CA1113509A - Xylene isomerization - Google Patents
Xylene isomerizationInfo
- Publication number
- CA1113509A CA1113509A CA329,236A CA329236A CA1113509A CA 1113509 A CA1113509 A CA 1113509A CA 329236 A CA329236 A CA 329236A CA 1113509 A CA1113509 A CA 1113509A
- Authority
- CA
- Canada
- Prior art keywords
- zeolite
- process according
- xylene
- crystal size
- micron
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 title claims abstract description 66
- 239000008096 xylene Substances 0.000 title claims abstract description 47
- 238000006317 isomerization reaction Methods 0.000 title abstract description 31
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims abstract description 126
- 239000010457 zeolite Substances 0.000 claims abstract description 107
- 229910021536 Zeolite Inorganic materials 0.000 claims abstract description 96
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 claims abstract description 66
- 239000003054 catalyst Substances 0.000 claims abstract description 59
- 239000013078 crystal Substances 0.000 claims abstract description 50
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 claims abstract description 44
- 238000000034 method Methods 0.000 claims abstract description 38
- 239000000203 mixture Substances 0.000 claims abstract description 34
- 230000008569 process Effects 0.000 claims abstract description 34
- 229910000323 aluminium silicate Inorganic materials 0.000 claims abstract description 29
- 238000006243 chemical reaction Methods 0.000 claims abstract description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims abstract description 12
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims abstract description 10
- 239000000377 silicon dioxide Substances 0.000 claims abstract description 6
- 238000001179 sorption measurement Methods 0.000 claims description 23
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 claims description 12
- 239000011230 binding agent Substances 0.000 claims description 10
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 239000000395 magnesium oxide Substances 0.000 claims description 7
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical group [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 5
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 4
- 229910052753 mercury Inorganic materials 0.000 claims description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 229940058172 ethylbenzene Drugs 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 abstract description 13
- 230000003197 catalytic effect Effects 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 37
- 229910052698 phosphorus Inorganic materials 0.000 description 27
- 239000011574 phosphorus Substances 0.000 description 27
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 24
- -1 alkyl aromatic compounds Chemical class 0.000 description 16
- 229910052796 boron Inorganic materials 0.000 description 16
- 238000010438 heat treatment Methods 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 14
- 239000001257 hydrogen Substances 0.000 description 13
- 229910052739 hydrogen Inorganic materials 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- 239000007788 liquid Substances 0.000 description 11
- 150000003738 xylenes Chemical class 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 9
- 229930195733 hydrocarbon Natural products 0.000 description 9
