CA1042896A - Process for the manufacture of 5-sulfamoyl-anthranilic acids - Google Patents
Process for the manufacture of 5-sulfamoyl-anthranilic acidsInfo
- Publication number
- CA1042896A CA1042896A CA219,264A CA219264A CA1042896A CA 1042896 A CA1042896 A CA 1042896A CA 219264 A CA219264 A CA 219264A CA 1042896 A CA1042896 A CA 1042896A
- Authority
- CA
- Canada
- Prior art keywords
- reaction
- sulfamoyl
- yield
- acid
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 14
- 238000004519 manufacturing process Methods 0.000 title abstract description 5
- JRGAUAWPCLQHTF-UHFFFAOYSA-N 2-amino-5-sulfamoylbenzoic acid Chemical class NC1=CC=C(S(N)(=O)=O)C=C1C(O)=O JRGAUAWPCLQHTF-UHFFFAOYSA-N 0.000 title description 2
- 150000001412 amines Chemical class 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 150000001735 carboxylic acids Chemical class 0.000 claims abstract description 6
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 3
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 125000004475 heteroaralkyl group Chemical group 0.000 claims abstract description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 17
- 239000002244 precipitate Substances 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 9
- 239000000047 product Substances 0.000 claims description 9
- 238000001953 recrystallisation Methods 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 238000001816 cooling Methods 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims 1
- 125000005842 heteroatom Chemical group 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 125000004076 pyridyl group Chemical group 0.000 claims 1
- 125000001544 thienyl group Chemical group 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract description 2
- 125000001931 aliphatic group Chemical group 0.000 abstract description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 2
- 229910052760 oxygen Inorganic materials 0.000 abstract description 2
- 239000001301 oxygen Substances 0.000 abstract description 2
- 229910052717 sulfur Inorganic materials 0.000 abstract description 2
- 239000011593 sulfur Substances 0.000 abstract description 2
- OAZOBYBYAKXURF-UHFFFAOYSA-N 2-(sulfamoylamino)benzoic acid Chemical class NS(=O)(=O)NC1=CC=CC=C1C(O)=O OAZOBYBYAKXURF-UHFFFAOYSA-N 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 48
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 18
- -1 cycloalkyl-alkyl radical Chemical class 0.000 description 15
- 238000000354 decomposition reaction Methods 0.000 description 12
- 239000007795 chemical reaction product Substances 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 239000013078 crystal Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 150000002825 nitriles Chemical class 0.000 description 7
- ATVMWYGTINXOLP-UHFFFAOYSA-N 2,4-dichloro-5-cyanobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC(C#N)=C(Cl)C=C1Cl ATVMWYGTINXOLP-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 229960000443 hydrochloric acid Drugs 0.000 description 5
- 235000011167 hydrochloric acid Nutrition 0.000 description 5
- 229960004592 isopropanol Drugs 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- PXJACNDVRNAFHD-UHFFFAOYSA-N (2-methoxyphenyl)methanamine Chemical compound COC1=CC=CC=C1CN PXJACNDVRNAFHD-UHFFFAOYSA-N 0.000 description 3
- RPGJTKZKYPGEHC-UHFFFAOYSA-N 2,4-diphenoxy-5-sulfamoylbenzoic acid Chemical compound C1=C(OC=2C=CC=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1OC1=CC=CC=C1 RPGJTKZKYPGEHC-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 3
- 229940031826 phenolate Drugs 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- IPRGYSAYIGOGMN-UHFFFAOYSA-N 2,4-dichloro-5-sulfamoylbenzamide Chemical compound NC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1Cl IPRGYSAYIGOGMN-UHFFFAOYSA-N 0.000 description 2
- ZSHHRBYVHTVRFK-UHFFFAOYSA-N 2,4-dichloro-5-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC(C(O)=O)=C(Cl)C=C1Cl ZSHHRBYVHTVRFK-UHFFFAOYSA-N 0.000 description 2
- CQDAJIJSONBXDL-UHFFFAOYSA-N 5-cyano-2,4-diphenoxybenzenesulfonamide Chemical compound C1=C(OC=2C=CC=CC=2)C(S(=O)(=O)N)=CC(C#N)=C1OC1=CC=CC=C1 CQDAJIJSONBXDL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000011260 aqueous acid Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- BJFPYGGTDAYECS-UHFFFAOYSA-N (3-chlorophenyl)methanamine Chemical compound NCC1=CC=CC(Cl)=C1 BJFPYGGTDAYECS-UHFFFAOYSA-N 0.000 description 1
- RDAFNSMYPSHCBK-QPJJXVBHSA-N (e)-3-phenylprop-2-en-1-amine Chemical compound NC\C=C\C1=CC=CC=C1 RDAFNSMYPSHCBK-QPJJXVBHSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- ZILSBZLQGRBMOR-UHFFFAOYSA-N 1,3-benzodioxol-5-ylmethanamine Chemical compound NCC1=CC=C2OCOC2=C1 ZILSBZLQGRBMOR-UHFFFAOYSA-N 0.000 description 1
- UMPSXRYVXUPCOS-UHFFFAOYSA-N 2,3-dichlorophenol Chemical class OC1=CC=CC(Cl)=C1Cl UMPSXRYVXUPCOS-UHFFFAOYSA-N 0.000 description 1
- DSIWZKWQIBJFLX-UHFFFAOYSA-N 2,3-diethoxyphenol Chemical class CCOC1=CC=CC(O)=C1OCC DSIWZKWQIBJFLX-UHFFFAOYSA-N 0.000 description 1
- QSZCGGBDNYTQHH-UHFFFAOYSA-N 2,3-dimethoxyphenol Chemical class COC1=CC=CC(O)=C1OC QSZCGGBDNYTQHH-UHFFFAOYSA-N 0.000 description 1
- PVFKKZKQKZVYFS-UHFFFAOYSA-N 2,4-bis(3-chlorophenoxy)-5-cyanobenzenesulfonamide Chemical compound C1=C(OC=2C=C(Cl)C=CC=2)C(S(=O)(=O)N)=CC(C#N)=C1OC1=CC=CC(Cl)=C1 PVFKKZKQKZVYFS-UHFFFAOYSA-N 0.000 description 1
- FCIFDNIRIJLTNC-UHFFFAOYSA-N 2,4-bis(3-chlorophenoxy)-5-sulfamoylbenzoic acid Chemical compound C1=C(OC=2C=C(Cl)C=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1OC1=CC=CC(Cl)=C1 FCIFDNIRIJLTNC-UHFFFAOYSA-N 0.000 description 1
- GDUBYEMEFUEONT-UHFFFAOYSA-N 2,4-bis(4-methoxyphenoxy)-5-sulfamoylbenzoic acid Chemical compound C1=CC(OC)=CC=C1OC1=CC(OC=2C=CC(OC)=CC=2)=C(S(N)(=O)=O)C=C1C(O)=O GDUBYEMEFUEONT-UHFFFAOYSA-N 0.000 description 1
- NAVPIFVINDTLCO-UHFFFAOYSA-N 2,4-bis(4-methylphenoxy)-5-sulfamoylbenzoic acid Chemical compound C1=CC(C)=CC=C1OC1=CC(OC=2C=CC(C)=CC=2)=C(S(N)(=O)=O)C=C1C(O)=O NAVPIFVINDTLCO-UHFFFAOYSA-N 0.000 description 1
- ZFCSOHFVAURLLG-UHFFFAOYSA-N 2-(2-benzylhydrazinyl)-4-(3-chlorophenoxy)-5-sulfamoylbenzoic acid Chemical compound C1=C(OC=2C=C(Cl)C=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1NNCC1=CC=CC=C1 ZFCSOHFVAURLLG-UHFFFAOYSA-N 0.000 description 1
- RKPJVFMHQPEGFC-UHFFFAOYSA-N 2-(chloromethoxy)phenol Chemical class OC1=CC=CC=C1OCCl RKPJVFMHQPEGFC-UHFFFAOYSA-N 0.000 description 1
- YQVRCJOKOORURF-UHFFFAOYSA-N 2-(cyclohexylmethylamino)-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound C1=C(OC=2C=CC=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1CCCCC1 YQVRCJOKOORURF-UHFFFAOYSA-N 0.000 description 1
- UOPHVWXRFSMBBX-UHFFFAOYSA-N 2-(furan-2-ylmethylamino)-4-(4-methoxyphenoxy)-5-sulfamoylbenzoic acid Chemical compound C1=CC(OC)=CC=C1OC1=CC(NCC=2OC=CC=2)=C(C(O)=O)C=C1S(N)(=O)=O UOPHVWXRFSMBBX-UHFFFAOYSA-N 0.000 description 1
- PUJCJXODEMVMNQ-UHFFFAOYSA-N 2-(furan-2-ylmethylamino)-4-(4-methylphenoxy)-5-sulfamoylbenzoic acid Chemical compound C1=CC(C)=CC=C1OC1=CC(NCC=2OC=CC=2)=C(C(O)=O)C=C1S(N)(=O)=O PUJCJXODEMVMNQ-UHFFFAOYSA-N 0.000 description 1
- LRBLIMZJQFWDLI-UHFFFAOYSA-N 2-(furan-2-ylmethylamino)-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound C1=C(OC=2C=CC=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 LRBLIMZJQFWDLI-UHFFFAOYSA-N 0.000 description 1
- DZYYSSXYFWTOLA-UHFFFAOYSA-N 2-(oxolan-2-ylmethylamino)-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound C1=C(OC=2C=CC=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1CCCO1 DZYYSSXYFWTOLA-UHFFFAOYSA-N 0.000 description 1
- IXQGCWUGDFDQMF-UHFFFAOYSA-N 2-Ethylphenol Chemical class CCC1=CC=CC=C1O IXQGCWUGDFDQMF-UHFFFAOYSA-N 0.000 description 1
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 1
- MZWUIOLTQFYKPX-UHFFFAOYSA-N 2-[(2-methoxyphenyl)methylamino]-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound COC1=CC=CC=C1CNC1=CC(OC=2C=CC=CC=2)=C(S(N)(=O)=O)C=C1C(O)=O MZWUIOLTQFYKPX-UHFFFAOYSA-N 0.000 description 1
- MNRJPGMADNCYNJ-UHFFFAOYSA-N 2-[(3-chlorophenyl)methylamino]-4-phenoxy-5-sulfamoylbenzoic acid Chemical compound C1=C(OC=2C=CC=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CC(Cl)=C1 MNRJPGMADNCYNJ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- VADKRMSMGWJZCF-UHFFFAOYSA-N 2-bromophenol Chemical class OC1=CC=CC=C1Br VADKRMSMGWJZCF-UHFFFAOYSA-N 0.000 description 1
- IMLAIXAZMVDRGA-UHFFFAOYSA-N 2-phenoxyethanamine Chemical compound NCCOC1=CC=CC=C1 IMLAIXAZMVDRGA-UHFFFAOYSA-N 0.000 description 1
- UBKQRASXZMLQRJ-UHFFFAOYSA-N 2-phenylsulfanylethanamine Chemical compound NCCSC1=CC=CC=C1 UBKQRASXZMLQRJ-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- SIRZAUFJHUZRTI-UHFFFAOYSA-N 3-methoxy-2-methylphenol Chemical class COC1=CC=CC(O)=C1C SIRZAUFJHUZRTI-UHFFFAOYSA-N 0.000 description 1
- OQENVWSNEPBMQE-UHFFFAOYSA-N 4-phenoxy-2-(pyridin-4-ylmethylamino)-5-sulfamoylbenzoic acid Chemical compound C1=C(OC=2C=CC=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=NC=C1 OQENVWSNEPBMQE-UHFFFAOYSA-N 0.000 description 1
- IAIYHTQKLYVNNO-UHFFFAOYSA-N 4-phenoxy-5-sulfamoyl-2-(thiophen-2-ylmethylamino)benzoic acid Chemical compound C1=C(OC=2C=CC=CC=2)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CS1 IAIYHTQKLYVNNO-UHFFFAOYSA-N 0.000 description 1
- DSFWVTPEIZKWLA-UHFFFAOYSA-N 5-cyano-2,4-bis(4-methoxyphenoxy)benzenesulfonamide Chemical compound C1=CC(OC)=CC=C1OC1=CC(OC=2C=CC(OC)=CC=2)=C(S(N)(=O)=O)C=C1C#N DSFWVTPEIZKWLA-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000002648 azanetriyl group Chemical group *N(*)* 0.000 description 1
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Substances N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000006278 bromobenzyl group Chemical group 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- CAOQEOHEZKVYOJ-UHFFFAOYSA-N cycloheptylmethanamine Chemical group NCC1CCCCCC1 CAOQEOHEZKVYOJ-UHFFFAOYSA-N 0.000 description 1
- GQOIKWAYFXTZOK-UHFFFAOYSA-N cyclooctylmethanamine Chemical compound NCC1CCCCCCC1 GQOIKWAYFXTZOK-UHFFFAOYSA-N 0.000 description 1
- 125000006286 dichlorobenzyl group Chemical group 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000006182 dimethyl benzyl group Chemical group 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000008423 fluorobenzenes Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- YNOGYQAEJGADFJ-UHFFFAOYSA-N oxolan-2-ylmethanamine Chemical compound NCC1CCCO1 YNOGYQAEJGADFJ-UHFFFAOYSA-N 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000006173 tetrahydropyranylmethyl group Chemical group 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- FKKJJPMGAWGYPN-UHFFFAOYSA-N thiophen-2-ylmethanamine Chemical compound NCC1=CC=CS1 FKKJJPMGAWGYPN-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 150000003739 xylenols Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pyridine Compounds (AREA)
- Furan Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2406972A DE2406972C3 (de) | 1974-02-14 | 1974-02-14 | Verfahren zur Herstellung von 5-Sulfamoylanthranilsäuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1042896A true CA1042896A (en) | 1978-11-21 |
Family
ID=5907335
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA219,264A Expired CA1042896A (en) | 1974-02-14 | 1975-02-03 | Process for the manufacture of 5-sulfamoyl-anthranilic acids |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4001284A (en:Method) |
| JP (1) | JPS50129529A (en:Method) |
| AT (1) | AT339279B (en:Method) |
| BE (1) | BE825567A (en:Method) |
| CA (1) | CA1042896A (en:Method) |
| CH (1) | CH593925A5 (en:Method) |
| DE (1) | DE2406972C3 (en:Method) |
| DK (1) | DK140011C (en:Method) |
| ES (1) | ES434568A1 (en:Method) |
| FI (1) | FI750376A7 (en:Method) |
| FR (1) | FR2261263B1 (en:Method) |
| GB (1) | GB1488086A (en:Method) |
| HU (1) | HU171908B (en:Method) |
| IE (1) | IE40602B1 (en:Method) |
| LU (1) | LU71829A1 (en:Method) |
| NL (1) | NL7501491A (en:Method) |
| SE (1) | SE7501651L (en:Method) |
| ZA (1) | ZA75920B (en:Method) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3009229A1 (de) * | 1980-03-11 | 1981-10-15 | Hoechst Ag, 6000 Frankfurt | 2,4-diamino-5-sulfamoylbenzolsulfosaeuren und verfahen zu ihrer herstellung |
| DE3101960A1 (de) * | 1981-01-22 | 1982-09-02 | Hoechst Ag, 6000 Frankfurt | "basisch substituierte anthranilsaeuren, verfahren zu ihrer herstellung und ihre verwendung" |
| RU2006133540A (ru) * | 2004-02-20 | 2008-03-27 | Авентис Фармасьютикалз Инк. (Us) | Фуросемидные модуляторы нм74 |
| US20250145767A1 (en) * | 2022-02-16 | 2025-05-08 | Northeastern University | Hexavalent substituted benzenes |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3658990A (en) * | 1969-06-10 | 1972-04-25 | Ciba Geigy Corp | Diuretic compositions |
| GB1287926A (en:Method) * | 1969-12-16 | 1972-09-06 |
-
1974
- 1974-02-14 DE DE2406972A patent/DE2406972C3/de not_active Expired
-
1975
- 1975-02-03 CA CA219,264A patent/CA1042896A/en not_active Expired
- 1975-02-07 NL NL7501491A patent/NL7501491A/xx not_active Application Discontinuation
- 1975-02-08 ES ES434568A patent/ES434568A1/es not_active Expired
- 1975-02-11 CH CH159575A patent/CH593925A5/xx not_active IP Right Cessation
- 1975-02-11 HU HU75HO00001767A patent/HU171908B/hu unknown
- 1975-02-12 LU LU71829A patent/LU71829A1/xx unknown
- 1975-02-12 FI FI750376A patent/FI750376A7/fi not_active Application Discontinuation
- 1975-02-12 US US05/549,430 patent/US4001284A/en not_active Expired - Lifetime
- 1975-02-13 AT AT107075A patent/AT339279B/de active
- 1975-02-13 DK DK52375A patent/DK140011C/da not_active IP Right Cessation
- 1975-02-13 ZA ZA00750920A patent/ZA75920B/xx unknown
- 1975-02-13 JP JP50017516A patent/JPS50129529A/ja active Pending
- 1975-02-13 GB GB6149/75A patent/GB1488086A/en not_active Expired
- 1975-02-13 IE IE282/75A patent/IE40602B1/xx unknown
- 1975-02-14 SE SE7501651A patent/SE7501651L/xx unknown
- 1975-02-14 FR FR7504756A patent/FR2261263B1/fr not_active Expired
- 1975-02-14 BE BE153392A patent/BE825567A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK52375A (en:Method) | 1975-10-06 |
| US4001284A (en) | 1977-01-04 |
| DK140011B (da) | 1979-06-05 |
| IE40602B1 (en) | 1979-07-04 |
| BE825567A (fr) | 1975-08-14 |
| JPS50129529A (en:Method) | 1975-10-13 |
| FR2261263A1 (en:Method) | 1975-09-12 |
| ES434568A1 (es) | 1976-12-01 |
| DE2406972A1 (de) | 1975-09-04 |
| FR2261263B1 (en:Method) | 1978-06-23 |
| AU7813075A (en) | 1976-08-12 |
| LU71829A1 (en:Method) | 1976-12-31 |
| FI750376A7 (en:Method) | 1975-08-15 |
| CH593925A5 (en:Method) | 1977-12-30 |
| DK140011C (da) | 1979-11-05 |
| NL7501491A (nl) | 1975-08-18 |
| IE40602L (en) | 1975-08-14 |
| DE2406972B2 (de) | 1978-11-23 |
| SE7501651L (en:Method) | 1975-08-15 |
| ZA75920B (en) | 1976-01-28 |
| AT339279B (de) | 1977-10-10 |
| ATA107075A (de) | 1977-02-15 |
| DE2406972C3 (de) | 1979-07-19 |
| HU171908B (hu) | 1978-04-28 |
| GB1488086A (en) | 1977-10-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3228516B2 (ja) | ナフトール誘導体およびその製法 | |
| EP0274379A2 (en) | Process for preparing pyridine-2,3-dicarboxylic acid compounds | |
| US3354173A (en) | Imidazole carboxylates | |
| KR20040026626A (ko) | 5-[비스(카르복시메틸)아미노]-3-카르복시메틸-4-시아노-2-티오펜카르복실산의 테트라에스테르의 산업적 합성 방법및 라넬산의 이가염 또는 그 수화물의 합성에의 적용 | |
| CA1042896A (en) | Process for the manufacture of 5-sulfamoyl-anthranilic acids | |
| US4131617A (en) | Preparation of new isobutylramide derivatives | |
| EP0544266A1 (de) | Verfahren zur Herstellung von Bismaleinimid-Derivaten | |
| US3201406A (en) | Pyridylcoumarins | |
| AU746709B2 (en) | Process for the preparation of heteroarylcarboxylic amides and esters | |
| CA1055502A (en) | Process for the preparation of 2,5-disubstituted benzamides | |
| US4658035A (en) | Preparation of 2-alkyl-4,5-dihydroxymethylimidazoles | |
| US2713048A (en) | Pyridyl thenylamines | |
| CA1047504A (en) | N-(2-pyrrolidinyl alkyl) substitutes and derivatives thereof | |
| CN112979555A (zh) | 一种合成西咪替丁的工艺 | |
| US4275216A (en) | Process for preparing 4(5)-hydroxymethyl 5(4)-lower alkyl imidazoles | |
| US4614798A (en) | Process for the production of xylazine | |
| US4088657A (en) | Process for manufacturing N-acyl derivatives of glycines α-substituted by radicals of aromatic nature and novel products thereof | |
| JP4110633B2 (ja) | 3−アミノ−4−フルオロ−2−不飽和カルボン酸エステル及びその製法 | |
| JP4251508B2 (ja) | 酸塩化物化合物の製造方法 | |
| KR900006556B1 (ko) | 2-구아니디노티아졸 유도체의 제조방법 | |
| JPS62138467A (ja) | N−置換マレイミドの製造方法 | |
| JP2767295B2 (ja) | インドール―3―カルボニトリル化合物の製造方法 | |
| DE1445775A1 (de) | Verfahren zur Herstellung basisch alkylierter Bisnaphthalimide | |
| KR800000746B1 (ko) | 5-설파모일-안트라닐산의 제조방법 | |
| JP3085610B2 (ja) | ビスマレイミド類の製造方法 |