CA1109342A - Internally coated reaction vessel for use in olefinic polymerization - Google Patents
Internally coated reaction vessel for use in olefinic polymerizationInfo
- Publication number
- CA1109342A CA1109342A CA299,215A CA299215A CA1109342A CA 1109342 A CA1109342 A CA 1109342A CA 299215 A CA299215 A CA 299215A CA 1109342 A CA1109342 A CA 1109342A
- Authority
- CA
- Canada
- Prior art keywords
- condensation product
- reaction vessel
- self
- resorcinol
- polyhydric
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000006116 polymerization reaction Methods 0.000 title claims abstract description 48
- 238000006243 chemical reaction Methods 0.000 title abstract description 28
- 238000000576 coating method Methods 0.000 claims abstract description 59
- 239000011248 coating agent Substances 0.000 claims abstract description 55
- 239000007859 condensation product Substances 0.000 claims abstract description 42
- 229920000642 polymer Polymers 0.000 claims abstract description 35
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 19
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims abstract description 17
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims abstract description 9
- 150000002989 phenols Chemical class 0.000 claims abstract description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 49
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims description 36
- 238000000034 method Methods 0.000 claims description 30
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 28
- 229910001868 water Inorganic materials 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- 230000008569 process Effects 0.000 claims description 19
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 claims description 16
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical group [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 claims description 3
- 239000003963 antioxidant agent Substances 0.000 claims description 3
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 claims description 3
- 229960001553 phloroglucinol Drugs 0.000 claims description 3
- 230000003078 antioxidant effect Effects 0.000 claims description 2
- 239000000178 monomer Substances 0.000 abstract description 25
- -1 vinyl halides Chemical class 0.000 abstract description 12
- 239000000203 mixture Chemical group 0.000 abstract description 8
- 239000012298 atmosphere Substances 0.000 abstract description 7
- 239000008199 coating composition Substances 0.000 abstract description 5
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 abstract description 5
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical group C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 abstract description 5
- 229920002554 vinyl polymer Polymers 0.000 abstract description 5
- 230000000379 polymerizing effect Effects 0.000 abstract description 3
- 239000004615 ingredient Substances 0.000 abstract description 2
- 239000000243 solution Substances 0.000 description 43
- 239000003054 catalyst Substances 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 239000007787 solid Substances 0.000 description 13
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 9
- 238000007792 addition Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 230000002411 adverse Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000005507 spraying Methods 0.000 description 5
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- 238000013019 agitation Methods 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 150000004780 naphthols Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000007790 scraping Methods 0.000 description 3
- 238000001179 sorption measurement Methods 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 229960005070 ascorbic acid Drugs 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- CPRMKOQKXYSDML-UHFFFAOYSA-M rubidium hydroxide Chemical compound [OH-].[Rb+] CPRMKOQKXYSDML-UHFFFAOYSA-M 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 150000005207 1,3-dihydroxybenzenes Chemical class 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- AEPWOCLBLLCOGZ-UHFFFAOYSA-N 2-cyanoethyl prop-2-enoate Chemical compound C=CC(=O)OCCC#N AEPWOCLBLLCOGZ-UHFFFAOYSA-N 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 241000282337 Nasua nasua Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- CWQSNJSRIUPVNR-UHFFFAOYSA-M [OH-].[Fr+] Chemical compound [OH-].[Fr+] CWQSNJSRIUPVNR-UHFFFAOYSA-M 0.000 description 1
