CA1064911A - Penicillins and their preparation - Google Patents
Penicillins and their preparationInfo
- Publication number
- CA1064911A CA1064911A CA238,194A CA238194A CA1064911A CA 1064911 A CA1064911 A CA 1064911A CA 238194 A CA238194 A CA 238194A CA 1064911 A CA1064911 A CA 1064911A
- Authority
- CA
- Canada
- Prior art keywords
- hydroxy
- ureido
- penicillin
- carbon atoms
- benzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930182555 Penicillin Natural products 0.000 title claims abstract description 49
- 150000002960 penicillins Chemical class 0.000 title claims abstract description 18
- 238000002360 preparation method Methods 0.000 title description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 17
- 125000003545 alkoxy group Chemical class 0.000 claims abstract description 11
- 125000004663 dialkyl amino group Chemical class 0.000 claims abstract description 7
- 229910052736 halogen Chemical class 0.000 claims abstract description 6
- 150000002367 halogens Chemical class 0.000 claims abstract description 6
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 6
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 6
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229940056360 penicillin g Drugs 0.000 claims description 115
- -1 methoxy, dimethylamino Chemical group 0.000 claims description 62
- 150000001875 compounds Chemical class 0.000 claims description 48
- 238000000034 method Methods 0.000 claims description 48
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 45
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 38
- 229940049954 penicillin Drugs 0.000 claims description 38
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 30
- 125000004432 carbon atom Chemical group C* 0.000 claims description 29
- 150000002148 esters Chemical class 0.000 claims description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 150000003839 salts Chemical class 0.000 claims description 22
- 239000000126 substance Substances 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 20
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 11
- 229960000723 ampicillin Drugs 0.000 claims description 10
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 claims description 10
- 238000001727 in vivo Methods 0.000 claims description 9
- 229960003022 amoxicillin Drugs 0.000 claims description 7
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 claims description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 claims description 7
- DCIHMFKXUPIFLL-UHFFFAOYSA-N 3h-[1,3]oxazolo[4,5-c]pyridin-2-one Chemical compound N1=CC=C2OC(=O)NC2=C1 DCIHMFKXUPIFLL-UHFFFAOYSA-N 0.000 claims description 6
- 125000005042 acyloxymethyl group Chemical group 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000000524 functional group Chemical group 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims description 2
- 241000965481 Darksidea alpha Species 0.000 claims 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 4
- LJJIWULGVPJIRK-UHFFFAOYSA-N 3h-[1,3]oxazolo[4,5-c][1,5]naphthyridin-2-one Chemical compound C1=CC=NC2=C(OC(=O)N3)C3=CN=C21 LJJIWULGVPJIRK-UHFFFAOYSA-N 0.000 claims 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 2
- RJSYPKWVIJGNLO-UHFFFAOYSA-N CCOClOC Chemical compound CCOClOC RJSYPKWVIJGNLO-UHFFFAOYSA-N 0.000 claims 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 2
- 125000001589 carboacyl group Chemical group 0.000 claims 2
- 238000006243 chemical reaction Methods 0.000 abstract description 12
- 241000894006 Bacteria Species 0.000 abstract description 3
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000002837 carbocyclic group Chemical group 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 23
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 230000000875 corresponding effect Effects 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 8
- 229940086542 triethylamine Drugs 0.000 description 8
- 239000012442 inert solvent Substances 0.000 description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- RPBAFSBGYDKNRG-NJBDSQKTSA-N epicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CCC=CC1 RPBAFSBGYDKNRG-NJBDSQKTSA-N 0.000 description 6
- 229960002457 epicillin Drugs 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229960001701 chloroform Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 150000002596 lactones Chemical class 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 235000019371 penicillin G benzathine Nutrition 0.000 description 4
- 229960003424 phenylacetic acid Drugs 0.000 description 4
- 239000003279 phenylacetic acid Substances 0.000 description 4
- 229960003342 pivampicillin Drugs 0.000 description 4
- ZEMIJUDPLILVNQ-ZXFNITATSA-N pivampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)[C@H](C(S3)(C)C)C(=O)OCOC(=O)C(C)(C)C)=CC=CC=C1 ZEMIJUDPLILVNQ-ZXFNITATSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 229910052727 yttrium Inorganic materials 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 125000005605 benzo group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 239000008298 dragée Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000007327 hydrogenolysis reaction Methods 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000003797 solvolysis reaction Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DQECFVGMGBQCPA-GLCLSGQWSA-N 2,2-dimethylpropanoyloxymethyl (2s,5r,6r)-6-[[(2r)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;hydron;chloride Chemical compound Cl.C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)[C@H](C(S3)(C)C)C(=O)OCOC(=O)C(C)(C)C)=CC=CC=C1 DQECFVGMGBQCPA-GLCLSGQWSA-N 0.000 description 2
- KZTWONRVIPPDKH-UHFFFAOYSA-N 2-(piperidin-1-yl)ethanol Chemical compound OCCN1CCCCC1 KZTWONRVIPPDKH-UHFFFAOYSA-N 0.000 description 2
- RCEFMOGVOYEGJN-UHFFFAOYSA-N 3-(2-hydroxyphenyl)-6-(3-nitrophenyl)-1,4-dihydropyrimidin-2-one Chemical compound OC1=CC=CC=C1N1C(=O)NC(C=2C=C(C=CC=2)[N+]([O-])=O)=CC1 RCEFMOGVOYEGJN-UHFFFAOYSA-N 0.000 description 2
- OIIBRAGQGFLUFI-UHFFFAOYSA-N 3-amino-1h-pyridin-4-one Chemical class NC1=CNC=CC1=O OIIBRAGQGFLUFI-UHFFFAOYSA-N 0.000 description 2
- NIQNIQVCPKCNQS-UHFFFAOYSA-N 3-amino-1h-quinolin-4-one Chemical class C1=CC=C2C(=O)C(N)=CNC2=C1 NIQNIQVCPKCNQS-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 241000589516 Pseudomonas Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 150000001715 carbamic acids Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 229960003326 cloxacillin Drugs 0.000 description 2
- LQOLIRLGBULYKD-JKIFEVAISA-N cloxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=CC=CC=C1Cl LQOLIRLGBULYKD-JKIFEVAISA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical group C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 150000005041 phenanthrolines Chemical class 0.000 description 2
- 229960004632 pivampicillin hydrochloride Drugs 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- BPNZQASDYYJPBN-UHFFFAOYSA-N 1h-[1,3]oxazolo[4,5-c][1,10]phenanthrolin-2-one Chemical compound C1=CN=C2C3=NC=C4NC(=O)OC4=C3C=CC2=C1 BPNZQASDYYJPBN-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- ZRPAUEVGEGEPFQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2 ZRPAUEVGEGEPFQ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- AZUMLDCKNIOCRV-UHFFFAOYSA-N 3h-[1,3]oxazolo[4,5-c][1,6]naphthyridin-2-one Chemical compound C1=CN=CC2=C(OC(=O)N3)C3=CN=C21 AZUMLDCKNIOCRV-UHFFFAOYSA-N 0.000 description 1
- WBLRDORZPJGLNO-UHFFFAOYSA-N 3h-[1,3]oxazolo[4,5-c][1,7]naphthyridin-2-one Chemical compound C1=NC=CC2=C(OC(=O)N3)C3=CN=C21 WBLRDORZPJGLNO-UHFFFAOYSA-N 0.000 description 1
- TVMDFRGNWZVRDL-UHFFFAOYSA-N 3h-[1,3]oxazolo[4,5-c][1,8]naphthyridin-2-one Chemical compound N1=CC=CC2=C(OC(=O)N3)C3=CN=C21 TVMDFRGNWZVRDL-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- XQXPVVBIMDBYFF-UHFFFAOYSA-N 4-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=C(O)C=C1 XQXPVVBIMDBYFF-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- ILUSXXHYBDBLSU-UHFFFAOYSA-N 6-bromo-3h-[1,3]oxazolo[4,5-c][1,6]naphthyridin-2-one Chemical compound N1=C2C(Br)=CN=CC2=C2OC(=O)NC2=C1 ILUSXXHYBDBLSU-UHFFFAOYSA-N 0.000 description 1
- UPSQQTRFGVJVGB-UHFFFAOYSA-N 6-bromo-3h-[1,3]oxazolo[4,5-c][1,7]naphthyridin-2-one Chemical compound N1=C2C(Br)=NC=CC2=C2OC(=O)NC2=C1 UPSQQTRFGVJVGB-UHFFFAOYSA-N 0.000 description 1
- UJRADQXRSACKQA-UHFFFAOYSA-N 6-bromo-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound N1=C2C(Br)=CC=CC2=C2OC(=O)NC2=C1 UJRADQXRSACKQA-UHFFFAOYSA-N 0.000 description 1
- QCGDVUOBGPJLBW-UHFFFAOYSA-N 6-chloro-3h-[1,3]oxazolo[4,5-c][1,6]naphthyridin-2-one Chemical compound N1=C2C(Cl)=CN=CC2=C2OC(=O)NC2=C1 QCGDVUOBGPJLBW-UHFFFAOYSA-N 0.000 description 1
- SMJQFMXZJRGQIG-UHFFFAOYSA-N 6-chloro-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound N1=C2C(Cl)=CC=CC2=C2OC(=O)NC2=C1 SMJQFMXZJRGQIG-UHFFFAOYSA-N 0.000 description 1
- JUWYJERUMCSQGD-UHFFFAOYSA-N 6-ethoxy-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound N1=C2C(OCC)=CC=CC2=C2OC(=O)NC2=C1 JUWYJERUMCSQGD-UHFFFAOYSA-N 0.000 description 1
- YUDKBGLWJZHWEA-UHFFFAOYSA-N 6-ethyl-3h-[1,3]oxazolo[4,5-c][1,5]naphthyridin-2-one Chemical compound N1=C2C(CC)=CC=NC2=C2OC(=O)NC2=C1 YUDKBGLWJZHWEA-UHFFFAOYSA-N 0.000 description 1
- ODOYQPRCFHYESL-UHFFFAOYSA-N 6-methoxy-3h-[1,3]oxazolo[4,5-c][1,5]naphthyridin-2-one Chemical compound N1=C2C(OC)=CC=NC2=C2OC(=O)NC2=C1 ODOYQPRCFHYESL-UHFFFAOYSA-N 0.000 description 1
- ZICAORNRHKSBKR-UHFFFAOYSA-N 6-methyl-3h-[1,3]oxazolo[4,5-c][1,6]naphthyridin-2-one Chemical compound N1=C2C(C)=CN=CC2=C2OC(=O)NC2=C1 ZICAORNRHKSBKR-UHFFFAOYSA-N 0.000 description 1
- LTCUKNBSOMRIJG-UHFFFAOYSA-N 7,8-dichloro-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=C2NC(=O)OC2=C2C=C(Cl)C(Cl)=CC2=N1 LTCUKNBSOMRIJG-UHFFFAOYSA-N 0.000 description 1
- PDTZJLSTBSROFC-UHFFFAOYSA-N 7-(2-methylpropyl)-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=NC2=CC(CC(C)C)=CC=C2C2=C1NC(=O)O2 PDTZJLSTBSROFC-UHFFFAOYSA-N 0.000 description 1
- HUGLYJKQQGMPEC-UHFFFAOYSA-N 7-amino-1,6-naphthyridin-8-ol Chemical compound C1=CC=NC2=C(O)C(N)=NC=C21 HUGLYJKQQGMPEC-UHFFFAOYSA-N 0.000 description 1
- WVBWVDONAPBJGC-UHFFFAOYSA-N 7-bromo-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=NC2=CC(Br)=CC=C2C2=C1NC(=O)O2 WVBWVDONAPBJGC-UHFFFAOYSA-N 0.000 description 1
- NPWKEMPLHRCAKU-UHFFFAOYSA-N 7-chloro-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=NC2=CC(Cl)=CC=C2C2=C1NC(=O)O2 NPWKEMPLHRCAKU-UHFFFAOYSA-N 0.000 description 1
- IUYHTKCUPUBUPA-UHFFFAOYSA-N 7-ethoxy-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=NC2=CC(OCC)=CC=C2C2=C1NC(=O)O2 IUYHTKCUPUBUPA-UHFFFAOYSA-N 0.000 description 1
- XVNNFWSHPORJOG-UHFFFAOYSA-N 7-ethyl-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=NC2=CC(CC)=CC=C2C2=C1NC(=O)O2 XVNNFWSHPORJOG-UHFFFAOYSA-N 0.000 description 1
- LVWXRYZERSIRLI-UHFFFAOYSA-N 7-fluoro-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=NC2=CC(F)=CC=C2C2=C1NC(=O)O2 LVWXRYZERSIRLI-UHFFFAOYSA-N 0.000 description 1
- JUGNHDHADOBMKL-UHFFFAOYSA-N 7-iodo-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=NC2=CC(I)=CC=C2C2=C1NC(=O)O2 JUGNHDHADOBMKL-UHFFFAOYSA-N 0.000 description 1
- DWBBNCCCEKQOAU-UHFFFAOYSA-N 7-methyl-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=NC2=CC(C)=CC=C2C2=C1NC(=O)O2 DWBBNCCCEKQOAU-UHFFFAOYSA-N 0.000 description 1
- FNYDCPDJHJFYOZ-UHFFFAOYSA-N 8-(diethylamino)-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C12=CC(N(CC)CC)=CC=C2N=CC2=C1OC(=O)N2 FNYDCPDJHJFYOZ-UHFFFAOYSA-N 0.000 description 1
- RARIBJFETMYSQL-UHFFFAOYSA-N 8-chloro-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C12=CC(Cl)=CC=C2N=CC2=C1OC(=O)N2 RARIBJFETMYSQL-UHFFFAOYSA-N 0.000 description 1
- QVBMCZZMIUKXID-UHFFFAOYSA-N 8-ethyl-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C12=CC(CC)=CC=C2N=CC2=C1OC(=O)N2 QVBMCZZMIUKXID-UHFFFAOYSA-N 0.000 description 1
- BJWJPKWHPKSKLJ-UHFFFAOYSA-N 8-methyl-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C12=CC(C)=CC=C2N=CC2=C1OC(=O)N2 BJWJPKWHPKSKLJ-UHFFFAOYSA-N 0.000 description 1
- YPLWGPWOKPWSRY-UHFFFAOYSA-N 9-chloro-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=C2NC(=O)OC2=C2C(Cl)=CC=CC2=N1 YPLWGPWOKPWSRY-UHFFFAOYSA-N 0.000 description 1
- WPBSWKYWOCXXCK-UHFFFAOYSA-N 9-ethyl-3h-[1,3]oxazolo[4,5-c]quinolin-2-one Chemical compound C1=C2NC(=O)OC2=C2C(CC)=CC=CC2=N1 WPBSWKYWOCXXCK-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 101100379067 Caenorhabditis elegans anc-1 gene Proteins 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- CEAZRRDELHUEMR-URQXQFDESA-N Gentamicin Chemical compound O1[C@H](C(C)NC)CC[C@@H](N)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](NC)[C@@](C)(O)CO2)O)[C@H](N)C[C@@H]1N CEAZRRDELHUEMR-URQXQFDESA-N 0.000 description 1
- 229930182566 Gentamicin Natural products 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- AKNUHUCEWALCOI-UHFFFAOYSA-N N-ethyldiethanolamine Chemical compound OCCN(CC)CCO AKNUHUCEWALCOI-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- 229930195708 Penicillin V Natural products 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000588767 Proteus vulgaris Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229960004821 amikacin Drugs 0.000 description 1
- LKCWBDHBTVXHDL-RMDFUYIESA-N amikacin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O LKCWBDHBTVXHDL-RMDFUYIESA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000002647 aminoglycoside antibiotic agent Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000001857 anti-mycotic effect Effects 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000002543 antimycotic Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- WZJYKHNJTSNBHV-UHFFFAOYSA-N benzo[h]quinoline Chemical class C1=CN=C2C3=CC=CC=C3C=CC2=C1 WZJYKHNJTSNBHV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001246 bromo group Chemical class Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 244000000010 microbial pathogen Species 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- KDLHZDBZIXYQEI-VENIDDJXSA-N palladium-100 Chemical compound [100Pd] KDLHZDBZIXYQEI-VENIDDJXSA-N 0.000 description 1
- 229940056367 penicillin v Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 229940007042 proteus vulgaris Drugs 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- JZKJGYBMTGSLJH-UHFFFAOYSA-N pyrido[2,3-b][1,5]naphthyridine Chemical compound C1=CC=NC2=CC3=CC=CN=C3N=C21 JZKJGYBMTGSLJH-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- NASFKTWZWDYFER-UHFFFAOYSA-N sodium;hydrate Chemical compound O.[Na] NASFKTWZWDYFER-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- 229960000707 tobramycin Drugs 0.000 description 1
- NLVFBUXFDBBNBW-PBSUHMDJSA-N tobramycin Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N NLVFBUXFDBBNBW-PBSUHMDJSA-N 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- UBOXGVDOUJQMTN-UHFFFAOYSA-N trichloroethylene Natural products ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229960004418 trolamine Drugs 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742450668 DE2450668A1 (de) | 1974-10-25 | 1974-10-25 | Ureidobenzylpenicilline und verfahren zu ihrer herstellung |
| DE19752535655 DE2535655A1 (de) | 1975-08-09 | 1975-08-09 | Penicilline und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1064911A true CA1064911A (en) | 1979-10-23 |
Family
ID=25767869
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA238,194A Expired CA1064911A (en) | 1974-10-25 | 1975-10-23 | Penicillins and their preparation |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4031230A (OSRAM) |
| JP (1) | JPS5176287A (OSRAM) |
| AT (1) | AT346483B (OSRAM) |
| CA (1) | CA1064911A (OSRAM) |
| CH (1) | CH618176A5 (OSRAM) |
| CS (1) | CS188973B2 (OSRAM) |
| DD (1) | DD122544A5 (OSRAM) |
| DK (1) | DK479475A (OSRAM) |
| ES (1) | ES442057A1 (OSRAM) |
| FR (1) | FR2288521A1 (OSRAM) |
| GB (1) | GB1501958A (OSRAM) |
| GR (1) | GR58290B (OSRAM) |
| HU (1) | HU170859B (OSRAM) |
| IE (1) | IE42057B1 (OSRAM) |
| IL (1) | IL48320A (OSRAM) |
| LU (1) | LU73640A1 (OSRAM) |
| NL (1) | NL7512496A (OSRAM) |
| SE (1) | SE7511931L (OSRAM) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PT67170B (de) * | 1976-11-06 | 1979-03-21 | Merck Patent Gmbh | Lactame verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel |
| DE2833018A1 (de) * | 1977-08-12 | 1979-03-01 | Taisho Pharma Co Ltd | Neue penicillinderivate und diese enthaltende mittel |
| ES477520A1 (es) * | 1978-02-25 | 1979-06-01 | Thomae Gmbh Dr K | Procedimiento para la preparacion de nuevas penicilinas. |
| DE2910190A1 (de) * | 1979-03-15 | 1980-10-02 | Thomae Gmbh Dr K | Neue penicilline, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| US4315858A (en) * | 1980-09-24 | 1982-02-16 | Warner-Lambert Company | Antibacterial amide compounds |
| US4315014A (en) * | 1980-09-24 | 1982-02-09 | Warner-Lambert Company | Antibacterial amide compounds and pharmaceutical composition containing the same |
| US6110929A (en) * | 1998-07-28 | 2000-08-29 | 3M Innovative Properties Company | Oxazolo, thiazolo and selenazolo [4,5-c]-quinolin-4-amines and analogs thereof |
| CA2572442A1 (fr) * | 2004-07-30 | 2006-03-09 | Palumed S.A. | Molecules hybrides qa ou q est une aminoquinoleine et a est un residu antibiotique, leur synthese et leurs utilisations en tant qu'agent antibacterien |
| WO2020111087A1 (ja) | 2018-11-28 | 2020-06-04 | 武田薬品工業株式会社 | 複素環化合物 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3720664A (en) * | 1969-11-17 | 1973-03-13 | Squibb & Sons Inc | Alpha-ureidocyclohexadienylalkylene-penicillins |
| US3951955A (en) * | 1970-12-29 | 1976-04-20 | Sumitomo Chemical Company, Limited | Penicillins substituted with heterocyclic groups |
| BE794886A (fr) * | 1972-02-22 | 1973-08-02 | Pfizer | Acides 6-(alpha-(omega-guanidinoalcanoylamino)acylamino)-penicillaniques |
| JPS5417754B2 (OSRAM) * | 1972-12-15 | 1979-07-02 | ||
| JPS5751837B2 (OSRAM) * | 1973-04-05 | 1982-11-04 | ||
| US3935189A (en) * | 1973-05-04 | 1976-01-27 | Beecham Group Limited | Penicillins |
| US3939150A (en) * | 1973-10-19 | 1976-02-17 | Yamanouchi Pharmaceutical Co., Ltd. | Penicillin derivatives |
-
1975
- 1975-10-16 FR FR7531677A patent/FR2288521A1/fr active Granted
- 1975-10-20 IL IL48320A patent/IL48320A/xx unknown
- 1975-10-21 CS CS757080A patent/CS188973B2/cs unknown
- 1975-10-22 GB GB43407/75A patent/GB1501958A/en not_active Expired
- 1975-10-22 US US05/624,763 patent/US4031230A/en not_active Expired - Lifetime
- 1975-10-23 CA CA238,194A patent/CA1064911A/en not_active Expired
- 1975-10-23 DD DD189018A patent/DD122544A5/xx unknown
- 1975-10-24 DK DK479475A patent/DK479475A/da unknown
- 1975-10-24 HU HUME001912 patent/HU170859B/hu unknown
- 1975-10-24 ES ES442057A patent/ES442057A1/es not_active Expired
- 1975-10-24 LU LU73640A patent/LU73640A1/xx unknown
- 1975-10-24 IE IE2320/75A patent/IE42057B1/en unknown
- 1975-10-24 SE SE7511931A patent/SE7511931L/xx unknown
- 1975-10-24 GR GR49201A patent/GR58290B/el unknown
- 1975-10-24 NL NL7512496A patent/NL7512496A/xx not_active Application Discontinuation
- 1975-10-24 AT AT813475A patent/AT346483B/de active
- 1975-10-24 CH CH1383775A patent/CH618176A5/de not_active IP Right Cessation
- 1975-10-25 JP JP50128805A patent/JPS5176287A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IE42057L (en) | 1976-04-25 |
| CS188973B2 (en) | 1979-03-30 |
| ATA813475A (de) | 1978-03-15 |
| HU170859B (hu) | 1977-09-28 |
| US4031230A (en) | 1977-06-21 |
| LU73640A1 (OSRAM) | 1977-05-31 |
| GR58290B (en) | 1977-09-20 |
| FR2288521B1 (OSRAM) | 1980-05-30 |
| ES442057A1 (es) | 1977-07-01 |
| IE42057B1 (en) | 1980-05-21 |
| CH618176A5 (OSRAM) | 1980-07-15 |
| AT346483B (de) | 1978-11-10 |
| IL48320A0 (en) | 1975-12-31 |
| FR2288521A1 (fr) | 1976-05-21 |
| IL48320A (en) | 1978-09-29 |
| DK479475A (da) | 1976-04-26 |
| DD122544A5 (OSRAM) | 1976-10-12 |
| SE7511931L (sv) | 1976-04-26 |
| GB1501958A (en) | 1978-02-22 |
| JPS5176287A (OSRAM) | 1976-07-01 |
| NL7512496A (nl) | 1976-04-27 |
| AU8590175A (en) | 1977-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI71126B (fi) | Foerfarande foer framstaellning av n-(1-alkyl- eller allyl-2-pyrrolidinylmetyl)-2-metoxi-4-amino-5-alkylsulfonylbensamider | |
| US3939150A (en) | Penicillin derivatives | |
| GB2108107A (en) | B-lactam intermediates | |
| CA1064911A (en) | Penicillins and their preparation | |
| US3954733A (en) | Naphthyridine-3-carboxamido-benzylpenicillins and salts thereof | |
| US3951955A (en) | Penicillins substituted with heterocyclic groups | |
| US3984556A (en) | Alkyl-substituted-tricyclic quinazolinones for lowering blood pressure | |
| EP0003115A1 (en) | Penicillins, per se and for use as antibacterially active antibiotics and their production | |
| US3951954A (en) | Novel oxofuryl ester derivatives of penicillin and cephalosporin | |
| US4119631A (en) | Penicillins and their preparation | |
| KR900005046B1 (ko) | 페니실린 유도체의 제조방법 | |
| NO169169B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive substituerte benzimidazoler | |
| SE451329B (sv) | 6-beta-jod-substituerade penicillansyror | |
| FI64940C (fi) | Foerfarande foer framstaellning av nya 6-metoxi-alfa-karboxipenicilliner | |
| FI71741B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara acyloxialkyl-6-(substituerade amidino) penicillanater | |
| KR970002641B1 (ko) | 퀴놀린 카르복실산의 유도체 | |
| US3982000A (en) | Alkyl-substituted-tricyclic quinazolinones as bronchodilators | |
| EP0015690B1 (en) | Penicillin derivatives, process for their preparation and pharmaceutical composition comprising them | |
| US4446317A (en) | Cephalosporin antibiotics | |
| DE2710979A1 (de) | Lactame, verfahren zu ihrer herstellung und diese verbindungen enthaltende mittel | |
| DE2450668A1 (de) | Ureidobenzylpenicilline und verfahren zu ihrer herstellung | |
| US3946019A (en) | 7H-Indolizino [5,6,7-IJ]isoquinoline derivatives | |
| US3719668A (en) | Semi-synthetic penicillin esters | |
| US3954775A (en) | Thiazolo(5,4-f)quinoline-8-carboxylic acid derivatives | |
| JPH02174784A (ja) | イソチアゾロキノリン誘導体 |