- 150000002430 hydrocarbons Chemical class 0.000 description 9
- 239000004215 Carbon black (E152) Substances 0.000 description 8
- 239000011777 magnesium Substances 0.000 description 8
- 229910052749 magnesium Inorganic materials 0.000 description 8
- 229940091250 magnesium supplement Drugs 0.000 description 8
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- 239000000571 coke Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- 229940078552 o-xylene Drugs 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 150000001340 alkali metals Chemical group 0.000 description 3
- 229910052787 antimony Inorganic materials 0.000 description 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 3
- 229910000410 antimony oxide Inorganic materials 0.000 description 3
- 238000001354 calcination Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 150000002681 magnesium compounds Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003463 sulfur Chemical class 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- JYIBXUUINYLWLR-UHFFFAOYSA-N aluminum;calcium;potassium;silicon;sodium;trihydrate Chemical compound O.O.O.[Na].[Al].[Si].[K].[Ca] JYIBXUUINYLWLR-UHFFFAOYSA-N 0.000 description 2
- 150000001639 boron compounds Chemical class 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910001603 clinoptilolite Inorganic materials 0.000 description 2
- 239000002131 composite material Substances 0.000 description 2
- 238000007323 disproportionation reaction Methods 0.000 description 2
- 229910052675 erionite Inorganic materials 0.000 description 2
- 239000007792 gaseous phase Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000012263 liquid product Substances 0.000 description 2
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- RYIOLWQRQXDECZ-UHFFFAOYSA-N phosphinous acid Chemical class PO RYIOLWQRQXDECZ-UHFFFAOYSA-N 0.000 description 2
- 150000003009 phosphonic acids Chemical class 0.000 description 2
- 239000006069 physical mixture Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000008929 regeneration Effects 0.000 description 2
- 238000011069 regeneration method Methods 0.000 description 2
- 238000010025 steaming Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 2
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 2
- QPKFVRWIISEVCW-UHFFFAOYSA-N 1-butane boronic acid Chemical compound CCCCB(O)O QPKFVRWIISEVCW-UHFFFAOYSA-N 0.000 description 1
- MNZAKDODWSQONA-UHFFFAOYSA-N 1-dibutylphosphorylbutane Chemical compound CCCCP(=O)(CCCC)CCCC MNZAKDODWSQONA-UHFFFAOYSA-N 0.000 description 1
- 101100305864 Alteromonas mediterranea (strain DSM 17117 / CIP 110805 / LMG 28347 / Deep ecotype) rph2 gene Proteins 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- NHEULQMXMXIOJY-UHFFFAOYSA-N Cl[PH2]=O Chemical class Cl[PH2]=O NHEULQMXMXIOJY-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- 101100135363 Yarrowia lipolytica (strain CLIB 122 / E 150) RIM101 gene Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- WTQCGJHQHGPVTP-UHFFFAOYSA-N [O-]C.[O-]C.[B+2]CCCC Chemical compound [O-]C.[O-]C.[B+2]CCCC WTQCGJHQHGPVTP-UHFFFAOYSA-N 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005600 alkyl phosphonate group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- HPTYUNKZVDYXLP-UHFFFAOYSA-N aluminum;trihydroxy(trihydroxysilyloxy)silane;hydrate Chemical group O.[Al].[Al].O[Si](O)(O)O[Si](O)(O)O HPTYUNKZVDYXLP-UHFFFAOYSA-N 0.000 description 1
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 1
- 239000011959 amorphous silica alumina Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- SZOADBKOANDULT-UHFFFAOYSA-K antimonous acid Chemical compound O[Sb](O)O SZOADBKOANDULT-UHFFFAOYSA-K 0.000 description 1
- 150000001462 antimony Chemical class 0.000 description 1
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 1
- 150000001463 antimony compounds Chemical class 0.000 description 1
- 229910000074 antimony hydride Inorganic materials 0.000 description 1
- DNCQWNWCEBTKGC-UHFFFAOYSA-N azane;phosphorous acid Chemical class N.N.OP(O)O DNCQWNWCEBTKGC-UHFFFAOYSA-N 0.000 description 1
- 230000002902 bimodal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910010277 boron hydride Inorganic materials 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- FLLNLJJKHKZKMB-UHFFFAOYSA-N boron;tetramethylazanium Chemical compound [B].C[N+](C)(C)C FLLNLJJKHKZKMB-UHFFFAOYSA-N 0.000 description 1
- OOSPDKSZPPFOBR-UHFFFAOYSA-N butyl dihydrogen phosphite Chemical compound CCCCOP(O)O OOSPDKSZPPFOBR-UHFFFAOYSA-N 0.000 description 1
- DLIJPAHLBJIQHE-UHFFFAOYSA-N butylphosphane Chemical compound CCCCP DLIJPAHLBJIQHE-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- UNYSKUBLZGJSLV-UHFFFAOYSA-L calcium;1,3,5,2,4,6$l^{2}-trioxadisilaluminane 2,4-dioxide;dihydroxide;hexahydrate Chemical compound O.O.O.O.O.O.[OH-].[OH-].[Ca+2].O=[Si]1O[Al]O[Si](=O)O1.O=[Si]1O[Al]O[Si](=O)O1 UNYSKUBLZGJSLV-UHFFFAOYSA-L 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229910052676 chabazite Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- NDDSMIZUPBHSCL-UHFFFAOYSA-N chloro hypochlorite;phenylphosphane Chemical compound ClOCl.PC1=CC=CC=C1 NDDSMIZUPBHSCL-UHFFFAOYSA-N 0.000 description 1
- KMJJJTCKNZYTEY-UHFFFAOYSA-N chloro-diethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(Cl)(=S)OCC KMJJJTCKNZYTEY-UHFFFAOYSA-N 0.000 description 1
- XGRJZXREYAXTGV-UHFFFAOYSA-N chlorodiphenylphosphine Chemical compound C=1C=CC=CC=1P(Cl)C1=CC=CC=C1 XGRJZXREYAXTGV-UHFFFAOYSA-N 0.000 description 1
- DQTRYXANLKJLPK-UHFFFAOYSA-N chlorophosphonous acid Chemical class OP(O)Cl DQTRYXANLKJLPK-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- DNUFCIOKWJELSH-UHFFFAOYSA-O diazanium dioxido(oxo)phosphanium Chemical compound [NH4+].[NH4+].[O-][P+]([O-])=O DNUFCIOKWJELSH-UHFFFAOYSA-O 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 229910001649 dickite Inorganic materials 0.000 description 1
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical compound CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 1
- RDXABLXNTVBVML-UHFFFAOYSA-N diethoxyphosphanyl diethyl phosphite Chemical compound CCOP(OCC)OP(OCC)OCC RDXABLXNTVBVML-UHFFFAOYSA-N 0.000 description 1
- ZUKLAAHCPUBQLQ-UHFFFAOYSA-N diethylphosphinous acid Chemical compound CCP(O)CC ZUKLAAHCPUBQLQ-UHFFFAOYSA-N 0.000 description 1
- BEQVQKJCLJBTKZ-UHFFFAOYSA-N diphenylphosphinic acid Chemical compound C=1C=CC=CC=1P(=O)(O)C1=CC=CC=C1 BEQVQKJCLJBTKZ-UHFFFAOYSA-N 0.000 description 1
- NFORZJQPTUSMRL-UHFFFAOYSA-N dipropan-2-yl hydrogen phosphite Chemical compound CC(C)OP(O)OC(C)C NFORZJQPTUSMRL-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 229910001683 gmelinite Inorganic materials 0.000 description 1
- 229910052621 halloysite Inorganic materials 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052677 heulandite Inorganic materials 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 229910052610 inosilicate Inorganic materials 0.000 description 1
