CA1055471A - Method of preparing phosphonium siloxanes and products thereof - Google Patents
Method of preparing phosphonium siloxanes and products thereofInfo
- Publication number
- CA1055471A CA1055471A CA237,534A CA237534A CA1055471A CA 1055471 A CA1055471 A CA 1055471A CA 237534 A CA237534 A CA 237534A CA 1055471 A CA1055471 A CA 1055471A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- compound
- water
- mixture
- average value
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 phosphonium siloxanes Chemical class 0.000 title claims abstract description 67
- 238000000034 method Methods 0.000 title claims description 55
- 239000003054 catalyst Substances 0.000 claims abstract description 118
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims abstract description 39
- 150000007514 bases Chemical class 0.000 claims abstract description 26
- 230000000379 polymerizing effect Effects 0.000 claims abstract description 9
- 238000010438 heat treatment Methods 0.000 claims abstract description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 69
- 239000000203 mixture Substances 0.000 claims description 48
- 150000003961 organosilicon compounds Chemical class 0.000 claims description 32
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 claims description 27
- 238000002156 mixing Methods 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims description 11
- 229930195733 hydrocarbon Natural products 0.000 claims description 11
- 150000003254 radicals Chemical group 0.000 claims description 11
- 230000003197 catalytic effect Effects 0.000 claims description 10
- IBWGNZVCJVLSHB-UHFFFAOYSA-M tetrabutylphosphanium;chloride Chemical compound [Cl-].CCCC[P+](CCCC)(CCCC)CCCC IBWGNZVCJVLSHB-UHFFFAOYSA-M 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000004205 dimethyl polysiloxane Substances 0.000 claims description 6
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229920001296 polysiloxane Polymers 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000000962 organic group Chemical group 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 14
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 abstract description 5
- 229910052698 phosphorus Inorganic materials 0.000 abstract description 5
- 239000011574 phosphorus Substances 0.000 abstract description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 230000007935 neutral effect Effects 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 10
- 238000006116 polymerization reaction Methods 0.000 description 10
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000012530 fluid Substances 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical group [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 5
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- BJQWBACJIAKDTJ-UHFFFAOYSA-N tetrabutylphosphanium Chemical compound CCCC[P+](CCCC)(CCCC)CCCC BJQWBACJIAKDTJ-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000011067 equilibration Methods 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000005375 organosiloxane group Chemical group 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002685 polymerization catalyst Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000005046 Chlorosilane Substances 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000004703 alkoxides Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- DJFBJKSMACBYBD-UHFFFAOYSA-N phosphane;hydrate Chemical group O.P DJFBJKSMACBYBD-UHFFFAOYSA-N 0.000 description 2
- 125000005496 phosphonium group Chemical group 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 230000004580 weight loss Effects 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- MOMWFXLCFJOAFX-UHFFFAOYSA-N OOOOOOOO Chemical compound OOOOOOOO MOMWFXLCFJOAFX-UHFFFAOYSA-N 0.000 description 1
- 241001208007 Procas Species 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- OGFYGJDCQZJOFN-UHFFFAOYSA-N [O].[Si].[Si] Chemical compound [O].[Si].[Si] OGFYGJDCQZJOFN-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- OZXRLJIEKITDLN-UHFFFAOYSA-M benzyl(triethyl)phosphanium;chloride Chemical compound [Cl-].CC[P+](CC)(CC)CC1=CC=CC=C1 OZXRLJIEKITDLN-UHFFFAOYSA-M 0.000 description 1
- BBLQQYUOIZZLQW-UHFFFAOYSA-N bis(ethenyl)-methyl-[methyl(diphenyl)silyl]oxysilane Chemical compound C=1C=CC=CC=1[Si](C)(O[Si](C)(C=C)C=C)C1=CC=CC=C1 BBLQQYUOIZZLQW-UHFFFAOYSA-N 0.000 description 1
- GSYQWXUNJYTHCJ-UHFFFAOYSA-N bis(ethenyl)-methyl-methylsilyloxysilane Chemical compound C[SiH2]O[Si](C)(C=C)C=C GSYQWXUNJYTHCJ-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- ABIUHPWEYMSGSR-UHFFFAOYSA-N bromocresol purple Chemical compound BrC1=C(O)C(C)=CC(C2(C3=CC=CC=C3S(=O)(=O)O2)C=2C=C(Br)C(O)=C(C)C=2)=C1 ABIUHPWEYMSGSR-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- NXXRXPHOTKKBCZ-UHFFFAOYSA-N butyl(chloro)phosphane Chemical compound CCCCPCl NXXRXPHOTKKBCZ-UHFFFAOYSA-N 0.000 description 1
- GLSRIVPZMSLPAX-UHFFFAOYSA-M butyl(tricyclohexyl)phosphanium;chloride Chemical compound [Cl-].C1CCCCC1[P+](C1CCCCC1)(CCCC)C1CCCCC1 GLSRIVPZMSLPAX-UHFFFAOYSA-M 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 125000004803 chlorobenzyl group Chemical group 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- NEKFEYXDJYXFBJ-UHFFFAOYSA-M diethyl(diphenyl)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1[P+](CC)(CC)C1=CC=CC=C1 NEKFEYXDJYXFBJ-UHFFFAOYSA-M 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 125000003709 fluoroalkyl group Chemical group 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- VOVZXURTCKPRDQ-CQSZACIVSA-N n-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3r)-3-hydroxypyrrolidin-1-yl]-5-(1h-pyrazol-5-yl)pyridine-3-carboxamide Chemical compound C1[C@H](O)CCN1C1=NC=C(C(=O)NC=2C=CC(OC(F)(F)Cl)=CC=2)C=C1C1=CC=NN1 VOVZXURTCKPRDQ-CQSZACIVSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 1
- 125000005007 perfluorooctyl group Chemical group FC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)* 0.000 description 1
- 125000005062 perfluorophenyl group Chemical group FC1=C(C(=C(C(=C1F)F)F)F)* 0.000 description 1
- LSMAIBOZUPTNBR-UHFFFAOYSA-N phosphanium;iodide Chemical compound [PH4+].[I-] LSMAIBOZUPTNBR-UHFFFAOYSA-N 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 239000005373 porous glass Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- LIXPXSXEKKHIRR-UHFFFAOYSA-M tetraethylphosphanium;bromide Chemical compound [Br-].CC[P+](CC)(CC)CC LIXPXSXEKKHIRR-UHFFFAOYSA-M 0.000 description 1
- WKSYTZHMRBAPAO-UHFFFAOYSA-M tetraethylphosphanium;iodide Chemical compound [I-].CC[P+](CC)(CC)CC WKSYTZHMRBAPAO-UHFFFAOYSA-M 0.000 description 1
- BXYHVFRRNNWPMB-UHFFFAOYSA-N tetramethylphosphanium Chemical compound C[P+](C)(C)C BXYHVFRRNNWPMB-UHFFFAOYSA-N 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- WHAFDJWJDDPMDO-UHFFFAOYSA-N trimethyl(phenyl)phosphanium Chemical compound C[P+](C)(C)C1=CC=CC=C1 WHAFDJWJDDPMDO-UHFFFAOYSA-N 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- AAPLIUHOKVUFCC-UHFFFAOYSA-N trimethylsilanol Chemical compound C[Si](C)(C)O AAPLIUHOKVUFCC-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/06—Preparatory processes
- C08G77/08—Preparatory processes characterised by the catalysts used
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/38—Polysiloxanes modified by chemical after-treatment
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/537,877 US4008261A (en) | 1975-01-02 | 1975-01-02 | Method of preparing phosphonium siloxanes and products thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1055471A true CA1055471A (en) | 1979-05-29 |
Family
ID=24144473
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA237,534A Expired CA1055471A (en) | 1975-01-02 | 1975-10-14 | Method of preparing phosphonium siloxanes and products thereof |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4008261A (Sortimente) |
| JP (1) | JPS5186423A (Sortimente) |
| AT (1) | AT354091B (Sortimente) |
| BE (1) | BE837233A (Sortimente) |
| CA (1) | CA1055471A (Sortimente) |
| DE (2) | DE2558020C2 (Sortimente) |
| FR (1) | FR2296656A1 (Sortimente) |
| GB (1) | GB1532051A (Sortimente) |
| IT (1) | IT1043724B (Sortimente) |
| NL (1) | NL160012C (Sortimente) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4101513A (en) * | 1977-02-02 | 1978-07-18 | Minnesota Mining And Manufacturing Company | Catalyst for condensation of hydrolyzable silanes and storage stable compositions thereof |
| US4177200A (en) * | 1977-11-25 | 1979-12-04 | General Electric Company | Silyl phosphates as neutralizing agents for alkali metal hydroxides |
| US4125551A (en) * | 1978-02-13 | 1978-11-14 | General Electric Company | Process for producing silylphosphates |
| US4433096A (en) * | 1983-03-14 | 1984-02-21 | Dow Corning Corporation | Polymerization of polydiorganosiloxane in the presence of filler |
| JPS60219337A (ja) * | 1984-04-12 | 1985-11-02 | 隈元 政文 | 水洗式大便器の汚水はね返り防止法 |
| DE3504185A1 (de) * | 1985-02-07 | 1986-08-07 | Wacker-Chemie GmbH, 8000 München | Verfahren zur erhoehung des molekulargewichts von diorgano(poly)-siloxan |
| EP0255957A3 (en) * | 1986-08-08 | 1988-11-17 | Asahi Glass Company Ltd. | Fluorosilicone polymer, processes for the production thereof and composition containing it |
| JP2799637B2 (ja) * | 1991-02-27 | 1998-09-21 | 信越化学工業株式会社 | 高分子量オルガノポリシロキサンの製造方法 |
| US5196559A (en) * | 1992-01-23 | 1993-03-23 | Dow Corning Corporation | Equilibration of cyclic siloxanes with novel catalysts |
| DE4317909A1 (de) * | 1993-05-28 | 1994-12-01 | Wacker Chemie Gmbh | Verfahren zum Kondensieren und/oder Äquilibrieren von Organosiliciumverbindungen |
| ES2173473T3 (es) | 1996-08-20 | 2002-10-16 | Dow Chemical Co | Procedimiento de produccion de bencenos alquilados. |
| US20030225236A1 (en) * | 2002-06-03 | 2003-12-04 | Masaharu Takahashi | Preparation of organopolysiloxane |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3057821A (en) * | 1962-10-09 | Ammonium halide stabilized organo- | ||
| US2683674A (en) * | 1950-08-07 | 1954-07-13 | Allied Chem & Dye Corp | Waterproofing masonry with alkyl polysiloxanes |
| US2830967A (en) * | 1953-01-13 | 1958-04-15 | Wacker Chemie Gmbh | Process for polymerizing polyorganosiloxanes with phosphorus-nitrogen compounds |
| US2739952A (en) * | 1953-06-24 | 1956-03-27 | Gen Electric | Organopolysiloxanes stabilized with organophosphorus compounds |
| US2789109A (en) * | 1954-06-29 | 1957-04-16 | Gen Electric | Neutralization of alkali metal hydroxide catalysts in organopolysiloxanes |
| US2908699A (en) * | 1955-12-23 | 1959-10-13 | Union Carbide Corp | Process for producing cyanoalkylsilanes employing hydrocarbyl phosphorous halide catalysts |
| GB857343A (en) * | 1958-01-17 | 1960-12-29 | Ici Ltd | Treatment of organopolysiloxanes |
| US3271359A (en) * | 1962-12-24 | 1966-09-06 | Gen Electric | Equilibration of organopolysiloxanes using phosphorus-containing catalysts |
| DE1795565A1 (de) * | 1964-05-05 | 1972-01-27 | Tondeo Werk Noss A | Verfahren zur Herstellung von lincarpolymeren Polydiorganosiloxanen,welche Organophosphorseitengruppen tragen |
-
1975
- 1975-01-02 US US05/537,877 patent/US4008261A/en not_active Expired - Lifetime
- 1975-10-14 CA CA237,534A patent/CA1055471A/en not_active Expired
- 1975-10-29 IT IT28766/75A patent/IT1043724B/it active
- 1975-12-15 JP JP50148583A patent/JPS5186423A/ja active Granted
- 1975-12-22 DE DE2558020A patent/DE2558020C2/de not_active Expired
- 1975-12-22 DE DE2559603A patent/DE2559603C2/de not_active Expired
- 1975-12-29 AT AT985475A patent/AT354091B/de not_active IP Right Cessation
- 1975-12-31 BE BE163241A patent/BE837233A/xx not_active IP Right Cessation
- 1975-12-31 FR FR7540295A patent/FR2296656A1/fr active Granted
- 1975-12-31 NL NL7515236.A patent/NL160012C/xx not_active IP Right Cessation
-
1976
- 1976-01-02 GB GB60/76A patent/GB1532051A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2296656A1 (fr) | 1976-07-30 |
| IT1043724B (it) | 1980-02-29 |
| DE2558020C2 (de) | 1982-10-28 |
| GB1532051A (en) | 1978-11-15 |
| JPS5186423A (en) | 1976-07-29 |
| ATA985475A (de) | 1979-05-15 |
| NL160012C (nl) | 1979-09-17 |
| US4008261A (en) | 1977-02-15 |
| JPS5549622B2 (Sortimente) | 1980-12-12 |
| NL7515236A (nl) | 1976-07-06 |
| DE2559603A1 (de) | 1977-04-21 |
| FR2296656B1 (Sortimente) | 1979-02-02 |
| BE837233A (fr) | 1976-06-30 |
| AT354091B (de) | 1979-12-27 |
| DE2559603C2 (de) | 1984-05-10 |
| NL160012B (nl) | 1979-04-17 |
| DE2558020A1 (de) | 1976-07-08 |
| AU8614475A (en) | 1977-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3989668A (en) | Method of making a silicone elastomer and the elastomer prepared thereby | |
| JP3657633B2 (ja) | オルガノシロキサン重合体の重縮合及び再分布用の新規触媒 | |
| US3989666A (en) | Crosslinker-platinum catalyst-inhibitor and method of preparation thereof | |
| KR0133943B1 (ko) | 자체 경화성 세라믹화가능한 폴리실옥산 | |
| CA1055471A (en) | Method of preparing phosphonium siloxanes and products thereof | |
| KR100203251B1 (ko) | 오가노폴리실옥산의 제조방법 | |
| JP4114723B2 (ja) | オルガノシロキサンもしくはポリオルガノシロキサンの製造のための触媒 | |
| US5457220A (en) | Process for the production of crosslinked siloxanes by disproportionation | |
| KR0167548B1 (ko) | 일액성 열경화성 오가노폴리실록산 조성물 | |
| US3294740A (en) | Method of polymerizing cyclotrisiloxanes ii | |
| US6353075B1 (en) | Polymerization of siloxanes | |
| JPS5935932B2 (ja) | シリコ−ンゲルの製造方法 | |
| US4722987A (en) | Method for the preparation of an organopolysiloxane | |
| US4267298A (en) | Process for preparing M-stopped silicone fluids from silanol fluids | |
| US6284859B1 (en) | Polymerization of siloxanes | |
| US4835237A (en) | Process for preparing diorganopolysiloxanes containing triorganosiloxy terminal groups | |
| US2883366A (en) | Quaternary phosphonium compounds as polymerization catalysts for siloxanes | |
| US3652711A (en) | Method of polymerizing siloxanes | |
| US6048819A (en) | Catalyst composition | |
| US4087448A (en) | Process for preparing equilibrated organopolysiloxane mixtures with organosulfonic acid groups linked to silicon | |
| KR20000048004A (ko) | 실록산의 중합 방법 | |
| US4272624A (en) | Process for producing high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositions | |
| JPH01193323A (ja) | フルオロシリコーンポリマー製造用触媒 | |
| JPS6121968B2 (Sortimente) | ||
| US3355475A (en) | Iodine as a polymerization catalyst for certain silazanes and siloxanes |