US3861029A - Method of making heater cable - Google Patents
Method of making heater cable Download PDFInfo
- Publication number
- US3861029A US3861029A US287444A US28744472A US3861029A US 3861029 A US3861029 A US 3861029A US 287444 A US287444 A US 287444A US 28744472 A US28744472 A US 28744472A US 3861029 A US3861029 A US 3861029A
- Authority
- US
- United States
- Prior art keywords
- temperature
- resistivity
- black
- annealing
- polymeric material
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000000463 material Substances 0.000 claims abstract description 10
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims abstract description 5
- 238000002844 melting Methods 0.000 claims abstract description 4
- 230000008018 melting Effects 0.000 claims abstract description 4
- 239000000203 mixture Substances 0.000 claims description 36
- 238000000137 annealing Methods 0.000 claims description 16
- 239000006229 carbon black Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 10
- -1 polyethylene Polymers 0.000 claims description 9
- 239000004698 Polyethylene Substances 0.000 claims description 7
- 229920001577 copolymer Polymers 0.000 claims description 6
- 230000001747 exhibiting effect Effects 0.000 claims description 6
- 229920000573 polyethylene Polymers 0.000 claims description 6
- 238000002441 X-ray diffraction Methods 0.000 claims description 3
- 229920001567 vinyl ester resin Polymers 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- 239000011159 matrix material Substances 0.000 abstract description 16
- 230000002035 prolonged effect Effects 0.000 abstract 1
- 229920000642 polymer Polymers 0.000 description 13
- 235000019241 carbon black Nutrition 0.000 description 12
- 238000011068 loading method Methods 0.000 description 12
- 229920006244 ethylene-ethyl acrylate Polymers 0.000 description 6
- 238000001125 extrusion Methods 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 4
- 230000001351 cycling effect Effects 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 229920001684 low density polyethylene Polymers 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 229920001169 thermoplastic Polymers 0.000 description 4
- 239000004416 thermosoftening plastic Substances 0.000 description 4
- 239000002033 PVDF binder Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000005038 ethylene vinyl acetate Substances 0.000 description 3
- 229920001903 high density polyethylene Polymers 0.000 description 3
- 239000004702 low-density polyethylene Substances 0.000 description 3
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 3
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004594 Masterbatch (MB) Substances 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000004700 high-density polyethylene Substances 0.000 description 2
- 229920001179 medium density polyethylene Polymers 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000005453 pelletization Methods 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 238000010248 power generation Methods 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229920006370 Kynar Polymers 0.000 description 1
- 241000276498 Pollachius virens Species 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- DQXBYHZEEUGOBF-UHFFFAOYSA-N but-3-enoic acid;ethene Chemical compound C=C.OC(=O)CC=C DQXBYHZEEUGOBF-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 239000004701 medium-density polyethylene Substances 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- UGQZLDXDWSPAOM-UHFFFAOYSA-N pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone Chemical compound C1=C2C(=O)NC(=O)C2=CC2=C1C(=O)NC2=O UGQZLDXDWSPAOM-UHFFFAOYSA-N 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Images
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/02—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient
- H01C7/027—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient consisting of conducting or semi-conducting material dispersed in a non-conductive organic material
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T29/00—Metal working
- Y10T29/49—Method of mechanical manufacture
- Y10T29/49002—Electrical device making
- Y10T29/49082—Resistor making
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T29/00—Metal working
- Y10T29/49—Method of mechanical manufacture
- Y10T29/49002—Electrical device making
- Y10T29/49082—Resistor making
- Y10T29/49083—Heater type
Definitions
- L percent by weight black and R is resistivity of the extrudate expressed in ohm-cm.
- R resistivity of the extrudate expressed in ohm-cm.
- the articles exhibit room temperature resistivity in the range from about 5 to 100,000 ohm-cm and may be employed, e.g., in heat tracing and thermostating applications.
- thermoplastic compositions have previously been achieved by the addition of conductive carbon black to a polymeric base.
- advantage has been taken of a non-linear positive temperature resistivity coefficient displayed by the particular material to obtain selfregulating or currentdimiting semicondu ctive articles.
- U.S. Pat. No. 3,243,753 to Kohler one such composition is described as containing from 25 to 75 percent carbon black about which the polymeric matrix has been formed by in situ polymerization.
- Self-regulating conductive compositions may, of course, be used in employments other than resistive heating, for example, in heat sensing and circuitbreaking applications.
- the high carbon black content characteristic of most prior art compositions is disadvantageous.
- High black loadings are associated with inferior elongation and stress crack resistance, as well as low temperature brittleness.
- high black loading appears to adversely affect the current-regulating properties of the conductive compositions.
- a semi-conductive thermoplastic composition is externally heated and its resistivity plotted against temperature (on the abscissa) the resulting curve will show resistivity rising with temperature from the low room temperature value (Ri) to a point of peak resistance (Rp), following which additional increase in temperature occasions a precipitous resistivity drop associated with the melt phase of the polymer matrix.
- Ri room temperature value
- Rp point of peak resistance
- the practice of cross-linking the polymer matrix has grown up, in which event resistivity levels off at the peak temperature and remains constant upon further increase in ambient temperature.
- Cross-linked semiconductive articles with high black loadings exhibit undesirably low resistivity when brought to peak temperature by exposure to very high or low ambient tempera tures. In such instances poor heat transfer characteristics can prevent dissipation of I Rp generation, causing burnout.
- the resulting articles are suitable for freeze protection and other selflimiting applications, exhibit high Rp/Ri, and are otherwise advantaged by low black content.
- their resistivity-temperature properties are stable in storage and unaffected by temperature cycling.
- FIG. 1 is a cross-sectioned end-on view of one jacketed extrudate formed according to the practice of this invention.
- FIG. 2 is a flow chart which depicts the steps of the preferred manner of obtaining jacketed extrudates like those depicted in FIG. 1.
- the polymeric matrix in which conductive black is dispersed in whatever proportion must exhibit overall an appropriately non-linear coefficient of thermal expansion, for which reason a degree of crystallinity is believed essential.
- polymers exhibiting at least about percent crystallinity as determined by x-ray diffraction are suited to the practice of the invention.
- polystyrene resin such as low, medium and high density polyethylenes and polypropylene, polybutene-l, poly(dodecamethylene pyromellitimide), ethylene-propylene copolymers and terpolymers with non-conjugated dienes, polyvinylidine fluoride, polyvinylidine fluoride-tetrafluoroethylene copolymers, etc.
- polyolefins such as low, medium and high density polyethylenes and polypropylene, polybutene-l, poly(dodecamethylene pyromellitimide), ethylene-propylene copolymers and terpolymers with non-conjugated dienes, polyvinylidine fluoride, polyvinylidine fluoride-tetrafluoroethylene copolymers, etc.
- limiting temperatures tailored to the application intended eg., freeze protection, thermostatting,
- polymeric matrix material may be obtained by appropriate selection of polymeric matrix material.
- elements which self-limit at temperatures on the order of 100F, 130F, 150F, 180F and 250F may be produced with, respectively, wax-poly(ethylene-vinyl acetate) blends, low density polyethylene, high density polyethylene, polypropylene and polyvinylidene fluoride.
- Other criteria of polymer selection will, in particular instances, include desired elongation, environmental resistance, ease of extrusibility, etc., as is well known.
- Particularly preferred matrix materials are multicomponent blends in which black is mixed with a first blend component to form a master batch which is in turn mixed with the principal polymeric component.
- the first and second polymer blend components are chosen such that they exhibit a positive free energy of mixing, one with the other. Their attendant incompatibility apparently has the effect of segregating contained black into generally delimited regions of the polymer matrix, and such blends have proven extremely stable in the face of temperature cycling in use. In the case of single component matrices, cycling has occasionally had the effect of requiring that successively higher temperatures be attained to provide identical wattage values. Of course, even in the case of single component matrices, the low black loadings achieved according to this invention can result in satisfactory stability to cycling.
- the minor polymeric blend component is chosen for superior compatibility with carbon black relative to the blend component present in major proportion, while the latter component is selected for the particular physical properties desired in the overall extrudate.
- the principal blend component is preferably present in at least'about 3:1 weight ratio relative to the minor component with which the black is first mixed.
- the blends most preferred have a polyethylene as the principal component, the other being an ethylene-vinyl ester copolymer, such as ethylene-vinyl acetate or ethylene-ethylacrylate copolymers.
- An especially preferred extrudate contains about 70:20 polyethylene: ethylene-ethyl acrylate copolymer by weight.
- the carbon blacks employed are those conventionally used in conductive plastics, eg., high structure varieties such as furnace and channels blacks.
- Other conventional addends such as antioxidants. etc., may be employed provided only that their quantities and characteristics do not subvert the objects of the invention.
- An especially interesting class of beneficial addends are materials such as waxes which, while compatible with the predominant blend component, melt at lower temperature. The result is to permit obtainment of a given wattage at lower temperature, owing to a first peaking effect of the wax on the resistivity-temperature curve.
- Compounding is conventional and generally involves banburying, milling and pelletizing prior to pressure extrusion of the selflimiting element from the melt.
- the black-containing matrix 1 is extruded onto a spaced-apart pair of elongate electrodes 2 to form an element rod-shaped or, most preferably, dumbellshaped in cross-section, the extruded thermoplastic both encapsulating and interconnecting the electrodes. Thereafter, polymeric jackets 3 and 4 may be extruded thereover, as in the fourth and sixth steps of the flow chart which is FIG. 2.
- resistivity values must be in the range from about 6,000 to 100,000 ohm-cm in order to generate 4-watts per foot and, of course, lower at a particular voltage to obtain as much as 8 watts/foot.
- room temperature resistivity is greater than about 10 ohm-cm, and most commonly on the order of the resistivity of the dielectric polymer matrix itself. At such resistivities available wattage under power is essentially zero.
- Annealing is performed at a temperature greater than about 250F, preferably at at least about 300F, and in any case at or above the melting point or range of the polymeric matrix in which the carbon black is dispersed.
- the period over which annealing is effected will, it will be appreciated, vary with the nature of the particular matrix and the amount of carbon black contained therein.
- annealing occurs over a time sufficient to reduce resistivity of the annealed element to satisfaction of the equation 2 L 5 log R s 45, preferably 40, and the time necessary in a particular case may be readily determined empirically.
- annealing is conducted over a period in excess of 15 hours, and commonly at least about a 24 hour anneal is had.
- control cooling is substantially less important where the requisite overall annealing residence time is divided into at least about three roughly equal stages, and the element returned to room temperature between each annealing stage.
- the self-limiting element Upon completion of annealing and optional addition of a further insulative jacket of, e.g., polyethylene, the self-limiting element is desirably subjected to ionizing radiation sufficient in strength to cross-link the blackcontaining core.
- Radiation dosage is selected with an eye to achieving cross-linking sufficient to impart a degree of thermal stability requisite to the particularly intended application without unduly diminishing crystallinity of the polymer matrix, i.e., overall crystallinity of the cross-linked black-containing matrix less than about 20 percent is to be avoided.
- radiation dosage may in particular cases range from about 2 to megarads or more, and preferably is about 12 megarads.
- EXAMPLE 1 Seventy-six lbs. of polyethylene (density 0.929 gm/cc, 32 lbs. ofa mixture of 34 percent Vulcan XC-72 and ethylene ethyl acrylate copolymer (density 0.930 gm/cc, 18 percent ethyl acrylate) were loaded with 1 lb. of antioxidant into a Banbury mixer. The ram was closed and mixing commenced. When temperature reached about 24050F the batch was dumped, placed in a 2-roll mill, and cut off in strips which were fed to a pelletizing extruder.
- the pelletized compound was next extruded onto two parallel tinned copper electrodes AWG 19/32) to form an extrudate generally dumbbell-shaped in cross-section.
- the electrodes were 0.275 inch apart (center-to-center), the interconnecting web being about 15 mils in thickness, at least 8 mils thickness of the semiconductive composition surrounding the electrodes.
- Extrusion was performed in a plasticating extruder with crosshead attachment (Davis- Standard 2 inches extruder, 24/1 L/D, with PE screw. Thereafter, the same extruder was arranged to extrude an 8 mil thick insulation jacket of polyurethane (Texin 59l-A, available from the Mobay Corporation).
- a conventional tube extrusion method was employed in which a vacuum (eg., 5-20 in. H O) is drawn in the molten tube to collapse it about the semiconductive core within about 3 inches of the extrusion head.
- the jacketed product was next spooled onto aluminum disks (26 inches dia) and exposed to 300F for 24 hours in a circulating air oven. Following this thermal structuring procedure and cooling to room temperature oven about 1 /2 hours the resistivity of the sample was determined at various tem- Additional extrudates were prepared with various polymers and black loadings following the procedure of Example 1 save where otherwise indicated below.
- the polymeric matrices for the various examples were as follows: (2) a 3:1 blend of low density polyethylene: ethylene ethyl acrylate copolymer; (3) a 5:1 blend of low density polyethylene: ethylene vinyl acetate copolymer; (4) polyvinylidene fluoride; (5) a 3:1 blend of medium density polyethylene: ethylene-ethyl acrylate copolymer; (6) a 3:1 blend of high density polyethylene: ethylene-ethyl acrylate copolymer; (7) ethylene/- propylene copolymer (Eastman Chemical Companys Polyallomer”); (8) polybutene-l; and (9) polyvinylidene fluoride/tetrafluoroethylene copolymer (Pennwalt Chemical Companys Kynar 5200).
- an electrically conductive self-regulating article which comprises the steps of l extruding onto a pair of elongate parallel electrodes held in spaced-apart relation an electrodeinterconnecting web of a composition consisting essentially of a thermoplastic crystalline polymeric material exhibiting overall at least about 20 percent crystallinity as determined by x-ray diffraction and (b) conductive carbon black, the percentage by weight (L) of carbon black based on the total weight of said composition being not greater than about 15, the resulting extrudate exhibiting room temperature resistivity (R, ohm-cm) greater than about 10, and (2) annealing the extrudate at or above the melting temperature of said crystalline polymeric material for a period of time sufficient to reduce R to satisfaction of the equation 2L-l-Slog R s 45,
- the value L being not more thanabout ten, annealing being performed at a temperature of at least about 300F over a period of not less than about 15 hours.
- polymeric material is a blend of polyethylene and, in minor proportion relative thereto, a copolymer of ethylene and a vinyl ester.
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Ceramic Engineering (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Conductive Materials (AREA)
- Apparatuses And Processes For Manufacturing Resistors (AREA)
- Semiconductor Integrated Circuits (AREA)
- Thermistors And Varistors (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US287444A US3861029A (en) | 1972-09-08 | 1972-09-08 | Method of making heater cable |
| DE2345303A DE2345303C2 (de) | 1972-09-08 | 1973-09-07 | Sich selbst regulierender elektrischer Widerstandskörper und Verfahren zu dessen Herstellung |
| BE135466A BE804628A (fr) | 1972-09-08 | 1973-09-07 | Produits manufactures extrudes conducteurs autolimitants |
| NO3500/73A NO141489C (no) | 1972-09-08 | 1973-09-07 | Fremgangsmaate ved fremstilling av et selvregulerende, baandformet, elektrisk motstandselement |
| FR7332300A FR2199175B1 (ja�@�@) | 1972-09-08 | 1973-09-07 | |
| JP48101001A JPS5818722B2 (ja) | 1972-09-08 | 1973-09-07 | 自己調節性電気物品およびその製造方法 |
| CA180,537A CA996171A (en) | 1972-09-08 | 1973-09-07 | Self limiting conductive extrudates |
| GB4214073A GB1449262A (en) | 1972-09-08 | 1973-09-07 | Sel-limiting conductive extrudates and methods for their manufacture |
| NL7312393A NL7312393A (ja�@�@) | 1972-09-08 | 1973-09-07 | |
| SE7312196A SE411086B (sv) | 1972-09-08 | 1973-09-07 | Elektriskt resistivt foremal for sjelvreglerande och strombegrensande tillempningar samt forfarande for dess framstellning |
| AU60168/73A AU489046B2 (en) | 1973-09-10 | Self-limiting conductive extrudates | |
| HK14/82A HK1482A (en) | 1972-09-08 | 1982-01-14 | Self-limiting conductive extrudates and methods for their manufacture |
| US07/195,558 US4954695A (en) | 1972-09-08 | 1988-05-12 | Self-limiting conductive extrudates and methods therefor |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US287444A US3861029A (en) | 1972-09-08 | 1972-09-08 | Method of making heater cable |
Related Child Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US54259275A Division | 1975-01-20 | 1975-01-20 | |
| US54259275A Continuation | 1975-01-20 | 1975-01-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3861029A true US3861029A (en) | 1975-01-21 |
Family
ID=23102943
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US287444A Expired - Lifetime US3861029A (en) | 1972-09-08 | 1972-09-08 | Method of making heater cable |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3861029A (ja�@�@) |
| JP (1) | JPS5818722B2 (ja�@�@) |
| BE (1) | BE804628A (ja�@�@) |
| CA (1) | CA996171A (ja�@�@) |
| DE (1) | DE2345303C2 (ja�@�@) |
| FR (1) | FR2199175B1 (ja�@�@) |
| GB (1) | GB1449262A (ja�@�@) |
| HK (1) | HK1482A (ja�@�@) |
| NL (1) | NL7312393A (ja�@�@) |
| NO (1) | NO141489C (ja�@�@) |
| SE (1) | SE411086B (ja�@�@) |
Cited By (116)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3972821A (en) * | 1973-04-30 | 1976-08-03 | Amchem Products, Inc. | Heat transfer composition and method of making |
| US4001760A (en) * | 1974-06-21 | 1977-01-04 | Pyrotenax Of Canada Limited | Heating cables and manufacture thereof |
| FR2320617A1 (fr) * | 1975-08-04 | 1977-03-04 | Raychem Corp | Procede de fabrication d'un objet presentant un coefficient de temperature positif, et composition propres a servir a la preparation de tels objets |
| US4033028A (en) * | 1974-06-21 | 1977-07-05 | Pyrotenax Of Canada Limited | Method of making heating cables |
| US4061827A (en) * | 1975-03-03 | 1977-12-06 | Imperial Chemical Industries Limited | Fibres |
| DE2755077A1 (de) * | 1976-12-13 | 1978-06-29 | Raychem Corp | Elektrische vorrichtungen mit leitfaehigen polymermassen |
| FR2434543A1 (fr) * | 1978-06-15 | 1980-03-21 | Hotfoil Ltd | Ruban electrique chauffant |
| US4200973A (en) * | 1978-08-10 | 1980-05-06 | Samuel Moore And Company | Method of making self-temperature regulating electrical heating cable |
| DE3011754A1 (de) * | 1979-03-26 | 1980-10-09 | Eb Ind Inc | Elektrisch leitfaehige zusammensetzung und verfahren zur herstellung eines gegenstandes unter deren verwendung |
| DE3017826A1 (de) * | 1979-05-10 | 1980-11-20 | Sunbeam Corp | Flexible heizelemente und verfahren zu deren herstellung |
| US4242573A (en) * | 1979-01-24 | 1980-12-30 | Raychem Corporation | Water immersible heater |
| US4286376A (en) * | 1975-01-20 | 1981-09-01 | Raychem Corporation | Method of making heater cable of self-limiting conductive extrudates |
| US4309596A (en) * | 1980-06-24 | 1982-01-05 | Sunbeam Corporation | Flexible self-limiting heating cable |
| US4313101A (en) * | 1978-05-18 | 1982-01-26 | Hotfoil Limited | Electrically impedant articles |
| US4318881A (en) * | 1980-05-19 | 1982-03-09 | Raychem Corporation | Method for annealing PTC compositions |
| US4334148A (en) * | 1974-08-30 | 1982-06-08 | Raychem Corporation | PTC Heaters |
| EP0040537A3 (en) * | 1980-05-19 | 1982-12-01 | Raychem Corporation | Ptc conductive polymer compositions and devices comprising them and a method of making them |
| US4388607A (en) * | 1976-12-16 | 1983-06-14 | Raychem Corporation | Conductive polymer compositions, and to devices comprising such compositions |
| US4421582A (en) * | 1975-08-04 | 1983-12-20 | Raychem Corporation | Self-heating article with deformable electrodes |
| US4426339A (en) | 1976-12-13 | 1984-01-17 | Raychem Corporation | Method of making electrical devices comprising conductive polymer compositions |
| US4459473A (en) * | 1982-05-21 | 1984-07-10 | Raychem Corporation | Self-regulating heaters |
| US4471215A (en) * | 1983-08-24 | 1984-09-11 | Eaton Corporation | Self-regulating heating cable having radiation grafted jacket |
| US4485297A (en) * | 1980-08-28 | 1984-11-27 | Flexwatt Corporation | Electrical resistance heater |
| US4560498A (en) * | 1975-08-04 | 1985-12-24 | Raychem Corporation | Positive temperature coefficient of resistance compositions |
| US4560524A (en) * | 1983-04-15 | 1985-12-24 | Smuckler Jack H | Method of manufacturing a positive temperature coefficient resistive heating element |
| US4574188A (en) * | 1982-04-16 | 1986-03-04 | Raychem Corporation | Elongate electrical assemblies |
| US4582983A (en) * | 1982-04-16 | 1986-04-15 | Raychem Corporation | Elongate electrical assemblies |
| US4591700A (en) * | 1980-05-19 | 1986-05-27 | Raychem Corporation | PTC compositions |
| US4611588A (en) * | 1985-06-05 | 1986-09-16 | Pfizer Hospital Products Group, Inc. | Laser beam resistant material |
| US4659913A (en) * | 1982-04-16 | 1987-04-21 | Raychem Corporation | Elongate electrical assemblies |
| US4668857A (en) * | 1985-08-16 | 1987-05-26 | Belton Corporation | Temperature self-regulating resistive heating element |
| DE3701814A1 (de) * | 1986-01-30 | 1987-08-06 | Sunbeam Corp | Elektrisch leitende polymerzusammensetzung mit positivem temperaturkoeffizienten sowie verfahren zu ihrer herstellung |
| US4689475A (en) * | 1985-10-15 | 1987-08-25 | Raychem Corporation | Electrical devices containing conductive polymers |
| US4693940A (en) * | 1983-02-14 | 1987-09-15 | Raychem Corporation | Laminate and method of preparing same |
| US4719335A (en) * | 1984-01-23 | 1988-01-12 | Raychem Corporation | Devices comprising conductive polymer compositions |
| EP0196885A3 (en) * | 1985-03-26 | 1988-01-27 | RAYCHEM CORPORATION (a Delaware corporation) | Method for monitoring a heater |
| US4724417A (en) * | 1985-03-14 | 1988-02-09 | Raychem Corporation | Electrical devices comprising cross-linked conductive polymers |
| US4733059A (en) * | 1987-06-15 | 1988-03-22 | Thermon Manufacturing Company | Elongated parallel, constant wattage heating cable |
| US4761541A (en) * | 1984-01-23 | 1988-08-02 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4764664A (en) * | 1976-12-13 | 1988-08-16 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4775500A (en) * | 1984-11-19 | 1988-10-04 | Matsushita Electric Industrial Co., Ltd. | Electrically conductive polymeric composite and method of making said composite |
| US4777351A (en) * | 1984-09-14 | 1988-10-11 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4780598A (en) * | 1984-07-10 | 1988-10-25 | Raychem Corporation | Composite circuit protection devices |
| US4785163A (en) * | 1985-03-26 | 1988-11-15 | Raychem Corporation | Method for monitoring a heater |
| JPS63278396A (ja) * | 1987-05-11 | 1988-11-16 | Nippon Mektron Ltd | 回路保護機能を有するプリント配線板 |
| US4791276A (en) * | 1982-04-16 | 1988-12-13 | Raychem Corporation | Elongate electrical assemblies |
| US4801785A (en) * | 1986-01-14 | 1989-01-31 | Raychem Corporation | Electrical devices |
| US4845838A (en) * | 1981-04-02 | 1989-07-11 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US4849611A (en) * | 1985-12-16 | 1989-07-18 | Raychem Corporation | Self-regulating heater employing reactive components |
| US4857880A (en) * | 1985-03-14 | 1989-08-15 | Raychem Corporation | Electrical devices comprising cross-linked conductive polymers |
| US4866253A (en) * | 1976-12-13 | 1989-09-12 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| WO1989009427A1 (en) * | 1988-03-25 | 1989-10-05 | Raychem Corporation | Liquid crystal electrical fault indicators |
| US4876440A (en) * | 1976-12-13 | 1989-10-24 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4889975A (en) * | 1988-03-16 | 1989-12-26 | The Fluorocarbon Company | Self-regulating heater having a heat tape that stops tracking |
| US4907340A (en) * | 1987-09-30 | 1990-03-13 | Raychem Corporation | Electrical device comprising conductive polymers |
| US4922083A (en) * | 1988-04-22 | 1990-05-01 | Thermon Manufacturing Company | Flexible, elongated positive temperature coefficient heating assembly and method |
| US4924074A (en) * | 1987-09-30 | 1990-05-08 | Raychem Corporation | Electrical device comprising conductive polymers |
| US4951382A (en) * | 1981-04-02 | 1990-08-28 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US4951384A (en) * | 1981-04-02 | 1990-08-28 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US4954695A (en) * | 1972-09-08 | 1990-09-04 | Raychem Corporation | Self-limiting conductive extrudates and methods therefor |
| US4955267A (en) * | 1981-04-02 | 1990-09-11 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| EP0388990A2 (en) | 1986-02-20 | 1990-09-26 | RAYCHEM CORPORATION (a Delaware corporation) | Method and articles employing ion exchange material |
| US4967057A (en) * | 1988-08-02 | 1990-10-30 | Bayless Ronald E | Snow melting heater mats |
| US5002501A (en) * | 1989-10-02 | 1991-03-26 | Raychem Corporation | Electrical plug |
| US5004432A (en) * | 1989-10-02 | 1991-04-02 | Raychem Corporation | Electrical connector |
| US5045673A (en) * | 1990-04-04 | 1991-09-03 | General Signal Corporation | PTC devices and their composition |
| US5049850A (en) * | 1980-04-21 | 1991-09-17 | Raychem Corporation | Electrically conductive device having improved properties under electrical stress |
| US5052699A (en) * | 1989-07-10 | 1991-10-01 | Raychem Corporation | Grommet |
| US5057673A (en) * | 1988-05-19 | 1991-10-15 | Fluorocarbon Company | Self-current-limiting devices and method of making same |
| US5064997A (en) * | 1984-07-10 | 1991-11-12 | Raychem Corporation | Composite circuit protection devices |
| WO1991017642A1 (en) * | 1990-05-07 | 1991-11-14 | Raychem Corporation | Elongated electrical resistance heater |
| US5089688A (en) * | 1984-07-10 | 1992-02-18 | Raychem Corporation | Composite circuit protection devices |
| US5140297A (en) * | 1981-04-02 | 1992-08-18 | Raychem Corporation | PTC conductive polymer compositions |
| US5148005A (en) * | 1984-07-10 | 1992-09-15 | Raychem Corporation | Composite circuit protection devices |
| US5166658A (en) * | 1987-09-30 | 1992-11-24 | Raychem Corporation | Electrical device comprising conductive polymers |
| US5174924A (en) * | 1990-06-04 | 1992-12-29 | Fujikura Ltd. | Ptc conductive polymer composition containing carbon black having large particle size and high dbp absorption |
| US5178797A (en) * | 1980-04-21 | 1993-01-12 | Raychem Corporation | Conductive polymer compositions having improved properties under electrical stress |
| US5185594A (en) * | 1991-05-20 | 1993-02-09 | Furon Company | Temperature sensing cable device and method of making same |