- RGXCTRIQQODGIZ-UHFFFAOYSA-O isodesmosine Chemical compound OC(=O)C(N)CCCC[N+]1=CC(CCC(N)C(O)=O)=CC(CCC(N)C(O)=O)=C1CCCC(N)C(O)=O RGXCTRIQQODGIZ-UHFFFAOYSA-O 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 229910001711 laumontite Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- PJJZFXPJNUVBMR-UHFFFAOYSA-L magnesium benzoate Chemical compound [Mg+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 PJJZFXPJNUVBMR-UHFFFAOYSA-L 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 229910012375 magnesium hydride Inorganic materials 0.000 description 1
- OVGXLJDWSLQDRT-UHFFFAOYSA-L magnesium lactate Chemical compound [Mg+2].CC(O)C([O-])=O.CC(O)C([O-])=O OVGXLJDWSLQDRT-UHFFFAOYSA-L 0.000 description 1
- 239000000626 magnesium lactate Substances 0.000 description 1
- 229960004658 magnesium lactate Drugs 0.000 description 1
- 235000015229 magnesium lactate Nutrition 0.000 description 1
- UHNWOJJPXCYKCG-UHFFFAOYSA-L magnesium oxalate Chemical compound [Mg+2].[O-]C(=O)C([O-])=O UHNWOJJPXCYKCG-UHFFFAOYSA-L 0.000 description 1
- 229940063002 magnesium palmitate Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- QENHCSSJTJWZAL-UHFFFAOYSA-N magnesium sulfide Chemical compound [Mg+2].[S-2] QENHCSSJTJWZAL-UHFFFAOYSA-N 0.000 description 1
- CGSNFLLWLBPMLH-UHFFFAOYSA-L magnesium;2-ethylhexanoate Chemical compound [Mg+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O CGSNFLLWLBPMLH-UHFFFAOYSA-L 0.000 description 1
- PKMBLJNMKINMSK-UHFFFAOYSA-N magnesium;azanide Chemical compound [NH2-].[NH2-].[Mg+2] PKMBLJNMKINMSK-UHFFFAOYSA-N 0.000 description 1
- GMDNUWQNDQDBNQ-UHFFFAOYSA-L magnesium;diformate Chemical compound [Mg+2].[O-]C=O.[O-]C=O GMDNUWQNDQDBNQ-UHFFFAOYSA-L 0.000 description 1
- BJZBHTNKDCBDNQ-UHFFFAOYSA-L magnesium;dodecanoate Chemical compound [Mg+2].CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O BJZBHTNKDCBDNQ-UHFFFAOYSA-L 0.000 description 1
- ABSWXCXMXIZDSN-UHFFFAOYSA-L magnesium;hexadecanoate Chemical compound [Mg+2].CCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCC([O-])=O ABSWXCXMXIZDSN-UHFFFAOYSA-L 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- AXLHVTKGDPVANO-UHFFFAOYSA-N methyl 2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate Chemical compound COC(=O)C(N)CNC(=O)OC(C)(C)C AXLHVTKGDPVANO-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 229910052680 mordenite Inorganic materials 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000008301 phosphite esters Chemical class 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000002407 reforming Methods 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical compound [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 1
- 125000001880 stiboryl group Chemical group *[Sb](*)(*)=O 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- ZVTQDOIPKNCMAR-UHFFFAOYSA-N sulfanylidene(sulfanylideneboranylsulfanyl)borane Chemical compound S=BSB=S ZVTQDOIPKNCMAR-UHFFFAOYSA-N 0.000 description 1
- OKQKDCXVLPGWPO-UHFFFAOYSA-N sulfanylidenephosphane Chemical group S=P OKQKDCXVLPGWPO-UHFFFAOYSA-N 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 238000010555 transalkylation reaction Methods 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 description 1
- WVLBCYQITXONBZ-UHFFFAOYSA-N trimethyl phosphate Chemical compound COP(=O)(OC)OC WVLBCYQITXONBZ-UHFFFAOYSA-N 0.000 description 1
- MXSVLWZRHLXFKH-UHFFFAOYSA-N triphenylborane Chemical compound C1=CC=CC=C1B(C=1C=CC=CC=1)C1=CC=CC=C1 MXSVLWZRHLXFKH-UHFFFAOYSA-N 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 239000011800 void material Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C5/00—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms
- C07C5/22—Preparation of hydrocarbons from hydrocarbons containing the same number of carbon atoms by isomerisation
- C07C5/27—Rearrangement of carbon atoms in the hydrocarbon skeleton
- C07C5/2767—Changing the number of side-chains
- C07C5/277—Catalytic processes
- C07C5/2775—Catalytic processes with crystalline alumino-silicates, e.g. molecular sieves
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/52—Improvements relating to the production of bulk chemicals using catalysts, e.g. selective catalysts
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US913,999 | 1978-06-09 | ||
| US05/913,999 US4159282A (en) | 1978-06-09 | 1978-06-09 | Xylene isomerization |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1113509A true CA1113509A (en) | 1981-12-01 |
Family
ID=25433793
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA329,236A Expired CA1113509A (en) | 1978-06-09 | 1979-06-07 | Xylene isomerization |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4159282A (enExample) |
| EP (1) | EP0006700B1 (enExample) |
| JP (2) | JPS55394A (enExample) |
| AU (1) | AU519892B2 (enExample) |
| CA (1) | CA1113509A (enExample) |
| DE (1) | DE2965029D1 (enExample) |
| ZA (1) | ZA792781B (enExample) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4231955A (en) * | 1979-07-13 | 1980-11-04 | Mobil Oil Corporation | Synthesis of alkyl and alkylaminonitriles |
| CA1148569A (en) * | 1980-02-14 | 1983-06-21 | Christine H. Kursewicz | Aromatics processing |
| ATE14869T1 (de) * | 1980-12-12 | 1985-08-15 | Exxon Research Engineering Co | Xylol-isomerisierung. |
| US4704495A (en) * | 1980-12-29 | 1987-11-03 | Mobil Oil Corporation | Catalytic conversions using shape selective metallic catalysts |
| US4482773A (en) * | 1982-02-25 | 1984-11-13 | Mobil Oil Corporation | Catalyst for xylene isomerization |
| NZ203202A (en) * | 1982-02-25 | 1985-04-30 | Mobil Oil Corp | Isomerisation of aromatic c8 feed:zeolite catalyst of crystal size greater than 1 micron containing p+ and mg |
| US4537995A (en) * | 1983-11-07 | 1985-08-27 | Celanese Corporation | Isomerization of branched aldehydes to ketones |
| US4899011A (en) * | 1986-01-15 | 1990-02-06 | Mobil Oil Corporation | Xylene isomerization process to exhaustively convert ethylbenzene and non-aromatics |
| US4723050A (en) * | 1986-09-03 | 1988-02-02 | Cosden Technology, Inc. | Xylene isomerization process |
| US4762957A (en) * | 1987-06-10 | 1988-08-09 | Uop Inc. | Process for isomerization of alkylaromatics |
| JPS6456628A (en) * | 1987-08-25 | 1989-03-03 | Toray Industries | Production of p-xylene |
| US4962259A (en) * | 1987-10-16 | 1990-10-09 | Uop | Catalyst for isomerizing alkylaromatics |
| US5043512A (en) * | 1988-10-06 | 1991-08-27 | Mobil Oil Corp. | Alkylaromatic isomerization process |
| US5030787A (en) * | 1990-01-24 | 1991-07-09 | Mobil Oil Corp. | Catalytic disproportionation/transalkylation utilizing a C9+ aromatics feed |
| US5028573A (en) * | 1990-01-29 | 1991-07-02 | Mobil Oil Corp. | Dual function catalyst and isomerization therewith |
| US5082984A (en) * | 1990-01-29 | 1992-01-21 | Mobil Oil Corp. | Dual function catalyst and isomerization therewith |
