ATE46080T1 - Pharmazeutische komposition. - Google Patents
Pharmazeutische komposition.Info
- Publication number
- ATE46080T1 ATE46080T1 AT85850007T AT85850007T ATE46080T1 AT E46080 T1 ATE46080 T1 AT E46080T1 AT 85850007 T AT85850007 T AT 85850007T AT 85850007 T AT85850007 T AT 85850007T AT E46080 T1 ATE46080 T1 AT E46080T1
- Authority
- AT
- Austria
- Prior art keywords
- pharmaceutical composition
- new
- compound
- relates
- present
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 2
- RGHAZVBIOOEVQX-UHFFFAOYSA-N Metoprolol succinate Chemical compound OC(=O)CCC(O)=O.COCCC1=CC=C(OCC(O)CNC(C)C)C=C1.COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 RGHAZVBIOOEVQX-UHFFFAOYSA-N 0.000 abstract 1
- 229960000939 metoprolol succinate Drugs 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/5073—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals having two or more different coatings optionally including drug-containing subcoatings
Landscapes
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Medicinal Preparation (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8400085A SE457505B (sv) | 1984-01-10 | 1984-01-10 | Laminatbelagd oral farmaceutisk komposition och foerfarande foer dess framstaellning |
| EP85850007A EP0148811B1 (de) | 1984-01-10 | 1985-01-08 | Pharmazeutische Komposition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ATE46080T1 true ATE46080T1 (de) | 1989-09-15 |
Family
ID=20354249
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT85850007T ATE46080T1 (de) | 1984-01-10 | 1985-01-08 | Pharmazeutische komposition. |
| AT88850123T ATE77077T1 (de) | 1984-01-10 | 1985-01-08 | Metoprololsuccinat und dieses enthaltende pharmazeutische zusammensetzung. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT88850123T ATE77077T1 (de) | 1984-01-10 | 1985-01-08 | Metoprololsuccinat und dieses enthaltende pharmazeutische zusammensetzung. |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4780318A (de) |
| EP (2) | EP0148811B1 (de) |
| AT (2) | ATE46080T1 (de) |
| DE (2) | DE3572767D1 (de) |
| HK (1) | HK24995A (de) |
| SE (2) | SE457505B (de) |
| SG (1) | SG2295G (de) |
Families Citing this family (86)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1981002671A1 (en) * | 1980-03-20 | 1981-10-01 | Ferring Farma Lab | Pharmaceutical composition and method for the treatment of colitis ulcerosa and crohn's disease by oral administration |
| US4960765A (en) * | 1980-03-20 | 1990-10-02 | Farmaceutisk Laboratorium Ferring A/S | Pharmaceutical composition and method for the treatment of colitis ulcerosa and Crohn's disease by oral administration |
| JPS6261916A (ja) * | 1985-09-12 | 1987-03-18 | Fujisawa Pharmaceut Co Ltd | 持続性製剤 |
| SE450087B (sv) * | 1985-10-11 | 1987-06-09 | Haessle Ab | Korn med kontrollerad frisettning av farmaceutiskt aktiva emnen som anbringats teckande pa ett kompakt olosligt kernmaterial |
| SE455836B (sv) * | 1985-10-11 | 1988-08-15 | Haessle Ab | Beredning med kontrollerad frisettning innehallande ett salt av metoprolol samt metod for framstellning av denna beredning |
| US4717567A (en) * | 1985-11-25 | 1988-01-05 | Eastman Kodak Company | Rumen-stable pellets |
| GB2186485B (en) * | 1986-02-13 | 1988-09-07 | Ethical Pharma Ltd | Slow release formulation |
| AU591248B2 (en) * | 1986-03-27 | 1989-11-30 | Kinaform Technology, Inc. | Sustained-release pharaceutical preparation |
| US5238686A (en) * | 1986-03-27 | 1993-08-24 | Kinaform Technology, Inc. | Sustained-release pharmaceutical preparation |
| WO1988004922A1 (fr) * | 1986-12-25 | 1988-07-14 | Teysan Pharmaceuticals Co., Ltd. | Granule a dissolution lente et granule composite a effet persistant prepare a partir du premier granule |
| SE460945B (sv) * | 1987-01-15 | 1989-12-11 | Lejus Medical Ab | En multipel-unit-dos komposition av furosemid |
| US4789549A (en) * | 1987-03-09 | 1988-12-06 | Warner-Lambert Company | Sustained release dosage forms |
| SE460946B (sv) * | 1987-03-16 | 1989-12-11 | Lejus Medical Ab | En multipel-unit-dos komposition av kinidinglukonat |
| SE8703881D0 (sv) * | 1987-10-08 | 1987-10-08 | Haessle Ab | New pharmaceutical preparation |
| IL88083A (en) * | 1987-11-06 | 1992-11-15 | Tanabe Seiyaku Co | Controlled release pharmaceutical dosage form and its preparation |
| FR2624732B1 (fr) * | 1987-12-21 | 1991-02-15 | Synthelabo | Formulation pharmaceutique a liberation prolongee |
| US4971805A (en) * | 1987-12-23 | 1990-11-20 | Teysan Pharmaceuticals Co., Ltd. | Slow-releasing granules and long acting mixed granules comprising the same |
| FI101344B1 (fi) * | 1988-03-31 | 1998-06-15 | Tanabe Seiyaku Co | Menetelmä valmistaa valmiste, josta kontrolloidusti vapautuu farmaseuttisesti aktiivista ainetta |
| US4892739A (en) * | 1988-04-25 | 1990-01-09 | Ciba-Geigy Corporation | Osmotic continuous dispensing oral delivery system containing a pharmaceutically acceptable active agent having a improved core membrane adhesion properties |
| FR2634376B1 (fr) * | 1988-07-21 | 1992-04-17 | Farmalyoc | Nouvelle forme unitaire, solide et poreuse comprenant des microparticules et/ou des nanoparticules, ainsi que sa preparation |
| EP0352800A3 (de) * | 1988-07-28 | 1991-05-08 | Warner-Lambert Company | Wässerige Polymerdispersion eines Cellulose- und Acrylharzes und ihre Anwendung für die Herstellung von Arzneidosiereinheiten |
| US5296236A (en) * | 1988-09-16 | 1994-03-22 | Recordati S.A., Chemical And Pharmaceutical Company | Controlled release therapeutic system for a liquid pharmaceutical formulations |
| GB8913889D0 (en) * | 1989-06-16 | 1989-08-02 | May & Baker Ltd | New compositions of matter |
| GB8915137D0 (en) * | 1989-06-30 | 1989-08-23 | Inmos Ltd | Message routing |
| US5422881A (en) * | 1989-06-30 | 1995-06-06 | Inmos Limited | Message encoding |
| IT1246382B (it) * | 1990-04-17 | 1994-11-18 | Eurand Int | Metodo per la cessione mirata e controllata di farmaci nell'intestino e particolarmente nel colon |
| EP0458751A1 (de) * | 1990-05-25 | 1991-11-27 | Warner-Lambert Company | System zur Freisetzung von cyclischen Aminosäuren mit verbessertem Geschmack, Struktur und Komprimierbarkeit |
| WO1992001477A1 (en) * | 1990-07-26 | 1992-02-06 | G.D. Searle & Co. | Polymeric drug delivery system |
| US5316772A (en) * | 1990-12-19 | 1994-05-31 | Solvay & Cie, S.A. (Societe Anonyme) | Bilayered oral pharmaceutical composition with pH dependent release |
| US6764697B1 (en) | 1991-06-27 | 2004-07-20 | Alza Corporation | System for delaying drug delivery up to seven hours |
| SG42869A1 (en) * | 1992-08-05 | 1997-10-17 | Faulding F H & Co Ltd | Pelletised pharmaceutical composition |
| EP0667148B1 (de) * | 1992-11-06 | 2002-07-03 | Hisamitsu Pharmaceutical Co., Inc. | Perorale pharmazeutische zubereitung mit freisetzung im unteren verfdauungstrakt |
| US5358502A (en) * | 1993-02-25 | 1994-10-25 | Pfizer Inc | PH-triggered osmotic bursting delivery devices |
| EP0621032B1 (de) * | 1993-04-23 | 2000-08-09 | Novartis AG | Wirkstoffabgabevorrichtung mit gesteuerter Freigabe |
| DE4329503A1 (de) * | 1993-09-01 | 1995-03-02 | Galenik Labor Freiburg Gmbh | Pharmazeutische Präparate zur gezielten Behandlung von Morbus Crohn und Colitis Ulcerosa |
| US6204243B1 (en) | 1993-09-01 | 2001-03-20 | Novatis Ag | Pharmaceutical preparations for the targeted treatment of crohn's disease and ulcerative colitis |
| US6039975A (en) * | 1995-10-17 | 2000-03-21 | Hoffman-La Roche Inc. | Colon targeted delivery system |
| CZ289290B6 (cs) * | 1995-12-21 | 2001-12-12 | Farmaceutisk Laboratorium Ferring A/S | Orální přípravek s modifikovaným uvolňováním |
| US8071128B2 (en) | 1996-06-14 | 2011-12-06 | Kyowa Hakko Kirin Co., Ltd. | Intrabuccally rapidly disintegrating tablet and a production method of the tablets |
| US5788987A (en) * | 1997-01-29 | 1998-08-04 | Poli Industria Chimica Spa | Methods for treating early morning pathologies |
| US5891474A (en) * | 1997-01-29 | 1999-04-06 | Poli Industria Chimica, S.P.A. | Time-specific controlled release dosage formulations and method of preparing same |
| DE19732903A1 (de) * | 1997-07-30 | 1999-02-04 | Falk Pharma Gmbh | Pellet-Formulierung zur Behandlung des Intestinaltraktes |
| DE19845358A1 (de) * | 1998-10-02 | 2000-04-06 | Roehm Gmbh | Überzogene Arzneiformen mit kontrollierter Wirkstoffabgabe |
| PT1146862E (pt) | 1999-01-29 | 2003-09-30 | Disphar Int Bv | Composicoes farmaceuticas |
| EP1313697B1 (de) | 2000-08-29 | 2005-11-30 | Nobex Corporation | Immunoregulierende verbindungen, deren derivate und ihre verwendung |
| CA2359812C (en) * | 2000-11-20 | 2004-02-10 | The Procter & Gamble Company | Pharmaceutical dosage form with multiple coatings for reduced impact of coating fractures |
| US20040105886A1 (en) * | 2001-02-16 | 2004-06-03 | Chih-Ming Chen | Divalproex sodium tablets |
| US6610326B2 (en) * | 2001-02-16 | 2003-08-26 | Andrx Corporation | Divalproex sodium tablets |
| IL157633A0 (en) * | 2001-03-13 | 2004-03-28 | Penwest Pharmaceuticals Co | Chronotherapeutic dosage forms |
| SE0102888D0 (sv) * | 2001-08-29 | 2001-08-29 | Astrazeneca Ab | New formulation |
| SE0102886D0 (sv) * | 2001-08-29 | 2001-08-29 | Astrazeneca Ab | New formulation |
| SE0102887D0 (sv) * | 2001-08-29 | 2001-08-29 | Astrazeneca Ab | New formulation |
| US8048924B2 (en) | 2001-08-29 | 2011-11-01 | Biocon Limited | Methods and compositions employing 4-aminophenylacetic acid compounds |
| US9358214B2 (en) | 2001-10-04 | 2016-06-07 | Adare Pharmaceuticals, Inc. | Timed, sustained release systems for propranolol |
| US6500454B1 (en) * | 2001-10-04 | 2002-12-31 | Eurand Pharmaceuticals Ltd. | Timed, sustained release systems for propranolol |
| US8282955B2 (en) | 2001-10-15 | 2012-10-09 | Ferring B.V. | Method for the preparation of a pharmaceutical composition comprising 5-aminosalicylic acid for use in treatment of ulcerative colitis and Crohn's disease |
| EP1467714A1 (de) * | 2002-01-07 | 2004-10-20 | Pharmacia Corporation | Wirkstoffmischung mit erhöhter auflösungsgeschwindigkeit |
| US7022342B2 (en) | 2002-03-28 | 2006-04-04 | Andrx Corporation, Inc. | Controlled release oral dosage form of beta-adrenergic blocking agents |
| WO2003086353A1 (en) * | 2002-04-05 | 2003-10-23 | Penwest Pharmaceuticals Co. | Sustained release metoprolol formulations |
| US8367111B2 (en) | 2002-12-31 | 2013-02-05 | Aptalis Pharmatech, Inc. | Extended release dosage forms of propranolol hydrochloride |
| EP1589957A1 (de) * | 2003-02-05 | 2005-11-02 | IPCA Laboratories Limited | Pharmazeutische zusammensetzungen und herstellungsverfahren dafür |
| WO2004093883A2 (en) | 2003-04-23 | 2004-11-04 | Ferring B.V. | Sachet for a pharmaceutical composition |
| US7314640B2 (en) * | 2003-07-11 | 2008-01-01 | Mongkol Sriwongjanya | Formulation and process for drug loaded cores |
| US20050032879A1 (en) * | 2003-08-07 | 2005-02-10 | Temple Okarter | Formulations and use of a beta-blocker and an ACE-inhibitor for the treatment of cardiovascular diseases |
| AP2006003585A0 (en) * | 2003-09-19 | 2006-04-30 | Penwest Pharmaceuticals Co | Delayed release dosage forms. |
| WO2005027843A2 (en) * | 2003-09-19 | 2005-03-31 | Penwest Pharmaceuticals Co. | Chronotherapeutic dosage forms |
| EP1547601A1 (de) | 2003-12-23 | 2005-06-29 | Ferring B.V. | Beschichtungsverfahren |
| EP1722758A1 (de) * | 2004-02-11 | 2006-11-22 | Athpharma Limited | Chronotherapeutische zusammensetzungen und anwendungsverfahren dafür |
| EP1773767B1 (de) | 2004-07-07 | 2016-03-09 | Biocon Limited | Synthese von azogebundenen, das immunsystem regulierenden verbindungen |
| US8747895B2 (en) | 2004-09-13 | 2014-06-10 | Aptalis Pharmatech, Inc. | Orally disintegrating tablets of atomoxetine |
| US9884014B2 (en) | 2004-10-12 | 2018-02-06 | Adare Pharmaceuticals, Inc. | Taste-masked pharmaceutical compositions |
| ES2409347T3 (es) | 2004-10-21 | 2013-06-26 | Aptalis Pharmatech, Inc. | Composiciones farmacéuticas de sabor enmascarado con agentes porogénicos gastrosolubles |
| US8481565B2 (en) | 2004-12-27 | 2013-07-09 | Eisai R&D Management Co., Ltd. | Method for stabilizing anti-dementia drug |
| US9161918B2 (en) | 2005-05-02 | 2015-10-20 | Adare Pharmaceuticals, Inc. | Timed, pulsatile release systems |
| US20070087056A1 (en) * | 2005-08-09 | 2007-04-19 | Claudia Guthmann | Pharmaceutical form with sustained pH-independent active ingredient release for active ingredients having strong pH-dependent solubility |
| US20070053983A1 (en) * | 2005-09-06 | 2007-03-08 | Girish Jain | Extended release compositions of metoprolol succinate |
| WO2007141593A2 (en) * | 2005-12-23 | 2007-12-13 | Medichem, S.A. | Process for the preparation of metoprolol and its salts |
| US20090028944A1 (en) * | 2007-07-16 | 2009-01-29 | Balaji Sathurappan | Pharmaceutical compositions comprising mesalamine |
| US20090036414A1 (en) * | 2007-08-02 | 2009-02-05 | Mutual Pharmaceutical Company, Inc. | Mesalamine Formulations |
| US20090062191A1 (en) * | 2007-08-29 | 2009-03-05 | Kiel Laboratories, Inc. | Composition for maintaining gastrointestinal homeostasis |
| US20090214665A1 (en) * | 2008-02-26 | 2009-08-27 | Lai Felix S | Controlled Release Muscarinic Receptor Antagonist Formulation |
| EA022886B1 (ru) | 2008-10-03 | 2016-03-31 | Др. Фальк Фарма Гмбх | Способ поддержания ремиссии язвенного колита у пациентов |
| EP2255791B1 (de) | 2009-04-03 | 2011-11-16 | Zaklady Farmaceutyczne Polpharma SA | Pharmazeutische Zusammensetzung mit verlängerter Freisetzung mit Metoprololsuccinat |
| CN102008457B (zh) * | 2009-09-04 | 2014-04-02 | 北京天衡药物研究院 | 酒石酸美托洛尔骨架缓释片 |
| RU2563623C2 (ru) | 2009-12-02 | 2015-09-20 | Апталис Фарма Лимитед | Микрокапсулы фексофенадина и содержащие их композиции |
| IL210279A0 (en) | 2009-12-25 | 2011-03-31 | Dexcel Pharma Technologies Ltd | Extended release compositions for high solubility, high permeability acdtive pharmaceutical ingredients |
Family Cites Families (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2099402A (en) * | 1934-01-17 | 1937-11-16 | Pratt Food Company | Pill or tablet |
| DE1228757B (de) * | 1962-06-28 | 1966-11-17 | Haessle Ab | Verfahren zur Herstellung eines in Wasser und Magensaft rasch zerfallenden UEberzuges auf festen Arzneiformen |
| DE1204363B (de) * | 1963-09-10 | 1965-11-04 | Hoffmann La Roche | Verfahren zur Herstellung einer oralen Arzneizubereitung, die ihren Wirkstoff erst im Ileum abgibt |
| US3483221A (en) * | 1964-09-10 | 1969-12-09 | Ciba Geigy Corp | 1 - (isopropylamino)-2-hydroxy-3-(alkenyloxyphenoxy) - propanes and the salts thereof |
| NL130749C (de) * | 1964-09-10 | |||
| AT270071B (de) * | 1966-08-12 | 1969-04-10 | Roehm & Haas Gmbh | Dragierlack für Arzneiformen |
| US3629237A (en) * | 1968-09-12 | 1971-12-21 | Shinetsu Chemical Co | Compositions useful as enteric coatings and method for preparing acid phthalates of cellulose ethers for them |
| SE384853B (sv) * | 1972-04-04 | 1976-05-24 | Haessle Ab | Forfarande for framstellning av nya aminer |
| SE354851B (de) * | 1970-02-18 | 1973-03-26 | Haessle Ab | |
| US3909444A (en) * | 1971-08-05 | 1975-09-30 | Ncr Co | Microcapsule |
| US4145442A (en) * | 1972-04-04 | 1979-03-20 | Aktiebolaget Hassle | Phenoxy-hydroxypropylamines, their preparation, and method and pharmaceutical preparations for treating cardiovascular diseases |
| IL43853A0 (en) * | 1973-02-16 | 1974-03-14 | Sparamedica Ag | Pharmaceutical compositions and their manufacture |
| JPS5518694B2 (de) * | 1973-04-02 | 1980-05-21 | ||
| GB1413186A (en) * | 1973-06-27 | 1975-11-12 | Toyo Jozo Kk | Process for encapsulation of medicaments |
| SE385693B (sv) * | 1973-10-08 | 1976-07-19 | Haessle Ab | Forfarande for framstellning av nya aminer |
| SE388849B (sv) * | 1974-02-14 | 1976-10-18 | Haessle Ab | Forfarande for framstellning av nya aminer med beta-receptorstimulerande verkan |
| JPS5512411B2 (de) * | 1974-03-12 | 1980-04-02 | ||
| ZA754241B (en) * | 1974-11-01 | 1976-06-30 | Haessle Ab | New amines |
