CA1038387A - Process for the production of carboxamides of oxo-1,2-benzothiazine 1, -1-dioxides - Google Patents
Process for the production of carboxamides of oxo-1,2-benzothiazine 1, -1-dioxidesInfo
- Publication number
- CA1038387A CA1038387A CA234,551A CA234551A CA1038387A CA 1038387 A CA1038387 A CA 1038387A CA 234551 A CA234551 A CA 234551A CA 1038387 A CA1038387 A CA 1038387A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- pyridyl
- oxo
- dihydro
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 27
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 5
- 150000003857 carboxamides Chemical class 0.000 title abstract description 10
- MJNPHLBKHKJDEF-UHFFFAOYSA-N 2h-1$l^{4},2-benzothiazine 1-oxide Chemical compound C1=CC=C2S(=O)NC=CC2=C1 MJNPHLBKHKJDEF-UHFFFAOYSA-N 0.000 title 1
- 150000001412 amines Chemical class 0.000 claims abstract description 8
- -1 3-methyl-2-pyridyl Chemical group 0.000 claims description 157
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 11
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000001246 bromo group Chemical group Br* 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 4
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 3
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- VSCYCJOVRGSJBT-UHFFFAOYSA-N 3,4-dihydro-2h-1$l^{6},2-benzothiazine 1,1-dioxide Chemical compound C1=CC=C2S(=O)(=O)NCCC2=C1 VSCYCJOVRGSJBT-UHFFFAOYSA-N 0.000 claims 1
- 239000012948 isocyanate Substances 0.000 abstract description 12
- 150000002513 isocyanates Chemical class 0.000 abstract description 10
- JBWSEIGJTHGZRV-UHFFFAOYSA-N 1,1-dioxo-4h-1$l^{6},2-benzothiazin-3-one Chemical class C1=CC=C2S(=O)(=O)NC(=O)CC2=C1 JBWSEIGJTHGZRV-UHFFFAOYSA-N 0.000 abstract description 2
- 238000007056 transamidation reaction Methods 0.000 abstract description 2
- LMSSPPBEVQDCCH-UHFFFAOYSA-N 1,1-dioxo-1$l^{6},2-benzothiazin-4-one Chemical compound C1=CC=C2C(=O)C=NS(=O)(=O)C2=C1 LMSSPPBEVQDCCH-UHFFFAOYSA-N 0.000 abstract 1
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 abstract 1
- 229960002069 diamorphine Drugs 0.000 abstract 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate Chemical compound [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 abstract 1
- 239000000041 non-steroidal anti-inflammatory agent Substances 0.000 abstract 1
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 9
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 239000008096 xylene Substances 0.000 description 8
- 125000000623 heterocyclic group Chemical group 0.000 description 7
- 125000005394 methallyl group Chemical group 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 229960000443 hydrochloric acid Drugs 0.000 description 5
- 235000011167 hydrochloric acid Nutrition 0.000 description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- 229940086542 triethylamine Drugs 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 238000005915 ammonolysis reaction Methods 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000000967 suction filtration Methods 0.000 description 3
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 2
- VXGHWBHTDJQBCP-UHFFFAOYSA-N 2-[2-(methylsulfamoyl)phenyl]acetic acid Chemical compound CNS(=O)(=O)C1=CC=CC=C1CC(O)=O VXGHWBHTDJQBCP-UHFFFAOYSA-N 0.000 description 2
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- AEDRXMZXUHVXEQ-UHFFFAOYSA-N 2-methyl-3h-1,2-benzothiazin-4-one Chemical compound C1=CC=C2SN(C)CC(=O)C2=C1 AEDRXMZXUHVXEQ-UHFFFAOYSA-N 0.000 description 2
- HXGXFIGGOKIYAQ-UHFFFAOYSA-N 2-methyl-4h-1,2-benzothiazin-3-one Chemical compound C1=CC=C2CC(=O)N(C)SC2=C1 HXGXFIGGOKIYAQ-UHFFFAOYSA-N 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BAJXNEYFJDMIFP-UHFFFAOYSA-N n,2-dimethylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1C BAJXNEYFJDMIFP-UHFFFAOYSA-N 0.000 description 2
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000036647 reaction Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- PEQMJVGRHNZPAM-UHFFFAOYSA-N 1,4-dichloro-2-isocyanatobenzene Chemical compound ClC1=CC=C(Cl)C(N=C=O)=C1 PEQMJVGRHNZPAM-UHFFFAOYSA-N 0.000 description 1
- NOHQUGRVHSJYMR-UHFFFAOYSA-N 1-chloro-2-isocyanatobenzene Chemical compound ClC1=CC=CC=C1N=C=O NOHQUGRVHSJYMR-UHFFFAOYSA-N 0.000 description 1
- WOHLSTOWRAOMSG-UHFFFAOYSA-N 2,3-dihydro-1,3-benzothiazole Chemical compound C1=CC=C2SCNC2=C1 WOHLSTOWRAOMSG-UHFFFAOYSA-N 0.000 description 1
- JNNXIBWXEGAIMV-UHFFFAOYSA-N 2-(3-oxo-1,2-benzothiazol-2-yl)acetic acid Chemical compound C1=CC=C2C(=O)N(CC(=O)O)SC2=C1 JNNXIBWXEGAIMV-UHFFFAOYSA-N 0.000 description 1
- CRNPZHDSGDQQQO-UHFFFAOYSA-N 2-methyl-1,1,4-trioxo-n-(1,3-thiazol-2-yl)-3h-1$l^{6},2-benzothiazine-3-carboxamide Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)N(C)C1C(=O)NC1=NC=CS1 CRNPZHDSGDQQQO-UHFFFAOYSA-N 0.000 description 1
- CPIFFCMMBZLKDK-UHFFFAOYSA-N 2-methyl-1,1-dioxo-3h-1$l^{6},2-benzothiazin-4-one Chemical compound C1=CC=C2S(=O)(=O)N(C)CC(=O)C2=C1 CPIFFCMMBZLKDK-UHFFFAOYSA-N 0.000 description 1
- YBDDTEQVZRHOAY-UHFFFAOYSA-N 2-methyl-3-oxo-4H-1,2-benzothiazine-4-carboxamide Chemical compound CN1SC2=C(C(C1=O)C(=O)N)C=CC=C2 YBDDTEQVZRHOAY-UHFFFAOYSA-N 0.000 description 1
- FHTMLUOTLXCYSX-UHFFFAOYSA-N 2-methyl-4-oxo-3h-1,2-benzothiazine-3-carboxamide Chemical compound C1=CC=C2C(=O)C(C(N)=O)N(C)SC2=C1 FHTMLUOTLXCYSX-UHFFFAOYSA-N 0.000 description 1
- ACWBOUGSHCTSJT-UHFFFAOYSA-N 2-methyl-4-oxo-n-phenyl-3h-1,2-benzothiazine-3-carboxamide Chemical compound CN1SC2=CC=CC=C2C(=O)C1C(=O)NC1=CC=CC=C1 ACWBOUGSHCTSJT-UHFFFAOYSA-N 0.000 description 1
- YCMLQMDWSXFTIF-UHFFFAOYSA-N 2-methylbenzenesulfonimidic acid Chemical compound CC1=CC=CC=C1S(N)(=O)=O YCMLQMDWSXFTIF-UHFFFAOYSA-N 0.000 description 1
- GHNLJDPNIAIWOQ-UHFFFAOYSA-N 2h-1$l^{6},2-benzothiazine 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)NC=CC2=C1 GHNLJDPNIAIWOQ-UHFFFAOYSA-N 0.000 description 1
- UJVBZCCNLAAMOV-UHFFFAOYSA-N 2h-1,2-benzothiazine Chemical compound C1=CC=C2C=CNSC2=C1 UJVBZCCNLAAMOV-UHFFFAOYSA-N 0.000 description 1
- FKOSZDBJQBJDIV-UHFFFAOYSA-N 2h-1,2-benzothiazine-3-carboxamide Chemical compound C1=CC=C2SNC(C(=O)N)=CC2=C1 FKOSZDBJQBJDIV-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYFWWEAIJOCMTQ-UHFFFAOYSA-N N-(2-chlorophenyl)-2-methyl-1,1,4-trioxo-3H-1lambda6,2-benzothiazine-3-carboxamide Chemical compound ClC1=C(NC(=O)C2N(S(C3=C(C2=O)C=CC=C3)(=O)=O)C)C=CC=C1 FYFWWEAIJOCMTQ-UHFFFAOYSA-N 0.000 description 1
- VGABMYXNGQJPAE-UHFFFAOYSA-N N-(2-chlorophenyl)-2-methyl-3-oxo-4H-1,2-benzothiazine-4-carboxamide Chemical compound ClC1=C(NC(=O)C2C(N(SC3=C2C=CC=C3)C)=O)C=CC=C1 VGABMYXNGQJPAE-UHFFFAOYSA-N 0.000 description 1
- IKGLLORIAZRFMY-UHFFFAOYSA-N N-(3-chlorophenyl)-2-methyl-4-oxo-3H-1,2-benzothiazine-3-carboxamide Chemical compound ClC=1C=C(NC(=O)C2N(SC3=C(C2=O)C=CC=C3)C)C=CC1 IKGLLORIAZRFMY-UHFFFAOYSA-N 0.000 description 1
- GRNAQPGAFPBZEY-UHFFFAOYSA-N N-(4-bromophenyl)-3-oxo-4H-1,2-benzothiazine-4-carboxamide Chemical compound BrC1=CC=C(NC(=O)C2C(NSC3=C2C=CC=C3)=O)C=C1 GRNAQPGAFPBZEY-UHFFFAOYSA-N 0.000 description 1
- VKRYQJKURLGPGJ-UHFFFAOYSA-N N-(4-fluorophenyl)-2-methyl-1,1,4-trioxo-3H-1lambda6,2-benzothiazine-3-carboxamide Chemical compound FC1=CC=C(NC(=O)C2N(S(C3=C(C2=O)C=CC=C3)(=O)=O)C)C=C1 VKRYQJKURLGPGJ-UHFFFAOYSA-N 0.000 description 1
- BXDZOYLPNAIDOC-UHFFFAOYSA-N N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]piperidine-4-carboxamide Chemical class CC(C)(C)c1cnc(CSc2cnc(NC(=O)C3CCN(CC(=O)NCCOCCOCCOCCNc4cccc5C(=O)N(C6CCC(=O)NC6=O)C(=O)c45)CC3)s2)o1 BXDZOYLPNAIDOC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- GEVUHWKYEWTTMW-UHFFFAOYSA-N n,n-dimethylacetamide;methanol Chemical compound OC.CN(C)C(C)=O GEVUHWKYEWTTMW-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- HAOKKJHTFUZWIM-UHFFFAOYSA-N pyridin-1-ium-2-amine;chloride Chemical compound Cl.NC1=CC=CC=N1 HAOKKJHTFUZWIM-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical class C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010583 slow cooling Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/02—1,2-Oxazines; Hydrogenated 1,2-oxazines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D279/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D279/02—1,2-Thiazines; Hydrogenated 1,2-thiazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US510892A US3891637A (en) | 1974-10-01 | 1974-10-01 | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1038387A true CA1038387A (en) | 1978-09-12 |
Family
ID=24032618
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA234,551A Expired CA1038387A (en) | 1974-10-01 | 1975-09-02 | Process for the production of carboxamides of oxo-1,2-benzothiazine 1, -1-dioxides |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US3891637A (enExample) |
| JP (1) | JPS5159877A (enExample) |
| AR (1) | AR212584A1 (enExample) |
| AT (1) | AT346356B (enExample) |
| BE (1) | BE833655A (enExample) |
| BG (1) | BG35596A3 (enExample) |
| CA (1) | CA1038387A (enExample) |
| CH (1) | CH605933A5 (enExample) |
| CS (1) | CS183818B2 (enExample) |
| DD (1) | DD121642A5 (enExample) |
| DE (1) | DE2541346A1 (enExample) |
| DK (1) | DK150511C (enExample) |
| ES (1) | ES441260A1 (enExample) |
| FI (1) | FI59592C (enExample) |
| FR (1) | FR2299335A1 (enExample) |
| GB (1) | GB1476608A (enExample) |
| HU (1) | HU170883B (enExample) |
| IE (1) | IE41689B1 (enExample) |
| IN (1) | IN141820B (enExample) |
| LU (1) | LU73467A1 (enExample) |
| NL (1) | NL7511179A (enExample) |
| NO (1) | NO143627C (enExample) |
| PL (1) | PL107232B1 (enExample) |
| RO (1) | RO67632A (enExample) |
| SE (1) | SE420726B (enExample) |
| SU (1) | SU676164A3 (enExample) |
| YU (1) | YU40125B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4474955A (en) * | 1981-06-17 | 1984-10-02 | Vincenzo Iannella | Process for preparing 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-[N-(2-pyridinyl)carboxamide]-1,1-dioxide, and its phosphoric ester |
| GT198276334A (es) * | 1981-08-03 | 1984-01-10 | Procedimiento e inter-medios para la produccion de carboxamidas de benzotiazina. | |
| IN159273B (enExample) * | 1981-10-05 | 1987-04-25 | Pfizer | |
| SU1306476A3 (ru) * | 1982-06-17 | 1987-04-23 | Пфайзер,Инк (Фирма) | Способ получени 2-метил-3- @ -(2-пиридил)-карбамоил-3,4-дигидро-2 @ -1,2-бензтиазин-1,1-диоксида |
| DE3374865D1 (en) * | 1982-07-07 | 1988-01-21 | Siegfried Ag | Process for preparing 4-hydroxy-2-methyl-n-2-pyridyl-2h-1,2-benzothiazine-3-carboxamide 1,1-dioxide |
| US4483982A (en) * | 1982-09-02 | 1984-11-20 | Pfizer Inc. | Processes for preparing piroxicam and intermediates leading thereto |
| DE3237473A1 (de) * | 1982-10-09 | 1984-04-12 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue 4-hydroxy-2h-1,2-benzothiazin-3-carboxamid-1,1-dioxide, verfahren zu ihrer herstellung, ihre verwendung und diese verbindungen enthaltende arzneimittel |
| US4761424A (en) * | 1985-10-01 | 1988-08-02 | Warner-Lambert Company | Enolamides, pharmaceutical compositions and methods for treating inflammation |
| WO2005110422A2 (en) * | 2004-05-19 | 2005-11-24 | Boehringer Ingelheim International Gmbh | Treatment of diseases associated with altered level of amyloid beta peptides |
| CN103232410B (zh) * | 2013-04-26 | 2014-12-10 | 苏州大学 | 一种制备2-氨基苯并噻嗪的方法 |
| RU2535997C1 (ru) * | 2013-12-18 | 2014-12-20 | Открытое Акционерное Общество "Международная Научно-Технологическая Корпорация" | 4-ГИДРОКСИ-N-(2-КАРБОКСИФЕНИЛ)1-МЕТИЛ-2,2-ДИОКСО-1H-2λ6,1-БЕНЗОТИАЗИН-3-КАРБОКСАМИД, ПРОЯВЛЯЮЩИЙ ДИУРЕТИЧЕСКУЮ АКТИВНОСТЬ |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3591584A (en) * | 1968-08-27 | 1971-07-06 | Pfizer | Benzothiazine dioxides |
| US3646020A (en) * | 1970-07-16 | 1972-02-29 | Warner Lambert Pharmaceutical | 4-acyloxy-3-phenylcarbamyl-2h-1 2-benzothiazine 1 1-dioxides |
| US3853862A (en) * | 1973-04-23 | 1974-12-10 | Pfizer | Production of 4-hydroxy-1,2-benzothiazine-3-carboxamides |
-
1974
- 1974-10-01 US US510892A patent/US3891637A/en not_active Expired - Lifetime
-
1975
- 1975-08-25 SE SE7509448A patent/SE420726B/xx not_active IP Right Cessation
- 1975-09-01 IN IN1684/CAL/75A patent/IN141820B/en unknown
- 1975-09-02 CA CA234,551A patent/CA1038387A/en not_active Expired
- 1975-09-11 IE IE1982/75A patent/IE41689B1/en unknown
- 1975-09-17 YU YU2341/75A patent/YU40125B/xx unknown
- 1975-09-17 DE DE19752541346 patent/DE2541346A1/de active Pending
- 1975-09-19 FI FI752623A patent/FI59592C/fi not_active IP Right Cessation
- 1975-09-19 BE BE1006897A patent/BE833655A/xx not_active IP Right Cessation
- 1975-09-22 FR FR7528986A patent/FR2299335A1/fr active Granted
- 1975-09-22 CS CS7500006385A patent/CS183818B2/cs unknown
- 1975-09-23 GB GB3903475A patent/GB1476608A/en not_active Expired
- 1975-09-23 NO NO753241A patent/NO143627C/no unknown
- 1975-09-23 NL NL7511179A patent/NL7511179A/xx unknown
- 1975-09-24 AT AT731275A patent/AT346356B/de not_active IP Right Cessation
- 1975-09-24 RO RO7583450A patent/RO67632A/ro unknown
- 1975-09-25 DK DK430075A patent/DK150511C/da not_active IP Right Cessation
- 1975-09-25 CH CH1245375A patent/CH605933A5/xx not_active IP Right Cessation
- 1975-09-25 SU SU752175364A patent/SU676164A3/ru active
- 1975-09-25 DD DD188567A patent/DD121642A5/xx unknown
- 1975-09-25 HU HU75PI00000490A patent/HU170883B/hu not_active IP Right Cessation
- 1975-09-25 ES ES441260A patent/ES441260A1/es not_active Expired
- 1975-09-26 LU LU73467A patent/LU73467A1/xx unknown
- 1975-09-26 AR AR260559A patent/AR212584A1/es active
- 1975-09-26 JP JP50116289A patent/JPS5159877A/ja active Granted
- 1975-09-26 BG BG031085A patent/BG35596A3/xx unknown
- 1975-09-26 PL PL1975183616A patent/PL107232B1/pl unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1038387A (en) | Process for the production of carboxamides of oxo-1,2-benzothiazine 1, -1-dioxides | |
| CA2122360C (en) | Quinazolinone antianginal agents | |
| USRE29668E (en) | Glycineamides | |
| US4116964A (en) | 2-[(N-2-pyridylcarbamoyl)methyl]saccharin | |
| DK145297B (da) | Analogifremgangsmaade til fremstilling af 2h-1,2-benzothiazin-1,1-dioxid-derivater eller tautomere eller basesalte deraf | |
| CA2076192A1 (en) | Thiazolylbenzofuran derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| CA1052376A (en) | Process for preparing carboxamides of oxo-1,2-benzothiazine-1,1-dioxides | |
| US4183856A (en) | Process for the production of urea derivatives | |
| US4289879A (en) | Synthetic method and intermediate for piroxicam | |
| US4104388A (en) | 3-Substituted benzisothiazole, 1,1-dioxides | |
| Clémence et al. | New route to N‐aryl and N‐heteroaryl derivatives of 4‐hydroxy‐3‐quinolinecarboxamides | |
| JPS6021190B2 (ja) | クマリン染料の製法 | |
| US4478996A (en) | Process for the preparation of 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxamide-1,1-dioxides | |
| US4104387A (en) | 3-(Arylcycloiminoalkyl)benzisothiazole 1,1-dioxides | |
| CA1048025A (en) | 4-hydroxy-2h-naphtho (2,1-e)-1,2-thiazine-3-carboxamide-1,1-dioxides, processes for their preparation and pharmaceuticals containing them | |
| KR790000859B1 (ko) | 3,4-디하이드로-2h-1,2-벤조티아진 1,1-디옥사이드의 제조방법 | |
| KR860001510B1 (ko) | 티아졸의 제조 방법 | |
| US3264316A (en) | Certain 2-acylimino-3-substitutedthiazoline-4 compounds | |
| US4376204A (en) | 3-Hydroxy 2-methyl benzisothiazolines as intermediates in production of piroxicam | |
| SU623520A3 (ru) | Способ получени производных тиенотиазина | |
| CA2007651C (en) | Anti-inflammatory 1-heteroaryloxindole-3-carboxamides | |
| US4536573A (en) | Process and intermediates for production of benzothiazine carboxamides | |
| US4683306A (en) | Process for the preparation of 3,4-dihydro-2-substituted-2H-1,2-thiazine-carboxylic acid 1,1-dioxide derivatives | |
| US4687857A (en) | Alkyl β-oxo-benzenepropanoates | |
| EP0076643B1 (en) | Processes for preparing piroxicam and intermediates leading thereto |