| US5554274A (en) * | 1992-12-11 | 1996-09-10 | Mobil Oil Corporation | Manufacture of improved catalyst |
| US5958217A (en) * | 1995-11-15 | 1999-09-28 | Chevron Chemical Company Llc | Two-stage reforming process that enhances para-xylene yield and minimizes ethylbenzene production |
| US6518472B1 (en) | 1996-08-05 | 2003-02-11 | Bp Corporation North America Inc. | Stabilized dual bed xylene isomerization catalyst system |
| US5877374A (en) * | 1997-04-02 | 1999-03-02 | Chevron Chemical Company | Low pressure hydrodealkylation of ethylbenzene and xylene isomerization |
| US6156689A (en) * | 1997-10-23 | 2000-12-05 | Phillips Petroleum Company | Catalyst composition comprising zinc compound or boron compound and hydrocarbon conversion process |
| US5981418A (en) * | 1998-04-08 | 1999-11-09 | Phillips Petroleum Company | Zeolite based catalyst containing zinc, boron and phosphorus and method of making such zeolite based catalyst |
| KR100506153B1 (ko) * | 1998-04-10 | 2006-02-28 | 에스케이 주식회사 | 크실렌 이성화용 촉매 및 이의 제조방법 |
| EP1109761B1 (en) * | 1998-08-25 | 2003-05-07 | Exxonmobil Oil Corporation | Para-xylene production process |
| US6815570B1 (en) * | 2002-05-07 | 2004-11-09 | Uop Llc | Shaped catalysts for transalkylation of aromatics for enhanced xylenes production |
| US6906233B2 (en) * | 2002-12-12 | 2005-06-14 | Exxon Mobil Chemical Patents Inc. | Modified metalloaluminophosphate molecular sieves |
| US6812373B2 (en) * | 2002-12-12 | 2004-11-02 | Exxonmobil Chemical Patents Inc. | Modified metalloaluminophosphate molecular sieves |
| TWI263630B (en) * | 2003-07-08 | 2006-10-11 | Toray Industries | Conversion catalyst for ethylbenzene containing xylenes and process for converting ethylbenzene containing xylenes by using catalyst |
| US7247762B2 (en) * | 2003-09-12 | 2007-07-24 | Exxonmobil Chemical Patents Inc. | Process for xylene isomerization and ethylbenzene conversion |
| US7411103B2 (en) * | 2003-11-06 | 2008-08-12 | Haldor Topsoe A/S | Process for the catalytic isomerisation of aromatic compounds |
| US6972348B2 (en) * | 2004-03-24 | 2005-12-06 | Uop Llc | Catalytic conversion of polycyclic aromatics into xylenes |
| US7220885B2 (en) * | 2004-05-27 | 2007-05-22 | Uop Llc | Catalyst treatment useful for aromatics conversion process |
| US7273828B1 (en) | 2004-05-27 | 2007-09-25 | Uop Llc | Catalyst treatment useful for aromatics conversion process |
| US7271118B2 (en) | 2004-07-29 | 2007-09-18 | Exxonmobil Chemical Patents Inc. | Xylenes isomerization catalyst system and use thereof |
| US7154014B1 (en) * | 2004-09-22 | 2006-12-26 | Uop Llc | Alumina guard bed for aromatics transalkylation process |
| US7271303B1 (en) | 2004-09-22 | 2007-09-18 | Uop Llc | Multi-zone process for the production of diesel and aromatic compounds |
| US7371913B2 (en) * | 2005-06-30 | 2008-05-13 | Uop Llc | Selective aromatics isomerization process |
| KR101470623B1 (ko) * | 2006-11-17 | 2014-12-12 | 에스케이이노베이션 주식회사 | 자일렌 이성화 촉매 및 그 제조방법 |
| US20080146859A1 (en) * | 2006-12-18 | 2008-06-19 | Rekoske James E | Selective Aromatics Isomerization Process |
| US7692052B2 (en) * | 2006-12-29 | 2010-04-06 | Uop Llc | Multi-zone process for the production of xylene compounds |
| WO2010000652A1 (en) * | 2008-07-04 | 2010-01-07 | Shell Internationale Research Maatschappij B.V. | Catalyst and isomerisation process |
| US8022263B2 (en) | 2008-11-19 | 2011-09-20 | Uop Llc | Selective aromatics isomerization process |
| CN101475438B (zh) * | 2008-12-18 | 2012-05-23 | 中国石油化工股份有限公司 | 苯乙烯存在下苯乙炔选择加氢的方法 |
| JP5550397B2 (ja) * | 2010-03-18 | 2014-07-16 | 帝人株式会社 | 炭素材料からなる燃料電池用電極触媒 |
| US8575055B2 (en) | 2010-03-30 | 2013-11-05 | Uop Llc | Surface-modified zeolites and methods for preparing the same |
| CN102452881B (zh) * | 2010-10-21 | 2015-11-25 | 中国石油化工股份有限公司 | 碳八烷基芳烃侧链异构化的方法 |
| US20130144097A1 (en) | 2011-12-06 | 2013-06-06 | Exxonmobil Chemical Patents Inc. | Aromatics Production Process and Apparatus |
| JP5949069B2 (ja) * | 2012-04-03 | 2016-07-06 | 株式会社明電舎 | 低級炭化水素芳香族化触媒の製造方法 |
| RU2544241C1 (ru) | 2014-01-22 | 2015-03-20 | Общество С Ограниченной Ответственностью "Новые Газовые Технологии-Синтез" | Способ получения ароматических углеводородов из природного газа и установка для его осуществления |
| RU2558955C1 (ru) | 2014-08-12 | 2015-08-10 | Общество С Ограниченной Ответственностью "Новые Газовые Технологии-Синтез" | Способ получения концентрата ароматических углеводородов из жидких углеводородных фракций и установка для его осуществления |
| RU2544017C1 (ru) | 2014-01-28 | 2015-03-10 | Ольга Васильевна Малова | Катализатор и способ ароматизации с3-с4 газов, легких углеводородных фракций алифатических спиртов, а также их смесей |
| RU2550354C1 (ru) | 2014-03-28 | 2015-05-10 | Общество С Ограниченной Ответственностью "Новые Газовые Технологии-Синтез" | Способ получения концентрата ароматических углеводородов из легких алифатических углеводородов и установка для его осуществления |
| EP3233770B1 (en) * | 2014-12-17 | 2020-07-15 | King Abdullah University Of Science And Technology | Xylene isomerization |
| WO2016148755A1 (en) | 2015-03-19 | 2016-09-22 | Exxonmobil Chemical Patents Inc. | Process and apparatus for the production of para-xylene |
| KR101974770B1 (ko) | 2015-04-30 | 2019-05-02 | 엑손모빌 케미칼 패턴츠 인코포레이티드 | 파라-자일렌의 제조를 위한 방법 및 장치 |
| WO2017048378A1 (en) | 2015-09-17 | 2017-03-23 | Exxonmobil Chemical Patents Inc. | Process for recovering para-xylene using a metal organic framework adsorbent in a simulated moving-bed process |
| WO2017146914A1 (en) | 2016-02-26 | 2017-08-31 | Exxonmobil Chemical Patents Inc. | Process for recovering para-xylene |
| WO2017155424A1 (en) | 2016-03-09 | 2017-09-14 | Limited Liability Company "New Gas Technologies-Synthesis" (Llc "Ngt-Synthesis") | Method and plant for producing high-octane gasolines |
| US10351489B2 (en) | 2016-06-30 | 2019-07-16 | Exxonmobil Chemical Patents Inc. | Processes for recovering paraxylene |
| US10300404B2 (en) | 2016-06-30 | 2019-05-28 | Exxonmobil Chemical Patents Inc. | Process for the recovering of paraxylene |
| RU2747869C1 (ru) | 2020-06-29 | 2021-05-17 | Общество С Ограниченной Ответственностью "Новые Газовые Технологии-Синтез" (Ооо "Нгт-Синтез") | Способ получения бензинов или концентратов ароматических соединений с различным распределением потоков оксигената и олефинсодержащей фракции |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3702886A (en) * | 1969-10-10 | 1972-11-14 | Mobil Oil Corp | Crystalline zeolite zsm-5 and method of preparing the same |
| US3856872A (en) * | 1973-09-13 | 1974-12-24 | Mobil Oil Corp | Xylene isomerization |
| US3856874A (en) * | 1973-09-13 | 1974-12-24 | Mobil Oil Corp | Xylene isomerization |
| JPS5341658B2 (enExample) * | 1973-09-13 | 1978-11-06 | ||
| US3856873A (en) * | 1973-09-13 | 1974-12-24 | Mobil Oil Corp | Xylene isomerization |