| SE402765B (sv) * | 1975-06-04 | 1978-07-17 | Haessle Ab | Forfarande for framstellning av en ny hjertaktiv forening |
| SE418247B (sv) * | 1975-11-17 | 1981-05-18 | Haessle Ab | Sett att framstella kroppar med reglerad frigoring av en aktiv komponent |
| DE2645710C2 (de) * | 1976-10-09 | 1985-06-27 | Merck Patent Gmbh, 6100 Darmstadt | Phenoxy-amino-propanole, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitung |
| US4218433A (en) * | 1977-03-03 | 1980-08-19 | Nippon Kayaku Kabushiki Kaisha | Constant-rate eluting tablet and method of producing same |
| GB1576376A (en) * | 1977-03-30 | 1980-10-08 | Benzon As Alfred | Multiple-unit drug dose |
| DE2905134A1 (de) * | 1978-02-17 | 1979-08-23 | Degussa | Neue acylierte aminoalkyl-cyanoguanidine mit einem heterocyclischen rest |
| SE426548B (sv) * | 1978-12-05 | 1983-01-31 | Haessle Ab | Fast farmaceutisk beredning innehallande en terapeutiskt effektiv hjertglykosid och en polymer |
| GB2051574B (en) * | 1979-05-10 | 1984-01-18 | Kyoto Pharma Ind | Adjuvant for promoting absorption of pharmacologically active substances through the rectum |
| FR2471186A1 (fr) * | 1979-12-10 | 1981-06-19 | Roussel Uclaf | Nouveaux comprimes a delitescence colique, ainsi que leur procede de preparation |
| SE8003805L (sv) * | 1980-05-21 | 1981-11-22 | Haessle Ab | En farmaceutisk beredning med forbettrade utlosningsegenskap |
| JPS57171428A (en) * | 1981-04-13 | 1982-10-22 | Sankyo Co Ltd | Preparation of coated solid preparation |
| ATE14379T1 (de) * | 1981-04-27 | 1985-08-15 | Haessle Ab | Pharmazeutisches praeparat. |
| ZA825384B (en) * | 1981-07-31 | 1983-05-25 | Tillott J B Ltd | Orally administrable pharmaceutical compositions |
| DK150008C (da) * | 1981-11-20 | 1987-05-25 | Benzon As Alfred | Fremgangsmaade til fremstilling af et farmaceutisk oralt polydepotpraeparat |
| DE3208791A1 (de) * | 1982-03-11 | 1983-09-22 | Röhm GmbH, 6100 Darmstadt | Verfahren zum ueberziehen von arzneiformen mittes eines in wasser dispergierten ueberzugsmittels |
| EP0094117A3 (de) * | 1982-05-06 | 1984-08-01 | The Procter & Gamble Company | Therapeutische Granulate |
| US4415547A (en) * | 1982-06-14 | 1983-11-15 | Sterling Drug Inc. | Sustained-release pharmaceutical tablet and process for preparation thereof |
| JPS5920219A (ja) * | 1982-07-26 | 1984-02-01 | Shin Etsu Chem Co Ltd | 腸溶性コ−テイング製剤の製造方法 |
| US4681583A (en) * | 1982-12-20 | 1987-07-21 | Alza Corporation | System for dispersing drug in biological environment |
| US4578075A (en) * | 1982-12-20 | 1986-03-25 | Alza Corporation | Delivery system housing a plurality of delivery devices |
| JPS59193831A (ja) * | 1983-04-18 | 1984-11-02 | Sankyo Co Ltd | 腸溶性製剤の製造法 |
| US4627850A (en) * | 1983-11-02 | 1986-12-09 | Alza Corporation | Osmotic capsule |
| EP0163696B1 (de) * | 1983-11-14 | 1992-11-25 | Columbia Laboratories, Inc. | Verwendung eines bioadhesives |
| US4623588A (en) * | 1984-02-06 | 1986-11-18 | Biotek, Inc. | Controlled release composite core coated microparticles |
| DE3405378A1 (de) * | 1984-02-15 | 1985-08-22 | Röhm GmbH, 6100 Darmstadt | Arzneimittelueberzug |
-
1984
- 1984-01-10 SE SE8400085A patent/SE457505B/sv not_active IP Right Cessation
-
1985
- 1985-01-08 AT AT85850007T patent/ATE46080T1/de not_active IP Right Cessation
- 1985-01-08 EP EP85850007A patent/EP0148811B1/de not_active Expired
- 1985-01-08 EP EP88850123A patent/EP0293347B1/de not_active Expired
- 1985-01-08 AT AT88850123T patent/ATE77077T1/de not_active IP Right Cessation
- 1985-01-08 DE DE8585850007T patent/DE3572767D1/de not_active Expired
- 1985-01-08 DE DE8888850123T patent/DE3586206T2/de not_active Expired - Lifetime
- 1985-01-10 US US06/690,197 patent/US4780318A/en not_active Expired - Lifetime
-
1986
- 1986-01-17 SE SE8600202A patent/SE462529B/sv not_active IP Right Cessation
-
1988
- 1988-03-25 US US07/172,897 patent/US5001161A/en not_active Expired - Lifetime
-
1995
- 1995-01-09 SG SG2295A patent/SG2295G/en unknown
- 1995-02-23 HK HK24995A patent/HK24995A/en not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3572767D1 (en) | 1989-10-12 |
| EP0148811A1 (de) | 1985-07-17 |
| HK24995A (en) | 1995-03-03 |
| US4780318A (en) | 1988-10-25 |
| SE8400085D0 (sv) | 1984-01-10 |
| DE3586206T2 (de) | 1992-12-24 |
| SE457505B (sv) | 1989-01-09 |
| SG2295G (en) | 1995-06-16 |
| DE3586206D1 (de) | 1992-07-16 |
| EP0148811B1 (de) | 1989-09-06 |
| ATE77077T1 (de) | 1992-06-15 |
| US5001161A (en) | 1991-03-19 |
| SE8400085L (sv) | 1985-07-11 |
| EP0293347B1 (de) | 1992-06-10 |
| SE8600202L (sv) | 1986-01-17 |
| EP0293347A1 (de) | 1988-11-30 |
| SE462529B (sv) | 1990-07-09 |
| SE8600202D0 (sv) | 1986-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ATE46080T1 (de) | Pharmazeutische komposition. | |
| DE3587577D1 (de) | Antimykotische pharmazeutische Präparate. | |
| DE3586545D1 (de) | Erhoehte schmerzlosigkeit bewirkende pharmazeutische zusammensetzungen. | |
| FI862094L (fi) | Bornerande terapeutisk komposition. | |
| DE68924540D1 (de) | Medizinische Aerosolformulierungen. | |
| DE3580304D1 (de) | Arzneimittel. | |
| DE3674593D1 (de) | Medizinische zusammensetzung. | |
| FI852804A7 (fi) | Säädellysti vapauttavia farmaseuttisia valmisteita. | |
| FI863976L (fi) | Terapeutisk komposition. | |
| DE3682083D1 (de) | Pharmazeutische zusammensetzungen. | |
| DE3669105D1 (de) | Therapeutische zusammensetzung. | |
| DE3576118D1 (de) | Pharmazeutische praeparate. | |
| DE3682960D1 (de) | Pharmazeutische praeparate. | |
| DE3674040D1 (de) | Pharmazeutische zusammensetzungen. | |
| IT1213453B (it) | Composizione farmaceutica. | |
| DE3576505D1 (de) | 3,4-dihydrobenzopyranverbindungen und diese enthaltende pharmazeutische zusammenstellungen. | |
| IT8521235A0 (it) | Composti farmacologicamente attivi. | |
| FI852658L (fi) | Farmaceutiska aemnen. | |
| DE68907609D1 (de) | Arzneimittelzusammensetzung. | |
| NO883609L (no) | Farmasoeytiske preparater for topisk anvendelse. | |
| DE3667915D1 (de) | Pharmazeutische zusammensetzung. | |
| ATE50495T1 (de) | Pharmazeutische praeparate. | |
| FI862334A7 (fi) | Terapeutiska kompositioner. | |
| IT8622051A1 (it) | Composizioni farmaceutiche ad attivita' cicatrizzante | |
| IT8783379A0 (it) | Composizioni farmaceutiche antimicotiche. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| UEP | Publication of translation of european patent specification | ||
| REN | Ceased due to non-payment of the annual fee |