CA1067496A - 1-(2-cyano-ethyl)-1,2,3,4,6,7-hexahydro-12h-indolo(2,3-a) quinolizino compounds - Google Patents
1-(2-cyano-ethyl)-1,2,3,4,6,7-hexahydro-12h-indolo(2,3-a) quinolizino compoundsInfo
- Publication number
- CA1067496A CA1067496A CA236,327A CA236327A CA1067496A CA 1067496 A CA1067496 A CA 1067496A CA 236327 A CA236327 A CA 236327A CA 1067496 A CA1067496 A CA 1067496A
- Authority
- CA
- Canada
- Prior art keywords
- general formula
- ethyl
- indolo
- hexahydro
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 29
- 238000000034 method Methods 0.000 claims abstract description 25
- 239000002253 acid Substances 0.000 claims abstract description 23
- 150000001450 anions Chemical class 0.000 claims abstract description 8
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 3
- 239000002585 base Substances 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 17
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 12
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 10
- 239000011541 reaction mixture Substances 0.000 claims description 10
- 239000003960 organic solvent Substances 0.000 claims description 9
- FCGGDEKTUUSBPS-UHFFFAOYSA-M quinolizin-5-ium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.C1=CC=CC2=CC=CC=[N+]21 FCGGDEKTUUSBPS-UHFFFAOYSA-M 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims 3
- 239000003513 alkali Substances 0.000 claims 2
- 239000012458 free base Substances 0.000 claims 2
- DFCXCIIPZTXJGS-UHFFFAOYSA-N 1-butyl-2,3,4,6,7,12-hexahydro-1h-indolo[2,3-a]quinolizin-5-ium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.N1C2=CC=CC=C2C(CC2)=C1C1=[N+]2CCCC1CCCC DFCXCIIPZTXJGS-UHFFFAOYSA-N 0.000 claims 1
- KJIDVKDDQARNFN-UHFFFAOYSA-N 1-ethyl-2,3,4,5,6,7-hexahydro-1h-indolo[2,3-a]quinolizin-5-ium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.N1C2=CC=CC=C2C(CC2)=C1C1=[N+]2CCCC1CC KJIDVKDDQARNFN-UHFFFAOYSA-N 0.000 claims 1
- 239000013067 intermediate product Substances 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- -1 hexahydro-indolo-quinolizidine derivatives Chemical class 0.000 description 10
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- 241000786363 Rhampholeon spectrum Species 0.000 description 4
- 229910052786 argon Inorganic materials 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- LLYCMZGLHLKPPU-UHFFFAOYSA-M perbromate Chemical compound [O-]Br(=O)(=O)=O LLYCMZGLHLKPPU-UHFFFAOYSA-M 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- DIQLGHMNRJRQPF-UHFFFAOYSA-N 4,5-dihydroquinolizin-5-ium perchlorate Chemical compound Cl(=O)(=O)(=O)O.C=1C=CCN2C=CC=CC12 DIQLGHMNRJRQPF-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241001342522 Vampyrum spectrum Species 0.000 description 1
- AVMNFQHJOOYCAP-UHFFFAOYSA-N acetic acid;propanoic acid Chemical compound CC(O)=O.CCC(O)=O AVMNFQHJOOYCAP-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- WFIZEGIEIOHZCP-UHFFFAOYSA-M potassium formate Chemical compound [K+].[O-]C=O WFIZEGIEIOHZCP-UHFFFAOYSA-M 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- APJYDQYYACXCRM-UHFFFAOYSA-N tryptamine Chemical compound C1=CC=C2C(CCN)=CNC2=C1 APJYDQYYACXCRM-UHFFFAOYSA-N 0.000 description 1
- 229960002726 vincamine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI544A HU170205B (en:Method) | 1974-09-27 | 1974-09-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1067496A true CA1067496A (en) | 1979-12-04 |
Family
ID=11000955
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA236,327A Expired CA1067496A (en) | 1974-09-27 | 1975-09-25 | 1-(2-cyano-ethyl)-1,2,3,4,6,7-hexahydro-12h-indolo(2,3-a) quinolizino compounds |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS5159897A (en:Method) |
| AT (1) | AT345994B (en:Method) |
| AU (1) | AU497150B2 (en:Method) |
| BE (1) | BE833894A (en:Method) |
| BG (1) | BG30777A3 (en:Method) |
| CA (1) | CA1067496A (en:Method) |
| CH (1) | CH623585A5 (en:Method) |
| CS (1) | CS186720B2 (en:Method) |
| DD (1) | DD122820A5 (en:Method) |
| DE (1) | DE2541485C3 (en:Method) |
| DK (1) | DK138328B (en:Method) |
| FR (1) | FR2286139A1 (en:Method) |
| GB (1) | GB1473484A (en:Method) |
| HU (1) | HU170205B (en:Method) |
| IL (1) | IL48144A (en:Method) |
| NL (1) | NL7511284A (en:Method) |
| PL (1) | PL96854B1 (en:Method) |
| SE (1) | SE421207B (en:Method) |
| SU (1) | SU619106A3 (en:Method) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU174502B (hu) * | 1976-12-30 | 1980-01-28 | Richter Gedeon Vegyeszet | Sposob poluchenija novykh proizvodnykh oktagidro-indolo/2,3-a/-khinolizina |
-
1974
- 1974-09-27 HU HURI544A patent/HU170205B/hu unknown
-
1975
- 1975-09-12 CH CH1208475A patent/CH623585A5/de not_active IP Right Cessation
- 1975-09-17 AT AT711275A patent/AT345994B/de not_active IP Right Cessation
- 1975-09-17 DE DE2541485A patent/DE2541485C3/de not_active Expired
- 1975-09-19 IL IL48144A patent/IL48144A/xx unknown
- 1975-09-19 AU AU85018/75A patent/AU497150B2/en not_active Expired
- 1975-09-23 CS CS7500006410A patent/CS186720B2/cs unknown
- 1975-09-23 FR FR7529073A patent/FR2286139A1/fr active Granted
- 1975-09-25 DD DD188550A patent/DD122820A5/xx unknown
- 1975-09-25 NL NL7511284A patent/NL7511284A/xx not_active Application Discontinuation
- 1975-09-25 GB GB3931375A patent/GB1473484A/en not_active Expired
- 1975-09-25 CA CA236,327A patent/CA1067496A/en not_active Expired
- 1975-09-25 SE SE7510784A patent/SE421207B/xx not_active IP Right Cessation
- 1975-09-25 BG BG031071A patent/BG30777A3/xx unknown
- 1975-09-26 PL PL1975183604A patent/PL96854B1/pl unknown
- 1975-09-26 JP JP50117084A patent/JPS5159897A/ja active Pending
- 1975-09-26 SU SU752176207A patent/SU619106A3/ru active
- 1975-09-26 BE BE160438A patent/BE833894A/xx not_active IP Right Cessation
- 1975-09-26 DK DK433175AA patent/DK138328B/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2286139B3 (en:Method) | 1978-05-05 |
| AT345994B (de) | 1978-10-10 |
| DK433175A (en:Method) | 1976-03-28 |
| DD122820A5 (en:Method) | 1976-11-05 |
| IL48144A0 (en) | 1975-11-25 |
| DE2541485A1 (de) | 1976-04-15 |
| SU619106A3 (ru) | 1978-08-05 |
| DK138328C (en:Method) | 1979-01-22 |
| JPS5159897A (en:Method) | 1976-05-25 |
| GB1473484A (en) | 1977-05-11 |
| BG30777A3 (en) | 1981-08-14 |
| SE421207B (sv) | 1981-12-07 |
| DE2541485B2 (de) | 1981-08-06 |
| NL7511284A (nl) | 1976-03-30 |
| BE833894A (fr) | 1976-01-16 |
| AU497150B2 (en) | 1978-12-07 |
| HU170205B (en:Method) | 1977-04-28 |
| CS186720B2 (en) | 1978-12-29 |
| SE7510784L (sv) | 1976-03-29 |
| IL48144A (en) | 1979-07-25 |
| CH623585A5 (en) | 1981-06-15 |
| DK138328B (da) | 1978-08-14 |
| ATA711275A (de) | 1978-02-15 |
| DE2541485C3 (de) | 1982-05-13 |
| AU8501875A (en) | 1977-03-24 |
| FR2286139A1 (fr) | 1976-04-23 |
| PL96854B1 (pl) | 1978-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Sheehan et al. | The synthesis of stereochemically pure peptide derivatives by the phthaloyl method | |
| US4695573A (en) | 9-amino-1,2,3,4-tetrahydroacridin-1-ol and related compounds | |
| FR2511247A1 (fr) | Dihydropyridines ayant une action positivement inotrope, leur utilisation comme medicaments et un procede pour leur preparation | |
| US2883384A (en) | Production of reserpine and analogs thereof | |
| IL103010A (en) | Preparation of 1,4-converted dihydropyridines | |
| US5700939A (en) | Intermediates useful in camptothecin synthesis | |
| SU873887A3 (ru) | Способ получени производных имидазо/2,1-в/тиазолина или имидазо /2,1-в/тиазина или их кислотно-аддитивных солей,в виде смеси изомеров или отдельных изомеров | |
| JPS6346077B2 (en:Method) | ||
| NZ202362A (en) | Process for the preparation of eburnamonine and indolo(2,3-a)quinolizine derivatives | |
| CA1067496A (en) | 1-(2-cyano-ethyl)-1,2,3,4,6,7-hexahydro-12h-indolo(2,3-a) quinolizino compounds | |
| CA1300127C (en) | Process for preparing lysergol derivatives | |
| US4036841A (en) | Indolo[2,3α]quinolizine derivatives | |
| Baxter et al. | 61. The application of the Hofmann reaction to the synthesis of heterocyclic compounds. Part II. Synthesis of xanthine from glyoxaline-4: 5-dicarboxyamide and of 9-methylxanthine from 1-methylglyoxaline-4: 5-dicarboxyamide | |
| US3681355A (en) | Ergonarcarnines | |
| NO137999B (no) | Analogifremgangsm}te ved fremstilling av terapeutisk aktive oxofurylestere av 6-(alfa-aminofenylacetamido)-penicillansyre | |
| JPS59210085A (ja) | 新規エルゴリン誘導体の製造法 | |
| US3428639A (en) | Preparation of ergot alkaloids | |
| US3583992A (en) | 1-methyl-d-lysergic acid-dihydroxy-alkyl-amides | |
| US4668678A (en) | Triazoloquinoxalin-1,4-diones | |
| US4044012A (en) | Indolo-quinolizidine derivatives | |
| US4929730A (en) | Bis(1,2,5)thiadiazolo(3,4-b:3',4'-E) pyrazine, a process for the preparation thereof and a method of using same | |
| SU1527865A1 (ru) | Индоло(5,6,7-д, @ )изохинолины | |
| US4054571A (en) | Nitrogen-containing polycyclic compounds and a process for the preparation thereof | |
| US3303195A (en) | Methylated deserpidine | |
| US3117955A (en) | 10-haloyohimbane alkaloids and process therefor |