CA1021332A - Pyridoindoles - Google Patents
PyridoindolesInfo
- Publication number
- CA1021332A CA1021332A CA215,232A CA215232A CA1021332A CA 1021332 A CA1021332 A CA 1021332A CA 215232 A CA215232 A CA 215232A CA 1021332 A CA1021332 A CA 1021332A
- Authority
- CA
- Canada
- Prior art keywords
- pyridoindoles
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- IVCGJOSPVGENCT-UHFFFAOYSA-N 1h-pyrrolo[2,3-f]quinoline Chemical class N1=CC=CC2=C(NC=C3)C3=CC=C21 IVCGJOSPVGENCT-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42261373A | 1973-12-06 | 1973-12-06 | |
| US05/522,145 US3991199A (en) | 1973-12-06 | 1974-11-08 | Pyridoindoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1021332A true CA1021332A (en) | 1977-11-22 |
Family
ID=27025674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA215,232A Expired CA1021332A (en) | 1973-12-06 | 1974-12-04 | Pyridoindoles |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3991199A (enExample) |
| JP (1) | JPS50105697A (enExample) |
| AR (2) | AR205452A1 (enExample) |
| AT (1) | AT343117B (enExample) |
| CA (1) | CA1021332A (enExample) |
| CH (1) | CH612434A5 (enExample) |
| DD (1) | DD117880A5 (enExample) |
| DE (1) | DE2457305A1 (enExample) |
| DK (1) | DK633874A (enExample) |
| ES (2) | ES432646A1 (enExample) |
| FI (1) | FI57950C (enExample) |
| FR (1) | FR2253520B1 (enExample) |
| GB (1) | GB1450002A (enExample) |
| IE (1) | IE40328B1 (enExample) |
| IL (1) | IL46193A (enExample) |
| LU (1) | LU71428A1 (enExample) |
| NL (1) | NL7415936A (enExample) |
| NO (1) | NO744397L (enExample) |
| PH (1) | PH11112A (enExample) |
| SU (1) | SU592359A3 (enExample) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE7702300L (sv) * | 1976-04-15 | 1977-10-16 | Endo Lab | Reduktionsforlopp |
| SE441448B (sv) * | 1977-05-23 | 1985-10-07 | Pfizer | Sett att framstella hexahydro-gamma-karbolinforeningar |
| US4252812A (en) * | 1977-05-23 | 1981-02-24 | Pfizer Inc. | 2-Substituted-trans-5-aryl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indoles |
| US4224329A (en) * | 1979-01-23 | 1980-09-23 | Pfizer Inc. | 2-Substituted-trans-5-aryl-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indoles |
| US4267331A (en) * | 1979-01-23 | 1981-05-12 | Pfizer Inc. | Process for the production of 2-substituted pyrido[4,3-b]-indoles |
| US4352807A (en) * | 1979-07-30 | 1982-10-05 | Pfizer Inc. | Hexahydro-trans-pyridoindole neuroleptic agents |
| US4432978A (en) * | 1979-07-30 | 1984-02-21 | Pfizer Inc. | Hexahydro-trans-pyridoindole |
| US4431646A (en) * | 1979-07-30 | 1984-02-14 | Pfizer Inc. | Hexahydro-trans- and tetrahydropyridoindole neuroleptic agents |
| US4431649A (en) * | 1979-07-30 | 1984-02-14 | Pfizer Inc. | Hexahydro-trans- and tetrahydropyridoindole neuroleptic agents |
| US4337250A (en) * | 1979-07-30 | 1982-06-29 | Pfizer Inc. | Hexahydro-trans- and tetrahydropyridoindole neuroleptic agents |
| US4252811A (en) * | 1979-07-30 | 1981-02-24 | Pfizer Inc. | Hexahydro-trans-pyridoindole neuroleptic agents |
| US4427679A (en) | 1981-01-16 | 1984-01-24 | Pfizer Inc. | Hexahydro-trans- and tetrahydropyridoindole neuroleptic agents |
| CS229067B1 (en) * | 1981-08-20 | 1984-04-16 | Svorad Stolc | Medicinal preparation with antiarhythmic and supporting effect applied with hypoxia,and method of preparing active substance thereof |
| US5319087A (en) * | 1987-04-16 | 1994-06-07 | Eli Lilly And Company | Piperidine opioid antagonists |
| US4992450A (en) * | 1987-04-16 | 1991-02-12 | Eli Lilly And Company | Piperidine opioid antagonists |
| US4891379A (en) * | 1987-04-16 | 1990-01-02 | Kabushiki Kaisha Kobe Seikosho | Piperidine opioid antagonists |
| US5229517A (en) * | 1990-09-27 | 1993-07-20 | Hoechst-Roussel Pharmaceuticals Incorporated | 2-(4-Piperindinyl)-1H-pyrido[4,3-B]indol-1-ones and related compounds |
| US5102889B1 (en) * | 1990-09-27 | 1993-05-11 | 2-(4-piperidinyl)-1h-pyrido(4,3-b)indol-1-ones and related compounds | |
| US5159081A (en) * | 1991-03-29 | 1992-10-27 | Eli Lilly And Company | Intermediates of peripherally selective n-carbonyl-3,4,4-trisubstituted piperidine opioid antagonists |
| US5270328A (en) * | 1991-03-29 | 1993-12-14 | Eli Lilly And Company | Peripherally selective piperidine opioid antagonists |
| US5250542A (en) * | 1991-03-29 | 1993-10-05 | Eli Lilly And Company | Peripherally selective piperidine carboxylate opioid antagonists |
| RU2106864C1 (ru) * | 1995-10-23 | 1998-03-20 | Николай Серафимович Зефиров | Средство для лечения болезни альцгеймера |
| TW470745B (en) * | 1996-05-23 | 2002-01-01 | Janssen Pharmaceutica Nv | Hexahydro-pyrido[4,3-b]indole derivatives |
| FR2796644B1 (fr) * | 1999-07-23 | 2001-09-07 | Adir | Nouveaux derives de beta-carboline, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| US20070179174A1 (en) * | 2003-12-08 | 2007-08-02 | Bachurin Sergei O | Methods and compositions for slowing aging |
| RU2283108C2 (ru) * | 2003-12-08 | 2006-09-10 | Сергей Олегович Бачурин | ГЕРОПРОТЕКТОР НА ОСНОВЕ ГИДРИРОВАННЫХ ПИРИДО(4,3-b) ИНДОЛОВ (ВАРИАНТЫ), ФАРМАКОЛОГИЧЕСКОЕ СРЕДСТВО НА ЕГО ОСНОВЕ И СПОСОБ ЕГО ПРИМЕНЕНИЯ |
| RU2330852C1 (ru) * | 2005-09-12 | 2008-08-10 | Общество с ограниченной ответственностью "Ксерон" | ОПТИЧЕСКИЕ ИЗОМЕРЫ (+)- И (-)-ТРАНС-2,3,4,4a,5,9b-ГЕКСАГИДРО-2,8-ДИМЕТИЛ-1Н-ПИРИДО[4,3-b]ИНДОЛА |
| WO2007032699A1 (en) * | 2005-09-12 | 2007-03-22 | Avdulov, Nikolai Andreevich | (+)-and-(-)-trans-2,3,4,4a,5,9b-hexahydro-2,8-dimethyl-1h-pyrido[4,3-b] indole optical isomers |
| US20070117834A1 (en) * | 2005-10-04 | 2007-05-24 | David Hung | Methods and compositions for treating Huntington's disease |
| CN116425670A (zh) * | 2022-07-15 | 2023-07-14 | 英矽智能科技(上海)有限公司 | 作为tead抑制剂的新型杂环化合物 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3657254A (en) * | 1969-10-31 | 1972-04-18 | Nikolai Konstantinovich Barkov | 3 6-dimethyl-1 2 3 4 4a 9a-hexahydro-gamma-carboline dihydrochloride |
| JPS541320B1 (enExample) * | 1971-03-06 | 1979-01-23 |
-
1974
- 1974-01-01 AR AR256795A patent/AR205452A1/es active
- 1974-11-08 US US05/522,145 patent/US3991199A/en not_active Expired - Lifetime
- 1974-12-04 FR FR7439640A patent/FR2253520B1/fr not_active Expired
- 1974-12-04 CA CA215,232A patent/CA1021332A/en not_active Expired
- 1974-12-04 DE DE19742457305 patent/DE2457305A1/de not_active Withdrawn
- 1974-12-04 SU SU742081445A patent/SU592359A3/ru active
- 1974-12-04 AT AT970074A patent/AT343117B/de not_active IP Right Cessation
- 1974-12-05 DD DD182819A patent/DD117880A5/xx unknown
- 1974-12-05 PH PH16593A patent/PH11112A/en unknown
- 1974-12-05 ES ES432646A patent/ES432646A1/es not_active Expired
- 1974-12-05 DK DK633874A patent/DK633874A/da not_active Application Discontinuation
- 1974-12-05 IE IE2507/74A patent/IE40328B1/xx unknown
- 1974-12-05 IL IL46193A patent/IL46193A/xx unknown
- 1974-12-05 CH CH1619374A patent/CH612434A5/xx not_active IP Right Cessation
- 1974-12-05 NO NO744397A patent/NO744397L/no unknown
- 1974-12-05 FI FI3528/74A patent/FI57950C/fi active
- 1974-12-05 LU LU71428A patent/LU71428A1/xx unknown
- 1974-12-05 GB GB5268274A patent/GB1450002A/en not_active Expired
- 1974-12-06 JP JP49141073A patent/JPS50105697A/ja active Pending
- 1974-12-06 NL NL7415936A patent/NL7415936A/xx not_active Application Discontinuation
-
1975
- 1975-01-01 AR AR260153A patent/AR205583A1/es active
-
1976
- 1976-09-16 ES ES451600A patent/ES451600A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SU592359A3 (ru) | 1978-02-05 |
| ES432646A1 (es) | 1977-04-16 |
| FI57950C (fi) | 1980-11-10 |
| IL46193A (en) | 1978-04-30 |
| IL46193A0 (en) | 1975-03-13 |
| US3991199A (en) | 1976-11-09 |
| AU7607874A (en) | 1976-06-10 |
| IE40328L (en) | 1975-06-06 |
| FI352874A7 (enExample) | 1975-06-07 |
| IE40328B1 (en) | 1979-05-09 |
| ATA970074A (de) | 1977-09-15 |
| AT343117B (de) | 1978-05-10 |
| NL7415936A (nl) | 1975-06-10 |
| LU71428A1 (enExample) | 1975-06-11 |
| FR2253520A1 (enExample) | 1975-07-04 |
| DD117880A5 (enExample) | 1976-02-05 |
| FR2253520B1 (enExample) | 1979-01-12 |
| FI57950B (fi) | 1980-07-31 |
| AR205583A1 (es) | 1976-05-14 |
| AR205452A1 (es) | 1976-05-07 |
| CH612434A5 (enExample) | 1979-07-31 |
| DK633874A (enExample) | 1975-07-28 |
| NO744397L (enExample) | 1975-06-30 |
| PH11112A (en) | 1977-10-27 |
| JPS50105697A (enExample) | 1975-08-20 |
| GB1450002A (en) | 1976-09-22 |
| DE2457305A1 (de) | 1975-06-12 |
| ES451600A1 (es) | 1977-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU474137B2 (en) | Auto-refractometer | |
| CA1021332A (en) | Pyridoindoles | |
| AU468964B2 (en) | Melik | |
| CA1030522A (en) | D-homo-20-keto-pregnanes | |
| CA1031323A (en) | D-homo-steroids | |
| AU498889B2 (en) | Piperidylene benzocycloheptathiophenes | |
| CA1012517A (en) | Railbed | |
| CA1034957A (en) | Fluoroaliphaticthiomethylsiloxanes | |
| AU476397B2 (en) | A-cycloalkylbenzyl lactamimides | |
| AU476505B2 (en) | Alkylbenxyl lactamimides | |
| AU472907B2 (en) | Firecheck | |
| CA1017743A (en) | Benzylpyrimidines | |
| AU476386B2 (en) | Dibenzocycloheptenyl lactamimides | |
| CA1018166A (en) | Benzylpyrimidines | |
| CA1014808A (en) | Impactor-vibrator | |
| AU471241B2 (en) | Benzothiazolylureas | |
| CA1031349A (en) | Thiadiazolylimidazolidinones | |
| AU492247B2 (en) | Ethenoanthracenes | |
| AU466103B2 (en) | Cis-chrysanthemate | |
| AU478880B2 (en) | 3-isoxazolidinones | |
| AU487916B2 (en) | Benzopyranopyridines | |
| AU489559B2 (en) | Amidinoureas | |
| AU489560B2 (en) | Amidinoureas | |
| AU491458B2 (en) | 7-halomethyl-17-hydroxy-3-oxo-17 -pregn-4-ene-21-carboxylic acid -lactones | |
| AU482276B2 (en) | Spiro-cyclopropanes |