CA1089473A - Process for the production of 3-amino-isoxazoles - Google Patents
Process for the production of 3-amino-isoxazolesInfo
- Publication number
- CA1089473A CA1089473A CA304,564A CA304564A CA1089473A CA 1089473 A CA1089473 A CA 1089473A CA 304564 A CA304564 A CA 304564A CA 1089473 A CA1089473 A CA 1089473A
- Authority
- CA
- Canada
- Prior art keywords
- acid
- formula
- aminoisoxazoles
- solvent
- yield
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RHFWLPWDOYJEAL-UHFFFAOYSA-N 1,2-oxazol-3-amine Chemical class NC=1C=CON=1 RHFWLPWDOYJEAL-UHFFFAOYSA-N 0.000 title claims abstract description 11
- 238000000034 method Methods 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 150000007975 iminium salts Chemical class 0.000 claims abstract description 25
- 239000002253 acid Substances 0.000 claims abstract description 16
- 239000002904 solvent Substances 0.000 claims abstract description 11
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 4
- 125000005059 halophenyl group Chemical group 0.000 claims abstract description 4
- 239000012442 inert solvent Substances 0.000 claims abstract description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract 2
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims abstract 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 12
- GGXGVZJHUKEJHO-UHFFFAOYSA-N 5-tert-butyl-1,2-oxazol-3-amine Chemical group CC(C)(C)C1=CC(N)=NO1 GGXGVZJHUKEJHO-UHFFFAOYSA-N 0.000 claims description 10
- MXZMACXOMZKYHJ-UHFFFAOYSA-N 4,4-dimethyl-3-oxopentanenitrile Chemical group CC(C)(C)C(=O)CC#N MXZMACXOMZKYHJ-UHFFFAOYSA-N 0.000 claims description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- -1 II Chemical compound 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- IAXWZYXUKABJAN-UHFFFAOYSA-N 1,2-oxazol-5-amine Chemical class NC1=CC=NO1 IAXWZYXUKABJAN-UHFFFAOYSA-N 0.000 description 3
- ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 3
- UTBQYHCOLZCUGD-UHFFFAOYSA-N methyl 4,4-dimethyl-3-oxopentanimidate;hydrochloride Chemical compound Cl.COC(=N)CC(=O)C(C)(C)C UTBQYHCOLZCUGD-UHFFFAOYSA-N 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- JSUCOYAWYDJVLG-UHFFFAOYSA-N 1-amino-1-methoxy-4,4-dimethylpent-1-en-3-one Chemical compound COC(N)=CC(=O)C(C)(C)C JSUCOYAWYDJVLG-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- SUNMBRGCANLOEG-UHFFFAOYSA-N monochloromethyl ketone Natural products ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011369 resultant mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- XPYQFIISZQCINN-QVXDJYSKSA-N 4-amino-1-[(2r,3e,4s,5r)-3-(fluoromethylidene)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrate Chemical compound O.O=C1N=C(N)C=CN1[C@H]1C(=C/F)/[C@H](O)[C@@H](CO)O1 XPYQFIISZQCINN-QVXDJYSKSA-N 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229910017912 NH2OH Inorganic materials 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 229940093499 ethyl acetate Drugs 0.000 description 1
- 235000019439 ethyl acetate Nutrition 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- HZVPJXOQDCOJRJ-UHFFFAOYSA-N isoxazolin-5-one Chemical class O=C1C=CNO1 HZVPJXOQDCOJRJ-UHFFFAOYSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical group 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP52068173A JPS5927343B2 (ja) | 1977-06-08 | 1977-06-08 | 3−アミノイソオキサゾ−ル類の合成法 |
| JP68173/1977 | 1977-06-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1089473A true CA1089473A (en) | 1980-11-11 |
Family
ID=13366106
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA304,564A Expired CA1089473A (en) | 1977-06-08 | 1978-06-01 | Process for the production of 3-amino-isoxazoles |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4200757A (OSRAM) |
| JP (1) | JPS5927343B2 (OSRAM) |
| CA (1) | CA1089473A (OSRAM) |
| CH (1) | CH636351A5 (OSRAM) |
| DE (1) | DE2825194A1 (OSRAM) |
| FR (1) | FR2393796A1 (OSRAM) |
| GB (1) | GB1582725A (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1152349B (de) * | 1960-08-12 | 1963-08-01 | Kiwi Polish Co Pty Ltd | Vorrichtung zum gleichzeitigen Ausstanzen und Auflegen eines Deckblattes, z. B. aus Aluminiumfolie, auf die glatte Oberflaeche gefuellter Dosen od. dgl. |