- 230000010062 adhesion mechanism Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- NSGQRLUGQNBHLD-UHFFFAOYSA-N butan-2-yl butan-2-yloxycarbonyloxy carbonate Chemical compound CCC(C)OC(=O)OOC(=O)OC(C)CC NSGQRLUGQNBHLD-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Inorganic materials [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 231100000206 health hazard Toxicity 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- DFQICHCWIIJABH-UHFFFAOYSA-N naphthalene-2,7-diol Chemical compound C1=CC(O)=CC2=CC(O)=CC=C21 DFQICHCWIIJABH-UHFFFAOYSA-N 0.000 description 1
- 229940065472 octyl acrylate Drugs 0.000 description 1
- ANISOHQJBAQUQP-UHFFFAOYSA-N octyl prop-2-enoate Chemical compound CCCCCCCCOC(=O)C=C ANISOHQJBAQUQP-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000007965 phenolic acids Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920002863 poly(1,4-phenylene oxide) polymer Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- PPASLZSBLFJQEF-RKJRWTFHSA-M sodium ascorbate Substances [Na+].OC[C@@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RKJRWTFHSA-M 0.000 description 1
- 235000010378 sodium ascorbate Nutrition 0.000 description 1
- 229960005055 sodium ascorbate Drugs 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/002—Scale prevention in a polymerisation reactor or its auxiliary parts
- C08F2/004—Scale prevention in a polymerisation reactor or its auxiliary parts by a prior coating on the reactor walls
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G2261/00—Macromolecular compounds obtained by reactions forming a carbon-to-carbon link in the main chain of the macromolecule
- C08G2261/30—Monomer units or repeat units incorporating structural elements in the main chain
- C08G2261/31—Monomer units or repeat units incorporating structural elements in the main chain incorporating aromatic structural elements in the main chain
- C08G2261/312—Non-condensed aromatic systems, e.g. benzene
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Materials For Medical Uses (AREA)
- Treatments Of Macromolecular Shaped Articles (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US807,959 | 1977-06-20 | ||
| US05/807,959 US4080173A (en) | 1977-06-20 | 1977-06-20 | Internally coated reaction vessel for use in olefinic polymerization |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1109342A true CA1109342A (en) | 1981-09-22 |
Family
ID=25197525
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA299,215A Expired CA1109342A (en) | 1977-06-20 | 1978-03-17 | Internally coated reaction vessel for use in olefinic polymerization |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4080173A (en:Method) |
| JP (1) | JPS547487A (en:Method) |
| AT (1) | AT363684B (en:Method) |
| AU (1) | AU516968B2 (en:Method) |
| BE (1) | BE865096A (en:Method) |
| BR (1) | BR7801707A (en:Method) |
| CA (1) | CA1109342A (en:Method) |
| CH (1) | CH628524A5 (en:Method) |
| DE (1) | DE2826681A1 (en:Method) |
| DK (1) | DK151887C (en:Method) |
| ES (1) | ES468080A1 (en:Method) |
| FR (1) | FR2395280B1 (en:Method) |
| GB (1) | GB1576198A (en:Method) |
| GR (1) | GR64568B (en:Method) |
| IN (1) | IN147318B (en:Method) |
| IT (1) | IT1111456B (en:Method) |
| MX (1) | MX148167A (en:Method) |
| NL (1) | NL176858C (en:Method) |
| NO (1) | NO155492C (en:Method) |
| NZ (1) | NZ186709A (en:Method) |
| PH (1) | PH13108A (en:Method) |
| PT (1) | PT67795A (en:Method) |
| SE (1) | SE444516B (en:Method) |
| TR (1) | TR20103A (en:Method) |
| YU (1) | YU40032B (en:Method) |
| ZA (1) | ZA782062B (en:Method) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1589404A (en) * | 1976-12-23 | 1981-05-13 | Ici Australia Ltd | Halogenated a-olefin polymerisation process and reactor therefor |
| US4182808A (en) * | 1978-08-25 | 1980-01-08 | The B. F. Goodrich Company | Inversion polymerization process for producing vinyl resins using a dual layer coating |
| AU526104B2 (en) * | 1978-09-08 | 1982-12-16 | Geon Company, The | Polymerization of vinyl chloride |
