CA1023746A - 2,6-dimethyl-4-phenyl-1,4-dihydropyridines - Google Patents
2,6-dimethyl-4-phenyl-1,4-dihydropyridinesInfo
- Publication number
- CA1023746A CA1023746A CA192,552A CA192552A CA1023746A CA 1023746 A CA1023746 A CA 1023746A CA 192552 A CA192552 A CA 192552A CA 1023746 A CA1023746 A CA 1023746A
- Authority
- CA
- Canada
- Prior art keywords
- dihydropyridines
- dimethyl
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- FEOAIYBLDKAOFS-UHFFFAOYSA-N 2,6-dimethyl-4-phenyl-1,4-dihydropyridine Chemical class C1=C(C)NC(C)=CC1C1=CC=CC=C1 FEOAIYBLDKAOFS-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA284,380A CA1029021A (en) | 1973-05-11 | 1977-08-09 | Process of producing novel 1,4-dihydro-pyridine derivatives |
| CA284,381A CA1029022A (en) | 1973-07-24 | 1977-08-09 | Process of producing novel 1,4-dihydro-pyridine derivatives |
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48020423A JPS5930704B2 (ja) | 1973-02-20 | 1973-02-20 | 新規1,4−ジヒドロピリジン誘導体の製法 |
| JP2556673A JPS49109384A (enExample) | 1973-03-03 | 1973-03-03 | |
| JP4482173A JPS5714348B2 (enExample) | 1973-04-20 | 1973-04-20 | |
| JP5230773A JPS49135976A (enExample) | 1973-05-11 | 1973-05-11 | |
| JP5493973A JPS504082A (enExample) | 1973-05-17 | 1973-05-17 | |
| JP8327673A JPS5720950B2 (enExample) | 1973-07-24 | 1973-07-24 | |
| JP13406973A JPS5545075B2 (enExample) | 1973-11-29 | 1973-11-29 | |
| JP13407073A JPS5084577A (enExample) | 1973-11-29 | 1973-11-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1023746A true CA1023746A (en) | 1978-01-03 |
Family
ID=27571887
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA192,552A Expired CA1023746A (en) | 1973-02-20 | 1974-02-14 | 2,6-dimethyl-4-phenyl-1,4-dihydropyridines |
Country Status (8)
| Country | Link |
|---|---|
| CA (1) | CA1023746A (enExample) |
| CH (1) | CH605755A5 (enExample) |
| DE (1) | DE2407115C3 (enExample) |
| DK (1) | DK142869B (enExample) |
| FI (1) | FI58772C (enExample) |
| GB (1) | GB1455502A (enExample) |
| NL (2) | NL176559C (enExample) |
| NO (1) | NO143846C (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK152285C (da) * | 1975-07-02 | 1988-10-10 | Fujisawa Pharmaceutical Co | Analogifremgangsmaade til fremstilling af 1,4-dihydropyridinderivater |
| JPS55301A (en) * | 1978-02-14 | 1980-01-05 | Yamanouchi Pharmaceut Co Ltd | 1,4-dihydropyridine-3,5-dicarboxylic ester derivative and its preparation |
| DE2815578C2 (de) * | 1978-04-11 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Neue pharmazeutische Verwendung von Nimodipin |
| IT1097538B (it) * | 1978-07-17 | 1985-08-31 | Medea Res Srl | Processo per la preparazione del 2,6-dimetil-4-3(3-nitrofenil)-3-metossicarbonil-1,4-didropiridin-5-carbossilati di 2(n-benzil-n-metilammino) |
| DE2949464A1 (de) * | 1978-12-18 | 1980-06-26 | Sandoz Ag | Benzoxadiazole und benzothiadiazole, ihre herstellung und verwendung |
| JPS5762257A (en) * | 1980-10-03 | 1982-04-15 | Yoshitomi Pharmaceut Ind Ltd | 1,4-dihydropyridine-3,5-dicarboxylic acid ester or its salt |
| JPS57200386A (en) * | 1981-06-04 | 1982-12-08 | Yoshitomi Pharmaceut Ind Ltd | Novel 1,4-dihydropyridine-3,5-dicarboxylic ester derivative and its salts |
| WO1983003249A1 (fr) * | 1982-03-17 | 1983-09-29 | Yoshitomi Pharmaceutical | Derives de 1,4-dihydropyridine-3,5-dicarboxylate |
| EP0094159B1 (en) * | 1982-05-10 | 1990-03-14 | Takeda Chemical Industries, Ltd. | Dihydropyridine derivatives, their production and use |
| DE3577184D1 (de) * | 1984-01-13 | 1990-05-23 | Yamanouchi Pharma Co Ltd | Arzneimittel fuer die behandlung und verhuetung von leberschaedigungen. |
| AT388375B (de) * | 1984-04-11 | 1989-06-12 | Bristol Myers Co | Verfahren zur herstellung von neuen dihydropyridincarbonsaeureamiden und -estern |
| ES8708211A1 (es) * | 1985-06-14 | 1987-10-01 | Sankyo Co | Un procedimiento para la preparacion de nuevos derivados de 4-(fenil sustituido)-1,4-dihidropiridina. |
| DE3531498A1 (de) * | 1985-09-04 | 1987-03-05 | Bayer Ag | Dihydropyridin-2-hydroxyamine, verfahren zur herstellung und ihre verwendung in arzneimitteln |
| DE3621104A1 (de) * | 1986-06-24 | 1988-01-07 | Heumann Pharma Gmbh & Co | 1,4-dihydropyridinderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| US4772596A (en) * | 1986-10-09 | 1988-09-20 | Sankyo Company Limited | Dihydropyridine derivatives, their preparation and their use |
| SI8810082A8 (en) * | 1988-01-18 | 1995-12-31 | Lek Tovarna Farmacevtskih | Process for preparing new inclusion complex of nicardipine or its hydrochloride with beta-cyclodextrine |
| NL9001752A (nl) * | 1990-08-02 | 1992-03-02 | Cedona Pharm Bv | Nieuwe 1,4-dihydropyridinederivaten. |
| JP4332902B2 (ja) * | 1997-04-25 | 2009-09-16 | 味の素株式会社 | 新規ジヒドロピリジン誘導体 |
| ES2332168B1 (es) * | 2008-04-30 | 2010-10-27 | Consejo Superior De Investigaciones Cientificas (Csic) (75%) | Forma pseudopolimorfica de hidrocloruro de nicardipina, procedimiento para su preparacion y formulacion que la contiene. |
-
1974
- 1974-02-11 GB GB604574A patent/GB1455502A/en not_active Expired
- 1974-02-14 CA CA192,552A patent/CA1023746A/en not_active Expired
- 1974-02-15 CH CH212174A patent/CH605755A5/xx not_active IP Right Cessation
- 1974-02-15 FI FI446/74A patent/FI58772C/fi active
- 1974-02-15 DE DE2407115A patent/DE2407115C3/de not_active Expired
- 1974-02-19 NL NLAANVRAGE7402277,A patent/NL176559C/xx active Protection Beyond IP Right Term
- 1974-02-19 NO NO740543A patent/NO143846C/no unknown
- 1974-02-19 DK DK87774AA patent/DK142869B/da not_active IP Right Cessation
-
1993
- 1993-03-25 NL NL930023C patent/NL930023I2/nl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL176559C (nl) | 1985-05-01 |
| DK142869C (enExample) | 1981-09-28 |
| FI58772C (fi) | 1981-04-10 |
| NO143846B (no) | 1981-01-12 |
| NL176559B (nl) | 1984-12-03 |
| CH605755A5 (enExample) | 1978-10-13 |
| DE2407115C3 (de) | 1980-05-08 |
| NL930023I2 (nl) | 1997-08-01 |
| DE2407115B2 (de) | 1979-08-09 |
| DK142869B (da) | 1981-02-16 |
| NO740543L (no) | 1974-08-21 |
| GB1455502A (en) | 1976-11-10 |
| AU6565574A (en) | 1975-08-21 |
| NL930023I1 (nl) | 1993-05-17 |
| NO143846C (no) | 1981-04-29 |
| NL7402277A (enExample) | 1974-08-22 |
| DE2407115A1 (de) | 1974-10-10 |
| FI58772B (fi) | 1980-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1008860A (en) | 1-phenyl-substituted 1,3,5-triazines | |
| CA1023746A (en) | 2,6-dimethyl-4-phenyl-1,4-dihydropyridines | |
| CA1025450A (en) | 1,4-dihydropyridine esters | |
| AU477010B2 (en) | 1,3-oxygenated &-oestratrienes | |
| CA1026760A (en) | 3,4-dihydro-2h-naphthalin-1-one-5-oxypropyl-piperazine derivatives | |
| CA1028710A (en) | 2-amino-3,4-dihydropyridines | |
| AU475890B2 (en) | 1,4-dihydropyridine compounds | |
| CA1008072A (en) | Amino substituted 1,2,4-triazinones | |
| CA1029726A (en) | 1,8-naphthyridine-3-carboxamidetetrazolyl derivatives | |
| CA1035359A (en) | 1-substituted-6,7-disubstituted-1,2,3,4-tetrahydroisoquinoline derivatives | |
| CA1024140A (en) | 6-anilino-1,4,5-trihydroxyanthraquinones | |
| AU503626B2 (en) | Substituted 1, 5-diphenyl-3-formazancarbonitriles | |
| CA1018157A (en) | 8,8'-dioxo-6,6'-azopurine | |
| AU489429B2 (en) | Novel 1,4-dihydropyridine derivatives | |
| CA1031779A (en) | 1,3,4-thiadiazol-2-yl-ureas with selective-herbicidal action | |
| CA1021331A (en) | 9,12-bridged ethenoanthracenes and compounds derived therefrom | |
| AU478074B2 (en) | 1,3-oxygenated s-oestratrienes | |
| AU507862B2 (en) | Novel 2,3-dioxopiperazine derivatives | |
| CA1032163A (en) | 1,2-dihydrophthalazine-1-acetic acids | |
| AU489033B2 (en) | HERDICIDAL l, 3, 4-THIADIAZOL-2-YL-UREAS | |
| AU477537B2 (en) | 3, 4-DIHYDRO-2H-NAPHTHALIN-lone-5-OXYPROPYLPIPERAZINE DERIVATIVES | |
| AU480736B2 (en) | 1, 2-diphenyl-ethane derivatives | |
| AU487239B2 (en) | 2, 3-methanoprostaglandin derivatives | |
| AU7112474A (en) | 1,3-oxygenated s-oestratrienes | |
| AU7206674A (en) | 2, 2-disubstitute-benzodioxoles |