CA1051425A - Azo compounds - Google Patents
Azo compoundsInfo
- Publication number
- CA1051425A CA1051425A CA204,755A CA204755A CA1051425A CA 1051425 A CA1051425 A CA 1051425A CA 204755 A CA204755 A CA 204755A CA 1051425 A CA1051425 A CA 1051425A
- Authority
- CA
- Canada
- Prior art keywords
- signifies
- radical
- formula
- alkyl
- iii
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000460 chlorine Substances 0.000 claims abstract description 76
- -1 monoazo com-pounds Chemical class 0.000 claims abstract description 23
- 150000001875 compounds Chemical class 0.000 claims abstract description 22
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 13
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 10
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims abstract description 9
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 6
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims abstract description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims abstract description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 3
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 150000003254 radicals Chemical class 0.000 claims description 13
- 238000004043 dyeing Methods 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 125000001246 bromo group Chemical group Br* 0.000 claims description 9
- 229920000728 polyester Polymers 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 239000004744 fabric Substances 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- 239000000758 substrate Substances 0.000 claims description 5
- 238000007639 printing Methods 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- VOLGAXAGEUPBDM-UHFFFAOYSA-N $l^{1}-oxidanylethane Chemical compound CC[O] VOLGAXAGEUPBDM-UHFFFAOYSA-N 0.000 claims description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 230000008878 coupling Effects 0.000 claims description 2
- 238000010168 coupling process Methods 0.000 claims description 2
- 238000005859 coupling reaction Methods 0.000 claims description 2
- 238000010016 exhaust dyeing Methods 0.000 claims description 2
- 230000002209 hydrophobic effect Effects 0.000 claims description 2
- 238000009980 pad dyeing Methods 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 229920002284 Cellulose triacetate Polymers 0.000 claims 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 239000000986 disperse dye Substances 0.000 abstract description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000000975 dye Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical group [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000003517 fume Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000009998 heat setting Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000013535 sea water Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- XEGMDUOAESTQCC-UHFFFAOYSA-N 1-(naphthalen-1-ylmethyl)naphthalene;sodium Chemical compound [Na].C1=CC=C2C(CC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 XEGMDUOAESTQCC-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000152447 Hades Species 0.000 description 1
- 229910004068 NO2Cl Inorganic materials 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 241001115903 Raphus cucullatus Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000005108 dry cleaning Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000007730 finishing process Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000001603 reducing effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
- C09B29/0833—Amino benzenes characterised by the substituent on the benzene ring excepted the substituents: CH3, C2H5, O-alkyl, NHCO-alkyl, NHCOO-alkyl, NHCO- C6H5, NHCOO-C6H5
- C09B29/0836—Amino benzenes characterised by the substituent on the benzene ring excepted the substituents: CH3, C2H5, O-alkyl, NHCO-alkyl, NHCOO-alkyl, NHCO- C6H5, NHCOO-C6H5 linked through -N=
- C09B29/0838—Amino benzenes characterised by the substituent on the benzene ring excepted the substituents: CH3, C2H5, O-alkyl, NHCO-alkyl, NHCOO-alkyl, NHCO- C6H5, NHCOO-C6H5 linked through -N= specific alkyl-CO-N-, aralkyl CON-, cycloalkyl CON-, alkyl OCON-
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1033373A CH583764A5 (enrdf_load_stackoverflow) | 1973-07-16 | 1973-07-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1051425A true CA1051425A (en) | 1979-03-27 |
Family
ID=4362082
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA204,755A Expired CA1051425A (en) | 1973-07-16 | 1974-07-15 | Azo compounds |
Country Status (19)
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53111043U (enrdf_load_stackoverflow) * | 1977-02-15 | 1978-09-05 | ||
| IT1112772B (it) * | 1978-05-09 | 1986-01-20 | Ici Ltd | Coloranti |
| JPS5723753U (enrdf_load_stackoverflow) * | 1980-07-14 | 1982-02-06 | ||
| JPS5853751U (ja) * | 1981-09-30 | 1983-04-12 | 村尾紡機株式会社 | 光電管使用のボビンの残糸検出装置 |
| JPH0714783B2 (ja) * | 1985-12-23 | 1995-02-22 | 株式会社ムラオ・アンド・カンパニー | ボビンの選別装置 |
| JPH0321066U (enrdf_load_stackoverflow) * | 1989-07-07 | 1991-03-01 | ||
| JP2531392B2 (ja) * | 1994-04-21 | 1996-09-04 | 村田機械株式会社 | ボビンの残糸検出装置 |
-
1973
- 1973-07-16 CH CH1033373A patent/CH583764A5/xx not_active IP Right Cessation
-
1974
- 1974-01-01 AR AR254700A patent/AR206320A1/es active
- 1974-07-11 DE DE2433260A patent/DE2433260C3/de not_active Expired
- 1974-07-12 GB GB3091574A patent/GB1471478A/en not_active Expired
- 1974-07-12 NL NL7409448A patent/NL7409448A/xx unknown
- 1974-07-15 BE BE146585A patent/BE817684R/xx active
- 1974-07-15 BR BR5819/74A patent/BR7405819D0/pt unknown
- 1974-07-15 PL PL1974172742A patent/PL88828B1/pl unknown
- 1974-07-15 AU AU71232/74A patent/AU7123274A/en not_active Expired
- 1974-07-15 JP JP8027574A patent/JPS56463B2/ja not_active Expired
- 1974-07-15 ES ES428268A patent/ES428268A1/es not_active Expired
- 1974-07-15 CA CA204,755A patent/CA1051425A/en not_active Expired
- 1974-07-15 DD DD179925A patent/DD113562A5/xx unknown
- 1974-07-16 FR FR7424625A patent/FR2237935B2/fr not_active Expired
- 1974-07-16 IT IT52135/74A patent/IT1048283B/it active
- 1974-07-16 ZA ZA00744544A patent/ZA744544B/xx unknown
-
1975
- 1975-07-10 IN IN1348/CAL/1975A patent/IN143471B/en unknown
-
1978
- 1978-09-15 KE KE2885A patent/KE2885A/xx unknown
- 1978-10-05 HK HK593/78A patent/HK59378A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AR206320A1 (es) | 1976-07-15 |
| FR2237935A2 (enrdf_load_stackoverflow) | 1975-02-14 |
| HK59378A (en) | 1978-10-13 |
| KE2885A (en) | 1978-09-29 |
| ES428268A1 (es) | 1976-11-16 |
| BR7405819D0 (pt) | 1975-05-13 |
| JPS5039736A (enrdf_load_stackoverflow) | 1975-04-12 |
| AU7123274A (en) | 1976-01-15 |
| ZA744544B (en) | 1976-02-25 |
| CH583764A5 (enrdf_load_stackoverflow) | 1977-01-14 |
| IN143471B (enrdf_load_stackoverflow) | 1977-12-03 |
| DE2433260B2 (de) | 1977-12-29 |
| PL88828B1 (enrdf_load_stackoverflow) | 1976-09-30 |
| DE2433260A1 (de) | 1975-02-06 |
| IT1048283B (it) | 1980-11-20 |
| JPS56463B2 (enrdf_load_stackoverflow) | 1981-01-08 |
| NL7409448A (nl) | 1975-01-20 |
| DE2433260C3 (de) | 1978-09-07 |
| FR2237935B2 (enrdf_load_stackoverflow) | 1978-01-20 |
| BE817684R (fr) | 1975-01-15 |
| DD113562A5 (enrdf_load_stackoverflow) | 1975-06-12 |
| GB1471478A (en) | 1977-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3342804A (en) | Monoazo dyes | |
| KR100847236B1 (ko) | 아조 염료, 염료 혼합물, 이들의 제조방법 및 이들을 사용한 소수성 섬유 재료의 염색 또는 날염 방법 | |
| CA1051425A (en) | Azo compounds | |
| PT1358274E (pt) | Corante à base de ftalimidilo azo, processo para a sua preparação e uso do mesmo | |
| CA2543056A1 (en) | Disperse azo dyestuffs | |
| KR100419691B1 (ko) | 모노아조분산염료 | |
| US4111930A (en) | Monoazo dyes having an aryloxyalkyl group on the nitrogen atom in the para position of a 1,4-phenylene coupling component radical | |
| CZ49698A3 (cs) | Směs barviv, způsob její přípravy a její použití | |
| US4488992A (en) | Monoazo dyestuffs derived from benzothiazole | |
| US3522234A (en) | Monoazo dyes of the azobenzene series | |
| GB1580536A (en) | Azo compounds containing a dioxane ring | |
| US6008332A (en) | Phthalimidylazo dyes, process for their preparation and the use thereof | |
| US4065447A (en) | Azo compounds having a 3-arylthio- or aliphaticthio-4-cyano- or alkoxycarbonyl-pyrazolyl-5 diazo component radical | |
| US3562789A (en) | Monoazodyestuffs containing a 3-n-(beta-hydroxy- alpha - cyclohexyloxy or aryloxy) propylamino-4-alkoxy-alranoylanilide group | |
| US3544548A (en) | Water-insoluble monoazo dyestuffs | |
| WO2004056926A1 (en) | Phthalimidylazo dyes, processes for the preparation thereof and the use thereof | |
| JPS5920696B2 (ja) | モノアゾ化合物の製法 | |
| CA1193248A (en) | Organic compounds | |
| US4218372A (en) | Azo compounds having a β-alkynyloxy carbonylalkyl group on the coupling component radical | |
| US4278599A (en) | Mono azo dyes from (2-alkoxy-5-alkanoylaminoanilino)alkoxy or aryloxy alkanes | |
| US5973127A (en) | Monoazo dyes substituted by haloalkylcarbamate and sulphonylfluoride groups | |
| KR20150020264A (ko) | 안트라퀴논 아조 염료 | |
| US3644329A (en) | Water-insoluble mono-azo dyestuffs containing a cinnamoylamine coupling component | |
| US4051120A (en) | Monoazo compounds having a 5-nitrothiazolyl-2 diazo component radical and a 1,4-phenylene coupling component radical having an n-(alkyl or allyl)-n-(alkoxyl- or alkoxyethoxy-ethoxycarbonyloxyalkyl)amino group in its para position | |
| US3773750A (en) | 2,6-dihalo-4-nitrophenyl-azo-phenylcompounds having an optionally substituted phenylcarbamoyloxyalkyl substituent |