CA1062947A - Photothermographic toners - Google Patents
Photothermographic tonersInfo
- Publication number
- CA1062947A CA1062947A CA260,688A CA260688A CA1062947A CA 1062947 A CA1062947 A CA 1062947A CA 260688 A CA260688 A CA 260688A CA 1062947 A CA1062947 A CA 1062947A
- Authority
- CA
- Canada
- Prior art keywords
- sheet material
- silver
- acid
- dry
- dry silver
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052709 silver Inorganic materials 0.000 claims abstract description 35
- 239000004332 silver Substances 0.000 claims abstract description 35
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims abstract description 26
- 239000000463 material Substances 0.000 claims abstract description 16
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 claims abstract description 14
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 claims abstract description 13
- 150000008064 anhydrides Chemical class 0.000 claims abstract description 5
- 239000000203 mixture Substances 0.000 claims description 19
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 claims description 16
- 239000003638 chemical reducing agent Substances 0.000 claims description 13
- -1 silver halide Chemical class 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 11
- 229940100890 silver compound Drugs 0.000 claims description 6
- 150000003379 silver compounds Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- CWJJAFQCTXFSTA-UHFFFAOYSA-N 4-methylphthalic acid Chemical compound CC1=CC=C(C(O)=O)C(C(O)=O)=C1 CWJJAFQCTXFSTA-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- KHARCSTZAGNHOT-UHFFFAOYSA-N naphthalene-2,3-dicarboxylic acid Chemical compound C1=CC=C2C=C(C(O)=O)C(C(=O)O)=CC2=C1 KHARCSTZAGNHOT-UHFFFAOYSA-N 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 230000006872 improvement Effects 0.000 claims description 2
- 238000006479 redox reaction Methods 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims 1
- 159000000032 aromatic acids Chemical class 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- 239000000243 solution Substances 0.000 description 18
- 238000000576 coating method Methods 0.000 description 16
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 15
- 239000011248 coating agent Substances 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- UKMSUNONTOPOIO-UHFFFAOYSA-N docosanoic acid Chemical compound CCCCCCCCCCCCCCCCCCCCCC(O)=O UKMSUNONTOPOIO-UHFFFAOYSA-N 0.000 description 10
- 239000000523 sample Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000000975 dye Substances 0.000 description 8
- 239000000344 soap Substances 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 7
- 229910052721 tungsten Inorganic materials 0.000 description 7
- 239000010937 tungsten Substances 0.000 description 7
- AQRYNYUOKMNDDV-UHFFFAOYSA-M silver behenate Chemical compound [Ag+].CCCCCCCCCCCCCCCCCCCCCC([O-])=O AQRYNYUOKMNDDV-UHFFFAOYSA-M 0.000 description 6
- 235000021357 Behenic acid Nutrition 0.000 description 5
- 238000007792 addition Methods 0.000 description 5
- 229940116226 behenic acid Drugs 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000013019 agitation Methods 0.000 description 4
- 229920002301 cellulose acetate Polymers 0.000 description 4
- ZHQLTKAVLJKSKR-UHFFFAOYSA-N homophthalic acid Chemical compound OC(=O)CC1=CC=CC=C1C(O)=O ZHQLTKAVLJKSKR-UHFFFAOYSA-N 0.000 description 4
- IJAPPYDYQCXOEF-UHFFFAOYSA-N phthalazin-1(2H)-one Chemical compound C1=CC=C2C(=O)NN=CC2=C1 IJAPPYDYQCXOEF-UHFFFAOYSA-N 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 230000001235 sensitizing effect Effects 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- GJYCVCVHRSWLNY-UHFFFAOYSA-N 2-butylphenol Chemical compound CCCCC1=CC=CC=C1O GJYCVCVHRSWLNY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229940116224 behenate Drugs 0.000 description 2
- 239000008199 coating composition Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- NGYIMTKLQULBOO-UHFFFAOYSA-L mercury dibromide Chemical compound Br[Hg]Br NGYIMTKLQULBOO-UHFFFAOYSA-L 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- FBSFWRHWHYMIOG-UHFFFAOYSA-N methyl 3,4,5-trihydroxybenzoate Chemical compound COC(=O)C1=CC(O)=C(O)C(O)=C1 FBSFWRHWHYMIOG-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- GVTLFGJNTIRUEG-ZHACJKMWSA-N (e)-n-(3-methoxyphenyl)-3-phenylprop-2-enamide Chemical compound COC1=CC=CC(NC(=O)\C=C\C=2C=CC=CC=2)=C1 GVTLFGJNTIRUEG-ZHACJKMWSA-N 0.000 description 1
- FLTJDUOFAQWHDF-UHFFFAOYSA-N 2,2-dimethylhexane Chemical compound CCCCC(C)(C)C FLTJDUOFAQWHDF-UHFFFAOYSA-N 0.000 description 1
- MMEDJBFVJUFIDD-UHFFFAOYSA-N 2-[2-(carboxymethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1CC(O)=O MMEDJBFVJUFIDD-UHFFFAOYSA-N 0.000 description 1
- QVIKUAVXSRNDPS-UHFFFAOYSA-N 2-methoxynaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(OC)=CC=C21 QVIKUAVXSRNDPS-UHFFFAOYSA-N 0.000 description 1
- UERPUZBSSSAZJE-UHFFFAOYSA-N 3-chlorophthalic anhydride Chemical compound ClC1=CC=CC2=C1C(=O)OC2=O UERPUZBSSSAZJE-UHFFFAOYSA-N 0.000 description 1
- SLBQXWXKPNIVSQ-UHFFFAOYSA-N 4-nitrophthalic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1C(O)=O SLBQXWXKPNIVSQ-UHFFFAOYSA-N 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- 229920008347 Cellulose acetate propionate Polymers 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- 235000018734 Sambucus australis Nutrition 0.000 description 1
- 244000180577 Sambucus australis Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- UKMSUNONTOPOIO-UHFFFAOYSA-M behenate Chemical compound CCCCCCCCCCCCCCCCCCCCCC([O-])=O UKMSUNONTOPOIO-UHFFFAOYSA-M 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N hydroquinone methyl ether Natural products COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 150000002730 mercury Chemical class 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- IBKQQKPQRYUGBJ-UHFFFAOYSA-N methyl gallate Natural products CC(=O)C1=CC(O)=C(O)C(O)=C1 IBKQQKPQRYUGBJ-UHFFFAOYSA-N 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N monomethylhydroquinone Natural products CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- XULSCZPZVQIMFM-IPZQJPLYSA-N odevixibat Chemical compound C12=CC(SC)=C(OCC(=O)N[C@@H](C(=O)N[C@@H](CC)C(O)=O)C=3C=CC(O)=CC=3)C=C2S(=O)(=O)NC(CCCC)(CCCC)CN1C1=CC=CC=C1 XULSCZPZVQIMFM-IPZQJPLYSA-N 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 238000003303 reheating Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000012488 sample solution Substances 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(I) nitrate Inorganic materials [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/494—Silver salt compositions other than silver halide emulsions; Photothermographic systems ; Thermographic systems using noble metal compounds
- G03C1/498—Photothermographic systems, e.g. dry silver
- G03C1/49836—Additives
- G03C1/49845—Active additives, e.g. toners, stabilisers, sensitisers
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S430/00—Radiation imagery chemistry: process, composition, or product thereof
- Y10S430/166—Toner containing
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US611025A US3994732A (en) | 1975-09-08 | 1975-09-08 | Dry silver toners |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1062947A true CA1062947A (en) | 1979-09-25 |
Family
ID=24447308
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA260,688A Expired CA1062947A (en) | 1975-09-08 | 1976-09-07 | Photothermographic toners |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3994732A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5233722A (cg-RX-API-DMAC7.html) |
| AR (1) | AR216636A1 (cg-RX-API-DMAC7.html) |
| BE (1) | BE845923A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7605898A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1062947A (cg-RX-API-DMAC7.html) |
| CH (1) | CH619892A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2640040C2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES451254A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2323168A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1556207A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1076806B (cg-RX-API-DMAC7.html) |
| MX (1) | MX146511A (cg-RX-API-DMAC7.html) |
| NL (1) | NL190295C (cg-RX-API-DMAC7.html) |
| SE (1) | SE415711B (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA765028B (cg-RX-API-DMAC7.html) |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3994732A (en) * | 1975-09-08 | 1976-11-30 | Minnesota Mining & Mfg | Dry silver toners |
| US4212937A (en) * | 1977-12-23 | 1980-07-15 | Asahi Kasei Kogyo Kabushiki Kaisha | Heat developable photosensitive materials |
| US4374921A (en) * | 1981-06-08 | 1983-02-22 | Minnesota Mining And Manufacturing Company | Image enhancement of photothermographic elements |
| US4476220A (en) * | 1982-07-29 | 1984-10-09 | Minnesota Mining And Manufacturing Company | Spectrally sensitized photothermographic materials and preparation thereof |
| US4477562A (en) * | 1983-05-24 | 1984-10-16 | Minnesota Mining And Manufacturing Company | Dry strip antihalation layer for photothermographic film |
| US4510236A (en) * | 1983-12-20 | 1985-04-09 | Minnesota Mining And Manufacturing Company | Thermally generated toning agent system for photothermographic imaging compositions |
| US4585734A (en) * | 1985-02-01 | 1986-04-29 | Minnesota Mining And Manufacturing Company | Photothermographic toners |
| IT1251499B (it) * | 1991-09-18 | 1995-05-15 | Minnesota Mining & Mfg | Elementi fotografici sviluppabili termicamente |
| US5264321A (en) * | 1992-07-16 | 1993-11-23 | Minnesota Mining And Manufacturing Company | Photothermographic elements with novel layer structures |
| US5369000A (en) * | 1993-04-29 | 1994-11-29 | Minnesota Mining And Manufacturing Company | Post-processing stabilizers for photothermographic articles |
| JP3616130B2 (ja) * | 1993-06-04 | 2005-02-02 | イーストマン コダック カンパニー | 感赤外線性光熱写真ハロゲン化銀要素及び画像形成性媒体の露光方法 |
| US5380644A (en) * | 1993-08-10 | 1995-01-10 | Minnesota Mining And Manufacturing Company | Additive for the reduction of mottle in photothermographic and thermographic elements |
| US5358843A (en) * | 1993-08-20 | 1994-10-25 | Minnesota Mining And Manufacturing Company | Photothermographic elements containing silyl blocking groups |
| US6171707B1 (en) | 1994-01-18 | 2001-01-09 | 3M Innovative Properties Company | Polymeric film base having a coating layer of organic solvent based polymer with a fluorinated antistatic agent |
| US5350669A (en) * | 1994-01-19 | 1994-09-27 | Minnesota Mining And Manufacturing Company | Silver-carboxylate/1,2-diazine compounds as silver sources in photothermographic and thermographic elements |
| US5382504A (en) * | 1994-02-22 | 1995-01-17 | Minnesota Mining And Manufacturing Company | Photothermographic element with core-shell-type silver halide grains |
| US5492805A (en) * | 1994-06-30 | 1996-02-20 | Minnesota Mining And Manufacturing Company | Blocked leuco dyes for photothermographic elements |
| US5492804A (en) * | 1994-06-30 | 1996-02-20 | Minnesota Mining And Manufacturing Company | Chromogenic leuco redox-dye-releasing compounds for photothermographic elements |
| US5458787A (en) * | 1994-10-27 | 1995-10-17 | Uop | Extraction of certain metal cations from aqueous solutions |
| US5443742A (en) * | 1994-11-07 | 1995-08-22 | Minnesota Mining And Manufacturing Company | Purification of stable organic compounds |
| US5928857A (en) * | 1994-11-16 | 1999-07-27 | Minnesota Mining And Manufacturing Company | Photothermographic element with improved adherence between layers |
| US5492803A (en) * | 1995-01-06 | 1996-02-20 | Minnesota Mining And Manufacturing Company | Hydrazide redox-dye-releasing compounds for photothermographic elements |
| US5532121A (en) * | 1995-03-24 | 1996-07-02 | Minnesota Mining And Manufacturing Company | Mottle reducing agent for photothermographic and thermographic elements |
| US5545505A (en) * | 1995-09-19 | 1996-08-13 | Minnesota Mining And Manufacturing Company | Amine compounds as contrast enhancers for black-and-white photothermographic and thermographic elements |
| US5545515A (en) * | 1995-09-19 | 1996-08-13 | Minnesota Mining And Manufacturing Company | Acrylonitrile compounds as co-developers for black-and-white photothermographic and thermographic elements |
| US5545507A (en) * | 1995-09-19 | 1996-08-13 | Minnesota Mining And Manufacturing Company | Hydroxamic acid compounds as contrast enhancers for black-and-white photothermographic and thermographic elements |
| GB9519085D0 (en) * | 1995-09-19 | 1995-11-22 | Minnesota Mining & Mfg | Photographic elements comprising hydroxamic acid developers |
| US5637449A (en) * | 1995-09-19 | 1997-06-10 | Imation Corp | Hydrogen atom donor compounds as contrast enhancers for black-and-white photothermographic and thermographic elements |
| US5635339A (en) * | 1996-05-16 | 1997-06-03 | Minnesota Mining And Manufacturing Company | 3-heteroaramatic-substituted acrylonitrile compounds as co-developers for black-and-white photothermographic and thermographic elements |
| US5783380A (en) * | 1996-09-24 | 1998-07-21 | Eastman Kodak Company | Thermally processable imaging element |
| US6143488A (en) * | 1996-12-30 | 2000-11-07 | Agfa-Gevaert | Photothermographic recording material coatable from an aqueous medium |
| US5891615A (en) * | 1997-04-08 | 1999-04-06 | Imation Corp. | Chemical sensitization of photothermographic silver halide emulsions |
| US6146822A (en) * | 1997-06-06 | 2000-11-14 | Fuji Photo Film Co., Ltd. | Thermographic or photothermographic image recording elements |
| US5939249A (en) * | 1997-06-24 | 1999-08-17 | Imation Corp. | Photothermographic element with iridium and copper doped silver halide grains |
| US6340985B1 (en) | 1997-12-10 | 2002-01-22 | Fuji Photo Film Co. Ltd. | Thermal recording apparatus |
| US6174657B1 (en) | 1998-06-24 | 2001-01-16 | Eastman Kodak Company | Photothermographic element having desired color |
| ATE300059T1 (de) * | 2000-03-17 | 2005-08-15 | Fuji Photo Film Co Ltd | Photothermographisches material und bildherstellungsmethode |
| US6280913B1 (en) | 2000-06-13 | 2001-08-28 | Eastman Kodak Company | Photographic element comprising an ion exchanged photographically useful compound |
| US6599685B1 (en) | 2002-01-08 | 2003-07-29 | Eastman Kodak Company | Thermally developable imaging materials having improved shelf stability and stabilizing compositions |
| US6630291B1 (en) | 2002-08-21 | 2003-10-07 | Eastman Kodak Company | Thermally sensitive imaging materials containing phthalazine precursor |
| US6605418B1 (en) | 2002-10-28 | 2003-08-12 | Eastman Kodak Company | Thermally developable emulsions and materials containing phthalazine compounds |
| US7291163B2 (en) | 2003-11-14 | 2007-11-06 | Adroit Development, Inc. | Inflatable thermal blanket having air flow channels for directing a conditioned gas |
| US20050106514A1 (en) * | 2003-11-17 | 2005-05-19 | Eastman Kodak Company | Stabilized high-speed thermally developable emulsions and photothermographic materials |
| US6962763B2 (en) * | 2004-02-25 | 2005-11-08 | Eastman Kodak Company | Silver-free black-and-white thermographic materials |
| US20050186521A1 (en) * | 2004-02-25 | 2005-08-25 | Eastman Kodak Company | Black-and-white thermographic materials with improved image tone |
| US7022441B2 (en) * | 2004-02-25 | 2006-04-04 | Eastman Kodak Company | Silver-free black-and-white thermographic materials containing a benzoquinone and methods of imaging |
| US7445884B2 (en) * | 2004-06-09 | 2008-11-04 | Konica Minolta Medical & Graphic, Inc. | Photothermographic material, development method and thermal development device thereof |
| JP4433918B2 (ja) * | 2004-07-15 | 2010-03-17 | コニカミノルタエムジー株式会社 | 画像形成方法 |
| US20060046214A1 (en) * | 2004-08-25 | 2006-03-02 | Eastman Kodak Company | Photothermographic materials with reduced development time |
| US7220536B2 (en) * | 2004-10-22 | 2007-05-22 | Konica Minolta Medical & Graphic, Inc. | Silver salt photothermographic dry imaging material, thermal development method of the same, and thermal development apparatus for the same |
| WO2007010777A1 (ja) | 2005-07-20 | 2007-01-25 | Konica Minolta Medical & Graphic, Inc. | 画像形成方法 |
| US7504200B2 (en) | 2007-02-02 | 2009-03-17 | Konica Minolta Medical & Graphic, Inc. | Photothermographic material |
| US7468241B1 (en) | 2007-09-21 | 2008-12-23 | Carestream Health, Inc. | Processing latitude stabilizers for photothermographic materials |
| US7524621B2 (en) | 2007-09-21 | 2009-04-28 | Carestream Health, Inc. | Method of preparing silver carboxylate soaps |
| US7622247B2 (en) | 2008-01-14 | 2009-11-24 | Carestream Health, Inc. | Protective overcoats for thermally developable materials |
| US9335623B2 (en) | 2014-03-24 | 2016-05-10 | Carestream Health, Inc. | Thermally developable imaging materials |
| US9523915B2 (en) | 2014-11-04 | 2016-12-20 | Carestream Health, Inc. | Image forming materials, preparations, and compositions |
| US9746770B2 (en) | 2015-06-02 | 2017-08-29 | Carestream Health, Inc. | Thermally developable imaging materials and methods |
| WO2017123444A1 (en) | 2016-01-15 | 2017-07-20 | Carestream Health, Inc. | Method of preparing silver carboxylate soaps |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1250842B (de) * | 1962-11-23 | 1967-09-28 | Minnesota Mining and Manufacturing Company, Saint Paul, Minn. (V. St. A.) | Wärmeempfindliches Kopiermaterial |
| US3589903A (en) * | 1968-02-28 | 1971-06-29 | Minnesota Mining & Mfg | Silver halide,heat-developable image sheet containing mercuric ion |
| US3745009A (en) * | 1968-10-09 | 1973-07-10 | Eastman Kodak Co | Photographic elements and light-absorbing layers |
| US3816122A (en) * | 1972-02-02 | 1974-06-11 | Eastman Kodak Co | Film element comprising aromatic diester containing copolyester support |
| JPS4917229A (cg-RX-API-DMAC7.html) * | 1972-06-02 | 1974-02-15 | ||
| US3847612A (en) * | 1973-02-02 | 1974-11-12 | Minnesota Mining & Mfg | Light-sensitive heat-developable sheet material |
| US3856526A (en) * | 1973-08-06 | 1974-12-24 | Eastman Kodak Co | Protective layer for photothermographic elements |
| US3911171A (en) * | 1973-09-14 | 1975-10-07 | Agfa Gevaert A Naamloze Vennoo | Thermographic recording process |
| US3994732A (en) * | 1975-09-08 | 1976-11-30 | Minnesota Mining & Mfg | Dry silver toners |
-
1975
- 1975-09-08 US US611025A patent/US3994732A/en not_active Expired - Lifetime
-
1976
- 1976-08-09 US US05/712,682 patent/US4123282A/en not_active Expired - Lifetime
- 1976-08-23 ZA ZA765028A patent/ZA765028B/xx unknown
- 1976-09-02 SE SE7609708A patent/SE415711B/xx not_active IP Right Cessation
- 1976-09-03 NL NLAANVRAGE7609823,A patent/NL190295C/xx not_active IP Right Cessation
- 1976-09-04 ES ES451254A patent/ES451254A1/es not_active Expired
- 1976-09-06 DE DE2640040A patent/DE2640040C2/de not_active Expired
- 1976-09-06 BR BR7605898A patent/BR7605898A/pt unknown
- 1976-09-06 CH CH1130076A patent/CH619892A5/de not_active IP Right Cessation
- 1976-09-07 GB GB37057/76A patent/GB1556207A/en not_active Expired
- 1976-09-07 FR FR7626858A patent/FR2323168A1/fr active Granted
- 1976-09-07 CA CA260,688A patent/CA1062947A/en not_active Expired
- 1976-09-07 AR AR264617A patent/AR216636A1/es active
- 1976-09-07 JP JP51107176A patent/JPS5233722A/ja active Granted
- 1976-09-07 MX MX166210A patent/MX146511A/es unknown
- 1976-09-07 IT IT51162/76A patent/IT1076806B/it active
- 1976-09-07 BE BE170412A patent/BE845923A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE415711B (sv) | 1980-10-20 |
| SE7609708L (sv) | 1977-03-09 |
| US3994732A (en) | 1976-11-30 |
| ZA765028B (en) | 1977-08-31 |
| BR7605898A (pt) | 1978-04-04 |
| CH619892A5 (cg-RX-API-DMAC7.html) | 1980-10-31 |
| US4123282A (en) | 1978-10-31 |
| JPS5233722A (en) | 1977-03-15 |
| ES451254A1 (es) | 1977-12-01 |
| DE2640040C2 (de) | 1982-04-22 |
| AU1752176A (en) | 1978-05-04 |
| NL7609823A (nl) | 1977-03-10 |
| DE2640040A1 (de) | 1977-03-10 |
| NL190295C (nl) | 1994-01-03 |
| FR2323168A1 (fr) | 1977-04-01 |
| BE845923A (fr) | 1977-03-07 |
| MX146511A (es) | 1982-07-07 |
| GB1556207A (en) | 1979-11-21 |
| AR216636A1 (es) | 1980-01-15 |
| NL190295B (nl) | 1993-08-02 |
| FR2323168B1 (cg-RX-API-DMAC7.html) | 1978-05-05 |
| JPS5420333B2 (cg-RX-API-DMAC7.html) | 1979-07-21 |
| IT1076806B (it) | 1985-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1062947A (en) | Photothermographic toners | |
| US4332889A (en) | Post-activation type dry image forming material | |
| US3847612A (en) | Light-sensitive heat-developable sheet material | |
| EP0067638B1 (en) | Image enhancement of photothermographic elements | |
| DE2811025A1 (de) | Silbersalze von 3-amino-1,2,4-mercaptotriazolderivaten | |
| DE2220597A1 (de) | Verbessertes photographisches material | |
| GB2085609A (en) | Heat-developable photosensitive material | |
| EP0107093B1 (en) | Photothermographic recording material comprising a substituted triazine stabilizer precursor compound | |
| US4585734A (en) | Photothermographic toners | |
| US3881931A (en) | Method for developing black diazotype photographic light-sensitive materials | |
| JPH0629946B2 (ja) | ハロゲン化銀含有型感光性熱現像性シート材料 | |
| JPS63187233A (ja) | 安定な発色現像剤を含有するフオトサーモグラフイー乳剤 | |
| EP0273590B1 (en) | Stabilization of ketazine dyes | |
| SU878210A3 (ru) | Листовой материал дл получени изображений | |
| GB2029038A (en) | Dry image forming material | |
| EP0029837B1 (en) | Photothermographic stabilizers | |
| CA1213460A (en) | Stabilization of latent images in photothermographic elements | |
| DE2141063A1 (de) | Verbessertes photographisches material | |
| US4038083A (en) | Photothermographic recording sheet | |
| US4082879A (en) | Stabilized transparent receptor sheet | |
| JPS5824774B2 (ja) | 乾式画像形成材料 | |
| DE2830704A1 (de) | Trocken-bildaufzeichnungsmaterial | |
| GB2032125A (en) | A Method of Providing Contrast Reduction in Image Reproduction with a Diazotype Material and Diazotype Materials Adapted for the Application of said Method | |
| DE2220618A1 (de) | Verbessertes photographisches material | |
| US4642383A (en) | Fast coupling lemon-yellow phenolic couplers |