CA1059863A - Detergent composition - Google Patents
Detergent compositionInfo
- Publication number
- CA1059863A CA1059863A CA238,958A CA238958A CA1059863A CA 1059863 A CA1059863 A CA 1059863A CA 238958 A CA238958 A CA 238958A CA 1059863 A CA1059863 A CA 1059863A
- Authority
- CA
- Canada
- Prior art keywords
- weight
- sodium
- carbon atoms
- ion exchange
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 160
- 239000003599 detergent Substances 0.000 title claims abstract description 68
- 239000000463 material Substances 0.000 claims abstract description 68
- 238000005342 ion exchange Methods 0.000 claims abstract description 54
- 229920001577 copolymer Polymers 0.000 claims abstract description 31
- 239000004094 surface-active agent Substances 0.000 claims abstract description 29
- 229920002554 vinyl polymer Polymers 0.000 claims abstract description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 77
- 125000004432 carbon atom Chemical group C* 0.000 claims description 62
- -1 vinyl compound Chemical class 0.000 claims description 50
- 125000000217 alkyl group Chemical group 0.000 claims description 42
- 239000000377 silicon dioxide Substances 0.000 claims description 39
- 239000011734 sodium Substances 0.000 claims description 34
- 229910052708 sodium Inorganic materials 0.000 claims description 31
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 30
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 26
- 229920001296 polysiloxane Polymers 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 21
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 20
- 229910019142 PO4 Inorganic materials 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 18
- 239000007859 condensation product Substances 0.000 claims description 16
- 235000012239 silicon dioxide Nutrition 0.000 claims description 16
- 239000002245 particle Substances 0.000 claims description 15
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 14
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 claims description 13
- 229910001424 calcium ion Inorganic materials 0.000 claims description 13
- 229910052681 coesite Inorganic materials 0.000 claims description 13
- 229910052906 cristobalite Inorganic materials 0.000 claims description 13
- 239000010452 phosphate Substances 0.000 claims description 13
- 229910052682 stishovite Inorganic materials 0.000 claims description 13
- 229910052905 tridymite Inorganic materials 0.000 claims description 13
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 238000007046 ethoxylation reaction Methods 0.000 claims description 11
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 11
- 239000011575 calcium Substances 0.000 claims description 10
- 150000001298 alcohols Chemical class 0.000 claims description 9
- 150000002191 fatty alcohols Chemical class 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 230000001105 regulatory effect Effects 0.000 claims description 7
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 229910052791 calcium Inorganic materials 0.000 claims description 6
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 6
- 235000010216 calcium carbonate Nutrition 0.000 claims description 6
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 6
- 125000000129 anionic group Chemical group 0.000 claims description 5
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- 239000004115 Sodium Silicate Substances 0.000 claims description 4
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- 229910052796 boron Inorganic materials 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000004200 microcrystalline wax Substances 0.000 claims description 4
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 229910021645 metal ion Inorganic materials 0.000 claims description 3
- 235000019808 microcrystalline wax Nutrition 0.000 claims description 3
- UHGIMQLJWRAPLT-UHFFFAOYSA-N octadecyl dihydrogen phosphate Chemical compound CCCCCCCCCCCCCCCCCCOP(O)(O)=O UHGIMQLJWRAPLT-UHFFFAOYSA-N 0.000 claims description 3
- 238000007127 saponification reaction Methods 0.000 claims description 3
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 claims description 3
- 229910009112 xH2O Inorganic materials 0.000 claims description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 claims description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 2
