CA1055800A - Urinal device - Google Patents
Urinal deviceInfo
- Publication number
- CA1055800A CA1055800A CA234,683A CA234683A CA1055800A CA 1055800 A CA1055800 A CA 1055800A CA 234683 A CA234683 A CA 234683A CA 1055800 A CA1055800 A CA 1055800A
- Authority
- CA
- Canada
- Prior art keywords
- trough
- urine
- forwardly
- walls
- downwardly
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims abstract description 24
- 239000002250 absorbent Substances 0.000 claims abstract description 12
- 230000002745 absorbent Effects 0.000 claims abstract description 11
- 230000002485 urinary effect Effects 0.000 claims abstract description 4
- 210000002700 urine Anatomy 0.000 claims description 6
- 239000001828 Gelatine Substances 0.000 claims description 2
- 229920000159 gelatin Polymers 0.000 claims description 2
- 235000019322 gelatine Nutrition 0.000 claims description 2
- 230000002035 prolonged effect Effects 0.000 claims description 2
- 210000003905 vulva Anatomy 0.000 claims description 2
- 238000007599 discharging Methods 0.000 claims 2
- 239000005018 casein Substances 0.000 claims 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 claims 1
- 235000021240 caseins Nutrition 0.000 claims 1
- 210000003708 urethra Anatomy 0.000 abstract description 2
- 206010046555 Urinary retention Diseases 0.000 abstract 1
- 241000209094 Oryza Species 0.000 description 7
- 235000007164 Oryza sativa Nutrition 0.000 description 7
- 235000009566 rice Nutrition 0.000 description 7
- 241001125929 Trisopterus luscus Species 0.000 description 4
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- KRTSDMXIXPKRQR-AATRIKPKSA-N monocrotophos Chemical compound CNC(=O)\C=C(/C)OP(=O)(OC)OC KRTSDMXIXPKRQR-AATRIKPKSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 101100421135 Caenorhabditis elegans sel-5 gene Proteins 0.000 description 1
- 101100152865 Danio rerio thraa gene Proteins 0.000 description 1
- 101150039033 Eci2 gene Proteins 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 241001313288 Labia Species 0.000 description 1
- 241001584775 Tunga penetrans Species 0.000 description 1
- 229940062352 aceon Drugs 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000002844 continuous effect Effects 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- VBCVPMMZEGZULK-NRFANRHFSA-N indoxacarb Chemical compound C([C@@]1(OC2)C(=O)OC)C3=CC(Cl)=CC=C3C1=NN2C(=O)N(C(=O)OC)C1=CC=C(OC(F)(F)F)C=C1 VBCVPMMZEGZULK-NRFANRHFSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000027939 micturition Effects 0.000 description 1
- IYNMDWMQHSMDDE-MHXJNQAMSA-N perindopril erbumine Chemical compound CC(C)(C)N.C1CCC[C@@H]2N(C(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC)[C@H](C(O)=O)C[C@@H]21 IYNMDWMQHSMDDE-MHXJNQAMSA-N 0.000 description 1
- 101150014006 thrA gene Proteins 0.000 description 1
- MBYLVOKEDDQJDY-UHFFFAOYSA-N tris(2-aminoethyl)amine Chemical compound NCCN(CCN)CCN MBYLVOKEDDQJDY-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61F—FILTERS IMPLANTABLE INTO BLOOD VESSELS; PROSTHESES; DEVICES PROVIDING PATENCY TO, OR PREVENTING COLLAPSING OF, TUBULAR STRUCTURES OF THE BODY, e.g. STENTS; ORTHOPAEDIC, NURSING OR CONTRACEPTIVE DEVICES; FOMENTATION; TREATMENT OR PROTECTION OF EYES OR EARS; BANDAGES, DRESSINGS OR ABSORBENT PADS; FIRST-AID KITS
- A61F5/00—Orthopaedic methods or devices for non-surgical treatment of bones or joints; Nursing devices ; Anti-rape devices
- A61F5/44—Devices worn by the patient for reception of urine, faeces, catamenial or other discharge; Colostomy devices
- A61F5/451—Genital or anal receptacles
- A61F5/455—Genital or anal receptacles for collecting urine or discharge from female member
- A61F5/4556—Portable urination aids, e.g. to allow females to urinate from a standing position
Landscapes
- Health & Medical Sciences (AREA)
- Epidemiology (AREA)
- Nursing (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Engineering & Computer Science (AREA)
- Biomedical Technology (AREA)
- Heart & Thoracic Surgery (AREA)
- Vascular Medicine (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Orthopedics, Nursing, And Contraception (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52788774A | 1974-11-27 | 1974-11-27 | |
| US05/573,249 US4023216A (en) | 1974-11-27 | 1975-04-30 | Urinal device |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1055800A true CA1055800A (en) | 1979-06-05 |
Family
ID=27062539
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA234,683A Expired CA1055800A (en) | 1974-11-27 | 1975-09-03 | Urinal device |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4023216A (enExample) |
| CA (1) | CA1055800A (enExample) |
| CH (1) | CH591238A5 (enExample) |
| DE (1) | DE2540612A1 (enExample) |
| GB (1) | GB1524838A (enExample) |
| NL (1) | NL7512545A (enExample) |
Families Citing this family (91)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4608046A (en) * | 1977-08-19 | 1986-08-26 | Keivan Towfigh | Flat folded female urinary aid |
| US4187562A (en) * | 1978-05-04 | 1980-02-12 | Mioduski Victoria F | Personal urinal device for females |
| US4202057A (en) * | 1978-09-05 | 1980-05-13 | Ibarra Guillermo N | Device for receiving and disposing of urine from bedridden women |
| EP0023942A1 (en) * | 1979-08-10 | 1981-02-18 | Akira Horiuchi | Help implement to be used by human females when urinating |
| US4296502A (en) * | 1980-03-17 | 1981-10-27 | Bonnie Bortle | Self-packaging urine conduit |
| GB2125287A (en) * | 1982-08-19 | 1984-03-07 | Leslie George Lowther | Urine deflector |
| US4750219A (en) * | 1983-10-28 | 1988-06-14 | Williams Douglas A | Urinal device |
| GB2148708B (en) * | 1983-11-04 | 1986-08-13 | Rocket Of London Ltd | Urine etc collection device |
| IT8435569U1 (it) * | 1984-02-10 | 1985-08-10 | Consagra Pietro | Dispositivo per consentire alle persone di sesso femminile di urinare in posizione eretta |
| US5002541A (en) * | 1984-06-19 | 1991-03-26 | Martin And Associates, Inc. | Method and device for removing and collecting urine |
| US4528703A (en) * | 1984-06-25 | 1985-07-16 | Kraus Richard J | Portable urinal |
| DE3578309D1 (de) * | 1984-12-13 | 1990-07-26 | Madeline Thomas | Fluessigkeitssammelbehaelter. |
| US4681573A (en) * | 1985-10-29 | 1987-07-21 | Aplex Corporation | Feminine urinary device |
| USD297462S (en) | 1986-02-19 | 1988-08-30 | Jung Corporation | Urinal bottle |
| US4846817A (en) * | 1986-07-16 | 1989-07-11 | Virginia Cleland | External urinary device for women |
| US4751751A (en) * | 1986-07-21 | 1988-06-21 | Reno Richard C | Disposable urinating funnel for females |
| WO1988004558A1 (en) * | 1986-12-22 | 1988-06-30 | Conkling J Michael | Urine sensing, collecting and storage device |
| US4764991A (en) * | 1987-05-21 | 1988-08-23 | Saleme Lola M | Female urinal for supine use |
| US5049144A (en) * | 1988-10-31 | 1991-09-17 | Payton Hugh W | Female urinary incontinence apparatus |
| US4937890A (en) * | 1989-10-05 | 1990-07-03 | Tafur Jose J | Flat folded disposable female urinary aid |
| US5065459A (en) * | 1990-05-03 | 1991-11-19 | Surja Tjahaja | Disposable portable urinal |
