CA1037015A - Process for improving the wettability of natural or synthetic zeolites - Google Patents
Process for improving the wettability of natural or synthetic zeolitesInfo
- Publication number
- CA1037015A CA1037015A CA212,804A CA212804A CA1037015A CA 1037015 A CA1037015 A CA 1037015A CA 212804 A CA212804 A CA 212804A CA 1037015 A CA1037015 A CA 1037015A
- Authority
- CA
- Canada
- Prior art keywords
- zeolite
- mole percent
- acids
- poly
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 title claims abstract description 81
- 238000000034 method Methods 0.000 title claims abstract description 45
- 230000008569 process Effects 0.000 title claims abstract description 41
- 239000010457 zeolite Substances 0.000 claims abstract description 99
- 229910021536 Zeolite Inorganic materials 0.000 claims abstract description 75
- 150000007942 carboxylates Chemical group 0.000 claims abstract description 33
- 239000002253 acid Substances 0.000 claims abstract description 27
- 238000006116 polymerization reaction Methods 0.000 claims abstract description 21
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 20
- 150000001875 compounds Chemical class 0.000 claims abstract description 19
- 239000007864 aqueous solution Substances 0.000 claims abstract description 18
- 229920000867 polyelectrolyte Polymers 0.000 claims abstract description 17
- 239000008346 aqueous phase Substances 0.000 claims abstract description 8
- 238000002156 mixing Methods 0.000 claims abstract description 4
- 229920000642 polymer Polymers 0.000 claims description 27
- -1 ethylene, propylene, vinyl methyl Chemical group 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 239000000843 powder Substances 0.000 claims description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 150000007513 acids Chemical class 0.000 claims description 14
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 9
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 8
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 239000002245 particle Substances 0.000 claims description 7
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 229910052727 yttrium Inorganic materials 0.000 claims description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 4
- 229910052770 Uranium Inorganic materials 0.000 claims description 4
- 229920001577 copolymer Polymers 0.000 claims description 4
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid group Chemical group C(\C=C/C(=O)O)(=O)O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical group OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229920002845 Poly(methacrylic acid) Polymers 0.000 claims description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 2
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 claims description 2
- 239000011976 maleic acid Substances 0.000 claims description 2
- 229920001444 polymaleic acid Polymers 0.000 claims description 2
- 239000007921 spray Substances 0.000 claims description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 229920002125 Sokalan® Polymers 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 229920005646 polycarboxylate Polymers 0.000 abstract description 10
- 239000000243 solution Substances 0.000 description 37
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 32
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 229910052681 coesite Inorganic materials 0.000 description 17
- 229910052906 cristobalite Inorganic materials 0.000 description 17
- 229910052682 stishovite Inorganic materials 0.000 description 17
- 238000011282 treatment Methods 0.000 description 17
- 229910052905 tridymite Inorganic materials 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 16
- 238000012360 testing method Methods 0.000 description 15
- 238000005406 washing Methods 0.000 description 15
- 235000013350 formula milk Nutrition 0.000 description 13
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- 230000001590 oxidative effect Effects 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 239000000377 silicon dioxide Substances 0.000 description 11
- 235000012239 silicon dioxide Nutrition 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- 150000001735 carboxylic acids Chemical class 0.000 description 9
- 238000007334 copolymerization reaction Methods 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- 239000012459 cleaning agent Substances 0.000 description 8
- 238000006386 neutralization reaction Methods 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 229910019142 PO4 Inorganic materials 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 239000000178 monomer Substances 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 235000019832 sodium triphosphate Nutrition 0.000 description 5
- 238000002336 sorption--desorption measurement Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 229940115440 aluminum sodium silicate Drugs 0.000 description 4
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 229910001388 sodium aluminate Inorganic materials 0.000 description 4
- 239000000429 sodium aluminium silicate Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 238000005705 Cannizzaro reaction Methods 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 3
- 238000003760 magnetic stirring Methods 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000001226 triphosphate Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229940063559 methacrylic acid Drugs 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 238000012673 precipitation polymerization Methods 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229960001866 silicon dioxide Drugs 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- HMENQNSSJFLQOP-UHFFFAOYSA-N 2-bromoprop-2-enoic acid Chemical compound OC(=O)C(Br)=C HMENQNSSJFLQOP-UHFFFAOYSA-N 0.000 description 1
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical compound CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 1
- AQTFKGDWFRRIHR-UHFFFAOYSA-L 3-[18-(2-carboxylatoethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoate;cobalt(2+);hydron Chemical compound [Co+2].[N-]1C(C=C2C(=C(C)C(C=C3C(=C(C)C(=C4)[N-]3)C=C)=N2)C=C)=C(C)C(CCC(O)=O)=C1C=C1C(CCC(O)=O)=C(C)C4=N1 AQTFKGDWFRRIHR-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 150000008063 acylals Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- YCNZFPXXIWEFCF-UHFFFAOYSA-N alumane;sodium Chemical compound [Na].[AlH3] YCNZFPXXIWEFCF-UHFFFAOYSA-N 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- JYIMWRSJCRRYNK-UHFFFAOYSA-N dialuminum;disodium;oxygen(2-);silicon(4+);hydrate Chemical compound O.[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Na+].[Na+].[Al+3].[Al+3].[Si+4] JYIMWRSJCRRYNK-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical class CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 125000005670 ethenylalkyl group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 125000001976 hemiacetal group Chemical group 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000019830 sodium polyphosphate Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/128—Aluminium silicates, e.g. zeolites
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B39/00—Compounds having molecular sieve and base-exchange properties, e.g. crystalline zeolites; Their preparation; After-treatment, e.g. ion-exchange or dealumination
- C01B39/02—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof; Direct preparation thereof; Preparation thereof starting from a reaction mixture containing a crystalline zeolite of another type, or from preformed reactants; After-treatment thereof
- C01B39/026—After-treatment
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/37—Polymers
- C11D3/3746—Macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- C11D3/3757—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions
- C11D3/3761—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions in solid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Wood Science & Technology (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Inorganic Chemistry (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Materials Engineering (AREA)
- Detergent Compositions (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2354432A DE2354432C3 (de) | 1973-10-31 | 1973-10-31 | Verfahren zur Verbesserung der Benetzbarkeit von natürlichen oder synthetischen Zeolithen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1037015A true CA1037015A (en) | 1978-08-22 |
Family
ID=5896873
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA212,804A Expired CA1037015A (en) | 1973-10-31 | 1974-10-31 | Process for improving the wettability of natural or synthetic zeolites |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3962132A (enExample) |
| JP (1) | JPS5545487B2 (enExample) |
| AT (1) | AT339259B (enExample) |
| BE (1) | BE821708A (enExample) |
| CA (1) | CA1037015A (enExample) |
| DE (1) | DE2354432C3 (enExample) |
| FR (1) | FR2249835B1 (enExample) |
| GB (1) | GB1436077A (enExample) |
| IT (1) | IT1021985B (enExample) |
| NL (1) | NL177304C (enExample) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4148603A (en) * | 1974-10-04 | 1979-04-10 | Henkel Kommanditgesellschaft Auf Aktien | Method of washing textiles and composition containing inorganic silicates and polycarboxylates and/or polyphosphonates |
| AT335035B (de) * | 1974-10-10 | 1977-02-25 | Henkel & Cie Gmbh | Stabile suspensionen wasserunloslicher, zum binden von calciumionen befahigter silikate und deren verwendung zur herstellung von wasch- und reinigungsmitteln |
| US4040972A (en) * | 1975-03-12 | 1977-08-09 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler | Ion-exchanging aluminum silicate with hydrophilic surfaces |
| DE2510675C3 (de) * | 1975-03-12 | 1983-12-15 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung eines kristallinen, ionenaustauschenden Alkalialuminiumsilikates mit hydrophiler Oberfläche und dessen Verwendung |
| US4088593A (en) * | 1975-03-12 | 1978-05-09 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Ion-exchanging aluminum silicate with hydrophilic surfaces |
| DE2510741C3 (de) * | 1975-03-12 | 1985-05-30 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung eines kristallinen, ionenaustauschenden Alkalialuminiumsilikates mit hydrophiler Oberfläche und dessen Verwendung |
| ZA774818B (en) * | 1976-08-17 | 1979-03-28 | Colgate Palmolive Co | Disintegrable detergent builder agglomerates |
| DE2653479A1 (de) * | 1976-11-25 | 1978-06-01 | Henkel Kgaa | Verfahren und vorrichtung zum maschinellen waschen und reinigen von festen werkstoffen unter verwendung phosphatarmer oder phosphatfreier wasch- und reinigungsmittel |
| DE2728812A1 (de) * | 1977-06-27 | 1979-01-18 | Henkel Kgaa | Verwendung feinteiliger wasserunloeslicher alkalialuminiumsilikate zum waschen und reinigen von rohhaeuten und pelzfellen |
| US4157978A (en) * | 1978-03-13 | 1979-06-12 | The Procter & Gamble Company | Modified silicates |
| DE2824443A1 (de) * | 1978-06-03 | 1979-12-13 | Basf Ag | Lagerstabile und fliessfaehige silikatsuspensionen |
| US4216125A (en) * | 1978-12-07 | 1980-08-05 | Pq Corporation | Detergent compositions with silane-zeolite silicate builder |
| DE2854484A1 (de) * | 1978-12-16 | 1980-06-26 | Bayer Ag | Stabile waessrige zeolith-suspensionen |
| US4248728A (en) * | 1979-02-28 | 1981-02-03 | Chemed Corporation | Liquid scouring cleanser |
| US4298501A (en) * | 1979-06-15 | 1981-11-03 | Uop Inc. | Technique to reduce the zeolite molecular sieve solubility in an aqueous system |
| US4243545A (en) * | 1979-12-10 | 1981-01-06 | Pq Corporation | Detergent compositions with silane-zeolite silicate builder |
| JPS5742099A (en) * | 1980-08-27 | 1982-03-09 | Sharp Kk | Voice informing device |
| DE3045221A1 (de) * | 1980-12-01 | 1982-06-03 | Joh. A. Benckiser Gmbh, 6700 Ludwigshafen | Abriebfestes granulat auf basis alkalialuminiumsilikat mit gutem dispergiervermoegen in waessriger follte |
| JPS57181534U (enExample) * | 1981-05-13 | 1982-11-17 | ||
| US4622166A (en) * | 1982-03-17 | 1986-11-11 | Mizusawa Kagaku Kogyo Kabushiki Kaisha | Process for preparation of zeolite slurry excellent in static stability and dynamic stability |
| DE3316513A1 (de) * | 1983-05-06 | 1984-11-08 | Joh. A. Benckiser Gmbh, 6700 Ludwigshafen | Abriebfeste granulate auf basis von alkalialuminiumsilikat |
| US4490271A (en) * | 1983-06-30 | 1984-12-25 | The Procter & Gamble Company | Detergent compositions containing polyethylene glycol and polyacrylate |
| AT384234B (de) * | 1985-05-08 | 1987-10-12 | Saveco Techn Ass Ltd | Verfahren zur behandlung von zeolithen und deren verwendung |
| DE3707806A1 (de) * | 1987-03-11 | 1988-09-22 | Dispo Kommerz Ag Huenenberg | Phosphatfreie zusaetze fuer waschmittel bzw. zum waschprozess |
| DE3715051A1 (de) * | 1987-05-06 | 1988-11-17 | Degussa | Phosphatfreier waschmittelbuilder |
| US5024782A (en) * | 1989-06-16 | 1991-06-18 | The Clorox Company | Zeolite agglomeration process and product |
| US5205958A (en) * | 1989-06-16 | 1993-04-27 | The Clorox Company | Zeolite agglomeration process and product |
| US5292697A (en) * | 1992-11-23 | 1994-03-08 | Amoco Corporation | Nondestructive trivalent cation exchange of molecular sieves |
| DE4303320C2 (de) * | 1993-02-05 | 1995-12-21 | Degussa | Waschmittelzusammensetzung mit verbessertem Schmutztragevermögen, Verfahren zu dessen Herstellung und Verwendung eines geeigneten Polycarboxylats hierfür |
| US5605883A (en) * | 1993-02-24 | 1997-02-25 | Iliff; Robert J. | Agglomerated colorant speckle exhibiting reduced colorant spotting |
| JP2958506B2 (ja) * | 1994-06-15 | 1999-10-06 | 花王株式会社 | 微粒子固体ビルダーの製造方法 |
| US6662951B1 (en) * | 2000-09-27 | 2003-12-16 | Basic Resources, Inc. | Process for extracting and purifying naturally occurring zeolite |
| US11014821B2 (en) * | 2018-07-09 | 2021-05-25 | Zeolyfe, LLC | Methods for preparation of CHA Zeolite at ambient pressure |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2213641A (en) * | 1938-09-01 | 1940-09-03 | Urlyn C Tainton | Cleaning powder |
| DK359362A (enExample) * | 1961-08-07 | |||
| ZA670030B (enExample) * | 1966-03-09 | |||
| DE1667443C2 (de) * | 1966-06-18 | 1982-10-21 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung feinteiliger Papierfüllstoffe auf Basis von organisch modifizierten Silikaten |
| DE1904940C2 (de) * | 1969-02-01 | 1982-07-22 | Degussa Ag, 6000 Frankfurt | Verwendung von Carboxyl- bzw. Carboxylat- und Hydroxylgruppen aufweisenden Polymeren als Komplexbildner |
| DE1904941A1 (de) * | 1969-02-01 | 1970-08-06 | Degussa | Polyoxycarbonsaeuren |
| FR2105475A5 (enExample) * | 1970-09-02 | 1972-04-28 | Sifrance | |
| CH569790A5 (enExample) * | 1970-12-14 | 1975-11-28 | Procter & Gamble | |
| CA962158A (en) * | 1971-03-11 | 1975-02-04 | Unilever Limited | Detergent compositions |
| US3852211A (en) * | 1972-08-09 | 1974-12-03 | Procter & Gamble | Detergent compositions |
| JPS5838919B2 (ja) * | 1974-06-24 | 1983-08-26 | キヤノン株式会社 | 閃光装置用電源回路 |
-
1973
- 1973-10-31 DE DE2354432A patent/DE2354432C3/de not_active Expired
-
1974
- 1974-09-10 NL NLAANVRAGE7412021,A patent/NL177304C/xx not_active IP Right Cessation
- 1974-09-18 FR FR7431504A patent/FR2249835B1/fr not_active Expired
- 1974-09-30 GB GB4232574A patent/GB1436077A/en not_active Expired
- 1974-10-16 JP JP11914274A patent/JPS5545487B2/ja not_active Expired
- 1974-10-29 IT IT53803/74A patent/IT1021985B/it active
- 1974-10-30 US US05/519,322 patent/US3962132A/en not_active Expired - Lifetime
- 1974-10-30 BE BE6044803A patent/BE821708A/xx not_active IP Right Cessation
- 1974-10-31 AT AT877274A patent/AT339259B/de not_active IP Right Cessation
- 1974-10-31 CA CA212,804A patent/CA1037015A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5545487B2 (enExample) | 1980-11-18 |
| NL177304C (nl) | 1987-07-16 |
| IT1021985B (it) | 1978-02-20 |
| DE2354432A1 (de) | 1975-05-15 |
| GB1436077A (en) | 1976-05-19 |
| BE821708A (fr) | 1975-04-30 |
| DE2354432C3 (de) | 1985-05-09 |
| AT339259B (de) | 1977-10-10 |
| NL7412021A (nl) | 1975-05-02 |
| FR2249835B1 (enExample) | 1979-02-02 |
| JPS5074600A (enExample) | 1975-06-19 |
| ATA877274A (de) | 1977-02-15 |
| FR2249835A1 (enExample) | 1975-05-30 |
| DE2354432B2 (de) | 1976-07-15 |
| US3962132A (en) | 1976-06-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1037015A (en) | Process for improving the wettability of natural or synthetic zeolites | |
| US4379080A (en) | Granular detergent compositions containing film-forming polymers | |
| US5506332A (en) | Preparation of polyacetals, use thereof and novel polyacetals | |
| US4303556A (en) | Spray-dried detergent compositions | |
| US4019999A (en) | Spray-dried granular detergent containing aluminosilicate, silicate, and pyrophosphate | |
| EP0402111B1 (en) | Formation of detergent granules by deagglomeration of detergent dough | |
| EP0013497B1 (en) | Process for producing a poly (alumino-silicate) and product prepared by this process | |
| CA1076096A (en) | Process for producing aluminum silicates | |
| EP0130639A1 (en) | Detergent compositions containing polyethylene glycol and polyacrylate | |
| JPS6052192B2 (ja) | 洗剤組成物 | |
| JPH0641596A (ja) | 粒状洗剤組成物または成分 | |
| EP0061226A1 (en) | Spray-dried detergent compositions | |
| EP0004112A2 (en) | Modified silicates | |
| EP0403084B1 (en) | Zeolite agglomeration process and product | |
| CN1043634C (zh) | 硅铝酸盐 | |
| EP0130640A1 (en) | Detergents containing polyacrylate polymer | |
| CA1229021A (en) | Granular detergent compositions containing sodium aluminosilicate or other phosphorus-free detergency builders | |
| US4288342A (en) | Inorganic water-softening bead | |
| US3956380A (en) | Polymers containing hydroxylic and carboxylic groups | |
| EP0063399B1 (en) | Granular detergent compositions containing film-forming polymers | |
| US2998410A (en) | Process for the manufacture of methylol melamines and alkylated methylol melamines | |
| CA1148919A (en) | Process for the production of finely-divided, low grit, zeolitic sodium aluminosilicates | |
| JP4016118B2 (ja) | アルミノシリケート | |
| US5464558A (en) | Polymers and detergent compositions containing them | |
| EP0883570A1 (en) | Stable high solids, high ratio alkali metal silicate solutions |