CA1042650A - Corrosion inhibitor - Google Patents
Corrosion inhibitorInfo
- Publication number
- CA1042650A CA1042650A CA211,005A CA211005A CA1042650A CA 1042650 A CA1042650 A CA 1042650A CA 211005 A CA211005 A CA 211005A CA 1042650 A CA1042650 A CA 1042650A
- Authority
- CA
- Canada
- Prior art keywords
- component
- acid
- phosphonic acid
- composition
- water soluble
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000005260 corrosion Methods 0.000 title claims abstract description 48
- 230000007797 corrosion Effects 0.000 title claims abstract description 48
- 239000003112 inhibitor Substances 0.000 title abstract description 5
- 239000000203 mixture Substances 0.000 claims abstract description 47
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims abstract description 16
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229920000388 Polyphosphate Polymers 0.000 claims abstract description 12
- 239000001205 polyphosphate Substances 0.000 claims abstract description 12
- 235000011176 polyphosphates Nutrition 0.000 claims abstract description 12
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229920000642 polymer Polymers 0.000 claims abstract description 9
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical class [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 claims abstract description 6
- 235000019982 sodium hexametaphosphate Nutrition 0.000 claims abstract description 6
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 claims abstract description 6
- 229920002125 Sokalan® Polymers 0.000 claims abstract description 4
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 claims abstract description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 36
- 230000002401 inhibitory effect Effects 0.000 claims description 25
- 229910019142 PO4 Inorganic materials 0.000 claims description 18
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 12
- 235000021317 phosphate Nutrition 0.000 claims description 12
- -1 aminomethylene phosphonic acid Chemical compound 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 10
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 9
- 239000010452 phosphate Substances 0.000 claims description 9
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims description 6
- 229910000318 alkali metal phosphate Inorganic materials 0.000 claims description 5
- 229920001519 homopolymer Polymers 0.000 claims description 5
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 claims description 4
- 229920003169 water-soluble polymer Polymers 0.000 claims description 4
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 claims description 2
- 229940063559 methacrylic acid Drugs 0.000 claims 2
- 150000002430 hydrocarbons Chemical class 0.000 abstract description 10
- 229930195733 hydrocarbon Natural products 0.000 abstract description 9
- 239000000356 contaminant Substances 0.000 abstract description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 abstract description 5
- 229910000037 hydrogen sulfide Inorganic materials 0.000 abstract description 5
- 239000011734 sodium Chemical class 0.000 abstract description 5
- 229910052708 sodium Inorganic materials 0.000 abstract description 4
- 239000004584 polyacrylic acid Substances 0.000 abstract description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 14
- 239000001257 hydrogen Substances 0.000 description 14
- 229920001577 copolymer Polymers 0.000 description 10
- 125000000217 alkyl group Chemical group 0.000 description 9
- 229940116254 phosphonic acid Drugs 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 229920002472 Starch Polymers 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000498 cooling water Substances 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 235000019698 starch Nutrition 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 235000015424 sodium Nutrition 0.000 description 4
- 229940083542 sodium Drugs 0.000 description 4
- 159000000000 sodium salts Chemical group 0.000 description 4
- 235000019832 sodium triphosphate Nutrition 0.000 description 4
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 4
- KYTWUFXLRDBYGE-UHFFFAOYSA-N CC.OP(=O)OP(O)=O Chemical class CC.OP(=O)OP(O)=O KYTWUFXLRDBYGE-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 229920001296 polysiloxane Polymers 0.000 description 3
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 2
- 235000019820 disodium diphosphate Nutrition 0.000 description 2
- GYQBBRRVRKFJRG-UHFFFAOYSA-L disodium pyrophosphate Chemical compound [Na+].[Na+].OP([O-])(=O)OP(O)([O-])=O GYQBBRRVRKFJRG-UHFFFAOYSA-L 0.000 description 2
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 235000001055 magnesium Nutrition 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229940091250 magnesium supplement Drugs 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 2
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- LJDSTRZHPWMDPG-UHFFFAOYSA-N 2-(butylamino)ethanol Chemical compound CCCCNCCO LJDSTRZHPWMDPG-UHFFFAOYSA-N 0.000 description 1
- LTHNHFOGQMKPOV-UHFFFAOYSA-N 2-ethylhexan-1-amine Chemical compound CCCCC(CC)CN LTHNHFOGQMKPOV-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229920008712 Copo Polymers 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 241001662022 Stenocarpus reticulatus Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 229920006322 acrylamide copolymer Polymers 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000002648 azanetriyl group Chemical group *N(*)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229940035564 duration Drugs 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000013529 heat transfer fluid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical compound CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical compound [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 description 1
- 229910001950 potassium oxide Inorganic materials 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 230000003134 recirculating effect Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- OTMVRSKBJZXYMF-UHFFFAOYSA-N sodium;[6-[bis(phosphonomethyl)amino]hexyl-(phosphonomethyl)amino]methylphosphonic acid Chemical group [Na+].OP(O)(=O)CN(CP(O)(O)=O)CCCCCCN(CP(O)(O)=O)CP(O)(O)=O OTMVRSKBJZXYMF-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229960004418 trolamine Drugs 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C23—COATING METALLIC MATERIAL; COATING MATERIAL WITH METALLIC MATERIAL; CHEMICAL SURFACE TREATMENT; DIFFUSION TREATMENT OF METALLIC MATERIAL; COATING BY VACUUM EVAPORATION, BY SPUTTERING, BY ION IMPLANTATION OR BY CHEMICAL VAPOUR DEPOSITION, IN GENERAL; INHIBITING CORROSION OF METALLIC MATERIAL OR INCRUSTATION IN GENERAL
- C23F—NON-MECHANICAL REMOVAL OF METALLIC MATERIAL FROM SURFACE; INHIBITING CORROSION OF METALLIC MATERIAL OR INCRUSTATION IN GENERAL; MULTI-STEP PROCESSES FOR SURFACE TREATMENT OF METALLIC MATERIAL INVOLVING AT LEAST ONE PROCESS PROVIDED FOR IN CLASS C23 AND AT LEAST ONE PROCESS COVERED BY SUBCLASS C21D OR C22F OR CLASS C25
- C23F11/00—Inhibiting corrosion of metallic material by applying inhibitors to the surface in danger of corrosion or adding them to the corrosive agent
- C23F11/08—Inhibiting corrosion of metallic material by applying inhibitors to the surface in danger of corrosion or adding them to the corrosive agent in other liquids
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Mechanical Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Preventing Corrosion Or Incrustation Of Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/404,256 US3992318A (en) | 1973-10-09 | 1973-10-09 | Corrosion inhibitor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1042650A true CA1042650A (en) | 1978-11-21 |
Family
ID=23598844
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA211,005A Expired CA1042650A (en) | 1973-10-09 | 1974-10-08 | Corrosion inhibitor |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3992318A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS585264B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE820826A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7408328D0 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1042650A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2447895C2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES430773A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2246620B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1463173A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1022687B (cg-RX-API-DMAC7.html) |
| NL (1) | NL7413235A (cg-RX-API-DMAC7.html) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51133143A (en) * | 1975-05-15 | 1976-11-18 | Katayama Chemical Works Co | Anticorrosive for condensed water in circulation system |
| JPS6017828B2 (ja) * | 1975-05-15 | 1985-05-07 | 株式会社片山化学工業研究所 | 循環系高濃縮水用防食剤 |
| US4168230A (en) * | 1976-11-10 | 1979-09-18 | Nalco Chemical Company | Synergistic composition comprising phosphorylated ethoxylated glycerine and polyacrylic acid for the prevention of CaCO3 scale in cooling water |
| GB1539974A (en) * | 1976-11-10 | 1979-02-07 | Ciba Geigy Ag | Method of inhibiting corrosion and scaling of metals in contact with water |
| US4105581A (en) * | 1977-02-18 | 1978-08-08 | Drew Chemical Corporation | Corrosion inhibitor |
| US4217216A (en) * | 1977-04-01 | 1980-08-12 | The Mogul Corporation | Corrosion inhibiting compositions |
| US4138353A (en) * | 1977-04-01 | 1979-02-06 | The Mogul Corporation | Corrosion inhibiting composition and process of using same |
| US4337186A (en) | 1978-01-17 | 1982-06-29 | National Research Development Corporation | Hardenable compositions |
| US4206075A (en) * | 1978-05-05 | 1980-06-03 | Calgon Corporation | Corrosion inhibitor |
| US4246030A (en) * | 1978-12-08 | 1981-01-20 | The Mogul Corporation | Corrosion inhibiting compositions and the process for using same |
| US4239643A (en) * | 1979-01-02 | 1980-12-16 | Monsanto Company | Peroxide stabilization |
| JPS55104530A (en) * | 1979-02-01 | 1980-08-11 | Kurita Water Ind Ltd | Operating method of gas-turbine |
| CA1114595A (en) * | 1979-04-02 | 1981-12-22 | Joseph J. Schuck | Corrosion inhibitor treatment for boiler water |
| US4411865A (en) * | 1979-04-05 | 1983-10-25 | Betz Laboratories, Inc. | Method of corrosion inhibition in aqueous mediums |
| JPS55155813U (cg-RX-API-DMAC7.html) * | 1979-04-24 | 1980-11-10 | ||
| US4317744A (en) * | 1979-04-25 | 1982-03-02 | Drew Chemical Corporation | Corrosion inhibitor |
| CA1151498A (en) * | 1979-10-23 | 1983-08-09 | Dearborn Chemicals Ltd. | Treatment of aqueous systems |
| DE3040729A1 (de) * | 1979-10-31 | 1981-05-14 | Nippon Paint Co., Ltd., Osaka | Waessriger anstrichstoff und seine verwendung |
| US4303568A (en) * | 1979-12-10 | 1981-12-01 | Betz Laboratories, Inc. | Corrosion inhibition treatments and method |
| US4351796A (en) * | 1980-02-25 | 1982-09-28 | Ciba-Geigy Corporation | Method for scale control |
| US4297237A (en) * | 1980-03-06 | 1981-10-27 | Calgon Corporation | Polyphosphate and polymaleic anhydride combination for treating corrosion |
| US4409121A (en) * | 1980-07-21 | 1983-10-11 | Uop Inc. | Corrosion inhibitors |
| US4384979A (en) * | 1980-10-31 | 1983-05-24 | Atlantic Richfield Company | Corrosion inhibitor |
| US4328180A (en) * | 1981-11-04 | 1982-05-04 | Atlantic Richfield Company | Cooling water corrosion inhibitor |
| US4446028A (en) * | 1982-12-20 | 1984-05-01 | Betz Laboratories, Inc. | Isopropenyl phosphonic acid copolymers used to inhibit scale formation |
| US4446046A (en) * | 1981-06-17 | 1984-05-01 | Betz Laboratories, Inc. | Poly (alkenyl) phosphonic acid and methods of use thereof |
| US4502978A (en) * | 1982-11-08 | 1985-03-05 | Nalco Chemical Company | Method of improving inhibitor efficiency in hard waters |
| JPS59100272A (ja) * | 1982-11-30 | 1984-06-09 | Kurita Water Ind Ltd | 金属の腐食防止剤 |
| US4936987A (en) * | 1983-03-07 | 1990-06-26 | Calgon Corporation | Synergistic scale and corrosion inhibiting admixtures containing carboxylic acid/sulfonic acid polymers |
| US4487712A (en) * | 1983-05-25 | 1984-12-11 | Basf Wyandotte Corporation | Gelation stabilized water-soluble silicates |
| US4929362A (en) * | 1983-10-26 | 1990-05-29 | Betz Laboratories, Inc. | Calcium phosphate scale control methods |
| US4868263A (en) * | 1983-10-26 | 1989-09-19 | Betz Laboratories, Inc. | Novel amine-containing copolymers and their use |
| US4944885A (en) * | 1983-10-26 | 1990-07-31 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4906383A (en) * | 1983-10-26 | 1990-03-06 | Betz Laboratories, Inc. | Novel amine-containing copolymers and their use |
| US4929695A (en) * | 1983-10-26 | 1990-05-29 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4980433A (en) * | 1983-10-26 | 1990-12-25 | Betz Laboratories, Inc. | Novel amine-containing copolymers and their use |
| US4869845A (en) * | 1983-10-26 | 1989-09-26 | Betz Laboratories, Inc. | Water treatment compositions |
| US4895916A (en) * | 1983-10-26 | 1990-01-23 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4895664A (en) * | 1983-10-26 | 1990-01-23 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4863614A (en) * | 1983-10-26 | 1989-09-05 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4898684A (en) * | 1983-10-26 | 1990-02-06 | Betz Laboratories, Inc. | Novel amine-containing copolymers and their use |
| US4849129A (en) * | 1988-05-06 | 1989-07-18 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4631131A (en) * | 1983-12-08 | 1986-12-23 | R. W. Grace & Co. | Method for inhibiting scale |
| US4600524A (en) * | 1983-12-08 | 1986-07-15 | W. R. Grace & Co. | Composition and method for inhibiting scale |
| US4640793A (en) * | 1984-02-14 | 1987-02-03 | Calgon Corporation | Synergistic scale and corrosion inhibiting admixtures containing carboxylic acid/sulfonic acid polymers |
| US4634532A (en) * | 1984-05-12 | 1987-01-06 | Calgon Corporation | Orthophosphate-containing desalination scale inhibitors |
| US4664884A (en) * | 1985-06-14 | 1987-05-12 | Drew Chemical Corporation | Corrosion inhibitor |
| US4806310A (en) * | 1985-06-14 | 1989-02-21 | Drew Chemical Corporation | Corrosion inhibitor |
| US4904413A (en) * | 1986-03-26 | 1990-02-27 | Nalco Chemical Company | Cooling water corrosion control method and composition |
| US4671934A (en) * | 1986-04-18 | 1987-06-09 | Buckman Laboratories, Inc. | Aminophosphonic acid/phosphate mixtures for controlling corrosion of metal and inhibiting calcium phosphate precipitation |
| US4752443A (en) * | 1986-05-09 | 1988-06-21 | Nalco Chemical Company | Cooling water corrosion inhibition method |
| US4929425A (en) * | 1986-05-09 | 1990-05-29 | Nalco Chemical Company | Cooling water corrosion inhibition method |
| US4895663A (en) * | 1986-05-16 | 1990-01-23 | Betz Laboratories, Inc. | Water treatment polymers and methods of use thereof |
| US4925568A (en) * | 1986-08-15 | 1990-05-15 | Calgon Corporation | Polyacrylate blends as boiler scale inhibitors |
| US5053161A (en) * | 1988-06-10 | 1991-10-01 | The Mogul Corporation | Composition for inhibiting scale in water systems |
| US4978456A (en) * | 1988-06-10 | 1990-12-18 | The Mogul Corporation | Method for inhibiting scale and corrosion in water systems |
| ES2082092T5 (es) * | 1990-10-23 | 1999-08-16 | Nalco Chemical Co | Procedimiento para la pasivacion controlada de las paredes interiores de un sistema de circuito de refrigeracion de acero al carbono. |
| EP1082272B1 (en) * | 1998-05-28 | 2001-11-21 | Owens Corning | Corrosion inhibiting composition for polyacrylic acid based binders |
| US6180056B1 (en) * | 1998-12-10 | 2001-01-30 | Buckman Laboratories International Inc. | Method and compositions for minimizing biological and colloidal fouling |
| US6913711B2 (en) | 2000-12-19 | 2005-07-05 | Avon Products, Inc. | Corrosion inhibitors |
| ES2363601T3 (es) * | 2003-09-22 | 2011-08-10 | Buckman Laboratories International, Inc. | Uso de sales de cerio para inhibir la deposición de manganeso en sistemas acuosos. |
| MXNL04000061A (es) * | 2004-07-21 | 2006-01-26 | Quimiproductos S A De C V | Inhibidor de corrosion para hermetapas de productos envasados y metodo y sistema para la aplicacion del mismo. |
| GB2465211B (en) * | 2008-07-18 | 2013-09-25 | Airedale Chemical Company Ltd | Treatment Solution |
| RU2580685C2 (ru) * | 2014-07-04 | 2016-04-10 | Акционерное общество "Химический завод им. Л.Я. Карпова" | Ингибитор коррозии и солеотложений |
| CN113621952B (zh) * | 2020-05-08 | 2024-02-20 | 广州天至环保科技有限公司 | 一种提升镀层耐腐蚀和表面润湿性的水性保护剂 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3336221A (en) * | 1964-11-05 | 1967-08-15 | Calgon Corp | Method of inhibiting precipitation and scale formation |
| GB1208827A (en) * | 1968-02-23 | 1970-10-14 | Grace W R & Co | Composition and process for inhibiting scaling and/or corrosion in cooling water systems and for stabilizing phosphate solutions |
| US3699048A (en) * | 1969-07-24 | 1972-10-17 | Benckiser Gmbh Joh A | Process of preventing scale and deposit formation in aqueous systems and product |
| US3630938A (en) * | 1969-09-29 | 1971-12-28 | Nalco Chemical Co | Chromate and organophosphate compositions and methods for controlling scale and inhibiting corrosion |
| US3620667A (en) * | 1969-11-18 | 1971-11-16 | William E Zimmie | Method of removing tubercles from a ferrous surface and inhibiting further tubercle formation thereon |
| US3751372A (en) * | 1971-06-18 | 1973-08-07 | Hercules Inc | Scale and corrosion control in circulating water using polyphosphates and organophonic acids |
| US3705005A (en) * | 1971-06-21 | 1972-12-05 | Betz Laboratories | Aminoalkylene phosphonate derivatives as corrosion inhibitors in aqueous systems |
-
1973
- 1973-10-09 US US05/404,256 patent/US3992318A/en not_active Expired - Lifetime
-
1974
- 1974-10-07 GB GB4331774A patent/GB1463173A/en not_active Expired
- 1974-10-08 CA CA211,005A patent/CA1042650A/en not_active Expired
- 1974-10-08 BE BE149321A patent/BE820826A/xx not_active IP Right Cessation
- 1974-10-08 IT IT28191/74A patent/IT1022687B/it active
- 1974-10-08 ES ES430773A patent/ES430773A1/es not_active Expired
- 1974-10-08 BR BR8328/74A patent/BR7408328D0/pt unknown
- 1974-10-08 DE DE2447895A patent/DE2447895C2/de not_active Expired
- 1974-10-08 NL NL7413235A patent/NL7413235A/xx active Search and Examination
- 1974-10-09 JP JP49115692A patent/JPS585264B2/ja not_active Expired
- 1974-10-09 FR FR7434014A patent/FR2246620B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3992318A (en) | 1976-11-16 |
| DE2447895A1 (de) | 1975-04-10 |
| GB1463173A (en) | 1977-02-02 |
| JPS50110949A (cg-RX-API-DMAC7.html) | 1975-09-01 |
| FR2246620A1 (cg-RX-API-DMAC7.html) | 1975-05-02 |
| JPS585264B2 (ja) | 1983-01-29 |
| DE2447895C2 (de) | 1986-12-11 |
| NL7413235A (nl) | 1975-04-11 |
| ES430773A1 (es) | 1976-10-16 |
| IT1022687B (it) | 1978-04-20 |
| BR7408328D0 (pt) | 1975-07-29 |
| BE820826A (fr) | 1975-02-03 |
| FR2246620B1 (cg-RX-API-DMAC7.html) | 1979-08-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1042650A (en) | Corrosion inhibitor | |
| US4105581A (en) | Corrosion inhibitor | |
| CA1252686A (en) | Process and composition for controlling calcium oxalate scale over a wide ph range | |
| CA1131436A (en) | Corrosion inhibition treatments and method | |
| AU635102B2 (en) | Methods of controlling scale formation in aqueous systems | |
| US3837803A (en) | Orthophosphate corrosion inhibitors and their use | |
| US3890228A (en) | Polyacrylate-polyphosphonic acid treatment in aqueous systems | |
| US6207079B1 (en) | Scale and/or corrosion inhibiting composition | |
| EP0093508B1 (en) | Method and composition for inhibiting corrosion and deposition in aqueous systems | |
| US5035806A (en) | Scaling salt threshold inhibition and dispersion with hydrophilic/hydrophobic polymers | |
| CA1219511A (en) | Deposit control method and composition | |
| CA1114978A (en) | Sludge conditioning composition for scale inhibition in water | |
| JPS61125497A (ja) | アクリル酸/2−アクリルアミド−2−メチルプロピルスルホン酸ポリマ−を含有する腐食抑制用組成物 | |
| US3505238A (en) | Methods and compositions for inhibiting scale in saline water evaporators | |
| US5093005A (en) | Method for controlling scale | |
| US4680124A (en) | Polyacrylate scale inhibition | |
| US4671934A (en) | Aminophosphonic acid/phosphate mixtures for controlling corrosion of metal and inhibiting calcium phosphate precipitation | |
| US4416785A (en) | Scale-inhibiting compositions of matter | |
| US5627145A (en) | Composition and method for controlling phosphonates tending to precipitate metal ions in water | |
| CA1174451A (en) | Low level zinc corrosion inhibitors | |
| JPS6295200A (ja) | 水系における金属類の腐食及びスケ−ル防止剤 | |
| CA1339521C (en) | Composition and method for preventing corrosion in aqueous systems | |
| IL33267A (en) | Method and compositions for inhibiting scale in saline water evaporators |