CA1067078A - Pharmacologically active substituted phenyl hydrazino-pyridazines - Google Patents
Pharmacologically active substituted phenyl hydrazino-pyridazinesInfo
- Publication number
- CA1067078A CA1067078A CA229,160A CA229160A CA1067078A CA 1067078 A CA1067078 A CA 1067078A CA 229160 A CA229160 A CA 229160A CA 1067078 A CA1067078 A CA 1067078A
- Authority
- CA
- Canada
- Prior art keywords
- butylamino
- hydroxypropoxy
- give
- mole
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KBQWMWCFNNULBL-UHFFFAOYSA-N (4-phenylpyridazin-3-yl)hydrazine Chemical class NNC1=NN=CC=C1C1=CC=CC=C1 KBQWMWCFNNULBL-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 70
- 239000001257 hydrogen Substances 0.000 claims abstract description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 17
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 7
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 6
- 125000003302 alkenyloxy group Chemical group 0.000 claims abstract description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims abstract description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 4
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims abstract 3
- 238000000034 method Methods 0.000 claims description 43
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 27
- -1 t-butyloxycarbonyl Chemical class 0.000 claims description 27
- QGONODUKOFNSOY-UHFFFAOYSA-N 1-(tert-butylamino)-3-[2-(6-hydrazinylpyridazin-3-yl)phenoxy]propan-2-ol Chemical compound CC(C)(C)NCC(O)COC1=CC=CC=C1C1=CC=C(NN)N=N1 QGONODUKOFNSOY-UHFFFAOYSA-N 0.000 claims description 6
- 150000007857 hydrazones Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 5
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims 2
- JYVXBCZDICFOED-UHFFFAOYSA-N 1-(tert-butylamino)-3-[5-fluoro-2-(6-hydrazinylpyridazin-3-yl)phenoxy]propan-2-ol Chemical compound C(C)(C)(C)NCC(COC1=C(C=CC(=C1)F)C=1N=NC(=CC1)NN)O JYVXBCZDICFOED-UHFFFAOYSA-N 0.000 claims 1
- ITZYTHBKTGVTFU-UHFFFAOYSA-N 3-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-1h-pyridazine-6-thione Chemical compound CC(C)(C)NCC(O)COC1=CC=CC=C1C1=NNC(=S)C=C1 ITZYTHBKTGVTFU-UHFFFAOYSA-N 0.000 claims 1
- 239000012351 deprotecting agent Substances 0.000 claims 1
- 229940124549 vasodilator Drugs 0.000 abstract description 3
- 239000003071 vasodilator agent Substances 0.000 abstract description 3
- 239000000674 adrenergic antagonist Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 126
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 105
- 239000000243 solution Substances 0.000 description 101
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 62
- 239000000203 mixture Substances 0.000 description 61
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 58
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 51
- 238000001704 evaporation Methods 0.000 description 46
- 230000008020 evaporation Effects 0.000 description 46
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 41
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 38
- 238000006243 chemical reaction Methods 0.000 description 38
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 37
- 238000010992 reflux Methods 0.000 description 37
- 239000012258 stirred mixture Substances 0.000 description 37
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 36
- 239000003921 oil Substances 0.000 description 35
- 235000019198 oils Nutrition 0.000 description 35
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 33
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 31
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 30
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 30
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 28
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- 229960000583 acetic acid Drugs 0.000 description 22
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 21
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 21
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical group C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 21
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 19
- 239000000460 chlorine Substances 0.000 description 19
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 19
- 238000010828 elution Methods 0.000 description 19
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 238000002360 preparation method Methods 0.000 description 18
- 239000000377 silicon dioxide Substances 0.000 description 18
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 15
- 239000000284 extract Substances 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 14
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 238000009835 boiling Methods 0.000 description 11
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 11
- 229910052794 bromium Inorganic materials 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 9
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 9
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- RYRMMWZPZWOQTP-UHFFFAOYSA-N 1-[2-(6-hydrazinylpyridazin-3-yl)phenoxy]-3-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(O)COC1=CC=CC=C1C1=CC=C(NN)N=N1 RYRMMWZPZWOQTP-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000012362 glacial acetic acid Substances 0.000 description 8
- 235000019260 propionic acid Nutrition 0.000 description 8
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 6
- 239000005711 Benzoic acid Substances 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 241001061127 Thione Species 0.000 description 6
- 235000010233 benzoic acid Nutrition 0.000 description 6
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- YTRGNBTVTHPFJM-UHFFFAOYSA-N pyridazin-3-ylhydrazine Chemical compound NNC1=CC=CN=N1 YTRGNBTVTHPFJM-UHFFFAOYSA-N 0.000 description 6
- 229940014800 succinic anhydride Drugs 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 238000006356 dehydrogenation reaction Methods 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 229940080818 propionamide Drugs 0.000 description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 4
- JTEVRTFFPRBPHQ-UHFFFAOYSA-N 2-(6-chloropyridazin-3-yl)-5-methoxyphenol Chemical compound OC1=CC(OC)=CC=C1C1=CC=C(Cl)N=N1 JTEVRTFFPRBPHQ-UHFFFAOYSA-N 0.000 description 4
- ACTLOQLEUUYVRQ-UHFFFAOYSA-N 3-chloro-4-phenylpyridazine Chemical class ClC1=NN=CC=C1C1=CC=CC=C1 ACTLOQLEUUYVRQ-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- FUKUFMFMCZIRNT-UHFFFAOYSA-N hydron;methanol;chloride Chemical compound Cl.OC FUKUFMFMCZIRNT-UHFFFAOYSA-N 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- DKACXUFSLUYRFU-UHFFFAOYSA-N tert-butyl n-aminocarbamate Chemical compound CC(C)(C)OC(=O)NN DKACXUFSLUYRFU-UHFFFAOYSA-N 0.000 description 4
- KYEACNNYFNZCST-UHFFFAOYSA-N 1-methylpyrrolidine-2,5-dione Chemical group CN1C(=O)CCC1=O KYEACNNYFNZCST-UHFFFAOYSA-N 0.000 description 3
- UXNQKCOMUCSBSS-UHFFFAOYSA-N 2-phenyl-1,5-dihydropyridazin-6-one Chemical compound N1C(=O)CC=CN1C1=CC=CC=C1 UXNQKCOMUCSBSS-UHFFFAOYSA-N 0.000 description 3
- DDHVIKQPVLQZHU-UHFFFAOYSA-N 4-(6-chloropyridazin-3-yl)benzene-1,3-diol Chemical compound OC1=CC(O)=CC=C1C1=CC=C(Cl)N=N1 DDHVIKQPVLQZHU-UHFFFAOYSA-N 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- 101000939348 Homo sapiens NEDD8-activating enzyme E1 regulatory subunit Proteins 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 102100029781 NEDD8-activating enzyme E1 regulatory subunit Human genes 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 206010047141 Vasodilatation Diseases 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 150000008064 anhydrides Chemical group 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-M benzoate Chemical compound [O-]C(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-M 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 3
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- QHVHVJABEOCWHW-UHFFFAOYSA-N n-butyl-2-(dimethylamino)-n-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-methylpentanamide Chemical compound O=C1C(N(C(=O)C(CC(C)C)N(C)C)CCCC)=C(C)N(C)N1C1=CC=CC=C1 QHVHVJABEOCWHW-UHFFFAOYSA-N 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000006228 supernatant Substances 0.000 description 3
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 230000024883 vasodilation Effects 0.000 description 3
- AYKYOOPFBCOXSL-UHFFFAOYSA-N (4-hydroxyphenyl)acetonitrile Chemical compound OC1=CC=C(CC#N)C=C1 AYKYOOPFBCOXSL-UHFFFAOYSA-N 0.000 description 2
- SSDAKJLEKSSAMH-UHFFFAOYSA-N 2,4-dihydro-1h-pyridazin-3-one Chemical group O=C1CC=CNN1 SSDAKJLEKSSAMH-UHFFFAOYSA-N 0.000 description 2
- YBPAYPRLUDCSEY-UHFFFAOYSA-N 2-(4-hydroxyphenyl)acetamide Chemical compound NC(=O)CC1=CC=C(O)C=C1 YBPAYPRLUDCSEY-UHFFFAOYSA-N 0.000 description 2
- ZISKJBABLDGRSZ-UHFFFAOYSA-N 2-(6-chloropyridazin-3-yl)-5-ethoxyphenol Chemical compound OC1=CC(OCC)=CC=C1C1=CC=C(Cl)N=N1 ZISKJBABLDGRSZ-UHFFFAOYSA-N 0.000 description 2
- MMLHFDAMOHTXQS-UHFFFAOYSA-N 3-(2,6-difluorophenyl)-4,5-dihydro-1H-pyridazin-6-one Chemical compound FC1=C(C(=CC=C1)F)C=1CCC(NN1)=O MMLHFDAMOHTXQS-UHFFFAOYSA-N 0.000 description 2
- ITUVPRZRSCWUPA-UHFFFAOYSA-N 3-(2-hydroxyphenyl)-1H-pyridazin-6-one Chemical compound OC1=CC=CC=C1C1=NNC(=O)C=C1 ITUVPRZRSCWUPA-UHFFFAOYSA-N 0.000 description 2
- IRJXUMOUDQWBMA-UHFFFAOYSA-N 3-(3-carboxypropanoyl)-4-hydroxybenzoic acid Chemical compound OC(=O)CCC(=O)C1=CC(C(O)=O)=CC=C1O IRJXUMOUDQWBMA-UHFFFAOYSA-N 0.000 description 2
- XHYMYVYGEHAZPN-UHFFFAOYSA-N 3-[2-[3-(tert-butylamino)-2-hydroxypropoxy]-5-methoxyphenyl]-4,5-dihydro-1h-pyridazin-6-one Chemical compound COC1=CC=C(OCC(O)CNC(C)(C)C)C(C=2CCC(=O)NN=2)=C1 XHYMYVYGEHAZPN-UHFFFAOYSA-N 0.000 description 2
- BJZOTSPDZMVWFS-UHFFFAOYSA-N 3-[5-amino-2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-1h-pyridazine-6-thione Chemical compound CC(C)(C)NCC(O)COC1=CC=C(N)C=C1C1=NNC(=S)C=C1 BJZOTSPDZMVWFS-UHFFFAOYSA-N 0.000 description 2
- UQAKTDJTFRZJBE-UHFFFAOYSA-N 4-(2-fluoro-6-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=C(O)C=CC=C1F UQAKTDJTFRZJBE-UHFFFAOYSA-N 0.000 description 2
- KFVDVTYLBHWHHJ-UHFFFAOYSA-N 4-(2-hydroxy-5-nitrophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC([N+]([O-])=O)=CC=C1O KFVDVTYLBHWHHJ-UHFFFAOYSA-N 0.000 description 2
- JVHVQJFNBQIPEJ-UHFFFAOYSA-N 4-(2-hydroxyphenyl)-3-methyl-4-oxobutanoic acid Chemical compound OC(=O)CC(C)C(=O)C1=CC=CC=C1O JVHVQJFNBQIPEJ-UHFFFAOYSA-N 0.000 description 2
- PFGWKMQUMPPXDZ-UHFFFAOYSA-N 4-(5-acetamido-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound CC(=O)NC1=CC=C(O)C(C(=O)CCC(O)=O)=C1 PFGWKMQUMPPXDZ-UHFFFAOYSA-N 0.000 description 2
- RYZPSWSXZLSRHS-UHFFFAOYSA-N 4-(5-amino-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound NC1=CC=C(O)C(C(=O)CCC(O)=O)=C1 RYZPSWSXZLSRHS-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 241000212342 Sium Species 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 125000005336 allyloxy group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000006286 aqueous extract Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 238000005695 dehalogenation reaction Methods 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 2
- VOBJDVORMSMFSD-UHFFFAOYSA-N ethyl 4-(4-chloro-2-hydroxyphenyl)-4-oxobutanoate Chemical compound CCOC(=O)CCC(=O)C1=CC=C(Cl)C=C1O VOBJDVORMSMFSD-UHFFFAOYSA-N 0.000 description 2
- RVCVDUWHPXZWKO-UHFFFAOYSA-N ethyl 4-[2-[3-(tert-butylamino)-2-hydroxypropoxy]-4-chlorophenyl]-4-oxobutanoate Chemical compound CCOC(=O)CCC(=O)C1=CC=C(Cl)C=C1OCC(O)CNC(C)(C)C RVCVDUWHPXZWKO-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- ZXDMDHCWDPLIDU-UHFFFAOYSA-N methyl 4-(2-hydroxy-5-nitrophenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC([N+]([O-])=O)=CC=C1O ZXDMDHCWDPLIDU-UHFFFAOYSA-N 0.000 description 2
- KELBDUWDIXOBIX-UHFFFAOYSA-N methyl 4-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=CC=C1OCC(O)CNC(C)(C)C KELBDUWDIXOBIX-UHFFFAOYSA-N 0.000 description 2
- KFBNTRCOECZDBA-UHFFFAOYSA-N methyl 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(4-methoxy-4-oxobutanoyl)benzoate Chemical compound COC(=O)CCC(=O)C1=CC(C(=O)OC)=CC=C1OCC(O)CNC(C)(C)C KFBNTRCOECZDBA-UHFFFAOYSA-N 0.000 description 2
- UCYWFUHZIODOJF-UHFFFAOYSA-N methyl 4-[5-acetamido-2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC(NC(C)=O)=CC=C1OCC(O)CNC(C)(C)C UCYWFUHZIODOJF-UHFFFAOYSA-N 0.000 description 2
- ZLAQXXCKJJLVIH-UHFFFAOYSA-N methyl 4-hydroxy-3-(4-methoxy-4-oxobutanoyl)benzoate Chemical compound COC(=O)CCC(=O)C1=CC(C(=O)OC)=CC=C1O ZLAQXXCKJJLVIH-UHFFFAOYSA-N 0.000 description 2
- KBWFHQOKZPEFIU-UHFFFAOYSA-N n-butyl-2-(dimethylamino)-n-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)propanamide Chemical compound O=C1C(N(C(=O)C(C)N(C)C)CCCC)=C(C)N(C)N1C1=CC=CC=C1 KBWFHQOKZPEFIU-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- LJRGBERXYNQPJI-UHFFFAOYSA-M sodium;3-nitrobenzenesulfonate Chemical compound [Na+].[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 LJRGBERXYNQPJI-UHFFFAOYSA-M 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- WYJIRAVZMKUVPC-UHFFFAOYSA-N 1,1-dichloroethane;methanol Chemical compound OC.CC(Cl)Cl WYJIRAVZMKUVPC-UHFFFAOYSA-N 0.000 description 1
- UEMGWPRHOOEKTA-UHFFFAOYSA-N 1,3-difluorobenzene Chemical compound FC1=CC=CC(F)=C1 UEMGWPRHOOEKTA-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HNZVSMJLUPKDQF-UHFFFAOYSA-N 1-(tert-butylamino)-3-[2-(6-chloropyridazin-3-yl)-5-methoxyphenoxy]propan-2-ol Chemical compound CC(C)(C)NCC(O)COC1=CC(OC)=CC=C1C1=CC=C(Cl)N=N1 HNZVSMJLUPKDQF-UHFFFAOYSA-N 0.000 description 1
- SVZALTRFBWXNMH-UHFFFAOYSA-N 1-(tert-butylamino)-3-[2-(6-hydrazinylpyridazin-3-yl)-4-nitrophenoxy]propan-2-ol Chemical compound CC(C)(C)NCC(O)COC1=CC=C([N+]([O-])=O)C=C1C1=CC=C(NN)N=N1 SVZALTRFBWXNMH-UHFFFAOYSA-N 0.000 description 1
- GPBJQFXXNGUQRR-UHFFFAOYSA-N 1-(tert-butylamino)-3-[2-(6-hydrazinylpyridazin-3-yl)-5-methoxyphenoxy]propan-2-ol Chemical compound CC(C)(C)NCC(O)COC1=CC(OC)=CC=C1C1=CC=C(NN)N=N1 GPBJQFXXNGUQRR-UHFFFAOYSA-N 0.000 description 1
- HKMVJOOZSUOYNM-UHFFFAOYSA-N 1-(tert-butylamino)-3-[5-methoxy-2-(6-methoxypyridazin-3-yl)phenoxy]propan-2-ol Chemical compound CC(C)(C)NCC(O)COC1=CC(OC)=CC=C1C1=CC=C(OC)N=N1 HKMVJOOZSUOYNM-UHFFFAOYSA-N 0.000 description 1
- YLJDSYYCRXITBF-UHFFFAOYSA-N 1-phenyl-2-phenylmethoxypropan-1-one Chemical compound C=1C=CC=CC=1C(=O)C(C)OCC1=CC=CC=C1 YLJDSYYCRXITBF-UHFFFAOYSA-N 0.000 description 1
- VMJNTFXCTXAXTC-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-5-carbonitrile Chemical group C1=C(C#N)C=C2OC(F)(F)OC2=C1 VMJNTFXCTXAXTC-UHFFFAOYSA-N 0.000 description 1
- FQAVRLYSVOWADY-UHFFFAOYSA-N 2-(6-hydrazinylpyridazin-3-yl)phenol Chemical compound N(N)C=1N=NC(=CC=1)C1=C(C=CC=C1)O FQAVRLYSVOWADY-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ZGOIRPFPRSXCMQ-UHFFFAOYSA-N 2-[6-(2-propan-2-ylidenehydrazinyl)pyridazin-3-yl]phenol Chemical compound OC1=C(C=CC=C1)C=1N=NC(=CC1)NN=C(C)C ZGOIRPFPRSXCMQ-UHFFFAOYSA-N 0.000 description 1
- 125000003816 2-hydroxybenzoyl group Chemical group OC1=C(C(=O)*)C=CC=C1 0.000 description 1
- ADOOGIDAYYNDJQ-UHFFFAOYSA-N 2-methyl-1-(2-phenylmethoxyphenyl)prop-2-en-1-one Chemical compound CC(=C)C(=O)C1=CC=CC=C1OCC1=CC=CC=C1 ADOOGIDAYYNDJQ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- GUSWJGOYDXFJSI-UHFFFAOYSA-N 3,6-dichloropyridazine Chemical compound ClC1=CC=C(Cl)N=N1 GUSWJGOYDXFJSI-UHFFFAOYSA-N 0.000 description 1
- POPWSWLVPINAOO-UHFFFAOYSA-N 3-(2,6-difluorophenyl)-1h-pyridazin-6-one Chemical compound FC1=CC=CC(F)=C1C1=NNC(=O)C=C1 POPWSWLVPINAOO-UHFFFAOYSA-N 0.000 description 1
- QIXBEKXPYWYHPO-UHFFFAOYSA-N 3-(2-fluoro-6-hydroxyphenyl)-1H-pyridazin-6-one Chemical compound FC1=C(C(=CC=C1)O)C=1C=CC(NN=1)=O QIXBEKXPYWYHPO-UHFFFAOYSA-N 0.000 description 1
- FQPUKRVBJIUJEL-UHFFFAOYSA-N 3-(2-fluoro-6-hydroxyphenyl)-1H-pyridazine-6-thione Chemical compound FC1=C(C(=CC=C1)O)C=1C=CC(NN1)=S FQPUKRVBJIUJEL-UHFFFAOYSA-N 0.000 description 1
- ODMBJAQJBFQMEV-UHFFFAOYSA-N 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one Chemical compound OC1=CC=CC=C1C1=NNC(=O)CC1 ODMBJAQJBFQMEV-UHFFFAOYSA-N 0.000 description 1
- GJHOYMMCLLSYLU-UHFFFAOYSA-N 3-(dimethylamino)-2-methyl-1-(2-phenylmethoxyphenyl)propan-1-one Chemical compound CN(C)CC(C)C(=O)C1=CC=CC=C1OCC1=CC=CC=C1 GJHOYMMCLLSYLU-UHFFFAOYSA-N 0.000 description 1
- PQVTVMSFPGUJCN-UHFFFAOYSA-N 3-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-1h-pyridazine-6-thione Chemical compound CC(C)NCC(O)COC1=CC=CC=C1C1=NNC(=S)C=C1 PQVTVMSFPGUJCN-UHFFFAOYSA-N 0.000 description 1
- JJPCDGXEYHIHSU-UHFFFAOYSA-N 3-[2-[3-(tert-butylamino)-2-hydroxypropoxy]-5-chlorophenyl]-4,5-dihydro-1h-pyridazin-6-one Chemical compound CC(C)(C)NCC(O)COC1=CC=C(Cl)C=C1C1=NNC(=O)CC1 JJPCDGXEYHIHSU-UHFFFAOYSA-N 0.000 description 1
- WIGWDOVWYDPMFN-UHFFFAOYSA-N 3-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-4,5-dihydro-1h-pyridazin-6-one Chemical compound CC(C)(C)NCC(O)COC1=CC=CC=C1C1=NNC(=O)CC1 WIGWDOVWYDPMFN-UHFFFAOYSA-N 0.000 description 1
- OOZSJTRHEQTTOY-UHFFFAOYSA-N 3-[3-(tert-butylamino)-2-hydroxypropoxy]-4-(6-chloropyridazin-3-yl)phenol Chemical compound CC(C)(C)NCC(O)COC1=CC(O)=CC=C1C1=CC=C(Cl)N=N1 OOZSJTRHEQTTOY-UHFFFAOYSA-N 0.000 description 1
- IBWYHNOFSKJKKY-UHFFFAOYSA-N 3-chloropyridazine Chemical compound ClC1=CC=CN=N1 IBWYHNOFSKJKKY-UHFFFAOYSA-N 0.000 description 1
- COKFNMSPXYDNMT-UHFFFAOYSA-N 3-fluoro-2-(6-hydrazinylpyridazin-3-yl)phenol Chemical compound FC1=C(C(=CC=C1)O)C=1N=NC(=CC1)NN COKFNMSPXYDNMT-UHFFFAOYSA-N 0.000 description 1
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 1
- ASFHDLDAWYTMJS-UHFFFAOYSA-N 3-methoxypyridazine Chemical compound COC1=CC=CN=N1 ASFHDLDAWYTMJS-UHFFFAOYSA-N 0.000 description 1
- PLUHHWJZORAODT-UHFFFAOYSA-N 3-methyl-4-oxo-4-(2-phenylmethoxyphenyl)butanenitrile Chemical compound N#CCC(C)C(=O)C1=CC=CC=C1OCC1=CC=CC=C1 PLUHHWJZORAODT-UHFFFAOYSA-N 0.000 description 1
- BTPKYAATVLVUEP-UHFFFAOYSA-N 4-(2,6-dihydroxyphenyl)-n-methyl-4-oxobutanamide Chemical compound CNC(=O)CCC(=O)C1=C(O)C=CC=C1O BTPKYAATVLVUEP-UHFFFAOYSA-N 0.000 description 1
- VERPGLCXXBNYLG-UHFFFAOYSA-N 4-(2,6-dimethoxyphenyl)-n-methyl-4-oxobutanamide Chemical compound CNC(=O)CCC(=O)C1=C(OC)C=CC=C1OC VERPGLCXXBNYLG-UHFFFAOYSA-N 0.000 description 1
- MRXKHNRFMSVSPY-UHFFFAOYSA-N 4-(2-hydroxy-3-nitrophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=CC([N+]([O-])=O)=C1O MRXKHNRFMSVSPY-UHFFFAOYSA-N 0.000 description 1
- VEMILKYHFUPAJA-UHFFFAOYSA-N 4-(2-hydroxy-4-methylphenyl)-4-oxobutanoic acid Chemical compound CC1=CC=C(C(=O)CCC(O)=O)C(O)=C1 VEMILKYHFUPAJA-UHFFFAOYSA-N 0.000 description 1
- LKCLKCOWTYSINF-UHFFFAOYSA-N 4-(2-hydroxy-5-methoxyphenyl)-4-oxobutanoic acid Chemical compound COC1=CC=C(O)C(C(=O)CCC(O)=O)=C1 LKCLKCOWTYSINF-UHFFFAOYSA-N 0.000 description 1
- NUMGKJNSGGELIA-UHFFFAOYSA-N 4-(2-hydroxy-5-methylphenyl)-4-oxobutanoic acid Chemical compound CC1=CC=C(O)C(C(=O)CCC(O)=O)=C1 NUMGKJNSGGELIA-UHFFFAOYSA-N 0.000 description 1
- XMKSYNSQMKQFSE-UHFFFAOYSA-N 4-(4-chloro-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=C(Cl)C=C1O XMKSYNSQMKQFSE-UHFFFAOYSA-N 0.000 description 1
- FICMSIMVCNKILG-UHFFFAOYSA-N 4-(4-fluoro-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=C(F)C=C1O FICMSIMVCNKILG-UHFFFAOYSA-N 0.000 description 1
- YBSVOTYKOZVOIJ-UHFFFAOYSA-N 4-(5-chloro-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC(Cl)=CC=C1O YBSVOTYKOZVOIJ-UHFFFAOYSA-N 0.000 description 1
- WEPFHOZDZFINGL-UHFFFAOYSA-N 4-(5-cyano-2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC(C#N)=CC=C1O WEPFHOZDZFINGL-UHFFFAOYSA-N 0.000 description 1
- LFPCYWXFROOMSO-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(3-carboxypropanoyl)benzoic acid Chemical compound CC(C)(C)NCC(O)COC1=CC=C(C(O)=O)C=C1C(=O)CCC(O)=O LFPCYWXFROOMSO-UHFFFAOYSA-N 0.000 description 1
- ICLOBPMMKINOSZ-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-oxo-1h-pyridazin-3-yl)benzoic acid Chemical compound CC(C)(C)NCC(O)COC1=CC=C(C(O)=O)C=C1C1=NNC(=O)C=C1 ICLOBPMMKINOSZ-UHFFFAOYSA-N 0.000 description 1
- JKFDFPJXVAVVGD-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)benzonitrile Chemical compound CC(C)(C)NCC(O)COC1=CC=C(C#N)C=C1C1=NNC(=O)CC1 JKFDFPJXVAVVGD-UHFFFAOYSA-N 0.000 description 1
- HIAWXKGEKRDCRJ-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-sulfanylidene-1h-pyridazin-3-yl)benzoic acid Chemical compound CC(C)(C)NCC(O)COC1=CC=C(C(O)=O)C=C1C1=NNC(=S)C=C1 HIAWXKGEKRDCRJ-UHFFFAOYSA-N 0.000 description 1
- OETAHPTYDZQPJD-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-[6-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]pyridazin-3-yl]benzoic acid Chemical compound CC(C)(C)NCC(O)COC1=CC=C(C(O)=O)C=C1C1=CC=C(NNC(=O)OC(C)(C)C)N=N1 OETAHPTYDZQPJD-UHFFFAOYSA-N 0.000 description 1
- VBZSVQQFVRASJZ-UHFFFAOYSA-N 4-[5-(cyanomethyl)-2-hydroxyphenyl]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC(CC#N)=CC=C1O VBZSVQQFVRASJZ-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- ZSLAKQOAQXNAKA-UHFFFAOYSA-N 5-methoxy-2-(6-methoxypyridazin-3-yl)phenol Chemical compound OC1=CC(OC)=CC=C1C1=CC=C(OC)N=N1 ZSLAKQOAQXNAKA-UHFFFAOYSA-N 0.000 description 1
- TVKFDBOFBKXOQT-UHFFFAOYSA-N 5-phenyl-1h-pyridazin-6-one Chemical compound O=C1NN=CC=C1C1=CC=CC=C1 TVKFDBOFBKXOQT-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- 101100516554 Caenorhabditis elegans nhr-5 gene Proteins 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 101150039033 Eci2 gene Proteins 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- QQSYDPFSRAZVMV-UHFFFAOYSA-N [2-(6-chloropyridazin-3-yl)phenyl] acetate Chemical compound CC(=O)OC1=CC=CC=C1C1=CC=C(Cl)N=N1 QQSYDPFSRAZVMV-UHFFFAOYSA-N 0.000 description 1
- NGGXLSGPCZZJLY-UHFFFAOYSA-N [2-(6-oxo-1h-pyridazin-3-yl)phenyl] acetate Chemical compound CC(=O)OC1=CC=CC=C1C1=NNC(=O)C=C1 NGGXLSGPCZZJLY-UHFFFAOYSA-N 0.000 description 1
- UHFKHDLFTPCYOZ-UHFFFAOYSA-N [3-fluoro-2-(6-oxo-1H-pyridazin-3-yl)phenyl] acetate Chemical compound C(C)(=O)OC1=C(C(=CC=C1)F)C=1C=CC(NN1)=O UHFKHDLFTPCYOZ-UHFFFAOYSA-N 0.000 description 1
- RYLHBWPTXXAGHJ-UHFFFAOYSA-N [4-(6-chloropyridazin-3-yl)-3-hydroxyphenyl] ethyl carbonate Chemical compound OC1=CC(OC(=O)OCC)=CC=C1C1=CC=C(Cl)N=N1 RYLHBWPTXXAGHJ-UHFFFAOYSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 230000006793 arrhythmia Effects 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical group C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- UTXXWDDEMFNIOL-UHFFFAOYSA-N ethyl 4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-oxo-1h-pyridazin-3-yl)benzoate Chemical compound CCOC(=O)C1=CC=C(OCC(O)CNC(C)(C)C)C(C2=NNC(=O)C=C2)=C1 UTXXWDDEMFNIOL-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- UUBJKHVFGWGJKX-UHFFFAOYSA-N hydrate tetrahydrochloride Chemical compound O.Cl.Cl.Cl.Cl UUBJKHVFGWGJKX-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229960001317 isoprenaline Drugs 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- QNYBHRXLWXGNIZ-UHFFFAOYSA-N methyl 4-(2-fluoro-6-methoxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=C(F)C=CC=C1OC QNYBHRXLWXGNIZ-UHFFFAOYSA-N 0.000 description 1
- WRVFBHYACVUZDM-UHFFFAOYSA-N methyl 4-(2-hydroxy-4-methylphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(C)C=C1O WRVFBHYACVUZDM-UHFFFAOYSA-N 0.000 description 1
- DDZBYCVFPQTSNL-UHFFFAOYSA-N methyl 4-(2-hydroxy-5-methoxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC(OC)=CC=C1O DDZBYCVFPQTSNL-UHFFFAOYSA-N 0.000 description 1
- FEBVPWGYFJSPIF-UHFFFAOYSA-N methyl 4-(2-hydroxyphenyl)-3-methyl-4-oxobutanoate Chemical compound COC(=O)CC(C)C(=O)C1=CC=CC=C1O FEBVPWGYFJSPIF-UHFFFAOYSA-N 0.000 description 1
- ZOOTXGXHWQPRGE-UHFFFAOYSA-N methyl 4-(2-hydroxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=CC=C1O ZOOTXGXHWQPRGE-UHFFFAOYSA-N 0.000 description 1
- MEQVMVVOUNBUPM-UHFFFAOYSA-N methyl 4-(3-chloro-2-hydroxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=CC(Cl)=C1O MEQVMVVOUNBUPM-UHFFFAOYSA-N 0.000 description 1
- LVHWYFLZVALMGD-UHFFFAOYSA-N methyl 4-(5-acetamido-2-hydroxyphenyl)-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC(NC(C)=O)=CC=C1O LVHWYFLZVALMGD-UHFFFAOYSA-N 0.000 description 1
- ZDAQBFHYDBHPJX-UHFFFAOYSA-N methyl 4-[2-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=CC=C1OCC(O)CNC(C)C ZDAQBFHYDBHPJX-UHFFFAOYSA-N 0.000 description 1
- QCABWAVYOFPKMF-UHFFFAOYSA-N methyl 4-[2-[3-(tert-butylamino)-2-hydroxypropoxy]-4-methylphenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(C)C=C1OCC(O)CNC(C)(C)C QCABWAVYOFPKMF-UHFFFAOYSA-N 0.000 description 1
- LXGIYTCAUIGEPT-UHFFFAOYSA-N methyl 4-[2-[3-(tert-butylamino)-2-hydroxypropoxy]-5-chlorophenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC(Cl)=CC=C1OCC(O)CNC(C)(C)C LXGIYTCAUIGEPT-UHFFFAOYSA-N 0.000 description 1
- VSEISGZOHQFPFQ-UHFFFAOYSA-N methyl 4-[2-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-methyl-4-oxobutanoate Chemical compound COC(=O)CC(C)C(=O)C1=CC=CC=C1OCC(O)CNC(C)(C)C VSEISGZOHQFPFQ-UHFFFAOYSA-N 0.000 description 1
- GGKFDLQOOYRSKP-UHFFFAOYSA-N methyl 4-[4-methyl-2-(oxiran-2-ylmethoxy)phenyl]-4-oxobutanoate Chemical compound COC(=O)CCC(=O)C1=CC=C(C)C=C1OCC1OC1 GGKFDLQOOYRSKP-UHFFFAOYSA-N 0.000 description 1
- SRXOJMOGPYFZKC-UHFFFAOYSA-N methyl 4-chloro-4-oxobutanoate Chemical compound COC(=O)CCC(Cl)=O SRXOJMOGPYFZKC-UHFFFAOYSA-N 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- NIROFIJHYFKOON-UHFFFAOYSA-N n-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-oxo-1h-pyridazin-3-yl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=C(OCC(O)CNC(C)(C)C)C(C2=NNC(=O)C=C2)=C1 NIROFIJHYFKOON-UHFFFAOYSA-N 0.000 description 1
- VRURQOFXQLLBNT-UHFFFAOYSA-N n-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=C(OCC(O)CNC(C)(C)C)C(C=2CCC(=O)NN=2)=C1 VRURQOFXQLLBNT-UHFFFAOYSA-N 0.000 description 1
- LURSFPPATBYVQI-UHFFFAOYSA-N n-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(6-sulfanylidene-1h-pyridazin-3-yl)phenyl]acetamide Chemical compound CC(=O)NC1=CC=C(OCC(O)CNC(C)(C)C)C(C2=NNC(=S)C=C2)=C1 LURSFPPATBYVQI-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- WSDQIHATCCOMLH-UHFFFAOYSA-N phenyl n-(3,5-dichlorophenyl)carbamate Chemical compound ClC1=CC(Cl)=CC(NC(=O)OC=2C=CC=CC=2)=C1 WSDQIHATCCOMLH-UHFFFAOYSA-N 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- RVUXIPACAZKWHU-UHFFFAOYSA-N sulfuric acid;heptahydrate Chemical compound O.O.O.O.O.O.O.OS(O)(=O)=O RVUXIPACAZKWHU-UHFFFAOYSA-N 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- SYOKIDBDQMKNDQ-XWTIBIIYSA-N vildagliptin Chemical compound C1C(O)(C2)CC(C3)CC1CC32NCC(=O)N1CCC[C@H]1C#N SYOKIDBDQMKNDQ-XWTIBIIYSA-N 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/22—Ethers with hydroxy compounds containing no oxirane rings with monohydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/32—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing keto groups
- C07C65/40—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing keto groups containing singly bound oxygen-containing groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/12—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/18—Sulfur atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB26864/74A GB1527712A (en) | 1974-06-18 | 1974-06-18 | Hydrazinopyridazines |
| GB2075 | 1975-01-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1067078A true CA1067078A (en) | 1979-11-27 |
Family
ID=26235616
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA229,160A Expired CA1067078A (en) | 1974-06-18 | 1975-06-12 | Pharmacologically active substituted phenyl hydrazino-pyridazines |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4053601A (OSRAM) |
| JP (1) | JPS5113782A (OSRAM) |
| CA (1) | CA1067078A (OSRAM) |
| CH (1) | CH617429A5 (OSRAM) |
| DE (1) | DE2527066A1 (OSRAM) |
| DK (1) | DK145099C (OSRAM) |
| ES (1) | ES438685A1 (OSRAM) |
| FI (1) | FI62532C (OSRAM) |
| FR (1) | FR2275213A1 (OSRAM) |
| IE (1) | IE42214B1 (OSRAM) |
| IL (1) | IL47351A (OSRAM) |
| LU (1) | LU72739A1 (OSRAM) |
| NL (1) | NL7507267A (OSRAM) |
| SE (1) | SE416650B (OSRAM) |
| SU (1) | SU862824A3 (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4314943A (en) * | 1977-07-13 | 1982-02-09 | Mead Johnson & Company | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols |
| US4272440A (en) * | 1978-02-24 | 1981-06-09 | Smithkline Corporation | Intermediates for preparing hydroxyphenylpyridazinones |
| IN148775B (OSRAM) * | 1978-08-04 | 1981-06-13 | Smithkline & French Lab Ltd Uk | |
| US4495352A (en) * | 1979-02-13 | 1985-01-22 | Mead Johnson & Company | Heterocyclic substituted aryloxy 3-indolyl-tertiary butylaminopropanols |
| DE3028453A1 (de) * | 1980-07-26 | 1982-03-18 | Zinser Textilmaschinen Gmbh, 7333 Ebersbach | Spinnmaschine |
| US4340733A (en) * | 1980-09-02 | 1982-07-20 | Smithkline Corporation | Process for preparing 3-chloro-6-(2-hydroxyphenyl)-pyridazines |
| EP0101156A3 (en) * | 1982-06-24 | 1984-08-22 | Smith Kline & French Laboratories Limited | Process for preparing 6-(2-hydroxyphenyl)-3-pyridazinone |
| DE3302442A1 (de) * | 1983-01-26 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | Neue pyridazinone, verfahren zu ihrer herstellung, diese verbindungen enthaltende therapeutische mittel und deren verwendung |
| GB8323553D0 (en) * | 1983-09-02 | 1983-10-05 | Smith Kline French Lab | Pharmaceutical compositions |
| JPH0629254B2 (ja) * | 1986-09-08 | 1994-04-20 | 帝国臓器製薬株式会社 | ピリダジノン誘導体 |
| CZ20033394A3 (cs) | 2001-06-12 | 2005-03-16 | Wellstat Therapeutics Corporation | Sloučeniny pro léčení metabolických poruch a způsob jejich přípravy |
| EP2492263A1 (en) | 2006-07-25 | 2012-08-29 | Cephalon, Inc. | Pyridizinone Derivatives |
| WO2013106547A1 (en) | 2012-01-10 | 2013-07-18 | President And Fellows Of Harvard College | Beta-cell replication promoting compounds and methods of their use |
| TW202216671A (zh) * | 2020-06-25 | 2022-05-01 | 瑞士商諾華公司 | 1,4—二取代的嗒𠯤化合物之製造方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE758146A (fr) * | 1969-10-29 | 1971-04-28 | Smith Kline French Lab | Derives de l'amidine |
| US3818097A (en) * | 1969-10-29 | 1974-06-18 | Smith Kline French Lab | Method of inhibiting histamine activity with isothioureas |
| IT1054107B (it) * | 1970-12-15 | 1981-11-10 | Isf Spa | Nuove 3,idrazinopiridazine 6,sostituite ad attivita antiiperten siva e loro preparazione |
| US3975530A (en) * | 1972-09-05 | 1976-08-17 | Smith Kline & French Laboratories Limited | N-cyano-N'-heterocyclic-alkyl quanidine inhibitors of H2 histamine receptors |
-
1975
- 1975-05-19 IE IE1124/75A patent/IE42214B1/en unknown
- 1975-05-26 IL IL47351A patent/IL47351A/xx unknown
- 1975-05-30 DK DK245275A patent/DK145099C/da not_active IP Right Cessation
- 1975-06-03 US US05/583,379 patent/US4053601A/en not_active Expired - Lifetime
- 1975-06-12 CA CA229,160A patent/CA1067078A/en not_active Expired
- 1975-06-16 FI FI751790A patent/FI62532C/fi not_active IP Right Cessation
- 1975-06-16 LU LU72739A patent/LU72739A1/xx unknown
- 1975-06-17 CH CH787175A patent/CH617429A5/de not_active IP Right Cessation
- 1975-06-17 SE SE7506947A patent/SE416650B/xx unknown
- 1975-06-17 JP JP50074260A patent/JPS5113782A/ja active Pending
- 1975-06-18 NL NL7507267A patent/NL7507267A/xx not_active Application Discontinuation
- 1975-06-18 FR FR7519034A patent/FR2275213A1/fr active Granted
- 1975-06-18 DE DE19752527066 patent/DE2527066A1/de not_active Ceased
- 1975-06-18 ES ES438685A patent/ES438685A1/es not_active Expired
-
1978
- 1978-12-22 SU SU782145553D patent/SU862824A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2275213B1 (OSRAM) | 1979-08-10 |
| IE42214L (en) | 1975-12-18 |
| FI751790A7 (OSRAM) | 1975-12-19 |
| NL7507267A (nl) | 1975-12-22 |
| ES438685A1 (es) | 1977-05-16 |
| DK245275A (da) | 1975-12-19 |
| JPS5113782A (OSRAM) | 1976-02-03 |
| DE2527066A1 (de) | 1976-01-08 |
| IL47351A0 (en) | 1975-07-28 |
| DK145099C (da) | 1983-01-31 |
| SE7506947L (sv) | 1975-12-19 |
| AU8158175A (en) | 1976-12-02 |
| DK145099B (da) | 1982-08-30 |
| SU862824A3 (ru) | 1981-09-07 |
| FI62532C (fi) | 1983-01-10 |
| IL47351A (en) | 1980-02-29 |
| FI62532B (fi) | 1982-09-30 |
| US4053601A (en) | 1977-10-11 |
| LU72739A1 (OSRAM) | 1975-10-08 |
| FR2275213A1 (fr) | 1976-01-16 |
| SE416650B (sv) | 1981-01-26 |
| CH617429A5 (OSRAM) | 1980-05-30 |
| IE42214B1 (en) | 1980-07-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1067078A (en) | Pharmacologically active substituted phenyl hydrazino-pyridazines | |
| US3931177A (en) | 6-(3-Substituted amino-2-hydroxypropoxyaryl)-4,5-dihydro-3(2H)-pyridazinones | |
| US4011321A (en) | Pharmaceutical compositions and methods of inhibiting β-adrenergic receptors | |
| CA1245651A (en) | Pyridazinones, preparation process thereof and utilization thereof, drugs containing pyridazinones | |
| US4978665A (en) | 3(2H)pyridazinone, and antagonistic agent against SRS-A containing it | |
| IE46852B1 (en) | Novel carbostyril derivatives | |
| CA2335104C (en) | Arylalkanoylpyridazines | |
| US3975388A (en) | Pyridazinones | |
| US4670434A (en) | (2-oxo-3-methylene-1,2,3,5-tetrahydroimidazo[2,1-b]quinazolinyl)oxyalkylamides useful as cyclic AMP phosphodiesterase inhibitors | |
| RU2232755C2 (ru) | Производные пиридазин-3-она и содержащие их лекарственные средства | |
| US5942511A (en) | Allylthiopyridazine derivatives and process for preparing the same | |
| EP0201765B1 (en) | 3(2h)pyridazinone, process for its preparation and anti-allergic agent containing it | |
| US4082843A (en) | 3-(3-(3-Substituted amino-2-hydroxypropoxy)phenyl)-6-hydrazino pyridazines and their use as vasodilators and β-adrenergic blocking agents | |
| US4088762A (en) | 6-(P-PIPERAZINO)-PHENYL-4,5-DIHYDRO-3(2H)pyridazinones | |
| IE45696B1 (en) | Derivatives of 2-(3-phenyl-2-aminopropionyloxy)-acetic acid | |
| US4007276A (en) | Triazolo isoindole derivatives | |
| US4111936A (en) | Pyridazinethiones | |
| JPS6159626B2 (OSRAM) | ||
| US4111935A (en) | 3-chloro-6-phenylpyridazine compounds | |
| US4882337A (en) | Tetrahydroisoquinoline antiarrhythmic agents | |
| IE46730B1 (en) | Pyridazinone derivatives | |
| JP2005503437A (ja) | アルキルアミノピリダジノン誘導体、この調製方法、およびこれを含む医薬組成物 | |
| EP0308059B1 (en) | 1,2,3,4-tetrahydroisoquinoline antiarrhythmic agents | |
| EP0047164B1 (en) | Process for preparing 3-chloro-6-(2-hydroxyphenyl)-pyridazines | |
| CA1083151A (en) | Naphthalenone phthalazinylhydrazones |