AU474062B2 - &- hydroxyiminoacylamido and & - acyloxyiminoacylamido penicillin and cephalosporin antibiotics - Google Patents
&- hydroxyiminoacylamido and & - acyloxyiminoacylamido penicillin and cephalosporin antibioticsInfo
- Publication number
- AU474062B2 AU474062B2 AU38450/72A AU3845072A AU474062B2 AU 474062 B2 AU474062 B2 AU 474062B2 AU 38450/72 A AU38450/72 A AU 38450/72A AU 3845072 A AU3845072 A AU 3845072A AU 474062 B2 AU474062 B2 AU 474062B2
- Authority
- AU
- Australia
- Prior art keywords
- hydroxyiminoacylamido
- acyloxyiminoacylamido
- penicillin
- cephalosporin antibiotics
- cephalosporin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930186147 Cephalosporin Natural products 0.000 title 1
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 239000003242 anti bacterial agent Substances 0.000 title 1
- 229940088710 antibiotic agent Drugs 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- 150000001780 cephalosporins Chemical class 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/02—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB3531/71 | 1971-01-29 | ||
| GB353171A GB1389194A (en) | 1971-01-29 | 1971-01-29 | Antibiotics |
| GB4588571 | 1971-10-01 | ||
| KR7200155A KR790000084B1 (en) | 1971-01-29 | 1972-02-03 | Process for preparation of antibiotics of cephalosphorin and penicillin series |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU3845072A AU3845072A (en) | 1973-08-02 |
| AU474062B2 true AU474062B2 (en) | 1976-07-15 |
Family
ID=27254286
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU38450/72A Expired AU474062B2 (en) | 1971-01-29 | 1972-01-28 | &- hydroxyiminoacylamido and & - acyloxyiminoacylamido penicillin and cephalosporin antibiotics |
Country Status (9)
| Country | Link |
|---|---|
| AT (2) | AT326814B (enExample) |
| AU (1) | AU474062B2 (enExample) |
| BE (2) | BE778630A (enExample) |
| CH (2) | CH598261A5 (enExample) |
| DE (3) | DE2204060A1 (enExample) |
| ES (2) | ES399267A1 (enExample) |
| FR (1) | FR2123544B1 (enExample) |
| GB (1) | GB1389194A (enExample) |
| NL (2) | NL7201156A (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4064346A (en) * | 1971-05-14 | 1977-12-20 | Glaxo Laboratories Limited | 3-Acetoxymethyl-7β-(2-carboxy-methoxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
| GB1443950A (en) * | 1972-10-25 | 1976-07-28 | Glaxo Lab Ltd | Acylamido-penam-carboxylic acids and their derivatives |
| US4033950A (en) * | 1971-05-14 | 1977-07-05 | Glaxo Laboratories Limited | 3-Hydroxymethyl-7β-(2-alkoxy-or benzyloxyimino-2-arylacetamido)ceph-3-em-4-carboxylic acids and salts thereof |
| US4079178A (en) * | 1971-05-14 | 1978-03-14 | Glaxo Laboratories Limited | Cephalosporins having (α-etherified oximino) acylamido groups at the 7-position |
| GB1447114A (en) * | 1973-02-20 | 1976-08-25 | Glaxo Lab Ltd | Process for the preparation of 2-aryl-2-hydroxyiminoacetic acid |
| GB1472534A (en) * | 1973-07-06 | 1977-05-04 | Glaxo Lab Ltd | 7beta-hydroxyiminoacylamido-cephalosporins |
| US4095021A (en) | 1973-12-21 | 1978-06-13 | Glaxo Laboratories Limited | 3-Carbamoyloxymethyl or N-methyl-carbamoyloxymethyl-7-[2-carboxymethoxyimino-2-(fur-2-yl or thien-2-yl)acetamido]ceph-3-em-4-carboxylic acids and derivatives thereof |
| US4144392A (en) | 1973-12-21 | 1979-03-13 | Glaxo Laboratories Limited | Cephalosporins having at position-7 a carboxy substituted α-etherified hydroxyimino-arylacetamido group and at position-3 the residue of a sulphur nucleophile |
| US4020058A (en) * | 1974-10-03 | 1977-04-26 | Glaxo Laboratories Limited | Improvements in or relating to cephalosporin antibiotics |
| US4200746A (en) | 1974-12-20 | 1980-04-29 | Glaxo Laboratories, Ltd. | Cephalosporins |
| US4143166A (en) * | 1975-02-04 | 1979-03-06 | Fujisawa Pharmaceutical Co., Ltd. | 7[(2-Hydroxyamino-2-disubstituted phenyl-acetamido)-]3-heterocyclicthio-3-cephem-4-carboxylic acids |
| GB1555471A (en) * | 1975-06-19 | 1979-11-14 | Glaxo Lab Ltd | 7 carbamoylalkoxyimino acetamido 3 em 4 carboxylic acidsand derivatives thereof |
| US4165430A (en) | 1976-03-19 | 1979-08-21 | Glaxo Laboratories Limited | Cephalosporins having a 7-carboxy substituted α-etherified oximinoarylacetamido) group |
| US4166115A (en) * | 1976-04-12 | 1979-08-28 | Fujisawa Pharmaceutical Co., Ltd. | Syn 7-oxoimino substituted derivatives of cephalosporanic acid |
| FR2384779A1 (fr) * | 1977-03-25 | 1978-10-20 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-chloro ou 3-methoxy 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| DE2714880A1 (de) * | 1977-04-02 | 1978-10-26 | Hoechst Ag | Cephemderivate und verfahren zu ihrer herstellung |
| DE2716677C2 (de) | 1977-04-15 | 1985-10-10 | Hoechst Ag, 6230 Frankfurt | Cephemderivate und Verfahren zu ihrer Herstellung |
| FR2418233A2 (fr) * | 1978-02-22 | 1979-09-21 | Roussel Uclaf | Nouvelles oximes derivees de l'acide 3-alkylthio ou 3-acylamino 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| US4409214A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical, Co., Ltd. | 7-Acylamino-3-vinylcephalosporanic acid derivatives and processes for the preparation thereof |
| US4409215A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical Co., Ltd. | 7-Acylamino-3-substituted cephalosporanic acid derivatives and processes for the preparation thereof |
| IL63207A (en) * | 1980-07-24 | 1985-09-29 | Lonza Ag | Process for the preparation of 2-(2-aminothiazole-4-yl)-2-(syn)-methoxyiminoacetic acid esters |
| US4443374A (en) * | 1982-02-01 | 1984-04-17 | E. R. Squibb & Sons, Inc. | Process for preparing (3S)-3-[[(2-amino-4-thiazolyl)[(1-carboxy-1-methylethoxy)imino]-acetyl]amino]-2-oxo-1-azetidinesulfonic acid, and 4-substituted derivatives |
| GB2173791B (en) * | 1985-04-16 | 1989-07-05 | Ici Plc | Fungicidal cyano oximes |
| GB8927871D0 (en) * | 1989-12-08 | 1990-02-14 | Beecham Group Plc | Novel compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1159449B (de) * | 1961-03-22 | 1963-12-19 | Gruenenthal Chemie | Verfahren zur Herstellung von 6-Acylaminopenicillansaeuren und deren Salzen |
| SE311519B (enExample) * | 1962-12-14 | 1969-06-16 | Astra Ab | |
| GB1208014A (en) * | 1967-03-23 | 1970-10-07 | Glaxo Lab Ltd | Cephalosporins |
| GB1208015A (en) * | 1967-03-23 | 1970-10-07 | Glaxo Lab Ltd | Cephalosporins |
-
1971
- 1971-01-29 GB GB353171A patent/GB1389194A/en not_active Expired
-
1972
- 1972-01-28 NL NL7201156A patent/NL7201156A/xx not_active Application Discontinuation
- 1972-01-28 DE DE19722204060 patent/DE2204060A1/de not_active Ceased
- 1972-01-28 DE DE19722204108 patent/DE2204108A1/de active Pending
- 1972-01-28 NL NL7201157A patent/NL7201157A/xx unknown
- 1972-01-28 BE BE778630A patent/BE778630A/xx not_active IP Right Cessation
- 1972-01-28 BE BE778631A patent/BE778631A/xx unknown
- 1972-01-28 AT AT70172A patent/AT326814B/de not_active IP Right Cessation
- 1972-01-28 AU AU38450/72A patent/AU474062B2/en not_active Expired
- 1972-01-28 AT AT70272*#A patent/AT327375B/de active
- 1972-01-28 ES ES399267A patent/ES399267A1/es not_active Expired
- 1972-01-28 CH CH124072A patent/CH598261A5/xx not_active IP Right Cessation
- 1972-01-28 DE DE2264676*A patent/DE2264676A1/de active Pending
- 1972-01-31 FR FR7203092A patent/FR2123544B1/fr not_active Expired
-
1974
- 1974-07-01 ES ES427859A patent/ES427859A1/es not_active Expired
-
1977
- 1977-06-24 CH CH774277A patent/CH621790A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ES399267A1 (es) | 1975-06-16 |
| FR2123544A1 (enExample) | 1972-09-08 |
| NL7201157A (enExample) | 1972-08-01 |
| ATA70172A (de) | 1975-03-15 |
| ES427859A1 (es) | 1976-08-01 |
| AU3845072A (en) | 1973-08-02 |
| ATA70272A (de) | 1975-04-15 |
| AT327375B (de) | 1976-01-26 |
| DE2204108A1 (de) | 1972-08-24 |
| FR2123544B1 (enExample) | 1975-10-10 |
| DE2204060A1 (de) | 1972-08-10 |
| AT326814B (de) | 1975-12-29 |
| BE778630A (enExample) | 1972-07-28 |
| DE2264676A1 (de) | 1974-08-08 |
| BE778631A (enExample) | 1972-07-28 |
| GB1389194A (en) | 1975-04-03 |
| CH621790A5 (en) | 1981-02-27 |
| NL7201156A (enExample) | 1972-08-01 |
| CH598261A5 (enExample) | 1978-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU474062B2 (en) | &- hydroxyiminoacylamido and & - acyloxyiminoacylamido penicillin and cephalosporin antibiotics | |
| AU476038B2 (en) | Penicillins and cephalosporins | |
| AU465803B2 (en) | Pencillin and cephalosporin compounds | |
| AU470085B2 (en) | Penicillins and cephalosporins | |
| CA1001153A (en) | Cephalosporin and penicillin intermediates | |
| AU4250472A (en) | Cephalosporins | |
| CA1003404A (en) | Cephalosporin carbamates and processes | |
| CA982117A (en) | Cephalosporin derivatives | |
| AU476331B2 (en) | Cephalosporin derivatives | |
| IE37940B1 (en) | Penicillin and cephalosporin derivatives | |
| AU475444B2 (en) | Cephalosporin antibiotics | |
| CA972362A (en) | Penicillins and cephalosporins | |
| CA1006870A (en) | Thioacetyl penicillins and cephalosporins | |
| IE39743L (en) | Penicillin and cephalosporin derivatives | |
| AU474902B2 (en) | Hydroxyiminoacylamido and (-acyloxyiminiacyl-amido penicillin and cepholosporin antibiotics | |
| AU470859B2 (en) | Penicillin and cephalosporin derivatives | |
| CA986098A (en) | Penicillin and cephalosporin derivatives | |
| CA1003821A (en) | Cephalosporin processes and products | |
| CA914164A (en) | Penicillin and cephalosporin derivatives | |
| CA834727A (en) | Penicillin and cephalosporin derivatives | |
| AU459168B2 (en) | Cephalosporin antibiotics and processes for their production | |
| AU459604B2 (en) | Esters of penicillin and cephalosporin antibiotics | |
| AU3001071A (en) | Cephalosporin antibiotics and processes for their production | |
| CA881488A (en) | Antibiotics | |
| AU463052B2 (en) | Antibiotics |