- 239000001509 sodium citrate Substances 0.000 claims description 2
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- IFTMCARQCOKBFG-UHFFFAOYSA-H [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)c1c(C([O-])=O)c(C([O-])=O)c(C([O-])=O)c(C([O-])=O)c1C([O-])=O Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)c1c(C([O-])=O)c(C([O-])=O)c(C([O-])=O)c(C([O-])=O)c1C([O-])=O IFTMCARQCOKBFG-UHFFFAOYSA-H 0.000 claims 1
- BNVZBQVIMPLFNA-UHFFFAOYSA-L disodium;2-(carboxymethoxy)butanedioate Chemical compound [Na+].[Na+].OC(=O)COC(C([O-])=O)CC([O-])=O BNVZBQVIMPLFNA-UHFFFAOYSA-L 0.000 claims 1
- NPCCEUVRYRJOLM-UHFFFAOYSA-L disodium;2-(carboxymethoxy)propanedioate Chemical compound [Na+].[Na+].OC(=O)COC(C([O-])=O)C([O-])=O NPCCEUVRYRJOLM-UHFFFAOYSA-L 0.000 claims 1
- XGMYMWYPSYIPQB-UHFFFAOYSA-J tetrasodium;2-(1,2-dicarboxylatoethoxy)butanedioate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CC(C([O-])=O)OC(C([O-])=O)CC([O-])=O XGMYMWYPSYIPQB-UHFFFAOYSA-J 0.000 claims 1
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 claims 1
- SIMZAOUCBQMDJV-UHFFFAOYSA-K trisodium 2,4,6-trisulfobenzene-1,3,5-triolate Chemical compound [Na+].[Na+].[Na+].Oc1c(c(O)c(c(O)c1S([O-])(=O)=O)S([O-])(=O)=O)S([O-])(=O)=O SIMZAOUCBQMDJV-UHFFFAOYSA-K 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 19
- 239000004615 ingredient Substances 0.000 abstract description 15
- 238000004140 cleaning Methods 0.000 abstract description 7
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 abstract description 4
- 229920000388 Polyphosphate Polymers 0.000 abstract description 3
- 239000008187 granular material Substances 0.000 abstract description 3
- 239000001205 polyphosphate Substances 0.000 abstract description 3
- 235000011176 polyphosphates Nutrition 0.000 abstract description 3
- 238000010410 dusting Methods 0.000 abstract 1
- 239000008233 hard water Substances 0.000 abstract 1
- 230000000704 physical effect Effects 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 235000021317 phosphate Nutrition 0.000 description 15
- 239000000243 solution Substances 0.000 description 13
- 229910001868 water Inorganic materials 0.000 description 13
- 239000003760 tallow Substances 0.000 description 11
- 150000008064 anhydrides Chemical class 0.000 description 10
- 241000894007 species Species 0.000 description 10
- 235000011180 diphosphates Nutrition 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 159000000000 sodium salts Chemical class 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 150000002500 ions Chemical class 0.000 description 8
- 229910052700 potassium Inorganic materials 0.000 description 8
- 239000011591 potassium Substances 0.000 description 8
- 239000002689 soil Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 125000001931 aliphatic group Chemical group 0.000 description 7
- 238000001694 spray drying Methods 0.000 description 7
- 235000013162 Cocos nucifera Nutrition 0.000 description 6
- 244000060011 Cocos nucifera Species 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 239000011574 phosphorus Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 159000000001 potassium salts Chemical class 0.000 description 5
- 229940048084 pyrophosphate Drugs 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- 239000000271 synthetic detergent Substances 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 150000004996 alkyl benzenes Chemical class 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 235000019864 coconut oil Nutrition 0.000 description 4
- 239000003240 coconut oil Substances 0.000 description 4
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 150000004665 fatty acids Chemical class 0.000 description 4
- 230000002209 hydrophobic effect Effects 0.000 description 4
- 229920005646 polycarboxylate Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000375 suspending agent Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 238000002441 X-ray diffraction Methods 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 3
- 229940105329 carboxymethylcellulose Drugs 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000001276 controlling effect Effects 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 238000004900 laundering Methods 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 239000003002 pH adjusting agent Substances 0.000 description 3
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 229910001388 sodium aluminate Inorganic materials 0.000 description 3
- 235000019795 sodium metasilicate Nutrition 0.000 description 3
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000006057 Non-nutritive feed additive Substances 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000001335 aliphatic alkanes Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 229940096386 coconut alcohol Drugs 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 2
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- DSEKYWAQQVUQTP-XEWMWGOFSA-N (2r,4r,4as,6as,6as,6br,8ar,12ar,14as,14bs)-2-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-2,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydro-1h-picen-3-one Chemical compound C([C@H]1[C@]2(C)CC[C@@]34C)C(C)(C)CC[C@]1(C)CC[C@]2(C)[C@H]4CC[C@@]1(C)[C@H]3C[C@@H](O)C(=O)[C@@H]1C DSEKYWAQQVUQTP-XEWMWGOFSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- SFRLSTJPMFGBDP-UHFFFAOYSA-N 1,2-diphosphonoethylphosphonic acid Chemical class OP(O)(=O)CC(P(O)(O)=O)P(O)(O)=O SFRLSTJPMFGBDP-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical compound OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- JVKRKMWZYMKVTQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JVKRKMWZYMKVTQ-UHFFFAOYSA-N 0.000 description 1
- XYJLPCAKKYOLGU-UHFFFAOYSA-N 2-phosphonoethylphosphonic acid Chemical class OP(O)(=O)CCP(O)(O)=O XYJLPCAKKYOLGU-UHFFFAOYSA-N 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- TWLKHTRAHQPZCI-UHFFFAOYSA-N 6-[dodecyl-methyl-(2-phenylethyl)azaniumyl]hexanoate Chemical compound CCCCCCCCCCCC[N+](C)(CCCCCC([O-])=O)CCC1=CC=CC=C1 TWLKHTRAHQPZCI-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical class CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241001553290 Euphorbia antisyphilitica Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 241000047703 Nonion Species 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000004964 aerogel Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- IRERQBUNZFJFGC-UHFFFAOYSA-L azure blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[S-]S[S-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] IRERQBUNZFJFGC-UHFFFAOYSA-L 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 229920005565 cyclic polymer Polymers 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- XQRLCLUYWUNEEH-UHFFFAOYSA-N diphosphonic acid Chemical compound OP(=O)OP(O)=O XQRLCLUYWUNEEH-UHFFFAOYSA-N 0.000 description 1
- LRVLKJSNOLCIQY-UHFFFAOYSA-L disodium;2-(1,2-dicarboxyethoxy)butanedioate Chemical compound [Na+].[Na+].OC(=O)CC(C(O)=O)OC(C([O-])=O)CC([O-])=O LRVLKJSNOLCIQY-UHFFFAOYSA-L 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 1
- 238000007580 dry-mixing Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 125000005313 fatty acid group Chemical group 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 1
- 229910001411 inorganic cation Inorganic materials 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000002366 lipolytic effect Effects 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 239000012170 montan wax Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- VSXGXPNADZQTGQ-UHFFFAOYSA-N oxirane;phenol Chemical compound C1CO1.OC1=CC=CC=C1 VSXGXPNADZQTGQ-UHFFFAOYSA-N 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 1
- 229920001921 poly-methyl-phenyl-siloxane Polymers 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 238000000634 powder X-ray diffraction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000013074 reference sample Substances 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004671 saturated fatty acids Chemical class 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 230000009919 sequestration Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- 235000013799 ultramarine blue Nutrition 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/37—Polymers
- C11D3/3746—Macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- C11D3/3757—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions
- C11D3/3761—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions in solid compositions
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/128—Aluminium silicates, e.g. zeolites
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB49174/74A GB1516848A (en) | 1974-11-13 | 1974-11-13 | Detergent composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1059863A true CA1059863A (en) | 1979-08-07 |
Family
ID=10451438
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA238,958A Expired CA1059863A (en) | 1974-11-13 | 1975-11-04 | Detergent composition |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US4072621A (enExample) |
| JP (1) | JPS5340604B2 (enExample) |
| BE (1) | BE835492A (enExample) |
| CA (1) | CA1059863A (enExample) |
| DE (1) | DE2549766C2 (enExample) |
| FR (1) | FR2291268A1 (enExample) |
| GB (1) | GB1516848A (enExample) |
| IT (1) | IT1049468B (enExample) |
| NL (1) | NL7513288A (enExample) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4102977A (en) * | 1975-11-18 | 1978-07-25 | Mizusawa Kagaku Kogyo Kabushiki Kaisha | Process for the preparation of alkali aluminosilicate detergent builder |
| DE2650278A1 (de) * | 1976-11-02 | 1978-05-03 | Henkel Kgaa | Verfahren zum maschinellen waschen und reinigen von festen werkstoffen unter verwendung phosphatarmer oder phosphatfreier wasch- und reinigungsmittel |
| DE2651793A1 (de) * | 1976-11-12 | 1978-05-18 | Henkel Kgaa | Verfahren zum maschinellen waschen und reinigen von festen werkstoffen unter verwendung phosphatarmer oder phosphatfreier wasch- und reinigungsmittel |
| BE5T2 (fr) * | 1977-06-21 | 1980-02-08 | Procter & Gamble Europ | Wasmiddelrn |
| US4180485A (en) * | 1977-11-02 | 1979-12-25 | The Procter & Gamble Company | Spray-dried detergent compositions |
| US4303556A (en) * | 1977-11-02 | 1981-12-01 | The Procter & Gamble Company | Spray-dried detergent compositions |
| EP0006268B2 (en) * | 1978-06-20 | 1988-08-24 | THE PROCTER & GAMBLE COMPANY | Washing and softening compositions and processes for making them |
| US4216125A (en) * | 1978-12-07 | 1980-08-05 | Pq Corporation | Detergent compositions with silane-zeolite silicate builder |
| US4243545A (en) * | 1979-12-10 | 1981-01-06 | Pq Corporation | Detergent compositions with silane-zeolite silicate builder |
| PH20653A (en) * | 1981-03-23 | 1987-03-16 | Unilever Nv | Process for preparing low silicate detergent compositions |
| US4379080A (en) * | 1981-04-22 | 1983-04-05 | The Procter & Gamble Company | Granular detergent compositions containing film-forming polymers |
| EP0063399B2 (en) * | 1981-04-22 | 1989-09-20 | THE PROCTER & GAMBLE COMPANY | Granular detergent compositions containing film-forming polymers |
| DE3271441D1 (en) * | 1981-11-16 | 1986-07-03 | Procter & Gamble | Process for preparing granular detergent compositions containing an intimately admixed anionic surfactant and an anionic polymer |
| DE3151536A1 (de) * | 1981-12-28 | 1983-07-07 | Henkel KGaA, 4000 Düsseldorf | Starkschaeumendes, koerniges waschmittel mit erhoehter kornstabilitaet und verfahren zu dessen herstellung |
| FR2528722A1 (fr) * | 1982-06-18 | 1983-12-23 | Rhone Poulenc Chim Base | Zeolite comme auxiliaire de detergence |
| US4545919A (en) * | 1982-08-31 | 1985-10-08 | Ciba-Geigy Corporation | Detergent composition for washing off dyeings obtained with fibre-reactive dyes and washing process comprising the use thereof |
| US4490271A (en) * | 1983-06-30 | 1984-12-25 | The Procter & Gamble Company | Detergent compositions containing polyethylene glycol and polyacrylate |
| US4536319A (en) * | 1983-10-04 | 1985-08-20 | The Procter & Gamble Company | Compositions comprising alkylpolysaccharide detergent surfactant |
| US4657693A (en) * | 1984-10-26 | 1987-04-14 | The Procter & Gamble Company | Spray-dried granular detergent compositions containing tripolyphosphate detergent builder, polyethylene glycol and polyacrylate |
| DE3444959A1 (de) * | 1984-12-10 | 1986-06-12 | Henkel KGaA, 4000 Düsseldorf | Teppichreinigungsmittel |
| GB8504733D0 (en) * | 1985-02-23 | 1985-03-27 | Procter & Gamble Ltd | Detergent compositions |
| CA1286563C (en) * | 1986-04-04 | 1991-07-23 | Jan Hendrik Eertink | Detergent powders and processes for preparing them |
| DE3644808A1 (de) * | 1986-12-31 | 1988-07-14 | Henkel Kgaa | Phosphatfreies waschmittel mit verringerter schaumneigung |
| US4871823A (en) | 1987-09-11 | 1989-10-03 | S. C. Johnson & Son, Inc. | 1-Alkene/excess maleic anhydride polymers |
| US4859752A (en) * | 1987-09-11 | 1989-08-22 | S. C. Johnson & Son, Inc. | Alkene/excess maleic anhydride polymer manufacture |
| US5104568A (en) * | 1990-06-18 | 1992-04-14 | The Procter & Gamble Company | Granular detergent compositions built with 2,2'-oxodisuccinate and zeolite a, process to make same, and agglomerated detergency builder |
| CA2107356C (en) * | 1991-05-14 | 2002-09-17 | Elizabeth J. Gladfelter | Two part solid detergent chemical concentrate |
| GB9113139D0 (en) * | 1991-06-18 | 1991-08-07 | Procter & Gamble | Detergent compositions |
| US5750485A (en) * | 1991-06-18 | 1998-05-12 | The Procter & Gamble Company | Laundry detergent containing a polyhydroxy fatty amide and insoluble ethoxylated alcohol |
| US5300250A (en) * | 1992-01-14 | 1994-04-05 | The Procter & Gamble Company | Granular laundry compositions having improved solubility |
| TW239160B (enExample) * | 1992-10-27 | 1995-01-21 | Procter & Gamble | |
| US5415806A (en) * | 1993-03-10 | 1995-05-16 | Lever Brothers Company, Division Of Conopco, Inc. | Cold water solubility for high density detergent powders |
| CA2204004E (en) * | 1994-10-31 | 2009-11-10 | Mike Godfrey | Global sound microphone system |
| US5562866A (en) * | 1995-06-20 | 1996-10-08 | Albemarle Corporation | Formulated branched chain alcohol ether sulfate compounds |
| GB9605534D0 (en) * | 1996-03-15 | 1996-05-15 | Unilever Plc | Detergent compositions |
| GB2315765A (en) * | 1996-08-01 | 1998-02-11 | Procter & Gamble | Detergent compositions for laundering clothes with low levels of sulphate and silicates |
| US6150324A (en) | 1997-01-13 | 2000-11-21 | Ecolab, Inc. | Alkaline detergent containing mixed organic and inorganic sequestrants resulting in improved soil removal |
| US6156715A (en) | 1997-01-13 | 2000-12-05 | Ecolab Inc. | Stable solid block metal protecting warewashing detergent composition |
| US6258765B1 (en) | 1997-01-13 | 2001-07-10 | Ecolab Inc. | Binding agent for solid block functional material |
| US6177392B1 (en) | 1997-01-13 | 2001-01-23 | Ecolab Inc. | Stable solid block detergent composition |
| USD419262S (en) * | 1999-03-12 | 2000-01-18 | Ecolab Inc. | Solid block detergent |
| GB0001021D0 (en) | 2000-01-14 | 2000-03-08 | Dow Corning Sa | Foam control agents |
| US6638902B2 (en) * | 2001-02-01 | 2003-10-28 | Ecolab Inc. | Stable solid enzyme compositions and methods employing them |
| US6632291B2 (en) | 2001-03-23 | 2003-10-14 | Ecolab Inc. | Methods and compositions for cleaning, rinsing, and antimicrobial treatment of medical equipment |
| US7125833B2 (en) * | 2003-03-24 | 2006-10-24 | Wacker Chemie Ag | Cyclodextrin laundry detergent additive complexes and compositions containing same |
| US20060178289A1 (en) * | 2004-07-20 | 2006-08-10 | Enrique Hernandez | Multifunctional material compositions and methods |
| US20060019865A1 (en) * | 2004-07-20 | 2006-01-26 | Enrique Hernandez | Methods and compositions of multifunctional detergent components |
| US20070161539A1 (en) * | 2006-01-12 | 2007-07-12 | Enrique Hernandez | Method of regulating degree of polymerization of an alkali metal silicate in solution using pH |
| DE102010023790A1 (de) | 2010-06-15 | 2011-12-15 | Heinrich-Heine-Universität Düsseldorf | Waschaktive Zusammensetzung |
| CN105254145A (zh) * | 2015-08-18 | 2016-01-20 | 海南卓越生物有限公司 | 包囊型活性钙乳液及其制备方法 |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL281834A (enExample) * | 1961-08-07 | |||
| US3308067A (en) * | 1963-04-01 | 1967-03-07 | Procter & Gamble | Polyelectrolyte builders and detergent compositions |
| US3870648A (en) * | 1971-01-14 | 1975-03-11 | Gaf Corp | Polyelectrolytes as detergent builders |
| US3794605A (en) * | 1971-07-19 | 1974-02-26 | Procter & Gamble | Built detergent composition containing whiteness maintenance additive |
| JPS5142818B2 (enExample) * | 1971-09-03 | 1976-11-18 | ||
| US3799880A (en) * | 1972-01-04 | 1974-03-26 | Lever Brothers Ltd | Spray dried controlled density detergent composition |
| JPS5247130B2 (enExample) * | 1972-06-21 | 1977-11-30 | ||
| GB1407997A (en) * | 1972-08-01 | 1975-10-01 | Procter & Gamble | Controlled sudsing detergent compositions |
| FI58652C (fi) * | 1973-04-13 | 1983-05-09 | Henkel Kgaa | Foerfarande foer tvaettning eller blekning av textilier samt medel foer genomfoerande av foerfarandet |
| AT330930B (de) * | 1973-04-13 | 1976-07-26 | Henkel & Cie Gmbh | Verfahren zur herstellung von festen, schuttfahigen wasch- oder reinigungsmitteln mit einem gehalt an calcium bindenden substanzen |
| AT375390B (de) * | 1973-05-23 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| US4605509A (en) * | 1973-05-11 | 1986-08-12 | The Procter & Gamble Company | Detergent compositions containing sodium aluminosilicate builders |
| US4083793A (en) * | 1973-05-23 | 1978-04-11 | Henkel Kommanditgesellschaft Auf Aktien | Washing compositions containing aluminosilicates and nonionics and method of washing textiles |
| CA1012624A (en) | 1973-08-31 | 1977-06-21 | Kenneth C. Allison | Insulation piercing clamp type electrical connector |
| LU68380A1 (enExample) * | 1973-09-07 | 1975-05-21 | ||
| AT335030B (de) * | 1974-01-14 | 1977-02-25 | Henkel & Cie Gmbh | Verfahren zum waschen von textilien, sowie mittel zur durchfuhrung des verfahrens |
| US3985669A (en) * | 1974-06-17 | 1976-10-12 | The Procter & Gamble Company | Detergent compositions |
| US3925262A (en) * | 1974-08-01 | 1975-12-09 | Procter & Gamble | Detergent composition having enhanced particulate soil removal performance |
| AT375394B (de) * | 1974-10-04 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| US4000080A (en) * | 1974-10-11 | 1976-12-28 | The Procter & Gamble Company | Low phosphate content detergent composition |
-
1974
- 1974-11-13 GB GB49174/74A patent/GB1516848A/en not_active Expired
-
1975
- 1975-11-04 CA CA238,958A patent/CA1059863A/en not_active Expired
- 1975-11-06 DE DE2549766A patent/DE2549766C2/de not_active Expired
- 1975-11-11 US US05/631,030 patent/US4072621A/en not_active Expired - Lifetime
- 1975-11-12 IT IT7529218A patent/IT1049468B/it active
- 1975-11-12 BE BE161795A patent/BE835492A/xx not_active IP Right Cessation
- 1975-11-12 FR FR7534519A patent/FR2291268A1/fr active Granted
- 1975-11-13 JP JP13674175A patent/JPS5340604B2/ja not_active Expired
- 1975-11-13 NL NL7513288A patent/NL7513288A/xx unknown
-
1980
- 1980-09-23 US US06/189,869 patent/US4303557A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2291268B1 (enExample) | 1980-06-27 |
| US4303557A (en) | 1981-12-01 |
| US4072621A (en) | 1978-02-07 |
| FR2291268A1 (fr) | 1976-06-11 |
| JPS5340604B2 (enExample) | 1978-10-28 |
| BE835492A (fr) | 1976-05-12 |
| DE2549766A1 (de) | 1976-05-20 |
| DE2549766C2 (de) | 1984-11-08 |
| IT1049468B (it) | 1981-01-20 |
| GB1516848A (en) | 1978-07-05 |
| JPS5198706A (enExample) | 1976-08-31 |
| NL7513288A (nl) | 1976-05-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1059863A (en) | Detergent composition | |
| CA1036889A (en) | Detergent compositions | |
| CA1290640C (en) | Antifoam ingredient | |
| US4274975A (en) | Detergent composition | |
| US4605509A (en) | Detergent compositions containing sodium aluminosilicate builders | |
| US4919845A (en) | Phosphate-free detergent having a reduced tendency towards incrustation | |
| US5393455A (en) | Zeolite-based phosphate-free detergent builder composition | |
| JPH0948995A (ja) | イミノジスクシネート類を含有する洗剤およびクリーナー | |
| IE56481B1 (en) | Bleaching compositions | |
| JPH0565557B2 (enExample) | ||
| EP0061226B1 (en) | Spray-dried detergent compositions | |
| DK164287B (da) | Granulaer detergentsammensaetning med et phosphorindhold paa mindre end 5% | |
| JPH0455640B2 (enExample) | ||
| GB1596756A (en) | Detergent compositions | |
| EP0080222B1 (en) | Process for preparing granular detergent compositions containing an intimately admixed anionic surfactant and an anionic polymer | |
| EP1038945A2 (en) | Polymer having a hydrophilic backbone and hydrophobic moieties as soil suspending agent in powder detergents | |
| DK159209B (da) | Stabiliseret blegende rensemiddel og fremgangsmaade til blegning | |
| EP0001853B2 (en) | Detergent compositions having improved bleaching effect | |
| EP0000215A1 (en) | Low-phosphate detergent composition for fabric washing | |
| IE51245B1 (en) | Granular detergent compositions | |
| CA1316790C (en) | Non-phosphorus detergent bleach compositions | |
| CA1040962A (en) | Monionic detergent composition | |
| JP2022500519A (ja) | 染料定着性ポリマーとして疎水変性ポリアルキレンイミンを含むファブリックケア組成物 | |
| DK159208B (da) | Stabiliseret blegende rensemiddel og fremgangsmaade til blegning | |
| KR920001656B1 (ko) | 무린세제 표백조성물 |