-02-23 | 1982-04-06 | Ppg Industries, Inc. | Method of operating a solid polymer electrolyte chlor-alkali cell |
| JPS55148777A (en) * | 1979-05-04 | 1980-11-19 | Asahi Glass Co Ltd | Manufacture of caustic alkali |
| JPS55161081A (en) * | 1979-06-01 | 1980-12-15 | Asahi Glass Co Ltd | Electrolytic cell |
| GB2051870B (en) * | 1979-06-07 | 1983-04-20 | Asahi Chemical Ind | Method for electrolysis of aqueous alkali metal chloride solution |
| US4340452A (en) * | 1979-08-03 | 1982-07-20 | Oronzio deNora Elettrochimici S.p.A. | Novel electrolysis cell |
| US4342629A (en) * | 1979-11-08 | 1982-08-03 | Ppg Industries, Inc. | Solid polymer electrolyte chlor-alkali process |
| US4364815A (en) * | 1979-11-08 | 1982-12-21 | Ppg Industries, Inc. | Solid polymer electrolyte chlor-alkali process and electrolytic cell |
| US4315805A (en) * | 1979-11-08 | 1982-02-16 | Ppg Industries, Inc. | Solid polymer electrolyte chlor-alkali process |
| US4364813A (en) * | 1979-12-19 | 1982-12-21 | Ppg Industries, Inc. | Solid polymer electrolyte cell and electrode for same |
| JPS5693883A (en) * | 1979-12-27 | 1981-07-29 | Permelec Electrode Ltd | Electrolytic apparatus using solid polymer electrolyte diaphragm and preparation thereof |
| US4369103A (en) * | 1980-02-11 | 1983-01-18 | Ppg Industries, Inc. | Solid polymer electrolyte cell |
| WO1981003186A1 (en) * | 1980-05-02 | 1981-11-12 | Gen Electric | Halogen evolution with improved anode catalyst |
| US4289591A (en) * | 1980-05-02 | 1981-09-15 | General Electric Company | Oxygen evolution with improved Mn stabilized catalyst |
| DE3036066A1 (de) * | 1980-09-25 | 1982-05-06 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung eines elektroden-membran-verbundsystems |
| DE3040470A1 (de) * | 1980-10-27 | 1982-06-03 | Siemens AG, 1000 Berlin und 8000 München | Verfahren und vorrichtung zur indirekten oxidation von harnstoff |
| US4386987A (en) * | 1981-06-26 | 1983-06-07 | Diamond Shamrock Corporation | Electrolytic cell membrane/SPE formation by solution coating |
| US4421579A (en) * | 1981-06-26 | 1983-12-20 | Diamond Shamrock Corporation | Method of making solid polymer electrolytes and electrode bonded with hydrophyllic fluorocopolymers |
| US4434116A (en) | 1981-06-26 | 1984-02-28 | Diamond Shamrock Corporation | Method for making a porous fluorinated polymer structure |
| US4457815A (en) * | 1981-12-09 | 1984-07-03 | Ppg Industries, Inc. | Electrolytic cell, permionic membrane, and method of electrolysis |
| JPS58176221A (ja) * | 1982-04-09 | 1983-10-15 | Permelec Electrode Ltd | 被覆を有する電解用イオン交換膜の製造方法 |
| JPS6022072B2 (ja) * | 1982-06-30 | 1985-05-30 | ペルメレツク電極株式会社 | 酸性溶液電解用陰極及びその製造方法 |
| US4465533A (en) * | 1983-01-13 | 1984-08-14 | Eltech Systems Limited | Method for making polymer bonded electrodes |
| US4648955A (en) * | 1985-04-19 | 1987-03-10 | Ivac Corporation | Planar multi-junction electrochemical cell |
| US4826554A (en) * | 1985-12-09 | 1989-05-02 | The Dow Chemical Company | Method for making an improved solid polymer electrolyte electrode using a binder |
| US4824508A (en) * | 1985-12-09 | 1989-04-25 | The Dow Chemical Company | Method for making an improved solid polymer electrolyte electrode using a liquid or solvent |
| US4654104A (en) * | 1985-12-09 | 1987-03-31 | The Dow Chemical Company | Method for making an improved solid polymer electrolyte electrode using a fluorocarbon membrane in a thermoplastic state |
| DE3602683A1 (de) * | 1986-01-30 | 1987-08-06 | Bayer Ag | Verfahren zur durchfuehrung der hcl-membranelektrolyse |
| EP0388990A3 (en) | 1986-02-20 | 1993-03-31 | RAYCHEM CORPORATION (a Delaware corporation) | Method and articles employing ion exchange material |
| US5019235A (en) * | 1986-02-20 | 1991-05-28 | Raychem Corporation | Method and articles employing ion exchange material |
| US5007989A (en) * | 1986-02-20 | 1991-04-16 | Raychem Corporation | Method and articles employing ion exchange material |
| US5074988A (en) * | 1986-02-20 | 1991-12-24 | Raychem Corporation | Apparatus for monitoring an electrolyte |
| US5045163A (en) * | 1986-02-20 | 1991-09-03 | Raychem Corporation | Electrochemical method for measuring chemical species employing ion exchange material |
| US4888098A (en) * | 1986-02-20 | 1989-12-19 | Raychem Corporation | Method and articles employing ion exchange material |
| JP2520266B2 (ja) * | 1987-10-02 | 1996-07-31 | 玲子 能登谷 | 酸素電極反応用電極 |
| US5186794A (en) * | 1990-09-26 | 1993-02-16 | Solar Reactor Technologies, Inc. | Alkali metal hydroxide generation system and the method therefor |
| US5171644A (en) * | 1991-01-09 | 1992-12-15 | The Dow Chemical Company | Electrochemical cell electrode |
| US5314760A (en) * | 1991-01-09 | 1994-05-24 | The Dow Chemical Company | Electrochemical cell electrode |
| DE4241150C1 (de) * | 1992-12-07 | 1994-06-01 | Fraunhofer Ges Forschung | Elektrodenmembran-Verbund, Verfahren zu dessen Herstellung sowie dessen Verwendung |
| US5976346A (en) * | 1993-11-22 | 1999-11-02 | E. I. Du Pont De Nemours And Company | Membrane hydration in electrochemical conversion of anhydrous hydrogen halide to halogen gas |
| USRE37433E1 (en) | 1993-11-22 | 2001-11-06 | E. I. Du Pont De Nemours And Company | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a membrane-electrode assembly or gas diffusion electrodes |
| US5961795A (en) * | 1993-11-22 | 1999-10-05 | E. I. Du Pont De Nemours And Company | Electrochemical cell having a resilient flow field |
| US5868912A (en) * | 1993-11-22 | 1999-02-09 | E. I. Du Pont De Nemours And Company | Electrochemical cell having an oxide growth resistant current distributor |
| US5863395A (en) * | 1993-11-22 | 1999-01-26 | E. I. Du Pont De Nemours And Company | Electrochemical cell having a self-regulating gas diffusion layer |
| US5798036A (en) | 1993-11-22 | 1998-08-25 | E. I. Du Pont De Nemours And Company | Electrochemical conversion of anhydrous hydrogen halide to halogens gas using a membrane-electrode assembly or gas diffusion electrodes |
| US5855748A (en) * | 1993-11-22 | 1999-01-05 | E. I. Du Pont De Nemours And Company | Electrochemical cell having a mass flow field made of glassy carbon |
| US5855759A (en) * | 1993-11-22 | 1999-01-05 | E. I. Du Pont De Nemours And Company | Electrochemical cell and process for splitting a sulfate solution and producing a hyroxide solution sulfuric acid and a halogen gas |
| US5411641A (en) * | 1993-11-22 | 1995-05-02 | E. I. Du Pont De Nemours And Company | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a cation-transporting membrane |
| US6180163B1 (en) | 1993-11-22 | 2001-01-30 | E. I. Du Pont De Nemours And Company | Method of making a membrane-electrode assembly |
| US5824199A (en) * | 1993-11-22 | 1998-10-20 | E. I. Du Pont De Nemours And Company | Electrochemical cell having an inflatable member |
| US6042702A (en) * | 1993-11-22 | 2000-03-28 | E.I. Du Pont De Nemours And Company | Electrochemical cell having a current distributor comprising a conductive polymer composite material |
| US5523177A (en) * | 1994-10-12 | 1996-06-04 | Giner, Inc. | Membrane-electrode assembly for a direct methanol fuel cell |
| DE19624024A1 (de) * | 1996-06-17 | 1997-12-18 | Verein Fuer Kernverfahrenstech | Verfahren zur Herstellung von Halogenen, Oxoverbindungen der Halogene sowie zur Herstellung von Peroxyverbindungen durch Elektrolyse |
| RU2138580C1 (ru) * | 1998-02-16 | 1999-09-27 | Орловский государственный технический университет | Способ получения солевого расплава, содержащего низшие галогениды металлов |
| WO1999062828A1 (en) | 1998-05-29 | 1999-12-09 | Proton Energy Systems | Fluids management system for water electrolysis |
| US6010317A (en) * | 1998-09-01 | 2000-01-04 | Baxter International Inc. | Electrochemical cell module having an inner and an outer shell with a nested arrangement |
| US6368472B1 (en) | 1998-11-04 | 2002-04-09 | Mcguire Byron Duvon | Electrolytic chemical generator |
| EP1240680A2 (en) * | 1999-11-18 | 2002-09-18 | Proton Energy Systems, Inc. | High differential pressure electrochemical cell |
| US20050250003A1 (en) * | 2002-08-09 | 2005-11-10 | Proton Energy Systems, Inc. | Electrochemical cell support structure |
| DE10152275A1 (de) * | 2001-10-23 | 2003-04-30 | Bayer Ag | Verfahren zur Elektrolyse von wässrigen Lösungen aus Chlorwasserstoff |
| JP4249693B2 (ja) * | 2004-11-25 | 2009-04-02 | 本田技研工業株式会社 | 電解水生成装置の電解槽 |
| US7513980B2 (en) * | 2004-11-25 | 2009-04-07 | Honda Motor Co., Ltd. | Electrolytic cell for electrolyzed water generator |
| GB2449655A (en) * | 2007-05-30 | 2008-12-03 | Jlj Engineering Sercices Ltd | An electrochemical reactor for aqueous solutions with high electrical resistance |
| DE102007044171A1 (de) * | 2007-09-15 | 2009-03-19 | Bayer Materialscience Ag | Verfahren zur Herstellung von Graphitelektroden für elektrolytische Prozesse |
| DE102009035546A1 (de) * | 2009-07-31 | 2011-02-03 | Bayer Materialscience Ag | Elektrode und Elektrodenbeschichtung |
| US20110198232A1 (en) * | 2010-02-15 | 2011-08-18 | Hamilton Sundstrand Corporation | High-differential-pressure water electrolysis cell and method of operation |
| DE102013009230A1 (de) | 2013-05-31 | 2014-12-04 | Otto-von-Guericke-Universität | Verfahren und Membranreaktor zur Herstellung von Chlor aus Chlorwasserstoffgas |
| GB201322494D0 (en) | 2013-12-19 | 2014-02-05 | Johnson Matthey Fuel Cells Ltd | Catalyst layer |
| US9909223B1 (en) | 2014-08-04 | 2018-03-06 | Byron Duvon McGuire | Expanded metal with unified margins and applications thereof |
| CN108367948B (zh) * | 2016-01-15 | 2022-02-01 | 安克信水技术公司 | 具有增加的污染物去除速率的用于废水处理的电化学电池 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT586875A (cg-RX-API-DMAC10.html) * | 1957-04-09 | 1900-01-01 | ||
| BE617375A (cg-RX-API-DMAC10.html) * | 1961-05-08 | 1900-01-01 | ||
| DE1546717C3 (de) * | 1964-05-14 | 1974-06-27 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Elektrochemische Zelle |
| US3291708A (en) * | 1964-12-31 | 1966-12-13 | Ionics | Electrolytic process for producing a halogen from its respective acid and the apparatus therefor |
| US3532556A (en) * | 1966-09-01 | 1970-10-06 | Matthey Bishop Inc | Process for forming platinum coated electrode |
| GB1163479A (en) * | 1967-03-17 | 1969-09-04 | Engelhard Min & Chem | Fuel Electrodes |
| DE1667225A1 (de) * | 1967-09-27 | 1971-08-12 | Pfrengle Otto Dr Ing | Vorrichtung zum Aufspruehen von Fluessigkeiten auf Pulverstoffe |
| US3528858A (en) * | 1968-12-04 | 1970-09-15 | Gen Electric | Sulfonated aryl-substituted polyphenylene ether ion exchange membranes |
| BE788557A (fr) * | 1971-09-09 | 1973-03-08 | Ppg Industries Inc | Diaphragmes pour cellules electrolytiques |
| US3992271A (en) * | 1973-02-21 | 1976-11-16 | General Electric Company | Method for gas generation |
| US3857737A (en) * | 1973-09-18 | 1974-12-31 | United Aircraft Corp | Sequential catalyzation of fuel cell supported platinum catalyst |
| US4100050A (en) * | 1973-11-29 | 1978-07-11 | Hooker Chemicals & Plastics Corp. | Coating metal anodes to decrease consumption rates |
| US4017663A (en) * | 1974-02-15 | 1977-04-12 | United Technologies Corporation | Electrodes for electrochemical cells |
| JPS526374A (en) * | 1975-07-07 | 1977-01-18 | Tokuyama Soda Co Ltd | Anode structure for electrolysis |
| US4039409A (en) * | 1975-12-04 | 1977-08-02 | General Electric Company | Method for gas generation utilizing platinum metal electrocatalyst containing 5 to 60% ruthenium |
| US4057479A (en) * | 1976-02-26 | 1977-11-08 | Billings Energy Research Corporation | Solid polymer electrolyte cell construction |
| US4043933A (en) * | 1976-06-15 | 1977-08-23 | United Technologies Corporation | Method of fabricating a fuel cell electrode |
| DE2802257C2 (de) * | 1977-01-21 | 1986-01-02 | Studiecentrum voor Kernenergie, S.C.K., Brüssel/Bruxelles | Membran für eine elektrochemische Zelle und ihre Verwendung in einer Elektrolysevorrichtung |
-
1978
- 1978-07-06 US US05/922,287 patent/US4210501A/en not_active Expired - Lifetime
- 1978-10-12 DE DE2844499A patent/DE2844499C2/de not_active Expired
- 1978-10-27 GB GB7842326A patent/GB2009792B/en not_active Expired
- 1978-10-31 CA CA315,521A patent/CA1125697A/en not_active Expired
- 1978-11-06 IN IN1200/CAL/78A patent/IN150899B/en unknown
- 1978-12-01 IT IT30453/78A patent/IT1104585B/it active
- 1978-12-04 DD DD78209499A patent/DD143932A5/de unknown
- 1978-12-06 ES ES475786A patent/ES475786A1/es not_active Expired
- 1978-12-08 SE SE7812641A patent/SE7812641L/xx unknown
- 1978-12-08 PL PL1978211561A patent/PL117326B1/pl unknown
- 1978-12-08 NL NL7811996A patent/NL7811996A/xx not_active Application Discontinuation
- 1978-12-08 MX MX175932A patent/MX148462A/es unknown
- 1978-12-08 FR FR7834643A patent/FR2411248A1/fr active Granted
- 1978-12-08 JP JP15117478A patent/JPS5495996A/ja active Granted
-
1979
- 1979-06-04 ES ES481257A patent/ES481257A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2844499A1 (de) | 1979-06-13 |
| US4210501A (en) | 1980-07-01 |
| JPS5495996A (en) | 1979-07-28 |
| FR2411248B1 (cg-RX-API-DMAC10.html) | 1983-01-28 |
| DE2844499C2 (de) | 1984-01-05 |
| ES481257A1 (es) | 1980-02-16 |
| ES475786A1 (es) | 1980-01-16 |
| DD143932A5 (de) | 1980-09-17 |
| IN150899B (cg-RX-API-DMAC10.html) | 1983-01-08 |
| PL117326B1 (en) | 1981-07-31 |
| FR2411248A1 (fr) | 1979-07-06 |
| GB2009792A (en) | 1979-06-20 |
| GB2009792B (en) | 1982-08-04 |
| JPS6127472B2 (cg-RX-API-DMAC10.html) | 1986-06-25 |
| IT1104585B (it) | 1985-10-21 |
| PL211561A1 (cg-RX-API-DMAC10.html) | 1980-02-25 |
| NL7811996A (nl) | 1979-06-12 |
| IT7830453A0 (it) | 1978-12-01 |
| SE7812641L (sv) | 1979-06-10 |
| MX148462A (es) | 1983-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1125697A (en) | Electrolysis of hydrogen halide in cell with catalytic electrodes bonded to membrane | |
| US4224121A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| US4311569A (en) | Device for evolution of oxygen with ternary electrocatalysts containing valve metals | |
| US4528083A (en) | Device for evolution of oxygen with ternary electrocatalysts containing valve metals | |
| CA2177133C (en) | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a cation-transporting membrane | |
| US4191618A (en) | Production of halogens in an electrolysis cell with catalytic electrodes bonded to an ion transporting membrane and an oxygen depolarized cathode | |
| US4707229A (en) | Method for evolution of oxygen with ternary electrocatalysts containing valve metals | |
| US4457823A (en) | Thermally stabilized reduced platinum oxide electrocatalyst | |
| CA1153730A (en) | Three-compartment cell with self-pressurized buffer compartment | |
| US4457824A (en) | Method and device for evolution of oxygen with ternary electrocatalysts containing valve metals | |
| CA1153729A (en) | Three-compartment cell with a pressurized buffer compartment | |
| EP0040031B1 (en) | Anode catalyst and generation of oxygen | |
| JP2000104189A (ja) | 過酸化水素の製造方法及び製造用電解槽 | |
| GB2071157A (en) | Catalytic electrode and combined catalytic electrode and electrolytic structure | |
| JPH04500097A (ja) | 水酸化第四アンモニウムの製造の改良方法 | |
| US4956061A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| US4772364A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| JP3538271B2 (ja) | 塩酸電解装置 | |
| SU1584752A3 (ru) | Способ получени хлора и гидроокиси натри | |
| US4360416A (en) | Anode catalysts for electrolysis of brine | |
| US5976346A (en) | Membrane hydration in electrochemical conversion of anhydrous hydrogen halide to halogen gas | |
| EP0828865B1 (en) | Electrochemical conversion of anhydrous hydrogen halide to halogen gas using a cation-transporting membrane | |
| US4569735A (en) | Production of halogens by electrolysis of alkali metal halides in an electrolysis cell having catalytic electrodes bonded to the surface of a solid polymer electrolyte membrane | |
| JPS58181879A (ja) | ハロゲンの電解製造法 | |
| EP0039608B1 (en) | Halogen evolution with improved anode catalyst |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |