AP256A - Explosive composition. - Google Patents
Explosive composition. Download PDFInfo
- Publication number
- AP256A AP256A APAP/P/1991/000342A AP9100342A AP256A AP 256 A AP256 A AP 256A AP 9100342 A AP9100342 A AP 9100342A AP 256 A AP256 A AP 256A
- Authority
- AP
- ARIPO
- Prior art keywords
- protein
- composition
- gas bubbles
- undenatured
- guar
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 93
- 239000002360 explosive Substances 0.000 title claims abstract description 50
- 102000004169 proteins and genes Human genes 0.000 claims abstract description 62
- 108090000623 proteins and genes Proteins 0.000 claims abstract description 62
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 34
- 238000005054 agglomeration Methods 0.000 claims abstract description 17
- 230000002776 aggregation Effects 0.000 claims abstract description 17
- 230000005012 migration Effects 0.000 claims abstract description 17
- 238000013508 migration Methods 0.000 claims abstract description 17
- 108010082495 Dietary Plant Proteins Proteins 0.000 claims abstract description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 24
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 22
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 claims description 20
- 239000002562 thickening agent Substances 0.000 claims description 15
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 13
- 239000000446 fuel Substances 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- 244000046052 Phaseolus vulgaris Species 0.000 claims description 10
- 235000010627 Phaseolus vulgaris Nutrition 0.000 claims description 10
- 235000010288 sodium nitrite Nutrition 0.000 claims description 10
- 229920002907 Guar gum Polymers 0.000 claims description 8
- 239000000665 guar gum Substances 0.000 claims description 8
- 235000010417 guar gum Nutrition 0.000 claims description 8
- 229960002154 guar gum Drugs 0.000 claims description 8
- WPHINMYYTFDPIA-UHFFFAOYSA-O methylazanium;nitrate Chemical group [NH3+]C.[O-][N+]([O-])=O WPHINMYYTFDPIA-UHFFFAOYSA-O 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- 230000001590 oxidative effect Effects 0.000 claims description 5
- 244000007835 Cyamopsis tetragonoloba Species 0.000 claims 4
- 235000018102 proteins Nutrition 0.000 description 46
- 239000007789 gas Substances 0.000 description 30
- 238000009472 formulation Methods 0.000 description 18
- 239000004411 aluminium Substances 0.000 description 14
- 229910052782 aluminium Inorganic materials 0.000 description 14
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 14
- 239000000463 material Substances 0.000 description 12
- 230000035945 sensitivity Effects 0.000 description 11
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 10
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 10
- 244000303965 Cyamopsis psoralioides Species 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 238000005422 blasting Methods 0.000 description 8
- 239000000049 pigment Substances 0.000 description 8
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 6
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- 238000005474 detonation Methods 0.000 description 6
- 108010000912 Egg Proteins Proteins 0.000 description 5
- 102000002322 Egg Proteins Human genes 0.000 description 5
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 5
- 235000011037 adipic acid Nutrition 0.000 description 5
- 239000001361 adipic acid Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000010348 incorporation Methods 0.000 description 5
- 235000010344 sodium nitrate Nutrition 0.000 description 5
- 239000004317 sodium nitrate Substances 0.000 description 5
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- 239000003431 cross linking reagent Substances 0.000 description 4
- 239000006260 foam Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000001737 promoting effect Effects 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 229910002651 NO3 Inorganic materials 0.000 description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- UCXOJWUKTTTYFB-UHFFFAOYSA-N antimony;heptahydrate Chemical compound O.O.O.O.O.O.O.[Sb].[Sb] UCXOJWUKTTTYFB-UHFFFAOYSA-N 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- -1 halide salt Chemical class 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 108010088751 Albumins Proteins 0.000 description 2
- 102000009027 Albumins Human genes 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229920000591 gum Polymers 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920002401 polyacrylamide Polymers 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 239000011800 void material Substances 0.000 description 2
- OMDQUFIYNPYJFM-XKDAHURESA-N (2r,3r,4s,5r,6s)-2-(hydroxymethyl)-6-[[(2r,3s,4r,5s,6r)-4,5,6-trihydroxy-3-[(2s,3s,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]oxane-3,4,5-triol Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O[C@H]2[C@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)[C@H](O)[C@H](O)[C@H](O)O1 OMDQUFIYNPYJFM-XKDAHURESA-N 0.000 description 1
- QCVGEOXPDFCNHA-UHFFFAOYSA-N 5,5-dimethyl-2,4-dioxo-1,3-oxazolidine-3-carboxamide Chemical compound CC1(C)OC(=O)N(C(N)=O)C1=O QCVGEOXPDFCNHA-UHFFFAOYSA-N 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 229920000926 Galactomannan Polymers 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 108090000942 Lactalbumin Proteins 0.000 description 1
- 102000004407 Lactalbumin Human genes 0.000 description 1
- 102000008192 Lactoglobulins Human genes 0.000 description 1
- 108010060630 Lactoglobulins Proteins 0.000 description 1
- 229920000161 Locust bean gum Polymers 0.000 description 1
- 102000014171 Milk Proteins Human genes 0.000 description 1
- 108010011756 Milk Proteins Proteins 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 238000005273 aeration Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- DVARTQFDIMZBAA-UHFFFAOYSA-O ammonium nitrate Chemical class [NH4+].[O-][N+]([O-])=O DVARTQFDIMZBAA-UHFFFAOYSA-O 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 239000002817 coal dust Substances 0.000 description 1
- 238000004581 coalescence Methods 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000014103 egg white Nutrition 0.000 description 1
- 210000000969 egg white Anatomy 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002314 glycerols Chemical class 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000000711 locust bean gum Substances 0.000 description 1
- 235000010420 locust bean gum Nutrition 0.000 description 1
- 235000021239 milk protein Nutrition 0.000 description 1
- 229940092253 ovalbumin Drugs 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003019 stabilising effect Effects 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- 239000000230 xanthan gum Substances 0.000 description 1
- 235000010493 xanthan gum Nutrition 0.000 description 1
- 229940082509 xanthan gum Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B23/00—Compositions characterised by non-explosive or non-thermic constituents
- C06B23/002—Sensitisers or density reducing agents, foam stabilisers, crystal habit modifiers
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Air Bags (AREA)
- Curing Cements, Concrete, And Artificial Stone (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Colloid Chemistry (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ZA909892 | 1990-12-10 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AP9100342A0 AP9100342A0 (en) | 1992-01-31 |
| AP256A true AP256A (en) | 1993-05-17 |
Family
ID=25580435
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| APAP/P/1991/000342A AP256A (en) | 1990-12-10 | 1991-12-10 | Explosive composition. |
Country Status (9)
| Country | Link |
|---|---|
| AP (1) | AP256A (cs) |
| CZ (1) | CZ284231B6 (cs) |
| DE (1) | DE4140619A1 (cs) |
| ES (1) | ES2051183B1 (cs) |
| FR (1) | FR2670203B1 (cs) |
| GB (1) | GB2252313B (cs) |
| PL (1) | PL168530B1 (cs) |
| PT (1) | PT99753A (cs) |
| ZA (1) | ZA919516B (cs) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK167938B1 (da) * | 1991-12-04 | 1994-01-03 | Ulrich Oppenhejm | Presenning forsynet med en dekoration af reflekterende materiale og fremgangsmaade til fremstilling deraf |
| CN114699985B (zh) * | 2022-03-31 | 2023-06-13 | 神华准格尔能源有限责任公司 | 水溶液配置方法、设备及计算机可读存储介质 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4130449A (en) * | 1977-06-23 | 1978-12-19 | Canadian Industries Limited | Thickened aqueous slurry explosive compositions |
| DE2829559A1 (de) * | 1977-07-05 | 1979-01-25 | Canadian Ind | Schlammsprengstoff |
| DE2826589A1 (de) * | 1978-06-19 | 1980-01-03 | Atlas Powder Co | Aluminium- und aminnitrat-sensibilisierte gelartige sprengstoffzusammensetzung und verfahren zu ihrer herstellung |
| GB2120228A (en) * | 1982-05-12 | 1983-11-30 | Union Explosivos Rio Tinto | Composition and process for the production of emulsion explosives |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3400026A (en) * | 1967-01-16 | 1968-09-03 | Du Pont | Thickened aqueous inorganic oxidizer salt explosive composition containing dissolvedproteinaceous material |
| US3617402A (en) * | 1968-12-24 | 1971-11-02 | Hercules Inc | Aqueous slurry blasting composition containing an aliphatic amine salt and a water soluble inorganic perchlorate |
| US3586553A (en) * | 1969-04-11 | 1971-06-22 | Du Pont | Water-bearing explosive containing proten and nitrogen-base salt |
| DE1930503A1 (de) * | 1969-06-16 | 1971-01-14 | Dynamit Nobel Ag | Sprengschaum |
| US3678140A (en) * | 1969-12-03 | 1972-07-18 | Du Pont | Process for foaming aqueous protein-containing blasting agents |