| US4394510A (en) * | 1981-02-02 | 1983-07-19 | Eli Lilly And Company | Process for preparing an isoxazolylurea |
| FI832754A7 (fi) * | 1982-08-09 | 1984-02-10 | Ppg Industries Inc | Menetelmä 3-amino-5- (substituoitu)isoksatsolin valmistamiseksi. |
| IL80260A0 (en) * | 1986-10-09 | 1987-01-30 | Bromine Compounds Ltd | Process for the manufacture of 3-amino-5-methylisoxazole |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD29481A (OSRAM) * | ||||
| DE1154482B (de) * | 1958-09-20 | 1963-09-19 | Shionogi & Co | Verfahren zur Herstellung von 3-Aminoisoxazolen |
| US3157669A (en) * | 1962-07-17 | 1964-11-17 | Hoffmann La Roche | Preparation of isoxazole compounds |
| CH421963A (de) * | 1963-08-06 | 1966-10-15 | Hoffmann La Roche | Verfahren zur Herstellung von Aminoisoxazolen |
| US3435047A (en) * | 1964-09-14 | 1969-03-25 | Sankyo Co | Process for preparing 3-aminoisoxazole derivatives |
| US3544582A (en) * | 1965-04-06 | 1970-12-01 | Hoffmann La Roche | Process for preparing aminoisoxazoles |
| GB1234088A (OSRAM) * | 1967-12-13 | 1971-06-03 |
-
1977
- 1977-06-08 JP JP52068173A patent/JPS5927343B2/ja not_active Expired
-
1978
- 1978-05-31 GB GB24935/78A patent/GB1582725A/en not_active Expired
- 1978-06-01 CA CA304,564A patent/CA1089473A/en not_active Expired
- 1978-06-01 CH CH602778A patent/CH636351A5/de not_active IP Right Cessation
- 1978-06-05 FR FR787816787A patent/FR2393796A1/fr active Granted
- 1978-06-05 US US05/912,252 patent/US4200757A/en not_active Expired - Lifetime
- 1978-06-08 DE DE19782825194 patent/DE2825194A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4200757A (en) | 1980-04-29 |
| FR2393796A1 (fr) | 1979-01-05 |
| FR2393796B1 (OSRAM) | 1981-07-24 |
| JPS543062A (en) | 1979-01-11 |
| GB1582725A (en) | 1981-01-14 |
| DE2825194A1 (de) | 1978-12-21 |
| JPS5927343B2 (ja) | 1984-07-05 |
| DE2825194C2 (OSRAM) | 1989-01-26 |
| CH636351A5 (de) | 1983-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100229180B1 (ko) | 2,3:4,5-비스-0-(1-메틸에틸리덴)-베타-d-프럭토피라노즈 및 (1-메틸사이클로헥실)메탄올의 클로로설페이트 및 설파메이트 유도체의 제조방법 | |
| Paik et al. | α-Aminosulfonopeptides as possible functional analogs of penicillin; evidence for their extreme instability | |
| CA1259629A (en) | Process for the synthesis of o-substituted oxime compounds and the conversion thereof into the corresponding hydroxylamine o-substituted compounds | |
| CA1089473A (en) | Process for the production of 3-amino-isoxazoles | |
| NO329701B1 (no) | Fremgangsmate for fremstilling av combretastaniner og mellomprodukt for fremgangsmaten | |
| US6281367B1 (en) | Process for the synthesis of HIV protease inhibitors | |
| US4186144A (en) | Process for the production of cyanopinacolone | |
| Maclaren | 2-Oxothiazolidine-4-carboxylic acid and related substances | |
| CA2183426A1 (en) | Process for producing 3-isoxazolecarboxylic acid | |
| KR890003598B1 (ko) | 시아노히드린의 제조방법 | |
| JPS5914461B2 (ja) | 5−メルカプト−1,2,3−トリアゾ−ルの製法 | |
| Mukaiyama et al. | The Reactions of Complexes of Thioboronite with Compounds Containing Carbon-Nitrogen Multiple Bond | |
| HU207718B (en) | Process for producing 3,5,6-trichloropyridin-2-ol | |
| US4612385A (en) | Process for the preparation of phenyl N-(2-biphenylylsulfonyl) carbamate | |
| CA1126279A (en) | Process for the production of 3-amino-5-t-butylisoxazole | |
| US4001353A (en) | Preparation of o,s-dimethyl-thiol-phosphoric acid diester-amide | |
| KR830000271B1 (ko) | 1,2,3-티아디아졸-5-일 우레아의 제조방법 | |
| US3145229A (en) | Process for the production of nu-substituted-1-phenylcyclohexylamines | |
| AU651246B2 (en) | A method for the preparation of N-ethyl-hydroxylamine hydrochloride | |
| US5206406A (en) | Method for the preparation of N-ethylhydroxylamine hydrochloride | |
| KR100232856B1 (ko) | 신규 아미노산 아미드 유도체 | |
| KR960007530B1 (ko) | 설포닐우레아 유도체의 제조방법 | |
| NO180416B (no) | Fremgangsmåte for fremstilling av et alifatisk amid og salter derav | |
| JP3926402B2 (ja) | カルバモイルオキシ酢酸の製造方法及び該方法に有用な中間体 | |
| SU295430A1 (ru) | Способ получени -карбалкокси- или -карбарилоксибензоксазолинтов-2 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |