BG48205A3 - Microbicide means - Google Patents
Microbicide meansInfo
- Publication number
- BG48205A3 BG48205A3 BG084407A BG8440788A BG48205A3 BG 48205 A3 BG48205 A3 BG 48205A3 BG 084407 A BG084407 A BG 084407A BG 8440788 A BG8440788 A BG 8440788A BG 48205 A3 BG48205 A3 BG 48205A3
- Authority
- BG
- Bulgaria
- Prior art keywords
- alkyl
- halogen
- substituted
- alkoxy
- cyclopropyl
- Prior art date
Links
- 230000003641 microbiacidal effect Effects 0.000 title 1
- 229940124561 microbicide Drugs 0.000 title 1
- 239000002855 microbicide agent Substances 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 4
- 229910052736 halogen Inorganic materials 0.000 abstract 4
- 150000002367 halogens Chemical class 0.000 abstract 4
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 abstract 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Chemical group 0.000 abstract 1
- 239000000654 additive Substances 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 230000000855 fungicidal effect Effects 0.000 abstract 1
- 125000004438 haloalkoxy group Chemical group 0.000 abstract 1
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- 150000002431 hydrogen Chemical class 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 230000000749 insecticidal effect Effects 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 244000005700 microbiome Species 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 238000001228 spectrum Methods 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/48—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with two nitrogen atoms as the only ring hetero atoms
- A01N43/54—1,3-Diazines; Hydrogenated 1,3-diazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH218887 | 1987-06-11 | ||
| CH131888 | 1988-04-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BG48205A3 true BG48205A3 (en) | 1990-12-14 |
Family
ID=25687315
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG084407A BG48205A3 (en) | 1987-06-11 | 1988-06-08 | Microbicide means |
| BG087225A BG49923A3 (en) | 1987-06-11 | 1988-06-08 | Method for preparing of 2- aniline- pyrimidine derivatives |
| BG087226A BG49939A3 (en) | 1987-06-11 | 1988-06-08 | Method for preparing of 2- aniline- pyrimidine derivatives |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BG087225A BG49923A3 (en) | 1987-06-11 | 1988-06-08 | Method for preparing of 2- aniline- pyrimidine derivatives |
| BG087226A BG49939A3 (en) | 1987-06-11 | 1988-06-08 | Method for preparing of 2- aniline- pyrimidine derivatives |
Country Status (20)
| Country | Link |
|---|---|
| EP (1) | EP0295210B1 (xx) |
| JP (1) | JP2632187B2 (xx) |
| KR (1) | KR970001478B1 (xx) |
| CN (1) | CN1032338A (xx) |
| AU (1) | AU615912B2 (xx) |
| BG (3) | BG48205A3 (xx) |
| BR (1) | BR8802852A (xx) |
| CA (1) | CA1305483C (xx) |
| CZ (1) | CZ281586B6 (xx) |
| DE (1) | DE3882821D1 (xx) |
| DK (2) | DK317588A (xx) |
| ES (1) | ES2058332T3 (xx) |
| FI (1) | FI98912C (xx) |
| HU (1) | HU208961B (xx) |
| IE (1) | IE62436B1 (xx) |
| IL (1) | IL86666A (xx) |
| NZ (1) | NZ224969A (xx) |
| PL (1) | PL154960B1 (xx) |
| PT (1) | PT87707B (xx) |
| ZW (1) | ZW7588A1 (xx) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2054867T3 (es) * | 1987-09-28 | 1994-08-16 | Ciba Geigy Ag | Plaguicidas y pesticidas. |
| US4966622A (en) * | 1988-04-12 | 1990-10-30 | Ciba-Geigy Corporation | N-phenyl-N-pyrimidin-2-ylureas |
| DE59010042D1 (de) * | 1989-03-22 | 1996-02-22 | Ciba Geigy Ag | Schädlingsbekämpfungsmittel |
| GB9117486D0 (en) * | 1991-08-13 | 1991-09-25 | Schering Ag | Fungicides |
| GB9212673D0 (en) * | 1992-06-15 | 1992-07-29 | Celltech Ltd | Chemical compounds |
| GB9304920D0 (en) * | 1993-03-10 | 1993-04-28 | Celltech Ltd | Chemical compounds |
| GB9304919D0 (en) * | 1993-03-10 | 1993-04-28 | Celltech Ltd | Chemical compounds |
| GB9326600D0 (en) * | 1993-12-22 | 1994-03-02 | Celltech Ltd | Chemical compounds |
| DE69433594T2 (de) * | 1993-12-22 | 2004-08-05 | Celltech R&D Ltd., Slough | Trisubstituierte phenyl-derivate, verfahren zu deren herstellung und deren verwendung als phosphodiesterase (typ iv) hemmstoffe |
| US6245774B1 (en) | 1994-06-21 | 2001-06-12 | Celltech Therapeutics Limited | Tri-substituted phenyl or pyridine derivatives |
| US5786354A (en) * | 1994-06-21 | 1998-07-28 | Celltech Therapeutics, Limited | Tri-substituted phenyl derivatives and processes for their preparation |
| GB9412571D0 (en) * | 1994-06-22 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| GB9412573D0 (en) * | 1994-06-22 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| GB9412672D0 (en) * | 1994-06-23 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| DE4444928A1 (de) | 1994-12-16 | 1996-06-27 | Hoechst Schering Agrevo Gmbh | Verfahren zur Herstellung von 2-Anilino-pyridin-Derivaten |
| GB9523675D0 (en) * | 1995-11-20 | 1996-01-24 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526245D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526243D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526246D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9608435D0 (en) * | 1996-04-24 | 1996-06-26 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9619284D0 (en) * | 1996-09-16 | 1996-10-30 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9622363D0 (en) | 1996-10-28 | 1997-01-08 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9625184D0 (en) * | 1996-12-04 | 1997-01-22 | Celltech Therapeutics Ltd | Chemical compounds |
| WO1998028281A1 (en) | 1996-12-23 | 1998-07-02 | Celltech Therapeutics Limited | Fused polycyclic 2-aminopyrimidine derivatives, their preparation and their use as protein tyrosine kinase inhibitors |
| GB9705361D0 (en) * | 1997-03-14 | 1997-04-30 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9713087D0 (en) * | 1997-06-20 | 1997-08-27 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9914258D0 (en) | 1999-06-18 | 1999-08-18 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9924862D0 (en) | 1999-10-20 | 1999-12-22 | Celltech Therapeutics Ltd | Chemical compounds |
| JP2001247411A (ja) * | 2000-03-09 | 2001-09-11 | Tomono Agrica Co Ltd | 有害生物防除剤 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD151404A1 (de) * | 1980-06-13 | 1981-10-21 | Friedrich Franke | Fungizide mittel |
| US4659363A (en) * | 1983-07-25 | 1987-04-21 | Ciba-Geigy Corporation | N-(2-nitrophenyl)-2-aminopyrimidine derivatives, the preparation and use thereof |
| ATE60591T1 (de) * | 1984-06-25 | 1991-02-15 | Ciba Geigy Ag | Pyrimidinderivate wirksam als schaedlingsbekaempfungsmittel. |
| DE3618353A1 (de) * | 1986-05-31 | 1987-12-03 | Hoechst Ag | Schaedlingsbekaempfungsmittel auf der basis von aminopyrimidin-derivaten sowie neue aminopyrimidin-verbindungen |
| DE3788494D1 (de) * | 1986-10-13 | 1994-01-27 | Ciba Geigy | Harnstoffe. |
| JPH0784445B2 (ja) * | 1986-12-03 | 1995-09-13 | クミアイ化学工業株式会社 | ピリミジン誘導体および農園芸用殺菌剤 |
| ES2054867T3 (es) * | 1987-09-28 | 1994-08-16 | Ciba Geigy Ag | Plaguicidas y pesticidas. |
-
1988
- 1988-06-02 ES ES88810361T patent/ES2058332T3/es not_active Expired - Lifetime
- 1988-06-02 DE DE8888810361T patent/DE3882821D1/de not_active Expired - Lifetime
- 1988-06-02 EP EP88810361A patent/EP0295210B1/de not_active Expired - Lifetime
- 1988-06-07 CZ CS883926A patent/CZ281586B6/cs unknown
- 1988-06-08 BG BG084407A patent/BG48205A3/xx unknown
- 1988-06-08 BG BG087225A patent/BG49923A3/xx unknown
- 1988-06-08 FI FI882709A patent/FI98912C/fi not_active IP Right Cessation
- 1988-06-08 BG BG087226A patent/BG49939A3/xx unknown
- 1988-06-09 PT PT87707A patent/PT87707B/pt not_active IP Right Cessation
- 1988-06-09 ZW ZW75/88A patent/ZW7588A1/xx unknown
- 1988-06-09 IL IL8886666A patent/IL86666A/xx not_active IP Right Cessation
- 1988-06-09 PL PL1988272950A patent/PL154960B1/pl unknown
- 1988-06-09 CA CA000568999A patent/CA1305483C/en not_active Expired - Lifetime
- 1988-06-09 NZ NZ224969A patent/NZ224969A/en unknown
- 1988-06-10 AU AU17606/88A patent/AU615912B2/en not_active Ceased
- 1988-06-10 HU HU883006A patent/HU208961B/hu not_active IP Right Cessation
- 1988-06-10 DK DK317588D patent/DK317588A/da unknown
- 1988-06-10 IE IE175988A patent/IE62436B1/en not_active IP Right Cessation
- 1988-06-10 BR BR8802852A patent/BR8802852A/pt not_active IP Right Cessation
- 1988-06-10 DK DK317588A patent/DK167975B1/da not_active IP Right Cessation
- 1988-06-11 KR KR1019880007066A patent/KR970001478B1/ko not_active IP Right Cessation
- 1988-06-11 JP JP63144552A patent/JP2632187B2/ja not_active Expired - Lifetime
- 1988-06-11 CN CN88103496A patent/CN1032338A/zh active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CN1032338A (zh) | 1989-04-12 |
| EP0295210A1 (de) | 1988-12-14 |
| DK317588D0 (da) | 1988-06-10 |
| PL272950A1 (en) | 1989-03-06 |
| BR8802852A (pt) | 1989-01-03 |
| AU615912B2 (en) | 1991-10-17 |
| HUT47383A (en) | 1989-03-28 |
| PL154960B1 (en) | 1991-10-31 |
| ZW7588A1 (en) | 1989-01-18 |
| JPS63316774A (ja) | 1988-12-26 |
| DK317588A (da) | 1988-12-12 |
| BG49923A3 (en) | 1992-03-16 |
| CA1305483C (en) | 1992-07-21 |
| BG49939A3 (en) | 1992-03-16 |
| IE62436B1 (en) | 1995-02-08 |
| ES2058332T3 (es) | 1994-11-01 |
| HU208961B (en) | 1994-02-28 |
| JP2632187B2 (ja) | 1997-07-23 |
| CZ281586B6 (cs) | 1996-11-13 |
| KR890000436A (ko) | 1989-03-14 |
| DK167975B1 (da) | 1994-01-10 |
| CZ392688A3 (en) | 1996-09-11 |
| FI882709A (fi) | 1988-12-12 |
| FI882709A0 (fi) | 1988-06-08 |
| NZ224969A (en) | 1991-04-26 |
| FI98912C (fi) | 1997-09-10 |
| FI98912B (fi) | 1997-05-30 |
| IE881759L (en) | 1988-12-11 |
| IL86666A (en) | 1992-09-06 |
| AU1760688A (en) | 1988-12-15 |
| PT87707B (pt) | 1995-01-31 |
| EP0295210B1 (de) | 1993-08-04 |
| KR970001478B1 (ko) | 1997-02-06 |
| PT87707A (pt) | 1989-05-31 |
| DE3882821D1 (de) | 1993-09-09 |
| IL86666A0 (en) | 1988-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG48205A3 (en) | Microbicide means | |
| ES2166359T3 (es) | Derivado de depsipeptido, su produccion y uso. | |
| FI883297A (fi) | Akrylaattifungisidit ja niiden käyttö | |
| ES2179047T3 (es) | Anilidas de acido carboxilico, procedimiento para su obtencion, y agentes que las contienen para el combate de hongos nocivos. | |
| BG29864A3 (en) | Means with herbicide and growth regulation action | |
| DK214285D0 (da) | 6-chlorbenzazolylacetamider, deres fremstilling og anvendelse som herbicider og fungicider | |
| EG20413A (en) | N-arylhydrazine derivatives as insecticidal and acaricidal agents | |
| BG28549A3 (bg) | Хербициден състав | |
| ES470219A1 (es) | Procedimiento para la preparacion de 1-aril-4-alcohil-1,2,4-triazol-5-onas | |
| BG32713A3 (en) | Insecticide means | |
| ZA857356B (en) | Sulfamoyl urea derivatives | |
| ES8801196A1 (es) | Procedimiento para la obtencion de i-benzoil-3-aril-ureas | |
| ES2092301T3 (es) | Composicion fungicida. | |
| BG28236A3 (en) | Insecticide composition | |
| JPS5419943A (en) | Urea or thiourea compounds, their preparation, and agricultural and horticultural fungicides comprising them as active constituents | |
| GB1483617A (en) | Pesticidal thiophosphoric acid esteramides | |
| BG34607A3 (en) | Fungicide means | |
| AR240861A2 (es) | Composicion fungicida. | |
| ES2102706T3 (es) | Procedimiento para la lucha contra las pestes y 2-anilinopiridinas. | |
| EA199901008A1 (ru) | Фунгицидная смесь | |
| WO1991019703A3 (en) | Fungicidal iminooxazolidinones | |
| ES2019617B3 (es) | Fungicidas. | |
| BG46152A3 (en) | Herbicide composition | |
| IL81202A0 (en) | Dihaloformaldoximes and their use as pesticides | |
| BG35894A3 (en) | Herbicide means and method for weed control |