CA1084047A - Process for the production of sulfuric acid semi- ester compounds - Google Patents
Process for the production of sulfuric acid semi- ester compoundsInfo
- Publication number
- CA1084047A CA1084047A CA283,916A CA283916A CA1084047A CA 1084047 A CA1084047 A CA 1084047A CA 283916 A CA283916 A CA 283916A CA 1084047 A CA1084047 A CA 1084047A
- Authority
- CA
- Canada
- Prior art keywords
- sulfuric acid
- formula
- weight
- parts
- dyestuff
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 title claims abstract description 72
- 238000000034 method Methods 0.000 title claims abstract description 22
- 230000008569 process Effects 0.000 title claims abstract description 20
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000000975 dye Substances 0.000 claims abstract description 50
- 238000004898 kneading Methods 0.000 claims abstract description 24
- 150000001875 compounds Chemical class 0.000 claims abstract description 19
- 238000006243 chemical reaction Methods 0.000 claims abstract description 12
- 230000032050 esterification Effects 0.000 claims abstract description 11
- 238000005886 esterification reaction Methods 0.000 claims abstract description 11
- 230000009471 action Effects 0.000 claims abstract description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 claims description 37
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- -1 aminoanthraqui-none compound Chemical class 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910004727 OSO3H Inorganic materials 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 230000006872 improvement Effects 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 2
- 239000012374 esterification agent Substances 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 9
- 230000000694 effects Effects 0.000 abstract description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 abstract 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 239000002351 wastewater Substances 0.000 abstract 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 239000000843 powder Substances 0.000 description 19
- 239000000463 material Substances 0.000 description 18
- 239000010949 copper Substances 0.000 description 13
- 239000000203 mixture Substances 0.000 description 11
- 159000000000 sodium salts Chemical class 0.000 description 10
- 229910006069 SO3H Inorganic materials 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 7
- 238000004043 dyeing Methods 0.000 description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 5
- 238000006386 neutralization reaction Methods 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 229960001407 sodium bicarbonate Drugs 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- 150000004056 anthraquinones Chemical class 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L calcium carbonate Substances [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000010865 sewage Substances 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 238000006887 Ullmann reaction Methods 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000001291 vacuum drying Methods 0.000 description 2
- YEBQUUKDSJCPIX-UHFFFAOYSA-N 12h-benzo[a]thioxanthene Chemical compound C1=CC=CC2=C3CC4=CC=CC=C4SC3=CC=C21 YEBQUUKDSJCPIX-UHFFFAOYSA-N 0.000 description 1
- VVZRKVYGKNFTRR-UHFFFAOYSA-N 12h-benzo[a]xanthene Chemical compound C1=CC=CC2=C3CC4=CC=CC=C4OC3=CC=C21 VVZRKVYGKNFTRR-UHFFFAOYSA-N 0.000 description 1
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- HGWQOFDAUWCQDA-UHFFFAOYSA-N 4-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 HGWQOFDAUWCQDA-UHFFFAOYSA-N 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000237074 Centris Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 101150039033 Eci2 gene Proteins 0.000 description 1
- 241000865653 Foerschichthys flavipinnis Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001366278 Leptotes marina Species 0.000 description 1
- 101150107341 RERE gene Proteins 0.000 description 1
- 229910006074 SO2NH2 Inorganic materials 0.000 description 1
- 101100044618 Tetrahymena thermophila ILSA gene Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- WDEQGLDWZMIMJM-UHFFFAOYSA-N benzyl 4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate Chemical compound OCC1CC(O)CN1C(=O)OCC1=CC=CC=C1 WDEQGLDWZMIMJM-UHFFFAOYSA-N 0.000 description 1
- 239000004566 building material Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- PPSZHCXTGRHULJ-UHFFFAOYSA-N dioxazine Chemical compound O1ON=CC=C1 PPSZHCXTGRHULJ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- 230000002226 simultaneous effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ORFSSYGWXNGVFB-UHFFFAOYSA-N sodium 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=C(C=C3)C(=CC(=C4N)S(=O)(=O)O)S(=O)(=O)O)O)OC)N=NC5=C(C6=C(C=C5)C(=CC(=C6N)S(=O)(=O)O)S(=O)(=O)O)O.[Na+] ORFSSYGWXNGVFB-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- ZNCPFRVNHGOPAG-UHFFFAOYSA-L sodium oxalate Chemical compound [Na+].[Na+].[O-]C(=O)C([O-])=O ZNCPFRVNHGOPAG-UHFFFAOYSA-L 0.000 description 1
- 229940039790 sodium oxalate Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- OIHZGFWAMWHYPA-UHFFFAOYSA-N xanthylium Chemical compound C1=CC=CC2=CC3=CC=CC=C3[O+]=C21 OIHZGFWAMWHYPA-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP2634855.0 | 1976-08-03 | ||
| DE19762634909 DE2634909C2 (de) | 1976-08-03 | 1976-08-03 | Verfahren zur Herstellung von Schwefelsäurehalbestern |
| DEP2634909.7 | 1976-08-03 | ||
| DE19762634855 DE2634855C3 (de) | 1976-08-03 | 1976-08-03 | Verfahren zur Herstellung von Anthrachinonschwefelsäurehalbester-Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1084047A true CA1084047A (en) | 1980-08-19 |
Family
ID=25770772
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA283,916A Expired CA1084047A (en) | 1976-08-03 | 1977-08-02 | Process for the production of sulfuric acid semi- ester compounds |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4315865A (enExample) |
| JP (1) | JPS5317636A (enExample) |
| AU (1) | AU508771B2 (enExample) |
| BR (1) | BR7705098A (enExample) |
| CA (1) | CA1084047A (enExample) |
| CH (1) | CH606349A5 (enExample) |
| FR (1) | FR2360643A1 (enExample) |
| GB (1) | GB1540565A (enExample) |
| IT (1) | IT1085430B (enExample) |
| MX (1) | MX147983A (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN152895B (enExample) * | 1979-07-19 | 1984-04-28 | Sumitomo Chemical Co | |
| US4482501A (en) * | 1979-07-19 | 1984-11-13 | Sumitomo Chemical Company, Limited | Process for producing aminoaryl-β-sulfatoethylsulfone |
| DE2945537A1 (de) * | 1979-11-10 | 1981-05-21 | Hoechst Ag, 6000 Frankfurt | Kupferkomplex-formazanverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| IN153408B (enExample) * | 1979-11-10 | 1984-07-14 | Hoechst Ag | |
| DE2945464A1 (de) * | 1979-11-10 | 1981-05-21 | Hoechst Ag, 6000 Frankfurt | Kupfer-formazanverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3161862D1 (en) * | 1980-03-28 | 1984-02-16 | Ciba Geigy Ag | Azo dyestuffs, methods for their preparation and their use |
| JPS5766932A (en) * | 1980-10-13 | 1982-04-23 | Teijin Ltd | Judging method of delivery end of molten polymer |
| US4629788A (en) * | 1983-10-11 | 1986-12-16 | Bayer Aktiengesellschaft | Triphendioxazine reactive dyestuffs |
| DE3439756A1 (de) * | 1984-02-11 | 1985-08-14 | Bayer Ag, 5090 Leverkusen | Triphendioxazin-vinylsulfon-farbstoffe |
| DE3426931A1 (de) * | 1984-07-21 | 1986-01-23 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung fluessiger, salzarmer, waessriger reaktivfarbstoffzubereitungen |
| DE3413315A1 (de) * | 1984-04-09 | 1985-10-17 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung fluessiger, salzarmer, waessriger reaktivfarbstoffzubereitungen |
| DE3426727A1 (de) * | 1984-07-20 | 1986-01-23 | Hoechst Ag, 6230 Frankfurt | Wasserloesliche triphendioxazin-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3703565A1 (de) * | 1987-02-06 | 1988-08-18 | Hoechst Ag | Wasserloesliche monoazo-pyrazolon-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| JPH0764998B2 (ja) * | 1987-04-09 | 1995-07-12 | 三菱化学株式会社 | 水溶性モノアゾ色素 |
| USD310953S (en) | 1987-04-22 | 1990-10-02 | Ilukowicz Robert J | Panel spacer pad |
| EP0410930B1 (de) * | 1989-07-24 | 1995-04-19 | Ciba-Geigy Ag | Faserreaktive Formazanfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung |
| US5456727A (en) * | 1994-05-24 | 1995-10-10 | Hoechst Celanese Corporation | Dye compositions for polyamides |
| DE19609338A1 (de) * | 1996-03-11 | 1997-09-18 | Hoechst Ag | Benzothioxanthen-Farbstoffe, ihre Herstellung und ihre Verwendung |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2134521A (en) * | 1935-12-24 | 1938-10-25 | Ici Ltd | Azo dyestuffs and their production |
| US2784204A (en) * | 1952-06-09 | 1957-03-05 | Hoechst Ag | Diphenylamine-vinylsulfone |
| US2755195A (en) * | 1952-07-04 | 1956-07-17 | Ciba Ltd | Process for preparing pigment preparations |
| US2912428A (en) * | 1956-03-07 | 1959-11-10 | Ciba Ltd | Process for the manufacture of azo pigments |
| DE1078116B (de) * | 1956-05-15 | 1960-03-24 | Fettchemie | Verfahren und Vorrichtung zur kontinuierlichen Veresterung von Fettalkoholen |
| US3177190A (en) * | 1961-06-14 | 1965-04-06 | Phillips Petroleum Co | Preparing and curing compositions of terminally reactive polymers |
| US3531459A (en) * | 1964-12-02 | 1970-09-29 | Gen Aniline & Film Corp | Monoazo-dyestuffs containing fiber-reactive and water solubilizing radicals |
| GB1124388A (en) * | 1965-11-15 | 1968-08-21 | Sumitomo Chemical Co | Reactive monoazo dyes of the benzene-azo-pyrazolone series and process for their manufacture and use |
| US3647827A (en) * | 1966-12-10 | 1972-03-07 | Sumitomo Chemical Co | Reactive phthalocyanate dyes containing an arylureamethylene group |
| DE2538722C2 (de) * | 1975-08-30 | 1984-10-11 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von 1-Aminobenzol-5-β-sulfatoäthylsulfon-2-sulfonsäure und 1-Aminobenzol-5-vinylsulfon-2-sulfonsäure und deren Alkali- und Erdalkalisalzen |
-
1977
- 1977-05-11 CH CH591777A patent/CH606349A5/xx not_active IP Right Cessation
- 1977-08-01 IT IT26384/77A patent/IT1085430B/it active
- 1977-08-02 MX MX170071A patent/MX147983A/es unknown
- 1977-08-02 JP JP9229177A patent/JPS5317636A/ja active Granted
- 1977-08-02 CA CA283,916A patent/CA1084047A/en not_active Expired
- 1977-08-02 AU AU27545/77A patent/AU508771B2/en not_active Expired
- 1977-08-03 FR FR7723899A patent/FR2360643A1/fr active Granted
- 1977-08-03 GB GB32532/77A patent/GB1540565A/en not_active Expired
- 1977-08-03 BR BR7705098A patent/BR7705098A/pt unknown
-
1978
- 1978-05-31 US US05/911,136 patent/US4315865A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4315865A (en) | 1982-02-16 |
| MX147983A (es) | 1983-02-22 |
| IT1085430B (it) | 1985-05-28 |
| FR2360643A1 (fr) | 1978-03-03 |
| JPS5317636A (en) | 1978-02-17 |
| CH606349A5 (enExample) | 1978-10-31 |
| JPS6115102B2 (enExample) | 1986-04-22 |
| AU2754577A (en) | 1979-02-08 |
| AU508771B2 (en) | 1980-04-03 |
| FR2360643B1 (enExample) | 1982-10-08 |
| BR7705098A (pt) | 1978-04-04 |
| GB1540565A (en) | 1979-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1084047A (en) | Process for the production of sulfuric acid semi- ester compounds | |
| GB2071683A (en) | Pigment compositions | |
| US3268548A (en) | Water-soluble phthalocyanine dyestuffs | |
| CA1038377A (en) | Water-soluble azo dyestuffs, their preparation and utilization | |
| US3324151A (en) | 1-amino-4-anilino-anthraquinone-2-sulfonic acids | |
| CA1094568A (en) | Process for the preparation of sulfuric acid semi- ester compounds | |
| CN107722667B (zh) | 一种基于蒽醌偶氮多发色基团的紫色活性染料及其制备方法和应用 | |
| CN102504589B (zh) | 一种翠蓝色染料及其制备方法和应用 | |
| US2108126A (en) | Azo-dyestuffs of the anthraquinone series | |
| CN102391670B (zh) | 一种翠蓝色反应性染料及其制备方法和应用 | |
| CA1098901A (en) | Process for the manufacture of sulfuric acid semi- ester compounds | |
| US4397649A (en) | Water-soluble phthalocyanine sulfonyl cyanamide compounds, process for their manufacture and their use as dyestuffs | |
| US2744914A (en) | Dyestuffs of the phthalocyanine series and their production | |
| US4165314A (en) | Mixtures of 1:2 cobalt complexes of monoazo compounds having an acetoacetanilide coupling component radical | |
| EP0279277B1 (de) | Wasserlösliche Monoazo-pyrazolon-Verbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| US3536502A (en) | Copper phthalocyanine pigment compositions | |
| US3926546A (en) | Polyhydroxyalkylamine salts of anionic dyestuffs | |
| US3409633A (en) | Water-soluble phthalocyanine dyestuffs and process for preparing them | |
| US4191703A (en) | Process for the manufacture of sulfuric acid semi-ester compounds | |
| US2557328A (en) | Sulfonated anthrapyrimidines and process of preparing the same | |
| US2779772A (en) | Green substantive dyes of the anthraquinone series | |
| US3297711A (en) | Water-soluble phthalocyanine dyestuffs and process for preparing them | |
| US3414558A (en) | Bis triazole azo dyestuffs | |
| US4005068A (en) | Disazo compounds from diphenylene sulfones and acetoacetylbenzimidazolones | |
| US2658899A (en) | Sulfonated anthraquinone naphthocarbazole dyestuffs and process for preparing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |