CA1060451A - Process for the preparation of cephalosporins - Google Patents
Process for the preparation of cephalosporinsInfo
- Publication number
- CA1060451A CA1060451A CA233,693A CA233693A CA1060451A CA 1060451 A CA1060451 A CA 1060451A CA 233693 A CA233693 A CA 233693A CA 1060451 A CA1060451 A CA 1060451A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- alkyl
- carbon atoms
- methyl
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 6
- 238000002360 preparation method Methods 0.000 title claims abstract description 4
- 229930186147 Cephalosporin Natural products 0.000 title description 3
- 229940124587 cephalosporin Drugs 0.000 title description 3
- 150000001780 cephalosporins Chemical class 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 36
- 239000002904 solvent Substances 0.000 claims abstract description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 19
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- -1 furyl-methyl Chemical group 0.000 claims abstract description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000000746 allylic group Chemical group 0.000 claims abstract description 3
- 230000026030 halogenation Effects 0.000 claims abstract description 3
- 238000005658 halogenation reaction Methods 0.000 claims abstract description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 36
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 10
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 claims description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 235000011056 potassium acetate Nutrition 0.000 claims description 5
- 239000000428 dust Substances 0.000 claims description 4
- PCZSPVPUWRXJLD-UHFFFAOYSA-M potassium;thiophene-2-carboxylate Chemical compound [K+].[O-]C(=O)C1=CC=CS1 PCZSPVPUWRXJLD-UHFFFAOYSA-M 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 8
- 239000001257 hydrogen Substances 0.000 abstract description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract description 6
- 125000003277 amino group Chemical group 0.000 abstract description 5
- 229910052736 halogen Inorganic materials 0.000 abstract description 5
- 150000002367 halogens Chemical class 0.000 abstract description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract description 4
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 4
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 4
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 4
- 239000003999 initiator Substances 0.000 abstract description 4
- 229910044991 metal oxide Inorganic materials 0.000 abstract description 4
- 150000004706 metal oxides Chemical class 0.000 abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract description 4
- 150000003254 radicals Chemical class 0.000 abstract description 4
- 125000003342 alkenyl group Chemical group 0.000 abstract description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract description 2
- 239000003638 chemical reducing agent Substances 0.000 abstract description 2
- 125000005843 halogen group Chemical group 0.000 abstract description 2
- 238000010438 heat treatment Methods 0.000 abstract description 2
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 abstract description 2
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 abstract description 2
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 2
- 125000001424 substituent group Chemical group 0.000 abstract description 2
- 125000004434 sulfur atom Chemical group 0.000 abstract description 2
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 abstract description 2
- 239000012434 nucleophilic reagent Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 239000000203 mixture Substances 0.000 description 18
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 16
- 101150041968 CDC13 gene Proteins 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 229960001866 silicon dioxide Drugs 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 239000002198 insoluble material Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- AOJDZKCUAATBGE-UHFFFAOYSA-N bromomethane Chemical compound Br[CH2] AOJDZKCUAATBGE-UHFFFAOYSA-N 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 4
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 2
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 1
- CSGFFYNMTALICU-ZWNOBZJWSA-N adipyl-7-aminodesacetoxycephalosporanic acid Natural products CC1=C(N2[C@H](SC1)[C@H](NC(=O)CCCCC(O)=O)C2=O)C(O)=O CSGFFYNMTALICU-ZWNOBZJWSA-N 0.000 description 1
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3590374A GB1472863A (en) | 1974-08-15 | 1974-08-15 | Intermediates for cephalosporin synthesis |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1060451A true CA1060451A (en) | 1979-08-14 |
Family
ID=10382828
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA233,693A Expired CA1060451A (en) | 1974-08-15 | 1975-08-12 | Process for the preparation of cephalosporins |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4077970A (esLanguage) |
| JP (1) | JPS5844676B2 (esLanguage) |
| AT (1) | AT348534B (esLanguage) |
| BE (1) | BE832424A (esLanguage) |
| CA (1) | CA1060451A (esLanguage) |
| CH (1) | CH617205A5 (esLanguage) |
| DE (1) | DE2535855A1 (esLanguage) |
| DK (1) | DK364775A (esLanguage) |
| ES (1) | ES440253A1 (esLanguage) |
| FR (4) | FR2288745A1 (esLanguage) |
| GB (1) | GB1472863A (esLanguage) |
| HU (1) | HU173015B (esLanguage) |
| NL (1) | NL178078C (esLanguage) |
| NO (1) | NO752812L (esLanguage) |
| SE (1) | SE425248B (esLanguage) |
| SU (1) | SU929010A3 (esLanguage) |
| ZA (1) | ZA755177B (esLanguage) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4332722A (en) * | 1975-02-17 | 1982-06-01 | Shionogi & Co., Ltd. | Cyclization to form cephem ring and intermediates therefor |
| GB1576219A (en) * | 1976-12-31 | 1980-10-01 | Connlab Holdings Ltd | Thiazoleneazetidinone derivatives |
| CA1090806A (en) * | 1977-01-10 | 1980-12-02 | Mitsuru Yoshioka | Oxazolines |
| US4271305A (en) * | 1979-02-01 | 1981-06-02 | Eli Lilly And Company | Thiazolinoazetidinones and process therefor |
| FR2455604A1 (fr) * | 1979-04-30 | 1980-11-28 | Lilly Co Eli | Nouveaux derives de thiazolino-azetidinones et leur preparation |
| US4482491A (en) * | 1981-05-01 | 1984-11-13 | Otsuka Kagaku Yakuhin Kabushiki Kaisha | Thiazolinoazetidinone derivatives and process for the preparation of the same |
| JPS5955888A (ja) | 1982-09-24 | 1984-03-31 | Otsuka Chem Co Ltd | アゼチジノン化合物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR6915080D0 (pt) * | 1969-06-12 | 1973-03-08 | Lilly Co Eli | Processo para a preparacao de um produto rearranjado de penicilina |
| GB1368232A (en) * | 1970-07-31 | 1974-09-25 | Glaxo Lab Ltd | Azetidino-thiazolidine compounds |
| GB1368236A (en) * | 1970-11-03 | 1974-09-25 | Glaxo Lab Ltd | Azetidinone derivatives and their preparation |
| US3862164A (en) * | 1971-02-03 | 1975-01-21 | Lilly Co Eli | Thiazolidine azetidinones |
| US3880872A (en) * | 1971-09-21 | 1975-04-29 | Lilly Co Eli | Process for preparing thiazoline azetidinones |
-
1974
- 1974-08-15 GB GB3590374A patent/GB1472863A/en not_active Expired
-
1975
- 1975-07-31 NL NLAANVRAGE7509132,A patent/NL178078C/xx not_active IP Right Cessation
- 1975-08-11 US US05/603,605 patent/US4077970A/en not_active Expired - Lifetime
- 1975-08-11 HU HU75SO00001154A patent/HU173015B/hu unknown
- 1975-08-11 AT AT622175A patent/AT348534B/de not_active IP Right Cessation
- 1975-08-12 CA CA233,693A patent/CA1060451A/en not_active Expired
- 1975-08-12 NO NO752812A patent/NO752812L/no unknown
- 1975-08-12 ZA ZA00755177A patent/ZA755177B/xx unknown
- 1975-08-12 DK DK364775A patent/DK364775A/da not_active Application Discontinuation
- 1975-08-12 DE DE19752535855 patent/DE2535855A1/de active Granted
- 1975-08-12 SE SE7509041A patent/SE425248B/xx not_active IP Right Cessation