| US5243712A (en) * | 1990-05-23 | 1993-09-14 | Cross Leta K | Disposable urinary device |
| US5091998A (en) * | 1990-06-29 | 1992-03-03 | Carlos Witzke | Funnel device to facilitate urination by women in an upright position |
| US5323719A (en) * | 1991-05-14 | 1994-06-28 | Mcdonald, Withers & Hughes, Inc. | Contaminated wastes disposal system |
| US5385105A (en) * | 1991-05-14 | 1995-01-31 | Mcdonald, Withers & Hughes, Inc. | Burnable wastes collector with liquid absorber and identifier |
| US5235705A (en) * | 1991-08-19 | 1993-08-17 | Brice Belisle | Pocket portable urinal |
| AU3249093A (en) * | 1991-12-16 | 1993-07-19 | William H. Cicio | Female urination aid |
| DE9209534U1 (de) * | 1992-07-16 | 1992-09-17 | Becker, Roswitha, 7562 Gernsbach | Auto- Trocken- WC |
| US5333330A (en) * | 1992-09-04 | 1994-08-02 | Murtagh Daniel S | Feminine urinary device |
| US5401263A (en) * | 1993-08-02 | 1995-03-28 | Cornellier; Maurice H. | Feminine urinary aid package |
| US5330453A (en) * | 1993-08-02 | 1994-07-19 | Cornellier Maurice H | Feminine urinary aid |
| USD356865S (en) | 1993-09-13 | 1995-03-28 | Ivie Marvin L | Feminine urinary funnel |
| DE9404033U1 (de) * | 1994-03-07 | 1994-05-11 | Jahn, Klara, 14059 Berlin | Urinier-Hilfe |
| US5566400A (en) * | 1994-03-22 | 1996-10-22 | Jonec; Viliam | Flat-folded disposable male urinary aid and compact portable dispenser therefor |
| DE4416094A1 (de) * | 1994-04-20 | 1995-11-16 | Gaia Arcelli | Vorrichtung zur Erleichterung des Urinlassens |
| US5605161A (en) * | 1994-06-24 | 1997-02-25 | Cross; Leta K. | Disposable urinalysis device with indicator |
| US5722096A (en) * | 1994-12-27 | 1998-03-03 | Pfaeffle; Patricia | Portable urinal |
| ITRM950331A1 (it) * | 1995-05-19 | 1996-11-19 | Corrado Cianci | Dispositivo convogliante applicabile all'apparato urinario femminile di pazienti disabili. |
| US5742948A (en) * | 1995-08-11 | 1998-04-28 | Cicio; William H. | Female urination aid |
| ITRM950614A1 (it) * | 1995-09-14 | 1997-03-14 | Bertolani Sergio | Canalizzatore igienico per la urinazione femminile in toilette pubbliche |
| US5820152A (en) * | 1995-12-01 | 1998-10-13 | Warren-Pfaeffle; Patricia E. | Wheelchair and water closet chair with remote control extending arms closing a cap |
| US6129320A (en) * | 1995-12-01 | 2000-10-10 | Warren-Pfaeffle; Patricia E. | Motor driven stand-up urinal |
| CH691654A5 (de) * | 1996-03-25 | 2001-09-14 | Creaholic Sa | Urinierhilfe für weibliche Personen. |
| US6327716B1 (en) | 1996-04-22 | 2001-12-11 | Reinhold Kaus | Urinal cone and packaging therefor |
| EP0991384B1 (en) * | 1997-03-27 | 2001-08-22 | Catharina Maria Dantuma-Van Dorp | Urinating aid for women |
| US5893176A (en) * | 1997-05-13 | 1999-04-13 | Rainbow Medical | Female urine device |
| US5966748A (en) * | 1998-05-04 | 1999-10-19 | Young; Edward J. | Tinkle safe |
| IT246131Y1 (it) * | 1998-09-11 | 2002-04-05 | Giacomo Quirino & C Snc Di Di | Dispositivo personale e monouso atto ad evitare contagi e promisquita'alle donne in caso di minzione,presso bagni pubblici |
| ES2151847B1 (es) * | 1998-10-07 | 2001-08-16 | Rodriguez Juan Carlos Caubin | Util para orinar las mujeres. |
| EP1055402A1 (en) * | 1999-05-25 | 2000-11-29 | Sima Mottale | Feminine urinary device, allowing women to urinate in an upright posture |
| US6547771B2 (en) | 2000-05-01 | 2003-04-15 | Caring Hands, Inc. | Non-invasive female urinary device |
| USD457237S1 (en) | 2001-06-27 | 2002-05-14 | Nabil Azo | Urine collection funnel |