| US3856871A (en) * | 1973-09-13 | 1974-12-24 | Mobil Oil Corp | Xylene isomerization |
| US4100214A (en) * | 1976-05-07 | 1978-07-11 | Mobil Oil Corporation | Isomerization of monocyclic alkyl aromatic hydrocarbons |
| JPS6024772A (ja) * | 1983-07-20 | 1985-02-07 | Nec Corp | 画情報表示制御装置 |
| JPS6024769A (ja) * | 1983-07-20 | 1985-02-07 | Ricoh Co Ltd | 中間調画像記録方式 |
-
1978
- 1978-06-09 US US05/913,999 patent/US4159282A/en not_active Ceased
-
1979
- 1979-06-05 AU AU47775/79A patent/AU519892B2/en not_active Ceased
- 1979-06-05 ZA ZA792781A patent/ZA792781B/xx unknown
- 1979-06-07 CA CA329,236A patent/CA1113509A/en not_active Expired
- 1979-06-07 JP JP7069379A patent/JPS55394A/ja active Granted
- 1979-06-08 DE DE7979301090T patent/DE2965029D1/de not_active Expired
- 1979-06-08 EP EP79301090A patent/EP0006700B1/en not_active Expired
-
1990
- 1990-01-10 JP JP2001643A patent/JPH03204825A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US4159282A (en) | 1979-06-26 |
| DE2965029D1 (en) | 1983-04-21 |
| EP0006700B1 (en) | 1983-03-16 |
| AU519892B2 (en) | 1981-12-24 |
| JPH03204825A (ja) | 1991-09-06 |
| JPS6256138B2 (enExample) | 1987-11-24 |
| ZA792781B (en) | 1981-01-28 |
| JPS55394A (en) | 1980-01-05 |
| AU4777579A (en) | 1979-12-13 |
| EP0006700A1 (en) | 1980-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1113509A (en) | Xylene isomerization | |
| US4086287A (en) | Selective ethylation of mono alkyl benzenes | |
| USRE31782E (en) | Xylene isomerization | |
| US3965208A (en) | Methylation of toluene | |
| US4117024A (en) | Ethylation of aromatic compounds | |
| US4128592A (en) | Selective production of para dialkyl benzene | |
| US4002698A (en) | Methylation of toluene in the presence of a phosphorus-modified activated crystalline aluminosilicate catalyst | |
| CA1086707A (en) | Catalyst and process for selective production of para dialkyl substituted benzenes | |
| US4143084A (en) | Di-alkylbenzene isomer mixtures | |
| US3962364A (en) | Alkylation in presence of phosphorus-modified crystalline luminosilicate catalyst | |
| US4465886A (en) | Silica-modified catalyst and use for selective production of para-dialkyl substituted benzenes | |
| US4477583A (en) | Silica-modified catalyst and use for selective production of para-dialkyl substituted benzenes | |
| US4080396A (en) | Selective production of para-xylene by conversion of olefins | |
| US3965207A (en) | Selective production of para-xylene | |
| CA1153748A (en) | Shape selective reactions with group via modified zeolite catalysts | |
| CA1084954A (en) | Disproportionation of toluene | |
| US4379761A (en) | Catalyst and process for making said catalyst | |
| CA1152482A (en) | Method for maintaining para-selectivity of modified zeolite catalyst | |
| US4695666A (en) | Phosphorus-containing alumina catalyst for the isomerization of aromatics | |
| US4181811A (en) | Selective reaction of 1,4-disubstituted aromatic compounds | |
| CA1122228A (en) | Selective reaction of 1,4-disubstituted benzene compounds | |
| CA1153747A (en) | Shape selective reactions with group viia metal modified zeolite catalysts | |
| US4371721A (en) | Selective cracking of disubstituted benzenes having polar substituents | |
| US4349461A (en) | Group VIIA metal-modified zeolite catalysts | |
| US4532226A (en) | Zeolite catalysts modified with Group VI A metal |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |