ZA823765B - Water-soluble benzothiazine dioxide salts - Google Patents
Water-soluble benzothiazine dioxide saltsInfo
- Publication number
- ZA823765B ZA823765B ZA823765A ZA823765A ZA823765B ZA 823765 B ZA823765 B ZA 823765B ZA 823765 A ZA823765 A ZA 823765A ZA 823765 A ZA823765 A ZA 823765A ZA 823765 B ZA823765 B ZA 823765B
- Authority
- ZA
- South Africa
- Prior art keywords
- soluble
- water
- dioxide salts
- benzothiazine dioxide
- benzothiazine
- Prior art date
Links
- GHNLJDPNIAIWOQ-UHFFFAOYSA-N 2h-1$l^{6},2-benzothiazine 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)NC=CC2=C1 GHNLJDPNIAIWOQ-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US26898081A | 1981-06-01 | 1981-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA823765B true ZA823765B (en) | 1983-03-30 |
Family
ID=23025342
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA823765A ZA823765B (en) | 1981-06-01 | 1982-05-28 | Water-soluble benzothiazine dioxide salts |
| ZA823764A ZA823764B (en) | 1981-06-01 | 1982-05-28 | Crystalline benzothiazine dioxide salts |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA823764A ZA823764B (en) | 1981-06-01 | 1982-05-28 | Crystalline benzothiazine dioxide salts |
Country Status (6)
| Country | Link |
|---|---|
| JP (2) | JPS57209288A (OSRAM) |
| CS (2) | CS228930B2 (OSRAM) |
| IN (1) | IN160683B (OSRAM) |
| PL (2) | PL138044B1 (OSRAM) |
| SU (2) | SU1053751A3 (OSRAM) |
| ZA (2) | ZA823765B (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RO88420A (ro) * | 1983-04-25 | 1986-01-30 | Pfizer Inc,Us | Procedeu pentru prepararea unor saruri bazice de piroxican depuse pe suporturi farmaceutice |
| US4582831A (en) * | 1984-11-16 | 1986-04-15 | Pfizer Inc. | Anti-inflammatory polymorphic monoethanolamine salt of N-(2-pyridyl)-2-methyl-4-hydroxy-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide compound, composition, and method of use therefor |
| IT1204751B (it) * | 1986-01-03 | 1989-03-10 | Therapicon Srl | Derivati idrosolubili dell'acido 4,5 -difenil- 2 -ossazolpropionico,loro preparazione ed utilizzo in composizioni farmaceutiche |
| IT1233836B (it) * | 1988-01-13 | 1992-04-21 | Euroresearch Srl | Sali idrosolubili dell'acido (+)2-(4 fluorofenil)-alfa-metil-5 benzoxazolo acetato. |
| JP2010083826A (ja) * | 2008-10-01 | 2010-04-15 | Nihon Generic Co Ltd | オキシカム系化合物を含む固形製剤を製造する方法 |
| PL244439B1 (pl) | 2021-06-02 | 2024-01-29 | Property Found Spolka Z Ograniczona Odpowiedzialnoscia | Rower, zwłaszcza dwukołowy, z napędem dźwigniowym |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE421792B (sv) * | 1976-01-12 | 1982-02-01 | Pfizer | Forfarande for framstellning av n-(2-pyridyl)-4-hydroxi-2-metyl-2h-1,2-benso-tiazin-3-karboxamid-1,1-dioxid |
-
1982
- 1982-04-28 IN IN332/DEL/82A patent/IN160683B/en unknown
- 1982-05-27 SU SU823447200A patent/SU1053751A3/ru active
- 1982-05-28 JP JP9113382A patent/JPS57209288A/ja active Granted
- 1982-05-28 ZA ZA823765A patent/ZA823765B/xx unknown
- 1982-05-28 PL PL23665382A patent/PL138044B1/pl unknown
- 1982-05-28 CS CS396382A patent/CS228930B2/cs unknown
- 1982-05-28 JP JP9113482A patent/JPS57209289A/ja active Pending
- 1982-05-28 PL PL23665482A patent/PL130912B1/pl unknown
- 1982-05-28 ZA ZA823764A patent/ZA823764B/xx unknown
- 1982-05-28 CS CS396282A patent/CS228929B2/cs unknown
- 1982-06-01 SU SU823450445A patent/SU1122225A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| JPS57209288A (en) | 1982-12-22 |
| IN160683B (OSRAM) | 1987-07-25 |
| JPS57209289A (en) | 1982-12-22 |
| SU1122225A3 (ru) | 1984-10-30 |
| PL236653A1 (en) | 1983-01-17 |
| SU1053751A3 (ru) | 1983-11-07 |
| JPS6350355B2 (OSRAM) | 1988-10-07 |
| CS228929B2 (cs) | 1984-05-14 |
| PL236654A1 (OSRAM) | 1982-12-20 |
| PL138044B1 (en) | 1986-08-30 |
| ZA823764B (en) | 1983-03-30 |
| CS228930B2 (cs) | 1984-05-14 |
| PL130912B1 (en) | 1984-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3262028D1 (en) | Water-soluble benzothiazine dioxide salts | |
| GB8330670D0 (en) | Aqueous oral solution | |
| AU8432582A (en) | Water-soluble benzothiazine dioxide salts | |
| GB2105335B (en) | Cephalosporin quinolinium betaines | |
| JPS57139076A (en) | Benzothiazine dioxide derivative | |
| AU529386B2 (en) | Crystalline benzothiazine dioxide salts | |
| GB2101986B (en) | Thiazolinoazetidinone derivatives | |
| DE3265238D1 (en) | Dye salts | |
| ZA823765B (en) | Water-soluble benzothiazine dioxide salts | |
| GB2110687B (en) | Biocidal azolyl-pentene derivatives | |
| DE3162752D1 (en) | 1-nitro-9-hydroxyalkylaminoacridines or their salts | |
| GB2104506B (en) | Benzothiazines | |
| GB2099423B (en) | Isopyrenylamine derivatives | |
| GB8331073D0 (en) | Line markings | |
| SG22587G (en) | 18-dehydro-apoy incaminol derivatives | |
| KE3706A (en) | Water-soluble benzothiazine dioxide salts | |
| ZA826019B (en) | N-methyl-d-glucamine salts | |
| EG15914A (en) | Water-soluble benzothiazine dioxide salts | |
| DE3273262D1 (en) | Combination tool | |
| DE3267620D1 (en) | Laser | |
| GB2092527B (en) | Ruler | |
| GB2093024B (en) | 2,4,8-triazaphenalenium salts and their preparation | |
| GB2078738B (en) | Benzothiazine derivatives | |
| GB2100728B (en) | 3-substituted -2- cyclopentenone derivatives | |
| GB2106908B (en) | Alkoxyvincamone derivatives |