| US7662138B2 (en) * | 2001-12-28 | 2010-02-16 | Sca Hygiene Products Ab | Absorbent article |
| US7799007B2 (en) * | 2001-12-28 | 2010-09-21 | Sca Hygiene Products Ab | Absorbent article with two-piece construction and method of making the same |
| US7481802B2 (en) * | 2001-12-28 | 2009-01-27 | Sca Hygiene Products Ab | Absorbent article |
| US7553300B2 (en) * | 2002-07-05 | 2009-06-30 | Sca Hygiene Products Ab | Absorbent product for men |
| US6904621B2 (en) * | 2003-03-27 | 2005-06-14 | Preferred Medical Devices, Inc. | Urine collection device |
| US7198071B2 (en) * | 2003-05-02 | 2007-04-03 | Össur Engineering, Inc. | Systems and methods of loading fluid in a prosthetic knee |
| US6922852B1 (en) | 2003-09-16 | 2005-08-02 | Alvin S. Blum | Disposable female urinal |
| US20050097662A1 (en) * | 2003-11-12 | 2005-05-12 | Brett Leimkuhler | Female urinary device |
| EP1541099A1 (en) * | 2003-12-12 | 2005-06-15 | Zofia Szlowieniec | Urinary assistance device |
| US20060149195A1 (en) * | 2005-01-06 | 2006-07-06 | Oprandi Arthur V | Disposable urine control device |
| US7131149B2 (en) * | 2005-03-31 | 2006-11-07 | Langford Marlynn J | Female urination aid device |
| US7458110B2 (en) * | 2005-05-05 | 2008-12-02 | Jin Rie | Hygienic commode for ladies with reverse sitting |
| DE102005037762B3 (de) * | 2005-08-10 | 2006-09-21 | Ulbrich, Ursula | Harnaufnahmegerät |
| DK176224B1 (da) * | 2005-12-08 | 2007-03-05 | Global Papir As | Engangsmanchet til stomiudskylning |
| ES2286954B1 (es) * | 2006-05-31 | 2008-10-16 | Global Ebejico, S.L. | Dispositivo urinario femenino. |
| US20080034481A1 (en) * | 2006-08-09 | 2008-02-14 | Bernard Cheng | Standup urination system for both sexes |
| EP2107889B1 (en) * | 2007-01-29 | 2012-08-01 | Hollister Incorporated | A device and method for the collection of a urine sample |
| USD602156S1 (en) | 2007-07-22 | 2009-10-13 | Young Larry M | Disposable urinal |
| US7454801B1 (en) * | 2007-07-30 | 2008-11-25 | Jin Rie | Commodes with user's upper-body support |
| US20090048569A1 (en) * | 2007-08-16 | 2009-02-19 | Marjan Salehi | Disposable female urinary aid |
| USD577435S1 (en) * | 2007-08-29 | 2008-09-23 | Ivie Marvin L | Personal urinary director for women |
| US20090056003A1 (en) * | 2007-08-29 | 2009-03-05 | International Sani-Fem, Inc. | Personal urinary director for women |
| US8250677B2 (en) * | 2007-11-06 | 2012-08-28 | Synhergy Holding Llc | Penis covering |
| US7694819B2 (en) * | 2007-12-20 | 2010-04-13 | E Z P | Disposable urinary device and dispenser |
| US20090287170A1 (en) * | 2008-05-13 | 2009-11-19 | Preferred Medical Devices, Inc. | Urine collection system |
| USD587366S1 (en) | 2008-05-16 | 2009-02-24 | Michael Turkat | Unisex urination conduit |
| USD619246S1 (en) * | 2009-02-13 | 2010-07-06 | Hazeres Paul J | Portable urinal for women |
| GB2469496B (en) * | 2009-04-16 | 2013-07-17 | Aim Straight Ltd | Urinary device |
| US8146179B1 (en) * | 2009-06-19 | 2012-04-03 | Duque Felix D | Urination canal for females |
| US20110030130A1 (en) * | 2009-08-07 | 2011-02-10 | Stein Patrice B | PP flushable urinating device for women |
| USD674087S1 (en) * | 2011-05-25 | 2013-01-08 | Caralyn Reynolds Linton | Vaginal shield |
| NL1039286C2 (en) * | 2012-01-06 | 2013-07-25 | Astrid Madsy Senus | Portable non-invasive urinary aids for women. |
| DE202013009952U1 (de) | 2013-10-28 | 2013-11-20 | Hakan Gülay | Frauenunterhose mit der eine Frau im stehen urinieren kann |
| US10786387B2 (en) * | 2017-08-14 | 2020-09-29 | James Mooney, Llc | Disposable urination device for women |
| USD842985S1 (en) * | 2018-01-24 | 2019-03-12 | Outstanding Innovations, Llc | Urinary capture device |
| US20200367864A1 (en) * | 2018-01-30 | 2020-11-26 | Deep Bajaj | Integrated urine testing device |
| US10568756B1 (en) * | 2018-09-04 | 2020-02-25 | Outstanding Innovations, Llc | Female urine device |
| US11304843B2 (en) * | 2018-10-17 | 2022-04-19 | Kellen Wolfgang Daniel Berry | Non-invasive urinary aid |
| WO2020105063A1 (en) | 2018-11-23 | 2020-05-28 | Gopakumar Gopalan NAIR | Reverse commode |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US190244A (en) * | 1877-05-01 | Improvement in urinals for invalids | ||
| US2685399A (en) * | 1951-02-12 | 1954-08-03 | Crosby William Holmes | Collapsible disposable container |
| US2968046A (en) * | 1959-03-20 | 1961-01-17 | William A Duke | Suction evacuated urinal |
| US3099017A (en) * | 1962-05-31 | 1963-07-30 | Lawrence J Sullivan | Disposable, collapsible urinal |
| US3335714A (en) * | 1964-08-28 | 1967-08-15 | Jerry D Giesy | Apparatus for obtaining urine samples |
| US3511241A (en) * | 1966-06-23 | 1970-05-12 | John W Lee | Incontinence device for the male patient |
| SE325102B (enExample) * | 1966-12-21 | 1970-06-22 | G Bjoerk | |
| US3613122A (en) * | 1970-06-23 | 1971-10-19 | Anton F Gross | Feminine hygiene device |
| US3731869A (en) * | 1971-07-02 | 1973-05-08 | N Griffin | Disposable container |
| US3742523A (en) * | 1972-02-10 | 1973-07-03 | S Atkins | Disposable urinal |
-
1975
- 1975-04-30 US US05/573,249 patent/US4023216A/en not_active Expired - Lifetime
- 1975-09-02 GB GB36019/75A patent/GB1524838A/en not_active Expired
- 1975-09-03 CA CA234,683A patent/CA1055800A/en not_active Expired
- 1975-09-12 DE DE19752540612 patent/DE2540612A1/de not_active Withdrawn
- 1975-09-17 CH CH1206275A patent/CH591238A5/xx not_active IP Right Cessation
- 1975-10-27 NL NL7512545A patent/NL7512545A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CH591238A5 (enExample) | 1977-09-15 |
| US4023216A (en) | 1977-05-17 |
| NL7512545A (nl) | 1976-05-31 |
| DE2540612A1 (de) | 1976-08-12 |
| GB1524838A (en) | 1978-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1055800A (en) | Urinal device | |
| US5091998A (en) | Funnel device to facilitate urination by women in an upright position | |
| US5687429A (en) | Urinal | |
| US5370633A (en) | Anatomical vaginal tampon | |
| US4528703A (en) | Portable urinal | |
| CA1306833C (en) | Anatomically shaped, self-aligning, sanitary protection device | |
| US4784656A (en) | Fecal incontinence receptacle and methods of use | |
| EP0991392B1 (en) | Adhesive faecal collector with optimal aperture | |
| US4756029A (en) | Feminine urinary device | |
| MXPA06006809A (es) | Articulo para capturar el exudado del cuerpo. | |
| US4734941A (en) | Flushable urine conducting appliance | |
| EP1455696A1 (en) | Supplemental interlabial device | |
| US5387205A (en) | Self-contained urine collecting device for use by females | |
| US20020058921A1 (en) | Labial pad | |
| US4937889A (en) | Female urinal | |
| EP1596783A1 (en) | Incontinence protection device for men | |
| US20110042258A1 (en) | Funnel-Like Urinary Device | |
| WO2002038089A1 (en) | An apparatus for aiding a woman in urinating in a standing position | |
| US6363541B1 (en) | Portable and disposable hygiene device | |
| CN2150844Y (zh) | 妇女月经卫生栓 | |
| CN214342063U (zh) | 纸质便携式小便器具 | |
| US20070169253A1 (en) | Funnel for female urine direction | |
| CN219307103U (zh) | 一种新型的大便收集袋 | |
| CN210960443U (zh) | 一种方便处理婴幼儿、病人老人大小便的内裤 | |
| CN218128969U (zh) | 分体式男性专用纸尿裤 |