IE39743L - Penicillin and cephalosporin derivatives - Google Patents
Penicillin and cephalosporin derivativesInfo
- Publication number
- IE39743L IE39743L IE114573A IE114573A IE39743L IE 39743 L IE39743 L IE 39743L IE 114573 A IE114573 A IE 114573A IE 114573 A IE114573 A IE 114573A IE 39743 L IE39743 L IE 39743L
- Authority
- IE
- Ireland
- Prior art keywords
- penicillin
- cephalosporin derivatives
- cephalosporin
- derivatives
- Prior art date
Links
- 229930186147 Cephalosporin Chemical class 0.000 title 1
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical class N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- 150000001780 cephalosporins Chemical class 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3200472A GB1433141A (en) | 1972-07-07 | 1972-07-07 | Antibiotics |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE39743L true IE39743L (en) | 1974-01-07 |
| IE39743B1 IE39743B1 (en) | 1978-12-20 |
Family
ID=10331586
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE114573A IE39743B1 (en) | 1972-07-07 | 1973-07-06 | Improvements in or relating to cephalsoporing an penicillin derivatives |
Country Status (8)
| Country | Link |
|---|---|
| BE (1) | BE801997R (en) |
| ES (1) | ES416646A2 (en) |
| FR (1) | FR2191883B2 (en) |
| GB (1) | GB1433141A (en) |
| IE (1) | IE39743B1 (en) |
| LU (1) | LU67955A1 (en) |
| PH (1) | PH11435A (en) |
| ZA (1) | ZA734593B (en) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1472534A (en) * | 1973-07-06 | 1977-05-04 | Glaxo Lab Ltd | 7beta-hydroxyiminoacylamido-cephalosporins |
| GB9104238D0 (en) * | 1990-03-16 | 1991-04-17 | Ici Pharma | 3-tetrazolylthiomethyl cephalosporin antibiotics |
| CN121181575B (en) * | 2025-11-24 | 2026-02-24 | 重庆汉佩生物科技有限公司 | Antibacterial compound and application and preparation method thereof |
-
1972
- 1972-07-07 GB GB3200472A patent/GB1433141A/en not_active Expired
- 1972-07-28 PH PH13759A patent/PH11435A/en unknown
-
1973
- 1973-07-06 ES ES416646A patent/ES416646A2/en not_active Expired
- 1973-07-06 FR FR7324943A patent/FR2191883B2/fr not_active Expired
- 1973-07-06 ZA ZA734593A patent/ZA734593B/en unknown
- 1973-07-06 LU LU67955D patent/LU67955A1/xx unknown
- 1973-07-06 IE IE114573A patent/IE39743B1/en unknown
- 1973-07-06 BE BE133186A patent/BE801997R/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| LU67955A1 (en) | 1973-09-11 |
| AU5785173A (en) | 1975-01-09 |
| ZA734593B (en) | 1974-06-26 |
| PH11435A (en) | 1978-02-01 |
| FR2191883B2 (en) | 1976-12-17 |
| ES416646A2 (en) | 1977-05-16 |
| IE39743B1 (en) | 1978-12-20 |
| BE801997R (en) | 1974-01-07 |
| FR2191883A2 (en) | 1974-02-08 |
| GB1433141A (en) | 1976-04-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL41361A0 (en) | Novel penicillin and cephalosporin derivatives and their preparation | |
| CA1032531A (en) | Penam and cepham derivatives and preparation thereof | |
| IL42510A0 (en) | Cephalosporin derivatives and their manufacture | |
| IE37402L (en) | Cephalosporin derivatives | |
| AU5321073A (en) | Penicillins and cephalosporins | |
| IL36281A0 (en) | Cephalosporin derivatives | |
| ZA746563B (en) | 2-oxo-1-pyridinyl penicillin and cephalosporin derivatives | |
| ZA731618B (en) | Cephalosporin derivatives | |
| IE37940B1 (en) | Penicillin and cephalosporin derivatives | |
| ZA715018B (en) | Cephalosporin derivatives | |
| IE39743L (en) | Penicillin and cephalosporin derivatives | |
| IL47348A0 (en) | Cephalosporin and penicillin derivatives | |
| PH10739A (en) | 2-4-dioxo-1-pyrimidinyl penicillin and cephalosporin derivatives | |
| IL45877A0 (en) | 4-oxo-1-pyridinyl penicillin and cephalosporin derivatives | |
| ZA738700B (en) | Ethynylindenyl compounds and derivatives thereof | |
| CA1006157A (en) | Penicillin derivatives | |
| ZA748050B (en) | Cephalosporin derivatives | |
| IE37109L (en) | Penicillins and cephalosporins | |
| CA986098A (en) | Penicillin and cephalosporin derivatives | |
| CA914164A (en) | Penicillin and cephalosporin derivatives | |
| ZA738002B (en) | Penam and cepham derivatives and preparation thereof | |
| CA834727A (en) | Penicillin and cephalosporin derivatives | |
| IE37110L (en) | Cephalosporin and penicillin derivatives | |
| ZA746454B (en) | 4-oxo-1-pyridinyl penicillin and cephalosporin derivatives | |
| AU470859B2 (en) | Penicillin and cephalosporin derivatives |