CA1051428A - Substituted 1,3-dihydrospiro (isobenzofuran) s - Google Patents
Substituted 1,3-dihydrospiro (isobenzofuran) sInfo
- Publication number
- CA1051428A CA1051428A CA215,786A CA215786A CA1051428A CA 1051428 A CA1051428 A CA 1051428A CA 215786 A CA215786 A CA 215786A CA 1051428 A CA1051428 A CA 1051428A
- Authority
- CA
- Canada
- Prior art keywords
- dihydro
- isobenzofuran
- formula
- carbon atoms
- piperidine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 title abstract description 5
- 238000000034 method Methods 0.000 claims abstract description 69
- 150000001875 compounds Chemical class 0.000 claims abstract description 35
- 125000004432 carbon atom Chemical group C* 0.000 claims description 69
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 51
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 47
- 125000000217 alkyl group Chemical group 0.000 claims description 38
- -1 phenyloxycarbonyl Chemical group 0.000 claims description 36
- 239000001257 hydrogen Substances 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 238000002360 preparation method Methods 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 150000002431 hydrogen Chemical group 0.000 claims description 18
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 claims description 16
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 12
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 10
- 230000000694 effects Effects 0.000 claims description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 239000007818 Grignard reagent Substances 0.000 claims description 7
- 150000004795 grignard reagents Chemical class 0.000 claims description 7
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 7
- HUUPVABNAQUEJW-UHFFFAOYSA-N 1-methylpiperidin-4-one Chemical compound CN1CCC(=O)CC1 HUUPVABNAQUEJW-UHFFFAOYSA-N 0.000 claims description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 229940093932 potassium hydroxide Drugs 0.000 claims description 6
- 235000011118 potassium hydroxide Nutrition 0.000 claims description 6
- CMGBHCCDZXPUIG-UHFFFAOYSA-N 1'-methyl-1-phenylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1CN(C)CCC21C1=CC=CC=C1C(C=1C=CC=CC=1)O2 CMGBHCCDZXPUIG-UHFFFAOYSA-N 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000001589 carboacyl group Chemical group 0.000 claims description 5
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 5
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 5
- 229910052744 lithium Inorganic materials 0.000 claims description 5
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 239000011777 magnesium Substances 0.000 claims description 4
- 229910052749 magnesium Inorganic materials 0.000 claims description 4
- 125000003003 spiro group Chemical group 0.000 claims description 4
- ZULSGRFUONBNOC-UHFFFAOYSA-N 1-bromo-2-[2-[2-(2-bromophenyl)-2-phenylethoxy]-1-phenylethyl]benzene Chemical compound BrC1=CC=CC=C1C(C=1C=CC=CC=1)COCC(C=1C(=CC=CC=1)Br)C1=CC=CC=C1 ZULSGRFUONBNOC-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- JTXAETLSYPFRJX-UHFFFAOYSA-N [Li]C1=C(C=CC=C1)C=1OCCN1 Chemical compound [Li]C1=C(C=CC=C1)C=1OCCN1 JTXAETLSYPFRJX-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 3
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 claims description 3
- SMBQBQBNOXIFSF-UHFFFAOYSA-N dilithium Chemical compound [Li][Li] SMBQBQBNOXIFSF-UHFFFAOYSA-N 0.000 claims description 3
- 150000002641 lithium Chemical class 0.000 claims description 3
- 230000003287 optical effect Effects 0.000 claims description 3
- 125000002524 organometallic group Chemical group 0.000 claims description 3
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- XLCYXINIUJNTPF-UHFFFAOYSA-N 2-(2-bromophenyl)-4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C(=CC=CC=2)Br)=N1 XLCYXINIUJNTPF-UHFFFAOYSA-N 0.000 claims description 2
- FRJPMDSTUKQCIU-UHFFFAOYSA-N 2-bromo-4-fluoro-1-[(4-fluorophenyl)-methoxymethyl]benzene Chemical compound C=1C=C(F)C=C(Br)C=1C(OC)C1=CC=C(F)C=C1 FRJPMDSTUKQCIU-UHFFFAOYSA-N 0.000 claims description 2
- XRXMNWGCKISMOH-UHFFFAOYSA-N 2-bromobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Br XRXMNWGCKISMOH-UHFFFAOYSA-N 0.000 claims description 2
- FUFZNHHSSMCXCZ-UHFFFAOYSA-N 5-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole Chemical compound FC(F)(F)C1=CC=CC(C=2N=C(ON=2)C2CCNCC2)=C1 FUFZNHHSSMCXCZ-UHFFFAOYSA-N 0.000 claims description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 238000007171 acid catalysis Methods 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 claims description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims description 2
- 239000012024 dehydrating agents Substances 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 16
- 229960000443 hydrochloric acid Drugs 0.000 claims 11
- 235000011167 hydrochloric acid Nutrition 0.000 claims 11
- ZFJQWOMHWFYLPD-UHFFFAOYSA-N 1-phenylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1CNCCC21C1=CC=CC=C1C(C=1C=CC=CC=1)O2 ZFJQWOMHWFYLPD-UHFFFAOYSA-N 0.000 claims 4
- JFWWJFRTGUIZEA-UHFFFAOYSA-N 1-(4-fluorophenyl)spiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1=CC(F)=CC=C1C1C2=CC=CC=C2C2(CCNCC2)O1 JFWWJFRTGUIZEA-UHFFFAOYSA-N 0.000 claims 3
- MYKMKAGZUORCFP-UHFFFAOYSA-N 1-phenylspiro[1h-2-benzofuran-3,3'-pyrrolidine] Chemical compound C1NCCC21C1=CC=CC=C1C(C=1C=CC=CC=1)O2 MYKMKAGZUORCFP-UHFFFAOYSA-N 0.000 claims 3
- JDOMLWIHDNTBAF-UHFFFAOYSA-N 5-methoxy-1-phenylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C12=CC(OC)=CC=C2C(C=2C=CC=CC=2)OC21CCNCC2 JDOMLWIHDNTBAF-UHFFFAOYSA-N 0.000 claims 3
- 238000007363 ring formation reaction Methods 0.000 claims 3
- WCUBNGCQXWEMIL-UHFFFAOYSA-N 1'-benzyl-1-phenylspiro[1h-2-benzofuran-3,3'-pyrrolidine] Chemical compound C=1C=CC=CC=1CN(C1)CCC1(C1=CC=CC=C11)OC1C1=CC=CC=C1 WCUBNGCQXWEMIL-UHFFFAOYSA-N 0.000 claims 2
- ZZWGYFCHURYJCG-UHFFFAOYSA-N 1-(4-fluorophenyl)-1'-methylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1CN(C)CCC21C1=CC=CC=C1C(C=1C=CC(F)=CC=1)O2 ZZWGYFCHURYJCG-UHFFFAOYSA-N 0.000 claims 2
- MPLDXQYSMWAITD-UHFFFAOYSA-N 1-(4-methoxyphenyl)spiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1=CC(OC)=CC=C1C1C2=CC=CC=C2C2(CCNCC2)O1 MPLDXQYSMWAITD-UHFFFAOYSA-N 0.000 claims 2
- YMXYFQFMLWUVIM-UHFFFAOYSA-N 1-(4-methylphenyl)spiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1=CC(C)=CC=C1C1C2=CC=CC=C2C2(CCNCC2)O1 YMXYFQFMLWUVIM-UHFFFAOYSA-N 0.000 claims 2
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 claims 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 2
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims 2
- FXPSDKQKMFMACP-UHFFFAOYSA-N 1'-benzyl-1-phenylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C=1C=CC=CC=1CN(CC1)CCC1(C1=CC=CC=C11)OC1C1=CC=CC=C1 FXPSDKQKMFMACP-UHFFFAOYSA-N 0.000 claims 1
- REGBPRVEEULXPZ-UHFFFAOYSA-N 1'-methyl-1-phenylspiro[1h-2-benzofuran-3,3'-pyrrolidine] Chemical compound C1N(C)CCC21C1=CC=CC=C1C(C=1C=CC=CC=1)O2 REGBPRVEEULXPZ-UHFFFAOYSA-N 0.000 claims 1
- ZIBROMBLAAUCOY-UHFFFAOYSA-N 1'-methyl-1-phenylspiro[2-benzofuran-3,4'-piperidine]-1-ol Chemical compound C1CN(C)CCC21C1=CC=CC=C1C(O)(C=1C=CC=CC=1)O2 ZIBROMBLAAUCOY-UHFFFAOYSA-N 0.000 claims 1
- PZTZUXFORXPMDO-UHFFFAOYSA-N 1-(4-fluorophenyl)-4-(1-phenylspiro[1h-2-benzofuran-3,4'-piperidine]-1'-yl)butan-1-one Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC2(C3=CC=CC=C3C(O2)C=2C=CC=CC=2)CC1 PZTZUXFORXPMDO-UHFFFAOYSA-N 0.000 claims 1
- SLPUTJFVMJPMKV-UHFFFAOYSA-N 1-methylpyrrolidin-3-one Chemical compound CN1CCC(=O)C1 SLPUTJFVMJPMKV-UHFFFAOYSA-N 0.000 claims 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical class NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 claims 1
- GYSDELHGKNCJME-UHFFFAOYSA-N 2-bromo-n-(1-hydroxy-2-methylpropan-2-yl)benzamide Chemical compound OCC(C)(C)NC(=O)C1=CC=CC=C1Br GYSDELHGKNCJME-UHFFFAOYSA-N 0.000 claims 1
- ICMJMKOIRYHDBC-UHFFFAOYSA-N 4-[2-(4,4-dimethyl-5h-1,3-oxazol-2-yl)phenyl]-1-methylpiperidin-4-ol Chemical compound C1CN(C)CCC1(O)C1=CC=CC=C1C1=NC(C)(C)CO1 ICMJMKOIRYHDBC-UHFFFAOYSA-N 0.000 claims 1
- HXAOUYGZEOZTJO-UHFFFAOYSA-N 4-chloro-1-(4-fluorophenyl)butan-1-one Chemical compound FC1=CC=C(C(=O)CCCCl)C=C1 HXAOUYGZEOZTJO-UHFFFAOYSA-N 0.000 claims 1
- UYFVUHISFCVHRP-UHFFFAOYSA-N 5-fluoro-1-(4-fluorophenyl)-1'-methylspiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1CN(C)CCC21C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)O2 UYFVUHISFCVHRP-UHFFFAOYSA-N 0.000 claims 1
- KASOQGOEIYDSMF-UHFFFAOYSA-N 5-fluoro-1-(4-fluorophenyl)spiro[1h-2-benzofuran-3,4'-piperidine] Chemical compound C1=CC(F)=CC=C1C1C2=CC=C(F)C=C2C2(CCNCC2)O1 KASOQGOEIYDSMF-UHFFFAOYSA-N 0.000 claims 1
- QANZRMGXJSNJQN-UHFFFAOYSA-N [Li]C1=C(COCC2=C(C=CC=C2)[Li])C=CC=C1.[Li] Chemical compound [Li]C1=C(COCC2=C(C=CC=C2)[Li])C=CC=C1.[Li] QANZRMGXJSNJQN-UHFFFAOYSA-N 0.000 claims 1
- 150000005215 alkyl ethers Chemical class 0.000 claims 1
- 239000002168 alkylating agent Substances 0.000 claims 1
- 229940100198 alkylating agent Drugs 0.000 claims 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims 1
- 238000003776 cleavage reaction Methods 0.000 claims 1
- 238000005661 deetherification reaction Methods 0.000 claims 1
- NVHHSFPXPBMBIJ-UHFFFAOYSA-N ethyl 1-phenylspiro[1h-2-benzofuran-3,4'-piperidine]-1'-carboxylate Chemical compound C1CN(C(=O)OCC)CCC21C1=CC=CC=C1C(C=1C=CC=CC=1)O2 NVHHSFPXPBMBIJ-UHFFFAOYSA-N 0.000 claims 1
- 230000007017 scission Effects 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 5
- 239000000730 antalgic agent Substances 0.000 abstract description 4
- 239000000935 antidepressant agent Substances 0.000 abstract description 3
- 229940005513 antidepressants Drugs 0.000 abstract description 3
- 239000003204 tranquilizing agent Substances 0.000 abstract description 3
- 230000002936 tranquilizing effect Effects 0.000 abstract description 3
- 239000000243 solution Substances 0.000 description 47
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 40
- 239000000203 mixture Substances 0.000 description 38
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 36
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 34
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 239000013078 crystal Substances 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 20
- 238000004458 analytical method Methods 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000003921 oil Substances 0.000 description 18
- 239000007787 solid Substances 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 239000002904 solvent Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 8
- 230000000875 corresponding effect Effects 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- 229940083608 sodium hydroxide Drugs 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 241000124008 Mammalia Species 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- DCQUBBDIPZQYBK-UHFFFAOYSA-N (2-bromo-4-fluorophenyl)-(4-fluorophenyl)methanol Chemical compound C=1C=C(F)C=C(Br)C=1C(O)C1=CC=C(F)C=C1 DCQUBBDIPZQYBK-UHFFFAOYSA-N 0.000 description 2
- SFCLQJQVSADLOP-UHFFFAOYSA-N (2-bromo-4-methoxyphenyl)-(4-fluorophenyl)methanol Chemical compound BrC1=CC(OC)=CC=C1C(O)C1=CC=C(F)C=C1 SFCLQJQVSADLOP-UHFFFAOYSA-N 0.000 description 2
- JOXJJOHFXZJYAK-UHFFFAOYSA-N (2-bromophenyl)-(4-methylphenyl)methanol Chemical compound C1=CC(C)=CC=C1C(O)C1=CC=CC=C1Br JOXJJOHFXZJYAK-UHFFFAOYSA-N 0.000 description 2
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 2
- OPZDXMCOWFPQPE-UHFFFAOYSA-N 2-bromo-4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C(Br)=C1 OPZDXMCOWFPQPE-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229940025084 amphetamine Drugs 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- BRKADVNLTRCLOW-UHFFFAOYSA-M magnesium;fluorobenzene;bromide Chemical compound [Mg+2].[Br-].FC1=CC=[C-]C=C1 BRKADVNLTRCLOW-UHFFFAOYSA-M 0.000 description 2
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000012289 standard assay Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- LJHMEWBXTMUWBK-UHFFFAOYSA-N (2-bromo-4,5-dimethoxyphenyl)-phenylmethanol Chemical compound C1=C(OC)C(OC)=CC(Br)=C1C(O)C1=CC=CC=C1 LJHMEWBXTMUWBK-UHFFFAOYSA-N 0.000 description 1
- QCMQYFUIIQLFJC-UHFFFAOYSA-N (2-bromo-4,5-dimethoxyphenyl)-phenylmethanone Chemical compound C1=C(OC)C(OC)=CC(Br)=C1C(=O)C1=CC=CC=C1 QCMQYFUIIQLFJC-UHFFFAOYSA-N 0.000 description 1
- PVOOOEKGGXYVAL-UHFFFAOYSA-N (2-bromo-4-fluorophenyl)-(4-fluorophenyl)methanone Chemical compound C1=CC(F)=CC=C1C(=O)C1=CC=C(F)C=C1Br PVOOOEKGGXYVAL-UHFFFAOYSA-N 0.000 description 1
- RRMGEXJZWUCSHO-UHFFFAOYSA-N (2-bromo-4-fluorophenyl)-phenylmethanol Chemical compound C=1C=C(F)C=C(Br)C=1C(O)C1=CC=CC=C1 RRMGEXJZWUCSHO-UHFFFAOYSA-N 0.000 description 1
- MMIDQHSATXDLNV-UHFFFAOYSA-N (2-bromo-4-fluorophenyl)-phenylmethanone Chemical compound BrC1=CC(F)=CC=C1C(=O)C1=CC=CC=C1 MMIDQHSATXDLNV-UHFFFAOYSA-N 0.000 description 1
- VWOCMJRHJKFMKS-UHFFFAOYSA-N (2-bromo-4-methoxyphenyl)-phenylmethanol Chemical compound BrC1=CC(OC)=CC=C1C(O)C1=CC=CC=C1 VWOCMJRHJKFMKS-UHFFFAOYSA-N 0.000 description 1
- YRSMISMMWHKCAL-UHFFFAOYSA-N (2-bromo-4-methoxyphenyl)-phenylmethanone Chemical compound BrC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 YRSMISMMWHKCAL-UHFFFAOYSA-N 0.000 description 1
- HOFSDZGFRKDXAD-UHFFFAOYSA-N (2-bromo-4-methylphenyl)-phenylmethanol Chemical compound BrC1=CC(C)=CC=C1C(O)C1=CC=CC=C1 HOFSDZGFRKDXAD-UHFFFAOYSA-N 0.000 description 1
- INTFJDJHLDMTQN-UHFFFAOYSA-N (2-bromo-5-chlorophenyl)-phenylmethanol Chemical compound C=1C(Cl)=CC=C(Br)C=1C(O)C1=CC=CC=C1 INTFJDJHLDMTQN-UHFFFAOYSA-N 0.000 description 1
- MKCLVAZPKSCYQH-UHFFFAOYSA-N (2-bromo-5-chlorophenyl)-phenylmethanone Chemical compound ClC1=CC=C(Br)C(C(=O)C=2C=CC=CC=2)=C1 MKCLVAZPKSCYQH-UHFFFAOYSA-N 0.000 description 1
- DDULRUPNYFZANK-UHFFFAOYSA-N (2-bromophenyl)-(2-methylphenyl)methanol Chemical compound CC1=CC=CC=C1C(O)C1=CC=CC=C1Br DDULRUPNYFZANK-UHFFFAOYSA-N 0.000 description 1
- FNOLIQBFMNUMST-UHFFFAOYSA-N (2-bromophenyl)-(3-fluorophenyl)methanol Chemical compound C=1C=CC=C(Br)C=1C(O)C1=CC=CC(F)=C1 FNOLIQBFMNUMST-UHFFFAOYSA-N 0.000 description 1
- WSGPNOCUUSZBHY-UHFFFAOYSA-N (2-bromophenyl)-(4-methoxyphenyl)methanol Chemical compound C1=CC(OC)=CC=C1C(O)C1=CC=CC=C1Br WSGPNOCUUSZBHY-UHFFFAOYSA-N 0.000 description 1
- KAQIWWJREILQAQ-UHFFFAOYSA-N (2-bromophenyl)-(4-methoxyphenyl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1Br KAQIWWJREILQAQ-UHFFFAOYSA-N 0.000 description 1
- PFNIDHUYBLYJGE-UHFFFAOYSA-N (2-bromophenyl)-phenylmethanol Chemical compound C=1C=CC=C(Br)C=1C(O)C1=CC=CC=C1 PFNIDHUYBLYJGE-UHFFFAOYSA-N 0.000 description 1
- ABEVIHIQUUXDMS-UHFFFAOYSA-N (2-bromophenyl)-phenylmethanone Chemical compound BrC1=CC=CC=C1C(=O)C1=CC=CC=C1 ABEVIHIQUUXDMS-UHFFFAOYSA-N 0.000 description 1
- DXSQTDIQQWMVEX-UHFFFAOYSA-N (2-fluoro-4-methoxyphenyl)-phenylmethanone Chemical compound FC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 DXSQTDIQQWMVEX-UHFFFAOYSA-N 0.000 description 1
- NTOIKDYVJIWVSU-WOJBJXKFSA-N (2r,3r)-2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid Chemical compound C1=CC(C)=CC=C1C(=O)[C@@](O)(C(O)=O)[C@](O)(C(O)=O)C(=O)C1=CC=C(C)C=C1 NTOIKDYVJIWVSU-WOJBJXKFSA-N 0.000 description 1
- QNRATNLHPGXHMA-XZHTYLCXSA-N (r)-(6-ethoxyquinolin-4-yl)-[(2s,4s,5r)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride Chemical compound Cl.C([C@H]([C@H](C1)CC)C2)CN1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OCC)C=C21 QNRATNLHPGXHMA-XZHTYLCXSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- DHGMDHQNUNRMIN-UHFFFAOYSA-N 1-benzylpyrrolidin-3-one Chemical group C1C(=O)CCN1CC1=CC=CC=C1 DHGMDHQNUNRMIN-UHFFFAOYSA-N 0.000 description 1
- PLDWAJLZAAHOGG-UHFFFAOYSA-N 1-bromo-3-methoxybenzene Chemical compound COC1=CC=CC(Br)=C1 PLDWAJLZAAHOGG-UHFFFAOYSA-N 0.000 description 1
- TXQKNSQVEWHJAQ-UHFFFAOYSA-N 2-(2-bromophenyl)propan-2-ol Chemical compound CC(C)(O)C1=CC=CC=C1Br TXQKNSQVEWHJAQ-UHFFFAOYSA-N 0.000 description 1
- UCEXMJMSILZCHZ-UHFFFAOYSA-N 2-[(4-butoxybenzoyl)amino]acetic acid Chemical compound CCCCOC1=CC=C(C(=O)NCC(O)=O)C=C1 UCEXMJMSILZCHZ-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- NRNBOHJOBDZOFK-UHFFFAOYSA-N 2-bromo-1-[(4-fluorophenyl)-methoxymethyl]-4-methoxybenzene Chemical compound C=1C=C(OC)C=C(Br)C=1C(OC)C1=CC=C(F)C=C1 NRNBOHJOBDZOFK-UHFFFAOYSA-N 0.000 description 1
- SFGFOJPGCOYQJK-UHFFFAOYSA-N 2-bromo-4-fluoro-1-methylbenzene Chemical compound CC1=CC=C(F)C=C1Br SFGFOJPGCOYQJK-UHFFFAOYSA-N 0.000 description 1
- MUZMDYCVUCMIDC-UHFFFAOYSA-N 2-bromo-4-methylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(Br)=C1 MUZMDYCVUCMIDC-UHFFFAOYSA-N 0.000 description 1
- BNQXSFFVGRPZIP-UHFFFAOYSA-N 2-bromo-5-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=CC=C1Br BNQXSFFVGRPZIP-UHFFFAOYSA-N 0.000 description 1
- NDOPHXWIAZIXPR-UHFFFAOYSA-N 2-bromobenzaldehyde Chemical compound BrC1=CC=CC=C1C=O NDOPHXWIAZIXPR-UHFFFAOYSA-N 0.000 description 1
- NZCKTGCKFJDGFD-UHFFFAOYSA-N 2-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Br NZCKTGCKFJDGFD-UHFFFAOYSA-N 0.000 description 1
- KOAMXHRRVFDWRQ-UHFFFAOYSA-N 4,4-dimethyl-5h-1,3-oxazole Chemical compound CC1(C)COC=N1 KOAMXHRRVFDWRQ-UHFFFAOYSA-N 0.000 description 1
- BIANZVZZKGIQKG-UHFFFAOYSA-N 4-[4-(5-hydroxypentoxy)phenyl]benzonitrile Chemical compound C1=CC(OCCCCCO)=CC=C1C1=CC=C(C#N)C=C1 BIANZVZZKGIQKG-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- KEVHHBOZLFCIKW-UHFFFAOYSA-N CC1=CC=C([Mg])C=C1 Chemical compound CC1=CC=C([Mg])C=C1 KEVHHBOZLFCIKW-UHFFFAOYSA-N 0.000 description 1
- YUVHAYYMXSMIGK-UHFFFAOYSA-N CC1=CC=CC=C1[Mg] Chemical compound CC1=CC=CC=C1[Mg] YUVHAYYMXSMIGK-UHFFFAOYSA-N 0.000 description 1
- 101100437861 Caenorhabditis elegans brc-1 gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- CDEMHJCJMMOFMB-UHFFFAOYSA-M ClC1=CC=C([Mg]Br)C=C1 Chemical compound ClC1=CC=C([Mg]Br)C=C1 CDEMHJCJMMOFMB-UHFFFAOYSA-M 0.000 description 1
- 101100381997 Danio rerio tbc1d32 gene Proteins 0.000 description 1
- 208000020401 Depressive disease Diseases 0.000 description 1
- 206010015995 Eyelid ptosis Diseases 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000218652 Larix Species 0.000 description 1
- 235000005590 Larix decidua Nutrition 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 101100381999 Mus musculus Tbc1d32 gene Proteins 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000011102 Thera Species 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- IPMRFNJFZBOIKO-UHFFFAOYSA-M [Br-].FC(F)(F)C1=CC=C([Mg+])C=C1 Chemical compound [Br-].FC(F)(F)C1=CC=C([Mg+])C=C1 IPMRFNJFZBOIKO-UHFFFAOYSA-M 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- RLGKYWLHSNOODU-UHFFFAOYSA-N [Li]C1=CC=CC=C1COCC1=CC=CC=C1[Li] Chemical compound [Li]C1=CC=CC=C1COCC1=CC=CC=C1[Li] RLGKYWLHSNOODU-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- IBNWKIKUJJNBKG-UHFFFAOYSA-N [methoxy(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(OC)C1=CC=CC=C1 IBNWKIKUJJNBKG-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 125000000218 acetic acid group Chemical class C(C)(=O)* 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 239000000159 acid neutralizing agent Substances 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000004791 alkyl magnesium halides Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 150000004792 aryl magnesium halides Chemical class 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical group C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- NBEMQPLNBYYUAZ-UHFFFAOYSA-N ethyl acetate;propan-2-one Chemical compound CC(C)=O.CCOC(C)=O NBEMQPLNBYYUAZ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 150000002238 fumaric acids Chemical class 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- SWGQITQOBPXVRC-UHFFFAOYSA-N methyl 2-bromobenzoate Chemical compound COC(=O)C1=CC=CC=C1Br SWGQITQOBPXVRC-UHFFFAOYSA-N 0.000 description 1
- STZCRXQWRGQSJD-GEEYTBSJSA-M methyl orange Chemical compound [Na+].C1=CC(N(C)C)=CC=C1\N=N\C1=CC=C(S([O-])(=O)=O)C=C1 STZCRXQWRGQSJD-GEEYTBSJSA-M 0.000 description 1
- 229940012189 methyl orange Drugs 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002913 oxalic acids Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 229940065347 propoxyphene hydrochloride Drugs 0.000 description 1
- 201000003004 ptosis Diseases 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- QJDUDPQVDAASMV-UHFFFAOYSA-M sodium;ethanethiolate Chemical compound [Na+].CC[S-] QJDUDPQVDAASMV-UHFFFAOYSA-M 0.000 description 1
- GASOCDUVJSYZGK-UHFFFAOYSA-N spirobenzofuran Chemical compound C1=2C=C(O)C(C)=CC=2OC(O)C21CC(=O)CC2(C)C GASOCDUVJSYZGK-UHFFFAOYSA-N 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 150000003444 succinic acids Chemical class 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/10—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/26—Psychostimulants, e.g. nicotine, cocaine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
- C07C43/17—Unsaturated ethers containing halogen
- C07C43/174—Unsaturated ethers containing halogen containing six-membered aromatic rings
- C07C43/1742—Unsaturated ethers containing halogen containing six-membered aromatic rings with halogen atoms bound to the aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/28—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of CHx-moieties
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/38—Unsaturated compounds having —CHO groups bound to carbon atoms of rings other than six—membered aromatic rings
- C07C47/45—Unsaturated compounds having —CHO groups bound to carbon atoms of rings other than six—membered aromatic rings having unsaturation outside the rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/80—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen
- C07C49/813—Ketones containing a keto group bound to a six-membered aromatic ring containing halogen polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/84—Ketones containing a keto group bound to a six-membered aromatic ring containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Neurosurgery (AREA)
- Pharmacology & Pharmacy (AREA)
- Biomedical Technology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Neurology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Pain & Pain Management (AREA)
- Psychiatry (AREA)
- Anesthesiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42411773A | 1973-12-12 | 1973-12-12 | |
| US05/502,650 US3959475A (en) | 1973-12-12 | 1974-09-03 | Substituted 1,3-dihydrospiro(isobenzofuran)s |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1051428A true CA1051428A (en) | 1979-03-27 |
Family
ID=27026243
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA215,786A Expired CA1051428A (en) | 1973-12-12 | 1974-12-11 | Substituted 1,3-dihydrospiro (isobenzofuran) s |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3959475A (instruction) |
| JP (1) | JPS5833876B2 (instruction) |
| CA (1) | CA1051428A (instruction) |
| CH (3) | CH617938A5 (instruction) |
| DE (1) | DE2458177A1 (instruction) |
| DK (1) | DK144214C (instruction) |
| EG (1) | EG12110A (instruction) |
| FI (1) | FI58128C (instruction) |
| FR (1) | FR2254331B1 (instruction) |
| GB (1) | GB1465999A (instruction) |
| HU (1) | HU169546B (instruction) |
| IE (1) | IE40298B1 (instruction) |
| IL (1) | IL46201A (instruction) |
| LU (1) | LU71461A1 (instruction) |
| NL (1) | NL7416115A (instruction) |
| NO (1) | NO146062C (instruction) |
| OA (1) | OA04852A (instruction) |
| SE (1) | SE419761B (instruction) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4024263A (en) * | 1975-04-30 | 1977-05-17 | American Hoechst Corporation | 1,3-Dihydrospiro[isobenzofuran-1,4'-piperidine]s |
| US3980786A (en) * | 1975-07-15 | 1976-09-14 | American Hoechst Corporation | 1,3-Dihydro-3-phenyl-1'-(2-propynyl)spiro[isobenzofuran]s |
| US3980787A (en) * | 1975-08-25 | 1976-09-14 | American Hoechst Corporation | 3-Phenylspiro[isobenzofuran-1,4'-piperidine]sulfenamides and derivatives |
| US3996354A (en) * | 1976-01-26 | 1976-12-07 | American Hoechst Corporation | 1,3-Dihydro-1'-dimethylphosphinylalkyl-3-phenylspiro(isobenzofuran)s |
| US4031224A (en) * | 1976-04-29 | 1977-06-21 | American Hoechst Corporation | 1,3-Dihydro-heteroarylspiro (isobenzofuran)s |
| US4241071A (en) * | 1977-01-27 | 1980-12-23 | American Hoechst Corporation | Antidepressant (α-phenyl-2-tolyl)azacycloalkanes |
| US4409229A (en) * | 1977-12-02 | 1983-10-11 | Hoechst-Roussel Pharmaceuticals, Inc. | Antidepressive and tranquilizing substituted 1,3-dihydrospiro[benzo(c)thiophene]s |
| EG13536A (en) * | 1977-12-02 | 1981-12-31 | Hoechst Ag | Substituted 1,3-dihydrospiro(benzo(c)thiophene)s |
| US4166119A (en) * | 1978-04-14 | 1979-08-28 | American Hoechst Corporation | Analgesic and tranquilizing spiro[dihydrobenzofuran]piperidines and pyrrolidines |
| US4166120A (en) * | 1978-04-14 | 1979-08-28 | American Hoechst Corporation | Analgesic and tranquilizing benzoylpropyl-spiro[dihydrobenzofuran]piperidines and pyrrolidines |
| US4263317A (en) * | 1979-09-06 | 1981-04-21 | Hoechst-Roussel Pharmaceuticals, Inc. | Spiro[cyclohexane-1,1'(3'H)-isobenzofuran]s |
| US4301292A (en) * | 1979-09-06 | 1981-11-17 | Hoechst-Roussel Pharmaceuticals, Incorporated | 1-[2-(4,5-Dihydro-4,4-dialkyl-2-oxazolyl)phenyl]-4-(dialkylamino)cyclohexanol |
| US4260623A (en) * | 1979-11-26 | 1981-04-07 | Warner-Lambert Company | Hexahydro-1-arylspiro(3H-oxazolo(3,4-A)pyridine-3,4'-piperidene) antidepressants, pharmaceutical compositions thereof and method of use thereof |
| US4268515A (en) * | 1980-02-04 | 1981-05-19 | Hoechst-Roussel Pharmaceuticals Inc. | Spiro[dihydrobenzofuran-piperidines and-pyrrolidines], pharmaceutical compositions thereof and methods of use thereof |
| US4304941A (en) * | 1980-08-01 | 1981-12-08 | Hoechst Roussel Pharmaceuticals, Inc. | Method of preparing poly-substituted acylbenzenes |
| US4517311A (en) * | 1981-10-19 | 1985-05-14 | Hoechst-Roussel Pharmaceuticals Inc. | 2'-Substituted-spiro[benzofuran-2(3H),1'-cycloalkanes] and their analgesic and anti-depressant compositions |
| US4404221A (en) * | 1981-10-19 | 1983-09-13 | Hoechst-Roussel Pharmaceuticals Inc. | 2'-Substituted-spiro[benzofuran-2(3H),1'-cyclohexanes] and its pharmaceutical use |
| US4524207A (en) * | 1981-10-20 | 1985-06-18 | Hoechst-Roussel Pharmaceuticals Inc. | Process for preparing substituted 1,3-dihydrospiro[benzo(c)thiophene]s |
| CA1315279C (en) * | 1987-01-12 | 1993-03-30 | Nancy Grace Bollinger | Anti-inflammatory agents |
| IL96507A0 (en) * | 1989-12-08 | 1991-08-16 | Merck & Co Inc | Nitrogen-containing spirocycles and pharmaceutical compositions containing them |
| CA2037287A1 (en) * | 1990-03-02 | 1991-09-03 | Ben E. Evans | Spirocyclic oxytocin antagonists |
| EP0445974A3 (en) * | 1990-03-05 | 1992-04-29 | Merck Sharp & Dohme Ltd. | Spirocyclic antipsychotic agents |
| US5693643A (en) * | 1991-09-16 | 1997-12-02 | Merck & Co., Inc. | Hydantoin and succinimide-substituted derivatives of spiroindanylcamphorsulfonyl oxytocin antagonists |
| EP0600318B1 (de) * | 1992-11-29 | 1998-04-08 | Clariant GmbH | Neue asymmetrische, halogenierte Benzophenone und Verfahren zu ihrer Herstellung |
| US6374762B1 (en) * | 1997-10-27 | 2002-04-23 | Correct Craft, Inc. | Water sport towing apparatus |
| US6433196B1 (en) * | 2000-02-17 | 2002-08-13 | Sumika Fine Chemicals Co., Ltd. | Production method of citalopram, intermediate therefor and production method of the intermediate |
| GB0213715D0 (en) * | 2002-06-14 | 2002-07-24 | Syngenta Ltd | Chemical compounds |
| US7879834B2 (en) * | 2004-08-19 | 2011-02-01 | Vertex Pharmaceuticals Incorporated | Spiroindoline modulators of muscarinic receptors |
| US7786141B2 (en) * | 2004-08-19 | 2010-08-31 | Vertex Pharmaceuticals Incorporated | Dihydrospiroindene modulators of muscarinic receptors |
| AU2005309365B2 (en) * | 2004-11-29 | 2011-10-06 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| EP1943250A1 (en) | 2005-09-09 | 2008-07-16 | Euro-Celtique S.A. | Fused and spirocycle compounds and the use thereof |
| WO2007076070A2 (en) * | 2005-12-22 | 2007-07-05 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| JP2009527568A (ja) * | 2006-02-22 | 2009-07-30 | バーテックス ファーマシューティカルズ インコーポレイテッド | ムスカリン受容体の調節剤 |
| ATE517106T1 (de) * | 2006-02-22 | 2011-08-15 | Vertex Pharma | Kondensierte spiropiperidine als modulatoren muskarinartiger rezeptoren |
| EP1847542A1 (en) * | 2006-04-21 | 2007-10-24 | Laboratorios del Dr. Esteve S.A. | Spiro[benzopyran] or spiro[benzofuran] derivatives which inhibit the sigma receptor |
| JP2009542670A (ja) * | 2006-06-29 | 2009-12-03 | バーテックス ファーマシューティカルズ インコーポレイテッド | ムスカリン受容体の調節剤 |
| CA2660903A1 (en) * | 2006-08-15 | 2008-02-21 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| US7786107B2 (en) * | 2006-08-18 | 2010-08-31 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| WO2009045519A1 (en) * | 2007-10-03 | 2009-04-09 | Vertex Pharmaceuticals Incorporated | Modulators of muscarinic receptors |
| WO2011137024A1 (en) * | 2010-04-26 | 2011-11-03 | Merck Sharp & Dohme Corp. | Novel spiropiperidine prolylcarboxypeptidase inhibitors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3686186A (en) * | 1970-10-05 | 1972-08-22 | William J Houlihan | Substituted isochroman or phthalan piperidenes |
-
1974
- 1974-09-03 US US05/502,650 patent/US3959475A/en not_active Expired - Lifetime
- 1974-12-06 IL IL7446201A patent/IL46201A/xx unknown
- 1974-12-09 DE DE19742458177 patent/DE2458177A1/de not_active Withdrawn
- 1974-12-10 FI FI3554/74A patent/FI58128C/fi active
- 1974-12-11 IE IE2648/74A patent/IE40298B1/xx unknown
- 1974-12-11 SE SE7415521A patent/SE419761B/xx unknown
- 1974-12-11 EG EG546/74A patent/EG12110A/xx active
- 1974-12-11 DK DK644974A patent/DK144214C/da active
- 1974-12-11 CA CA215,786A patent/CA1051428A/en not_active Expired
- 1974-12-11 HU HUHO1754A patent/HU169546B/hu unknown
- 1974-12-11 LU LU71461A patent/LU71461A1/xx unknown
- 1974-12-11 OA OA55362A patent/OA04852A/xx unknown
- 1974-12-11 NL NL7416115A patent/NL7416115A/xx not_active Application Discontinuation
- 1974-12-11 CH CH1647074A patent/CH617938A5/de not_active IP Right Cessation
- 1974-12-11 NO NO744471A patent/NO146062C/no unknown
- 1974-12-12 FR FR7441005A patent/FR2254331B1/fr not_active Expired
- 1974-12-12 JP JP49142997A patent/JPS5833876B2/ja not_active Expired
- 1974-12-12 GB GB5374474A patent/GB1465999A/en not_active Expired
-
1979
- 1979-09-05 CH CH800179A patent/CH619229A5/de not_active IP Right Cessation
- 1979-09-05 CH CH800079A patent/CH619228A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| HU169546B (instruction) | 1976-12-28 |
| JPS5833876B2 (ja) | 1983-07-22 |
| NO146062B (no) | 1982-04-13 |
| DK144214C (da) | 1982-06-21 |
| FI58128C (fi) | 1980-12-10 |
| IE40298B1 (en) | 1979-04-25 |
| DK144214B (da) | 1982-01-18 |
| CH619229A5 (instruction) | 1980-09-15 |
| OA04852A (fr) | 1980-10-31 |
| DE2458177A1 (de) | 1976-09-30 |
| LU71461A1 (instruction) | 1976-11-11 |
| IL46201A (en) | 1982-04-30 |
| US3959475A (en) | 1976-05-25 |
| CH617938A5 (instruction) | 1980-06-30 |
| FI58128B (fi) | 1980-08-29 |
| IL46201A0 (en) | 1975-03-13 |
| AU7624674A (en) | 1976-06-10 |
| JPS50100052A (instruction) | 1975-08-08 |
| SE419761B (sv) | 1981-08-24 |
| DK644974A (instruction) | 1975-08-18 |
| SE7415521L (instruction) | 1975-06-13 |
| FR2254331A1 (instruction) | 1975-07-11 |
| FI355474A7 (instruction) | 1975-06-13 |
| GB1465999A (en) | 1977-03-02 |
| EG12110A (en) | 1981-03-31 |
| FR2254331B1 (instruction) | 1978-07-21 |
| CH619228A5 (instruction) | 1980-09-15 |
| NO146062C (no) | 1982-08-11 |
| NO744471L (instruction) | 1975-07-07 |
| NL7416115A (nl) | 1975-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1051428A (en) | Substituted 1,3-dihydrospiro (isobenzofuran) s | |
| US3962259A (en) | 1,3-Dihydrospiro[isobenzofuran]s and derivatives thereof | |
| US4287341A (en) | Alkoxy-substituted-6-chloro-quinazoline-2,4-diones | |
| AU649468B2 (en) | 3-substituted piperidine derivatives | |
| US4216218A (en) | Antidepressant and analgesic 4-aryloxy- and 4-arylthio-3-phenylpiperidines | |
| CA1132988A (en) | N-¬3-(4-fluorobenzoyl)propyl|spiro¬dihydro- benzofuranpiperidine and -pyrrolidine|s, derivatives thereof, process for their manufacture and their use as medicaments | |
| US4420485A (en) | 1'-[3-(1,2-Benzisoxazol-3-yl) proply]spiro[benzofuran-2(3H),3' or 4'-piperidines or 3'-pyrrolidines] | |
| US4377581A (en) | Chloro- and alkoxy-substituted-2,4-diaminoquinazolines | |
| US4209625A (en) | Spiro[indoline-3,4'-piperidine]s | |
| US4409229A (en) | Antidepressive and tranquilizing substituted 1,3-dihydrospiro[benzo(c)thiophene]s | |
| GB1603030A (en) | Spiro(indoline-3,4'-piperidine)s and related compounds | |
| US4309348A (en) | Tricyclic indole derivatives | |
| US4351940A (en) | Chloro- and alkoxy-substituted-2-chloro-4-aminodquinazolines | |
| US4379933A (en) | Process for preparing spiro[indoline-3,4'-piperidine]s | |
| US4524207A (en) | Process for preparing substituted 1,3-dihydrospiro[benzo(c)thiophene]s | |
| KR810000027B1 (ko) | 치환된 1,3-디하이드로스피로 [이소벤조푸란]류의 제조방법 | |
| US4345081A (en) | Spiro[indoline-3,4'-piperidine]s | |
| AT347459B (de) | Verfahren zur herstellung von neuen substi- tuierten 1,3-dihydrospiro(isobenzofuranen) sowie von optischen antipoden und saeure- additionssalzen dieser verbindungen | |
| FR2477153A1 (fr) | Spiro dihydrobenzofuranne-piperidines et-pyrrolidines, leur procede de preparation et leur application pharmaceutique | |
| US4302590A (en) | Intermediates for the preparation of 4-aryloxy-3-phenylpiperidines | |
| US4235901A (en) | 1-Hydroxyalkanamine pyrano(3,4-b)indole compositions and use thereof | |
| EP0285267A3 (en) | Pyridine derivatives for treatment and prevention of liver damage, and their preparation | |
| US3952025A (en) | Substituted 2-phenyl-4,6,7,8-tetrahydrofuro and 1,4,5,6,7,8-hexahydropyrrolo[3,2,-c]azepines | |
| Umio et al. | Synthesis and pharmacological properties of 3-(10, 11-dihydro-5H-dibenzo [a, d] cyclohepten-5-ylidene)-1, 2-dialkylpyrrolidine derivatives | |
| US4408050A (en) | Spiro(indoline-3,4'-piperidine) and related compounds |