| US4200712A (en) * | 1978-10-23 | 1980-04-29 | The B. F. Goodrich Company | Coating polymerization reactors with oligomer coatings derived from reaction products of substituted phenols |
| US4228130A (en) * | 1978-10-23 | 1980-10-14 | The B. F. Goodrich Company | Coating polymerization reactors with oligomers derived from polyhydric phenols plus a bleach |
| US4297320A (en) * | 1979-04-30 | 1981-10-27 | The B. F. Goodrich Company | Coating polymerization reactors with the reaction products of thiodiphenols and a bleach |
| CA1147098A (en) * | 1979-04-30 | 1983-05-24 | Louis Cohen | Coating polymerization reactors with the reaction products of thiodiphenols and a bleach |
| US4263421A (en) * | 1979-09-14 | 1981-04-21 | The B. F. Goodrich Company | Process for coating reactors using organic compound vapor application |
| US4267291A (en) * | 1979-09-14 | 1981-05-12 | The B. F. Goodrich Company | Process for coating reactors using organic compound vapor application |
| JPS578207A (en) * | 1980-06-17 | 1982-01-16 | Tokuyama Sekisui Kogyo Kk | Suspension polymerization of vinyl chloride |
| WO1982000645A1 (en) * | 1980-08-25 | 1982-03-04 | Co B F Goodrich | Internally coated reaction vessel for use in emulsion polymerization of olefinic monomers |
| EP0052421B1 (en) * | 1980-10-31 | 1986-11-26 | Imperial Chemical Industries Plc | Vinyl chloride polymerisation process |
| JPH057402B2 (en:Method) * | 1981-01-16 | 1993-01-28 | Goodrich Co B F | |
| DE3176568D1 (en) * | 1981-01-16 | 1988-01-21 | Goodrich Co B F | Internally coated reaction vessel for use in olefinic polymerization |
| GB2101498B (en) * | 1981-05-22 | 1984-09-19 | Kanegafuchi Chemical Ind | A process for polymerizing vinyl chloride |
| GR77680B (en:Method) * | 1981-07-27 | 1984-09-25 | Goodrich Co B F | |
| US4432840A (en) * | 1982-04-26 | 1984-02-21 | Formosa Plastics Corporation | Prevention of polymer buildup in polymerization reactors using thin organic coatings by electrolysis of phenol |
| FR2527102A1 (fr) * | 1982-05-19 | 1983-11-25 | Chloe Chemie | Procede de traitement d'un reacteur de polymerisation |
| US4659791A (en) * | 1984-09-11 | 1987-04-21 | The B.F. Goodrich Company | Internally coated reaction vessel for use in olefinic polymerization |
| US4719089A (en) * | 1984-09-11 | 1988-01-12 | The B. F. Goodrich Company | Internally coated reaction vessel for use in olefinic polymerization |
| US4588613A (en) * | 1984-10-10 | 1986-05-13 | Formosa Plastics Corporation | Process for reducing polymer buildup |
| US4680349A (en) * | 1985-01-14 | 1987-07-14 | Toyo Soda Manufacturing Co., Ltd. | Method of polymerizing vinyl monomers with coated reactor |
| JPH0739445B2 (ja) * | 1988-12-07 | 1995-05-01 | 信越化学工業株式会社 | 重合体スケールの付着防止方法 |
| JP2831412B2 (ja) * | 1989-12-28 | 1998-12-02 | 三井化学株式会社 | 塩化ビニルの重合方法 |
| US5194301A (en) * | 1990-08-09 | 1993-03-16 | Investigacion Y Desarrollo, C.A. | Process for reducing scale formation in vinyl polymerization reactors |
| US5139823A (en) * | 1990-08-09 | 1992-08-18 | Investigacion Y Desarrollo C.A. | Process for reducing scale formation in vinyl polymerization reactors |
| EP0632058B1 (en) * | 1993-06-15 | 1998-01-28 | Shin-Etsu Chemical Co., Ltd. | Polymer scale preventive agent |
| CA2138182C (en) * | 1993-12-27 | 1996-11-12 | Seiichi Masuko | Polymerization process of vinyl chloride |
| EP0702033B1 (en) | 1994-09-14 | 1997-12-03 | Shin-Etsu Chemical Co., Ltd. | Process of producing vinyl chloride type polymer |
| US5780104A (en) * | 1995-12-28 | 1998-07-14 | Mitsui Chemicals, Inc. | Method for preventing the inner wall surfaces of the polymerization apparatus from being fouled with scale during the polymerizatioin of vinyl chloride |
| DE60134503D1 (de) | 2001-12-12 | 2008-07-31 | Tokuyama Corp | Belagsverhinderer, verfahren zu seiner herstellung, polymerisationsreaktor, dessen innenwände mit dem belagsverhinderer bedeckt sind, und verfahren zur herstellung von vinylpolymeren unter verwendung des polymerisationsreaktors |
| JP4554602B2 (ja) * | 2004-03-11 | 2010-09-29 | 株式会社クラレ | スケール付着防止剤 |
| CN109369831A (zh) * | 2018-09-12 | 2019-02-22 | 蓝凤祥 | 一种不需清釜的防冻型多元酚黄色防粘釜剂及其制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3340160A (en) * | 1964-06-23 | 1967-09-05 | Phillips Petroleum Co | Composition and method for inhibiting the formation of polymers during fractional distillation |
