AT284338B - Verfahren zur Herstellung von Rifamycinen - Google Patents
Verfahren zur Herstellung von RifamycinenInfo
- Publication number
- AT284338B AT284338B AT542968A AT542968A AT284338B AT 284338 B AT284338 B AT 284338B AT 542968 A AT542968 A AT 542968A AT 542968 A AT542968 A AT 542968A AT 284338 B AT284338 B AT 284338B
- Authority
- AT
- Austria
- Prior art keywords
- rifamycins
- production
- Prior art date
Links
- 229930189077 Rifamycin Natural products 0.000 title 1
- BTVYFIMKUHNOBZ-QXMMDKDBSA-N rifamycin s Chemical class O=C1C(C(O)=C2C)=C3C(=O)C=C1NC(=O)\C(C)=C/C=C\C(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C(C)C(OC)\C=C/OC1(C)OC2=C3C1=O BTVYFIMKUHNOBZ-QXMMDKDBSA-N 0.000 title 1
- 229940081192 rifamycins Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1692567 | 1967-06-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT284338B true AT284338B (de) | 1970-09-10 |
Family
ID=11149560
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT542968A AT284338B (de) | 1967-06-07 | 1968-06-06 | Verfahren zur Herstellung von Rifamycinen |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3542762A (show.php) |
| AT (1) | AT284338B (show.php) |
| BE (1) | BE716123A (show.php) |
| BR (1) | BR6899560D0 (show.php) |
| CH (2) | CH502373A (show.php) |
| DE (2) | DE1770579C3 (show.php) |
| DK (1) | DK134911B (show.php) |
| ES (1) | ES354780A1 (show.php) |
| FI (1) | FI58922C (show.php) |
| FR (1) | FR1585041A (show.php) |
| GB (1) | GB1219360A (show.php) |
| IL (1) | IL30053A (show.php) |
| NL (1) | NL145554B (show.php) |
| NO (1) | NO128028B (show.php) |
| SE (2) | SE362432B (show.php) |
| YU (1) | YU33662B (show.php) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR207763A1 (es) * | 1973-07-25 | 1976-10-29 | Archifar Ind Chim Trentino | Metodo para la preparacion de 1,3-oxacino(5,6-c)rifamicinas |
| DE2728869A1 (de) * | 1976-06-25 | 1977-12-29 | Antibiotice Iasi Intreprindere | Rifamycinen und verfahren zu deren herstellung |
| JPS5473799A (en) * | 1977-11-16 | 1979-06-13 | Kanebo Ltd | Preparation of 1,3-oxazino (5,6-c) rifamycin derivative |
| GB1594134A (en) * | 1977-11-25 | 1981-07-30 | Holco Investment Inc | Rifamycins |
| JPS5776597A (en) * | 1980-10-30 | 1982-05-13 | Kiyouritsu Kurieiteibu Asoshie | Electric musical instrument |
| GB8308166D0 (en) * | 1983-03-24 | 1983-05-05 | Erba Farmitalia | Preparation of azinomethyl-rifamycins |
| GB8318072D0 (en) * | 1983-07-04 | 1983-08-03 | Lepetit Spa | Water-soluble rifampicin derivatives |
| CN103819487B (zh) * | 2014-02-07 | 2016-08-24 | 天津大学 | 一种利福平晶体及其制备方法 |
| CN103755723B (zh) * | 2014-02-07 | 2016-04-20 | 天津大学 | 一种利福平i晶型的制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1090115A (en) * | 1964-04-02 | 1967-11-08 | Lepetit Spa | Mannich bases of rifamycin sv |
| FR208F (show.php) * | 1964-07-31 | |||
| FR1457435A (fr) * | 1964-07-31 | 1966-01-24 | Lepetit Spa | Procédé pour préparer des composés dérivés de la rifamycine |
-
1968
- 1968-05-21 NL NL6807202A patent/NL145554B/xx not_active IP Right Cessation
- 1968-05-21 US US730902A patent/US3542762A/en not_active Expired - Lifetime
- 1968-05-23 IL IL30053A patent/IL30053A/xx unknown
- 1968-05-29 NO NO02104/68A patent/NO128028B/no unknown
- 1968-06-04 FR FR1585041D patent/FR1585041A/fr not_active Expired
- 1968-06-04 BR BR199560/68A patent/BR6899560D0/pt unknown
- 1968-06-05 FI FI1559/68A patent/FI58922C/fi active
- 1968-06-05 GB GB26730/68A patent/GB1219360A/en not_active Expired