- 1975-08-13 FR FR7525236A patent/FR2288745A1/fr active Granted
- 1975-08-14 BE BE159195A patent/BE832424A/xx not_active IP Right Cessation
- 1975-08-14 CH CH1061575A patent/CH617205A5/de not_active IP Right Cessation
- 1975-08-14 SU SU752163173A patent/SU929010A3/ru active
- 1975-08-14 JP JP50099046A patent/JPS5844676B2/ja not_active Expired
- 1975-08-14 ES ES440253A patent/ES440253A1/es not_active Expired
-
1976
- 1976-05-07 FR FR7613702A patent/FR2296640A1/fr active Granted
- 1976-05-07 FR FR7613703A patent/FR2296641A1/fr active Granted
- 1976-05-07 FR FR7613704A patent/FR2296642A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CH617205A5 (esLanguage) | 1980-05-14 |
| FR2296640A1 (fr) | 1976-07-30 |
| FR2296641A1 (fr) | 1976-07-30 |
| GB1472863A (en) | 1977-05-11 |
| FR2296642B1 (esLanguage) | 1979-04-27 |
| NL7509132A (nl) | 1976-02-17 |
| JPS5143791A (esLanguage) | 1976-04-14 |
| FR2288745B1 (esLanguage) | 1979-03-23 |
| DE2535855A1 (de) | 1976-03-04 |
| SE7509041L (sv) | 1976-02-16 |
| SU929010A3 (ru) | 1982-05-15 |
| SE425248B (sv) | 1982-09-13 |
| NL178078C (nl) | 1986-01-16 |
| US4077970A (en) | 1978-03-07 |
| BE832424A (fr) | 1976-02-16 |
| AT348534B (de) | 1979-02-26 |
| HU173015B (hu) | 1979-01-28 |
| FR2296642A1 (fr) | 1976-07-30 |
| ES440253A1 (es) | 1977-03-01 |
| FR2296641B1 (esLanguage) | 1979-04-27 |
| AU8393275A (en) | 1977-02-17 |
| DK364775A (da) | 1976-02-16 |
| NL178078B (nl) | 1985-08-16 |
| JPS5844676B2 (ja) | 1983-10-04 |
| ATA622175A (de) | 1978-07-15 |
| DE2535855C2 (esLanguage) | 1987-07-02 |
| NO752812L (esLanguage) | 1976-02-17 |
| FR2288745A1 (fr) | 1976-05-21 |
| FR2296640B1 (esLanguage) | 1979-05-04 |
| ZA755177B (en) | 1976-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR880001426B1 (ko) | 세팔로스포린 제조용 중간체의 제조방법 | |
| US4734512A (en) | Intermediates for the production of podophyllotoxin and related compounds and processes for the preparation and use thereof | |
| CA1060451A (en) | Process for the preparation of cephalosporins | |
| US4571428A (en) | 6-Substituted-4-hydroxy-tetrahydropyran-2-ones | |
| US4603014A (en) | Thiazolinoazetidinone derivatives and process for the preparation of the same | |
| FI75572B (fi) | Mellanprodukt foer framstaellning av cefalosporiner och foerfarande foer framstaellning av mellanprodukter. | |
| US5106996A (en) | Process for the preparation of podophyllotoxin | |
| US4155911A (en) | Process for the production of substituted 4-thia-2,6-diaza[3.2.0]-2-heptene-7-one | |
| RU2070200C1 (ru) | Способ получения цефалоспориновых антибиотиков | |
| CN1037514A (zh) | 制备2α-甲基-2β-(1,2,3-三唑-1-基)甲基青霉-3α-羧酸衍生物的方法 | |
| SU1277897A3 (ru) | Способ получени 1,1-диоксо-6-бром(или-6,6-дибром)пеницилланоилоксиметиловых эфиров 6-(2-азидо-2-фенилацетамидо)пенициллановой кислоты | |
| EP0102893B1 (en) | A novel production of 1-oxacephams | |
| US3880837A (en) | 6-Hydrazono penicillins and method of preparation thereof | |
| Henninger et al. | Stereodivergent routes from tyrosine to the 7-(R) and 7-(S) diastereomers of the 7-hydroxy-2, 3, 7, 7a-tetrahydroindole ring found in gliotoxin | |
| JP3171400B2 (ja) | ヒドロキシカルボニル誘導体およびその製造方法 | |
| US4353825A (en) | 5,6-Dehydropenicillins | |
| JPH0459310B2 (esLanguage) | ||
| GB2218095A (en) | Cepholosporin isomerisation | |
| US5013851A (en) | Intermediates for the production of podophyllotoxin and related compounds | |
| EP0244143A2 (en) | Substituted dioxanones and dioxinones | |
| CS196417B2 (en) | Method of producing 1-oxadethiacephamderivatives | |
| US4175076A (en) | Azetidinone mercury sulfides and process therefor | |
| US4148995A (en) | Process for preparing cephem lactones for cephalosporin-type antibiotics | |
| US4841071A (en) | 6-substituted-4-hydroxy-tetrahydropyran-2-ones | |
| FI73973C (fi) | Foerfarande foer framstaellning av -acyloxi- -(4-amino-fenyl)-acetamider. lisaeys patenttiin 59396 - tillaegg till patent 59396. |