AU2015247382B2 - Beta-lactamases with improved properties for therapy - Google Patents
Beta-lactamases with improved properties for therapy Download PDFInfo
- Publication number
- AU2015247382B2 AU2015247382B2 AU2015247382A AU2015247382A AU2015247382B2 AU 2015247382 B2 AU2015247382 B2 AU 2015247382B2 AU 2015247382 A AU2015247382 A AU 2015247382A AU 2015247382 A AU2015247382 A AU 2015247382A AU 2015247382 B2 AU2015247382 B2 AU 2015247382B2
- Authority
- AU
- Australia
- Prior art keywords
- beta
- lactamase
- mutation
- polar
- ambler classification
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 102000006635 beta-lactamase Human genes 0.000 title claims abstract description 239
- 238000002560 therapeutic procedure Methods 0.000 title claims description 15
- 230000001976 improved effect Effects 0.000 title claims description 9
- 108020004256 Beta-lactamase Proteins 0.000 title abstract description 132
- 239000000203 mixture Substances 0.000 claims abstract description 63
- 238000000034 method Methods 0.000 claims abstract description 57
- 108090000204 Dipeptidase 1 Proteins 0.000 claims description 114
- 230000003115 biocidal effect Effects 0.000 claims description 91
- 230000035772 mutation Effects 0.000 claims description 89
- 239000008194 pharmaceutical composition Substances 0.000 claims description 89
- 230000000694 effects Effects 0.000 claims description 68
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 63
- 239000003242 anti bacterial agent Substances 0.000 claims description 53
- VAAUVRVFOQPIGI-SPQHTLEESA-N ceftriaxone Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1CSC1=NC(=O)C(=O)NN1C VAAUVRVFOQPIGI-SPQHTLEESA-N 0.000 claims description 49
- 229960004755 ceftriaxone Drugs 0.000 claims description 47
- 241000193163 Clostridioides difficile Species 0.000 claims description 44
- 201000010099 disease Diseases 0.000 claims description 43
- 229930186147 Cephalosporin Natural products 0.000 claims description 39
- 229940124587 cephalosporin Drugs 0.000 claims description 39
- 150000001780 cephalosporins Chemical class 0.000 claims description 39
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 claims description 37
- 229960000723 ampicillin Drugs 0.000 claims description 36
- 150000001413 amino acids Chemical group 0.000 claims description 35
- -1 cefozolin Chemical compound 0.000 claims description 35
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Natural products NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 34
- 102220581989 Putative uncharacterized protein FER1L6-AS1_S240D_mutation Human genes 0.000 claims description 31
- 229960004261 cefotaxime Drugs 0.000 claims description 28
- 230000007935 neutral effect Effects 0.000 claims description 23
- 102200026652 rs28371717 Human genes 0.000 claims description 23
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 claims description 22
- 235000004279 alanine Nutrition 0.000 claims description 22
- 229930182555 Penicillin Natural products 0.000 claims description 21
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 claims description 19
- 208000015181 infectious disease Diseases 0.000 claims description 19
- 239000003814 drug Substances 0.000 claims description 17
- 102000040430 polynucleotide Human genes 0.000 claims description 17
- 108091033319 polynucleotide Proteins 0.000 claims description 17
- 239000002157 polynucleotide Substances 0.000 claims description 17
- 102200055882 rs121917721 Human genes 0.000 claims description 17
- 210000000813 small intestine Anatomy 0.000 claims description 17
- 230000002411 adverse Effects 0.000 claims description 16
- 229960001668 cefuroxime Drugs 0.000 claims description 16
- JFPVXVDWJQMJEE-IZRZKJBUSA-N cefuroxime Chemical compound N([C@@H]1C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)\C(=N/OC)C1=CC=CO1 JFPVXVDWJQMJEE-IZRZKJBUSA-N 0.000 claims description 16
- 229960000484 ceftazidime Drugs 0.000 claims description 15
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 15
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 14
- 229960004682 cefoperazone Drugs 0.000 claims description 14
- GCFBRXLSHGKWDP-XCGNWRKASA-N cefoperazone Chemical compound O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC(O)=CC=1)C(=O)N[C@@H]1C(=O)N2C(C(O)=O)=C(CSC=3N(N=NN=3)C)CS[C@@H]21 GCFBRXLSHGKWDP-XCGNWRKASA-N 0.000 claims description 14
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 claims description 13
- 239000002775 capsule Substances 0.000 claims description 12
- 210000001198 duodenum Anatomy 0.000 claims description 12
- 102220059220 rs786202787 Human genes 0.000 claims description 12
- 229940009098 aspartate Drugs 0.000 claims description 11
- 229960002100 cefepime Drugs 0.000 claims description 11
- HVFLCNVBZFFHBT-ZKDACBOMSA-N cefepime Chemical compound S([C@@H]1[C@@H](C(N1C=1C([O-])=O)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1C[N+]1(C)CCCC1 HVFLCNVBZFFHBT-ZKDACBOMSA-N 0.000 claims description 11
- 150000002960 penicillins Chemical class 0.000 claims description 11
- 230000002265 prevention Effects 0.000 claims description 11
- 102220586070 Two pore channel protein 2_D276K_mutation Human genes 0.000 claims description 10
- 229940049954 penicillin Drugs 0.000 claims description 10
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 claims description 9
- 239000004473 Threonine Substances 0.000 claims description 9
- 230000003197 catalytic effect Effects 0.000 claims description 9
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 claims description 9
- DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Natural products OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 claims description 8
- 239000004471 Glycine Substances 0.000 claims description 8
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 claims description 8
- 235000009582 asparagine Nutrition 0.000 claims description 8
- 229960001230 asparagine Drugs 0.000 claims description 8
- 210000001630 jejunum Anatomy 0.000 claims description 8
- 210000003405 ileum Anatomy 0.000 claims description 7
- 239000004475 Arginine Substances 0.000 claims description 6
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 claims description 6
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 claims description 6
- 235000018417 cysteine Nutrition 0.000 claims description 6
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 6
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 102220096007 rs876660626 Human genes 0.000 claims description 6
- 206010012735 Diarrhoea Diseases 0.000 claims description 5
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 claims description 5
- 239000004472 Lysine Substances 0.000 claims description 5
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 claims description 5
- 102200043150 rs121909589 Human genes 0.000 claims description 5
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 claims description 4
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 claims description 4
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 claims description 4
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 claims description 4
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 claims description 4
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 claims description 4
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 claims description 4
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 claims description 4
- 229930195712 glutamate Natural products 0.000 claims description 4
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 claims description 4
- 229960000310 isoleucine Drugs 0.000 claims description 4
- 229930182817 methionine Natural products 0.000 claims description 4
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 claims description 4
- 239000004474 valine Substances 0.000 claims description 4
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 claims description 3
- 102200039244 rs121908530 Human genes 0.000 claims description 2
- 102220493526 Sodium/calcium exchanger 3_F33Y_mutation Human genes 0.000 claims 5
- 125000000613 asparagine group Chemical group N[C@@H](CC(N)=O)C(=O)* 0.000 claims 4
- 125000000637 arginyl group Chemical group N[C@@H](CCCNC(N)=N)C(=O)* 0.000 claims 2
- CKLJMWTZIZZHCS-REOHCLBHSA-L aspartate group Chemical group N[C@@H](CC(=O)[O-])C(=O)[O-] CKLJMWTZIZZHCS-REOHCLBHSA-L 0.000 claims 1
- GPRBEKHLDVQUJE-VINNURBNSA-N cefotaxime Chemical compound N([C@@H]1C(N2C(=C(COC(C)=O)CS[C@@H]21)C(O)=O)=O)C(=O)/C(=N/OC)C1=CSC(N)=N1 GPRBEKHLDVQUJE-VINNURBNSA-N 0.000 claims 1
- NMVPEQXCMGEDNH-TZVUEUGBSA-N ceftazidime pentahydrate Chemical compound O.O.O.O.O.S([C@@H]1[C@@H](C(N1C=1C([O-])=O)=O)NC(=O)\C(=N/OC(C)(C)C(O)=O)C=2N=C(N)SC=2)CC=1C[N+]1=CC=CC=C1 NMVPEQXCMGEDNH-TZVUEUGBSA-N 0.000 claims 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 claims 1
- 125000000430 tryptophan group Chemical group [H]N([H])C(C(=O)O*)C([H])([H])C1=C([H])N([H])C2=C([H])C([H])=C([H])C([H])=C12 0.000 claims 1
- 102000004190 Enzymes Human genes 0.000 abstract description 37
- 108090000790 Enzymes Proteins 0.000 abstract description 37
- 210000001035 gastrointestinal tract Anatomy 0.000 abstract description 19
- 101800001318 Capsid protein VP4 Proteins 0.000 description 119
- 239000003795 chemical substances by application Substances 0.000 description 90
- 108090000623 proteins and genes Proteins 0.000 description 71
- 235000018102 proteins Nutrition 0.000 description 70
- 102000004169 proteins and genes Human genes 0.000 description 68
- 239000000523 sample Substances 0.000 description 50
- 229940024606 amino acid Drugs 0.000 description 37
- 235000001014 amino acid Nutrition 0.000 description 37
- 210000004027 cell Anatomy 0.000 description 36
- 210000001072 colon Anatomy 0.000 description 29
- AZZMGZXNTDTSME-JUZDKLSSSA-M cefotaxime sodium Chemical compound [Na+].N([C@@H]1C(N2C(=C(COC(C)=O)CS[C@@H]21)C([O-])=O)=O)C(=O)\C(=N/OC)C1=CSC(N)=N1 AZZMGZXNTDTSME-JUZDKLSSSA-M 0.000 description 28
- 238000004191 hydrophobic interaction chromatography Methods 0.000 description 28
- 102220398968 c.731G>C Human genes 0.000 description 26
- 238000003556 assay Methods 0.000 description 24
- 238000011282 treatment Methods 0.000 description 24
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 23
- 230000001580 bacterial effect Effects 0.000 description 22
- 239000012530 fluid Substances 0.000 description 22
- 102200052244 rs199469624 Human genes 0.000 description 22
- 102200022214 rs372080941 Human genes 0.000 description 22
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 21
- 229940088710 antibiotic agent Drugs 0.000 description 21
- 241000282414 Homo sapiens Species 0.000 description 20
- 235000014469 Bacillus subtilis Nutrition 0.000 description 19
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 19
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 19
- 208000035475 disorder Diseases 0.000 description 19
- 238000004458 analytical method Methods 0.000 description 18
- 239000008103 glucose Substances 0.000 description 18
- ORFOPKXBNMVMKC-DWVKKRMSSA-N ceftazidime Chemical compound S([C@@H]1[C@@H](C(N1C=1C([O-])=O)=O)NC(=O)\C(=N/OC(C)(C)C(O)=O)C=2N=C(N)SC=2)CC=1C[N+]1=CC=CC=C1 ORFOPKXBNMVMKC-DWVKKRMSSA-N 0.000 description 17
- 241000588724 Escherichia coli Species 0.000 description 16
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 16
- 238000010828 elution Methods 0.000 description 16
- 239000000706 filtrate Substances 0.000 description 16
- 230000002496 gastric effect Effects 0.000 description 16
- 235000002639 sodium chloride Nutrition 0.000 description 16
- 102220542936 Eukaryotic peptide chain release factor GTP-binding subunit ERF3A_S233Y_mutation Human genes 0.000 description 15
- 125000003275 alpha amino acid group Chemical group 0.000 description 15
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 15
- 210000002429 large intestine Anatomy 0.000 description 14
- 238000000746 purification Methods 0.000 description 14
- 230000001225 therapeutic effect Effects 0.000 description 14
- 102220509110 Sphingosine 1-phosphate receptor 1_E146Y_mutation Human genes 0.000 description 13
- 238000009472 formulation Methods 0.000 description 13
- 150000003839 salts Chemical class 0.000 description 13
- 238000002415 sodium dodecyl sulfate polyacrylamide gel electrophoresis Methods 0.000 description 13
- 241000894006 Bacteria Species 0.000 description 12
- 239000001166 ammonium sulphate Substances 0.000 description 12
- 235000011130 ammonium sulphate Nutrition 0.000 description 12
- 230000002401 inhibitory effect Effects 0.000 description 12
- 244000005700 microbiome Species 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 229960005256 sulbactam Drugs 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 11
- 239000013543 active substance Substances 0.000 description 11
- 230000015556 catabolic process Effects 0.000 description 11
- 238000006731 degradation reaction Methods 0.000 description 11
- FKENQMMABCRJMK-RITPCOANSA-N sulbactam Chemical compound O=S1(=O)C(C)(C)[C@H](C(O)=O)N2C(=O)C[C@H]21 FKENQMMABCRJMK-RITPCOANSA-N 0.000 description 11
- 239000013598 vector Substances 0.000 description 11
- 102220520039 Guanylyl cyclase-activating protein 1_E128Y_mutation Human genes 0.000 description 10
- 102220576557 HLA class I histocompatibility antigen, A alpha chain_F33Y_mutation Human genes 0.000 description 10
- 102000035195 Peptidases Human genes 0.000 description 10
- 108091005804 Peptidases Proteins 0.000 description 10
- 239000004365 Protease Substances 0.000 description 10
- 238000000576 coating method Methods 0.000 description 10
- 239000012228 culture supernatant Substances 0.000 description 10
- 230000003247 decreasing effect Effects 0.000 description 10
- 230000002209 hydrophobic effect Effects 0.000 description 10
- 102220090324 rs876657851 Human genes 0.000 description 10
- 208000024891 symptom Diseases 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- 238000011360 adjunctive therapy Methods 0.000 description 9
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 9
- 229960001139 cefazolin Drugs 0.000 description 9
- 238000013270 controlled release Methods 0.000 description 9
- 238000010790 dilution Methods 0.000 description 9
- 239000012895 dilution Substances 0.000 description 9
- 238000002474 experimental method Methods 0.000 description 9
- 239000000499 gel Substances 0.000 description 9
- 125000001165 hydrophobic group Chemical group 0.000 description 9
- 238000002347 injection Methods 0.000 description 9
- 239000007924 injection Substances 0.000 description 9
- 230000000968 intestinal effect Effects 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 230000004048 modification Effects 0.000 description 9
- 238000012986 modification Methods 0.000 description 9
- 239000013612 plasmid Substances 0.000 description 9
- 238000002741 site-directed mutagenesis Methods 0.000 description 9
- 229940124597 therapeutic agent Drugs 0.000 description 9
- 102220543096 Protein pitchfork_T48V_mutation Human genes 0.000 description 8
- 238000004113 cell culture Methods 0.000 description 8
- 230000003111 delayed effect Effects 0.000 description 8
- 230000001419 dependent effect Effects 0.000 description 8
- 239000002552 dosage form Substances 0.000 description 8
- 230000000670 limiting effect Effects 0.000 description 8
- 229960002260 meropenem Drugs 0.000 description 8
- DMJNNHOOLUXYBV-PQTSNVLCSA-N meropenem Chemical compound C=1([C@H](C)[C@@H]2[C@H](C(N2C=1C(O)=O)=O)[C@H](O)C)S[C@@H]1CN[C@H](C(=O)N(C)C)C1 DMJNNHOOLUXYBV-PQTSNVLCSA-N 0.000 description 8
- 238000002708 random mutagenesis Methods 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- 102220645900 Protein pitchfork_T48R_mutation Human genes 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 239000011248 coating agent Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 238000011534 incubation Methods 0.000 description 7
- 239000002773 nucleotide Substances 0.000 description 7
- 125000003729 nucleotide group Chemical group 0.000 description 7
- 239000006228 supernatant Substances 0.000 description 7
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 6
- 241000193830 Bacillus <bacterium> Species 0.000 description 6
- JFPVXVDWJQMJEE-QMTHXVAHSA-N Cefuroxime Chemical compound N([C@@H]1C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)C(=NOC)C1=CC=CO1 JFPVXVDWJQMJEE-QMTHXVAHSA-N 0.000 description 6
- HZZVJAQRINQKSD-UHFFFAOYSA-N Clavulanic acid Natural products OC(=O)C1C(=CCO)OC2CC(=O)N21 HZZVJAQRINQKSD-UHFFFAOYSA-N 0.000 description 6
- 206010029803 Nosocomial infection Diseases 0.000 description 6
- 101710084578 Short neurotoxin 1 Proteins 0.000 description 6
- 101710182532 Toxin a Proteins 0.000 description 6
- 230000008901 benefit Effects 0.000 description 6
- 239000003781 beta lactamase inhibitor Substances 0.000 description 6
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 6
- 229940126813 beta-lactamase inhibitor Drugs 0.000 description 6
- 210000004534 cecum Anatomy 0.000 description 6
- 230000008859 change Effects 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000010586 diagram Methods 0.000 description 6
- 230000002255 enzymatic effect Effects 0.000 description 6
- 230000001404 mediated effect Effects 0.000 description 6
- 239000012528 membrane Substances 0.000 description 6
- 210000004379 membrane Anatomy 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- 238000013268 sustained release Methods 0.000 description 6
- 239000012730 sustained-release form Substances 0.000 description 6
- 150000003952 β-lactams Chemical class 0.000 description 6
- 229910019142 PO4 Inorganic materials 0.000 description 5
- 102220506476 Phenylalanine-tRNA ligase, mitochondrial_P77V_mutation Human genes 0.000 description 5
- 102220472148 Protein ENL_E11N_mutation Human genes 0.000 description 5
- 108010076504 Protein Sorting Signals Proteins 0.000 description 5
- 125000000539 amino acid group Chemical group 0.000 description 5
- 108010032601 beta-lactamase CTX-2 Proteins 0.000 description 5
- OWMVSZAMULFTJU-UHFFFAOYSA-N bis-tris Chemical compound OCCN(CCO)C(CO)(CO)CO OWMVSZAMULFTJU-UHFFFAOYSA-N 0.000 description 5
- 229960003324 clavulanic acid Drugs 0.000 description 5
- HZZVJAQRINQKSD-PBFISZAISA-N clavulanic acid Chemical compound OC(=O)[C@H]1C(=C/CO)/O[C@@H]2CC(=O)N21 HZZVJAQRINQKSD-PBFISZAISA-N 0.000 description 5
- 230000000593 degrading effect Effects 0.000 description 5
- 238000005516 engineering process Methods 0.000 description 5
- 230000006872 improvement Effects 0.000 description 5
- 238000001990 intravenous administration Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000011159 matrix material Substances 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- 101150019841 penP gene Proteins 0.000 description 5
- 239000010452 phosphate Substances 0.000 description 5
- WCMIIGXFCMNQDS-IDYPWDAWSA-M piperacillin sodium Chemical compound [Na+].O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N2[C@@H](C([O-])=O)C(C)(C)S[C@@H]21 WCMIIGXFCMNQDS-IDYPWDAWSA-M 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 210000002784 stomach Anatomy 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000000108 ultra-filtration Methods 0.000 description 5
- LHNIIDJCEODSHA-OQRUQETBSA-N (6r,7r)-3-[(e)-2-(2,4-dinitrophenyl)ethenyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N([C@H]1[C@H]2SCC(=C(N2C1=O)C(=O)O)\C=C\C=1C(=CC(=CC=1)[N+]([O-])=O)[N+]([O-])=O)C(=O)CC1=CC=CS1 LHNIIDJCEODSHA-OQRUQETBSA-N 0.000 description 4
- FUOOLUPWFVMBKG-UHFFFAOYSA-N 2-Aminoisobutyric acid Chemical compound CC(C)(N)C(O)=O FUOOLUPWFVMBKG-UHFFFAOYSA-N 0.000 description 4
- 102220590671 Adenylosuccinate synthetase isozyme 1_N106Y_mutation Human genes 0.000 description 4
- 108010011667 Ala-Phe-Ala Proteins 0.000 description 4
- 102220638160 Arylamine N-acetyltransferase 1_R64K_mutation Human genes 0.000 description 4
- 206010009657 Clostridium difficile colitis Diseases 0.000 description 4
- 102220487212 Cytochrome b-245 chaperone 1_D188H_mutation Human genes 0.000 description 4
- 102000009596 GDP-dissociation inhibitor activity proteins Human genes 0.000 description 4
- 244000199885 Lactobacillus bulgaricus Species 0.000 description 4
- 235000013960 Lactobacillus bulgaricus Nutrition 0.000 description 4
- 208000012868 Overgrowth Diseases 0.000 description 4
- 108010087702 Penicillinase Proteins 0.000 description 4
- 102220627977 Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2_N106T_mutation Human genes 0.000 description 4
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 108010059993 Vancomycin Proteins 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 238000012512 characterization method Methods 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- 238000013461 design Methods 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 230000002068 genetic effect Effects 0.000 description 4
- 244000005709 gut microbiome Species 0.000 description 4
- 229940004208 lactobacillus bulgaricus Drugs 0.000 description 4
- 108010034529 leucyl-lysine Proteins 0.000 description 4
- 239000002502 liposome Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000002703 mutagenesis Methods 0.000 description 4
- 231100000350 mutagenesis Toxicity 0.000 description 4
- 229940124531 pharmaceutical excipient Drugs 0.000 description 4
- 229960002292 piperacillin Drugs 0.000 description 4
- 238000011533 pre-incubation Methods 0.000 description 4
- 238000000547 structure data Methods 0.000 description 4
- 230000009885 systemic effect Effects 0.000 description 4
- MYPYJXKWCTUITO-LYRMYLQWSA-N vancomycin Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C2C=C3C=C1OC1=CC=C(C=C1Cl)[C@@H](O)[C@H](C(N[C@@H](CC(N)=O)C(=O)N[C@H]3C(=O)N[C@H]1C(=O)N[C@H](C(N[C@@H](C3=CC(O)=CC(O)=C3C=3C(O)=CC=C1C=3)C(O)=O)=O)[C@H](O)C1=CC=C(C(=C1)Cl)O2)=O)NC(=O)[C@@H](CC(C)C)NC)[C@H]1C[C@](C)(N)[C@H](O)[C@H](C)O1 MYPYJXKWCTUITO-LYRMYLQWSA-N 0.000 description 4
- MYPYJXKWCTUITO-UHFFFAOYSA-N vancomycin Natural products O1C(C(=C2)Cl)=CC=C2C(O)C(C(NC(C2=CC(O)=CC(O)=C2C=2C(O)=CC=C3C=2)C(O)=O)=O)NC(=O)C3NC(=O)C2NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CC(C)C)NC)C(O)C(C=C3Cl)=CC=C3OC3=CC2=CC1=C3OC1OC(CO)C(O)C(O)C1OC1CC(C)(N)C(O)C(C)O1 MYPYJXKWCTUITO-UHFFFAOYSA-N 0.000 description 4
- 239000003981 vehicle Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 102220580808 15-hydroxyprostaglandin dehydrogenase [NAD(+)]_Q148N_mutation Human genes 0.000 description 3
- FWMNVWWHGCHHJJ-SKKKGAJSSA-N 4-amino-1-[(2r)-6-amino-2-[[(2r)-2-[[(2r)-2-[[(2r)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid Chemical compound C([C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(CC1)C(O)=O)NC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 FWMNVWWHGCHHJJ-SKKKGAJSSA-N 0.000 description 3
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 3
- 208000004998 Abdominal Pain Diseases 0.000 description 3
- 244000063299 Bacillus subtilis Species 0.000 description 3
- 102220565164 Cellular tumor antigen p53_S240P_mutation Human genes 0.000 description 3
- 108020004705 Codon Proteins 0.000 description 3
- 102220554117 Cyclic GMP-AMP synthase_L17T_mutation Human genes 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 102220597459 Formyltetrahydrofolate synthetase_K56Q_mutation Human genes 0.000 description 3
- 102220597499 Formyltetrahydrofolate synthetase_K56T_mutation Human genes 0.000 description 3
- 102220561149 Furin_E249Q_mutation Human genes 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- 102220624327 Interferon alpha-8_N106Y_mutation Human genes 0.000 description 3
- 240000001046 Lactobacillus acidophilus Species 0.000 description 3
- 235000013956 Lactobacillus acidophilus Nutrition 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 102220526795 Methenyltetrahydrofolate cyclohydrolase_D225E_mutation Human genes 0.000 description 3
- 241000736262 Microbiota Species 0.000 description 3
- 102220514706 Myoglobin_D94S_mutation Human genes 0.000 description 3
- YBAFDPFAUTYYRW-UHFFFAOYSA-N N-L-alpha-glutamyl-L-leucine Natural products CC(C)CC(C(O)=O)NC(=O)C(N)CCC(O)=O YBAFDPFAUTYYRW-UHFFFAOYSA-N 0.000 description 3
- 206010028813 Nausea Diseases 0.000 description 3
- 108091028043 Nucleic acid sequence Proteins 0.000 description 3
- 102220512045 Protein N-terminal glutamine amidohydrolase_E121D_mutation Human genes 0.000 description 3
- 206010037660 Pyrexia Diseases 0.000 description 3
- 102220478924 Sodium channel protein type 2 subunit alpha_A240S_mutation Human genes 0.000 description 3
- 102220509095 Sphingosine 1-phosphate receptor 1_E146T_mutation Human genes 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 102220529137 T-box transcription factor TBX19_P226W_mutation Human genes 0.000 description 3
- 101710182223 Toxin B Proteins 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 238000002835 absorbance Methods 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- QWCKQJZIFLGMSD-UHFFFAOYSA-N alpha-aminobutyric acid Chemical compound CCC(N)C(O)=O QWCKQJZIFLGMSD-UHFFFAOYSA-N 0.000 description 3
- 229960003022 amoxicillin Drugs 0.000 description 3
- 238000010171 animal model Methods 0.000 description 3
- 108010068385 carbapenemase Proteins 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 235000010980 cellulose Nutrition 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 238000005119 centrifugation Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000029142 excretion Effects 0.000 description 3
- ZVGNESXIJDCBKN-UUEYKCAUSA-N fidaxomicin Chemical compound O([C@@H]1[C@@H](C)O[C@H]([C@H]([C@H]1O)OC)OCC\1=C/C=C/C[C@H](O)/C(C)=C/[C@@H]([C@H](/C(C)=C/C(/C)=C/C[C@H](OC/1=O)[C@@H](C)O)O[C@H]1[C@H]([C@@H](O)[C@H](OC(=O)C(C)C)C(C)(C)O1)O)CC)C(=O)C1=C(O)C(Cl)=C(O)C(Cl)=C1CC ZVGNESXIJDCBKN-UUEYKCAUSA-N 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 3
- 150000004679 hydroxides Chemical class 0.000 description 3
- 210000000987 immune system Anatomy 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 229940039695 lactobacillus acidophilus Drugs 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 238000012417 linear regression Methods 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- VAOCPAMSLUNLGC-UHFFFAOYSA-N metronidazole Chemical group CC1=NC=C([N+]([O-])=O)N1CCO VAOCPAMSLUNLGC-UHFFFAOYSA-N 0.000 description 3
- 230000000813 microbial effect Effects 0.000 description 3
- 230000008693 nausea Effects 0.000 description 3
- 108010071437 oxacillinase Proteins 0.000 description 3
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000000063 preceeding effect Effects 0.000 description 3
- 239000006041 probiotic Substances 0.000 description 3
- 235000018291 probiotics Nutrition 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 210000000664 rectum Anatomy 0.000 description 3
- 239000012925 reference material Substances 0.000 description 3
- 238000013207 serial dilution Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- LPQZKKCYTLCDGQ-WEDXCCLWSA-N tazobactam Chemical compound C([C@]1(C)S([C@H]2N(C(C2)=O)[C@H]1C(O)=O)(=O)=O)N1C=CN=N1 LPQZKKCYTLCDGQ-WEDXCCLWSA-N 0.000 description 3
- 229960003865 tazobactam Drugs 0.000 description 3
- 239000003053 toxin Substances 0.000 description 3
- 231100000765 toxin Toxicity 0.000 description 3
- 108700012359 toxins Proteins 0.000 description 3
- 230000009261 transgenic effect Effects 0.000 description 3
- 229960003165 vancomycin Drugs 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 2
- WDLWHQDACQUCJR-ZAMMOSSLSA-N (6r,7r)-7-[[(2r)-2-azaniumyl-2-(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-[(e)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)/C=C/C)C(O)=O)=CC=C(O)C=C1 WDLWHQDACQUCJR-ZAMMOSSLSA-N 0.000 description 2
- 102220643913 39S ribosomal protein L9, mitochondrial_D101E_mutation Human genes 0.000 description 2
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 description 2
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 2
- LSLIRHLIUDVNBN-CIUDSAMLSA-N Ala-Asp-Lys Chemical compound C[C@H](N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](C(O)=O)CCCCN LSLIRHLIUDVNBN-CIUDSAMLSA-N 0.000 description 2
- CSAHOYQKNHGDHX-ACZMJKKPSA-N Ala-Gln-Asn Chemical compound C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(O)=O CSAHOYQKNHGDHX-ACZMJKKPSA-N 0.000 description 2
- SMCGQGDVTPFXKB-XPUUQOCRSA-N Ala-Gly-Val Chemical compound CC(C)[C@@H](C(O)=O)NC(=O)CNC(=O)[C@H](C)N SMCGQGDVTPFXKB-XPUUQOCRSA-N 0.000 description 2
- CFPQUJZTLUQUTJ-HTFCKZLJSA-N Ala-Ile-Ile Chemical compound CC[C@H](C)[C@@H](C(O)=O)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@H](C)N CFPQUJZTLUQUTJ-HTFCKZLJSA-N 0.000 description 2
- PMQXMXAASGFUDX-SRVKXCTJSA-N Ala-Lys-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](C)N)CCCCN PMQXMXAASGFUDX-SRVKXCTJSA-N 0.000 description 2
- XRUJOVRWNMBAAA-NHCYSSNCSA-N Ala-Phe-Ala Chemical compound OC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@@H](N)C)CC1=CC=CC=C1 XRUJOVRWNMBAAA-NHCYSSNCSA-N 0.000 description 2
- SYIFFFHSXBNPMC-UWJYBYFXSA-N Ala-Ser-Tyr Chemical compound C[C@@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O)N SYIFFFHSXBNPMC-UWJYBYFXSA-N 0.000 description 2
- 102220477559 Aldehyde oxidase_E175H_mutation Human genes 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- 102220625509 Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3_L177N_mutation Human genes 0.000 description 2
- 102220625508 Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3_L177Q_mutation Human genes 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ZTKHZAXGTFXUDD-VEVYYDQMSA-N Arg-Asn-Thr Chemical compound [H]N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O ZTKHZAXGTFXUDD-VEVYYDQMSA-N 0.000 description 2
- NKBQZKVMKJJDLX-SRVKXCTJSA-N Arg-Glu-Leu Chemical compound [H]N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(O)=O NKBQZKVMKJJDLX-SRVKXCTJSA-N 0.000 description 2
- DPLFNLDACGGBAK-KKUMJFAQSA-N Arg-Phe-Glu Chemical compound C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)NC(=O)[C@H](CCCN=C(N)N)N DPLFNLDACGGBAK-KKUMJFAQSA-N 0.000 description 2
- XRNXPIGJPQHCPC-RCWTZXSCSA-N Arg-Thr-Val Chemical compound CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CCCNC(N)=N)[C@@H](C)O)C(O)=O XRNXPIGJPQHCPC-RCWTZXSCSA-N 0.000 description 2
- QHUOOCKNNURZSL-IHRRRGAJSA-N Arg-Tyr-Ser Chemical compound [H]N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CO)C(O)=O QHUOOCKNNURZSL-IHRRRGAJSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- ZWASIOHRQWRWAS-UGYAYLCHSA-N Asn-Asp-Ile Chemical compound [H]N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(O)=O ZWASIOHRQWRWAS-UGYAYLCHSA-N 0.000 description 2
- DMLSCRJBWUEALP-LAEOZQHASA-N Asn-Glu-Val Chemical compound [H]N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(O)=O DMLSCRJBWUEALP-LAEOZQHASA-N 0.000 description 2
- OLVIPTLKNSAYRJ-YUMQZZPRSA-N Asn-Gly-Lys Chemical compound C(CCN)C[C@@H](C(=O)O)NC(=O)CNC(=O)[C@H](CC(=O)N)N OLVIPTLKNSAYRJ-YUMQZZPRSA-N 0.000 description 2
- YUOXLJYVSZYPBJ-CIUDSAMLSA-N Asn-Pro-Glu Chemical compound [H]N[C@@H](CC(N)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(O)=O)C(O)=O YUOXLJYVSZYPBJ-CIUDSAMLSA-N 0.000 description 2
- GKKUBLFXKRDMFC-BQBZGAKWSA-N Asn-Pro-Gly Chemical compound [H]N[C@@H](CC(N)=O)C(=O)N1CCC[C@H]1C(=O)NCC(O)=O GKKUBLFXKRDMFC-BQBZGAKWSA-N 0.000 description 2
- YNQIDCRRTWGHJD-ZLUOBGJFSA-N Asp-Asn-Ala Chemical compound OC(=O)[C@H](C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CC(O)=O YNQIDCRRTWGHJD-ZLUOBGJFSA-N 0.000 description 2
- GCACQYDBDHRVGE-LKXGYXEUSA-N Asp-Thr-Ser Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](N)CC(O)=O GCACQYDBDHRVGE-LKXGYXEUSA-N 0.000 description 2
- 102220617592 B1 bradykinin receptor_S42C_mutation Human genes 0.000 description 2
- 102220470698 BUD13 homolog_V30P_mutation Human genes 0.000 description 2
- 241000194108 Bacillus licheniformis Species 0.000 description 2
- 102220548456 CBY1-interacting BAR domain-containing protein 1_G113S_mutation Human genes 0.000 description 2
- 102220534033 Cadherin-1_P170V_mutation Human genes 0.000 description 2
- 101100468275 Caenorhabditis elegans rep-1 gene Proteins 0.000 description 2
- 102000014914 Carrier Proteins Human genes 0.000 description 2
- 208000017667 Chronic Disease Diseases 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 2
- 206010011409 Cross infection Diseases 0.000 description 2
- 102220472972 Cytochrome c oxidase subunit 6B1_E141V_mutation Human genes 0.000 description 2
- 238000001712 DNA sequencing Methods 0.000 description 2
- 208000005156 Dehydration Diseases 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 102220476614 Dynein axonemal assembly factor 10_T185S_mutation Human genes 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 102220516909 Estrogen-related receptor gamma_F38E_mutation Human genes 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 102220625746 FAD-linked sulfhydryl oxidase ALR_S234N_mutation Human genes 0.000 description 2
- UIOFUWFRIANQPC-JKIFEVAISA-N Floxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=C(F)C=CC=C1Cl UIOFUWFRIANQPC-JKIFEVAISA-N 0.000 description 2
- 102220563892 Forkhead box protein O3_K245A_mutation Human genes 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 102220541665 Gliomedin_L156C_mutation Human genes 0.000 description 2
- IDEODOAVGCMUQV-GUBZILKMSA-N Glu-Ser-Leu Chemical compound [H]N[C@@H](CCC(O)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(O)=O IDEODOAVGCMUQV-GUBZILKMSA-N 0.000 description 2
- MWTGQXBHVRTCOR-GLLZPBPUSA-N Glu-Thr-Gln Chemical compound [H]N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(N)=O)C(O)=O MWTGQXBHVRTCOR-GLLZPBPUSA-N 0.000 description 2
- WGYHAAXZWPEBDQ-IFFSRLJSSA-N Glu-Val-Thr Chemical compound [H]N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)O)C(O)=O WGYHAAXZWPEBDQ-IFFSRLJSSA-N 0.000 description 2
- 102220529427 Glutathione S-transferase LANCL1_R134N_mutation Human genes 0.000 description 2
- BUEFQXUHTUZXHR-LURJTMIESA-N Gly-Gly-Pro zwitterion Chemical compound NCC(=O)NCC(=O)N1CCC[C@H]1C(O)=O BUEFQXUHTUZXHR-LURJTMIESA-N 0.000 description 2
- YXTFLTJYLIAZQG-FJXKBIBVSA-N Gly-Thr-Arg Chemical compound NCC(=O)N[C@@H]([C@H](O)C)C(=O)N[C@H](C(O)=O)CCCN=C(N)N YXTFLTJYLIAZQG-FJXKBIBVSA-N 0.000 description 2
- 102220562001 HLA class I histocompatibility antigen, A alpha chain_D5E_mutation Human genes 0.000 description 2
- TZCGZYWNIDZZMR-UHFFFAOYSA-N Ile-Arg-Ala Natural products CCC(C)C(N)C(=O)NC(C(=O)NC(C)C(O)=O)CCCN=C(N)N TZCGZYWNIDZZMR-UHFFFAOYSA-N 0.000 description 2
- KFVUBLZRFSVDGO-BYULHYEWSA-N Ile-Gly-Asp Chemical compound CC[C@H](C)[C@H](N)C(=O)NCC(=O)N[C@H](C(O)=O)CC(O)=O KFVUBLZRFSVDGO-BYULHYEWSA-N 0.000 description 2
- 102220471661 Interleukin-10 receptor subunit alpha_W220F_mutation Human genes 0.000 description 2
- 244000199866 Lactobacillus casei Species 0.000 description 2
- 235000013958 Lactobacillus casei Nutrition 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- YOZCKMXHBYKOMQ-IHRRRGAJSA-N Leu-Arg-Lys Chemical compound CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)O)N YOZCKMXHBYKOMQ-IHRRRGAJSA-N 0.000 description 2
- KAFOIVJDVSZUMD-UHFFFAOYSA-N Leu-Gln-Gln Natural products CC(C)CC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CCC(N)=O)C(O)=O KAFOIVJDVSZUMD-UHFFFAOYSA-N 0.000 description 2
- HFBCHNRFRYLZNV-GUBZILKMSA-N Leu-Glu-Asp Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(O)=O HFBCHNRFRYLZNV-GUBZILKMSA-N 0.000 description 2
- AVEGDIAXTDVBJS-XUXIUFHCSA-N Leu-Ile-Arg Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O AVEGDIAXTDVBJS-XUXIUFHCSA-N 0.000 description 2
- KOSWSHVQIVTVQF-ZPFDUUQYSA-N Leu-Ile-Asp Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(O)=O)C(O)=O KOSWSHVQIVTVQF-ZPFDUUQYSA-N 0.000 description 2
- KUIDCYNIEJBZBU-AJNGGQMLSA-N Leu-Ile-Leu Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(O)=O KUIDCYNIEJBZBU-AJNGGQMLSA-N 0.000 description 2
- QESXLSQLQHHTIX-RHYQMDGZSA-N Leu-Val-Thr Chemical compound CC(C)C[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)O)C(O)=O QESXLSQLQHHTIX-RHYQMDGZSA-N 0.000 description 2
- YVMQJGWLHRWMDF-MNXVOIDGSA-N Lys-Gln-Ile Chemical compound CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](CCCCN)N YVMQJGWLHRWMDF-MNXVOIDGSA-N 0.000 description 2
- GPJGFSFYBJGYRX-YUMQZZPRSA-N Lys-Gly-Asp Chemical compound NCCCC[C@H](N)C(=O)NCC(=O)N[C@H](C(O)=O)CC(O)=O GPJGFSFYBJGYRX-YUMQZZPRSA-N 0.000 description 2
- YPLVCBKEPJPBDQ-MELADBBJSA-N Lys-Leu-Pro Chemical compound CC(C)C[C@@H](C(=O)N1CCC[C@@H]1C(=O)O)NC(=O)[C@H](CCCCN)N YPLVCBKEPJPBDQ-MELADBBJSA-N 0.000 description 2
- UQRZFMQQXXJTTF-AVGNSLFASA-N Lys-Lys-Glu Chemical compound [H]N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(O)=O UQRZFMQQXXJTTF-AVGNSLFASA-N 0.000 description 2
- 102220644371 Lysophosphatidic acid phosphatase type 6_A257L_mutation Human genes 0.000 description 2
- 101710084218 Master replication protein Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- RJQXTJLFIWVMTO-TYNCELHUSA-N Methicillin Chemical compound COC1=CC=CC(OC)=C1C(=O)N[C@@H]1C(=O)N2[C@@H](C(O)=O)C(C)(C)S[C@@H]21 RJQXTJLFIWVMTO-TYNCELHUSA-N 0.000 description 2
- 108010021466 Mutant Proteins Proteins 0.000 description 2
- 102000008300 Mutant Proteins Human genes 0.000 description 2
- 102220561253 Myocardin-related transcription factor B_L52D_mutation Human genes 0.000 description 2
- 102220561257 Myocardin-related transcription factor B_L89D_mutation Human genes 0.000 description 2
- 102220531926 N-acetylaspartylglutamate synthase A_L109M_mutation Human genes 0.000 description 2
- AJHCSUXXECOXOY-UHFFFAOYSA-N N-glycyl-L-tryptophan Natural products C1=CC=C2C(CC(NC(=O)CN)C(O)=O)=CNC2=C1 AJHCSUXXECOXOY-UHFFFAOYSA-N 0.000 description 2
- 108010002311 N-glycylglutamic acid Proteins 0.000 description 2
- 102220581723 Neuron navigator 1_D127W_mutation Human genes 0.000 description 2
- 102220547894 Nucleobindin-1_N140H_mutation Human genes 0.000 description 2
- 208000002193 Pain Diseases 0.000 description 2
- 101710112078 Para-Rep C2 Proteins 0.000 description 2
- 102220517306 Phosphate-regulating neutral endopeptidase PHEX_K168R_mutation Human genes 0.000 description 2
- 241000235648 Pichia Species 0.000 description 2
- 102220596269 Pre-mRNA-splicing factor CWC22 homolog_G211W_mutation Human genes 0.000 description 2
- SGCZFWSQERRKBD-BQBZGAKWSA-N Pro-Asp-Gly Chemical compound OC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@@H]1CCCN1 SGCZFWSQERRKBD-BQBZGAKWSA-N 0.000 description 2
- NXEYSLRNNPWCRN-SRVKXCTJSA-N Pro-Glu-Leu Chemical compound [H]N1CCC[C@H]1C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(O)=O NXEYSLRNNPWCRN-SRVKXCTJSA-N 0.000 description 2
- FHJQROWZEJFZPO-SRVKXCTJSA-N Pro-Val-Val Chemical compound CC(C)[C@@H](C(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H]1CCCN1 FHJQROWZEJFZPO-SRVKXCTJSA-N 0.000 description 2
- 102220511117 Probable aminopeptidase NPEPL1_G86P_mutation Human genes 0.000 description 2
- 102220506594 Prolyl endopeptidase FAP_R123E_mutation Human genes 0.000 description 2
- 102220620624 Protein pitchfork_D179A_mutation Human genes 0.000 description 2
- 102220645899 Protein pitchfork_T48W_mutation Human genes 0.000 description 2
- 241000588769 Proteus <enterobacteria> Species 0.000 description 2
- 241000588767 Proteus vulgaris Species 0.000 description 2
- 208000003100 Pseudomembranous Enterocolitis Diseases 0.000 description 2
- 206010037128 Pseudomembranous colitis Diseases 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 102220536030 Quinone oxidoreductase-like protein 1_N143L_mutation Human genes 0.000 description 2
- ZVGNESXIJDCBKN-WUIGKKEISA-N R-Tiacumicin B Natural products O([C@@H]1[C@@H](C)O[C@H]([C@H]([C@H]1O)OC)OCC1=CC=CC[C@H](O)C(C)=C[C@@H]([C@H](C(C)=CC(C)=CC[C@H](OC1=O)[C@@H](C)O)O[C@H]1[C@H]([C@@H](O)[C@H](OC(=O)C(C)C)C(C)(C)O1)O)CC)C(=O)C1=C(O)C(Cl)=C(O)C(Cl)=C1CC ZVGNESXIJDCBKN-WUIGKKEISA-N 0.000 description 2
- 241000235070 Saccharomyces Species 0.000 description 2
- 241000187560 Saccharopolyspora Species 0.000 description 2
- QEDMOZUJTGEIBF-FXQIFTODSA-N Ser-Arg-Asp Chemical compound [H]N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(O)=O QEDMOZUJTGEIBF-FXQIFTODSA-N 0.000 description 2
- QKQDTEYDEIJPNK-GUBZILKMSA-N Ser-Glu-Lys Chemical compound NCCCC[C@@H](C(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](N)CO QKQDTEYDEIJPNK-GUBZILKMSA-N 0.000 description 2
- QYSFWUIXDFJUDW-DCAQKATOSA-N Ser-Leu-Arg Chemical compound [H]N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O QYSFWUIXDFJUDW-DCAQKATOSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000194020 Streptococcus thermophilus Species 0.000 description 2
- MQCPGOZXFSYJPS-KZVJFYERSA-N Thr-Ala-Arg Chemical compound [H]N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O MQCPGOZXFSYJPS-KZVJFYERSA-N 0.000 description 2
- SLUWOCTZVGMURC-BFHQHQDPSA-N Thr-Gly-Ala Chemical compound C[C@@H](O)[C@H](N)C(=O)NCC(=O)N[C@@H](C)C(O)=O SLUWOCTZVGMURC-BFHQHQDPSA-N 0.000 description 2
- NIEWSKWFURSECR-FOHZUACHSA-N Thr-Gly-Asp Chemical compound [H]N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(O)=O NIEWSKWFURSECR-FOHZUACHSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- DVWAIHZOPSYMSJ-ZVZYQTTQSA-N Trp-Glu-Val Chemical compound C1=CC=C2C(C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(O)=O)=CNC2=C1 DVWAIHZOPSYMSJ-ZVZYQTTQSA-N 0.000 description 2
- FBGDDUKYOBNZJL-WDSOQIARSA-N Trp-Met-Lys Chemical compound CSCC[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@H](CC1=CNC2=CC=CC=C21)N FBGDDUKYOBNZJL-WDSOQIARSA-N 0.000 description 2
- QUIXRGCMQOXUSV-SZMVWBNQSA-N Trp-Pro-Pro Chemical compound O=C([C@@H]1CCCN1C(=O)[C@H](CC=1C2=CC=CC=C2NC=1)N)N1CCC[C@H]1C(O)=O QUIXRGCMQOXUSV-SZMVWBNQSA-N 0.000 description 2
- 102220564494 Uncharacterized protein C18orf63_A103G_mutation Human genes 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- BTWMICVCQLKKNR-DCAQKATOSA-N Val-Leu-Ser Chemical compound CC(C)[C@H]([NH3+])C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C([O-])=O BTWMICVCQLKKNR-DCAQKATOSA-N 0.000 description 2
- 102220634406 Vitamin K epoxide reductase complex subunit 1_R98E_mutation Human genes 0.000 description 2
- 206010047700 Vomiting Diseases 0.000 description 2
- 102220507794 Xaa-Pro dipeptidase_E200Q_mutation Human genes 0.000 description 2
- 241000235013 Yarrowia Species 0.000 description 2
- 230000021736 acetylation Effects 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 235000003704 aspartic acid Nutrition 0.000 description 2
- 108010040443 aspartyl-aspartic acid Proteins 0.000 description 2
- 108010093581 aspartyl-proline Proteins 0.000 description 2
- 108010038633 aspartylglutamate Proteins 0.000 description 2
- 108010092854 aspartyllysine Proteins 0.000 description 2
- 244000052616 bacterial pathogen Species 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000002869 basic local alignment search tool Methods 0.000 description 2
- 239000003782 beta lactam antibiotic agent Substances 0.000 description 2
- 229940000635 beta-alanine Drugs 0.000 description 2
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 2
- 230000027455 binding Effects 0.000 description 2
- 108091008324 binding proteins Proteins 0.000 description 2
- 238000004820 blood count Methods 0.000 description 2
- 238000002815 broth microdilution Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- FPPNZSSZRUTDAP-UWFZAAFLSA-N carbenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C(O)=O)C1=CC=CC=C1 FPPNZSSZRUTDAP-UWFZAAFLSA-N 0.000 description 2
- QYIYFLOTGYLRGG-GPCCPHFNSA-N cefaclor Chemical compound C1([C@H](C(=O)N[C@@H]2C(N3C(=C(Cl)CS[C@@H]32)C(O)=O)=O)N)=CC=CC=C1 QYIYFLOTGYLRGG-GPCCPHFNSA-N 0.000 description 2
- 229960005361 cefaclor Drugs 0.000 description 2
- 229960003719 cefdinir Drugs 0.000 description 2
- RTXOFQZKPXMALH-GHXIOONMSA-N cefdinir Chemical compound S1C(N)=NC(C(=N\O)\C(=O)N[C@@H]2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=C1 RTXOFQZKPXMALH-GHXIOONMSA-N 0.000 description 2
- AFZFFLVORLEPPO-UVYJNCLZSA-N cefditoren pivoxil Chemical compound S([C@@H]1[C@@H](C(N1C=1C(=O)OCOC(=O)C(C)(C)C)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1\C=C/C=1SC=NC=1C AFZFFLVORLEPPO-UVYJNCLZSA-N 0.000 description 2
- OKBVVJOGVLARMR-QSWIMTSFSA-N cefixime Chemical compound S1C(N)=NC(C(=N\OCC(O)=O)\C(=O)N[C@@H]2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=C1 OKBVVJOGVLARMR-QSWIMTSFSA-N 0.000 description 2
- ZCCUWMICIWSJIX-NQJJCJBVSA-N ceftaroline fosamil Chemical compound S([C@@H]1[C@@H](C(N1C=1C([O-])=O)=O)NC(=O)\C(=N/OCC)C=2N=C(NP(O)(O)=O)SN=2)CC=1SC(SC=1)=NC=1C1=CC=[N+](C)C=C1 ZCCUWMICIWSJIX-NQJJCJBVSA-N 0.000 description 2
- UNJFKXSSGBWRBZ-BJCIPQKHSA-N ceftibuten Chemical compound S1C(N)=NC(C(=C\CC(O)=O)\C(=O)N[C@@H]2C(N3C(=CCS[C@@H]32)C(O)=O)=O)=C1 UNJFKXSSGBWRBZ-BJCIPQKHSA-N 0.000 description 2
- VOAZJEPQLGBXGO-SDAWRPRTSA-N ceftobiprole Chemical compound S1C(N)=NC(C(=N\O)\C(=O)N[C@@H]2C(N3C(=C(\C=C/4C(N([C@H]5CNCC5)CC\4)=O)CS[C@@H]32)C(O)=O)=O)=N1 VOAZJEPQLGBXGO-SDAWRPRTSA-N 0.000 description 2
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 description 2
- 210000004978 chinese hamster ovary cell Anatomy 0.000 description 2
- 210000004913 chyme Anatomy 0.000 description 2
- QJHCNBWLPSXHBL-UHFFFAOYSA-N cimetidine hydrochloride Chemical compound [H+].[Cl-].N#C/N=C(/NC)NCCSCC=1N=CNC=1C QJHCNBWLPSXHBL-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000010367 cloning Methods 0.000 description 2
- LQOLIRLGBULYKD-JKIFEVAISA-N cloxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=CC=CC=C1Cl LQOLIRLGBULYKD-JKIFEVAISA-N 0.000 description 2
- 238000011260 co-administration Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 239000012468 concentrated sample Substances 0.000 description 2
- XVOYSCVBGLVSOL-UHFFFAOYSA-N cysteic acid Chemical compound OC(=O)C(N)CS(O)(=O)=O XVOYSCVBGLVSOL-UHFFFAOYSA-N 0.000 description 2
- 231100000599 cytotoxic agent Toxicity 0.000 description 2
- 239000007857 degradation product Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- YFAGHNZHGGCZAX-JKIFEVAISA-N dicloxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=C(Cl)C=CC=C1Cl YFAGHNZHGGCZAX-JKIFEVAISA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 201000006549 dyspepsia Diseases 0.000 description 2
- KWORUUGOSLYAGD-YPPDDXJESA-N esomeprazole magnesium Chemical compound [Mg+2].C([S@](=O)C=1[N-]C2=CC=C(C=C2N=1)OC)C1=NC=C(C)C(OC)=C1C.C([S@](=O)C=1[N-]C2=CC=C(C=C2N=1)OC)C1=NC=C(C)C(OC)=C1C KWORUUGOSLYAGD-YPPDDXJESA-N 0.000 description 2
- 210000003238 esophagus Anatomy 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- 210000003527 eukaryotic cell Anatomy 0.000 description 2
- 230000002550 fecal effect Effects 0.000 description 2
- 229960000628 fidaxomicin Drugs 0.000 description 2
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 108010057083 glutamyl-aspartyl-leucine Proteins 0.000 description 2
- YQEMORVAKMFKLG-UHFFFAOYSA-N glycerine monostearate Natural products CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO YQEMORVAKMFKLG-UHFFFAOYSA-N 0.000 description 2
- SVUQHVRAGMNPLW-UHFFFAOYSA-N glycerol monostearate Natural products CCCCCCCCCCCCCCCCC(=O)OCC(O)CO SVUQHVRAGMNPLW-UHFFFAOYSA-N 0.000 description 2
- 108010051307 glycyl-glycyl-proline Proteins 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 208000024798 heartburn Diseases 0.000 description 2
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 2
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000000099 in vitro assay Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 230000000415 inactivating effect Effects 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 229960000318 kanamycin Drugs 0.000 description 2
- 229930027917 kanamycin Natural products 0.000 description 2
- SBUJHOSQTJFQJX-NOAMYHISSA-N kanamycin Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 2
- 229930182823 kanamycin A Natural products 0.000 description 2
- 230000002147 killing effect Effects 0.000 description 2
- 229940017800 lactobacillus casei Drugs 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- MJIHNNLFOKEZEW-UHFFFAOYSA-N lansoprazole Chemical compound CC1=C(OCC(F)(F)F)C=CN=C1CS(=O)C1=NC2=CC=CC=C2N1 MJIHNNLFOKEZEW-UHFFFAOYSA-N 0.000 description 2
- 210000004698 lymphocyte Anatomy 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 239000003550 marker Substances 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 229960003085 meticillin Drugs 0.000 description 2
- 229960000282 metronidazole Drugs 0.000 description 2
- YPBATNHYBCGSSN-VWPFQQQWSA-N mezlocillin Chemical compound N([C@@H](C(=O)N[C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C=1C=CC=CC=1)C(=O)N1CCN(S(C)(=O)=O)C1=O YPBATNHYBCGSSN-VWPFQQQWSA-N 0.000 description 2
- 244000000010 microbial pathogen Species 0.000 description 2
- 230000002906 microbiologic effect Effects 0.000 description 2
- 239000011859 microparticle Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- GPXLMGHLHQJAGZ-JTDSTZFVSA-N nafcillin Chemical compound C1=CC=CC2=C(C(=O)N[C@@H]3C(N4[C@H](C(C)(C)S[C@@H]43)C(O)=O)=O)C(OCC)=CC=C21 GPXLMGHLHQJAGZ-JTDSTZFVSA-N 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 229940112641 nexium Drugs 0.000 description 2
- 150000007523 nucleic acids Chemical group 0.000 description 2
- 230000000474 nursing effect Effects 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- UWYHMGVUTGAWSP-JKIFEVAISA-N oxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=CC=CC=C1 UWYHMGVUTGAWSP-JKIFEVAISA-N 0.000 description 2
- 230000002974 pharmacogenomic effect Effects 0.000 description 2
- BPLBGHOLXOTWMN-MBNYWOFBSA-N phenoxymethylpenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)COC1=CC=CC=C1 BPLBGHOLXOTWMN-MBNYWOFBSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 230000036470 plasma concentration Effects 0.000 description 2
- 229940032668 prevacid Drugs 0.000 description 2
- 229940089505 prilosec Drugs 0.000 description 2
- 230000000529 probiotic effect Effects 0.000 description 2
- 210000001236 prokaryotic cell Anatomy 0.000 description 2
- 229940007042 proteus vulgaris Drugs 0.000 description 2
- 239000012857 radioactive material Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229960003040 rifaximin Drugs 0.000 description 2
- NZCRJKRKKOLAOJ-XRCRFVBUSA-N rifaximin Chemical compound OC1=C(C(O)=C2C)C3=C4N=C5C=C(C)C=CN5C4=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O NZCRJKRKKOLAOJ-XRCRFVBUSA-N 0.000 description 2
- 102220045433 rs587782104 Human genes 0.000 description 2
- 239000012146 running buffer Substances 0.000 description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 229940106721 tagamet Drugs 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- BVCKFLJARNKCSS-DWPRYXJFSA-N temocillin Chemical compound N([C@]1(OC)C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C(C(O)=O)C=1C=CSC=1 BVCKFLJARNKCSS-DWPRYXJFSA-N 0.000 description 2
- 108010061238 threonyl-glycine Proteins 0.000 description 2
- OHKOGUYZJXTSFX-KZFFXBSXSA-N ticarcillin Chemical compound C=1([C@@H](C(O)=O)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)C=CSC=1 OHKOGUYZJXTSFX-KZFFXBSXSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000013518 transcription Methods 0.000 description 2
- 230000035897 transcription Effects 0.000 description 2
- 230000008673 vomiting Effects 0.000 description 2
- 239000002132 β-lactam antibiotic Substances 0.000 description 2
- 229940124586 β-lactam antibiotics Drugs 0.000 description 2
- FDKWRPBBCBCIGA-REOHCLBHSA-N (2r)-2-azaniumyl-3-$l^{1}-selanylpropanoate Chemical compound [Se]C[C@H](N)C(O)=O FDKWRPBBCBCIGA-REOHCLBHSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical class OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- BVAUMRCGVHUWOZ-ZETCQYMHSA-N (2s)-2-(cyclohexylazaniumyl)propanoate Chemical compound OC(=O)[C@H](C)NC1CCCCC1 BVAUMRCGVHUWOZ-ZETCQYMHSA-N 0.000 description 1
- MRTPISKDZDHEQI-YFKPBYRVSA-N (2s)-2-(tert-butylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC(C)(C)C MRTPISKDZDHEQI-YFKPBYRVSA-N 0.000 description 1
- NPDBDJFLKKQMCM-SCSAIBSYSA-N (2s)-2-amino-3,3-dimethylbutanoic acid Chemical compound CC(C)(C)[C@H](N)C(O)=O NPDBDJFLKKQMCM-SCSAIBSYSA-N 0.000 description 1
- LITBAYYWXZOHAW-XDZRHBBOSA-N (2s,5r,6r)-6-[[(2r)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;(2s,3s,5r)-3-methyl-4,4,7-trioxo-3-(triazol-1-ylmethyl)-4$l^{6}-thia-1-azabicyclo[3.2.0]hept Chemical compound C([C@]1(C)S([C@H]2N(C(C2)=O)[C@H]1C(O)=O)(=O)=O)N1C=CN=N1.O=C1C(=O)N(CC)CCN1C(=O)N[C@H](C=1C=CC=CC=1)C(=O)N[C@@H]1C(=O)N2[C@@H](C(O)=O)C(C)(C)S[C@@H]21 LITBAYYWXZOHAW-XDZRHBBOSA-N 0.000 description 1
- QJVHTELASVOWBE-AGNWQMPPSA-N (2s,5r,6r)-6-[[(2r)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;(2r,3z,5r)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound OC(=O)[C@H]1C(=C/CO)/O[C@@H]2CC(=O)N21.C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 QJVHTELASVOWBE-AGNWQMPPSA-N 0.000 description 1
- FKENQMMABCRJMK-LWOQYNTDSA-N (5r)-3,3-dimethyl-4,4,7-trioxo-4$l^{6}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound O=S1(=O)C(C)(C)C(C(O)=O)N2C(=O)C[C@H]21 FKENQMMABCRJMK-LWOQYNTDSA-N 0.000 description 1
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N (e)-2-hydroxybut-2-enedioic acid Chemical compound OC(=O)\C=C(\O)C(O)=O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- BSIMZHVOQZIAOY-SCSAIBSYSA-N 1-carbapenem-3-carboxylic acid Chemical group OC(=O)C1=CC[C@@H]2CC(=O)N12 BSIMZHVOQZIAOY-SCSAIBSYSA-N 0.000 description 1
- 102220580811 15-hydroxyprostaglandin dehydrogenase [NAD(+)]_Q148A_mutation Human genes 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- OGNSCSPNOLGXSM-UHFFFAOYSA-N 2,4-diaminobutyric acid Chemical compound NCCC(N)C(O)=O OGNSCSPNOLGXSM-UHFFFAOYSA-N 0.000 description 1
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 1
- 102220500361 2-acylglycerol O-acyltransferase 2_P196H_mutation Human genes 0.000 description 1
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical compound CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 1
- AFENDNXGAFYKQO-UHFFFAOYSA-N 2-hydroxybutyric acid Chemical compound CCC(O)C(O)=O AFENDNXGAFYKQO-UHFFFAOYSA-N 0.000 description 1
- IVHKZCSZELZKSJ-UHFFFAOYSA-N 2-hydroxyethyl sulfonate Chemical compound OCCOS(=O)=O IVHKZCSZELZKSJ-UHFFFAOYSA-N 0.000 description 1
- HMGCGUWFPZVPEK-UHFFFAOYSA-N 2-naphthalen-2-ylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=C1 HMGCGUWFPZVPEK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-M 3-carboxy-2,3-dihydroxypropanoate Chemical compound OC(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-M 0.000 description 1
- 102220624198 3-hydroxy-3-methylglutaryl-coenzyme A reductase_Y75A_mutation Human genes 0.000 description 1
- GUPXYSSGJWIURR-UHFFFAOYSA-N 3-octoxypropane-1,2-diol Chemical compound CCCCCCCCOCC(O)CO GUPXYSSGJWIURR-UHFFFAOYSA-N 0.000 description 1
- 102220589097 39S ribosomal protein L1, mitochondrial_K238S_mutation Human genes 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- 102220575769 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9_N62Q_mutation Human genes 0.000 description 1
- 102220490664 4-hydroxybenzoate polyprenyltransferase, mitochondrial_K182F_mutation Human genes 0.000 description 1
- 102220487767 4-hydroxybenzoate polyprenyltransferase, mitochondrial_S234K_mutation Human genes 0.000 description 1
- 102220487776 4-hydroxybenzoate polyprenyltransferase, mitochondrial_S57T_mutation Human genes 0.000 description 1
- 102220587605 4-hydroxybenzoate polyprenyltransferase, mitochondrial_S96N_mutation Human genes 0.000 description 1
- OBKXEAXTFZPCHS-UHFFFAOYSA-N 4-phenylbutyric acid Chemical compound OC(=O)CCCC1=CC=CC=C1 OBKXEAXTFZPCHS-UHFFFAOYSA-N 0.000 description 1
- 102220575569 40S ribosomal protein S16_K56D_mutation Human genes 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- GEHRSERUQRFUFW-UHFFFAOYSA-N 5-ethylhex-2-ynedioic acid Chemical compound CCC(C(O)=O)CC#CC(O)=O GEHRSERUQRFUFW-UHFFFAOYSA-N 0.000 description 1
- 102220598666 5-hydroxytryptamine receptor 1E_R33E_mutation Human genes 0.000 description 1
- 102220497104 5-hydroxytryptamine receptor 3B_E59L_mutation Human genes 0.000 description 1
- 102220497101 5-hydroxytryptamine receptor 3B_E59Q_mutation Human genes 0.000 description 1
- 102220470040 60S acidic ribosomal protein P0-like_L47H_mutation Human genes 0.000 description 1
- 102220588949 60S ribosomal protein L7-like 1_Q63A_mutation Human genes 0.000 description 1
- ZGXJTSGNIOSYLO-UHFFFAOYSA-N 88755TAZ87 Chemical compound NCC(=O)CCC(O)=O ZGXJTSGNIOSYLO-UHFFFAOYSA-N 0.000 description 1
- 102220535257 A disintegrin and metalloproteinase with thrombospondin motifs 9_S96T_mutation Human genes 0.000 description 1
- 102220530504 ADAMTS-like protein 2_R69F_mutation Human genes 0.000 description 1
- 102220546915 ADP-ribosylation factor 3_D35L_mutation Human genes 0.000 description 1
- 102220491140 ADP-ribosylation factor-like protein 14_L232G_mutation Human genes 0.000 description 1
- 102220631993 AH receptor-interacting protein_K120R_mutation Human genes 0.000 description 1
- 102220609864 AP-1 complex subunit sigma-1A_L139H_mutation Human genes 0.000 description 1
- 102220553765 APC membrane recruitment protein 1_E116A_mutation Human genes 0.000 description 1
- 102220511160 APC membrane recruitment protein 1_G86S_mutation Human genes 0.000 description 1
- 102220554127 APC membrane recruitment protein 1_K45A_mutation Human genes 0.000 description 1
- 102220554146 APC membrane recruitment protein 1_L107A_mutation Human genes 0.000 description 1
- 102220570560 ATP-binding cassette sub-family C member 4_G187W_mutation Human genes 0.000 description 1
- 102220549849 ATP-binding cassette sub-family D member 1_A95D_mutation Human genes 0.000 description 1
- 102220552290 ATP-binding cassette sub-family D member 1_N214D_mutation Human genes 0.000 description 1
- 102220638472 ATP-binding cassette sub-family G member 1_K124M_mutation Human genes 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000589220 Acetobacter Species 0.000 description 1
- 102220478419 Acetyl-coenzyme A thioesterase_L190H_mutation Human genes 0.000 description 1
- 102220491522 Acid ceramidase_E138V_mutation Human genes 0.000 description 1
- 102220490015 Acid ceramidase_N259Q_mutation Human genes 0.000 description 1
- 102220566256 Acid-sensing ion channel 3_Y67N_mutation Human genes 0.000 description 1
- 102220565734 Acid-sensing ion channel 4_T26K_mutation Human genes 0.000 description 1
- 241000266272 Acidithiobacillus Species 0.000 description 1
- 241001019659 Acremonium <Plectosphaerellaceae> Species 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 102220646192 Actin-like protein 7A_A31Y_mutation Human genes 0.000 description 1
- 102220646188 Actin-like protein 7A_A41Y_mutation Human genes 0.000 description 1
- 102220560785 Acyl-CoA dehydrogenase family member 10_D71Y_mutation Human genes 0.000 description 1
- 102220466236 Acyl-coenzyme A thioesterase MBLAC2_K119A_mutation Human genes 0.000 description 1
- 102220466237 Acyl-coenzyme A thioesterase MBLAC2_K168A_mutation Human genes 0.000 description 1
- 102220511881 Acyl-coenzyme A thioesterase THEM4_L17R_mutation Human genes 0.000 description 1
- 102220511405 Adenine DNA glycosylase_V231M_mutation Human genes 0.000 description 1
- 102220573865 Adenosine receptor A2a_V83D_mutation Human genes 0.000 description 1
- 102220590672 Adenylosuccinate synthetase isozyme 1_N106S_mutation Human genes 0.000 description 1
- 102220636430 Adiponectin receptor protein 1_G113W_mutation Human genes 0.000 description 1
- 241000607534 Aeromonas Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000589158 Agrobacterium Species 0.000 description 1
- FUSPCLTUKXQREV-ACZMJKKPSA-N Ala-Glu-Ala Chemical compound [H]N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(O)=O FUSPCLTUKXQREV-ACZMJKKPSA-N 0.000 description 1
- HHRAXZAYZFFRAM-CIUDSAMLSA-N Ala-Leu-Asn Chemical compound [H]N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(O)=O HHRAXZAYZFFRAM-CIUDSAMLSA-N 0.000 description 1
- MEFILNJXAVSUTO-JXUBOQSCSA-N Ala-Leu-Thr Chemical compound C[C@H](N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)O)C(O)=O MEFILNJXAVSUTO-JXUBOQSCSA-N 0.000 description 1
- KQESEZXHYOUIIM-CQDKDKBSSA-N Ala-Lys-Tyr Chemical compound [H]N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(O)=O KQESEZXHYOUIIM-CQDKDKBSSA-N 0.000 description 1
- HOVPGJUNRLMIOZ-CIUDSAMLSA-N Ala-Ser-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](C)N HOVPGJUNRLMIOZ-CIUDSAMLSA-N 0.000 description 1
- MMLHRUJLOUSRJX-CIUDSAMLSA-N Ala-Ser-Lys Chemical compound C[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H](C(O)=O)CCCCN MMLHRUJLOUSRJX-CIUDSAMLSA-N 0.000 description 1
- WQKAQKZRDIZYNV-VZFHVOOUSA-N Ala-Ser-Thr Chemical compound [H]N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(O)=O WQKAQKZRDIZYNV-VZFHVOOUSA-N 0.000 description 1
- MTDDMSUUXNQMKK-BPNCWPANSA-N Ala-Tyr-Arg Chemical compound C[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)N MTDDMSUUXNQMKK-BPNCWPANSA-N 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 241000588986 Alcaligenes Species 0.000 description 1
- 102220477558 Aldehyde oxidase_E136H_mutation Human genes 0.000 description 1
- 102220469546 Aldo-keto reductase family 1 member C2_K238D_mutation Human genes 0.000 description 1
- 102220495836 Alkaline ceramidase 1_G25T_mutation Human genes 0.000 description 1
- 241001136561 Allomyces Species 0.000 description 1
- 102220546985 Alpha-1B adrenergic receptor_V51G_mutation Human genes 0.000 description 1
- 102220478243 Alpha-endosulfine_E36G_mutation Human genes 0.000 description 1
- 102220486650 Alpha-galactosidase A_A230T_mutation Human genes 0.000 description 1
- 102220486668 Alpha-galactosidase A_D244H_mutation Human genes 0.000 description 1
- 102220486488 Alpha-galactosidase A_V254A_mutation Human genes 0.000 description 1
- 102220625513 Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3_L177M_mutation Human genes 0.000 description 1
- 102220512138 Alpha-sarcoglycan_A93V_mutation Human genes 0.000 description 1
- 102220534069 Angiopoietin-related protein 3_R235T_mutation Human genes 0.000 description 1
- 102220613803 Angiotensin-converting enzyme 2_F40D_mutation Human genes 0.000 description 1
- 102220613706 Angiotensin-converting enzyme 2_R192D_mutation Human genes 0.000 description 1
- 102220493872 Ankyrin repeat and protein kinase domain-containing protein 1_D4Y_mutation Human genes 0.000 description 1
- 102220566102 Antileukoproteinase_L97G_mutation Human genes 0.000 description 1
- 102220566105 Antileukoproteinase_L97R_mutation Human genes 0.000 description 1
- 102220615687 Apolipoprotein E_R154C_mutation Human genes 0.000 description 1
- 102220552601 Appetite-regulating hormone_L72M_mutation Human genes 0.000 description 1
- HJDNZFIYILEIKR-OSUNSFLBSA-N Arg-Ile-Thr Chemical compound [H]N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(O)=O HJDNZFIYILEIKR-OSUNSFLBSA-N 0.000 description 1
- CZUHPNLXLWMYMG-UBHSHLNASA-N Arg-Phe-Ala Chemical compound NC(N)=NCCC[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](C)C(O)=O)CC1=CC=CC=C1 CZUHPNLXLWMYMG-UBHSHLNASA-N 0.000 description 1
- 102220482668 Arginine-hydroxylase NDUFAF5, mitochondrial_G86V_mutation Human genes 0.000 description 1
- 102220610451 Argininosuccinate synthase_A164P_mutation Human genes 0.000 description 1
- 102220610448 Argininosuccinate synthase_N184K_mutation Human genes 0.000 description 1
- 241000186063 Arthrobacter Species 0.000 description 1
- 241001495180 Arthrospira Species 0.000 description 1
- 102220535442 Aryl hydrocarbon receptor nuclear translocator-like protein 2_L122E_mutation Human genes 0.000 description 1
- 102220471100 Aryl hydrocarbon receptor_L118D_mutation Human genes 0.000 description 1
- 102220625387 Arylamine N-acetyltransferase 1_G194E_mutation Human genes 0.000 description 1
- 102220625389 Arylamine N-acetyltransferase 1_G194R_mutation Human genes 0.000 description 1
- 102220607129 Arylsulfatase A_G86D_mutation Human genes 0.000 description 1
- XWFPGQVLOVGSLU-CIUDSAMLSA-N Asn-Gln-Arg Chemical compound NC(=O)C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(O)=O)CCCN=C(N)N XWFPGQVLOVGSLU-CIUDSAMLSA-N 0.000 description 1
- NJSNXIOKBHPFMB-GMOBBJLQSA-N Asn-Pro-Ile Chemical compound CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)N)N NJSNXIOKBHPFMB-GMOBBJLQSA-N 0.000 description 1
- RTFXPCYMDYBZNQ-SRVKXCTJSA-N Asn-Tyr-Asn Chemical compound [H]N[C@@H](CC(N)=O)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CC(N)=O)C(O)=O RTFXPCYMDYBZNQ-SRVKXCTJSA-N 0.000 description 1
- NJIKKGUVGUBICV-ZLUOBGJFSA-N Asp-Ala-Ser Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(O)=O NJIKKGUVGUBICV-ZLUOBGJFSA-N 0.000 description 1
- SBHUBSDEZQFJHJ-CIUDSAMLSA-N Asp-Asp-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](N)CC(O)=O SBHUBSDEZQFJHJ-CIUDSAMLSA-N 0.000 description 1
- CELPEWWLSXMVPH-CIUDSAMLSA-N Asp-Asp-Lys Chemical compound NCCCC[C@@H](C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](N)CC(O)=O CELPEWWLSXMVPH-CIUDSAMLSA-N 0.000 description 1
- SVFOIXMRMLROHO-SRVKXCTJSA-N Asp-Asp-Phe Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 SVFOIXMRMLROHO-SRVKXCTJSA-N 0.000 description 1
- IJHUZMGJRGNXIW-CIUDSAMLSA-N Asp-Glu-Arg Chemical compound [H]N[C@@H](CC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O IJHUZMGJRGNXIW-CIUDSAMLSA-N 0.000 description 1
- QNMKWNONJGKJJC-NHCYSSNCSA-N Asp-Leu-Val Chemical compound [H]N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(O)=O QNMKWNONJGKJJC-NHCYSSNCSA-N 0.000 description 1
- GKWFMNNNYZHJHV-SRVKXCTJSA-N Asp-Lys-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CC(O)=O GKWFMNNNYZHJHV-SRVKXCTJSA-N 0.000 description 1
- JJQGZGOEDSSHTE-FOHZUACHSA-N Asp-Thr-Gly Chemical compound [H]N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(O)=O JJQGZGOEDSSHTE-FOHZUACHSA-N 0.000 description 1
- 108010011485 Aspartame Proteins 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 102220624755 Atrial natriuretic peptide receptor 1_T68V_mutation Human genes 0.000 description 1
- 102220624694 Atrial natriuretic peptide receptor 1_T79V_mutation Human genes 0.000 description 1
- 102220478438 Atypical chemokine receptor 3_T147V_mutation Human genes 0.000 description 1
- 102220584080 Atypical kinase COQ8A, mitochondrial_L229A_mutation Human genes 0.000 description 1
- 102220528623 Aurora kinase A_G198N_mutation Human genes 0.000 description 1
- 102220618194 Autophagy-related protein 9A_Y242A_mutation Human genes 0.000 description 1
- 108090001008 Avidin Proteins 0.000 description 1
- 241000589151 Azotobacter Species 0.000 description 1
- 101150076489 B gene Proteins 0.000 description 1
- 102220534198 B-cell lymphoma/leukemia 10_L47A_mutation Human genes 0.000 description 1
- 210000002237 B-cell of pancreatic islet Anatomy 0.000 description 1
- 102220617586 B1 bradykinin receptor_K16Q_mutation Human genes 0.000 description 1
- 238000009020 BCA Protein Assay Kit Methods 0.000 description 1
- 102220567604 BICD family-like cargo adapter 2_T29S_mutation Human genes 0.000 description 1
- 102220603717 BPI fold-containing family A member 1_V253C_mutation Human genes 0.000 description 1
- 102220519450 BTB/POZ domain-containing protein KCTD1_L107W_mutation Human genes 0.000 description 1
- 241000193744 Bacillus amyloliquefaciens Species 0.000 description 1
- 101100004567 Bacillus licheniformis penP gene Proteins 0.000 description 1
- 102220533512 Baculoviral IAP repeat-containing protein 1_K124R_mutation Human genes 0.000 description 1
- 102220518579 Baculoviral IAP repeat-containing protein 6_T43E_mutation Human genes 0.000 description 1
- 102220520233 Barrier-to-autointegration factor_G25Q_mutation Human genes 0.000 description 1
- 102220520198 Barrier-to-autointegration factor_R37E_mutation Human genes 0.000 description 1
- 102220521251 Bcl-2-associated transcription factor 1_S209C_mutation Human genes 0.000 description 1
- 102220521229 Beclin-2_A217L_mutation Human genes 0.000 description 1
- 102220556603 Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase_G126F_mutation Human genes 0.000 description 1
- 102220623782 Beta-1,3-galactosyltransferase 6_S159Y_mutation Human genes 0.000 description 1
- 102220537158 Beta-nerve growth factor_G194C_mutation Human genes 0.000 description 1
- 241000186016 Bifidobacterium bifidum Species 0.000 description 1
- 241000186012 Bifidobacterium breve Species 0.000 description 1
- 241001608472 Bifidobacterium longum Species 0.000 description 1
- 241000186015 Bifidobacterium longum subsp. infantis Species 0.000 description 1
- 102220477368 Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]_K81M_mutation Human genes 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241001465180 Botrytis Species 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- 102220486838 Breast cancer type 1 susceptibility protein_L165P_mutation Human genes 0.000 description 1
- 241000722885 Brettanomyces Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000012619 Butyl Sepharose® Substances 0.000 description 1
- 102220615754 C-C chemokine receptor type 5_L122P_mutation Human genes 0.000 description 1
- 102220485312 C-type lectin domain family 4 member E_R183V_mutation Human genes 0.000 description 1
- 102220549297 CBY1-interacting BAR domain-containing protein 1_A193S_mutation Human genes 0.000 description 1
- 102220553521 CBY1-interacting BAR domain-containing protein 1_E172A_mutation Human genes 0.000 description 1
- 102220485621 CBY1-interacting BAR domain-containing protein 1_E175D_mutation Human genes 0.000 description 1
- 102220548303 CBY1-interacting BAR domain-containing protein 1_G113A_mutation Human genes 0.000 description 1
- 102220548286 CBY1-interacting BAR domain-containing protein 1_G114A_mutation Human genes 0.000 description 1
- 102220548287 CBY1-interacting BAR domain-containing protein 1_G114P_mutation Human genes 0.000 description 1
- 102220549213 CBY1-interacting BAR domain-containing protein 1_K267A_mutation Human genes 0.000 description 1
- 102220549207 CBY1-interacting BAR domain-containing protein 1_R134A_mutation Human genes 0.000 description 1
- 102220549208 CBY1-interacting BAR domain-containing protein 1_R134E_mutation Human genes 0.000 description 1
- 102220616637 CCAAT/enhancer-binding protein alpha_E59A_mutation Human genes 0.000 description 1
- 102220616655 CCAAT/enhancer-binding protein alpha_Y67A_mutation Human genes 0.000 description 1
- 102220616904 CCAAT/enhancer-binding protein alpha_Y67F_mutation Human genes 0.000 description 1
- 102220520339 CYFIP-related Rac1 interactor B_R161D_mutation Human genes 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 101100086436 Caenorhabditis elegans rap-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 102220591756 Calcium homeostasis modulator protein 1_N74A_mutation Human genes 0.000 description 1
- 102220531024 Calcium/calmodulin-dependent protein kinase type II subunit delta_D167E_mutation Human genes 0.000 description 1
- 102220531161 Calcium/calmodulin-dependent protein kinase type II subunit delta_D236R_mutation Human genes 0.000 description 1
- 102220615676 Calmodulin-3_E141K_mutation Human genes 0.000 description 1
- 102220614565 Calmodulin-3_G18A_mutation Human genes 0.000 description 1
- 102220614550 Calmodulin-3_G25A_mutation Human genes 0.000 description 1
- 102220614782 Calmodulin-3_K8A_mutation Human genes 0.000 description 1
- 102220614558 Calmodulin-3_N27A_mutation Human genes 0.000 description 1
- 102220614544 Calmodulin-3_R33A_mutation Human genes 0.000 description 1
- 102220590097 Calsyntenin-3_S209G_mutation Human genes 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 102220534036 Carbonic anhydrase 1_E172P_mutation Human genes 0.000 description 1
- 102220499814 Carbonic anhydrase 2_N62A_mutation Human genes 0.000 description 1
- 102220499813 Carbonic anhydrase 2_N62D_mutation Human genes 0.000 description 1
- 102220499807 Carbonic anhydrase 2_N62H_mutation Human genes 0.000 description 1
- 102220499804 Carbonic anhydrase 2_N62L_mutation Human genes 0.000 description 1
- 102220499805 Carbonic anhydrase 2_N62T_mutation Human genes 0.000 description 1
- 102220499800 Carbonic anhydrase 2_N62V_mutation Human genes 0.000 description 1
- 102220499436 Carbonic anhydrase 2_V142G_mutation Human genes 0.000 description 1
- 102220499441 Carbonic anhydrase 2_V142H_mutation Human genes 0.000 description 1
- 102220499448 Carbonic anhydrase 2_V142Y_mutation Human genes 0.000 description 1
- 102220485544 Carboxypeptidase A4_R183L_mutation Human genes 0.000 description 1
- 102220547739 Carcinoembryonic antigen-related cell adhesion molecule 3_K90Q_mutation Human genes 0.000 description 1
- 102220547700 Carcinoembryonic antigen-related cell adhesion molecule 3_N74G_mutation Human genes 0.000 description 1
- 102220471075 Carcinoembryonic antigen-related cell adhesion molecule 5_E133A_mutation Human genes 0.000 description 1
- 102220470969 Carcinoembryonic antigen-related cell adhesion molecule 5_V73A_mutation Human genes 0.000 description 1
- 102220634221 Casein kinase I isoform alpha-like_T43Q_mutation Human genes 0.000 description 1
- 102220595198 Casein kinase II subunit alpha'-interacting protein_M87Y_mutation Human genes 0.000 description 1
- 102220581852 Caspase recruitment domain-containing protein 16_S57P_mutation Human genes 0.000 description 1
- 102220581818 Caspase-4_L61H_mutation Human genes 0.000 description 1
- 102220557508 Caspase-4_N102A_mutation Human genes 0.000 description 1
- 102220584676 Catechol O-methyltransferase_M181A_mutation Human genes 0.000 description 1
- 102220574879 Cation channel sperm-associated auxiliary subunit epsilon_T66K_mutation Human genes 0.000 description 1
- 241000863012 Caulobacter Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 102220572741 Cbp/p300-interacting transactivator 1_L165A_mutation Human genes 0.000 description 1
- 102220572749 Cbp/p300-interacting transactivator 1_L176A_mutation Human genes 0.000 description 1
- RTXOFQZKPXMALH-PRHODGIISA-N Cefzon Chemical compound S1C(N)=NC(C(=NO)C(=O)N[C@@H]2C(N3C(=C(C=C)CS[C@@H]32)C(O)=O)=O)=C1 RTXOFQZKPXMALH-PRHODGIISA-N 0.000 description 1
- 102220504483 Cell division cycle-associated protein 7_R161E_mutation Human genes 0.000 description 1
- 102220522499 Cellular tumor antigen p53_A189D_mutation Human genes 0.000 description 1
- 102220522533 Cellular tumor antigen p53_A189P_mutation Human genes 0.000 description 1
- 102220582871 Cellular tumor antigen p53_A39P_mutation Human genes 0.000 description 1
- 102220522546 Cellular tumor antigen p53_G187C_mutation Human genes 0.000 description 1
- 102220522540 Cellular tumor antigen p53_G187N_mutation Human genes 0.000 description 1
- 102220522503 Cellular tumor antigen p53_G187S_mutation Human genes 0.000 description 1
- 102220522507 Cellular tumor antigen p53_G187V_mutation Human genes 0.000 description 1
- 102220566892 Cellular tumor antigen p53_G262C_mutation Human genes 0.000 description 1
- 102220566891 Cellular tumor antigen p53_G262D_mutation Human genes 0.000 description 1
- 102220566900 Cellular tumor antigen p53_G262H_mutation Human genes 0.000 description 1
- 102220574824 Cellular tumor antigen p53_K120M_mutation Human genes 0.000 description 1
- 102220574822 Cellular tumor antigen p53_K120R_mutation Human genes 0.000 description 1
- 102220575233 Cellular tumor antigen p53_N131D_mutation Human genes 0.000 description 1
- 102220551923 Cellular tumor antigen p53_P222A_mutation Human genes 0.000 description 1
- 102220551874 Cellular tumor antigen p53_P222Q_mutation Human genes 0.000 description 1
- 102220551865 Cellular tumor antigen p53_P222R_mutation Human genes 0.000 description 1
- 102220551875 Cellular tumor antigen p53_P222T_mutation Human genes 0.000 description 1
- 102220584231 Cellular tumor antigen p53_P77A_mutation Human genes 0.000 description 1
- 102220575718 Cellular tumor antigen p53_R174M_mutation Human genes 0.000 description 1
- 102220575715 Cellular tumor antigen p53_R174S_mutation Human genes 0.000 description 1
- 102220575716 Cellular tumor antigen p53_R174T_mutation Human genes 0.000 description 1
- 102220575713 Cellular tumor antigen p53_R174W_mutation Human genes 0.000 description 1
- 102220549651 Cellular tumor antigen p53_R213W_mutation Human genes 0.000 description 1
- 102220587394 Cellular tumor antigen p53_S96C_mutation Human genes 0.000 description 1
- 102220583897 Cellular tumor antigen p53_S96F_mutation Human genes 0.000 description 1
- 102220583904 Cellular tumor antigen p53_S96P_mutation Human genes 0.000 description 1
- 102220573636 Cellular tumor antigen p53_T150K_mutation Human genes 0.000 description 1
- 102220573634 Cellular tumor antigen p53_T150N_mutation Human genes 0.000 description 1
- 102220573632 Cellular tumor antigen p53_T150R_mutation Human genes 0.000 description 1
- 102220572065 Cellular tumor antigen p53_V157G_mutation Human genes 0.000 description 1
- 102220572063 Cellular tumor antigen p53_V157L_mutation Human genes 0.000 description 1
- 102220584270 Cellular tumor antigen p53_V73E_mutation Human genes 0.000 description 1
- 102220584269 Cellular tumor antigen p53_V73L_mutation Human genes 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- 102220607389 Cerebral cavernous malformations 2 protein_L229Q_mutation Human genes 0.000 description 1
- 102220598158 Ceroid-lipofuscinosis neuronal protein 5_N143Q_mutation Human genes 0.000 description 1
- 241000195597 Chlamydomonas reinhardtii Species 0.000 description 1
- 241000195649 Chlorella <Chlorellales> Species 0.000 description 1
- 240000009108 Chlorella vulgaris Species 0.000 description 1
- 235000007089 Chlorella vulgaris Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102220607107 Choline transporter-like protein 1_D179Q_mutation Human genes 0.000 description 1
- 102220626948 Choline transporter-like protein 2_K119T_mutation Human genes 0.000 description 1
- 241000588881 Chromobacterium Species 0.000 description 1
- 102220504991 Chymotrypsin-C_A257T_mutation Human genes 0.000 description 1
- 102220503654 Chymotrypsin-C_D35H_mutation Human genes 0.000 description 1
- 241000588923 Citrobacter Species 0.000 description 1
- 102220579680 Claudin-1_A39R_mutation Human genes 0.000 description 1
- 241000193403 Clostridium Species 0.000 description 1
- 241000193171 Clostridium butyricum Species 0.000 description 1
- 102220628215 Coagulation factor IX_L52S_mutation Human genes 0.000 description 1
- 102220570326 Coagulation factor IX_V227D_mutation Human genes 0.000 description 1
- 102220519408 Coatomer subunit alpha_P221A_mutation Human genes 0.000 description 1
- 102220635487 Cochlin_N76Y_mutation Human genes 0.000 description 1
- 108091026890 Coding region Proteins 0.000 description 1
- 102220496392 Coiled-coil domain-containing protein 102A_T130C_mutation Human genes 0.000 description 1
- 102220546571 Coiled-coil domain-containing protein 27_Q54E_mutation Human genes 0.000 description 1
- 208000003322 Coinfection Diseases 0.000 description 1
- 208000002881 Colic Diseases 0.000 description 1
- 206010009900 Colitis ulcerative Diseases 0.000 description 1
- 102220600350 Collagen alpha-1(I) chain_G224C_mutation Human genes 0.000 description 1
- 241000589519 Comamonas Species 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 102220608863 Conserved oligomeric Golgi complex subunit 8_L169K_mutation Human genes 0.000 description 1
- 102220608860 Conserved oligomeric Golgi complex subunit 8_Q55E_mutation Human genes 0.000 description 1
- 102220608859 Conserved oligomeric Golgi complex subunit 8_S117A_mutation Human genes 0.000 description 1
- 241000186216 Corynebacterium Species 0.000 description 1
- 208000011231 Crohn disease Diseases 0.000 description 1
- 102220553685 Cyclic GMP-AMP synthase_K173A_mutation Human genes 0.000 description 1
- 102220553678 Cyclic GMP-AMP synthase_K173R_mutation Human genes 0.000 description 1
- 102220553722 Cyclic GMP-AMP synthase_K252E_mutation Human genes 0.000 description 1
- 102220553761 Cyclic GMP-AMP synthase_S57D_mutation Human genes 0.000 description 1
- 102220553647 Cyclic GMP-AMP synthase_T130E_mutation Human genes 0.000 description 1
- 102220553774 Cyclic GMP-AMP synthase_T68E_mutation Human genes 0.000 description 1
- 102220503738 Cyclin-dependent kinase inhibitor 2A_D14E_mutation Human genes 0.000 description 1
- 102220504493 Cyclin-dependent kinase inhibitor 2A_D84H_mutation Human genes 0.000 description 1
- 102220593029 Cyclin-dependent kinase inhibitor 2A_L97R_mutation Human genes 0.000 description 1
- 102220598781 Cyclin-dependent kinase-like 5_T158D_mutation Human genes 0.000 description 1
- 102220598604 Cyclin-dependent kinase-like 5_T158V_mutation Human genes 0.000 description 1
- 102220599250 Cysteine and histidine-rich domain-containing protein 1_A217G_mutation Human genes 0.000 description 1
- 102220587546 Cysteinyl leukotriene receptor 1_S42D_mutation Human genes 0.000 description 1
- 102220527032 Cytochrome b5 reductase 4_T66V_mutation Human genes 0.000 description 1
- 102220620548 Cytokine receptor-like factor 1_Y75D_mutation Human genes 0.000 description 1
- 102220523212 Cytoplasmic tyrosine-protein kinase BMX_L122H_mutation Human genes 0.000 description 1
- 102220519474 Cytosolic phospholipase A2 gamma_H82N_mutation Human genes 0.000 description 1
- 102220503788 Cytotoxic T-lymphocyte protein 4_L47D_mutation Human genes 0.000 description 1
- 101710112752 Cytotoxin Proteins 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FDKWRPBBCBCIGA-UWTATZPHSA-N D-Selenocysteine Natural products [Se]C[C@@H](N)C(O)=O FDKWRPBBCBCIGA-UWTATZPHSA-N 0.000 description 1
- DSLZVSRJTYRBFB-LLEIAEIESA-N D-glucaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O DSLZVSRJTYRBFB-LLEIAEIESA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- 102220496805 DNA dC->dU-editing enzyme APOBEC-3A_R28E_mutation Human genes 0.000 description 1
- 102220497066 DNA dC->dU-editing enzyme APOBEC-3C_L72D_mutation Human genes 0.000 description 1
- 102220581497 DNA dC->dU-editing enzyme APOBEC-3G_R213E_mutation Human genes 0.000 description 1
- 102220578534 DNA helicase MCM8_Q63K_mutation Human genes 0.000 description 1
- 102220490511 DNA mismatch repair protein Mlh3_A41G_mutation Human genes 0.000 description 1
- 102220490416 DNA mismatch repair protein Mlh3_A41S_mutation Human genes 0.000 description 1
- 102220525524 DNA polymerase delta catalytic subunit_D236N_mutation Human genes 0.000 description 1
- 102220552539 DNA primase small subunit_K256C_mutation Human genes 0.000 description 1
- 102220555200 DNA topoisomerase 3-alpha_D23R_mutation Human genes 0.000 description 1
- 102220641188 DNA-dependent metalloprotease SPRTN_L109R_mutation Human genes 0.000 description 1
- 102220569994 DNA-directed RNA polymerase, mitochondrial_D236N_mutation Human genes 0.000 description 1
- 102000004163 DNA-directed RNA polymerases Human genes 0.000 description 1
- 108090000626 DNA-directed RNA polymerases Proteins 0.000 description 1
- 241000252212 Danio rerio Species 0.000 description 1
- 241000235035 Debaryomyces Species 0.000 description 1
- 101710088194 Dehydrogenase Proteins 0.000 description 1
- 102220548576 Delta and Notch-like epidermal growth factor-related receptor_P34F_mutation Human genes 0.000 description 1
- 102220548598 Delta and Notch-like epidermal growth factor-related receptor_Y32A_mutation Human genes 0.000 description 1
- 102220480435 Deoxyhypusine synthase_D243A_mutation Human genes 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 102220559716 Differentially expressed in FDCP 8 homolog_Y67G_mutation Human genes 0.000 description 1
- 102220531664 Dihydropyrimidinase_T68R_mutation Human genes 0.000 description 1
- 102220604368 Dipeptidase 1_E141C_mutation Human genes 0.000 description 1
- 102220511738 Dipeptidyl peptidase 1_D236Y_mutation Human genes 0.000 description 1
- 102220511723 Dipeptidyl peptidase 1_V129E_mutation Human genes 0.000 description 1
- 102220511748 Dipeptidyl peptidase 1_Y210D_mutation Human genes 0.000 description 1
- 102220511746 Dipeptidyl peptidase 1_Y210F_mutation Human genes 0.000 description 1
- 102220483252 Diphosphoinositol polyphosphate phosphohydrolase 2_F40A_mutation Human genes 0.000 description 1
- 102220610778 Diphosphomevalonate decarboxylase_R161L_mutation Human genes 0.000 description 1
- 102220582589 Disintegrin and metalloproteinase domain-containing protein 29_S234F_mutation Human genes 0.000 description 1
- 102220499648 DnaJ homolog subfamily C member 2_Y99A_mutation Human genes 0.000 description 1
- 102220625352 Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase_R154G_mutation Human genes 0.000 description 1
- 102220578419 Doublesex- and mab-3-related transcription factor 3_N261T_mutation Human genes 0.000 description 1
- 102220563203 Dual adapter for phosphotyrosine and 3-phosphotyrosine and 3-phosphoinositide_K173L_mutation Human genes 0.000 description 1
- 102220465711 Dual specificity tyrosine-phosphorylation-regulated kinase 1B_D239A_mutation Human genes 0.000 description 1
- 102220511304 Dual specificity tyrosine-phosphorylation-regulated kinase 3_K238M_mutation Human genes 0.000 description 1
- 102220477047 Dynein axonemal assembly factor 10_N76G_mutation Human genes 0.000 description 1
- 102220521714 Dynein light chain 2, cytoplasmic_D167K_mutation Human genes 0.000 description 1
- 102220519690 Dynein light chain Tctex-type 3_A153G_mutation Human genes 0.000 description 1
- 102220467460 Dynein regulatory complex protein 11_K8M_mutation Human genes 0.000 description 1
- 102220499627 Dysferlin_D71A_mutation Human genes 0.000 description 1
- 206010013911 Dysgeusia Diseases 0.000 description 1
- 102220548055 Dystrophin_E141A_mutation Human genes 0.000 description 1
- 102220635615 E3 UFM1-protein ligase 1_D5N_mutation Human genes 0.000 description 1
- 102220538870 E3 ubiquitin-protein ligase BRE1B_L109S_mutation Human genes 0.000 description 1
- 102220482304 E3 ubiquitin-protein ligase DCST1_E138D_mutation Human genes 0.000 description 1
- 102220482305 E3 ubiquitin-protein ligase DCST1_E138Q_mutation Human genes 0.000 description 1
- 102220480814 E3 ubiquitin-protein ligase DCST1_K81A_mutation Human genes 0.000 description 1
- 102220579943 E3 ubiquitin-protein ligase RING2_R98A_mutation Human genes 0.000 description 1
- 102220508341 E3 ubiquitin-protein ligase XIAP_Y75G_mutation Human genes 0.000 description 1
- 102220473766 ELAV-like protein 1_T185Y_mutation Human genes 0.000 description 1
- 102220473803 ELAV-like protein 1_Y75T_mutation Human genes 0.000 description 1
- 102220500686 ELMO domain-containing protein 2_K245N_mutation Human genes 0.000 description 1
- 102220561049 ENTH domain-containing protein 1_D244R_mutation Human genes 0.000 description 1
- 102220499208 Echinoderm microtubule-associated protein-like 1_R192S_mutation Human genes 0.000 description 1
- 102220476047 Ectodysplasin-A_G198A_mutation Human genes 0.000 description 1
- 102220468961 Ectodysplasin-A_L89Q_mutation Human genes 0.000 description 1
- 102220473529 Ectopic P granules protein 5 homolog_A193L_mutation Human genes 0.000 description 1
- 102220473501 Ectopic P granules protein 5 homolog_D244A_mutation Human genes 0.000 description 1
- 102220516209 Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial_Q55C_mutation Human genes 0.000 description 1
- 102220635184 Elongation factor G, mitochondrial_S57Y_mutation Human genes 0.000 description 1
- 102220545601 Endonuclease III-like protein 1_D239Y_mutation Human genes 0.000 description 1
- 102220545606 Endonuclease III-like protein 1_R33K_mutation Human genes 0.000 description 1
- 102220472614 Endothelin-1_K90T_mutation Human genes 0.000 description 1
- 241000283073 Equus caballus Species 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- 241001360526 Escherichia coli ATCC 25922 Species 0.000 description 1
- 241000701959 Escherichia virus Lambda Species 0.000 description 1
- 229920003134 Eudragit® polymer Polymers 0.000 description 1
- 102220542934 Eukaryotic peptide chain release factor GTP-binding subunit ERF3A_S233A_mutation Human genes 0.000 description 1
- 102220542938 Eukaryotic peptide chain release factor GTP-binding subunit ERF3A_S233G_mutation Human genes 0.000 description 1
- 102220542941 Eukaryotic peptide chain release factor GTP-binding subunit ERF3A_S233T_mutation Human genes 0.000 description 1
- 102220542222 Eukaryotic peptide chain release factor GTP-binding subunit ERF3B_L52K_mutation Human genes 0.000 description 1
- 102220505066 Eukaryotic translation initiation factor 3 subunit B_L89Y_mutation Human genes 0.000 description 1
- 102220628817 Eukaryotic translation initiation factor 5A-2_G50P_mutation Human genes 0.000 description 1
- 102220496254 Exocyst complex component 3-like protein_Y75N_mutation Human genes 0.000 description 1
- 102220636289 Exopolyphosphatase PRUNE1_F163Y_mutation Human genes 0.000 description 1
- 102220646250 Exosome complex exonuclease RRP44_K173T_mutation Human genes 0.000 description 1
- 102220615108 Extracellular calcium-sensing receptor_D215G_mutation Human genes 0.000 description 1
- 102220615227 Extracellular calcium-sensing receptor_R69E_mutation Human genes 0.000 description 1
- 102220615097 Extracellular calcium-sensing receptor_S171N_mutation Human genes 0.000 description 1
- 102220583772 Extracellular matrix protein 1_T130M_mutation Human genes 0.000 description 1
- 102220511795 F-actin-capping protein subunit beta_A207Y_mutation Human genes 0.000 description 1
- 102220500873 F-box only protein 32_L169Q_mutation Human genes 0.000 description 1
- 102220568902 F-box/LRR-repeat protein 2_D149C_mutation Human genes 0.000 description 1
- 102220564963 FAD synthase region_K245M_mutation Human genes 0.000 description 1
- 102220510254 FAS-associated death domain protein_L176E_mutation Human genes 0.000 description 1
- 102220546867 Fanconi anemia group C protein_L190F_mutation Human genes 0.000 description 1
- 102220545082 Far upstream element-binding protein 1_L89S_mutation Human genes 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 102220467701 Ferrochelatase, mitochondrial_E172G_mutation Human genes 0.000 description 1
- 102220573434 Fibroblast growth factor 22_D14C_mutation Human genes 0.000 description 1
- 102220597432 Fizzy-related protein homolog_S151A_mutation Human genes 0.000 description 1
- 241000589565 Flavobacterium Species 0.000 description 1
- 102220560989 Flotillin-2_D167R_mutation Human genes 0.000 description 1
- 102220560986 Flotillin-2_L160D_mutation Human genes 0.000 description 1
- 102220560990 Flotillin-2_L160E_mutation Human genes 0.000 description 1
- 102220566405 Folylpolyglutamate synthase, mitochondrial_A155H_mutation Human genes 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 102220500669 Formylglycine-generating enzyme_K173G_mutation Human genes 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- 102220465687 Fructose-bisphosphate aldolase B_R134S_mutation Human genes 0.000 description 1
- 102220575486 Fucose mutarotase_R174D_mutation Human genes 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 102220564662 GDP-fucose transporter 1_F135E_mutation Human genes 0.000 description 1
- 102220620100 GPI ethanolamine phosphate transferase 3_T130N_mutation Human genes 0.000 description 1
- 102220483961 GPI-linked NAD(P)(+)-arginine ADP-ribosyltransferase 1_S159D_mutation Human genes 0.000 description 1
- 102220582022 GTP cyclohydrolase 1_T186K_mutation Human genes 0.000 description 1
- 102220616650 GTP-binding nuclear protein Ran_T24L_mutation Human genes 0.000 description 1
- 102220605904 GTPase HRas_P34G_mutation Human genes 0.000 description 1
- 102220605905 GTPase HRas_Y32F_mutation Human genes 0.000 description 1
- 102220631430 GTPase IMAP family member 7_E136W_mutation Human genes 0.000 description 1
- 229920000926 Galactomannan Polymers 0.000 description 1
- 102220568810 Galactose-3-O-sulfotransferase 3_L232M_mutation Human genes 0.000 description 1
- 102220474042 Galectin-9C_N131D_mutation Human genes 0.000 description 1
- 102220607146 Gap junction beta-1 protein_L9W_mutation Human genes 0.000 description 1
- 102220486953 Gap junction beta-1 protein_R183S_mutation Human genes 0.000 description 1
- 102220507961 Gasdermin-E_R154A_mutation Human genes 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 102220558028 Gem-associated protein 2_R213D_mutation Human genes 0.000 description 1
- 102220498724 General transcription factor IIE subunit 1_T186N_mutation Human genes 0.000 description 1
- 108700039691 Genetic Promoter Regions Proteins 0.000 description 1
- 241000626621 Geobacillus Species 0.000 description 1
- 241001135750 Geobacter Species 0.000 description 1
- 102220601686 Gliomedin_L156H_mutation Human genes 0.000 description 1
- ZEEPYMXTJWIMSN-GUBZILKMSA-N Gln-Lys-Ser Chemical compound NCCCC[C@@H](C(=O)N[C@@H](CO)C(O)=O)NC(=O)[C@@H](N)CCC(N)=O ZEEPYMXTJWIMSN-GUBZILKMSA-N 0.000 description 1
- SWDSRANUCKNBLA-AVGNSLFASA-N Gln-Phe-Asp Chemical compound C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)NC(=O)[C@H](CCC(=O)N)N SWDSRANUCKNBLA-AVGNSLFASA-N 0.000 description 1
- FYBSCGZLICNOBA-XQXXSGGOSA-N Glu-Ala-Thr Chemical compound [H]N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)O)C(O)=O FYBSCGZLICNOBA-XQXXSGGOSA-N 0.000 description 1
- JVSBYEDSSRZQGV-GUBZILKMSA-N Glu-Asp-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](N)CCC(O)=O JVSBYEDSSRZQGV-GUBZILKMSA-N 0.000 description 1
- HNVFSTLPVJWIDV-CIUDSAMLSA-N Glu-Glu-Gln Chemical compound OC(=O)CC[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(N)=O)C(O)=O HNVFSTLPVJWIDV-CIUDSAMLSA-N 0.000 description 1
- HVYWQYLBVXMXSV-GUBZILKMSA-N Glu-Leu-Ala Chemical compound [H]N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(O)=O HVYWQYLBVXMXSV-GUBZILKMSA-N 0.000 description 1
- YGLCLCMAYUYZSG-AVGNSLFASA-N Glu-Lys-His Chemical compound OC(=O)CC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(O)=O)CC1=CN=CN1 YGLCLCMAYUYZSG-AVGNSLFASA-N 0.000 description 1
- SOEPMWQCTJITPZ-SRVKXCTJSA-N Glu-Met-Lys Chemical compound CSCC[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@H](CCC(=O)O)N SOEPMWQCTJITPZ-SRVKXCTJSA-N 0.000 description 1
- 102220543465 Glucagon-like peptide 1 receptor_E128Q_mutation Human genes 0.000 description 1
- 102220558019 Glucocorticoid receptor_D101K_mutation Human genes 0.000 description 1
- 241000589236 Gluconobacter Species 0.000 description 1
- 102220555339 Glutamate carboxypeptidase 2_N76A_mutation Human genes 0.000 description 1
- 102220555337 Glutamate carboxypeptidase 2_Y75H_mutation Human genes 0.000 description 1
- 102220533602 Glutamine and serine-rich protein 1_V157E_mutation Human genes 0.000 description 1
- 102220495643 Glutaredoxin-like protein C5orf63_K119N_mutation Human genes 0.000 description 1
- 102220600921 Glutathione-specific gamma-glutamylcyclotransferase 2_N214K_mutation Human genes 0.000 description 1
- FCKPEGOCSVZPNC-WHOFXGATSA-N Gly-Ile-Phe Chemical compound NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 FCKPEGOCSVZPNC-WHOFXGATSA-N 0.000 description 1
- UWQDKRIZSROAKS-FJXKBIBVSA-N Gly-Met-Thr Chemical compound [H]NCC(=O)N[C@@H](CCSC)C(=O)N[C@@H]([C@@H](C)O)C(O)=O UWQDKRIZSROAKS-FJXKBIBVSA-N 0.000 description 1
- FKESCSGWBPUTPN-FOHZUACHSA-N Gly-Thr-Asn Chemical compound [H]NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(O)=O FKESCSGWBPUTPN-FOHZUACHSA-N 0.000 description 1
- BAYQNCWLXIDLHX-ONGXEEELSA-N Gly-Val-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@H](C(C)C)NC(=O)CN BAYQNCWLXIDLHX-ONGXEEELSA-N 0.000 description 1
- 102220534760 Glycogen phosphorylase, liver form_T26S_mutation Human genes 0.000 description 1
- 102220534759 Glycogen phosphorylase, liver form_T26V_mutation Human genes 0.000 description 1
- 102220534026 Glycogen phosphorylase, liver form_V231E_mutation Human genes 0.000 description 1
- 102220644332 Glycogenin-2_R235L_mutation Human genes 0.000 description 1
- 102220485772 Glycophorin-A_E91C_mutation Human genes 0.000 description 1
- 102220541510 Golgi to ER traffic protein 4 homolog_D84K_mutation Human genes 0.000 description 1
- 102220626373 Granzyme A_V227E_mutation Human genes 0.000 description 1
- 102220480575 Gremlin-1_K252A_mutation Human genes 0.000 description 1
- 102220592685 Guanidinoacetate N-methyltransferase_L258A_mutation Human genes 0.000 description 1
- 102220592690 Guanidinoacetate N-methyltransferase_L258G_mutation Human genes 0.000 description 1
- 102220592691 Guanidinoacetate N-methyltransferase_L258P_mutation Human genes 0.000 description 1
- 102220487369 Guanine nucleotide-binding protein G(i) subunit alpha-1_E116L_mutation Human genes 0.000 description 1
- 102220520020 Guanylyl cyclase-activating protein 1_L246A_mutation Human genes 0.000 description 1
- 102220519038 Guanylyl cyclase-activating protein 1_Y99N_mutation Human genes 0.000 description 1
- 102220519036 Guanylyl cyclase-activating protein 1_Y99S_mutation Human genes 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 102220576268 HLA class I histocompatibility antigen, A alpha chain_K168Q_mutation Human genes 0.000 description 1
- 102220575538 HLA class I histocompatibility antigen, A alpha chain_T158K_mutation Human genes 0.000 description 1
- 102220576103 HLA class I histocompatibility antigen, B alpha chain_A15G_mutation Human genes 0.000 description 1
- 102220576058 HLA class I histocompatibility antigen, B alpha chain_A93R_mutation Human genes 0.000 description 1
- 102220593933 HLA class I histocompatibility antigen, alpha chain G_E138H_mutation Human genes 0.000 description 1
- 102220500520 HLA class II histocompatibility antigen, DM beta chain_A162E_mutation Human genes 0.000 description 1
- 102220474644 HLA class II histocompatibility antigen, DP alpha 1 chain_L97S_mutation Human genes 0.000 description 1
- 102220467950 HLA class II histocompatibility antigen, DP beta 1 chain_A31L_mutation Human genes 0.000 description 1
- 102220467946 HLA class II histocompatibility antigen, DP beta 1 chain_F38D_mutation Human genes 0.000 description 1
- 102220467947 HLA class II histocompatibility antigen, DP beta 1 chain_F38H_mutation Human genes 0.000 description 1
- 102220467933 HLA class II histocompatibility antigen, DP beta 1 chain_F38L_mutation Human genes 0.000 description 1
- 102220467934 HLA class II histocompatibility antigen, DP beta 1 chain_F38Y_mutation Human genes 0.000 description 1
- 102220468011 HLA class II histocompatibility antigen, DP beta 1 chain_G113D_mutation Human genes 0.000 description 1
- 102220468009 HLA class II histocompatibility antigen, DP beta 1 chain_G113V_mutation Human genes 0.000 description 1
- 102220468007 HLA class II histocompatibility antigen, DP beta 1 chain_P115A_mutation Human genes 0.000 description 1
- 102220545757 HLA class II histocompatibility antigen, DQ alpha 1 chain_V73D_mutation Human genes 0.000 description 1
- 102220588681 HLA class II histocompatibility antigen, DR alpha chain_A93L_mutation Human genes 0.000 description 1
- 102220498341 HLA class II histocompatibility antigen, DRB1 beta chain_A103E_mutation Human genes 0.000 description 1
- 102220498326 HLA class II histocompatibility antigen, DRB1 beta chain_A103L_mutation Human genes 0.000 description 1
- 102220498327 HLA class II histocompatibility antigen, DRB1 beta chain_A103Q_mutation Human genes 0.000 description 1
- 102220498324 HLA class II histocompatibility antigen, DRB1 beta chain_A103R_mutation Human genes 0.000 description 1
- 102220498307 HLA class II histocompatibility antigen, DRB1 beta chain_E166A_mutation Human genes 0.000 description 1
- 102220626282 Hemoglobin subunit alpha_D127G_mutation Human genes 0.000 description 1
- 108091005904 Hemoglobin subunit beta Proteins 0.000 description 1
- 102220605090 Hemoglobin subunit beta_A202D_mutation Human genes 0.000 description 1
- 102220606740 Hemoglobin subunit beta_N140S_mutation Human genes 0.000 description 1
- 102220622871 Hemoglobin subunit delta_V30L_mutation Human genes 0.000 description 1
- 102220509201 Heparin cofactor 2_K204M_mutation Human genes 0.000 description 1
- 102220509202 Heparin cofactor 2_K204N_mutation Human genes 0.000 description 1
- 102220508970 Heparin cofactor 2_K204T_mutation Human genes 0.000 description 1
- 102220491237 Heterochromatin protein 1-binding protein 3_E136P_mutation Human genes 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 102220565940 Hexokinase HKDC1_K245E_mutation Human genes 0.000 description 1
- 102220633335 Hexokinase-4_S151T_mutation Human genes 0.000 description 1
- 102220491783 High mobility group protein B1_K3A_mutation Human genes 0.000 description 1
- 102220491780 High mobility group protein B1_R123A_mutation Human genes 0.000 description 1
- 102220491824 High mobility group protein B1_S42E_mutation Human genes 0.000 description 1
- KDDKJKKQODQQBR-NHCYSSNCSA-N His-Val-Asp Chemical compound CC(C)[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)NC(=O)[C@H](CC1=CN=CN1)N KDDKJKKQODQQBR-NHCYSSNCSA-N 0.000 description 1
- 102220628501 Histone H1.1_D94H_mutation Human genes 0.000 description 1
- 102220628523 Histone H1.1_D94N_mutation Human genes 0.000 description 1
- 102220609221 Histone H1.1_T152E_mutation Human genes 0.000 description 1
- 102220585137 Histone H1t_K110V_mutation Human genes 0.000 description 1
- 102220466683 Histone H4 transcription factor_Q105P_mutation Human genes 0.000 description 1
- 102220470743 Histone deacetylase 7_M181H_mutation Human genes 0.000 description 1
- 102220470982 Histone deacetylase 8_D101L_mutation Human genes 0.000 description 1
- 102220596678 Histone-lysine N-methyltransferase SETD1B_V129G_mutation Human genes 0.000 description 1
- 102220588775 Histone-lysine N-methyltransferase, H3 lysine-79 specific_L107T_mutation Human genes 0.000 description 1
- 102220588776 Histone-lysine N-methyltransferase, H3 lysine-79 specific_M87H_mutation Human genes 0.000 description 1
- 102220588739 Histone-lysine N-methyltransferase, H3 lysine-79 specific_M87I_mutation Human genes 0.000 description 1
- 102220526863 Homeobox protein Hox-A4_T251P_mutation Human genes 0.000 description 1
- 102220604059 Homeobox protein SIX3_A93D_mutation Human genes 0.000 description 1
- 102220604126 Homeobox protein SIX3_D70A_mutation Human genes 0.000 description 1
- 102220590197 Homeobox protein TGIF2_T186V_mutation Human genes 0.000 description 1
- 241000700588 Human alphaherpesvirus 1 Species 0.000 description 1
- 102220517958 Humanin_L9A_mutation Human genes 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- 102220475419 Iduronate 2-sulfatase_S117Y_mutation Human genes 0.000 description 1
- KIMHKBDJQQYLHU-PEFMBERDSA-N Ile-Glu-Asp Chemical compound CC[C@H](C)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O)N KIMHKBDJQQYLHU-PEFMBERDSA-N 0.000 description 1
- UIEZQYNXCYHMQS-BJDJZHNGSA-N Ile-Lys-Ala Chemical compound CC[C@H](C)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)O)N UIEZQYNXCYHMQS-BJDJZHNGSA-N 0.000 description 1
- DGTOKVBDZXJHNZ-WZLNRYEVSA-N Ile-Thr-Tyr Chemical compound CC[C@H](C)[C@@H](C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O)N DGTOKVBDZXJHNZ-WZLNRYEVSA-N 0.000 description 1
- 102220545595 Ileal sodium/bile acid cotransporter_S171A_mutation Human genes 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102220628895 Immediate early response gene 2 protein_R235E_mutation Human genes 0.000 description 1
- 108700005091 Immunoglobulin Genes Proteins 0.000 description 1
- 102220617353 Immunoglobulin heavy constant gamma 1_L118E_mutation Human genes 0.000 description 1
- 102220478028 Immunoglobulin lambda variable 10-54_D4K_mutation Human genes 0.000 description 1
- 102220498572 InaD-like protein_F38W_mutation Human genes 0.000 description 1
- 102220632348 Inactive N-acetylated-alpha-linked acidic dipeptidase-like protein 2_E121K_mutation Human genes 0.000 description 1
- 102220632330 Inactive N-acetylated-alpha-linked acidic dipeptidase-like protein 2_P196A_mutation Human genes 0.000 description 1
- 102220636814 Inactive rhomboid protein 1_N131Q_mutation Human genes 0.000 description 1
- 102220635687 Inner centromere protein_E36R_mutation Human genes 0.000 description 1
- 102220641838 Inorganic pyrophosphatase_N102H_mutation Human genes 0.000 description 1
- 102220468816 Inositol 1,4,5-trisphosphate receptor type 2_L169A_mutation Human genes 0.000 description 1
- 102220600113 Inositol 1,4,5-trisphosphate receptor-interacting protein-like 1_T130V_mutation Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- 102220583202 Insulin-degrading enzyme_N184C_mutation Human genes 0.000 description 1
- 102220509927 Insulin-induced gene 2 protein_S151E_mutation Human genes 0.000 description 1
- 102220465481 Insulin-like growth factor II_K120N_mutation Human genes 0.000 description 1
- 102220468768 Insulin-like growth factor-binding protein 6_R134L_mutation Human genes 0.000 description 1
- 102220528921 Integrin beta-3_D243V_mutation Human genes 0.000 description 1
- 102220624326 Interferon alpha-8_N106P_mutation Human genes 0.000 description 1
- 102220465288 Interferon alpha-8_W180A_mutation Human genes 0.000 description 1
- 102220618069 Interferon-induced protein 44-like_K110L_mutation Human genes 0.000 description 1
- 102220478629 Interleukin-1 beta_E141N_mutation Human genes 0.000 description 1
- 102220637846 Interleukin-1 receptor-associated kinase-like 2_T66E_mutation Human genes 0.000 description 1
- 102220465506 Interleukin-33_D149K_mutation Human genes 0.000 description 1
- 102220465488 Interleukin-33_D244K_mutation Human genes 0.000 description 1
- 102220487959 Isoaspartyl peptidase/L-asparaginase_T147E_mutation Human genes 0.000 description 1
- 102220517092 Jerky protein homolog-like_P132S_mutation Human genes 0.000 description 1
- 102220475429 Junctional protein associated with coronary artery disease_D215S_mutation Human genes 0.000 description 1
- 102220517657 KAT8 regulatory NSL complex subunit 3_T24F_mutation Human genes 0.000 description 1
- 102220561296 KH homology domain-containing protein 4_S151D_mutation Human genes 0.000 description 1
- 102220511586 Kappa-casein_D84R_mutation Human genes 0.000 description 1
- 102220477973 Kelch-like protein 4_A207E_mutation Human genes 0.000 description 1
- 102220475922 Keratin, type I cytoskeletal 10_D4A_mutation Human genes 0.000 description 1
- 102220475927 Keratin, type I cytoskeletal 10_F6A_mutation Human genes 0.000 description 1
- 102220475874 Keratin, type I cytoskeletal 10_L17A_mutation Human genes 0.000 description 1
- 102000011782 Keratins Human genes 0.000 description 1
- 108010076876 Keratins Proteins 0.000 description 1
- 102220509244 Ketohexokinase_V129F_mutation Human genes 0.000 description 1
- 102220565460 Killer cell immunoglobulin-like receptor 2DL2_A15Q_mutation Human genes 0.000 description 1
- 102220525251 Killer cell lectin-like receptor subfamily B member 1_S151G_mutation Human genes 0.000 description 1
- 102220529399 Kinectin_T152D_mutation Human genes 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- 101000740455 Klebsiella pneumoniae Metallo-beta-lactamase type 2 Proteins 0.000 description 1
- 241000235649 Kluyveromyces Species 0.000 description 1
- 102220516685 Kynurenine-oxoglutarate transaminase 1_G262K_mutation Human genes 0.000 description 1
- SNDPXSYFESPGGJ-BYPYZUCNSA-N L-2-aminopentanoic acid Chemical compound CCC[C@H](N)C(O)=O SNDPXSYFESPGGJ-BYPYZUCNSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- RHGKLRLOHDJJDR-BYPYZUCNSA-N L-citrulline Chemical compound NC(=O)NCCC[C@H]([NH3+])C([O-])=O RHGKLRLOHDJJDR-BYPYZUCNSA-N 0.000 description 1
- XIGSAGMEBXLVJJ-YFKPBYRVSA-N L-homocitrulline Chemical compound NC(=O)NCCCC[C@H]([NH3+])C([O-])=O XIGSAGMEBXLVJJ-YFKPBYRVSA-N 0.000 description 1
- SNDPXSYFESPGGJ-UHFFFAOYSA-N L-norVal-OH Natural products CCCC(N)C(O)=O SNDPXSYFESPGGJ-UHFFFAOYSA-N 0.000 description 1
- LRQKBLKVPFOOQJ-YFKPBYRVSA-N L-norleucine Chemical compound CCCC[C@H]([NH3+])C([O-])=O LRQKBLKVPFOOQJ-YFKPBYRVSA-N 0.000 description 1
- ZFOMKMMPBOQKMC-KXUCPTDWSA-N L-pyrrolysine Chemical compound C[C@@H]1CC=N[C@H]1C(=O)NCCCC[C@H]([NH3+])C([O-])=O ZFOMKMMPBOQKMC-KXUCPTDWSA-N 0.000 description 1
- 238000007397 LAMP assay Methods 0.000 description 1
- 102220637763 LIM domain kinase 1_Y242F_mutation Human genes 0.000 description 1
- 102220596114 LINE-1 retrotransposable element ORF1 protein_R235A_mutation Human genes 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 241000186660 Lactobacillus Species 0.000 description 1
- 240000006024 Lactobacillus plantarum Species 0.000 description 1
- 235000013965 Lactobacillus plantarum Nutrition 0.000 description 1
- 241000917009 Lactobacillus rhamnosus GG Species 0.000 description 1
- 241000194036 Lactococcus Species 0.000 description 1
- 102220531101 Left-right determination factor 1_L92S_mutation Human genes 0.000 description 1
- 241000713666 Lentivirus Species 0.000 description 1
- ZRLUISBDKUWAIZ-CIUDSAMLSA-N Leu-Ala-Asp Chemical compound CC(C)C[C@H](N)C(=O)N[C@@H](C)C(=O)N[C@H](C(O)=O)CC(O)=O ZRLUISBDKUWAIZ-CIUDSAMLSA-N 0.000 description 1
- RFUBXQQFJFGJFV-GUBZILKMSA-N Leu-Asn-Gln Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(O)=O RFUBXQQFJFGJFV-GUBZILKMSA-N 0.000 description 1
- RIMMMMYKGIBOSN-DCAQKATOSA-N Leu-Asn-Met Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCSC)C(O)=O RIMMMMYKGIBOSN-DCAQKATOSA-N 0.000 description 1
- CLVUXCBGKUECIT-HJGDQZAQSA-N Leu-Asp-Thr Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O CLVUXCBGKUECIT-HJGDQZAQSA-N 0.000 description 1
- KAFOIVJDVSZUMD-DCAQKATOSA-N Leu-Gln-Gln Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(O)=O KAFOIVJDVSZUMD-DCAQKATOSA-N 0.000 description 1
- WIDZHJTYKYBLSR-DCAQKATOSA-N Leu-Glu-Glu Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(O)=O WIDZHJTYKYBLSR-DCAQKATOSA-N 0.000 description 1
- DBSLVQBXKVKDKJ-BJDJZHNGSA-N Leu-Ile-Ala Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(O)=O DBSLVQBXKVKDKJ-BJDJZHNGSA-N 0.000 description 1
- JNDYEOUZBLOVOF-AVGNSLFASA-N Leu-Leu-Gln Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(O)=O JNDYEOUZBLOVOF-AVGNSLFASA-N 0.000 description 1
- HVHRPWQEQHIQJF-AVGNSLFASA-N Leu-Lys-Glu Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(O)=O HVHRPWQEQHIQJF-AVGNSLFASA-N 0.000 description 1
- NHRINZSPIUXYQZ-DCAQKATOSA-N Leu-Met-Cys Chemical compound CC(C)C[C@@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CS)C(=O)O)N NHRINZSPIUXYQZ-DCAQKATOSA-N 0.000 description 1
- YUTNOGOMBNYPFH-XUXIUFHCSA-N Leu-Pro-Ile Chemical compound [H]N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H]([C@@H](C)CC)C(O)=O YUTNOGOMBNYPFH-XUXIUFHCSA-N 0.000 description 1
- AIQWYVFNBNNOLU-RHYQMDGZSA-N Leu-Thr-Val Chemical compound [H]N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(O)=O AIQWYVFNBNNOLU-RHYQMDGZSA-N 0.000 description 1
- 102220557547 Leucine-rich repeat transmembrane protein FLRT3_D188T_mutation Human genes 0.000 description 1
- 102220618932 Leucine-rich repeat-containing protein 34_A95G_mutation Human genes 0.000 description 1
- 102220599168 Leukemia inhibitory factor_N76F_mutation Human genes 0.000 description 1
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 1
- 102220520945 Linker for activation of T-cells family member 2_K263S_mutation Human genes 0.000 description 1
- 102220498146 Lipoma-preferred partner_D70S_mutation Human genes 0.000 description 1
- 102220553019 Lipoprotein lipase_S159G_mutation Human genes 0.000 description 1
- 102220551000 Lipoprotein lipase_V227A_mutation Human genes 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001625930 Luria Species 0.000 description 1
- 239000006142 Luria-Bertani Agar Substances 0.000 description 1
- 102220465649 Lymphocyte activation gene 3 protein_Y99F_mutation Human genes 0.000 description 1
- 102220496740 Lymphocyte expansion molecule_G126C_mutation Human genes 0.000 description 1
- 102220496737 Lymphocyte function-associated antigen 3_V49Q_mutation Human genes 0.000 description 1
- SJNZALDHDUYDBU-IHRRRGAJSA-N Lys-Arg-Lys Chemical compound NCCCC[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(O)=O SJNZALDHDUYDBU-IHRRRGAJSA-N 0.000 description 1
- HKCCVDWHHTVVPN-CIUDSAMLSA-N Lys-Asp-Ala Chemical compound [H]N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](C)C(O)=O HKCCVDWHHTVVPN-CIUDSAMLSA-N 0.000 description 1
- QUYCUALODHJQLK-CIUDSAMLSA-N Lys-Asp-Asp Chemical compound [H]N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(O)=O)C(O)=O QUYCUALODHJQLK-CIUDSAMLSA-N 0.000 description 1
- VMTYLUGCXIEDMV-QWRGUYRKSA-N Lys-Leu-Gly Chemical compound OC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCCCN VMTYLUGCXIEDMV-QWRGUYRKSA-N 0.000 description 1
- ALGGDNMLQNFVIZ-SRVKXCTJSA-N Lys-Lys-Asp Chemical compound C(CCN)C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)O)C(=O)O)N ALGGDNMLQNFVIZ-SRVKXCTJSA-N 0.000 description 1
- JOSAKOKSPXROGQ-BJDJZHNGSA-N Lys-Ser-Ile Chemical compound [H]N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)CC)C(O)=O JOSAKOKSPXROGQ-BJDJZHNGSA-N 0.000 description 1
- RMKJOQSYLQQRFN-KKUMJFAQSA-N Lys-Tyr-Asp Chemical compound [H]N[C@@H](CCCCN)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CC(O)=O)C(O)=O RMKJOQSYLQQRFN-KKUMJFAQSA-N 0.000 description 1
- IKXQOBUBZSOWDY-AVGNSLFASA-N Lys-Val-Val Chemical compound CC(C)[C@@H](C(=O)N[C@@H](C(C)C)C(=O)O)NC(=O)[C@H](CCCCN)N IKXQOBUBZSOWDY-AVGNSLFASA-N 0.000 description 1
- 102220644370 Lysophosphatidic acid phosphatase type 6_A257W_mutation Human genes 0.000 description 1
- 102220553275 Lysosomal acid glucosylceramidase_E80K_mutation Human genes 0.000 description 1
- 102220641423 Lysosomal alpha-mannosidase_A250S_mutation Human genes 0.000 description 1
- 102220569980 MHC class I polypeptide-related sequence A_T147S_mutation Human genes 0.000 description 1
- 102220570016 MHC class I polypeptide-related sequence A_V49G_mutation Human genes 0.000 description 1
- 102220507166 MICOS complex subunit MIC25_A95S_mutation Human genes 0.000 description 1
- 102220507276 MKI67 FHA domain-interacting nucleolar phosphoprotein_P144Q_mutation Human genes 0.000 description 1
- 102220501901 MOB kinase activator 1B_T251S_mutation Human genes 0.000 description 1
- 239000007993 MOPS buffer Substances 0.000 description 1
- 241001344133 Magnaporthe Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 102220611302 Magnesium transporter MRS2 homolog, mitochondrial_L61K_mutation Human genes 0.000 description 1
- 102220611300 Magnesium transporter MRS2 homolog, mitochondrial_L97D_mutation Human genes 0.000 description 1
- 102220619525 Major facilitator superfamily domain-containing protein 6-like_T186E_mutation Human genes 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 102220582826 Mannose-binding protein C_N214Y_mutation Human genes 0.000 description 1
- 102220573527 Matrix metalloproteinase-21_P115Q_mutation Human genes 0.000 description 1
- 102220621066 Medium-chain acyl-CoA ligase ACSF2, mitochondrial_D188P_mutation Human genes 0.000 description 1
- 102220550687 Megakaryocyte and platelet inhibitory receptor G6b_L190A_mutation Human genes 0.000 description 1
- 102220579522 Melanocyte-stimulating hormone receptor_K238R_mutation Human genes 0.000 description 1
- 102220522927 Melanoma-associated antigen C3_L165M_mutation Human genes 0.000 description 1
- 102220514509 Membrane-bound transcription factor site-2 protease_E172Q_mutation Human genes 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 102220639895 Mesencephalic astrocyte-derived neurotrophic factor_L109Q_mutation Human genes 0.000 description 1
- RVYDCISQIGHAFC-ZPFDUUQYSA-N Met-Ile-Gln Chemical compound CSCC[C@H](N)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(N)=O)C(O)=O RVYDCISQIGHAFC-ZPFDUUQYSA-N 0.000 description 1
- UNPGTBHYKJOCCZ-DCAQKATOSA-N Met-Lys-Ala Chemical compound CSCC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(O)=O UNPGTBHYKJOCCZ-DCAQKATOSA-N 0.000 description 1
- 102220548782 Metalloproteinase inhibitor 4_D4R_mutation Human genes 0.000 description 1
- 108090000157 Metallothionein Proteins 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 102220562494 Methylosome subunit pICln_S171Y_mutation Human genes 0.000 description 1
- 102220562506 Methylosome subunit pICln_T251Y_mutation Human genes 0.000 description 1
- 102220507944 Methyltransferase-like protein 27_S171W_mutation Human genes 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 241001148170 Microlunatus Species 0.000 description 1
- 102220597721 Mitochondrial basic amino acids transporter_N27H_mutation Human genes 0.000 description 1
- 102220612495 Mitogen-activated protein kinase kinase kinase 1_T130D_mutation Human genes 0.000 description 1
- 102220535198 Mitotic checkpoint serine/threonine-protein kinase BUB1_L122G_mutation Human genes 0.000 description 1
- 102220550069 Mixed lineage kinase domain-like protein_L165G_mutation Human genes 0.000 description 1
- 102220538277 Modulator of macroautophagy TMEM150B_Y32Q_mutation Human genes 0.000 description 1
- 241000713333 Mouse mammary tumor virus Species 0.000 description 1
- 102220501183 Multifunctional methyltransferase subunit TRM112-like protein_L9D_mutation Human genes 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 102220550234 Muscular LMNA-interacting protein_D127R_mutation Human genes 0.000 description 1
- 102220483782 Myb/SANT-like DNA-binding domain-containing protein 1_A21D_mutation Human genes 0.000 description 1
- 241000186359 Mycobacterium Species 0.000 description 1
- 101710107068 Myelin basic protein Proteins 0.000 description 1
- 102220506993 Myelin protein P0_P132L_mutation Human genes 0.000 description 1
- 102220528418 Myelin protein P0_R98S_mutation Human genes 0.000 description 1
- 102220485015 Myelin proteolipid protein_A248E_mutation Human genes 0.000 description 1
- 102220504085 Myeloid differentiation primary response protein MyD88_D197A_mutation Human genes 0.000 description 1
- 102220508326 Myeloid differentiation primary response protein MyD88_S209R_mutation Human genes 0.000 description 1
- 102220608094 Myosin-binding protein H_S42L_mutation Human genes 0.000 description 1
- 102220599237 Myotubularin_R69P_mutation Human genes 0.000 description 1
- 102220598996 Myotubularin_S209A_mutation Human genes 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical compound CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- QIAFMBKCNZACKA-UHFFFAOYSA-N N-benzoylglycine Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1 QIAFMBKCNZACKA-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 102220544925 N-terminal Xaa-Pro-Lys N-methyltransferase 1_D167Q_mutation Human genes 0.000 description 1
- 102220605379 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1_K110A_mutation Human genes 0.000 description 1
- 102220504759 NADH-ubiquinone oxidoreductase chain 5_G194S_mutation Human genes 0.000 description 1
- 102220631011 NCK-interacting protein with SH3 domain_D14T_mutation Human genes 0.000 description 1
- 102220476547 NF-kappa-B inhibitor alpha_D35A_mutation Human genes 0.000 description 1
- 102220536793 NKG2-A/NKG2-B type II integral membrane protein_K16P_mutation Human genes 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 102220494561 NOP protein chaperone 1_K8Q_mutation Human genes 0.000 description 1
- 102220592846 NPC intracellular cholesterol transporter 1_V231G_mutation Human genes 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- RHGKLRLOHDJJDR-UHFFFAOYSA-N Ndelta-carbamoyl-DL-ornithine Natural products OC(=O)C(N)CCCNC(N)=O RHGKLRLOHDJJDR-UHFFFAOYSA-N 0.000 description 1
- 102220574033 Neprilysin_L156S_mutation Human genes 0.000 description 1
- 102220537720 Netrin-3_K223A_mutation Human genes 0.000 description 1
- 102220515719 Neurensin-1_F40G_mutation Human genes 0.000 description 1
- 102220573812 Neuroendocrine protein 7B2_T79Y_mutation Human genes 0.000 description 1
- 102220499878 Neuronal acetylcholine receptor subunit beta-3_L118Q_mutation Human genes 0.000 description 1
- 241000221960 Neurospora Species 0.000 description 1
- 101100420081 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) rps-0 gene Proteins 0.000 description 1
- 102220606690 Neurotrimin_D23N_mutation Human genes 0.000 description 1
- 102220481793 Neutral amino acid transporter A_A164G_mutation Human genes 0.000 description 1
- 102220500341 Neutral and basic amino acid transport protein rBAT_D179Y_mutation Human genes 0.000 description 1
- 102220500403 Neutral and basic amino acid transport protein rBAT_F40V_mutation Human genes 0.000 description 1
- 102220541925 Neutrophil elastase_L47R_mutation Human genes 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- 102220480223 Nicotinate phosphoribosyltransferase_K3R_mutation Human genes 0.000 description 1
- 102220480981 Nicotinate phosphoribosyltransferase_K45G_mutation Human genes 0.000 description 1
- 102220480917 Nicotinate phosphoribosyltransferase_K45L_mutation Human genes 0.000 description 1
- 102220480988 Nicotinate phosphoribosyltransferase_L52T_mutation Human genes 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102220592907 Nitric oxide synthase, endothelial_N27Q_mutation Human genes 0.000 description 1
- 102220590538 Non-homologous end-joining factor 1_L139A_mutation Human genes 0.000 description 1
- 102220590514 Non-homologous end-joining factor 1_L61E_mutation Human genes 0.000 description 1
- 102220590517 Non-homologous end-joining factor 1_R64G_mutation Human genes 0.000 description 1
- 102220492970 Nuclear RNA export factor 1_L22D_mutation Human genes 0.000 description 1
- 102220520881 Nuclear autoantigenic sperm protein_L53S_mutation Human genes 0.000 description 1
- 102220558657 Nuclear protein 1_L53A_mutation Human genes 0.000 description 1
- 102220558593 Nuclear protein 1_R192A_mutation Human genes 0.000 description 1
- 102220558706 Nuclear protein 1_T68Q_mutation Human genes 0.000 description 1
- 102220609775 Nuclear protein MDM1_E11R_mutation Human genes 0.000 description 1
- 102220630238 Nucleic acid dioxygenase ALKBH1_K182A_mutation Human genes 0.000 description 1
- 102220630191 Nucleic acid dioxygenase ALKBH1_K241A_mutation Human genes 0.000 description 1
- 102220547866 Nucleobindin-1_N140Q_mutation Human genes 0.000 description 1
- 102220547020 Nucleobindin-1_T29A_mutation Human genes 0.000 description 1
- 102220526269 Nucleophosmin_K263A_mutation Human genes 0.000 description 1
- 102220525994 NudC domain-containing protein 1_D239N_mutation Human genes 0.000 description 1
- 102220623305 O-phosphoseryl-tRNA(Sec) selenium transferase_K173M_mutation Human genes 0.000 description 1
- 102220623303 O-phosphoseryl-tRNA(Sec) selenium transferase_Q105A_mutation Human genes 0.000 description 1
- 102220488467 Olfactory receptor 10G4_V195E_mutation Human genes 0.000 description 1
- 102220558160 Olfactory receptor 2A1/2A42_R235M_mutation Human genes 0.000 description 1
- 102220504244 Olfactory receptor 3A2_L190V_mutation Human genes 0.000 description 1
- 102220587644 Olfactory receptor 4D5_K252Q_mutation Human genes 0.000 description 1
- 102220575848 Olfactory receptor 8A1_N143C_mutation Human genes 0.000 description 1
- 102220536416 Omega-amidase NIT2_V231A_mutation Human genes 0.000 description 1
- 102220516530 Oncostatin-M_T150Q_mutation Human genes 0.000 description 1
- 102220497089 Orexin/Hypocretin receptor type 1_K3G_mutation Human genes 0.000 description 1
- 102220497087 Orexin/Hypocretin receptor type 1_K8G_mutation Human genes 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 102220575407 Ovarian cancer G-protein coupled receptor 1_K241Q_mutation Human genes 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 102220581212 Oxidized purine nucleoside triphosphate hydrolase_Q54P_mutation Human genes 0.000 description 1
- 102220581192 Oxidized purine nucleoside triphosphate hydrolase_V83M_mutation Human genes 0.000 description 1
- 102220483376 P protein_A257D_mutation Human genes 0.000 description 1
- 102220541553 PDZ domain-containing protein GIPC1_F38R_mutation Human genes 0.000 description 1
- 102220479454 PH and SEC7 domain-containing protein 1_K238V_mutation Human genes 0.000 description 1
- 102220634878 PH and SEC7 domain-containing protein 3_T186P_mutation Human genes 0.000 description 1
- 102220471023 PTEN upstream open reading frame MP31_T29V_mutation Human genes 0.000 description 1
- 241000235652 Pachysolen Species 0.000 description 1
- 102220493626 Paired box protein Pax-6_G18W_mutation Human genes 0.000 description 1
- 102220578116 Palladin_L232T_mutation Human genes 0.000 description 1
- 241000282577 Pan troglodytes Species 0.000 description 1
- 108010067372 Pancreatic elastase Proteins 0.000 description 1
- 102220479493 Pantetheinase_R33N_mutation Human genes 0.000 description 1
- 241000520272 Pantoea Species 0.000 description 1
- 241001504519 Papio ursinus Species 0.000 description 1
- 101710112083 Para-Rep C1 Proteins 0.000 description 1
- 102220493735 Parkinson disease protein 7_A104T_mutation Human genes 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 229930195708 Penicillin V Natural products 0.000 description 1
- 102220511855 Peptide chain release factor 1-like, mitochondrial_L177F_mutation Human genes 0.000 description 1
- 102220578099 Peptidyl-prolyl cis-trans isomerase A-like 4F_G113C_mutation Human genes 0.000 description 1
- 102220578098 Peptidyl-prolyl cis-trans isomerase A-like 4F_G113M_mutation Human genes 0.000 description 1
- 102220468814 Peptidyl-tRNA hydrolase ICT1, mitochondrial_N76K_mutation Human genes 0.000 description 1
- 102220515106 Peroxisomal sarcosine oxidase_E11V_mutation Human genes 0.000 description 1
- 102220474373 Peroxisomal trans-2-enoyl-CoA reductase_E91A_mutation Human genes 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- 241000199264 Phaseolus carteri Species 0.000 description 1
- BBDSZDHUCPSYAC-QEJZJMRPSA-N Phe-Ala-Leu Chemical compound [H]N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(O)=O BBDSZDHUCPSYAC-QEJZJMRPSA-N 0.000 description 1
- ULECEJGNDHWSKD-QEJZJMRPSA-N Phe-Ala-Lys Chemical compound NCCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC1=CC=CC=C1 ULECEJGNDHWSKD-QEJZJMRPSA-N 0.000 description 1
- LBSARGIQACMGDF-WBAXXEDZSA-N Phe-Ala-Phe Chemical compound C([C@H](N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)C1=CC=CC=C1 LBSARGIQACMGDF-WBAXXEDZSA-N 0.000 description 1
- UHRNIXJAGGLKHP-DLOVCJGASA-N Phe-Ala-Ser Chemical compound [H]N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(O)=O UHRNIXJAGGLKHP-DLOVCJGASA-N 0.000 description 1
- LDSOBEJVGGVWGD-DLOVCJGASA-N Phe-Asp-Ala Chemical compound OC(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](N)CC1=CC=CC=C1 LDSOBEJVGGVWGD-DLOVCJGASA-N 0.000 description 1
- IEIFEYBAYFSRBQ-IHRRRGAJSA-N Phe-Val-Ser Chemical compound CC(C)[C@@H](C(=O)N[C@@H](CO)C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)N IEIFEYBAYFSRBQ-IHRRRGAJSA-N 0.000 description 1
- 102220636993 Phenylalanine-4-hydroxylase_A104D_mutation Human genes 0.000 description 1
- 102220617998 Phenylalanine-4-hydroxylase_D84Y_mutation Human genes 0.000 description 1
- 102220506477 Phenylalanine-tRNA ligase, mitochondrial_P77K_mutation Human genes 0.000 description 1
- 102220517143 Phosphate-regulating neutral endopeptidase PHEX_D84E_mutation Human genes 0.000 description 1
- 102220517148 Phosphate-regulating neutral endopeptidase PHEX_D84Q_mutation Human genes 0.000 description 1
- 102220493302 Phosphate-regulating neutral endopeptidase PHEX_K168N_mutation Human genes 0.000 description 1
- 102220493275 Phosphate-regulating neutral endopeptidase PHEX_L160R_mutation Human genes 0.000 description 1
- 102220517267 Phosphate-regulating neutral endopeptidase PHEX_L92A_mutation Human genes 0.000 description 1
- 102220569028 Phosphatidylcholine translocator ABCB4_A250P_mutation Human genes 0.000 description 1
- 102220498921 Phosphatidylinositol 4-phosphate 5-kinase type-1 beta_Y242H_mutation Human genes 0.000 description 1
- 102220620755 Phosphatidylserine decarboxylase proenzyme, mitochondrial_A41N_mutation Human genes 0.000 description 1
- 102220619694 Phosphoethanolamine/phosphocholine phosphatase_D203S_mutation Human genes 0.000 description 1
- 102220473261 Photoreceptor ankyrin repeat protein_L232A_mutation Human genes 0.000 description 1
- 102220630400 Piezo-type mechanosensitive ion channel component 1_D225G_mutation Human genes 0.000 description 1
- 102220497755 Pirin_A162S_mutation Human genes 0.000 description 1
- 102220620269 Pituitary-specific positive transcription factor 1_F135C_mutation Human genes 0.000 description 1
- 102220531513 Piwi-like protein 1_V30A_mutation Human genes 0.000 description 1
- 102220509039 Platelet-activating factor acetylhydrolase IB subunit beta_L72A_mutation Human genes 0.000 description 1
- 102220509020 Platelet-activating factor acetylhydrolase IB subunit beta_L72E_mutation Human genes 0.000 description 1
- 102220481505 Podocan_V73F_mutation Human genes 0.000 description 1
- 102220481317 Podocan_V73S_mutation Human genes 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 102220630361 Poly(A) RNA polymerase GLD2_D215A_mutation Human genes 0.000 description 1
- 102220631416 Poly(A) RNA polymerase GLD2_F163A_mutation Human genes 0.000 description 1
- 102220635375 Polyadenylate-binding protein 4-like_D5V_mutation Human genes 0.000 description 1
- 102220630068 Polypeptide N-acetylgalactosaminyltransferase 11_D197Y_mutation Human genes 0.000 description 1
- 208000020584 Polyploidy Diseases 0.000 description 1
- 102220581264 Porphobilinogen deaminase_A31P_mutation Human genes 0.000 description 1
- 102220581436 Porphobilinogen deaminase_E80G_mutation Human genes 0.000 description 1
- 102220502606 Post-GPI attachment to proteins factor 4_M260A_mutation Human genes 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102220549832 Pre-mRNA-processing factor 39_T29K_mutation Human genes 0.000 description 1
- 102220641232 Pregnancy-specific beta-1-glycoprotein 1_T43P_mutation Human genes 0.000 description 1
- 102220644293 Prelamin-A/C_T24S_mutation Human genes 0.000 description 1
- 102220630442 Presenilin-1_G206D_mutation Human genes 0.000 description 1
- VJLJGKQAOQJXJG-CIUDSAMLSA-N Pro-Asp-Glu Chemical compound [H]N1CCC[C@H]1C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(O)=O VJLJGKQAOQJXJG-CIUDSAMLSA-N 0.000 description 1
- KLSOMAFWRISSNI-OSUNSFLBSA-N Pro-Ile-Thr Chemical compound C[C@@H](O)[C@@H](C(O)=O)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]1CCCN1 KLSOMAFWRISSNI-OSUNSFLBSA-N 0.000 description 1
- 102220621923 Pro-neuropeptide Y_L22M_mutation Human genes 0.000 description 1
- 102220549201 Probable 2-oxoglutarate dehydrogenase E1 component DHKTD1, mitochondrial_F20L_mutation Human genes 0.000 description 1
- 102220579393 Probable ATP-dependent RNA helicase DHX37_K223V_mutation Human genes 0.000 description 1
- 102220613920 Probable E3 ubiquitin-protein ligase HERC1_L107H_mutation Human genes 0.000 description 1
- 102220512977 Probable JmjC domain-containing histone demethylation protein 2C_K124G_mutation Human genes 0.000 description 1
- 102220637940 Probable cation-transporting ATPase 13A5_S96Y_mutation Human genes 0.000 description 1
- 102220592625 Probable guanine nucleotide exchange factor MCF2L2_K182G_mutation Human genes 0.000 description 1
- 102220535504 Probable phospholipid-transporting ATPase IIA_A217H_mutation Human genes 0.000 description 1
- 102220535503 Probable phospholipid-transporting ATPase IIA_A217R_mutation Human genes 0.000 description 1
- 102220535502 Probable phospholipid-transporting ATPase IIA_N214H_mutation Human genes 0.000 description 1
- 102220535501 Probable phospholipid-transporting ATPase IIA_N214V_mutation Human genes 0.000 description 1
- 102220543074 Probable polypeptide N-acetylgalactosaminyltransferase 8_A41E_mutation Human genes 0.000 description 1
- 102220542213 Probable polypeptide N-acetylgalactosaminyltransferase 8_S209D_mutation Human genes 0.000 description 1
- 102220482149 Probable tRNA methyltransferase 9B_K223L_mutation Human genes 0.000 description 1
- 102220547177 Profilin-3_A41R_mutation Human genes 0.000 description 1
- 102220629705 Proheparin-binding EGF-like growth factor_D71G_mutation Human genes 0.000 description 1
- 102220628909 Proheparin-binding EGF-like growth factor_E141H_mutation Human genes 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 102220566973 Propionyl-CoA carboxylase beta chain, mitochondrial_G198D_mutation Human genes 0.000 description 1
- 102220517103 Protease-associated domain-containing protein 1_E133Q_mutation Human genes 0.000 description 1
- 102220472877 Proteasomal ATPase-associated factor 1_L89C_mutation Human genes 0.000 description 1
- 102220474046 Protection of telomeres protein 1_P222V_mutation Human genes 0.000 description 1
- 102220556890 Protein ALEX_K16V_mutation Human genes 0.000 description 1
- 102220548924 Protein Bop_L118A_mutation Human genes 0.000 description 1
- 102220480860 Protein C-ets-1_R134K_mutation Human genes 0.000 description 1
- 102220472531 Protein ENL_S117V_mutation Human genes 0.000 description 1
- 102220472528 Protein ENL_T26E_mutation Human genes 0.000 description 1
- 102220472526 Protein ENL_T26H_mutation Human genes 0.000 description 1
- 102220531990 Protein FosB_Q63N_mutation Human genes 0.000 description 1
- 102220622450 Protein Hook homolog 3_F40Y_mutation Human genes 0.000 description 1
- 102220622911 Protein Hook homolog 3_L97T_mutation Human genes 0.000 description 1
- 102220511903 Protein MTSS 1_A207C_mutation Human genes 0.000 description 1
- 102220537266 Protein NDRG2_E172D_mutation Human genes 0.000 description 1
- 102220537280 Protein NDRG2_E172S_mutation Human genes 0.000 description 1
- 102220636365 Protein PALS2_V227G_mutation Human genes 0.000 description 1
- 102220478946 Protein WFDC9_N27T_mutation Human genes 0.000 description 1
- 102220639120 Protein Wnt-11_S57E_mutation Human genes 0.000 description 1
- 102220472203 Protein Wnt-2_K237M_mutation Human genes 0.000 description 1
- 102220497213 Protein Wnt-3a_S209T_mutation Human genes 0.000 description 1
- 102220543120 Protein adenylyltransferase FICD_L258D_mutation Human genes 0.000 description 1
- 102220545385 Protein capicua homolog_E166V_mutation Human genes 0.000 description 1
- 102220622272 Protein farnesyltransferase subunit beta_N143K_mutation Human genes 0.000 description 1
- 102220581148 Protein fem-1 homolog C_D188K_mutation Human genes 0.000 description 1
- 102220620884 Protein pitchfork_D179R_mutation Human genes 0.000 description 1
- 102220645898 Protein pitchfork_T48Y_mutation Human genes 0.000 description 1
- 102220534514 Protein quaking_K90S_mutation Human genes 0.000 description 1
- 102220638260 Protein rogdi homolog_K90A_mutation Human genes 0.000 description 1
- 102220468936 Protein unc-13 homolog A_E80N_mutation Human genes 0.000 description 1
- 102220520976 Protein unc-13 homolog D_H82C_mutation Human genes 0.000 description 1
- 102220643306 Protein-glutamine gamma-glutamyltransferase 2_S171E_mutation Human genes 0.000 description 1
- 102220643305 Protein-glutamine gamma-glutamyltransferase 2_W180F_mutation Human genes 0.000 description 1
- 102220643310 Protein-glutamine gamma-glutamyltransferase 2_W180L_mutation Human genes 0.000 description 1
- 102220558516 Proteinase-activated receptor 2_Y210L_mutation Human genes 0.000 description 1
- 102220515165 Protocadherin beta-7_R69D_mutation Human genes 0.000 description 1
- 102220543869 Protocadherin-10_S42G_mutation Human genes 0.000 description 1
- 102220640358 Proton channel OTOP1_L160T_mutation Human genes 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 102220635458 Putative POU domain, class 5, transcription factor 1B_K182T_mutation Human genes 0.000 description 1
- 102220525017 Putative T-complex protein 1 subunit theta-like 1_L122Q_mutation Human genes 0.000 description 1
- 102220549954 Putative beta-lactamase-like 1_L258M_mutation Human genes 0.000 description 1
- 102220549953 Putative beta-lactamase-like 1_T186N_mutation Human genes 0.000 description 1
- 102220501807 Putative chemokine-related protein FP248_L246W_mutation Human genes 0.000 description 1
- 102220501816 Putative chemokine-related protein FP248_S234Y_mutation Human genes 0.000 description 1
- 102220603720 Putative dispanin subfamily A member 2d_N184D_mutation Human genes 0.000 description 1
- 102220587517 Putative uncharacterized protein FLJ13197_D60G_mutation Human genes 0.000 description 1
- 102220587527 Putative uncharacterized protein FLJ13197_K81D_mutation Human genes 0.000 description 1
- 102220587526 Putative uncharacterized protein FLJ13197_N62W_mutation Human genes 0.000 description 1
- 102220586410 Putative uncharacterized protein FLJ13197_S159A_mutation Human genes 0.000 description 1
- 102220589461 Putative uncharacterized protein UNQ5830/PRO19650/PRO19816_E200S_mutation Human genes 0.000 description 1
- 102220524025 Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1_E141R_mutation Human genes 0.000 description 1
- 102220524026 Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1_E80R_mutation Human genes 0.000 description 1
- 102220516968 Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial_S171D_mutation Human genes 0.000 description 1
- 102220536096 Quinone oxidoreductase PIG3_S151V_mutation Human genes 0.000 description 1
- 102220601428 RING finger protein 11_D127L_mutation Human genes 0.000 description 1
- 102220581886 RNA N6-adenosine-methyltransferase METTL16_N184A_mutation Human genes 0.000 description 1
- 102220610245 RNA polymerase I-specific transcription initiation factor RRN3_K256E_mutation Human genes 0.000 description 1
- 102220530148 RNA polymerase-associated protein LEO1_S57G_mutation Human genes 0.000 description 1
- 230000004570 RNA-binding Effects 0.000 description 1
- 102220626287 RUN domain-containing protein 3B_L47M_mutation Human genes 0.000 description 1
- 102220639875 Radial spoke head protein 3 homolog_S96A_mutation Human genes 0.000 description 1
- 102220639963 Radial spoke head protein 3 homolog_T186A_mutation Human genes 0.000 description 1
- 102220639962 Radial spoke head protein 3 homolog_T186D_mutation Human genes 0.000 description 1
- 102220639957 Radial spoke head protein 3 homolog_T205A_mutation Human genes 0.000 description 1
- 102220639959 Radial spoke head protein 3 homolog_T205D_mutation Human genes 0.000 description 1
- 102220547557 Ragulator complex protein LAMTOR1_E11G_mutation Human genes 0.000 description 1
- 241000232299 Ralstonia Species 0.000 description 1
- 102220509959 Ras-related C3 botulinum toxin substrate 1_V51L_mutation Human genes 0.000 description 1
- 102220509958 Ras-related C3 botulinum toxin substrate 1_V51M_mutation Human genes 0.000 description 1
- 102220510503 Ras-related C3 botulinum toxin substrate 2_P34H_mutation Human genes 0.000 description 1
- 102220510444 Ras-related C3 botulinum toxin substrate 2_T24N_mutation Human genes 0.000 description 1
- 102220606957 Ras-related protein Rap-1b_Q63E_mutation Human genes 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 102220630934 Receptor-interacting serine/threonine-protein kinase 1_E166S_mutation Human genes 0.000 description 1
- 102220630959 Receptor-interacting serine/threonine-protein kinase 1_R161S_mutation Human genes 0.000 description 1
- 102220512936 Receptor-interacting serine/threonine-protein kinase 2_K45M_mutation Human genes 0.000 description 1
- 102220591179 Receptor-type tyrosine-protein phosphatase kappa_H82S_mutation Human genes 0.000 description 1
- 108020004511 Recombinant DNA Proteins 0.000 description 1
- 102220566606 Recombining binding protein suppressor of hairless-like protein_H82A_mutation Human genes 0.000 description 1
- 206010038063 Rectal haemorrhage Diseases 0.000 description 1
- 102220576534 Regulatory solute carrier protein family 1 member 1_Q54L_mutation Human genes 0.000 description 1
- 102220615369 Remodeling and spacing factor 1_L169S_mutation Human genes 0.000 description 1
- 102220571567 Renin_E36Q_mutation Human genes 0.000 description 1
- 102220503750 Replication factor C subunit 3_T66N_mutation Human genes 0.000 description 1
- 102220492201 Replication stress response regulator SDE2_K81L_mutation Human genes 0.000 description 1
- 102220484214 Replication stress response regulator SDE2_R192G_mutation Human genes 0.000 description 1
- 102220492229 Replication stress response regulator SDE2_R37A_mutation Human genes 0.000 description 1
- 102220492283 Replication stress response regulator SDE2_R37K_mutation Human genes 0.000 description 1
- 102220483824 Replication stress response regulator SDE2_V51E_mutation Human genes 0.000 description 1
- 102220555329 Retinal-specific phospholipid-transporting ATPase ABCA4_K223Q_mutation Human genes 0.000 description 1
- 102220558360 Retinoid isomerohydrolase_D167A_mutation Human genes 0.000 description 1
- 102220531765 Retinoid-inducible serine carboxypeptidase_D244N_mutation Human genes 0.000 description 1
- 102220531760 Retinoid-inducible serine carboxypeptidase_Y210H_mutation Human genes 0.000 description 1
- 102220642709 Retinol dehydrogenase 12_G145E_mutation Human genes 0.000 description 1
- 241000589180 Rhizobium Species 0.000 description 1
- 241000235527 Rhizopus Species 0.000 description 1
- 102220529486 Rho guanine nucleotide exchange factor 28_R98M_mutation Human genes 0.000 description 1
- 241000316848 Rhodococcus <scale insect> Species 0.000 description 1
- 102220485672 Rhodopsin_L176M_mutation Human genes 0.000 description 1
- 102220485513 Rhodopsin_L17F_mutation Human genes 0.000 description 1
- 102220474419 Ribitol-5-phosphate xylosyltransferase 1_R69A_mutation Human genes 0.000 description 1
- 102220644564 Ribonuclease H2 subunit A_Y210A_mutation Human genes 0.000 description 1
- 102220469278 Ribosomal RNA processing protein 1 homolog B_E138R_mutation Human genes 0.000 description 1
- 241000714474 Rous sarcoma virus Species 0.000 description 1
- 102220592516 Runt-related transcription factor 2_T205R_mutation Human genes 0.000 description 1
- 102220517868 SCO-spondin_N259A_mutation Human genes 0.000 description 1
- 102220514467 SERTA domain-containing protein 1_L97A_mutation Human genes 0.000 description 1
- 102220611338 SPOC domain-containing protein 1_L190W_mutation Human genes 0.000 description 1
- 102220629109 STING ER exit protein_K256H_mutation Human genes 0.000 description 1
- 102220538878 SUMO-conjugating enzyme UBC9_D127S_mutation Human genes 0.000 description 1
- 241000235346 Schizosaccharomyces Species 0.000 description 1
- 102220587956 Seipin_L156D_mutation Human genes 0.000 description 1
- 102220587955 Seipin_L169D_mutation Human genes 0.000 description 1
- 102220595957 Selenoprotein S_N261A_mutation Human genes 0.000 description 1
- 238000012300 Sequence Analysis Methods 0.000 description 1
- 102220601916 Sequestosome-1_R213Q_mutation Human genes 0.000 description 1
- MMGJPDWSIOAGTH-ACZMJKKPSA-N Ser-Ala-Gln Chemical compound [H]N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(O)=O MMGJPDWSIOAGTH-ACZMJKKPSA-N 0.000 description 1
- JAWGSPUJAXYXJA-IHRRRGAJSA-N Ser-Phe-Arg Chemical compound NC(N)=NCCC[C@@H](C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CO)N)CC1=CC=CC=C1 JAWGSPUJAXYXJA-IHRRRGAJSA-N 0.000 description 1
- 102220483931 Serine/threonine-protein kinase Chk2_T68A_mutation Human genes 0.000 description 1
- 102220498534 Serine/threonine-protein kinase N3_A155K_mutation Human genes 0.000 description 1
- 102220585332 Serine/threonine-protein kinase STK11_L160P_mutation Human genes 0.000 description 1
- 102220541489 Serine/threonine-protein kinase WNK2_K256M_mutation Human genes 0.000 description 1
- 102220504635 Serine/threonine-protein kinase receptor R3_E59V_mutation Human genes 0.000 description 1
- 102220491164 Serpin H1_A41P_mutation Human genes 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 102220585589 Short-chain dehydrogenase/reductase family 42E member 1_Q63P_mutation Human genes 0.000 description 1
- 241001135312 Sinorhizobium Species 0.000 description 1
- 102220612903 Small EDRK-rich factor 1_Q12A_mutation Human genes 0.000 description 1
- 102220620697 Small integral membrane protein 32_M260T_mutation Human genes 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 102220523228 Sodium channel protein type 1 subunit alpha_L61F_mutation Human genes 0.000 description 1
- 102220524196 Sodium- and chloride-dependent glycine transporter 2_A162G_mutation Human genes 0.000 description 1
- 102220513211 Sodium/hydrogen exchanger 1_L165C_mutation Human genes 0.000 description 1
- 102220645837 Sodium/hydrogen exchanger 1_L177C_mutation Human genes 0.000 description 1
- 102220609022 Solute carrier family 15 member 1_S117N_mutation Human genes 0.000 description 1
- 102220551043 Sonic hedgehog protein_L109F_mutation Human genes 0.000 description 1
- 241000221948 Sordaria Species 0.000 description 1
- 102220524372 Sortilin-related receptor_Q148L_mutation Human genes 0.000 description 1
- 102220524375 Sortilin-related receptor_Q148P_mutation Human genes 0.000 description 1
- 102220606500 Sorting nexin-10_F40M_mutation Human genes 0.000 description 1
- 102220606457 Sorting nexin-10_L89M_mutation Human genes 0.000 description 1
- 102220606007 Sorting nexin-10_Y32S_mutation Human genes 0.000 description 1
- 102220601606 Speckle-type POZ protein_L190D_mutation Human genes 0.000 description 1
- 102220509097 Sphingosine 1-phosphate receptor 1_E146N_mutation Human genes 0.000 description 1
- 101000857870 Squalus acanthias Gonadoliberin Proteins 0.000 description 1
- 102220509417 Src-like-adapter_L229S_mutation Human genes 0.000 description 1
- 241000122971 Stenotrophomonas Species 0.000 description 1
- 102220541320 Steroid Delta-isomerase_P222H_mutation Human genes 0.000 description 1
- 102220563227 Stonin-1_L109D_mutation Human genes 0.000 description 1
- 108010090804 Streptavidin Proteins 0.000 description 1
- 241000194017 Streptococcus Species 0.000 description 1
- 101000874347 Streptococcus agalactiae IgA FC receptor Proteins 0.000 description 1
- 241000187747 Streptomyces Species 0.000 description 1
- 102220577394 Stromal cell-derived factor 1_K45S_mutation Human genes 0.000 description 1
- 102220623070 Structural maintenance of chromosomes flexible hinge domain-containing protein 1_E136G_mutation Human genes 0.000 description 1
- 102220600386 Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial_K90L_mutation Human genes 0.000 description 1
- 102220607204 Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial_S234R_mutation Human genes 0.000 description 1
- 102220601859 Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial_T152N_mutation Human genes 0.000 description 1
- 102220495862 Succinate dehydrogenase assembly factor 3, mitochondrial_D167V_mutation Human genes 0.000 description 1
- 102220610096 Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial_L122D_mutation Human genes 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 102220522155 Sulfotransferase 1C4_T205P_mutation Human genes 0.000 description 1
- 102220503468 Superoxide dismutase [Cu-Zn]_D84S_mutation Human genes 0.000 description 1
- 102220538706 Superoxide dismutase [Cu-Zn]_L9Q_mutation Human genes 0.000 description 1
- 102220616453 Superoxide dismutase [Mn], mitochondrial_L9M_mutation Human genes 0.000 description 1
- 102220608462 Suppressor of cytokine signaling 3_L22F_mutation Human genes 0.000 description 1
- 102220578492 Suppressor of fused homolog_R174E_mutation Human genes 0.000 description 1
- 102220578476 Suppressor of fused homolog_S234V_mutation Human genes 0.000 description 1
- 102220565026 Survival motor neuron protein_A46N_mutation Human genes 0.000 description 1
- 241000282898 Sus scrofa Species 0.000 description 1
- 102220577078 Synapsin-1_L61A_mutation Human genes 0.000 description 1
- 102220512015 Synaptotagmin-7_Q54A_mutation Human genes 0.000 description 1
- 102220606704 Syndecan-1_T29D_mutation Human genes 0.000 description 1
- 241000192584 Synechocystis Species 0.000 description 1
- 102220493237 Syntaxin-binding protein 1_T26M_mutation Human genes 0.000 description 1
- 102220521961 THAP domain-containing protein 1_A7D_mutation Human genes 0.000 description 1
- 102220521969 THAP domain-containing protein 1_K16A_mutation Human genes 0.000 description 1
- 102220521945 THAP domain-containing protein 1_L177P_mutation Human genes 0.000 description 1
- 102220521929 THAP domain-containing protein 1_L72R_mutation Human genes 0.000 description 1
- 102220538051 TIP41-like protein_D71L_mutation Human genes 0.000 description 1
- 102220603323 TYRO protein tyrosine kinase-binding protein_D14A_mutation Human genes 0.000 description 1
- 241000228341 Talaromyces Species 0.000 description 1
- 229920002253 Tannate Polymers 0.000 description 1
- 102220500145 Target of EGR1 protein 1_N27D_mutation Human genes 0.000 description 1
- 102220548687 Tectonin beta-propeller repeat-containing protein 1_T66P_mutation Human genes 0.000 description 1
- 241000405713 Tetraselmis suecica Species 0.000 description 1
- 241000589596 Thermus Species 0.000 description 1
- 102220610852 Thialysine N-epsilon-acetyltransferase_L72G_mutation Human genes 0.000 description 1
- WKDDRNSBRWANNC-UHFFFAOYSA-N Thienamycin Natural products C1C(SCCN)=C(C(O)=O)N2C(=O)C(C(O)C)C21 WKDDRNSBRWANNC-UHFFFAOYSA-N 0.000 description 1
- GLQFKOVWXPPFTP-VEVYYDQMSA-N Thr-Arg-Asp Chemical compound [H]N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(O)=O GLQFKOVWXPPFTP-VEVYYDQMSA-N 0.000 description 1
- IRKWVRSEQFTGGV-VEVYYDQMSA-N Thr-Asn-Arg Chemical compound [H]N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O IRKWVRSEQFTGGV-VEVYYDQMSA-N 0.000 description 1
- HJOSVGCWOTYJFG-WDCWCFNPSA-N Thr-Glu-Lys Chemical compound C[C@H]([C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O)N)O HJOSVGCWOTYJFG-WDCWCFNPSA-N 0.000 description 1
- BIENEHRYNODTLP-HJGDQZAQSA-N Thr-Glu-Met Chemical compound C[C@H]([C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCSC)C(=O)O)N)O BIENEHRYNODTLP-HJGDQZAQSA-N 0.000 description 1
- UBDDORVPVLEECX-FJXKBIBVSA-N Thr-Gly-Met Chemical compound [H]N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CCSC)C(O)=O UBDDORVPVLEECX-FJXKBIBVSA-N 0.000 description 1
- AHOLTQCAVBSUDP-PPCPHDFISA-N Thr-Ile-Lys Chemical compound CC[C@H](C)[C@H](NC(=O)[C@@H](N)[C@@H](C)O)C(=O)N[C@@H](CCCCN)C(O)=O AHOLTQCAVBSUDP-PPCPHDFISA-N 0.000 description 1
- MEJHFIOYJHTWMK-VOAKCMCISA-N Thr-Leu-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)[C@@H](C)O MEJHFIOYJHTWMK-VOAKCMCISA-N 0.000 description 1
- MECLEFZMPPOEAC-VOAKCMCISA-N Thr-Leu-Lys Chemical compound C[C@H]([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)O)N)O MECLEFZMPPOEAC-VOAKCMCISA-N 0.000 description 1
- JWQNAFHCXKVZKZ-UVOCVTCTSA-N Thr-Lys-Thr Chemical compound [H]N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(O)=O JWQNAFHCXKVZKZ-UVOCVTCTSA-N 0.000 description 1
- DXPURPNJDFCKKO-RHYQMDGZSA-N Thr-Lys-Val Chemical compound CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)[C@@H](C)O)C(O)=O DXPURPNJDFCKKO-RHYQMDGZSA-N 0.000 description 1
- OGOYMQWIWHGTGH-KZVJFYERSA-N Thr-Val-Ala Chemical compound C[C@@H](O)[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(O)=O OGOYMQWIWHGTGH-KZVJFYERSA-N 0.000 description 1
- 102000006601 Thymidine Kinase Human genes 0.000 description 1
- 108020004440 Thymidine kinase Proteins 0.000 description 1
- 102220481580 Thymocyte selection-associated high mobility group box protein TOX_T152P_mutation Human genes 0.000 description 1
- 102220617210 Tissue factor pathway inhibitor_W199R_mutation Human genes 0.000 description 1
- 102220641736 Toll-like receptor 5_N143T_mutation Human genes 0.000 description 1
- 102220468085 Trafficking protein particle complex subunit 3_L53T_mutation Human genes 0.000 description 1
- 102220534965 Trafficking regulator of GLUT4 1_F20S_mutation Human genes 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 102220590230 Transcription factor 7-like 2_T212V_mutation Human genes 0.000 description 1
- 102220593206 Transcription factor GATA-4_P226Q_mutation Human genes 0.000 description 1
- 102220604981 Transcription factor Sp2_L47Q_mutation Human genes 0.000 description 1
- 102220498152 Transcriptional adapter 2-alpha_T88E_mutation Human genes 0.000 description 1
- 102220600066 Transcriptional coactivator YAP1_W199A_mutation Human genes 0.000 description 1
- 102220561788 Transcriptional repressor NF-X1_F20A_mutation Human genes 0.000 description 1
- 102220567572 Transitional endoplasmic reticulum ATPase_K256A_mutation Human genes 0.000 description 1
- 102220633953 Translation initiation factor eIF-2B subunit epsilon_V73G_mutation Human genes 0.000 description 1
- 102220498133 Transmembrane 4 L6 family member 20_F13P_mutation Human genes 0.000 description 1
- 102220495941 Transmembrane protein 185B_F13A_mutation Human genes 0.000 description 1
- 241000223259 Trichoderma Species 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 102220478576 Tropomyosin alpha-1 chain_K237A_mutation Human genes 0.000 description 1
- 102220538684 Tropomyosin beta chain_D14V_mutation Human genes 0.000 description 1
- 102220483625 Troponin I, cardiac muscle_D188A_mutation Human genes 0.000 description 1
- 102220563705 Troponin T, cardiac muscle_K263R_mutation Human genes 0.000 description 1
- 102220510420 Tubulin alpha chain-like 3_G86E_mutation Human genes 0.000 description 1
- 102220586116 Tubulin polymerization-promoting protein_S159E_mutation Human genes 0.000 description 1
- 102220529070 Tudor and KH domain-containing protein_V142N_mutation Human genes 0.000 description 1
- 102220586067 Two pore channel protein 2_K204A_mutation Human genes 0.000 description 1
- CRWOSTCODDFEKZ-HRCADAONSA-N Tyr-Arg-Pro Chemical compound C1C[C@@H](N(C1)C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC2=CC=C(C=C2)O)N)C(=O)O CRWOSTCODDFEKZ-HRCADAONSA-N 0.000 description 1
- ITDWWLTTWRRLCC-KJEVXHAQSA-N Tyr-Thr-Arg Chemical compound NC(N)=NCCC[C@@H](C(O)=O)NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](N)CC1=CC=C(O)C=C1 ITDWWLTTWRRLCC-KJEVXHAQSA-N 0.000 description 1
- 102220563325 Tyrosine-protein kinase BTK_R174K_mutation Human genes 0.000 description 1
- 102220563347 Tyrosine-protein kinase BTK_R28P_mutation Human genes 0.000 description 1
- 102220573512 Tyrosine-protein kinase Fer_D70K_mutation Human genes 0.000 description 1
- 102220541383 Tyrosyl-DNA phosphodiesterase 1_K238A_mutation Human genes 0.000 description 1
- 102220618248 U2 small nuclear ribonucleoprotein A'_T68K_mutation Human genes 0.000 description 1
- 102220604918 U4/U6 small nuclear ribonucleoprotein Prp4_R192E_mutation Human genes 0.000 description 1
- 102220523925 UDP-glucose 6-dehydrogenase_A104L_mutation Human genes 0.000 description 1
- 102220613237 Ubiquinone biosynthesis protein COQ9, mitochondrial_L190E_mutation Human genes 0.000 description 1
- 102220568950 Ubiquitin thioesterase OTUB2_N184Q_mutation Human genes 0.000 description 1
- 102220568941 Ubiquitin thioesterase OTUB2_T68G_mutation Human genes 0.000 description 1
- 102220606434 Ubiquitin-conjugating enzyme E2 R1_E133R_mutation Human genes 0.000 description 1
- 201000006704 Ulcerative Colitis Diseases 0.000 description 1
- 102220613740 Uncharacterized protein C19orf84_L160Y_mutation Human genes 0.000 description 1
- 102220480901 Uncharacterized protein EXOC3-AS1_V49S_mutation Human genes 0.000 description 1
- 102220555696 Urokinase plasminogen activator surface receptor_S151W_mutation Human genes 0.000 description 1
- 241000221566 Ustilago Species 0.000 description 1
- 102220579876 V-type proton ATPase catalytic subunit A_K256Q_mutation Human genes 0.000 description 1
- 102220476879 Vacuolar protein sorting-associated protein 16 homolog_E200R_mutation Human genes 0.000 description 1
- 102220635539 Vacuolar protein sorting-associated protein 33A_K45R_mutation Human genes 0.000 description 1
- 102220635538 Vacuolar protein sorting-associated protein 33A_N74S_mutation Human genes 0.000 description 1
- 102220475222 Vacuolar protein sorting-associated protein 33A_R64S_mutation Human genes 0.000 description 1
- 102220635199 Vacuolar protein sorting-associated protein 33A_S117T_mutation Human genes 0.000 description 1
- 102220532871 Vacuolar protein sorting-associated protein 37A_L246E_mutation Human genes 0.000 description 1
- 102220532651 Vacuolar protein sorting-associated protein 37A_L72H_mutation Human genes 0.000 description 1
- 102220514960 Vacuolar protein sorting-associated protein 4B_A15D_mutation Human genes 0.000 description 1
- 102220634008 Vacuolar protein-sorting-associated protein 36_A202R_mutation Human genes 0.000 description 1
- 102220639683 Vacuolar-sorting protein SNF8_F6E_mutation Human genes 0.000 description 1
- 102220621588 Vacuolar-sorting protein SNF8_M87E_mutation Human genes 0.000 description 1
- IQQYYFPCWKWUHW-YDHLFZDLSA-N Val-Asn-Tyr Chemical compound CC(C)[C@@H](C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O)N IQQYYFPCWKWUHW-YDHLFZDLSA-N 0.000 description 1
- OVLIFGQSBSNGHY-KKHAAJSZSA-N Val-Asp-Thr Chemical compound C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C(C)C)N)O OVLIFGQSBSNGHY-KKHAAJSZSA-N 0.000 description 1
- XXROXFHCMVXETG-UWVGGRQHSA-N Val-Gly-Val Chemical compound CC(C)[C@H](N)C(=O)NCC(=O)N[C@@H](C(C)C)C(O)=O XXROXFHCMVXETG-UWVGGRQHSA-N 0.000 description 1
- UEPLNXPLHJUYPT-AVGNSLFASA-N Val-Met-Lys Chemical compound CC(C)[C@H](N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCCCN)C(O)=O UEPLNXPLHJUYPT-AVGNSLFASA-N 0.000 description 1
- 102220610585 Vasoactive intestinal polypeptide receptor 1_L122A_mutation Human genes 0.000 description 1
- 102220610602 Vasoactive intestinal polypeptide receptor 1_R64E_mutation Human genes 0.000 description 1
- 102220567331 Vasopressin V2 receptor_L53R_mutation Human genes 0.000 description 1
- 102220593177 Vasopressin-neurophysin 2-copeptin_L232S_mutation Human genes 0.000 description 1
- 102220569948 Vasorin_K119E_mutation Human genes 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 102220634407 Vitamin K epoxide reductase complex subunit 1_R98K_mutation Human genes 0.000 description 1
- 102220634593 Vitamin K epoxide reductase complex subunit 1_S57A_mutation Human genes 0.000 description 1
- 102220526967 Vitamin K-dependent protein C_A240G_mutation Human genes 0.000 description 1
- 102220512314 Vitamin K-dependent protein C_G145R_mutation Human genes 0.000 description 1
- 102220469588 Voltage-dependent L-type calcium channel subunit beta-2_D60A_mutation Human genes 0.000 description 1
- 102220469587 Voltage-dependent L-type calcium channel subunit beta-2_D60K_mutation Human genes 0.000 description 1
- 102220469752 Voltage-dependent L-type calcium channel subunit beta-2_G50D_mutation Human genes 0.000 description 1
- 102220469751 Voltage-dependent L-type calcium channel subunit beta-2_G50K_mutation Human genes 0.000 description 1
- 102220470249 Voltage-dependent L-type calcium channel subunit beta-2_R28A_mutation Human genes 0.000 description 1
- 102220497191 WD repeat domain phosphoinositide-interacting protein 4_A208D_mutation Human genes 0.000 description 1
- 102220591670 WW domain-binding protein 2_Y75F_mutation Human genes 0.000 description 1
- 102220472084 Wee1-like protein kinase 2_K8T_mutation Human genes 0.000 description 1
- 102220472159 Wilms tumor protein_E116Q_mutation Human genes 0.000 description 1
- 102220555361 X-box-binding protein 1_T212N_mutation Human genes 0.000 description 1
- 241000589634 Xanthomonas Species 0.000 description 1
- ZZXDRXVIRVJQBT-UHFFFAOYSA-M Xylenesulfonate Chemical compound CC1=CC=CC(S([O-])(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-M 0.000 description 1
- 102220589754 YjeF N-terminal domain-containing protein 3_G25F_mutation Human genes 0.000 description 1
- 102220589714 YjeF N-terminal domain-containing protein 3_T24Y_mutation Human genes 0.000 description 1
- 102220477119 Zinc finger protein 280A_D101E_mutation Human genes 0.000 description 1
- 102220476747 Zinc finger protein 280A_G25E_mutation Human genes 0.000 description 1
- 102220482548 Zinc finger protein 543_L246H_mutation Human genes 0.000 description 1
- 102220482616 Zinc finger protein 559_T251N_mutation Human genes 0.000 description 1
- 102220637633 Zinc finger protein 600_M2V_mutation Human genes 0.000 description 1
- 102220516515 Zinc finger protein Helios_L160A_mutation Human genes 0.000 description 1
- 102220516353 Zinc finger protein Helios_R161A_mutation Human genes 0.000 description 1
- 102220515546 Zinc finger protein Helios_R183A_mutation Human genes 0.000 description 1
- 102220594693 Zinc finger protein PLAGL1_A207M_mutation Human genes 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 208000019790 abdominal distention Diseases 0.000 description 1
- 230000003187 abdominal effect Effects 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 108010041407 alanylaspartic acid Proteins 0.000 description 1
- 108010005233 alanylglutamic acid Proteins 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 108010050122 alpha 1-Antitrypsin Proteins 0.000 description 1
- 108010026331 alpha-Fetoproteins Proteins 0.000 description 1
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 1
- 230000001668 ameliorated effect Effects 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 229960002684 aminocaproic acid Drugs 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940090588 amoxil Drugs 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 238000009635 antibiotic susceptibility testing Methods 0.000 description 1
- 238000009175 antibody therapy Methods 0.000 description 1
- 230000004596 appetite loss Effects 0.000 description 1
- 230000001174 ascending effect Effects 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 108010077245 asparaginyl-proline Proteins 0.000 description 1
- 239000000605 aspartame Substances 0.000 description 1
- IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartame Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(=O)OC)CC1=CC=CC=C1 IAOZJIPTCAWIRG-QWRGUYRKSA-N 0.000 description 1
- 235000010357 aspartame Nutrition 0.000 description 1
- 229960003438 aspartame Drugs 0.000 description 1
- 108010069205 aspartyl-phenylalanine Proteins 0.000 description 1
- 229940098164 augmentin Drugs 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 229960002379 avibactam Drugs 0.000 description 1
- NDCUAPJVLWFHHB-UHNVWZDZSA-N avibactam Chemical compound C1N2[C@H](C(N)=O)CC[C@@]1([H])N(OS(O)(=O)=O)C2=O NDCUAPJVLWFHHB-UHNVWZDZSA-N 0.000 description 1
- JTWOMNBEOCYFNV-NFFDBFGFSA-N azlocillin Chemical compound N([C@@H](C(=O)N[C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C=1C=CC=CC=1)C(=O)N1CCNC1=O JTWOMNBEOCYFNV-NFFDBFGFSA-N 0.000 description 1
- 229960003623 azlocillin Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 229940002008 bifidobacterium bifidum Drugs 0.000 description 1
- 229940004120 bifidobacterium infantis Drugs 0.000 description 1
- 229940009291 bifidobacterium longum Drugs 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 210000003445 biliary tract Anatomy 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000012148 binding buffer Substances 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 239000012620 biological material Substances 0.000 description 1
- 238000001574 biopsy Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000001815 biotherapy Methods 0.000 description 1
- 229960002685 biotin Drugs 0.000 description 1
- 235000020958 biotin Nutrition 0.000 description 1
- 239000011616 biotin Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000009534 blood test Methods 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 102220370481 c.101C>G Human genes 0.000 description 1
- 102220360343 c.110G>A Human genes 0.000 description 1
- 102220358890 c.116C>A Human genes 0.000 description 1
- 102200108120 c.116C>T Human genes 0.000 description 1
- 102220360497 c.124T>A Human genes 0.000 description 1
- 102220362554 c.127A>G Human genes 0.000 description 1
- 102220395130 c.128C>G Human genes 0.000 description 1
- 102220424828 c.137C>T Human genes 0.000 description 1
- 102220346311 c.139C>T Human genes 0.000 description 1
- 102220356489 c.148G>T Human genes 0.000 description 1
- 102220346634 c.148G>T Human genes 0.000 description 1
- 102220377346 c.151G>T Human genes 0.000 description 1
- 102220368360 c.157C>G Human genes 0.000 description 1
- 102220361400 c.164A>C Human genes 0.000 description 1
- 102220350264 c.175G>A Human genes 0.000 description 1
- 102220360922 c.181C>A Human genes 0.000 description 1
- 102220362998 c.182T>C Human genes 0.000 description 1
- 102220358252 c.182T>G Human genes 0.000 description 1
- 102220362973 c.18C>A Human genes 0.000 description 1
- 102220403236 c.191G>T Human genes 0.000 description 1
- 102220348242 c.205C>G Human genes 0.000 description 1
- 102220353540 c.20C>G Human genes 0.000 description 1
- 102220389253 c.213C>G Human genes 0.000 description 1
- 102220359783 c.234_235invCA Human genes 0.000 description 1
- 102220431755 c.247G>C Human genes 0.000 description 1
- 102220398034 c.248T>G Human genes 0.000 description 1
- 102220412485 c.263C>T Human genes 0.000 description 1
- 102220364590 c.268A>G Human genes 0.000 description 1
- 102220355138 c.268_269delAAinsGT Human genes 0.000 description 1
- 102220366004 c.26T>C Human genes 0.000 description 1
- 102220359935 c.26T>G Human genes 0.000 description 1
- 102220347973 c.282C>G Human genes 0.000 description 1
- 102220388270 c.283G>A Human genes 0.000 description 1
- 102220359541 c.284C>T Human genes 0.000 description 1
- 102220360285 c.292C>G Human genes 0.000 description 1
- 102220364606 c.293G>T Human genes 0.000 description 1
- 102220360476 c.302A>G Human genes 0.000 description 1
- 102220355191 c.304A>G Human genes 0.000 description 1
- 102200122304 c.308C>T Human genes 0.000 description 1
- 102220353608 c.319C>T Human genes 0.000 description 1
- 102220358505 c.326T>C Human genes 0.000 description 1
- 102220406079 c.330G>C Human genes 0.000 description 1
- 102220361260 c.337G>A Human genes 0.000 description 1
- 102200091490 c.340G>A Human genes 0.000 description 1
- 102220415534 c.341G>A Human genes 0.000 description 1
- 102220370510 c.344C>A Human genes 0.000 description 1
- 102220352426 c.349T>C Human genes 0.000 description 1
- 102220385349 c.350C>T Human genes 0.000 description 1
- 102220346646 c.352C>A Human genes 0.000 description 1
- 102220361158 c.352C>T Human genes 0.000 description 1
- 102220430696 c.364C>G Human genes 0.000 description 1
- 102200012614 c.377G>A Human genes 0.000 description 1
- 102220383647 c.377G>T Human genes 0.000 description 1
- 102220411555 c.381C>A Human genes 0.000 description 1
- 102220431382 c.388A>T Human genes 0.000 description 1
- 102220429364 c.395C>G Human genes 0.000 description 1
- 102220355826 c.406G>C Human genes 0.000 description 1
- 102220355192 c.409C>T Human genes 0.000 description 1
- 102220414501 c.40G>A Human genes 0.000 description 1
- 102220348556 c.410C>A Human genes 0.000 description 1
- 102220359291 c.410C>T Human genes 0.000 description 1
- 102220354971 c.415C>A Human genes 0.000 description 1
- 102220353616 c.416T>G Human genes 0.000 description 1
- 102220358597 c.424G>C Human genes 0.000 description 1
- 102220356867 c.427A>G Human genes 0.000 description 1
- 102220355795 c.428A>G Human genes 0.000 description 1
- 102220424861 c.431C>G Human genes 0.000 description 1
- 102220361180 c.434G>T Human genes 0.000 description 1
- 102220415108 c.439A>C Human genes 0.000 description 1
- 102220392647 c.446A>T Human genes 0.000 description 1
- 102220355749 c.44C>T Human genes 0.000 description 1
- 102220354217 c.451T>C Human genes 0.000 description 1
- 102220383435 c.452C>G Human genes 0.000 description 1
- 102220414532 c.452C>T Human genes 0.000 description 1
- 102220358034 c.457G>T Human genes 0.000 description 1
- 102220352557 c.472A>T Human genes 0.000 description 1
- 102200091175 c.481C>G Human genes 0.000 description 1
- 102220365168 c.481C>T Human genes 0.000 description 1
- 102220363558 c.488T>G Human genes 0.000 description 1
- 102220370702 c.502A>G Human genes 0.000 description 1
- 102220353289 c.508C>A Human genes 0.000 description 1
- 102220351025 c.509C>G Human genes 0.000 description 1
- 102220361255 c.512C>T Human genes 0.000 description 1
- 102220364116 c.517A>G Human genes 0.000 description 1
- 102220352408 c.523G>C Human genes 0.000 description 1
- 102220362474 c.527T>C Human genes 0.000 description 1
- 102200162311 c.52G>A Human genes 0.000 description 1
- 102220347930 c.538T>C Human genes 0.000 description 1
- 102220402998 c.53G>A Human genes 0.000 description 1
- 102220360653 c.541A>G Human genes 0.000 description 1
- 102220412356 c.542T>C Human genes 0.000 description 1
- 102220358920 c.544A>C Human genes 0.000 description 1
- 102220348627 c.548G>A Human genes 0.000 description 1
- 102200105867 c.559G>C Human genes 0.000 description 1
- 102220383410 c.566C>A Human genes 0.000 description 1
- 102220354944 c.581G>A Human genes 0.000 description 1
- 102220457761 c.581G>T Human genes 0.000 description 1
- 102220354461 c.592G>A Human genes 0.000 description 1
- 102220419291 c.598G>A Human genes 0.000 description 1
- 102220429076 c.604G>T Human genes 0.000 description 1
- 102220357644 c.622G>T Human genes 0.000 description 1
- 102220362473 c.626C>T Human genes 0.000 description 1
- 102220411568 c.629A>G Human genes 0.000 description 1
- 102220358038 c.638G>A Human genes 0.000 description 1
- 102220396666 c.638G>C Human genes 0.000 description 1
- 102220355091 c.660G>T Human genes 0.000 description 1
- 102220418791 c.662C>G Human genes 0.000 description 1
- 102220414676 c.670G>A Human genes 0.000 description 1
- 102220362468 c.673G>T Human genes 0.000 description 1
- 102220347709 c.689C>G Human genes 0.000 description 1
- 102220414042 c.68A>G Human genes 0.000 description 1
- 102220359312 c.694C>G Human genes 0.000 description 1
- 102220361721 c.701C>T Human genes 0.000 description 1
- 102220366328 c.703C>A Human genes 0.000 description 1
- 102200093315 c.704G>A Human genes 0.000 description 1
- 102220352870 c.704G>C Human genes 0.000 description 1
- 102220360076 c.707A>T Human genes 0.000 description 1
- 102200102206 c.709A>G Human genes 0.000 description 1
- 102220359207 c.711G>C Human genes 0.000 description 1
- 102220360595 c.713A>C Human genes 0.000 description 1
- 102220418142 c.714G>C Human genes 0.000 description 1
- 102220370206 c.71C>G Human genes 0.000 description 1
- 102220389194 c.727G>T Human genes 0.000 description 1
- 102220364077 c.728A>G Human genes 0.000 description 1
- 102220346603 c.729T>G Human genes 0.000 description 1
- 102220383332 c.737T>C Human genes 0.000 description 1
- 102220354537 c.73G>A Human genes 0.000 description 1
- 102220346567 c.73G>T Human genes 0.000 description 1
- 102220356254 c.743C>T Human genes 0.000 description 1
- 102220347887 c.749C>A Human genes 0.000 description 1
- 102220349137 c.749C>G Human genes 0.000 description 1
- 102200149789 c.773T>C Human genes 0.000 description 1
- 102220354364 c.785G>A Human genes 0.000 description 1
- 102220351565 c.787A>C Human genes 0.000 description 1
- 102220353762 c.799A>G Human genes 0.000 description 1
- 102220363899 c.7A>G Human genes 0.000 description 1
- 102220347799 c.801G>C Human genes 0.000 description 1
- 102220364486 c.8A>T Human genes 0.000 description 1
- 102220363250 c.97C>T Human genes 0.000 description 1
- 102200002501 c.98G>A Human genes 0.000 description 1
- 102220347737 c.98G>T Human genes 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000007894 caplet Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229940041011 carbapenems Drugs 0.000 description 1
- 229960003669 carbenicillin Drugs 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 229940097644 cedax Drugs 0.000 description 1
- 229960004841 cefadroxil Drugs 0.000 description 1
- NBFNMSULHIODTC-CYJZLJNKSA-N cefadroxil monohydrate Chemical compound O.C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=C(O)C=C1 NBFNMSULHIODTC-CYJZLJNKSA-N 0.000 description 1
- 229960000603 cefalotin Drugs 0.000 description 1
- OLVCFLKTBJRLHI-AXAPSJFSSA-N cefamandole Chemical compound CN1N=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)[C@H](O)C=3C=CC=CC=3)[C@H]2SC1 OLVCFLKTBJRLHI-AXAPSJFSSA-N 0.000 description 1
- 229960003012 cefamandole Drugs 0.000 description 1
- ICZOIXFFVKYXOM-YCLOEFEOSA-M cefamandole nafate Chemical compound [Na+].CN1N=NN=C1SCC1=C(C([O-])=O)N2C(=O)[C@@H](NC(=O)[C@H](OC=O)C=3C=CC=CC=3)[C@H]2SC1 ICZOIXFFVKYXOM-YCLOEFEOSA-M 0.000 description 1
- FLKYBGKDCCEQQM-WYUVZMMLSA-M cefazolin sodium Chemical compound [Na+].S1C(C)=NN=C1SCC1=C(C([O-])=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 FLKYBGKDCCEQQM-WYUVZMMLSA-M 0.000 description 1
- 229960004069 cefditoren Drugs 0.000 description 1
- 229960002129 cefixime Drugs 0.000 description 1
- 229940088508 cefizox Drugs 0.000 description 1
- WZOZEZRFJCJXNZ-ZBFHGGJFSA-N cefoxitin Chemical compound N([C@]1(OC)C(N2C(=C(COC(N)=O)CS[C@@H]21)C(O)=O)=O)C(=O)CC1=CC=CS1 WZOZEZRFJCJXNZ-ZBFHGGJFSA-N 0.000 description 1
- 229960002682 cefoxitin Drugs 0.000 description 1
- 229960005090 cefpodoxime Drugs 0.000 description 1
- WYUSVOMTXWRGEK-HBWVYFAYSA-N cefpodoxime Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC)C(O)=O)C(=O)C(=N/OC)\C1=CSC(N)=N1 WYUSVOMTXWRGEK-HBWVYFAYSA-N 0.000 description 1
- LTINZAODLRIQIX-FBXRGJNPSA-N cefpodoxime proxetil Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC)C(=O)OC(C)OC(=O)OC(C)C)C(=O)C(=N/OC)\C1=CSC(N)=N1 LTINZAODLRIQIX-FBXRGJNPSA-N 0.000 description 1
- 229960002580 cefprozil Drugs 0.000 description 1
- 229960004828 ceftaroline fosamil Drugs 0.000 description 1
- 229960004086 ceftibuten Drugs 0.000 description 1
- 229940047496 ceftin Drugs 0.000 description 1
- 229960001991 ceftizoxime Drugs 0.000 description 1
- NNULBSISHYWZJU-LLKWHZGFSA-N ceftizoxime Chemical compound N([C@@H]1C(N2C(=CCS[C@@H]21)C(O)=O)=O)C(=O)\C(=N/OC)C1=CSC(N)=N1 NNULBSISHYWZJU-LLKWHZGFSA-N 0.000 description 1
- 229950004259 ceftobiprole Drugs 0.000 description 1
- 229960002405 ceftolozane Drugs 0.000 description 1
- JHFNIHVVXRKLEF-DCZLAGFPSA-N ceftolozane Chemical compound CN1C(N)=C(NC(=O)NCCN)C=[N+]1CC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)C(=N/OC(C)(C)C([O-])=O)\C=3N=C(N)SN=3)[C@H]2SC1 JHFNIHVVXRKLEF-DCZLAGFPSA-N 0.000 description 1
- 229940099237 cefzil Drugs 0.000 description 1
- 239000013592 cell lysate Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 229940106164 cephalexin Drugs 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 229960005091 chloramphenicol Drugs 0.000 description 1
- WIIZWVCIJKGZOK-RKDXNWHRSA-N chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 1
- JOYKCMAPFCSKNO-UHFFFAOYSA-N chloro benzenesulfonate Chemical compound ClOS(=O)(=O)C1=CC=CC=C1 JOYKCMAPFCSKNO-UHFFFAOYSA-N 0.000 description 1
- KVSASDOGYIBWTA-UHFFFAOYSA-N chloro benzoate Chemical compound ClOC(=O)C1=CC=CC=C1 KVSASDOGYIBWTA-UHFFFAOYSA-N 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- VYVRIXWNTVOIRD-LRHBOZQDSA-N ciguatoxin CTX1B Chemical compound C([C@@]12[C@@H](C)[C@@H]([C@@H]3[C@H]([C@H]([C@H](C)[C@H]4O[C@H]5C[C@@H](C)C[C@H]6O[C@@]7(C)[C@H](O)C[C@H]8O[C@H]9C=C[C@H]%10O[C@H]%11C[C@@H]%12[C@H]([C@@H]([C@H]%13O[C@H](C=CC[C@@H]%13O%12)\C=C\[C@H](O)CO)O)O[C@@H]%11C=C[C@@H]%10O[C@@H]9C\C=C/C[C@@H]8O[C@@H]7C[C@@H]6O[C@@H]5C[C@@H]4O3)O)O2)C)[C@H](O)CO1 VYVRIXWNTVOIRD-LRHBOZQDSA-N 0.000 description 1
- 229940114081 cinnamate Drugs 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 229960002173 citrulline Drugs 0.000 description 1
- 235000013477 citrulline Nutrition 0.000 description 1
- 229940088530 claforan Drugs 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 229960002227 clindamycin Drugs 0.000 description 1
- KDLRVYVGXIQJDK-AWPVFWJPSA-N clindamycin Chemical compound CN1C[C@H](CCC)C[C@H]1C(=O)N[C@H]([C@H](C)Cl)[C@@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](SC)O1 KDLRVYVGXIQJDK-AWPVFWJPSA-N 0.000 description 1
- 229960003326 cloxacillin Drugs 0.000 description 1
- 238000011278 co-treatment Methods 0.000 description 1
- 206010009887 colitis Diseases 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 230000001447 compensatory effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000000599 controlled substance Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 239000002254 cytotoxic agent Substances 0.000 description 1
- 238000002784 cytotoxicity assay Methods 0.000 description 1
- 231100000263 cytotoxicity test Toxicity 0.000 description 1
- 239000002619 cytotoxin Substances 0.000 description 1
- 230000006240 deamidation Effects 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-M decanoate Chemical compound CCCCCCCCCC([O-])=O GHVNFZFCNZKVNT-UHFFFAOYSA-M 0.000 description 1
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 229960001585 dicloxacillin Drugs 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940004552 dificid Drugs 0.000 description 1
- 210000002249 digestive system Anatomy 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 229940126534 drug product Drugs 0.000 description 1
- 238000007908 dry granulation Methods 0.000 description 1
- 229940099739 duricef Drugs 0.000 description 1
- 235000019564 dysgeusia Nutrition 0.000 description 1
- 102220481234 eIF5-mimic protein 2_R28D_mutation Human genes 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 239000012636 effector Substances 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000012149 elution buffer Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 238000011067 equilibration Methods 0.000 description 1
- 210000000267 erythroid cell Anatomy 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 210000001508 eye Anatomy 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 229940063190 flagyl Drugs 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 238000009541 flexible sigmoidoscopy Methods 0.000 description 1
- 229940115473 florajen3 Drugs 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 229960004273 floxacillin Drugs 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 229940124307 fluoroquinolone Drugs 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 229940089936 fortaz Drugs 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 229960002737 fructose Drugs 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 230000005714 functional activity Effects 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000007897 gelcap Substances 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 230000007946 glucose deprivation Effects 0.000 description 1
- 230000013595 glycosylation Effects 0.000 description 1
- 238000006206 glycosylation reaction Methods 0.000 description 1
- 108010050848 glycylleucine Proteins 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 210000005256 gram-negative cell Anatomy 0.000 description 1
- 210000005255 gram-positive cell Anatomy 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 208000021760 high fever Diseases 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 210000003630 histaminocyte Anatomy 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 230000007366 host health Effects 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229960002591 hydroxyproline Drugs 0.000 description 1
- 210000003016 hypothalamus Anatomy 0.000 description 1
- 229960002182 imipenem Drugs 0.000 description 1
- ZSKVGTPCRGIANV-ZXFLCMHBSA-N imipenem Chemical compound C1C(SCC\N=C\N)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 ZSKVGTPCRGIANV-ZXFLCMHBSA-N 0.000 description 1
- 239000012729 immediate-release (IR) formulation Substances 0.000 description 1
- 238000003018 immunoassay Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000005462 in vivo assay Methods 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 210000004347 intestinal mucosa Anatomy 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 208000002551 irritable bowel syndrome Diseases 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- TWBYWOBDOCUKOW-UHFFFAOYSA-M isonicotinate Chemical compound [O-]C(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-M 0.000 description 1
- BPHPUYQFMNQIOC-NXRLNHOXSA-N isopropyl beta-D-thiogalactopyranoside Chemical compound CC(C)S[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O BPHPUYQFMNQIOC-NXRLNHOXSA-N 0.000 description 1
- 229940090589 keflex Drugs 0.000 description 1
- 230000003907 kidney function Effects 0.000 description 1
- 229940039696 lactobacillus Drugs 0.000 description 1
- 229940072205 lactobacillus plantarum Drugs 0.000 description 1
- 229940059406 lactobacillus rhamnosus gg Drugs 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 108010030617 leucyl-phenylalanyl-valine Proteins 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 229960004194 lidocaine Drugs 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 230000029226 lipidation Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000003908 liver function Effects 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 208000019017 loss of appetite Diseases 0.000 description 1
- 235000021266 loss of appetite Nutrition 0.000 description 1
- 208000020442 loss of weight Diseases 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 108010003700 lysyl aspartic acid Proteins 0.000 description 1
- 102220602238 m7GpppX diphosphatase_P170H_mutation Human genes 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 229940021422 maxipime Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229940087515 mefoxin Drugs 0.000 description 1
- 208000004840 megacolon Diseases 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 102000020235 metallo-beta-lactamase Human genes 0.000 description 1
- 108060004734 metallo-beta-lactamase Proteins 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- IZYBEMGNIUSSAX-UHFFFAOYSA-N methyl benzenecarboperoxoate Chemical compound COOC(=O)C1=CC=CC=C1 IZYBEMGNIUSSAX-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 229960000198 mezlocillin Drugs 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 239000004005 microsphere Substances 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000000302 molecular modelling Methods 0.000 description 1
- 238000013365 molecular weight analysis method Methods 0.000 description 1
- 210000002200 mouth mucosa Anatomy 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 231100000219 mutagenic Toxicity 0.000 description 1
- 230000003505 mutagenic effect Effects 0.000 description 1
- 108010065781 myosin light chain 2 Proteins 0.000 description 1
- 229960000515 nafcillin Drugs 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 210000001331 nose Anatomy 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical compound CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 210000004248 oligodendroglia Anatomy 0.000 description 1
- 229940031908 omnicef Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 229960001019 oxacillin Drugs 0.000 description 1
- 239000006179 pH buffering agent Substances 0.000 description 1
- 229940014662 pantothenate Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 230000006320 pegylation Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 229940056367 penicillin v Drugs 0.000 description 1
- 206010034674 peritonitis Diseases 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229940066843 pfizerpen Drugs 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- DYUMLJSJISTVPV-UHFFFAOYSA-N phenyl propanoate Chemical compound CCC(=O)OC1=CC=CC=C1 DYUMLJSJISTVPV-UHFFFAOYSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 108010024607 phenylalanylalanine Proteins 0.000 description 1
- 229950009215 phenylbutanoic acid Drugs 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 230000026731 phosphorylation Effects 0.000 description 1
- 238000006366 phosphorylation reaction Methods 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 229940104641 piperacillin / tazobactam Drugs 0.000 description 1
- 229940099765 pipracil Drugs 0.000 description 1
- 230000008488 polyadenylation Effects 0.000 description 1
- 238000003752 polymerase chain reaction Methods 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 229940071643 prefilled syringe Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-M propynoate Chemical compound [O-]C(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-M 0.000 description 1
- 239000012460 protein solution Substances 0.000 description 1
- 230000006337 proteolytic cleavage Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000003908 quality control method Methods 0.000 description 1
- 238000003259 recombinant expression Methods 0.000 description 1
- 230000022532 regulation of transcription, DNA-dependent Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000012465 retentate Substances 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 210000003705 ribosome Anatomy 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229940081561 rocephin Drugs 0.000 description 1
- 102220323419 rs1002894711 Human genes 0.000 description 1
- 102220221827 rs1004988362 Human genes 0.000 description 1
- 102220230405 rs1006375117 Human genes 0.000 description 1
- 102220286810 rs1034265990 Human genes 0.000 description 1
- 102220269718 rs1037879170 Human genes 0.000 description 1
- 102220235777 rs1038990717 Human genes 0.000 description 1
- 102220276006 rs1043292415 Human genes 0.000 description 1
- 102200151999 rs1044498 Human genes 0.000 description 1
- 102220297740 rs1048525846 Human genes 0.000 description 1
- 102200025065 rs104893749 Human genes 0.000 description 1
- 102200141489 rs104893788 Human genes 0.000 description 1
- 102200141491 rs104893793 Human genes 0.000 description 1
- 102200141498 rs104893793 Human genes 0.000 description 1
- 102200089573 rs104893826 Human genes 0.000 description 1
- 102220041766 rs104893826 Human genes 0.000 description 1
- 102220003030 rs104893858 Human genes 0.000 description 1
- 102200067878 rs104893967 Human genes 0.000 description 1
- 102200109604 rs104894003 Human genes 0.000 description 1
- 102200015929 rs104894076 Human genes 0.000 description 1
- 102200044416 rs104894256 Human genes 0.000 description 1
- 102200147946 rs104894525 Human genes 0.000 description 1
- 102200004146 rs104894575 Human genes 0.000 description 1
- 102200072128 rs104894671 Human genes 0.000 description 1
- 102200132989 rs104894729 Human genes 0.000 description 1
- 102220054253 rs104894729 Human genes 0.000 description 1
- 102220054381 rs104894729 Human genes 0.000 description 1
- 102200074455 rs104894780 Human genes 0.000 description 1
- 102200153079 rs104894818 Human genes 0.000 description 1
- 102200009646 rs104895219 Human genes 0.000 description 1
- 102220032372 rs104895229 Human genes 0.000 description 1
- 102220032340 rs104895312 Human genes 0.000 description 1
- 102200078012 rs104895325 Human genes 0.000 description 1
- 102220032336 rs104895325 Human genes 0.000 description 1
- 102200071317 rs1055138 Human genes 0.000 description 1
- 102220198437 rs1057520006 Human genes 0.000 description 1
- 102220198799 rs1057520183 Human genes 0.000 description 1
- 102220214938 rs1060500089 Human genes 0.000 description 1
- 102220315951 rs1060500234 Human genes 0.000 description 1
- 102220217549 rs1060500666 Human genes 0.000 description 1
- 102220218718 rs1060500754 Human genes 0.000 description 1
- 102220215346 rs1060501163 Human genes 0.000 description 1
- 102220214161 rs1060501307 Human genes 0.000 description 1
- 102220224536 rs1060501486 Human genes 0.000 description 1
- 102220216328 rs1060501891 Human genes 0.000 description 1
- 102220223279 rs1060502343 Human genes 0.000 description 1
- 102220220268 rs1060502473 Human genes 0.000 description 1
- 102220215709 rs1060502610 Human genes 0.000 description 1
- 102220224869 rs1060502717 Human genes 0.000 description 1
- 102220222005 rs1060502744 Human genes 0.000 description 1
- 102220222043 rs1060502775 Human genes 0.000 description 1
- 102220218282 rs1060503458 Human genes 0.000 description 1
- 102220217972 rs1060503468 Human genes 0.000 description 1
- 102220214822 rs1060503549 Human genes 0.000 description 1
- 102220214800 rs1060503568 Human genes 0.000 description 1
- 102220221476 rs1060503624 Human genes 0.000 description 1
- 102220011342 rs1063385 Human genes 0.000 description 1
- 102220227884 rs1064793082 Human genes 0.000 description 1
- 102220227713 rs1064793211 Human genes 0.000 description 1
- 102220230053 rs1064793357 Human genes 0.000 description 1
- 102220227959 rs1064793625 Human genes 0.000 description 1
- 102220226106 rs1064793655 Human genes 0.000 description 1
- 102220226177 rs1064793870 Human genes 0.000 description 1
- 102220228203 rs1064793928 Human genes 0.000 description 1
- 102220230918 rs1064794245 Human genes 0.000 description 1
- 102220228799 rs1064794568 Human genes 0.000 description 1
- 102220226396 rs1064794951 Human genes 0.000 description 1
- 102220227259 rs1064795189 Human genes 0.000 description 1
- 102220225518 rs1064795294 Human genes 0.000 description 1
- 102220230158 rs1064795594 Human genes 0.000 description 1
- 102200105918 rs1064795841 Human genes 0.000 description 1
- 102220230387 rs1064795842 Human genes 0.000 description 1
- 102220283149 rs1064795842 Human genes 0.000 description 1
- 102220227966 rs1064796148 Human genes 0.000 description 1
- 102220225373 rs1064796625 Human genes 0.000 description 1
- 102200102881 rs1064796681 Human genes 0.000 description 1
- 102220233388 rs1085307624 Human genes 0.000 description 1
- 102220232846 rs1085307645 Human genes 0.000 description 1
- 102220232511 rs1085307970 Human genes 0.000 description 1
- 102220233021 rs1085307971 Human genes 0.000 description 1
- 102220012808 rs111033485 Human genes 0.000 description 1
- 102200074036 rs111033551 Human genes 0.000 description 1
- 102200012475 rs111033674 Human genes 0.000 description 1
- 102200012477 rs111033675 Human genes 0.000 description 1
- 102200012531 rs111033829 Human genes 0.000 description 1
- 102200085101 rs111887056 Human genes 0.000 description 1
- 102220124510 rs112306225 Human genes 0.000 description 1
- 102220089045 rs112344257 Human genes 0.000 description 1
- 102220234639 rs1131690962 Human genes 0.000 description 1
- 102200108475 rs1131691023 Human genes 0.000 description 1
- 102200108477 rs1131691023 Human genes 0.000 description 1
- 102200103756 rs1131691025 Human genes 0.000 description 1
- 102220234991 rs1131691251 Human genes 0.000 description 1
- 102220235660 rs1131691993 Human genes 0.000 description 1
- 102220283165 rs1131692078 Human genes 0.000 description 1
- 102220030906 rs113488591 Human genes 0.000 description 1
- 102220301594 rs114443105 Human genes 0.000 description 1
- 102220311282 rs114786489 Human genes 0.000 description 1
- 102220163334 rs115335100 Human genes 0.000 description 1
- 102200090276 rs11548633 Human genes 0.000 description 1
- 102200006183 rs11552822 Human genes 0.000 description 1
- 102200011729 rs115775983 Human genes 0.000 description 1
- 102220273497 rs1162974793 Human genes 0.000 description 1
- 102220042680 rs116440799 Human genes 0.000 description 1
- 102220324094 rs1166189035 Human genes 0.000 description 1
- 102220008231 rs116840773 Human genes 0.000 description 1
- 102220008240 rs116840789 Human genes 0.000 description 1
- 102220082450 rs117510230 Human genes 0.000 description 1
- 102200012978 rs11757455 Human genes 0.000 description 1
- 102200062433 rs118203345 Human genes 0.000 description 1
- 102200062437 rs118203354 Human genes 0.000 description 1
- 102200059492 rs118203951 Human genes 0.000 description 1
- 102200125453 rs118203971 Human genes 0.000 description 1
- 102200004059 rs120074179 Human genes 0.000 description 1
- 102200004060 rs120074179 Human genes 0.000 description 1
- 102220327223 rs1211622922 Human genes 0.000 description 1
- 102200121302 rs12142270 Human genes 0.000 description 1
- 102200147377 rs121434280 Human genes 0.000 description 1
- 102200001998 rs121908108 Human genes 0.000 description 1
- 102200079954 rs121908978 Human genes 0.000 description 1
- 102200008028 rs121912294 Human genes 0.000 description 1
- 102200008027 rs121912306 Human genes 0.000 description 1
- 102200131573 rs121912436 Human genes 0.000 description 1
- 102200131624 rs121912440 Human genes 0.000 description 1
- 102200034883 rs121912643 Human genes 0.000 description 1
- 102200108481 rs121912654 Human genes 0.000 description 1
- 102200107954 rs121912658 Human genes 0.000 description 1
- 102200107958 rs121912658 Human genes 0.000 description 1
- 102200105827 rs121912665 Human genes 0.000 description 1
- 102200094891 rs121913566 Human genes 0.000 description 1
- 102200081516 rs121913589 Human genes 0.000 description 1
- 102200081522 rs121913589 Human genes 0.000 description 1
- 102200081521 rs121913590 Human genes 0.000 description 1
- 102200081460 rs121913596 Human genes 0.000 description 1
- 102220253683 rs121913596 Human genes 0.000 description 1
- 102200081304 rs121913599 Human genes 0.000 description 1
- 102200081498 rs121913604 Human genes 0.000 description 1
- 102200067182 rs121913657 Human genes 0.000 description 1
- 102200072280 rs121917953 Human genes 0.000 description 1
- 102200056786 rs121918375 Human genes 0.000 description 1
- 102200056787 rs121918375 Human genes 0.000 description 1
- 102200012952 rs121918641 Human genes 0.000 description 1
- 102200012954 rs121918642 Human genes 0.000 description 1
- 102220316537 rs1220477298 Human genes 0.000 description 1
- 102220277584 rs1220529268 Human genes 0.000 description 1
- 102220267191 rs1245083102 Human genes 0.000 description 1
- 102220279001 rs1271849120 Human genes 0.000 description 1
- 102220281630 rs1291378382 Human genes 0.000 description 1
- 102220289851 rs1322095182 Human genes 0.000 description 1
- 102200024624 rs132630284 Human genes 0.000 description 1
- 102200132802 rs132630304 Human genes 0.000 description 1
- 102200097346 rs132630309 Human genes 0.000 description 1
- 102220338085 rs1340928778 Human genes 0.000 description 1
- 102220252701 rs1343618467 Human genes 0.000 description 1
- 102200063912 rs137852243 Human genes 0.000 description 1
- 102200063913 rs137852243 Human genes 0.000 description 1
- 102200003905 rs137852397 Human genes 0.000 description 1
- 102200095679 rs137853003 Human genes 0.000 description 1
- 102200126635 rs137853313 Human genes 0.000 description 1
- 102200126561 rs137853314 Human genes 0.000 description 1
- 102220010440 rs137886900 Human genes 0.000 description 1
- 102220329384 rs138189707 Human genes 0.000 description 1
- 102220020811 rs138338446 Human genes 0.000 description 1
- 102220165692 rs138592626 Human genes 0.000 description 1
- 102220139406 rs138662263 Human genes 0.000 description 1
- 102220257007 rs1387584638 Human genes 0.000 description 1
- 102220126492 rs139093654 Human genes 0.000 description 1
- 102200019549 rs140075817 Human genes 0.000 description 1
- 102220098368 rs140821420 Human genes 0.000 description 1
- 102220057412 rs141021599 Human genes 0.000 description 1
- 102220118962 rs141035459 Human genes 0.000 description 1
- 102220082469 rs141066870 Human genes 0.000 description 1
- 102220073966 rs141331864 Human genes 0.000 description 1
- 102220283178 rs1417452362 Human genes 0.000 description 1
- 102220212860 rs141754300 Human genes 0.000 description 1
- 102220287501 rs1417779335 Human genes 0.000 description 1
- 102220313552 rs141793230 Human genes 0.000 description 1
- 102220103687 rs141976385 Human genes 0.000 description 1
- 102220307898 rs142045411 Human genes 0.000 description 1
- 102220037461 rs142136104 Human genes 0.000 description 1
- 102220250970 rs142153571 Human genes 0.000 description 1
- 102220036885 rs142189122 Human genes 0.000 description 1
- 102220264656 rs1422655933 Human genes 0.000 description 1
- 102220266732 rs142653301 Human genes 0.000 description 1
- 102220083213 rs143417961 Human genes 0.000 description 1
- 102220237586 rs1434289035 Human genes 0.000 description 1
- 102200128606 rs143456784 Human genes 0.000 description 1
- 102220211862 rs144030074 Human genes 0.000 description 1
- 102220224385 rs144221071 Human genes 0.000 description 1
- 102220075238 rs144565191 Human genes 0.000 description 1
- 102220104842 rs144980336 Human genes 0.000 description 1
- 102220395357 rs145088715 Human genes 0.000 description 1
- 102220161915 rs145252200 Human genes 0.000 description 1
- 102220265043 rs1457631500 Human genes 0.000 description 1
- 102220253802 rs146090744 Human genes 0.000 description 1
- 102220308083 rs1462326368 Human genes 0.000 description 1
- 102200106726 rs146340390 Human genes 0.000 description 1
- 102220322897 rs146361949 Human genes 0.000 description 1
- 102220221082 rs146387899 Human genes 0.000 description 1
- 102220270377 rs146735953 Human genes 0.000 description 1
- 102220271672 rs1468589409 Human genes 0.000 description 1
- 102200102213 rs147138516 Human genes 0.000 description 1
- 102220078461 rs148304857 Human genes 0.000 description 1
- 102220282326 rs1483962771 Human genes 0.000 description 1
- 102220057261 rs148538950 Human genes 0.000 description 1
- 102220165744 rs148656104 Human genes 0.000 description 1
- 102220293609 rs149245876 Human genes 0.000 description 1
- 102220050226 rs149253719 Human genes 0.000 description 1
- 102220280887 rs150113270 Human genes 0.000 description 1
- 102220040905 rs150548839 Human genes 0.000 description 1
- 102220020371 rs151020603 Human genes 0.000 description 1
- 102220319392 rs151276683 Human genes 0.000 description 1
- 102220239237 rs1553156155 Human genes 0.000 description 1
- 102220313401 rs1553255479 Human genes 0.000 description 1
- 102220332829 rs1553258115 Human genes 0.000 description 1
- 102220253605 rs1553259649 Human genes 0.000 description 1
- 102220247071 rs1553259811 Human genes 0.000 description 1
- 102220292874 rs1553264656 Human genes 0.000 description 1
- 102220313393 rs1553282527 Human genes 0.000 description 1
- 102220244606 rs1553323036 Human genes 0.000 description 1
- 102220249739 rs1553338193 Human genes 0.000 description 1
- 102220257006 rs1553350075 Human genes 0.000 description 1
- 102220316056 rs1553351592 Human genes 0.000 description 1
- 102220257014 rs1553351613 Human genes 0.000 description 1
- 102220257167 rs1553408119 Human genes 0.000 description 1
- 102220277218 rs1553410216 Human genes 0.000 description 1
- 102220285274 rs1553411480 Human genes 0.000 description 1
- 102220277090 rs1553411488 Human genes 0.000 description 1
- 102220284422 rs1553431702 Human genes 0.000 description 1
- 102220239320 rs1553452537 Human genes 0.000 description 1
- 102220256454 rs1553506950 Human genes 0.000 description 1
- 102220308025 rs1553603146 Human genes 0.000 description 1
- 102220317569 rs1553613127 Human genes 0.000 description 1
- 102220289192 rs1553619963 Human genes 0.000 description 1
- 102220316484 rs1553619979 Human genes 0.000 description 1
- 102220276847 rs1553628364 Human genes 0.000 description 1
- 102220316977 rs1553638767 Human genes 0.000 description 1
- 102220277461 rs1553644132 Human genes 0.000 description 1
- 102220258954 rs1553645702 Human genes 0.000 description 1
- 102220315613 rs1553674341 Human genes 0.000 description 1
- 102220008529 rs1553731681 Human genes 0.000 description 1
- 102220317648 rs1553902415 Human genes 0.000 description 1
- 102220286546 rs1554067157 Human genes 0.000 description 1
- 102220286589 rs1554074763 Human genes 0.000 description 1
- 102220245899 rs1554247605 Human genes 0.000 description 1
- 102220297506 rs1554258798 Human genes 0.000 description 1
- 102220278760 rs1554304012 Human genes 0.000 description 1
- 102220278720 rs1554305000 Human genes 0.000 description 1
- 102220319450 rs1554378297 Human genes 0.000 description 1
- 102220243753 rs1554379882 Human genes 0.000 description 1
- 102220263496 rs1554566720 Human genes 0.000 description 1
- 102220279010 rs1554568357 Human genes 0.000 description 1
- 102220264732 rs1554654113 Human genes 0.000 description 1
- 102220294914 rs1554661565 Human genes 0.000 description 1
- 102220263547 rs1554731003 Human genes 0.000 description 1
- 102220279258 rs1554817812 Human genes 0.000 description 1
- 102220265576 rs1554825264 Human genes 0.000 description 1
- 102200088871 rs1554884979 Human genes 0.000 description 1
- 102220322695 rs1554890769 Human genes 0.000 description 1
- 102220286945 rs1555059544 Human genes 0.000 description 1
- 102220266437 rs1555066315 Human genes 0.000 description 1
- 102220324017 rs1555165872 Human genes 0.000 description 1
- 102220268225 rs1555201301 Human genes 0.000 description 1
- 102220280446 rs1555280374 Human genes 0.000 description 1
- 102220324621 rs1555280870 Human genes 0.000 description 1
- 102220308938 rs1555361380 Human genes 0.000 description 1
- 102220325516 rs1555375788 Human genes 0.000 description 1
- 102220325488 rs1555383695 Human genes 0.000 description 1
- 102220293716 rs1555417323 Human genes 0.000 description 1
- 102220282083 rs1555461798 Human genes 0.000 description 1
- 102220270435 rs1555462056 Human genes 0.000 description 1
- 102220326945 rs1555497690 Human genes 0.000 description 1
- 102220270676 rs1555497725 Human genes 0.000 description 1
- 102200105879 rs1555525921 Human genes 0.000 description 1
- 102220282507 rs1555558583 Human genes 0.000 description 1
- 102220343082 rs1555569038 Human genes 0.000 description 1
- 102220252209 rs1555574641 Human genes 0.000 description 1
- 102220287602 rs1555593593 Human genes 0.000 description 1
- 102220328483 rs1555593600 Human genes 0.000 description 1
- 102220282721 rs1555593602 Human genes 0.000 description 1
- 102200062089 rs1555593767 Human genes 0.000 description 1
- 102220271671 rs1555596419 Human genes 0.000 description 1
- 102220272277 rs1555599608 Human genes 0.000 description 1
- 102220245308 rs1555601006 Human genes 0.000 description 1
- 102220246768 rs1555603936 Human genes 0.000 description 1
- 102220327699 rs1555607101 Human genes 0.000 description 1
- 102220283530 rs1555609260 Human genes 0.000 description 1
- 102220271883 rs1555611550 Human genes 0.000 description 1
- 102220273265 rs1555615732 Human genes 0.000 description 1
- 102220329491 rs1555684976 Human genes 0.000 description 1
- 102220283875 rs1555735046 Human genes 0.000 description 1
- 102220283400 rs1555737824 Human genes 0.000 description 1
- 102220329434 rs1555777015 Human genes 0.000 description 1
- 102220274414 rs1555789213 Human genes 0.000 description 1
- 102220274355 rs1555814427 Human genes 0.000 description 1
- 102220335304 rs1555833051 Human genes 0.000 description 1
- 102220275570 rs1555864037 Human genes 0.000 description 1
- 102220116954 rs1555865401 Human genes 0.000 description 1
- 102220238271 rs1555933860 Human genes 0.000 description 1
- 102200153174 rs1555937161 Human genes 0.000 description 1
- 102200152967 rs1555937233 Human genes 0.000 description 1
- 102220290605 rs1555954685 Human genes 0.000 description 1
- 102220312275 rs1556009247 Human genes 0.000 description 1
- 102220243050 rs1556020752 Human genes 0.000 description 1
- 102220275989 rs1556435940 Human genes 0.000 description 1
- 102220333092 rs1556523682 Human genes 0.000 description 1
- 102200052384 rs16844422 Human genes 0.000 description 1
- 102200131666 rs16853238 Human genes 0.000 description 1
- 102200043387 rs17876030 Human genes 0.000 description 1
- 102200032169 rs1800973 Human genes 0.000 description 1
- 102200071354 rs1801272 Human genes 0.000 description 1
- 102220271065 rs180177086 Human genes 0.000 description 1
- 102220282069 rs180177086 Human genes 0.000 description 1
- 102220074294 rs180177217 Human genes 0.000 description 1
- 102200039208 rs180177258 Human genes 0.000 description 1
- 102220074330 rs180177260 Human genes 0.000 description 1
- 102220324113 rs182282150 Human genes 0.000 description 1
- 102200000135 rs186264635 Human genes 0.000 description 1
- 102220035901 rs187864727 Human genes 0.000 description 1
- 102220037740 rs187930476 Human genes 0.000 description 1
- 102220066135 rs192628905 Human genes 0.000 description 1
- 102200079952 rs193302877 Human genes 0.000 description 1
- 102200079945 rs193302882 Human genes 0.000 description 1
- 102200079946 rs193302889 Human genes 0.000 description 1
- 102200079940 rs193302894 Human genes 0.000 description 1
- 102200080086 rs193302902 Human genes 0.000 description 1
- 102220008872 rs193921400 Human genes 0.000 description 1
- 102220008873 rs193921400 Human genes 0.000 description 1
- 102220008516 rs193922432 Human genes 0.000 description 1
- 102220009294 rs193922491 Human genes 0.000 description 1
- 102200004212 rs199472697 Human genes 0.000 description 1
- 102220071776 rs199472697 Human genes 0.000 description 1
- 102220024756 rs199472705 Human genes 0.000 description 1
- 102220024935 rs199473369 Human genes 0.000 description 1
- 102220024893 rs199473498 Human genes 0.000 description 1
- 102220024959 rs199473657 Human genes 0.000 description 1
- 102200004176 rs199473671 Human genes 0.000 description 1
- 102220167669 rs199515173 Human genes 0.000 description 1
- 102220123679 rs199536893 Human genes 0.000 description 1
- 102220042718 rs199651600 Human genes 0.000 description 1
- 102220198682 rs199699339 Human genes 0.000 description 1
- 102200017278 rs199768005 Human genes 0.000 description 1
- 102220044946 rs199845467 Human genes 0.000 description 1
- 102220061207 rs200048921 Human genes 0.000 description 1
- 102220087240 rs200048921 Human genes 0.000 description 1
- 102220271089 rs200048921 Human genes 0.000 description 1
- 102200148728 rs200185747 Human genes 0.000 description 1
- 102200029475 rs200313585 Human genes 0.000 description 1
- 102220056354 rs200336608 Human genes 0.000 description 1
- 102220054556 rs200529550 Human genes 0.000 description 1
- 102200104301 rs200579969 Human genes 0.000 description 1
- 102220197616 rs200703101 Human genes 0.000 description 1
- 102220270309 rs200756519 Human genes 0.000 description 1
- 102220074061 rs200820631 Human genes 0.000 description 1
- 102220044467 rs201141645 Human genes 0.000 description 1
- 102200060691 rs201258663 Human genes 0.000 description 1
- 102200114508 rs201382018 Human genes 0.000 description 1
- 102200114509 rs201382018 Human genes 0.000 description 1
- 102220456152 rs201393279 Human genes 0.000 description 1
- 102200098614 rs201431517 Human genes 0.000 description 1
- 102220058701 rs201486221 Human genes 0.000 description 1
- 102220074523 rs201622476 Human genes 0.000 description 1
- 102220233036 rs201692151 Human genes 0.000 description 1
- 102220313038 rs201782441 Human genes 0.000 description 1
- 102220065400 rs201820268 Human genes 0.000 description 1
- 102220259476 rs201826605 Human genes 0.000 description 1
- 102220316409 rs201834175 Human genes 0.000 description 1
- 102220176291 rs201872851 Human genes 0.000 description 1
- 102220075487 rs201956727 Human genes 0.000 description 1
- 102220111772 rs202004658 Human genes 0.000 description 1
- 102220040624 rs202083738 Human genes 0.000 description 1
- 102200057448 rs202194596 Human genes 0.000 description 1
- 102220285721 rs202194596 Human genes 0.000 description 1
- 102220010259 rs202247806 Human genes 0.000 description 1
- 102200148712 rs202247819 Human genes 0.000 description 1
- 102200058890 rs2227624 Human genes 0.000 description 1
- 102200016535 rs2335052 Human genes 0.000 description 1
- 102220011364 rs267606561 Human genes 0.000 description 1
- 102200017291 rs267606664 Human genes 0.000 description 1
- 102200115309 rs267607160 Human genes 0.000 description 1
- 102200027627 rs267607259 Human genes 0.000 description 1
- 102200071435 rs267607269 Human genes 0.000 description 1
- 102200131367 rs267607560 Human genes 0.000 description 1
- 102220024646 rs267607611 Human genes 0.000 description 1
- 102200131507 rs267607649 Human genes 0.000 description 1
- 102220027788 rs267607927 Human genes 0.000 description 1
- 102220026503 rs267608038 Human genes 0.000 description 1
- 102220022000 rs273901743 Human genes 0.000 description 1
- 102220019759 rs276174893 Human genes 0.000 description 1
- 102200068666 rs281865237 Human genes 0.000 description 1
- 102200076845 rs281865496 Human genes 0.000 description 1
- 102200068107 rs281875292 Human genes 0.000 description 1
- 102200067064 rs28897675 Human genes 0.000 description 1
- 102200028426 rs28934906 Human genes 0.000 description 1
- 102200148949 rs28936686 Human genes 0.000 description 1
- 102220056660 rs28936686 Human genes 0.000 description 1
- 102200077865 rs28936687 Human genes 0.000 description 1
- 102200087500 rs28937575 Human genes 0.000 description 1
- 102200087826 rs3212723 Human genes 0.000 description 1
- 102220005387 rs33910377 Human genes 0.000 description 1
- 102200117902 rs33910475 Human genes 0.000 description 1
- 102200117906 rs33910475 Human genes 0.000 description 1
- 102200118188 rs33913712 Human genes 0.000 description 1
- 102200118190 rs33917785 Human genes 0.000 description 1
- 102200118191 rs33917785 Human genes 0.000 description 1
- 102200071414 rs33933481 Human genes 0.000 description 1
- 102220005349 rs33933481 Human genes 0.000 description 1
- 102200118192 rs33940204 Human genes 0.000 description 1
- 102220005187 rs33941844 Human genes 0.000 description 1
- 102220005194 rs33941844 Human genes 0.000 description 1
- 102220005249 rs33941844 Human genes 0.000 description 1
- 102200082933 rs33968721 Human genes 0.000 description 1
- 102200082938 rs33968721 Human genes 0.000 description 1
- 102200118172 rs33993568 Human genes 0.000 description 1
- 102200135483 rs34047482 Human genes 0.000 description 1
- 102200117905 rs34240441 Human genes 0.000 description 1
- 102200083530 rs34382405 Human genes 0.000 description 1
- 102220005287 rs34407387 Human genes 0.000 description 1
- 102220005526 rs34410516 Human genes 0.000 description 1
- 102200092878 rs34420481 Human genes 0.000 description 1
- 102220005522 rs34472107 Human genes 0.000 description 1
- 102200118229 rs34665886 Human genes 0.000 description 1
- 102200067482 rs34817956 Human genes 0.000 description 1
- 102200092884 rs34933313 Human genes 0.000 description 1
- 102200118189 rs35002698 Human genes 0.000 description 1
- 102220005182 rs35068498 Human genes 0.000 description 1
- 102220005451 rs35317336 Human genes 0.000 description 1
- 102200118175 rs35553496 Human genes 0.000 description 1
- 102220091419 rs35765893 Human genes 0.000 description 1
- 102200155456 rs35947557 Human genes 0.000 description 1
- 102220005293 rs35960772 Human genes 0.000 description 1
- 102220005481 rs36024711 Human genes 0.000 description 1
- 102200118233 rs36081208 Human genes 0.000 description 1
- 102200096400 rs367567630 Human genes 0.000 description 1
- 102220221195 rs367797765 Human genes 0.000 description 1
- 102220237891 rs367797765 Human genes 0.000 description 1
- 102220323432 rs368945911 Human genes 0.000 description 1
- 102220057359 rs369120013 Human genes 0.000 description 1
- 102220118939 rs369186379 Human genes 0.000 description 1
- 102220222493 rs370082083 Human genes 0.000 description 1
- 102220324108 rs370268888 Human genes 0.000 description 1
- 102220235295 rs370411488 Human genes 0.000 description 1
- 102220056150 rs371142225 Human genes 0.000 description 1
- 102200075616 rs371848318 Human genes 0.000 description 1
- 102220114727 rs372166877 Human genes 0.000 description 1
- 102220013610 rs372825868 Human genes 0.000 description 1
- 102220401156 rs372844636 Human genes 0.000 description 1
- 102220058531 rs373000587 Human genes 0.000 description 1
- 102220244279 rs373241693 Human genes 0.000 description 1
- 102220097952 rs373648967 Human genes 0.000 description 1
- 102200019315 rs3737084 Human genes 0.000 description 1
- 102220093396 rs375336614 Human genes 0.000 description 1
- 102220238039 rs375646186 Human genes 0.000 description 1
- 102200078653 rs376371866 Human genes 0.000 description 1
- 102220277413 rs377430566 Human genes 0.000 description 1
- 102220273860 rs377605009 Human genes 0.000 description 1
- 102220225307 rs377718922 Human genes 0.000 description 1
- 102220078387 rs377724143 Human genes 0.000 description 1
- 102200027051 rs3824874 Human genes 0.000 description 1
- 102220011910 rs386134124 Human genes 0.000 description 1
- 102220028414 rs386352335 Human genes 0.000 description 1
- 102220054119 rs386789728 Human genes 0.000 description 1
- 102200049497 rs386833427 Human genes 0.000 description 1
- 102200010981 rs386833663 Human genes 0.000 description 1
- 102200022447 rs386833730 Human genes 0.000 description 1
- 102220227596 rs386834128 Human genes 0.000 description 1
- 102200017870 rs387906615 Human genes 0.000 description 1
- 102200126044 rs387907039 Human genes 0.000 description 1
- 102220023086 rs387907440 Human genes 0.000 description 1
- 102220009473 rs397507189 Human genes 0.000 description 1
- 102200067525 rs397507873 Human genes 0.000 description 1
- 102220019639 rs397507881 Human genes 0.000 description 1
- 102220089991 rs397507881 Human genes 0.000 description 1
- 102220020679 rs397508609 Human genes 0.000 description 1
- 102220020769 rs397508723 Human genes 0.000 description 1
- 102220020778 rs397508736 Human genes 0.000 description 1
- 102220021057 rs397508897 Human genes 0.000 description 1
- 102220021058 rs397508898 Human genes 0.000 description 1
- 102220021458 rs397509053 Human genes 0.000 description 1
- 102220021592 rs397509071 Human genes 0.000 description 1
- 102220022222 rs397509306 Human genes 0.000 description 1
- 102220000379 rs397514441 Human genes 0.000 description 1
- 102200150161 rs397514728 Human genes 0.000 description 1
- 102200105357 rs397516436 Human genes 0.000 description 1
- 102220013071 rs397516447 Human genes 0.000 description 1
- 102220013090 rs397516461 Human genes 0.000 description 1
- 102220013967 rs397516849 Human genes 0.000 description 1
- 102220014681 rs397517221 Human genes 0.000 description 1
- 102220016949 rs397517895 Human genes 0.000 description 1
- 102220016983 rs397517907 Human genes 0.000 description 1
- 102220288940 rs398122368 Human genes 0.000 description 1
- 102220029632 rs398123606 Human genes 0.000 description 1
- 102200030302 rs398124656 Human genes 0.000 description 1
- 102220392937 rs41273533 Human genes 0.000 description 1
- 102220019324 rs41293469 Human genes 0.000 description 1
- 102200134447 rs41295338 Human genes 0.000 description 1
- 102220159804 rs41307461 Human genes 0.000 description 1
- 102200062393 rs45517109 Human genes 0.000 description 1
- 102220036288 rs45525839 Human genes 0.000 description 1
- 102200105055 rs4790235 Human genes 0.000 description 1
- 102220039653 rs483353047 Human genes 0.000 description 1
- 102200112962 rs4904210 Human genes 0.000 description 1
- 102200089632 rs5030807 Human genes 0.000 description 1
- 102200089633 rs5030807 Human genes 0.000 description 1
- 102200091511 rs5030830 Human genes 0.000 description 1
- 102200091512 rs5030830 Human genes 0.000 description 1
- 102220036003 rs515726092 Human genes 0.000 description 1
- 102220269956 rs530722554 Human genes 0.000 description 1
- 102220168071 rs532180601 Human genes 0.000 description 1
- 102220074042 rs533405046 Human genes 0.000 description 1
- 102220103882 rs534158221 Human genes 0.000 description 1
- 102220059243 rs534184145 Human genes 0.000 description 1
- 102220204947 rs534473091 Human genes 0.000 description 1
- 102220159710 rs535143891 Human genes 0.000 description 1
- 102220057651 rs539285592 Human genes 0.000 description 1
- 102220075323 rs540745201 Human genes 0.000 description 1
- 102220223172 rs542193901 Human genes 0.000 description 1
- 102220174076 rs548909101 Human genes 0.000 description 1
- 102220324097 rs555774342 Human genes 0.000 description 1
- 102220040697 rs55755457 Human genes 0.000 description 1
- 102220142620 rs558211174 Human genes 0.000 description 1
- 102220019757 rs55854959 Human genes 0.000 description 1
- 102220288781 rs571490973 Human genes 0.000 description 1
- 102220288357 rs572035776 Human genes 0.000 description 1
- 102220024449 rs57286292 Human genes 0.000 description 1
- 102220258802 rs574777861 Human genes 0.000 description 1
- 102200053926 rs58163069 Human genes 0.000 description 1
- 102220075174 rs58528748 Human genes 0.000 description 1
- 102220024364 rs58706476 Human genes 0.000 description 1
- 102200077463 rs587777147 Human genes 0.000 description 1
- 102200075810 rs587777232 Human genes 0.000 description 1
- 102220039980 rs587778115 Human genes 0.000 description 1
- 102220222915 rs587778115 Human genes 0.000 description 1
- 102220040727 rs587778447 Human genes 0.000 description 1
- 102220041145 rs587778638 Human genes 0.000 description 1
- 102200105308 rs587778720 Human genes 0.000 description 1
- 102200105309 rs587778720 Human genes 0.000 description 1
- 102200105349 rs587778720 Human genes 0.000 description 1
- 102220026037 rs587778876 Human genes 0.000 description 1
- 102220027000 rs587779003 Human genes 0.000 description 1
- 102220027715 rs587779154 Human genes 0.000 description 1
- 102220034581 rs587779601 Human genes 0.000 description 1
- 102220036482 rs587779842 Human genes 0.000 description 1
- 102220036700 rs587779970 Human genes 0.000 description 1
- 102220036814 rs587780060 Human genes 0.000 description 1
- 102220037012 rs587780164 Human genes 0.000 description 1
- 102220037053 rs587780187 Human genes 0.000 description 1
- 102220041685 rs587780689 Human genes 0.000 description 1
- 102220041841 rs587780779 Human genes 0.000 description 1
- 102220041920 rs587780816 Human genes 0.000 description 1
- 102200086453 rs587780911 Human genes 0.000 description 1
- 102220044720 rs587781513 Human genes 0.000 description 1
- 102220198353 rs587781525 Human genes 0.000 description 1
- 102220044776 rs587781563 Human genes 0.000 description 1
- 102220044907 rs587781670 Human genes 0.000 description 1
- 102200109057 rs587782160 Human genes 0.000 description 1
- 102220045520 rs587782176 Human genes 0.000 description 1
- 102220059790 rs587782176 Human genes 0.000 description 1
- 102220045819 rs587782411 Human genes 0.000 description 1
- 102200108188 rs587782423 Human genes 0.000 description 1
- 102220045989 rs587782546 Human genes 0.000 description 1
- 102220046274 rs587782792 Human genes 0.000 description 1
- 102220046285 rs587782804 Human genes 0.000 description 1
- 102220330649 rs587782813 Human genes 0.000 description 1
- 102220047659 rs587783138 Human genes 0.000 description 1
- 102220048830 rs587783741 Human genes 0.000 description 1
- 102200132794 rs587783796 Human genes 0.000 description 1
- 102200132778 rs587783848 Human genes 0.000 description 1
- 102200132775 rs587783850 Human genes 0.000 description 1
- 102200131520 rs58917027 Human genes 0.000 description 1
- 102220087848 rs58917027 Human genes 0.000 description 1
- 102200081810 rs5952410 Human genes 0.000 description 1
- 102200131344 rs59914820 Human genes 0.000 description 1
- 102220089529 rs59914820 Human genes 0.000 description 1
- 102200076409 rs60551555 Human genes 0.000 description 1
- 102200004679 rs61540016 Human genes 0.000 description 1
- 102200028427 rs61748411 Human genes 0.000 description 1
- 102220078415 rs61750441 Human genes 0.000 description 1
- 102200100804 rs61751277 Human genes 0.000 description 1
- 102200100737 rs61752883 Human genes 0.000 description 1
- 102200047049 rs61753163 Human genes 0.000 description 1
- 102220033243 rs61753173 Human genes 0.000 description 1
- 102200163542 rs63749994 Human genes 0.000 description 1
- 102200061607 rs63750082 Human genes 0.000 description 1
- 102220032618 rs63750082 Human genes 0.000 description 1
- 102220215401 rs63750085 Human genes 0.000 description 1
- 102220026637 rs63750098 Human genes 0.000 description 1
- 102200027519 rs63750255 Human genes 0.000 description 1
- 102220005506 rs63750467 Human genes 0.000 description 1
- 102200163547 rs63750706 Human genes 0.000 description 1
- 102220027108 rs63750706 Human genes 0.000 description 1
- 102220104430 rs63750821 Human genes 0.000 description 1
- 102220257305 rs63750913 Human genes 0.000 description 1
- 102220276879 rs63750913 Human genes 0.000 description 1
- 102220005476 rs63750950 Human genes 0.000 description 1
- 102220027732 rs63751040 Human genes 0.000 description 1
- 102200164344 rs63751661 Human genes 0.000 description 1
- 102220316828 rs63751661 Human genes 0.000 description 1
- 102200148399 rs672601366 Human genes 0.000 description 1
- 102220032082 rs67890094 Human genes 0.000 description 1
- 102200101903 rs72556259 Human genes 0.000 description 1
- 102220032073 rs72556261 Human genes 0.000 description 1
- 102220032083 rs72556268 Human genes 0.000 description 1
- 102200101662 rs72558416 Human genes 0.000 description 1
- 102220032115 rs72558424 Human genes 0.000 description 1
- 102220051104 rs727503347 Human genes 0.000 description 1
- 102220054254 rs727503499 Human genes 0.000 description 1
- 102220055109 rs727503935 Human genes 0.000 description 1
- 102220051010 rs727504245 Human genes 0.000 description 1
- 102220054396 rs727504591 Human genes 0.000 description 1
- 102220256604 rs73003124 Human genes 0.000 description 1
- 102220056393 rs730880039 Human genes 0.000 description 1
- 102220056210 rs730880065 Human genes 0.000 description 1
- 102220056149 rs730880232 Human genes 0.000 description 1
- 102220057201 rs730880397 Human genes 0.000 description 1
- 102220057214 rs730880408 Human genes 0.000 description 1
- 102220326202 rs730880408 Human genes 0.000 description 1
- 102220056935 rs730880464 Human genes 0.000 description 1
- 102220056648 rs730881059 Human genes 0.000 description 1
- 102220056644 rs730881062 Human genes 0.000 description 1
- 102220057295 rs730881073 Human genes 0.000 description 1
- 102200115281 rs730881163 Human genes 0.000 description 1
- 102220058400 rs730881695 Human genes 0.000 description 1
- 102220057450 rs730881811 Human genes 0.000 description 1
- 102220057451 rs730881811 Human genes 0.000 description 1
- 102220286181 rs730881811 Human genes 0.000 description 1
- 102220057679 rs730881861 Human genes 0.000 description 1
- 102200091177 rs730882035 Human genes 0.000 description 1
- 102220058441 rs730882127 Human genes 0.000 description 1
- 102220243370 rs730882127 Human genes 0.000 description 1
- 102220058522 rs730882254 Human genes 0.000 description 1
- 102220102435 rs745802492 Human genes 0.000 description 1
- 102220082390 rs745913809 Human genes 0.000 description 1
- 102220069537 rs746136472 Human genes 0.000 description 1
- 102220058914 rs746259256 Human genes 0.000 description 1
- 102220263662 rs746487281 Human genes 0.000 description 1
- 102220076681 rs746557446 Human genes 0.000 description 1
- 102220158453 rs747515126 Human genes 0.000 description 1
- 102220252563 rs747522089 Human genes 0.000 description 1
- 102220279085 rs747536732 Human genes 0.000 description 1
- 102220125362 rs747642602 Human genes 0.000 description 1
- 102220253513 rs748402400 Human genes 0.000 description 1
- 102220267366 rs748554882 Human genes 0.000 description 1
- 102220062433 rs748636216 Human genes 0.000 description 1
- 102220224466 rs748636216 Human genes 0.000 description 1
- 102220237415 rs748654930 Human genes 0.000 description 1
- 102220250587 rs748964205 Human genes 0.000 description 1
- 102220093316 rs749037674 Human genes 0.000 description 1
- 102220094427 rs749037674 Human genes 0.000 description 1
- 102220226502 rs749671520 Human genes 0.000 description 1
- 102220242548 rs750080180 Human genes 0.000 description 1
- 102220076321 rs750266156 Human genes 0.000 description 1
- 102220332697 rs750356640 Human genes 0.000 description 1
- 102220267142 rs750386693 Human genes 0.000 description 1
- 102220216166 rs750821213 Human genes 0.000 description 1
- 102220270280 rs750928338 Human genes 0.000 description 1
- 102220064637 rs750955319 Human genes 0.000 description 1
- 102220149644 rs752540751 Human genes 0.000 description 1
- 102220272204 rs753085009 Human genes 0.000 description 1
- 102220324299 rs753101641 Human genes 0.000 description 1
- 102220323131 rs753389706 Human genes 0.000 description 1
- 102220188063 rs753646145 Human genes 0.000 description 1
- 102220095360 rs754033733 Human genes 0.000 description 1
- 102200121588 rs754036398 Human genes 0.000 description 1
- 102220266379 rs754283907 Human genes 0.000 description 1
- 102220214707 rs754478179 Human genes 0.000 description 1
- 102220317291 rs754699919 Human genes 0.000 description 1
- 102220196873 rs755382547 Human genes 0.000 description 1
- 102220288955 rs756980496 Human genes 0.000 description 1
- 102220277494 rs758040210 Human genes 0.000 description 1
- 102220096880 rs758624540 Human genes 0.000 description 1
- 102220287908 rs758642067 Human genes 0.000 description 1
- 102220310730 rs758826475 Human genes 0.000 description 1
- 102220316349 rs759171890 Human genes 0.000 description 1
- 102220274442 rs759594383 Human genes 0.000 description 1
- 102220212669 rs759829161 Human genes 0.000 description 1
- 102220072199 rs760185784 Human genes 0.000 description 1
- 102220067289 rs761359362 Human genes 0.000 description 1
- 102220216205 rs761954026 Human genes 0.000 description 1
- 102220316268 rs762400168 Human genes 0.000 description 1
- 102220102929 rs762648754 Human genes 0.000 description 1
- 102220080892 rs762874073 Human genes 0.000 description 1
- 102220098936 rs763547482 Human genes 0.000 description 1
- 102220198342 rs764146326 Human genes 0.000 description 1
- 102220198349 rs764146326 Human genes 0.000 description 1
- 102220214871 rs764149433 Human genes 0.000 description 1
- 102220318009 rs764280416 Human genes 0.000 description 1
- 102220223523 rs764312409 Human genes 0.000 description 1
- 102220224027 rs764312409 Human genes 0.000 description 1
- 102220100018 rs764472307 Human genes 0.000 description 1
- 102220317624 rs764472307 Human genes 0.000 description 1
- 102220274487 rs764641221 Human genes 0.000 description 1
- 102220315544 rs764764823 Human genes 0.000 description 1
- 102220238083 rs765070826 Human genes 0.000 description 1
- 102220185333 rs765090704 Human genes 0.000 description 1
- 102220139542 rs765931092 Human genes 0.000 description 1
- 102220268380 rs766131342 Human genes 0.000 description 1
- 102220086575 rs766203500 Human genes 0.000 description 1
- 102220254294 rs766907690 Human genes 0.000 description 1
- 102220285557 rs767157505 Human genes 0.000 description 1
- 102220058931 rs767371843 Human genes 0.000 description 1
- 102220194786 rs767371843 Human genes 0.000 description 1
- 102200114115 rs767564684 Human genes 0.000 description 1
- 102220258442 rs767581059 Human genes 0.000 description 1
- 102220226395 rs767780451 Human genes 0.000 description 1
- 102220326201 rs768526036 Human genes 0.000 description 1
- 102220330850 rs768542145 Human genes 0.000 description 1
- 102220214341 rs769061878 Human genes 0.000 description 1
- 102200067148 rs769650474 Human genes 0.000 description 1
- 102220104792 rs769882912 Human genes 0.000 description 1
- 102220231914 rs770020244 Human genes 0.000 description 1
- 102220224231 rs770503805 Human genes 0.000 description 1
- 102220245078 rs771011731 Human genes 0.000 description 1
- 102200057225 rs771170000 Human genes 0.000 description 1
- 102220227468 rs771300829 Human genes 0.000 description 1
- 102220222910 rs771332058 Human genes 0.000 description 1
- 102220215245 rs771612764 Human genes 0.000 description 1
- 102220246476 rs772347588 Human genes 0.000 description 1
- 102220216713 rs773580818 Human genes 0.000 description 1
- 102220251947 rs773916549 Human genes 0.000 description 1
- 102220084102 rs773998134 Human genes 0.000 description 1
- 102220213091 rs774237159 Human genes 0.000 description 1
- 102220095999 rs774521832 Human genes 0.000 description 1
- 102220227720 rs775217949 Human genes 0.000 description 1
- 102220251723 rs776827432 Human genes 0.000 description 1
- 102220245898 rs777266582 Human genes 0.000 description 1
- 102220280607 rs777373591 Human genes 0.000 description 1
- 102220219601 rs777689913 Human genes 0.000 description 1
- 102220095092 rs777845808 Human genes 0.000 description 1
- 102220316816 rs777965976 Human genes 0.000 description 1
- 102220141930 rs778259023 Human genes 0.000 description 1
- 102220215248 rs778528329 Human genes 0.000 description 1
- 102220240379 rs780178733 Human genes 0.000 description 1
- 102220273022 rs780581573 Human genes 0.000 description 1
- 102220292648 rs780774076 Human genes 0.000 description 1
- 102220127115 rs781835089 Human genes 0.000 description 1
- 102220331520 rs781947413 Human genes 0.000 description 1
- 102220340038 rs782167890 Human genes 0.000 description 1
- 102220266138 rs782308530 Human genes 0.000 description 1
- 102200009423 rs78408272 Human genes 0.000 description 1
- 102220330013 rs78488639 Human genes 0.000 description 1
- 102220059857 rs786201252 Human genes 0.000 description 1
- 102220198398 rs786201419 Human genes 0.000 description 1
- 102220059035 rs786201910 Human genes 0.000 description 1
- 102220062241 rs786201968 Human genes 0.000 description 1
- 102220062242 rs786201968 Human genes 0.000 description 1
- 102220316041 rs786202335 Human genes 0.000 description 1
- 102220061993 rs786202533 Human genes 0.000 description 1
- 102220061705 rs786202993 Human genes 0.000 description 1
- 102220058894 rs786203226 Human genes 0.000 description 1
- 102220062461 rs786203283 Human genes 0.000 description 1
- 102220061992 rs786203319 Human genes 0.000 description 1
- 102220061202 rs786203440 Human genes 0.000 description 1
- 102220061417 rs786203607 Human genes 0.000 description 1
- 102220062554 rs786204153 Human genes 0.000 description 1
- 102220063427 rs786205005 Human genes 0.000 description 1
- 102220064548 rs786205494 Human genes 0.000 description 1
- 102200007405 rs794727239 Human genes 0.000 description 1
- 102220069943 rs794727777 Human genes 0.000 description 1
- 102220072097 rs794728201 Human genes 0.000 description 1
- 102220070991 rs794728711 Human genes 0.000 description 1
- 102220070978 rs794728761 Human genes 0.000 description 1
- 102220072442 rs794728978 Human genes 0.000 description 1
- 102220075990 rs796052481 Human genes 0.000 description 1
- 102220076551 rs796052528 Human genes 0.000 description 1
- 102220076765 rs796052619 Human genes 0.000 description 1
- 102220074729 rs796053206 Human genes 0.000 description 1
- 102220075553 rs796053359 Human genes 0.000 description 1
- 102220077423 rs797044950 Human genes 0.000 description 1
- 102200018967 rs79761867 Human genes 0.000 description 1
- 102220319678 rs79761867 Human genes 0.000 description 1
- 102200147926 rs80338704 Human genes 0.000 description 1
- 102200040544 rs80356525 Human genes 0.000 description 1
- 102220009454 rs80356863 Human genes 0.000 description 1
- 102220028143 rs80356864 Human genes 0.000 description 1
- 102220020965 rs80356883 Human genes 0.000 description 1
- 102220009472 rs80357084 Human genes 0.000 description 1
- 102200067143 rs80357438 Human genes 0.000 description 1
- 102200083967 rs80358210 Human genes 0.000 description 1
- 102220019141 rs80358660 Human genes 0.000 description 1
- 102220019199 rs80358691 Human genes 0.000 description 1
- 102220019329 rs80358747 Human genes 0.000 description 1
- 102220019742 rs80358956 Human genes 0.000 description 1
- 102220096029 rs80358956 Human genes 0.000 description 1
- 102200067655 rs80358961 Human genes 0.000 description 1
- 102220005617 rs80359822 Human genes 0.000 description 1
- 102220081831 rs863223983 Human genes 0.000 description 1
- 102200152969 rs863224471 Human genes 0.000 description 1
- 102220083649 rs863224573 Human genes 0.000 description 1
- 102220083467 rs863224774 Human genes 0.000 description 1
- 102220084260 rs863224855 Human genes 0.000 description 1
- 102220085849 rs864321700 Human genes 0.000 description 1
- 102200102904 rs864622115 Human genes 0.000 description 1
- 102220087254 rs864622284 Human genes 0.000 description 1
- 102200091488 rs869025636 Human genes 0.000 description 1
- 102220089254 rs869312808 Human genes 0.000 description 1
- 102220090408 rs876657989 Human genes 0.000 description 1
- 102220096730 rs876658359 Human genes 0.000 description 1
- 102220095190 rs876658581 Human genes 0.000 description 1
- 102220095943 rs876659107 Human genes 0.000 description 1
- 102220094426 rs876659274 Human genes 0.000 description 1
- 102220097494 rs876659315 Human genes 0.000 description 1
- 102220095237 rs876659353 Human genes 0.000 description 1
- 102220097491 rs876659614 Human genes 0.000 description 1
- 102220095374 rs876659832 Human genes 0.000 description 1
- 102220096878 rs876659849 Human genes 0.000 description 1
- 102220285791 rs876660173 Human genes 0.000 description 1
- 102220095063 rs876660196 Human genes 0.000 description 1
- 102220095998 rs876660440 Human genes 0.000 description 1
- 102220094084 rs876660490 Human genes 0.000 description 1
- 102220097528 rs876660641 Human genes 0.000 description 1
- 102220094411 rs876660926 Human genes 0.000 description 1
- 102220093431 rs876661010 Human genes 0.000 description 1
- 102220093681 rs876661079 Human genes 0.000 description 1
- 102200153173 rs876661119 Human genes 0.000 description 1
- 102220093558 rs876661210 Human genes 0.000 description 1
- 102220093421 rs876661239 Human genes 0.000 description 1
- 102220093170 rs876661257 Human genes 0.000 description 1
- 102220098054 rs876661376 Human genes 0.000 description 1
- 102220099580 rs878853748 Human genes 0.000 description 1
- 102220099568 rs878853751 Human genes 0.000 description 1
- 102220100724 rs878854056 Human genes 0.000 description 1
- 102220098981 rs878854155 Human genes 0.000 description 1
- 102220103616 rs878854701 Human genes 0.000 description 1
- 102220103944 rs878854923 Human genes 0.000 description 1
- 102220103151 rs878854946 Human genes 0.000 description 1
- 102220104277 rs879254200 Human genes 0.000 description 1
- 102220105566 rs879254627 Human genes 0.000 description 1
- 102200121015 rs879255632 Human genes 0.000 description 1
- 102220267843 rs879762286 Human genes 0.000 description 1
- 102220089103 rs886037806 Human genes 0.000 description 1
- 102220285718 rs886037806 Human genes 0.000 description 1
- 102220114604 rs886038899 Human genes 0.000 description 1
- 102220114396 rs886039195 Human genes 0.000 description 1
- 102220115424 rs886039513 Human genes 0.000 description 1
- 102220118474 rs886042066 Human genes 0.000 description 1
- 102220122509 rs886043109 Human genes 0.000 description 1
- 102220125918 rs886044113 Human genes 0.000 description 1
- 102220226059 rs886044113 Human genes 0.000 description 1
- 102220126814 rs886044376 Human genes 0.000 description 1
- 102220175451 rs886049644 Human genes 0.000 description 1
- 102220170639 rs886049774 Human genes 0.000 description 1
- 102220430129 rs886051892 Human genes 0.000 description 1
- 102220133422 rs886054767 Human genes 0.000 description 1
- 102220190202 rs886056552 Human genes 0.000 description 1
- 102220145201 rs886059686 Human genes 0.000 description 1
- 102220155715 rs886062788 Human genes 0.000 description 1
- 102220324277 rs889470853 Human genes 0.000 description 1
- 102220318824 rs904474688 Human genes 0.000 description 1
- 102220313220 rs915794675 Human genes 0.000 description 1
- 102220329489 rs923000484 Human genes 0.000 description 1
- 102200160773 rs934996 Human genes 0.000 description 1
- 102220328780 rs947488726 Human genes 0.000 description 1
- 102220278116 rs977002306 Human genes 0.000 description 1
- 102220276450 rs978988174 Human genes 0.000 description 1
- 102220287825 rs990737815 Human genes 0.000 description 1
- 102220284165 rs999812302 Human genes 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 229960002181 saccharomyces boulardii Drugs 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000007423 screening assay Methods 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- 229940055619 selenocysteine Drugs 0.000 description 1
- ZKZBPNGNEQAJSX-UHFFFAOYSA-N selenocysteine Natural products [SeH]CC(N)C(O)=O ZKZBPNGNEQAJSX-UHFFFAOYSA-N 0.000 description 1
- 235000016491 selenocysteine Nutrition 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000002864 sequence alignment Methods 0.000 description 1
- 238000012163 sequencing technique Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 210000002027 skeletal muscle Anatomy 0.000 description 1
- 235000020183 skimmed milk Nutrition 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 229940010329 spectracef Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- TYFQFVWCELRYAO-UHFFFAOYSA-L suberate(2-) Chemical compound [O-]C(=O)CCCCCCC([O-])=O TYFQFVWCELRYAO-UHFFFAOYSA-L 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000013595 supernatant sample Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 229940072226 suprax Drugs 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 102220482183 tRNA pseudouridine synthase A_E11S_mutation Human genes 0.000 description 1
- 102220482685 tRNA pseudouridine synthase A_P226A_mutation Human genes 0.000 description 1
- 102220532847 tRNA wybutosine-synthesizing protein 3 homolog_K8L_mutation Human genes 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 101150032575 tcdA gene Proteins 0.000 description 1
- 101150089436 tcdB gene Proteins 0.000 description 1
- 229940036731 teflaro Drugs 0.000 description 1
- 229960001114 temocillin Drugs 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 230000002381 testicular Effects 0.000 description 1
- KTAVBOYXMBQFGR-MAODNAKNSA-J tetrasodium;(6r,7r)-7-[[(2z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-1-oxidoethylidene]amino]-3-[(2-methyl-5,6-dioxo-1h-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;heptahydrate Chemical compound O.O.O.O.O.O.O.[Na+].[Na+].[Na+].[Na+].S([C@@H]1[C@@H](C(N1C=1C([O-])=O)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1CSC1=NC(=O)C([O-])=NN1C.S([C@@H]1[C@@H](C(N1C=1C([O-])=O)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1CSC1=NC(=O)C([O-])=NN1C KTAVBOYXMBQFGR-MAODNAKNSA-J 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 229960004659 ticarcillin Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000003325 tomography Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 230000005030 transcription termination Effects 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 230000014616 translation Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
- 241001430294 unidentified retrovirus Species 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 229940072335 vancocin Drugs 0.000 description 1
- 229940054969 vantin Drugs 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 102220503108 von Hippel-Lindau disease tumor suppressor_G114C_mutation Human genes 0.000 description 1
- 102220503201 von Hippel-Lindau disease tumor suppressor_N131T_mutation Human genes 0.000 description 1
- 102220503018 von Hippel-Lindau disease tumor suppressor_R161P_mutation Human genes 0.000 description 1
- 102220588469 von Willebrand factor A domain-containing protein 5B1_S96D_mutation Human genes 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005550 wet granulation Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000009637 wintergreen oil Substances 0.000 description 1
- 229940030186 xpect Drugs 0.000 description 1
- 229940071104 xylenesulfonate Drugs 0.000 description 1
- 210000005253 yeast cell Anatomy 0.000 description 1
- 229940126085 β‑Lactamase Inhibitor Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N9/00—Enzymes; Proenzymes; Compositions thereof; Processes for preparing, activating, inhibiting, separating or purifying enzymes
- C12N9/14—Hydrolases (3)
- C12N9/78—Hydrolases (3) acting on carbon to nitrogen bonds other than peptide bonds (3.5)
- C12N9/86—Hydrolases (3) acting on carbon to nitrogen bonds other than peptide bonds (3.5) acting on amide bonds in cyclic amides, e.g. penicillinase (3.5.2)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/54—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame
- A61K31/542—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame ortho- or peri-condensed with heterocyclic ring systems
- A61K31/545—Compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins, cefaclor, or cephalexine
- A61K31/546—Compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins, cefaclor, or cephalexine containing further heterocyclic rings, e.g. cephalothin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
- A61K38/16—Peptides having more than 20 amino acids; Gastrins; Somatostatins; Melanotropins; Derivatives thereof
- A61K38/43—Enzymes; Proenzymes; Derivatives thereof
- A61K38/46—Hydrolases (3)
- A61K38/50—Hydrolases (3) acting on carbon-nitrogen bonds, other than peptide bonds (3.5), e.g. asparaginase
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/0012—Galenical forms characterised by the site of application
- A61K9/0053—Mouth and digestive tract, i.e. intraoral and peroral administration
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P39/00—General protective or antinoxious agents
- A61P39/02—Antidotes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Y—ENZYMES
- C12Y305/00—Hydrolases acting on carbon-nitrogen bonds, other than peptide bonds (3.5)
- C12Y305/02—Hydrolases acting on carbon-nitrogen bonds, other than peptide bonds (3.5) in cyclic amides (3.5.2)
- C12Y305/02006—Beta-lactamase (3.5.2.6)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2300/00—Mixtures or combinations of active ingredients, wherein at least one active ingredient is fully defined in groups A61K31/00 - A61K41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Zoology (AREA)
- Wood Science & Technology (AREA)
- Genetics & Genomics (AREA)
- General Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Biomedical Technology (AREA)
- Biotechnology (AREA)
- Microbiology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Gastroenterology & Hepatology (AREA)
- Immunology (AREA)
- Nutrition Science (AREA)
- Physiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Toxicology (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Enzymes And Modification Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Micro-Organisms Or Cultivation Processes Thereof (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (5)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US201461980844P | 2014-04-17 | 2014-04-17 | |
US61/980,844 | 2014-04-17 | ||
US201462046627P | 2014-09-05 | 2014-09-05 | |
US62/046,627 | 2014-09-05 | ||
PCT/US2015/026457 WO2015161243A2 (en) | 2014-04-17 | 2015-04-17 | Beta-lactamases with improved properties for therapy |
Publications (2)
Publication Number | Publication Date |
---|---|
AU2015247382A1 AU2015247382A1 (en) | 2016-09-15 |
AU2015247382B2 true AU2015247382B2 (en) | 2020-04-23 |
Family
ID=54321063
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
AU2015247382A Active AU2015247382B2 (en) | 2014-04-17 | 2015-04-17 | Beta-lactamases with improved properties for therapy |
Country Status (10)
Families Citing this family (13)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
AU2015330937B2 (en) | 2014-10-08 | 2021-07-15 | Theriva Biologics, Inc. | Beta-lactamase formulations and uses thereof |
WO2016144856A1 (en) * | 2015-03-06 | 2016-09-15 | Synthetic Biologics, Inc. | Safe and effective beta-lactamase dosing for microbiome protection |
WO2017144495A1 (en) * | 2016-02-23 | 2017-08-31 | Da Volterra | Beta-lactamase variants |
US10982205B2 (en) | 2016-02-23 | 2021-04-20 | Da Volterra | Beta-lactamase variants |
WO2018005606A1 (en) | 2016-06-28 | 2018-01-04 | Synthetic Biologics, Inc. | Microbiome protection from oral antibiotics |
KR20210040395A (ko) | 2018-08-05 | 2021-04-13 | 다 볼떼라 | 이식편 대 숙주 질환의 치료를 위한 조성물 |
AU2019317986A1 (en) | 2018-08-05 | 2021-02-11 | Da Volterra | Method for improving anticancer agent efficacy |
CN109337889B (zh) * | 2018-12-26 | 2020-10-02 | 广州白云山拜迪生物医药有限公司 | 一种酶活提高的金属β-内酰胺酶突变体及其构建方法 |
CN109576250A (zh) * | 2018-12-26 | 2019-04-05 | 广州白云山拜迪生物医药有限公司 | 一种酶活提高的头孢菌素酶突变体及其构建方法 |
CN113939308A (zh) * | 2019-05-06 | 2022-01-14 | 合成生物制品有限公司 | 用于治疗移植物抗宿主病的β-内酰胺酶组合物 |
EP4148136A1 (en) | 2021-09-08 | 2023-03-15 | Da Volterra | An engineered yeast cell for the delivery of antibiotic-inactivating enzymes |
WO2024012487A1 (en) * | 2022-07-14 | 2024-01-18 | The Hong Kong Polytechnic University | Biosensor comprising a modified beta-lactamase and uses thereof |
CN115433701B (zh) * | 2022-11-08 | 2023-03-17 | 南京农业大学 | 一株变形杆菌及其菌剂和在降解头孢类抗生素中的应用 |
Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE102004032995A1 (de) * | 2004-07-08 | 2006-03-30 | Henkel Kgaa | Neue, sekretierte Genprodukte von Bacillus licheniformis und darauf aufbauende verbesserte biotechnologische Produktionsverfahren |
WO2008066931A2 (en) * | 2006-11-29 | 2008-06-05 | Novozymes, Inc. | Bacillus licheniformis chromosome |
WO2011148041A1 (en) * | 2010-05-24 | 2011-12-01 | Prevab R Llc | Modified beta-lactamases and methods and uses related thereto |
US8168417B2 (en) * | 2004-01-09 | 2012-05-01 | Novozymes A/S | Bacillus licheniformis chromosome |
Family Cites Families (28)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
NL197650A (US06650917-20031118-M00005.png) | 1954-05-29 | |||
US2941995A (en) | 1957-08-02 | 1960-06-21 | Beecham Res Lab | Recovery of solid 6-aminopenicillanic acid |
US2982696A (en) | 1959-05-01 | 1961-05-02 | Schenley Ind Inc | Ion-exchange procedures for the purification of penicillinase |
US3070511A (en) | 1960-02-10 | 1962-12-25 | Lepetit Spa | Process for preparing 6-aminopenicillanic acid |
US3150059A (en) | 1962-12-26 | 1964-09-22 | Lilly Co Eli | Penicillin deacylation via actinoplanaceae fermentation |
US3239394A (en) | 1964-06-15 | 1966-03-08 | Merck & Co Inc | Process for producing 7-amino-cephalosporanic acid |
US3499909A (en) | 1966-05-18 | 1970-03-10 | Koninklijke Gist Spiritus | Process for production of 6-aminopenicillanic acid |
US3488729A (en) | 1966-08-22 | 1970-01-06 | Lilly Co Eli | Cephalothin ester |
GB1241844A (en) | 1968-08-23 | 1971-08-04 | Beecham Group Ltd | Penicillins |
FI59265C (fi) | 1974-08-13 | 1981-07-10 | Beecham Group Ltd | Foerfarande foer framstaellning av 6-aminopenicillansyra |
GB1463513A (en) | 1974-08-13 | 1977-02-02 | Beecham Group Ltd | Enzymes |
GB2199582A (en) | 1987-01-07 | 1988-07-13 | Bayer Ag | Analogues of pancreatic secretory trypsin inhibitor |
FR2613624B1 (fr) | 1987-04-10 | 1990-11-23 | Roussy Inst Gustave | Composition pharmaceutique, administrable par voie orale, destinee a reduire les effets des b-lactamines |
CA2007083A1 (en) | 1989-01-09 | 1990-07-09 | Nobuhiko Katunuma | Pharmaceutical use of trypstatin |
CS275231B2 (en) | 1989-09-29 | 1992-02-19 | Ustav Makormolekularni Chemie | Medicine bottle |
FI920206A0 (fi) | 1992-01-17 | 1992-01-17 | Pekka Untamo Heino | Medicinsk anvaendning, medicinskt foerfarande och preparat. |
JPH11509096A (ja) | 1995-07-07 | 1999-08-17 | ノボ ノルディスク アクティーゼルスカブ | 胞子形成できないバチルスを用いるタンパク質の生産 |
CN1363680A (zh) * | 2001-01-05 | 2002-08-14 | 上海博德基因开发有限公司 | 一种新的多肽——β内酰胺酶20.24和编码这种多肽的多核苷酸 |
EP1391502B1 (en) | 2001-05-29 | 2012-04-25 | Kao Corporation | Host microorganisms |
FI112666B (fi) | 2001-11-06 | 2003-12-31 | Ipsat Therapies Oy | Itiöimätön Bacillus subtilis, sen valmistus ja käyttö |
FR2843302B1 (fr) | 2002-08-09 | 2004-10-22 | Centre Nat Rech Scient | Forme galenique pour la delivrance colique de principes actifs |
EP1564286A1 (en) | 2004-02-11 | 2005-08-17 | Université de Liège | Hybrid proteins of beta-lactamase class A |
AU2006249100B2 (en) | 2005-05-18 | 2012-01-19 | Assistance Publique - Hospitaux De Paris | Colonic delivery of adsorbents |
FI119190B (fi) * | 2006-06-21 | 2008-08-29 | Ipsat Therapies Oy | Modifioitu beta-laktamaasi ja menetelmä sen valmistamiseksi |
CN101104858A (zh) * | 2006-07-10 | 2008-01-16 | 温州医学院 | 一种体外定向进化获取高活力超广谱β-内酰胺酶的方法 |
FI119678B (fi) | 2006-11-28 | 2009-02-13 | Ipsat Therapies Oy | Beta-laktamaasin käyttö |
CN101647022B (zh) * | 2007-01-31 | 2012-07-18 | 麦科罗医药科技(武汉)有限公司 | 描述蛋白质的构象和根据折叠、整体形状与结构序列对其进行评价的方法、系统及装置 |
US9458453B2 (en) * | 2012-06-12 | 2016-10-04 | The Johns Hopkins University | Methods for efficient, expansive, user-defined DNA mutagenesis |
-
2015
- 2015-04-17 JP JP2016562248A patent/JP6685925B2/ja active Active
- 2015-04-17 KR KR1020167027846A patent/KR102360582B1/ko active IP Right Grant
- 2015-04-17 US US14/689,877 patent/US9290754B2/en active Active
- 2015-04-17 CN CN201580019029.7A patent/CN106163546B/zh active Active
- 2015-04-17 EP EP15780157.2A patent/EP3132033B1/en active Active
- 2015-04-17 WO PCT/US2015/026457 patent/WO2015161243A2/en active Application Filing
- 2015-04-17 RU RU2016140627A patent/RU2678124C2/ru active
- 2015-04-17 AU AU2015247382A patent/AU2015247382B2/en active Active
- 2015-04-17 BR BR112016023360-3A patent/BR112016023360B1/pt active IP Right Grant
- 2015-04-17 CA CA2942971A patent/CA2942971C/en active Active
-
2016
- 2016-02-09 US US15/019,474 patent/US9376673B1/en active Active
- 2016-05-20 US US15/160,669 patent/US9404103B1/en active Active
- 2016-07-01 US US15/200,508 patent/US9464280B1/en active Active
- 2016-08-24 US US15/245,517 patent/US9695409B2/en active Active
-
2017
- 2017-06-02 US US15/611,881 patent/US9783797B1/en active Active
- 2017-08-10 US US15/674,177 patent/US10011824B2/en active Active
-
2018
- 2018-05-30 US US15/993,159 patent/US10087433B1/en active Active
- 2018-08-24 US US16/112,283 patent/US10336995B2/en active Active
-
2019
- 2019-05-16 US US16/414,411 patent/US10584326B2/en active Active
- 2019-12-05 JP JP2019220462A patent/JP7038094B2/ja active Active
-
2020
- 2020-01-24 US US16/751,734 patent/US10767171B2/en active Active
- 2020-07-24 US US16/938,318 patent/US11236319B2/en active Active
-
2021
- 2021-12-08 US US17/545,050 patent/US11608494B2/en active Active
-
2023
- 2023-02-07 US US18/165,470 patent/US20230313166A1/en active Pending
Patent Citations (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US8168417B2 (en) * | 2004-01-09 | 2012-05-01 | Novozymes A/S | Bacillus licheniformis chromosome |
DE102004032995A1 (de) * | 2004-07-08 | 2006-03-30 | Henkel Kgaa | Neue, sekretierte Genprodukte von Bacillus licheniformis und darauf aufbauende verbesserte biotechnologische Produktionsverfahren |
WO2008066931A2 (en) * | 2006-11-29 | 2008-06-05 | Novozymes, Inc. | Bacillus licheniformis chromosome |
WO2011148041A1 (en) * | 2010-05-24 | 2011-12-01 | Prevab R Llc | Modified beta-lactamases and methods and uses related thereto |
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US11608494B2 (en) | Beta-lactamases with improved properties for therapy | |
Bahr et al. | Metallo-β-lactamases in the age of multidrug resistance: from structure and mechanism to evolution, dissemination, and inhibitor design | |
EP3261662B1 (en) | Carbapenemases for use with antibiotics for the protection of the intestinal microbiome | |
EP2486131A1 (en) | Carbapenemase and antibacterial treatment | |
Fontana et al. | The final goal: penicillin-binding proteins and the target of cephalosporins | |
Cheng | Structural and functional studies of antibiotic resistance enzymes | |
Medina | Active Site Loops and Substrate Profile in Class B Metallo-β-Lactamases: From Mechanistic Studies to Therapy Development |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
FGA | Letters patent sealed or granted (standard patent) | ||
HB | Alteration of name in register |
Owner name: THERIVA BIOLOGICS, INC. Free format text: FORMER NAME(S): SYNTHETIC BIOLOGICS, INC. |