| US3711345A (en) * | 1970-08-18 | 1973-01-16 | Du Pont | Chemical foaming of water-bearing explosives |
| US3787254A (en) * | 1971-06-01 | 1974-01-22 | Ireco Chemicals | Explosive compositions containing calcium nitrate |
| US3886010A (en) * | 1972-07-24 | 1975-05-27 | Ireco Chemicals | Stabilized and aerated blasting slurry containing thiourea and a nitrite gassing agent |
| US4084994A (en) * | 1975-03-14 | 1978-04-18 | Dyno Industrier A.S. | Aqueous hydrocarbon oil-soluble lignosulphonate explosive composition |
| US4008110A (en) * | 1975-07-07 | 1977-02-15 | Atlas Powder Company | Water gel explosives |
| ZA76430B (en) * | 1976-01-27 | 1977-09-28 | Aeci Ltd | Improvements in and relating to explosive compositions |
| AU578460B2 (en) * | 1984-04-19 | 1988-10-27 | Ici Australia Limited | Water in oil emulsion explosives and stabilizers therefor |
| ES2009381A6 (es) * | 1987-11-18 | 1989-09-16 | Cbs Explosives | Composicion explosiva de mezclado en seco. |
-
1991
- 1991-12-03 ZA ZA919516A patent/ZA919516B/xx unknown
- 1991-12-10 GB GB9126215A patent/GB2252313B/en not_active Expired - Fee Related
- 1991-12-10 PL PL91292703A patent/PL168530B1/pl unknown
- 1991-12-10 AP APAP/P/1991/000342A patent/AP256A/en active
- 1991-12-10 DE DE4140619A patent/DE4140619A1/de not_active Ceased
- 1991-12-10 PT PT99753A patent/PT99753A/pt not_active Application Discontinuation
- 1991-12-10 ES ES09102753A patent/ES2051183B1/es not_active Expired - Lifetime
- 1991-12-10 CZ CS913741A patent/CZ284231B6/cs not_active IP Right Cessation
- 1991-12-10 FR FR919115304A patent/FR2670203B1/fr not_active Expired - Fee Related
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4130449A (en) * | 1977-06-23 | 1978-12-19 | Canadian Industries Limited | Thickened aqueous slurry explosive compositions |
| DE2829559A1 (de) * | 1977-07-05 | 1979-01-25 | Canadian Ind | Schlammsprengstoff |
| DE2826589A1 (de) * | 1978-06-19 | 1980-01-03 | Atlas Powder Co | Aluminium- und aminnitrat-sensibilisierte gelartige sprengstoffzusammensetzung und verfahren zu ihrer herstellung |
| GB2120228A (en) * | 1982-05-12 | 1983-11-30 | Union Explosivos Rio Tinto | Composition and process for the production of emulsion explosives |
| DE3313246C2 (cs) * | 1982-05-12 | 1988-01-07 | Union Explosivos Rio Tinto S.A., Madrid, Es |
Also Published As
| Publication number | Publication date |
|---|---|
| DE4140619A1 (de) | 1992-06-11 |
| PL168530B1 (pl) | 1996-02-29 |
| AU644497B2 (en) | 1993-12-09 |
| AP9100342A0 (en) | 1992-01-31 |
| ES2051183A1 (es) | 1994-06-01 |
| PT99753A (pt) | 1993-01-29 |
| AU8892591A (en) | 1992-06-11 |
| GB2252313A (en) | 1992-08-05 |
| ES2051183B1 (es) | 1994-12-01 |
| GB9126215D0 (en) | 1992-02-12 |
| PL292703A1 (en) | 1992-08-10 |
| FR2670203A1 (fr) | 1992-06-12 |
| GB2252313B (en) | 1994-05-18 |
| FR2670203B1 (fr) | 1994-08-05 |
| ZA919516B (en) | 1993-06-03 |
| CS374191A3 (en) | 1992-07-15 |
| CZ284231B6 (cs) | 1998-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4141767A (en) | Emulsion blasting agent | |
| US4111727A (en) | Water-in-oil blasting composition | |
| CA1321881C (en) | Emulsion explosive composition with selective ph range | |
| EP0161821B1 (en) | Gas bubble-sensitized water-in-oil emulsion explosive compositions | |
| US4448619A (en) | Emulsion explosive composition | |
| EP0487246B1 (en) | Stabilized emulsion explosive | |
| US3886010A (en) | Stabilized and aerated blasting slurry containing thiourea and a nitrite gassing agent | |
| CA1239285A (en) | Gas bubble-sensitized explosive compositions | |
| US3400026A (en) | Thickened aqueous inorganic oxidizer salt explosive composition containing dissolvedproteinaceous material | |
| US3995673A (en) | Stabilized air bubble-containing explosive compositions | |
| AP256A (en) | Explosive composition. | |
| US4026738A (en) | Stabilized, foamed water gel explosives and method | |
| US5490887A (en) | Low density watergel explosive composition | |
| AU609930B2 (en) | Chemical foaming of emulsion explosives | |
| US3678140A (en) | Process for foaming aqueous protein-containing blasting agents | |
| US4032375A (en) | Blasting composition containing calcium nitrate and sulfur | |
| US4207126A (en) | Watergel explosives containing microspheres | |
| EP0044671A2 (en) | Emulsion blasting agent containing urea perchlorate | |
| CA1166852A (en) | Permissible slurry explosive | |
| EP0044664A2 (en) | Emulsion type blasting agent containing hydrazine mononitrate | |
| CA2064777C (en) | Rheology controlled emulsion | |
| US3586553A (en) | Water-bearing explosive containing proten and nitrogen-base salt | |
| CA1308914C (en) | Foamable explosive combinations | |
| AU660362B2 (en) | Low density watergel explosive composition | |
| JPS60161386A (ja) | 界面活性剤組合せ組成物を使用する乳化速度の増強 |