ZA200107629B - Method of producing 3,4-dihydroprolines and 3,4-dehydropiperidines. - Google Patents
Method of producing 3,4-dihydroprolines and 3,4-dehydropiperidines. Download PDFInfo
- Publication number
- ZA200107629B ZA200107629B ZA200107629A ZA200107629A ZA200107629B ZA 200107629 B ZA200107629 B ZA 200107629B ZA 200107629 A ZA200107629 A ZA 200107629A ZA 200107629 A ZA200107629 A ZA 200107629A ZA 200107629 B ZA200107629 B ZA 200107629B
- Authority
- ZA
- South Africa
- Prior art keywords
- alkyl
- formula
- hydrogen
- reaction
- dehydropiperidines
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 3
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 claims description 3
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims description 3
- DWKUKQRKVCMOLP-UHFFFAOYSA-N 1-piperideine Chemical class C1CCN=CC1 DWKUKQRKVCMOLP-UHFFFAOYSA-N 0.000 claims description 2
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 claims description 2
- 101150096839 Fcmr gene Proteins 0.000 claims description 2
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 2
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 claims description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims 1
- 239000001569 carbon dioxide Substances 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 10
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 9
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- 150000001413 amino acids Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 4
- -1 hydroxyproline ester Chemical class 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000006027 Birch reduction reaction Methods 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 3
- JVQIKJMSUIMUDI-UHFFFAOYSA-N 3-pyrroline Chemical compound C1NCC=C1 JVQIKJMSUIMUDI-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229960002591 hydroxyproline Drugs 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003236 pyrrolines Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- YZSOPZXHDQUUJP-BYPYZUCNSA-N (2s)-2-(1h-imidazol-2-ylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=NC=CN1 YZSOPZXHDQUUJP-BYPYZUCNSA-N 0.000 description 1
- XGUIFUMAHBYCME-YFKPBYRVSA-N (2s)-2-(1h-pyrrol-2-ylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CC=CN1 XGUIFUMAHBYCME-YFKPBYRVSA-N 0.000 description 1
- BURVSCKWRUZTPY-YFKPBYRVSA-N (2s)-2-(cyclobutylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1CCC1 BURVSCKWRUZTPY-YFKPBYRVSA-N 0.000 description 1
- VQDMQFJXWAHHJA-QMMMGPOBSA-N (2s)-2-(cycloheptylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1CCCCCC1 VQDMQFJXWAHHJA-QMMMGPOBSA-N 0.000 description 1
- BVAUMRCGVHUWOZ-ZETCQYMHSA-N (2s)-2-(cyclohexylazaniumyl)propanoate Chemical compound OC(=O)[C@H](C)NC1CCCCC1 BVAUMRCGVHUWOZ-ZETCQYMHSA-N 0.000 description 1
- LDUWTIUXPVCEQF-LURJTMIESA-N (2s)-2-(cyclopentylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1CCCC1 LDUWTIUXPVCEQF-LURJTMIESA-N 0.000 description 1
- VVDBQHCKPZBJPG-YFKPBYRVSA-N (2s)-2-(furan-2-ylazaniumyl)propanoate Chemical class OC(=O)[C@H](C)NC1=CC=CO1 VVDBQHCKPZBJPG-YFKPBYRVSA-N 0.000 description 1
- IYKLZBIWFXPUCS-VIFPVBQESA-N (2s)-2-(naphthalen-1-ylamino)propanoic acid Chemical class C1=CC=C2C(N[C@@H](C)C(O)=O)=CC=CC2=C1 IYKLZBIWFXPUCS-VIFPVBQESA-N 0.000 description 1
- MRTPISKDZDHEQI-YFKPBYRVSA-N (2s)-2-(tert-butylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC(C)(C)C MRTPISKDZDHEQI-YFKPBYRVSA-N 0.000 description 1
- NPDBDJFLKKQMCM-SCSAIBSYSA-N (2s)-2-amino-3,3-dimethylbutanoic acid Chemical compound CC(C)(C)[C@H](N)C(O)=O NPDBDJFLKKQMCM-SCSAIBSYSA-N 0.000 description 1
- WAMWSIDTKSNDCU-ZETCQYMHSA-N (2s)-2-azaniumyl-2-cyclohexylacetate Chemical compound OC(=O)[C@@H](N)C1CCCCC1 WAMWSIDTKSNDCU-ZETCQYMHSA-N 0.000 description 1
- XGUXJMWPVJQIHI-YFKPBYRVSA-N (2s)-2-azaniumyl-3-cyclopropylpropanoate Chemical compound [O-]C(=O)[C@@H]([NH3+])CC1CC1 XGUXJMWPVJQIHI-YFKPBYRVSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VYKAFBPZJHOYQY-UHFFFAOYSA-N 1-methoxycarbonyl-2,5-dihydropyrrole-2-carboxylic acid Chemical compound COC(=O)N1CC=CC1C(O)=O VYKAFBPZJHOYQY-UHFFFAOYSA-N 0.000 description 1
- RLOQBKJCOAXOLR-UHFFFAOYSA-N 1h-pyrrole-2-carboxamide Chemical class NC(=O)C1=CC=CN1 RLOQBKJCOAXOLR-UHFFFAOYSA-N 0.000 description 1
- OMGHIGVFLOPEHJ-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-1-ium-2-carboxylate Chemical compound OC(=O)C1NCC=C1 OMGHIGVFLOPEHJ-UHFFFAOYSA-N 0.000 description 1
- LTHGZYQCFFPTAJ-UHFFFAOYSA-N 2-(1-adamantylamino)acetic acid Chemical compound C1C(C2)CC3CC2CC1(NCC(=O)O)C3 LTHGZYQCFFPTAJ-UHFFFAOYSA-N 0.000 description 1
- VIXMOEKUHKZJMV-UHFFFAOYSA-N 2-(1h-imidazol-2-ylamino)acetic acid Chemical compound OC(=O)CNC1=NC=CN1 VIXMOEKUHKZJMV-UHFFFAOYSA-N 0.000 description 1
- SEPZVWYNULYCQA-UHFFFAOYSA-N 2-(1h-pyrrol-2-ylamino)acetic acid Chemical compound OC(=O)CNC1=CC=CN1 SEPZVWYNULYCQA-UHFFFAOYSA-N 0.000 description 1
- KQLGGQARRCMYGD-UHFFFAOYSA-N 2-(cyclobutylamino)acetic acid Chemical compound OC(=O)CNC1CCC1 KQLGGQARRCMYGD-UHFFFAOYSA-N 0.000 description 1
- NPLBBQAAYSJEMO-UHFFFAOYSA-N 2-(cycloheptylazaniumyl)acetate Chemical compound OC(=O)CNC1CCCCCC1 NPLBBQAAYSJEMO-UHFFFAOYSA-N 0.000 description 1
- LRHRHAWNXCGABU-UHFFFAOYSA-N 2-(cyclopentylazaniumyl)acetate Chemical compound OC(=O)CNC1CCCC1 LRHRHAWNXCGABU-UHFFFAOYSA-N 0.000 description 1
- DXQCCQKRNWMECV-UHFFFAOYSA-N 2-(cyclopropylazaniumyl)acetate Chemical compound OC(=O)CNC1CC1 DXQCCQKRNWMECV-UHFFFAOYSA-N 0.000 description 1
- DUJAUTCYDLIGAY-UHFFFAOYSA-N 2-(furan-2-ylamino)acetic acid Chemical class OC(=O)CNC1=CC=CO1 DUJAUTCYDLIGAY-UHFFFAOYSA-N 0.000 description 1
- ZAQXSMCYFQJRCQ-UHFFFAOYSA-N 3-(1-adamantyl)-2-azaniumylpropanoate Chemical compound C1C(C2)CC3CC2CC1(CC(N)C(O)=O)C3 ZAQXSMCYFQJRCQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- 239000005922 Phosphane Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229940122388 Thrombin inhibitor Drugs 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 230000021523 carboxylation Effects 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 231100000481 chemical toxicant Toxicity 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000005595 deprotonation Effects 0.000 description 1
- 238000010537 deprotonation reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical class [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- VCXZJBRVEJBECK-UHFFFAOYSA-N methyl 2,5-dihydropyrrole-1-carboxylate Chemical compound COC(=O)N1CC=CC1 VCXZJBRVEJBECK-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000004005 nitrosamines Chemical class 0.000 description 1
- 239000000816 peptidomimetic Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910000064 phosphane Inorganic materials 0.000 description 1
- LSMAIBOZUPTNBR-UHFFFAOYSA-N phosphanium;iodide Chemical compound [PH4+].[I-] LSMAIBOZUPTNBR-UHFFFAOYSA-N 0.000 description 1
- 150000003147 proline derivatives Chemical class 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 150000003233 pyrroles Chemical class 0.000 description 1
- ZIJTYIRGFVHPHZ-UHFFFAOYSA-N selenium oxide(seo) Chemical class [Se]=O ZIJTYIRGFVHPHZ-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical class [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000001149 thermolysis Methods 0.000 description 1
- 239000003868 thrombin inhibitor Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
- Peptides Or Proteins (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19913699A DE19913699A1 (de) | 1999-03-26 | 1999-03-26 | Verfahren zur Herstellung von 3,4-Dihydroprolinen und 3,4-Dehydropiperidinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA200107629B true ZA200107629B (en) | 2002-09-17 |
Family
ID=7902464
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA200107629A ZA200107629B (en) | 1999-03-26 | 2001-09-17 | Method of producing 3,4-dihydroprolines and 3,4-dehydropiperidines. |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US6579971B1 (enExample) |
| EP (1) | EP1165509B1 (enExample) |
| JP (1) | JP3868210B2 (enExample) |
| KR (1) | KR20010104730A (enExample) |
| CN (1) | CN1345310A (enExample) |
| AT (1) | ATE278665T1 (enExample) |
| AU (1) | AU3962500A (enExample) |
| BR (1) | BR0009330A (enExample) |
| CA (1) | CA2368479C (enExample) |
| CZ (1) | CZ20013456A3 (enExample) |
| DE (2) | DE19913699A1 (enExample) |
| ES (1) | ES2230088T3 (enExample) |
| HK (1) | HK1045156A1 (enExample) |
| HU (1) | HUP0200420A2 (enExample) |
| IL (1) | IL145525A0 (enExample) |
| MX (1) | MXPA01009679A (enExample) |
| NO (1) | NO20014645L (enExample) |
| RU (1) | RU2001129097A (enExample) |
| TR (1) | TR200102747T2 (enExample) |
| TW (1) | TWI276626B (enExample) |
| WO (1) | WO2000058284A1 (enExample) |
| ZA (1) | ZA200107629B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN100396666C (zh) * | 2005-12-14 | 2008-06-25 | 郑州大学 | （4s）-1-叔丁氧羰基-4-氨基-l-脯氨酸乙酯及其合成工艺 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4291040A (en) * | 1979-10-22 | 1981-09-22 | E. R. Squibb & Sons, Inc. | Mercaptoacyl derivatives of 4-disubstituted prolines and 4-substituted dehydroprolines |
| US5580575A (en) | 1989-12-22 | 1996-12-03 | Imarx Pharmaceutical Corp. | Therapeutic drug delivery systems |
| JPH09502191A (ja) | 1993-09-09 | 1997-03-04 | シエーリング アクチエンゲゼルシヤフト | 作用物質およびガスを含有する微粒子 |
| DE19630082A1 (de) * | 1996-07-26 | 1998-01-29 | Basf Ag | Verfahren zur Herstellung von 3-Pyrrolin-2-carbonsäure-Derivaten |
| US6090800A (en) | 1997-05-06 | 2000-07-18 | Imarx Pharmaceutical Corp. | Lipid soluble steroid prodrugs |
| DE19723473A1 (de) * | 1997-06-04 | 1998-12-10 | Basf Ag | Verfahren zur Herstellung von chiralen 3,4-Didehydroprolinen |
| CA2319433C (en) | 1998-02-09 | 2008-04-22 | Bracco Research S.A. | Targeted delivery of biologically active media |
-
1999
- 1999-03-26 DE DE19913699A patent/DE19913699A1/de not_active Withdrawn
-
2000
- 2000-03-09 TW TW089104251A patent/TWI276626B/zh not_active IP Right Cessation
- 2000-03-17 US US09/937,312 patent/US6579971B1/en not_active Expired - Lifetime
- 2000-03-17 BR BR0009330-0A patent/BR0009330A/pt not_active IP Right Cessation
- 2000-03-17 CN CN00805579A patent/CN1345310A/zh active Pending
- 2000-03-17 CA CA002368479A patent/CA2368479C/en not_active Expired - Fee Related
- 2000-03-17 DE DE50008117T patent/DE50008117D1/de not_active Expired - Fee Related
- 2000-03-17 RU RU2001129097/04A patent/RU2001129097A/ru unknown
- 2000-03-17 EP EP00918809A patent/EP1165509B1/de not_active Expired - Lifetime
- 2000-03-17 HU HU0200420A patent/HUP0200420A2/hu unknown
- 2000-03-17 ES ES00918809T patent/ES2230088T3/es not_active Expired - Lifetime
- 2000-03-17 AT AT00918809T patent/ATE278665T1/de not_active IP Right Cessation
- 2000-03-17 CZ CZ20013456A patent/CZ20013456A3/cs unknown
- 2000-03-17 HK HK02106153.8A patent/HK1045156A1/zh unknown
- 2000-03-17 JP JP2000607987A patent/JP3868210B2/ja not_active Expired - Fee Related
- 2000-03-17 TR TR2001/02747T patent/TR200102747T2/xx unknown
- 2000-03-17 MX MXPA01009679A patent/MXPA01009679A/es unknown
- 2000-03-17 KR KR1020017012187A patent/KR20010104730A/ko not_active Abandoned
- 2000-03-17 AU AU39625/00A patent/AU3962500A/en not_active Abandoned
- 2000-03-17 WO PCT/EP2000/002377 patent/WO2000058284A1/de not_active Ceased
- 2000-03-17 IL IL14552599A patent/IL145525A0/xx unknown
-
2001
- 2001-09-17 ZA ZA200107629A patent/ZA200107629B/en unknown
- 2001-09-25 NO NO20014645A patent/NO20014645L/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| RU2001129097A (ru) | 2004-03-20 |
| CZ20013456A3 (cs) | 2002-05-15 |
| AU3962500A (en) | 2000-10-16 |
| NO20014645D0 (no) | 2001-09-25 |
| MXPA01009679A (es) | 2002-03-14 |
| EP1165509B1 (de) | 2004-10-06 |
| KR20010104730A (ko) | 2001-11-26 |
| CA2368479C (en) | 2005-03-01 |
| WO2000058284A1 (de) | 2000-10-05 |
| TWI276626B (en) | 2007-03-21 |
| CN1345310A (zh) | 2002-04-17 |
| NO20014645L (no) | 2001-09-25 |
| HUP0200420A2 (hu) | 2002-05-29 |
| CA2368479A1 (en) | 2000-10-05 |
| ATE278665T1 (de) | 2004-10-15 |
| TR200102747T2 (tr) | 2002-02-21 |
| ES2230088T3 (es) | 2005-05-01 |
| BR0009330A (pt) | 2002-01-08 |
| IL145525A0 (en) | 2002-06-30 |
| DE50008117D1 (de) | 2004-11-11 |
| EP1165509A1 (de) | 2002-01-02 |
| JP2002540190A (ja) | 2002-11-26 |
| US6579971B1 (en) | 2003-06-17 |
| HK1045156A1 (zh) | 2002-11-15 |
| JP3868210B2 (ja) | 2007-01-17 |
| DE19913699A1 (de) | 2000-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1124725A (en) | Alkanoyl-thio-acyl derivatives of dehydrocyclicimino acids | |
| CA1244041A (en) | Process for the preparation of cis, endo- octahydrocyclopenta¬b|pyrrole-2-carboxylate | |
| NZ191036A (en) | Ether and thioether mercaptoacyl prolines and pharmaceutical compositions | |
| Oba et al. | Synthesis of non-proteinogenic amino acids using Michael addition to unsaturated orthopyroglutamate derivative | |
| Yuste et al. | Synthesis of enantiomerically pure 2-amino alcohols from amino acids mediated by sulfoxides | |
| CA1055037A (en) | Pyrrolidine derivatives | |
| IE49123B1 (en) | (1,4)thiazines or thiazepines | |
| CA2589042A1 (en) | Novel process for the manufacture of 3-pyrrolidin-2-yl-propionic acid derivatives | |
| US5770732A (en) | Pyrrolinone-based peptidomimetics | |
| CA2368479C (en) | Method of producing 3,4-dehydroprolines and 3,4-dehydropiperidines | |
| JP4197741B2 (ja) | ３―ピロリン―２―カルボン酸誘導体の製法 | |
| PL118158B1 (en) | Process for preparing novel halogen derivatives of mercaptoacyloaminoacidscilaminokislot | |
| IE48497B1 (en) | Derivatives of pyrrolidinecarboxaldehyde and piperidinecarboxaldehyde and intermediates therefor | |
| US5514814A (en) | Pyrrolinone-based compounds | |
| US6166222A (en) | Method for producing chiral 3,4-dehydroprolines | |
| Sivaprakasam et al. | A straightforward synthesis of 3-substituted azetidinic amino acids | |
| US5929242A (en) | Manufacture of levobupivacaine and analogues thereof from L-lysine | |
| AU748779B2 (en) | The preparation of 3-pyroline-2-carboxylic acid amine derivatives | |
| PL79142B1 (en) | Novel cephalosporin derivatives, and processes for their preparation [gb1271013a] | |
| MXPA99010984A (en) | Method for producing chiral 3,4-dehydroprolines | |
| HU196369B (en) | New process for producing n-acylized l-prolin derivatives | |
| GB2039906A (en) | Dehydroproline derivative | |
| IE50531B1 (en) | Mercaptoacyl derivatives of keto substituted proline and pipecolic acid | |
| SE453496B (sv) | Nya 4-oxo-2-azetidinyl-ettiksyra-derivat till anvendning som mellanprodukt till thienamyciner |