| US3825434A (en) * | 1972-10-27 | 1974-07-23 | Goodrich Co B F | Internally coated reaction vessel and process for coating the same |
| US3849179A (en) * | 1973-08-27 | 1974-11-19 | Goodrich Co B F | Internally coated reaction vessel and process for coating the same |
| US4007320A (en) * | 1974-05-21 | 1977-02-08 | Kemanord Aktiebolag | Process for reducing polymer build-up |
| US4024330A (en) * | 1975-04-08 | 1977-05-17 | The B. F. Goodrich Company | Internally coated reaction vessel and process for coating the same |
| CA1077197A (en) * | 1975-03-24 | 1980-05-06 | Kazuhiko Kurimoto | Method for bulk polymerization of vinyl chloride |
| US4024301A (en) * | 1975-05-02 | 1977-05-17 | The B. F. Goodrich Company | Internally coated reaction vessel for use in olefinic polymerization |
| GB1589404A (en) * | 1976-12-23 | 1981-05-13 | Ici Australia Ltd | Halogenated a-olefin polymerisation process and reactor therefor |
-
1977
- 1977-06-20 US US05/807,959 patent/US4080173A/en not_active Expired - Lifetime
-
1978
- 1978-03-16 NZ NZ186709A patent/NZ186709A/xx unknown
- 1978-03-17 GR GR55730A patent/GR64568B/el unknown
- 1978-03-17 IN IN285/CAL/78A patent/IN147318B/en unknown
- 1978-03-17 CA CA299,215A patent/CA1109342A/en not_active Expired
- 1978-03-20 PT PT67795A patent/PT67795A/pt unknown
- 1978-03-20 NO NO780996A patent/NO155492C/no unknown
- 1978-03-20 BR BR7801707A patent/BR7801707A/pt unknown
- 1978-03-20 JP JP3117478A patent/JPS547487A/ja active Granted
- 1978-03-20 MX MX172844A patent/MX148167A/es unknown
- 1978-03-20 BE BE186100A patent/BE865096A/xx not_active IP Right Cessation
- 1978-03-20 ES ES468080A patent/ES468080A1/es not_active Expired
- 1978-03-20 DK DK124978A patent/DK151887C/da active
- 1978-03-20 NL NLAANVRAGE7802989,A patent/NL176858C/xx not_active IP Right Cessation
- 1978-03-20 AU AU34324/78A patent/AU516968B2/en not_active Expired
- 1978-03-20 GB GB10865/78A patent/GB1576198A/en not_active Expired
- 1978-03-20 YU YU667/78A patent/YU40032B/xx unknown
- 1978-03-21 CH CH305078A patent/CH628524A5/fr not_active IP Right Cessation
- 1978-03-23 IT IT67649/78A patent/IT1111456B/it active
- 1978-04-11 ZA ZA00782062A patent/ZA782062B/xx unknown
- 1978-04-17 FR FR7811269A patent/FR2395280B1/fr not_active Expired
- 1978-04-25 TR TR20103A patent/TR20103A/xx unknown
- 1978-05-04 PH PH21101A patent/PH13108A/en unknown
- 1978-06-08 SE SE7806683A patent/SE444516B/sv not_active IP Right Cessation
- 1978-06-19 AT AT0445378A patent/AT363684B/de not_active IP Right Cessation
- 1978-06-19 DE DE19782826681 patent/DE2826681A1/de active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1109342A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| US4255470A (en) | Process for preventing polymer buildup in a polymerization reactor | |
| EP0020541B1 (en) | Coating polymerization reactors with oligomer coatings derived from reaction products of substituted phenols | |
| US4081248A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| US4579758A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| US4105840A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| CA1134683A (en) | Coating polymerization reactors with oligomers derived from polyhydric phenols plus a bleach | |
| GB1592403A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| CA1147098A (en) | Coating polymerization reactors with the reaction products of thiodiphenols and a bleach | |
| CA1264396A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| EP0070296B1 (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| AU552670B2 (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| EP0071223A1 (en) | Internally coated reaction vessel for use in suspension polymerization of vinyl monomers | |
| US4297320A (en) | Coating polymerization reactors with the reaction products of thiodiphenols and a bleach | |
| AU537544B2 (en) | Coating polymerization reactors with the reaction products ofthiodiphenols and a bleach | |
| NO158745B (no) | Fremgangsmaate og polymerisasjonsreaksjonsbeholder for polymerisering av etylenisk umettede monomerer. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |