CA1040628A - 4-benzazonine derivatives and process for preparation thereof - Google Patents
4-benzazonine derivatives and process for preparation thereofInfo
- Publication number
- CA1040628A CA1040628A CA199,159A CA199159A CA1040628A CA 1040628 A CA1040628 A CA 1040628A CA 199159 A CA199159 A CA 199159A CA 1040628 A CA1040628 A CA 1040628A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- methano
- formula
- compound
- hexahydro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 153
- BDNJXCPWLLNGMV-UHFFFAOYSA-N 4h-4-benzazonine Chemical class C1=CNC=CC=C2C=CC=CC2=C1 BDNJXCPWLLNGMV-UHFFFAOYSA-N 0.000 title claims abstract description 23
- 238000002360 preparation method Methods 0.000 title claims abstract description 18
- 150000001875 compounds Chemical class 0.000 claims abstract description 145
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 62
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 38
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 27
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 19
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 11
- 150000003839 salts Chemical class 0.000 claims abstract description 10
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 4
- 239000002904 solvent Substances 0.000 claims description 44
- 230000001603 reducing effect Effects 0.000 claims description 42
- 229910052739 hydrogen Inorganic materials 0.000 claims description 39
- 239000001257 hydrogen Substances 0.000 claims description 39
- -1 R2 is H Chemical group 0.000 claims description 30
- 150000002431 hydrogen Chemical group 0.000 claims description 28
- 239000000126 substance Substances 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 26
- 238000009835 boiling Methods 0.000 claims description 25
- 239000003054 catalyst Substances 0.000 claims description 24
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 18
- 229910052987 metal hydride Inorganic materials 0.000 claims description 17
- 150000004681 metal hydrides Chemical class 0.000 claims description 17
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 12
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- JSEJPHRJZMYYFX-UHFFFAOYSA-N 11-methyl-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-trien-8-one Chemical class C1N(C)CCC2C3=CC=CC=C3C(=O)C1C2 JSEJPHRJZMYYFX-UHFFFAOYSA-N 0.000 claims description 8
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 8
- 150000004820 halides Chemical class 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 239000012279 sodium borohydride Substances 0.000 claims description 7
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 7
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- OGZFRXPAKFMBNS-UHFFFAOYSA-N 11-methyl-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-trien-8-ol Chemical class C1N(C)CCC2C3=CC=CC=C3C(O)C1C2 OGZFRXPAKFMBNS-UHFFFAOYSA-N 0.000 claims description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 5
- 235000019253 formic acid Nutrition 0.000 claims description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 5
- 239000011707 mineral Substances 0.000 claims description 5
- ZOWQTJXNFTWSCS-UHFFFAOYSA-N 1,4-dimethyl-2,3,4,5,6,7-hexahydro-1h-1,6-methano-4-benzazonin-10-ol Chemical compound C1N(C)CCC2(C)C3=CC(O)=CC=C3CC1C2 ZOWQTJXNFTWSCS-UHFFFAOYSA-N 0.000 claims description 4
- 230000001035 methylating effect Effects 0.000 claims description 4
- AYWDHBYYXMCUGK-UHFFFAOYSA-N 1,4-dimethyl-2,3,4,5,6,7-hexahydro-1,6-methano-1h-4-benzazonine Chemical compound C1N(C)CCC2(C)C3=CC=CC=C3CC1C2 AYWDHBYYXMCUGK-UHFFFAOYSA-N 0.000 claims description 3
- ZINPOCFXWPGFLY-UHFFFAOYSA-N 11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-trien-8-ol Chemical compound C1C2CCNCC1C(O)C1=CC=CC=C12 ZINPOCFXWPGFLY-UHFFFAOYSA-N 0.000 claims description 3
- PYMCWPNDUHYOLW-UHFFFAOYSA-N 11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene Chemical compound C1NCCC2C3=CC=CC=C3CC1C2 PYMCWPNDUHYOLW-UHFFFAOYSA-N 0.000 claims description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- QLHMMZYJQZLPTK-UHFFFAOYSA-N 1,4-dimethyl-2,3,4,5,6,7-hexahydro-1,6-methano-1h-4-benzazonin-7-ol Chemical compound C1N(C)CCC2(C)C3=CC=CC=C3C(O)C1C2 QLHMMZYJQZLPTK-UHFFFAOYSA-N 0.000 claims description 2
- FEENOKVZMMZQSG-UHFFFAOYSA-N 4-methoxy-1,11-dimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-8-one Chemical compound C1C2(C)CCN(C)CC1C(=O)C1=CC=C(OC)C=C12 FEENOKVZMMZQSG-UHFFFAOYSA-N 0.000 claims description 2
- LMCITFOGXAUPRN-UHFFFAOYSA-N ac1l6vs4 Chemical compound C1C2(C)CCN(C)CC1C(O)C1=CC=C(OC)C=C12 LMCITFOGXAUPRN-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 5
- 150000004678 hydrides Chemical class 0.000 claims 3
- 230000003301 hydrolyzing effect Effects 0.000 claims 3
- LPKJMELWIVJNOA-UHFFFAOYSA-N 11-(cyclopropylmethyl)-1-methyl-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-trien-8-ol Chemical compound C1CC(C)(C2=CC=CC=C2C2O)CC2CN1CC1CC1 LPKJMELWIVJNOA-UHFFFAOYSA-N 0.000 claims 2
- GSNRHDUASANGRU-UHFFFAOYSA-N 4-allyl-2,3,4,5,6,7-hexahydro-1,6-methano-1h-4 -benzazonin-7-ol Chemical compound C1C2CCN(CC=C)CC1C(O)C1=CC=CC=C12 GSNRHDUASANGRU-UHFFFAOYSA-N 0.000 claims 2
- GKHHTAKMPWHDHL-UHFFFAOYSA-N 4-methoxy-1,11-dimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-triene Chemical compound C1C2(C)CCN(C)CC1CC1=CC=C(OC)C=C12 GKHHTAKMPWHDHL-UHFFFAOYSA-N 0.000 claims 2
- HBAQKEZCMHFEPL-UHFFFAOYSA-N 4-methoxy-1-methyl-11-(2-phenylethyl)-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-triene Chemical compound C12=CC(OC)=CC=C2CC(C2)CC1(C)CCN2CCC1=CC=CC=C1 HBAQKEZCMHFEPL-UHFFFAOYSA-N 0.000 claims 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims 2
- WFYIDVLHUQRRSE-UHFFFAOYSA-N 1,11,14-trimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-trien-8-ol Chemical compound C1N(C)CCC2(C)C3=CC=CC=C3C(O)C1C2C WFYIDVLHUQRRSE-UHFFFAOYSA-N 0.000 claims 1
- XMWIRHHXZICAHD-UHFFFAOYSA-N 1-methyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol Chemical compound C1C2CC3=CC=C(O)C=C3C1(C)CCNC2 XMWIRHHXZICAHD-UHFFFAOYSA-N 0.000 claims 1
- AUAMPENPEYMIOO-UHFFFAOYSA-N 4-[2-(methylamino)ethyl]-3,4-dihydro-2h-naphthalen-1-one Chemical class C1=CC=C2C(CCNC)CCC(=O)C2=C1 AUAMPENPEYMIOO-UHFFFAOYSA-N 0.000 claims 1
- RAYLESKNYREMMJ-UHFFFAOYSA-N 4-methyl-4-benzazonine Chemical class CN1C=CC=C2C(=CC=C1)C=CC=C2 RAYLESKNYREMMJ-UHFFFAOYSA-N 0.000 claims 1
- HPNLYVACULLUHJ-UHFFFAOYSA-N ac1miokn Chemical compound C1N(C)CCC2C3=CC(O)=CC=C3CC1C2 HPNLYVACULLUHJ-UHFFFAOYSA-N 0.000 claims 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 claims 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 claims 1
- 239000012458 free base Substances 0.000 claims 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims 1
- MQAYPFVXSPHGJM-UHFFFAOYSA-M trimethyl(phenyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)C1=CC=CC=C1 MQAYPFVXSPHGJM-UHFFFAOYSA-M 0.000 claims 1
- 229920006395 saturated elastomer Polymers 0.000 abstract description 4
- 230000001225 therapeutic effect Effects 0.000 abstract description 4
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 abstract description 3
- 230000000202 analgesic effect Effects 0.000 abstract description 2
- 230000000954 anitussive effect Effects 0.000 abstract description 2
- 229940124584 antitussives Drugs 0.000 abstract description 2
- 210000003169 central nervous system Anatomy 0.000 abstract description 2
- 230000007721 medicinal effect Effects 0.000 abstract description 2
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 abstract 1
- 230000001624 sedative effect Effects 0.000 abstract 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 81
- 238000006243 chemical reaction Methods 0.000 description 74
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 72
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 51
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 44
- 239000000047 product Substances 0.000 description 42
- 239000000203 mixture Substances 0.000 description 40
- 239000000243 solution Substances 0.000 description 30
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 29
- 238000002844 melting Methods 0.000 description 28
- 230000008018 melting Effects 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 21
- 230000002829 reductive effect Effects 0.000 description 20
- 238000006722 reduction reaction Methods 0.000 description 19
- 239000007858 starting material Substances 0.000 description 18
- 230000015572 biosynthetic process Effects 0.000 description 16
- 239000007788 liquid Substances 0.000 description 16
- 238000003786 synthesis reaction Methods 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000000376 reactant Substances 0.000 description 15
- 239000013078 crystal Substances 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 12
- 235000011167 hydrochloric acid Nutrition 0.000 description 12
- 229960000443 hydrochloric acid Drugs 0.000 description 12
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 12
- FVIZARNDLVOMSU-UHFFFAOYSA-N ginsenoside K Natural products C1CC(C2(CCC3C(C)(C)C(O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC1OC(CO)C(O)C(O)C1O FVIZARNDLVOMSU-UHFFFAOYSA-N 0.000 description 11
- 229960004592 isopropanol Drugs 0.000 description 11
- 206010001497 Agitation Diseases 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 229960000583 acetic acid Drugs 0.000 description 10
- 238000013019 agitation Methods 0.000 description 10
- 238000005984 hydrogenation reaction Methods 0.000 description 10
- 229910052763 palladium Inorganic materials 0.000 description 10
- 239000012259 ether extract Substances 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 8
- 238000005292 vacuum distillation Methods 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 229940126062 Compound A Drugs 0.000 description 7
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 7
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 6
- 229910052697 platinum Inorganic materials 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 5
- 241000700198 Cavia Species 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 150000001299 aldehydes Chemical class 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 238000002329 infrared spectrum Methods 0.000 description 5
- 238000007086 side reaction Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- HADKRTWCOYPCPH-UHFFFAOYSA-M trimethylphenylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C1=CC=CC=C1 HADKRTWCOYPCPH-UHFFFAOYSA-M 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000006198 methoxylation reaction Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- VOKSWYLNZZRQPF-GDIGMMSISA-N pentazocine Chemical compound C1C2=CC=C(O)C=C2[C@@]2(C)[C@@H](C)[C@@H]1N(CC=C(C)C)CC2 VOKSWYLNZZRQPF-GDIGMMSISA-N 0.000 description 4
- 229960005301 pentazocine Drugs 0.000 description 4
- 229940075930 picrate Drugs 0.000 description 4
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 239000007810 chemical reaction solvent Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- INAXVFBXDYWQFN-XHSDSOJGSA-N morphinan Chemical group C1C2=CC=CC=C2[C@]23CCCC[C@H]3[C@@H]1NCC2 INAXVFBXDYWQFN-XHSDSOJGSA-N 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- FPTAUFZCOOBHOX-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1,6-methano-1h-4-benzazonin-7(6h)-one Chemical compound C1C2CCNCC1C(=O)C1=CC=CC=C12 FPTAUFZCOOBHOX-UHFFFAOYSA-N 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- DMGLUDJTJZXMMG-UHFFFAOYSA-N 3-benzazocine Chemical class C1=CN=CC=CC2=CC=CC=C21 DMGLUDJTJZXMMG-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000006683 Mannich reaction Methods 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- ZRKWMRDKSOPRRS-UHFFFAOYSA-N N-Methyl-N-nitrosourea Chemical compound O=NN(C)C(N)=O ZRKWMRDKSOPRRS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000002950 deficient Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- XRKQMIFKHDXFNQ-UHFFFAOYSA-N n-cyclohexyl-n-ethylcyclohexanamine Chemical compound C1CCCCC1N(CC)C1CCCCC1 XRKQMIFKHDXFNQ-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 230000007096 poisonous effect Effects 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 2
- 230000036647 reaction Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- DKSZLDSPXIWGFO-BLOJGBSASA-N (4r,4ar,7s,7ar,12bs)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol;phosphoric acid;hydrate Chemical compound O.OP(O)(O)=O.OP(O)(O)=O.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC.C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC DKSZLDSPXIWGFO-BLOJGBSASA-N 0.000 description 1
- WJIDGFVKDOMGDU-UHFFFAOYSA-N 1,11,14-trimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol Chemical compound C1N(C)CCC2(C)C3=CC(O)=CC=C3CC1C2C WJIDGFVKDOMGDU-UHFFFAOYSA-N 0.000 description 1
- STPYWRFYCHMTGY-UHFFFAOYSA-N 1-ethyl-4-methoxy-11,14-dimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-8-one Chemical compound C1CN(C)CC2C(=O)C3=CC=C(OC)C=C3C1(CC)C2C STPYWRFYCHMTGY-UHFFFAOYSA-N 0.000 description 1
- VGPCTTYQRACTLI-UHFFFAOYSA-N 1-ethyl-4-methoxy-11,14-dimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-triene hydrochloride Chemical compound Cl.C1CN(C)CC2CC3=CC=C(OC)C=C3C1(CC)C2C VGPCTTYQRACTLI-UHFFFAOYSA-N 0.000 description 1
- SCXJRQCBJHSCBF-UHFFFAOYSA-N 11-(2-phenylethyl)-1-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-trien-8-ol Chemical compound C12=CC=CC=C2C(O)C(C2)CN1CCC2CCC1=CC=CC=C1 SCXJRQCBJHSCBF-UHFFFAOYSA-N 0.000 description 1
- MYEOHYOHFBZCNX-UHFFFAOYSA-N 11-(2-phenylethyl)-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene Chemical compound C1CC(C2=CC=CC=C2C2)CC2CN1CCC1=CC=CC=C1 MYEOHYOHFBZCNX-UHFFFAOYSA-N 0.000 description 1
- JMSSGVWMZMIERW-UHFFFAOYSA-N 11-butyl-1-methyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol hydrobromide Chemical compound Br.C1N(CCCC)CCC2(C)C3=CC(O)=CC=C3CC1C2 JMSSGVWMZMIERW-UHFFFAOYSA-N 0.000 description 1
- CRBPKAZRYFASJZ-UHFFFAOYSA-N 11-butyl-4-methoxy-1-methyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-triene Chemical compound C1N(CCCC)CCC2(C)C3=CC(OC)=CC=C3CC1C2 CRBPKAZRYFASJZ-UHFFFAOYSA-N 0.000 description 1
- VWMSPULBPYDWCJ-UHFFFAOYSA-N 11-ethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2,4,6-triene hydrochloride Chemical compound Cl.C1N(CC)CCC2C3=CC=CC=C3CC1C2 VWMSPULBPYDWCJ-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- RZPFVRFSYMUDJO-UHFFFAOYSA-N 2h-naphthalen-1-one Chemical compound C1=CC=C2C(=O)CC=CC2=C1 RZPFVRFSYMUDJO-UHFFFAOYSA-N 0.000 description 1
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 1
- OOUGWZQPWDGXMA-UHFFFAOYSA-N 4-phenethyl-2,3,4,5,6,7-hexahydro-1,6-methano-1h-4-benzazonin-7-ol Chemical compound C12=CC=CC=C2C(O)C(C2)CC1CCN2CCC1=CC=CC=C1 OOUGWZQPWDGXMA-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000006214 Clemmensen reduction reaction Methods 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CAUBWLYZCDDYEF-UHFFFAOYSA-N N-Nitroso-N-methylurethane Chemical compound CCOC(=O)N(C)N=O CAUBWLYZCDDYEF-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- HAFOCRMCQBVAMT-UHFFFAOYSA-N ac1micit Chemical compound C1N(C)CCC2C3=CC=CC=C3CC1C2 HAFOCRMCQBVAMT-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003434 antitussive agent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000006364 carbonyl oxy methylene group Chemical group [H]C([H])([*:2])OC([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 229960004415 codeine phosphate Drugs 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 230000017858 demethylation Effects 0.000 description 1
- 238000010520 demethylation reaction Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 210000004209 hair Anatomy 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- GNMJFQWRASXXMS-UHFFFAOYSA-M trimethyl(phenyl)azanium;bromide Chemical compound [Br-].C[N+](C)(C)C1=CC=CC=C1 GNMJFQWRASXXMS-UHFFFAOYSA-M 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D225/00—Heterocyclic compounds containing rings of more than seven members having one nitrogen atom as the only ring hetero atom
- C07D225/04—Heterocyclic compounds containing rings of more than seven members having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D225/06—Heterocyclic compounds containing rings of more than seven members having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems condensed with one six-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5145973A JPS49134691A (enExample) | 1973-05-08 | 1973-05-08 | |
| JP5146173A JPS49134693A (enExample) | 1973-05-08 | 1973-05-08 | |
| JP5146073A JPS49134692A (enExample) | 1973-05-08 | 1973-05-08 | |
| JP5145873A JPS49134690A (enExample) | 1973-05-08 | 1973-05-08 | |
| JP768374A JPS50101372A (enExample) | 1974-01-16 | 1974-01-16 | |
| JP49015281A JPS50106985A (enExample) | 1973-05-08 | 1974-02-05 | |
| JP1528274A JPS5921866B2 (ja) | 1974-02-05 | 1974-02-05 | 4−ベンズアゾニン系化合物の製法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1040628A true CA1040628A (en) | 1978-10-17 |
Family
ID=27563420
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA199,159A Expired CA1040628A (en) | 1973-05-08 | 1974-05-07 | 4-benzazonine derivatives and process for preparation thereof |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4008219A (enExample) |
| JP (1) | JPS50106985A (enExample) |
| BE (1) | BE814733A (enExample) |
| CA (1) | CA1040628A (enExample) |
| CH (2) | CH608793A5 (enExample) |
| DK (1) | DK142578A (enExample) |
| FR (1) | FR2228492B1 (enExample) |
| GB (1) | GB1443311A (enExample) |
| IT (1) | IT1056734B (enExample) |
| NL (1) | NL171806C (enExample) |
| NO (1) | NO142909C (enExample) |
| SE (3) | SE409033B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3630539A1 (de) * | 1986-09-08 | 1988-03-10 | Madaus & Co Dr | Derivate von 2,3,4,5,6,7-hexahydro-2,7-methano-1,5-benzoxazonin (bzw. -1,4-benzoxazonin), verfahren zu ihrer herstellung und arzneimittel, die diese verbindung enthalten |
| US5387590A (en) * | 1989-08-30 | 1995-02-07 | Pfizer Inc. | Benzazabicyclic carbamates as novel cholinesterase inhibitors |
| CN110563605B (zh) * | 2018-06-05 | 2021-10-08 | 上海医药工业研究院 | 制备氢溴酸依他佐辛的中间体及其制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1000506A (en) * | 1960-12-01 | 1965-08-04 | Sterling Drug Inc | 1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocines |
-
1974
- 1974-02-05 JP JP49015281A patent/JPS50106985A/ja active Pending
- 1974-05-03 GB GB1956774A patent/GB1443311A/en not_active Expired
- 1974-05-06 SE SE7406003A patent/SE409033B/xx not_active IP Right Cessation
- 1974-05-06 US US05/467,520 patent/US4008219A/en not_active Expired - Lifetime
- 1974-05-07 CA CA199,159A patent/CA1040628A/en not_active Expired
- 1974-05-07 CH CH746169A patent/CH608793A5/xx not_active IP Right Cessation
- 1974-05-07 NO NO741651A patent/NO142909C/no unknown
- 1974-05-08 NL NLAANVRAGE7406183,A patent/NL171806C/xx not_active IP Right Cessation
- 1974-05-08 FR FR7415840A patent/FR2228492B1/fr not_active Expired
- 1974-05-08 BE BE144075A patent/BE814733A/xx unknown
- 1974-05-08 IT IT22464/74A patent/IT1056734B/it active
-
1977
- 1977-07-14 SE SE7708175A patent/SE442111B/xx not_active IP Right Cessation
-
1978
- 1978-03-30 DK DK142578A patent/DK142578A/da not_active Application Discontinuation
- 1978-04-14 CH CH401278A patent/CH616156A5/fr not_active IP Right Cessation
-
1982
- 1982-02-05 SE SE8200673A patent/SE8200673L/sv unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL171806B (nl) | 1982-12-16 |
| GB1443311A (en) | 1976-07-21 |
| SE8200673L (sv) | 1982-02-05 |
| CH616156A5 (enExample) | 1980-03-14 |
| SE442111B (sv) | 1985-12-02 |
| DE2422309A1 (de) | 1974-11-21 |
| DE2422309B2 (de) | 1976-10-07 |
| CH608793A5 (en) | 1979-01-31 |
| US4008219A (en) | 1977-02-15 |
| NO741651L (no) | 1974-11-11 |
| FR2228492B1 (enExample) | 1978-07-21 |
| DK142578A (da) | 1978-03-30 |
| JPS50106985A (enExample) | 1975-08-22 |
| NO142909B (no) | 1980-08-04 |
| SE7708175L (sv) | 1977-07-14 |
| SE409033B (sv) | 1979-07-23 |
| IT1056734B (it) | 1982-02-20 |
| NO142909C (no) | 1980-11-12 |
| BE814733A (fr) | 1974-09-02 |
| FR2228492A1 (enExample) | 1974-12-06 |
| NL171806C (nl) | 1983-05-16 |
| NL7406183A (enExample) | 1974-11-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5663344A (en) | Method for the synthesis of huperzine A and analogs thereof and compounds useful therein | |
| EP0460062B1 (en) | Huperzine a analogs | |
| CA1081220A (en) | New, in 11-positions substituted 5,11-dihydro-6h-pyrido (2,3-b) - (1,4-) benzodiazepine-6-ones, processes for their production and pharmaceutical compositions containing these compounds | |
| PL163884B1 (pl) | Sposób wytwarzania fluoksetyny PL PL PL | |
| CA1137478A (en) | Vincadifformine synthesis process | |
| KR970005308B1 (ko) | 푸로[3,4-c]피리딘 에난티오머의 입체특이적 제조방법, 이와 같이 제조된 화합물 및 그의 제약 조성물 | |
| CA1040628A (en) | 4-benzazonine derivatives and process for preparation thereof | |
| US3780062A (en) | Indoline derivatives | |
| IE50885B1 (en) | 1-phenyl-2-cyclohexene-1-alkylamine derivatives,a process for their preparation and medicaments containing them | |
| GB1569251A (en) | Pyridobenzodiazepines | |
| US3810899A (en) | 2-hydroxy-n-substituted-morphinan derivatives | |
| CA1040640A (en) | Indazole-3-carboxylic acid hydrazides and a process for the preparation thereof | |
| US4194044A (en) | Process for preparing 3-phenoxy morphinans | |
| GB1594687A (en) | 2-aminotetralin derivatives and processes for producing the same | |
| US3914232A (en) | 2-And 4-acryloxy-N-substituted-morphinan derivatives | |
| US3932384A (en) | Dibenzazecines | |
| EP0246077B1 (en) | Heteropolycyclic aromatic compounds | |
| US4082744A (en) | 4-benzazonine derivatives and process for preparation thereof | |
| US3029247A (en) | Certain tetrahydro-beta-carbolines | |
| Ziering et al. | 3'-Methyl, 8-methyl, and 8-phenyl derivatives of 5, 9-dimethyl-6, 7-benzomorphans | |
| CA1131236A (en) | 2,9-dioxatricyclo[4,3,1,0 su3,7 xx]decane derivatives, processes for their preparation and pharmaceutical compositions thereof | |
| KR800000538B1 (ko) | 아미노-페닐-에탄올아민의 제조방법 | |
| EP0331320B1 (en) | New alkaloid compounds, pharmaceutical compositions and their methods of use | |
| EP0009227B1 (en) | Fluorination process and fluoro analogs of hydrocodone and oxycodone | |
| DAUZONNE et al. | A Versatile Synthesis of 1-Aryl-2-nitro-3-(3, 4-, 5-trimethoxyphenyl)-propenes as Precursors of Novel Mescaline Derivatives |