AU4768679A - Preparation of diphenylmethane dicarbamates and polymethylene polyphenyl carbamates - Google Patents
Preparation of diphenylmethane dicarbamates and polymethylene polyphenyl carbamatesInfo
- Publication number
- AU4768679A AU4768679A AU47686/79A AU4768679A AU4768679A AU 4768679 A AU4768679 A AU 4768679A AU 47686/79 A AU47686/79 A AU 47686/79A AU 4768679 A AU4768679 A AU 4768679A AU 4768679 A AU4768679 A AU 4768679A
- Authority
- AU
- Australia
- Prior art keywords
- preparation
- polymethylene polyphenyl
- diphenylmethane dicarbamates
- polyphenyl carbamates
- carbamates
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- OTSJRHVZRARHBC-UHFFFAOYSA-N benzylbenzene;carbamic acid Chemical class NC(O)=O.NC(O)=O.C=1C=CC=CC=1CC1=CC=CC=C1 OTSJRHVZRARHBC-UHFFFAOYSA-N 0.000 title 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 title 1
- -1 polymethylene Polymers 0.000 title 1
- 229920006389 polyphenyl polymer Polymers 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/953,135 US4162362A (en) | 1978-10-20 | 1978-10-20 | Process for the preparation of diphenylmethane dicarbamates and polymethylene polyphenyl carbamates |
| US953135 | 1978-10-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU4768679A true AU4768679A (en) | 1980-04-24 |
Family
ID=25493621
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU47686/79A Abandoned AU4768679A (en) | 1978-10-20 | 1979-06-01 | Preparation of diphenylmethane dicarbamates and polymethylene polyphenyl carbamates |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4162362A (enExample) |
| JP (1) | JPS5557550A (enExample) |
| AU (1) | AU4768679A (enExample) |
| BE (1) | BE879534A (enExample) |
| BR (1) | BR7904877A (enExample) |
| CA (1) | CA1116177A (enExample) |
| DE (1) | DE2931473A1 (enExample) |
| ES (1) | ES482987A1 (enExample) |
| FR (1) | FR2439183A1 (enExample) |
| GB (1) | GB2034691B (enExample) |
| IT (1) | IT1119798B (enExample) |
| NL (1) | NL7903674A (enExample) |
| NO (1) | NO793255L (enExample) |
| PL (1) | PL117371B1 (enExample) |
| SE (1) | SE7908699L (enExample) |
| YU (1) | YU155879A (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5579358A (en) * | 1978-12-13 | 1980-06-14 | Mitsui Toatsu Chem Inc | Preparation of polyethylene polyphenyl carbamate |
| US4202986A (en) * | 1979-02-12 | 1980-05-13 | Atlantic Richfield Company | Preparation of diphenylmethane dicarbamates and polymethylene polyphenyl carbamates with Lewis acid catalysts intercalated in graphite |
| US4230877A (en) * | 1979-03-22 | 1980-10-28 | Atlantic Richfield Company | Method for increasing the 4,4'dicarbamate isomer of the diphenylmethane dicarbamates during preparation thereof |
| JPS5612357A (en) * | 1979-07-09 | 1981-02-06 | Mitsui Toatsu Chem Inc | Production of polymethylenepolyphenylpolycarbamate |
| DE2931554A1 (de) * | 1979-08-03 | 1981-02-26 | Basf Ag | Verfahren zur herstellung von methylen-bis-phenyl-carbaminsaeureestern und polymethylen-polyphenylcarbaminsaeureestern |
| CA1150293A (en) * | 1979-10-01 | 1983-07-19 | Keisuke Wada | Process for the production of methylenedicarbanilates |
| JPS5679658A (en) * | 1979-12-05 | 1981-06-30 | Mitsui Toatsu Chem Inc | Novel polyisocyanate composition |
| DE3013907A1 (de) * | 1980-04-11 | 1981-10-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von methylen-bis-phenylcarbaminsaeureestern und polymethylen-polyphenylcarbamidsaeureestern |
| JPS56156252A (en) * | 1980-05-02 | 1981-12-02 | Mitsubishi Chem Ind Ltd | Preparation of methylene dicarbanilates |
| JPS56167655A (en) * | 1980-05-28 | 1981-12-23 | Mitsubishi Chem Ind Ltd | Preparation of methylenedicarbanilate |
| DE3020784A1 (de) * | 1980-05-31 | 1981-12-10 | Basf Ag, 6700 Ludwigshafen | Aralkylanilinderivate und herbizide, die diese verbindungen enthalten |
| US4290968A (en) * | 1980-07-23 | 1981-09-22 | Atlantic Richfield Company | Preparation of polyisocyanates from polycarbamates |
| US4369141A (en) * | 1980-08-25 | 1983-01-18 | Atlantic Richfield Company | Process to improve isocyanate yield upon pyrolysis of a polyfunctional urethane which has been extracted with a combination of hydrochloric acid and alcohol |
| US4292254A (en) * | 1980-10-17 | 1981-09-29 | Atlantic Richfield Company | Preparation of polyisocyanates from polycarbamates |
| US4303794A (en) * | 1980-12-22 | 1981-12-01 | The Dow Chemical Company | Separation and recovery of 4,4'-methylene dimethyl diphenyldicarbamate |
| US4543419A (en) * | 1981-02-25 | 1985-09-24 | Atlantic Richfield Company | Process for the preparation of diphenylmethane dicarbamates and polymethylene polyphenyl carbamates |
| US4318861A (en) * | 1981-03-18 | 1982-03-09 | Atlantic Richfield Company | Stabilized diphenylmethane diisocyanate-polymethylene polyphenyl isocyanate compositions |
| US4320069A (en) * | 1981-03-20 | 1982-03-16 | Atlantic Richfield Company | Oxazoline stabilized diphenylmethane diisocyanate-polymethylene polyphenyl isocyanate compositions |
| US4332741A (en) * | 1981-03-23 | 1982-06-01 | Atlantic Richfield Company | Dichloroparabanic acid stabilized diphenylmethane diisocyanate-polymethylene polyphenyl isocyanate compositions |
| HU188157B (en) * | 1981-11-10 | 1986-03-28 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara,Hu | Process for producing 1,1-dichloro-4-methyl-1,3-pentadiene |
| JPH02111065U (enExample) * | 1989-02-22 | 1990-09-05 | ||
| ATE163407T1 (de) * | 1991-06-26 | 1998-03-15 | Lucky Ltd | Verfahren zur selektiven herstellung von 4,4- methylen-bis-(n-phenylalkylcarbamate) |
| US5206412A (en) * | 1992-02-07 | 1993-04-27 | Arco Chemical Technology, L.P. | Selective process for the preparation of diphenylmethane diisocyanate precursors |
| JP2008175295A (ja) * | 2007-01-18 | 2008-07-31 | Aisin Ai Co Ltd | 手動変速機のリバースレストリクト機構 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB461352A (en) * | 1935-07-11 | 1937-02-11 | Deutschen Celluloid Fabrik | Manufacture of condensation products and of lacquers and plastic masses therefrom |
| US2946768A (en) * | 1957-08-12 | 1960-07-26 | Bayer Ag | Condensation products of carbamic acid esters |
| US4014914A (en) * | 1970-01-12 | 1977-03-29 | Badische Anilin- & Soda-Fabrik Aktiengesellschaft | Manufacture of 4,4'-diphenylmethane diisocyanate and a mixture of diisocyanates and polyisocyanates |
| US3962302A (en) * | 1974-03-08 | 1976-06-08 | Atlantic Richfield Company | Production of isocyanates from esters of carbamic acids (urethanes) |
| US3919279A (en) * | 1974-06-26 | 1975-11-11 | Atlantic Richfield Co | Catalytic production of isocyanates from esters of carbamic acids |
-
1978
- 1978-10-20 US US05/953,135 patent/US4162362A/en not_active Expired - Lifetime
-
1979
- 1979-04-23 CA CA326,088A patent/CA1116177A/en not_active Expired
- 1979-05-10 NL NL7903674A patent/NL7903674A/nl not_active Application Discontinuation
- 1979-05-31 JP JP6741479A patent/JPS5557550A/ja active Granted
- 1979-06-01 AU AU47686/79A patent/AU4768679A/en not_active Abandoned
- 1979-06-28 GB GB7922506A patent/GB2034691B/en not_active Expired
- 1979-06-29 YU YU01558/79A patent/YU155879A/xx unknown
- 1979-07-25 IT IT49854/79A patent/IT1119798B/it active
- 1979-07-28 PL PL1979217432A patent/PL117371B1/pl unknown
- 1979-07-30 ES ES482987A patent/ES482987A1/es not_active Expired
- 1979-07-30 BR BR7904877A patent/BR7904877A/pt unknown
- 1979-08-02 DE DE19792931473 patent/DE2931473A1/de not_active Withdrawn
- 1979-10-10 NO NO793255A patent/NO793255L/no unknown
- 1979-10-18 FR FR7925914A patent/FR2439183A1/fr active Granted
- 1979-10-19 BE BE0/197743A patent/BE879534A/fr not_active IP Right Cessation
- 1979-10-19 SE SE7908699A patent/SE7908699L/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| IT7949854A0 (it) | 1979-07-25 |
| US4162362A (en) | 1979-07-24 |
| YU155879A (en) | 1982-08-31 |
| NL7903674A (nl) | 1980-04-22 |
| NO793255L (no) | 1980-04-22 |
| PL117371B1 (en) | 1981-07-31 |
| PL217432A1 (enExample) | 1980-04-21 |
| SE7908699L (sv) | 1980-04-21 |
| JPS5557550A (en) | 1980-04-28 |
| GB2034691B (en) | 1983-05-11 |
| CA1116177A (en) | 1982-01-12 |
| GB2034691A (en) | 1980-06-11 |
| JPS6123182B2 (enExample) | 1986-06-04 |
| ES482987A1 (es) | 1980-04-16 |
| BR7904877A (pt) | 1980-07-15 |
| BE879534A (fr) | 1980-04-21 |
| FR2439183A1 (fr) | 1980-05-16 |
| FR2439183B1 (enExample) | 1984-09-14 |
| IT1119798B (it) | 1986-03-10 |
| DE2931473A1 (de) | 1980-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU4768679A (en) | Preparation of diphenylmethane dicarbamates and polymethylene polyphenyl carbamates | |
| JPS54137098A (en) | Liquid diphenylmethane diisocyanate composition* and preparation thereof | |
| JPS5538380A (en) | Manufacture of isocyanurate group contained polyisocyanate and its use | |
| EP0046626A3 (en) | Substituted benzenesulfonyl isocyanates and preparation thereof | |
| AU5817980A (en) | Half-esters and polyurethanes prepared therefrom | |
| IL55558A0 (en) | The preparation of diphenylmethane monoand dicarbamates and dicarbamates and polymethylene polyphenyl carbamates | |
| AU527075B2 (en) | Electrolyas of hc1 | |
| DE3060401D1 (en) | A method for the preparation of a mixture of diphenyl methane dicarbamates and polymethylene polyphenyl carbamates | |
| DE3060086D1 (en) | Preparation of diphenylmethane dicarbamates and polymethylene polyphenyl carbamates with lewis acid catalysts intercalated in graphite | |
| JPS5592356A (en) | Polyisocyanate*its manufacture and use | |
| JPS5665856A (en) | Manufacture of mixture of diphenylmethanee diisocyanate and polyphenyllpolymethylenee polyisocyanate | |
| AU523252B2 (en) | 1-benzoyl-3-pyridinyl ureas and their use as insecticides | |
| JPS5649346A (en) | Manufacture of ppsubstituted aromatic carbamic ester | |
| GB2034697B (en) | Herbicidally active carbamic acid phenyl esters and their manufacture and use | |
| GB2022091B (en) | Preparation of isocyanates | |
| AU523736B2 (en) | Discontinouosly holding cotton-like material | |
| GB2014999B (en) | Stabilisation of isocyanates | |
| JPS54143520A (en) | Carbamic acid ester * production and use thereof | |
| PH15469A (en) | Arylalkyl and aryloxyalkyl phosphate | |
| AU522297B2 (en) | N-substituted carbamic acid esters and herbicides | |
| DE3065209D1 (en) | Process for the preparation of polymethylene polypheny polyisocyanate compositions and use thereof | |
| JPS5687546A (en) | Manufacture of aromatic monoisocyanate and diisocyanate | |
| GB2012788B (en) | Substituted carbamates preparation thereof and use thereof as insecticides | |
| DE3064944D1 (en) | Process for the preparation of 1-haloalkyl isocyanates and 1-alkenyl isocyanates | |
| IL68584A0 (en) | O-carbalkoxy benzenosulfonyl isocyanates and their preparation |