- 1968-06-05 BE BE716123D patent/BE716123A/xx not_active IP Right Cessation
- 1968-06-06 DK DK263168AA patent/DK134911B/da not_active IP Right Cessation
- 1968-06-06 SE SE03909/71A patent/SE362432B/xx unknown
- 1968-06-06 DE DE1770579A patent/DE1770579C3/de not_active Expired
- 1968-06-06 DE DE1795741A patent/DE1795741C2/de not_active Expired
- 1968-06-06 SE SE6807604A patent/SE372270B/xx unknown
- 1968-06-06 CH CH297170A patent/CH502373A/fr not_active IP Right Cessation
- 1968-06-06 AT AT542968A patent/AT284338B/de not_active IP Right Cessation
- 1968-06-06 CH CH837368A patent/CH488731A/fr not_active IP Right Cessation
- 1968-06-07 ES ES354780A patent/ES354780A1/es not_active Expired
- 1968-06-07 YU YU1323/68A patent/YU33662B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3542762A (en) | 1970-11-24 |
| DE1770579B2 (de) | 1980-03-20 |
| CH488731A (fr) | 1970-04-15 |
| CH502373A (fr) | 1971-01-31 |
| YU33662B (en) | 1977-12-31 |
| DE1795741C2 (de) | 1985-07-04 |
| SE362432B (show.php) | 1973-12-10 |
| SE372270B (show.php) | 1974-12-16 |
| DE1770579A1 (de) | 1972-03-09 |
| IL30053A0 (en) | 1968-07-25 |
| DE1795741A1 (de) | 1974-05-30 |
| ES354780A1 (es) | 1969-12-01 |
| DE1770579C3 (de) | 1980-11-20 |
| DK134911C (show.php) | 1977-06-27 |
| GB1219360A (en) | 1971-01-13 |
| NL145554B (nl) | 1975-04-15 |
| NO128028B (show.php) | 1973-09-17 |
| BR6899560D0 (pt) | 1973-05-10 |
| FI58922C (fi) | 1981-05-11 |
| FR1585041A (show.php) | 1970-01-09 |
| DK134911B (da) | 1977-02-07 |
| FI58922B (fi) | 1981-01-30 |
| NL6807202A (show.php) | 1968-12-09 |
| YU132368A (show.php) | 1977-06-30 |
| BE716123A (show.php) | 1968-11-04 |
| IL30053A (en) | 1972-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH498825A (de) | Verfahren zur Herstellung von 2-C-Methyl-nukleosiden | |
| AT297321B (de) | Verfahren zur Herstellung von Polyurethanen | |
| AT306765B (de) | Verfahren zur Herstellung von Ferrovanadin | |
| AT282933B (de) | Verfahren zur Herstellung von Polyolefinen | |
| CH556355A (de) | Verfahren zur herstellung von 5-chromenolaethern. | |
| AT278846B (de) | Verfahren zur kontinuierlichen Herstellung von Isobutylidendiharnstoff | |
| CH507326A (de) | Verfahren zur Herstellung von Poly-e-caproamid | |
| AT284338B (de) | Verfahren zur Herstellung von Rifamycinen | |
| CH479636A (de) | Verfahren zur Herstellung von Copolymerisaten | |
| CH494228A (de) | Verfahren zur Herstellung von Lactamen | |
| CH555800A (de) | Verfahren zur herstellung von naphthylisopropylaminen. | |
| CH506602A (de) | Verfahren zur Herstellung von Farbstoffen | |
| CH496731A (de) | Verfahren zur Herstellung von Penicillinen | |
| AT283373B (de) | Verfahren zur Herstellung von N-Methylpiperazin | |
| CH485002A (de) | Verfahren zur Herstellung von Farbstoffen | |
| AT282189B (de) | Verfahren zur Herstellung von Polyolefin | |
| AT277140B (de) | Verfahren zur Herstellung von Vliesstoffen | |
| AT315477B (de) | Verfahren zur Herstellung von Formkörpern | |
| CH501689A (de) | Verfahren zur Herstellung von Polyestern | |
| CH502970A (de) | Verfahren zur Herstellung von Methylen-d2-chlorid | |
| AT283591B (de) | Verfahren zur Herstellung von Penicillinen | |
| CH513231A (de) | Verfahren zur Herstellung von Schmiermittelgemischen | |
| AT281791B (de) | Verfahren zur Herstellung von β-Jonon | |
| CH484897A (de) | Verfahren zur Herstellung von e-Caprolacton | |
| AT311072B (de) | Verfahren zur Herstellung von Vliesstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELA | Expired due to lapse of time |