CA1052376A - Process for preparing carboxamides of oxo-1,2-benzothiazine-1,1-dioxides - Google Patents
Process for preparing carboxamides of oxo-1,2-benzothiazine-1,1-dioxidesInfo
- Publication number
- CA1052376A CA1052376A CA235,575A CA235575A CA1052376A CA 1052376 A CA1052376 A CA 1052376A CA 235575 A CA235575 A CA 235575A CA 1052376 A CA1052376 A CA 1052376A
- Authority
- CA
- Canada
- Prior art keywords
- pyridyl
- methyl
- carbon atoms
- alkyl
- thiazolyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 7
- 150000003857 carboxamides Chemical class 0.000 title description 9
- -1 N-substituted-3,4-dihydro-2-substituted-4-oxo-2H-1,2-benzothiazine-3-carboxamide-1,1-dioxides Chemical class 0.000 claims abstract description 105
- 238000000034 method Methods 0.000 claims abstract description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 31
- 150000001875 compounds Chemical class 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 239000002253 acid Substances 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 10
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 10
- 239000011707 mineral Substances 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 239000012442 inert solvent Substances 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 6
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 4
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 claims description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 4
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000005309 thioalkoxy group Chemical group 0.000 claims description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 150000002081 enamines Chemical class 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims 2
- 239000011260 aqueous acid Substances 0.000 claims 1
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 claims 1
- 229940121363 anti-inflammatory agent Drugs 0.000 abstract description 3
- 239000002260 anti-inflammatory agent Substances 0.000 abstract description 3
- 230000000694 effects Effects 0.000 abstract description 3
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 3
- 238000001311 chemical methods and process Methods 0.000 abstract description 2
- GHNLJDPNIAIWOQ-UHFFFAOYSA-N 2h-1$l^{6},2-benzothiazine 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)NC=CC2=C1 GHNLJDPNIAIWOQ-UHFFFAOYSA-N 0.000 abstract 1
- 239000003246 corticosteroid Substances 0.000 abstract 1
- 229960001334 corticosteroids Drugs 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 239000000243 solution Substances 0.000 description 11
- 230000000875 corresponding effect Effects 0.000 description 10
- 239000010410 layer Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 229960001701 chloroform Drugs 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 125000000468 ketone group Chemical group 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 229930194542 Keto Natural products 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 229960004592 isopropanol Drugs 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000000335 thiazolyl group Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 241000534944 Thia Species 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 150000002085 enols Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- MSXIJQBIJCOXDT-UHFFFAOYSA-N 2-(3H-1,2-benzothiazol-2-yl)-2-oxoacetic acid Chemical compound O=C(C(=O)O)N1SC2=C(C1)C=CC=C2 MSXIJQBIJCOXDT-UHFFFAOYSA-N 0.000 description 1
- HROAENUNAQHOPC-UHFFFAOYSA-N 2-methyl-1,1-dioxo-4-propan-2-yloxy-1$l^{6},2-benzothiazine-3-carboxylic acid Chemical compound C1=CC=C2C(OC(C)C)=C(C(O)=O)N(C)S(=O)(=O)C2=C1 HROAENUNAQHOPC-UHFFFAOYSA-N 0.000 description 1
- OFASCUMLCUIXDL-UHFFFAOYSA-N 2-methyl-4-propan-2-yloxy-1,2-benzothiazine-3-carboxylic acid Chemical compound C1=CC=C2C(OC(C)C)=C(C(O)=O)N(C)SC2=C1 OFASCUMLCUIXDL-UHFFFAOYSA-N 0.000 description 1
- YKOOHAXEGNWJQW-UHFFFAOYSA-N 2-methyl-4-pyrrolidin-1-yl-3,4-dihydro-1,2-benzothiazine-3-carboxylic acid Chemical compound N1(CCCC1)C1C(N(SC2=C1C=CC=C2)C)C(=O)O YKOOHAXEGNWJQW-UHFFFAOYSA-N 0.000 description 1
- FKOSZDBJQBJDIV-UHFFFAOYSA-N 2h-1,2-benzothiazine-3-carboxamide Chemical compound C1=CC=C2SNC(C(=O)N)=CC2=C1 FKOSZDBJQBJDIV-UHFFFAOYSA-N 0.000 description 1
- BNNNRTHFDVJELR-UHFFFAOYSA-N 2h-thiazine-3-carboxylic acid Chemical class OC(=O)C1=CC=CSN1 BNNNRTHFDVJELR-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 101100294102 Caenorhabditis elegans nhr-2 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 229910019213 POCl3 Inorganic materials 0.000 description 1
- 235000018734 Sambucus australis Nutrition 0.000 description 1
- 244000180577 Sambucus australis Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000005915 ammonolysis reaction Methods 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- FBOSKQVOIHEWAX-UHFFFAOYSA-N benzothiazine Chemical compound C1=CC=C2N=CCSC2=C1 FBOSKQVOIHEWAX-UHFFFAOYSA-N 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000003500 enol ether group Chemical group 0.000 description 1
- 150000002084 enol ethers Chemical class 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- GEVUHWKYEWTTMW-UHFFFAOYSA-N n,n-dimethylacetamide;methanol Chemical compound OC.CN(C)C(C)=O GEVUHWKYEWTTMW-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D279/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D279/02—1,2-Thiazines; Hydrogenated 1,2-thiazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US514570A US3892740A (en) | 1974-10-15 | 1974-10-15 | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1052376A true CA1052376A (en) | 1979-04-10 |
Family
ID=24047770
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA235,575A Expired CA1052376A (en) | 1974-10-15 | 1975-09-16 | Process for preparing carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US3892740A (member.php) |
| JP (1) | JPS5159878A (member.php) |
| AR (1) | AR209326A1 (member.php) |
| AT (1) | AT356123B (member.php) |
| BE (1) | BE834064A (member.php) |
| BG (1) | BG35597A3 (member.php) |
| CA (1) | CA1052376A (member.php) |
| CH (1) | CH609052A5 (member.php) |
| CS (1) | CS188254B2 (member.php) |
| DD (1) | DD122384A5 (member.php) |
| DE (1) | DE2541832A1 (member.php) |
| DK (1) | DK146535C (member.php) |
| ES (1) | ES441290A1 (member.php) |
| FI (1) | FI63573C (member.php) |
| FR (1) | FR2287907A1 (member.php) |
| GB (2) | GB1505932A (member.php) |
| HU (1) | HU172059B (member.php) |
| IE (1) | IE41690B1 (member.php) |
| IN (1) | IN141982B (member.php) |
| LU (1) | LU73491A1 (member.php) |
| NL (1) | NL7511492A (member.php) |
| NO (1) | NO154395C (member.php) |
| NZ (1) | NZ178678A (member.php) |
| PL (1) | PL102293B1 (member.php) |
| RO (1) | RO68145A (member.php) |
| SE (2) | SE423096B (member.php) |
| SU (1) | SU664563A3 (member.php) |
| YU (1) | YU40127B (member.php) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4100347A (en) * | 1976-06-10 | 1978-07-11 | Pfizer Inc. | 3,4-Dihydro-2-methyl-4-oxo-2H-1,2-benzothiazine-3-carboxylic acid-1,1-dioxide |
| DE2756113A1 (de) * | 1977-12-16 | 1979-06-21 | Thomae Gmbh Dr K | Neue 4-hydroxy-2h-1,2-benzothiazin- 3-carboxamid-1,1-dioxide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
| US4213980A (en) * | 1978-01-30 | 1980-07-22 | Ciba-Geigy Corporation | Azathianaphthalenes |
| JPS57140785A (en) * | 1981-02-24 | 1982-08-31 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation, and pharmaceutical composition containing the same |
| JPS5714589A (en) * | 1980-06-27 | 1982-01-25 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation and drug composition |
| IN158333B (member.php) * | 1981-08-03 | 1986-10-18 | Pfizer | |
| IN159273B (member.php) * | 1981-10-05 | 1987-04-25 | Pfizer | |
| CA1197244A (en) * | 1982-04-16 | 1985-11-26 | Medichem, S.A. | Process for the preparation of 4-hydroxy-2-methyl-2h- 1,2-benzothiazine-3-carboxamide-1,1-dioxides |
| US4551452A (en) * | 1983-12-21 | 1985-11-05 | Pfizer Inc. | Anti-inflammatory 2-methyl-2H-1,2-benzo-(or -thieno-)thiazine-3-carboxamide 1,1-dioxide derivatives, compositions, and method of use therefor |
| US4683306A (en) * | 1984-07-13 | 1987-07-28 | Yuhan Corporation Co., Ltd. | Process for the preparation of 3,4-dihydro-2-substituted-2H-1,2-thiazine-carboxylic acid 1,1-dioxide derivatives |
| US4761424A (en) * | 1985-10-01 | 1988-08-02 | Warner-Lambert Company | Enolamides, pharmaceutical compositions and methods for treating inflammation |
| WO1987006933A1 (en) * | 1986-05-16 | 1987-11-19 | Pfizer Inc. | Benzothiazine dioxide derivatives |
| FI893111L (fi) * | 1987-10-26 | 1989-06-26 | Pfizer | Benzotiazindioxidderivat. |
| WO1990009794A1 (fr) * | 1989-02-28 | 1990-09-07 | Nippon Hypox Laboratories Incorporated | Remede contre le diabete |
| WO1997046532A1 (en) * | 1996-06-03 | 1997-12-11 | Boehringer Ingelheim Pharmaceuticals, Inc. | 2-benzyl-4-sulfonyl-4h-isoquinolin-1,3-diones and their use as anti-inflammatory agents |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3646020A (en) * | 1970-07-16 | 1972-02-29 | Warner Lambert Pharmaceutical | 4-acyloxy-3-phenylcarbamyl-2h-1 2-benzothiazine 1 1-dioxides |
| US3853862A (en) * | 1973-04-23 | 1974-12-10 | Pfizer | Production of 4-hydroxy-1,2-benzothiazine-3-carboxamides |
-
1974
- 1974-10-15 US US514570A patent/US3892740A/en not_active Expired - Lifetime
-
1975
- 1975-09-09 SE SE7510041A patent/SE423096B/xx not_active IP Right Cessation
- 1975-09-11 IE IE1983/75A patent/IE41690B1/en unknown
- 1975-09-15 NZ NZ178678A patent/NZ178678A/xx unknown
- 1975-09-16 CA CA235,575A patent/CA1052376A/en not_active Expired
- 1975-09-17 IN IN1781/CAL/75A patent/IN141982B/en unknown
- 1975-09-19 DE DE19752541832 patent/DE2541832A1/de active Pending
- 1975-09-24 AT AT731175A patent/AT356123B/de not_active IP Right Cessation
- 1975-09-24 NO NO753250A patent/NO154395C/no unknown
- 1975-09-26 YU YU2428/75A patent/YU40127B/xx unknown
- 1975-09-26 ES ES441290A patent/ES441290A1/es not_active Expired
- 1975-09-29 FI FI752717A patent/FI63573C/fi not_active IP Right Cessation
- 1975-09-30 BG BG031124A patent/BG35597A3/xx unknown
- 1975-09-30 NL NL7511492A patent/NL7511492A/xx unknown
- 1975-09-30 FR FR7529864A patent/FR2287907A1/fr active Granted
- 1975-09-30 HU HU75PI00000492A patent/HU172059B/hu not_active IP Right Cessation
- 1975-09-30 DK DK440275A patent/DK146535C/da not_active IP Right Cessation
- 1975-09-30 RO RO7583483A patent/RO68145A/ro unknown
- 1975-09-30 CH CH1269175A patent/CH609052A5/xx not_active IP Right Cessation
- 1975-10-01 DD DD188667A patent/DD122384A5/xx unknown
- 1975-10-01 LU LU73491A patent/LU73491A1/xx unknown
- 1975-10-01 JP JP50118205A patent/JPS5159878A/ja active Granted
- 1975-10-01 BE BE1006915A patent/BE834064A/xx not_active IP Right Cessation
- 1975-10-01 CS CS756649A patent/CS188254B2/cs unknown
- 1975-10-03 SU SU752177441A patent/SU664563A3/ru active
- 1975-10-10 GB GB16028/77A patent/GB1505932A/en not_active Expired
- 1975-10-10 GB GB41695/75A patent/GB1505931A/en not_active Expired
- 1975-10-14 PL PL1975183995A patent/PL102293B1/pl unknown
- 1975-10-17 AR AR260636A patent/AR209326A1/es active
-
1979
- 1979-02-08 SE SE7901131A patent/SE446266B/sv not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1052376A (en) | Process for preparing carboxamides of oxo-1,2-benzothiazine-1,1-dioxides | |
| US3591584A (en) | Benzothiazine dioxides | |
| US5679678A (en) | Thienithiazine derivatives | |
| CA2079822A1 (en) | 2-substituted saccharin derivative proteolytic enzyme inhibitors | |
| USRE29669E (en) | Production of 4-hydroxy-1,2-benzothiazine-3-carboxamides | |
| HU182052B (en) | Process for preparing 7-/2-/2-amino-thiazol-4-yl/-2-syn-methoxyimino-acetamido/-cef-3-em-4-carboxylic acid derivatives | |
| US4224445A (en) | Thienothiazine derivatives | |
| FI59253C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 4-hydroxi-2h-tieno(2,3-e) och (3,4-e)-1,2-tiazin-3-karboxamid-1,1-dioxid-derivat | |
| CA1093081A (en) | Process for the production of aryl ureas | |
| US3891637A (en) | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides | |
| CA1077934A (en) | Process for the preparation of 3,4-dihydro-2-methyl-4-oxo-2h-1,2-benzothiazine-3-carboxylic acid-1,1-dioxide and its use as an intermediate | |
| NO143317B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive tiazindioksyder | |
| SU715021A3 (ru) | Способ получени производных 2,1,3-тиадиазин-4-он-2,2-диоксида | |
| CA1111034A (en) | Azathianaphthalene derivatives, process for their manufacture, pharmaceutical preparations containing them and their use | |
| JPH0546356B2 (member.php) | ||
| IE41691B1 (en) | The preparation of benzothiazine-1,1-dioxide derivatives | |
| US3927002A (en) | N-(pyridyl)-N{40 -alkyl-N{40 -(2-alkoxycarbonylbenzenesulfonyl)-glycineamides and derivatives | |
| Stachel et al. | Metal Complexes of Functionalized Sulfur‐Containing Ligands. Part XIX: Synthesis and Reactions of New Pyrroloisothiazoles | |
| KR790000858B1 (ko) | 옥소벤조티아진 디옥사이드의 카복사미드의 제조방법 | |
| CA1207767A (en) | 4-hydroxy-2h-1,2-benzothiazine-3-carboxamide-1,1- dioxides, processes for their preparation, their use and pharmaceutical compositions containing them | |
| Kim | The chemistry of 5H‐benzoxazolo [3, 2‐a] quinolin‐5‐ones. 5H‐Benzoxazolo [3, 2‐a] quinolin‐5‐ones as synthons for the preparation of novel quinoline derivatives | |
| US4177193A (en) | Thienothiazine derivatives | |
| Bohrisch et al. | Syntheses of S, N-heterocycles from N-thioacyllactamimines | |
| CA1187873A (en) | Processes for preparing piroxicam and intermediates leading thereto | |
| CS233736B2 (en) | Processing of derivative of 1,1-dioxid 4-hydroxy-2-methyl-2h-1,2-benzothiazin-3-karboxyl acid |