| US5195013A (en) * | 1981-04-02 | 1993-03-16 | Raychem Corporation | PTC conductive polymer compositions |
| US5227946A (en) * | 1981-04-02 | 1993-07-13 | Raychem Corporation | Electrical device comprising a PTC conductive polymer |
| US5250226A (en) * | 1988-06-03 | 1993-10-05 | Raychem Corporation | Electrical devices comprising conductive polymers |
| US5300760A (en) * | 1989-03-13 | 1994-04-05 | Raychem Corporation | Method of making an electrical device comprising a conductive polymer |
| US5317061A (en) * | 1993-02-24 | 1994-05-31 | Raychem Corporation | Fluoropolymer compositions |
| DE2760471C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Verfahren zur Herstellung einer aus einer Elektrode und einer elektrisch leitfähigen Polymermasse bestehenden elektrischen Vorrichtung |
| DE2760408C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Heizstreifen und Verfahren zu seiner Herstellung |
| US5550350A (en) * | 1994-11-17 | 1996-08-27 | Donald W. Barnes | Heated ice-melting blocks for steps |
| US5552199A (en) * | 1994-09-02 | 1996-09-03 | Minnesota Mining And Manufacturing Company | Melt-processable electroconductive fluoroplastic |
| US5558794A (en) * | 1991-08-02 | 1996-09-24 | Jansens; Peter J. | Coaxial heating cable with ground shield |
| US5580493A (en) * | 1994-06-08 | 1996-12-03 | Raychem Corporation | Conductive polymer composition and device |
| US5622642A (en) * | 1995-02-06 | 1997-04-22 | Raychem Corporation | Sealing apparatus for elongate cables having movable insert with gripping members |
| EP0780849A2 (de) | 1995-12-23 | 1997-06-25 | Abb Research Ltd. | Verfahren zur Herstellung eines Materials für PTC-Widerstände |
| US5718600A (en) * | 1996-01-17 | 1998-02-17 | Raychem Corporation | Electrical plug |
| US5756972A (en) * | 1994-10-25 | 1998-05-26 | Raychem Corporation | Hinged connector for heating cables of various sizes |
| US5767448A (en) * | 1996-09-30 | 1998-06-16 | Raychem Corporation | Sealing device |
| US5792987A (en) * | 1995-08-28 | 1998-08-11 | Raychem Corporation | Sealing device |
| US5802709A (en) * | 1995-08-15 | 1998-09-08 | Bourns, Multifuse (Hong Kong), Ltd. | Method for manufacturing surface mount conductive polymer devices |
| US5814264A (en) * | 1996-04-12 | 1998-09-29 | Littelfuse, Inc. | Continuous manufacturing methods for positive temperature coefficient materials |
| US5849129A (en) * | 1995-08-15 | 1998-12-15 | Bourns Multifuse (Hong Kong) Ltd. | Continuous process and apparatus for manufacturing conductive polymer components |
| WO1999030334A1 (fr) * | 1997-12-08 | 1999-06-17 | Acome Societe Cooperative De Travailleurs | Cables auto-regulants extrudes et leur procede de fabrication |
| US5925276A (en) * | 1989-09-08 | 1999-07-20 | Raychem Corporation | Conductive polymer device with fuse capable of arc suppression |
| US5993990A (en) * | 1998-05-15 | 1999-11-30 | Moltech Corporation | PTC current limiting header assembly |
| US6005232A (en) * | 1996-06-28 | 1999-12-21 | Raychem Corporation | Heating cable |
| US6020808A (en) * | 1997-09-03 | 2000-02-01 | Bourns Multifuse (Hong Kong) Ltd. | Multilayer conductive polymer positive temperature coefficent device |
| US6111234A (en) * | 1991-05-07 | 2000-08-29 | Batliwalla; Neville S. | Electrical device |
| US6206720B1 (en) | 1998-10-15 | 2001-03-27 | Tyco Electronics Corporation | Connector for electrical cable |
| US6228287B1 (en) | 1998-09-25 | 2001-05-08 | Bourns, Inc. | Two-step process for preparing positive temperature coefficient polymer materials |
| US6564011B1 (en) * | 2000-08-23 | 2003-05-13 | Fmc Technologies, Inc. | Self-regulating heat source for subsea equipment |
| US6597551B2 (en) | 2000-12-13 | 2003-07-22 | Huladyne Corporation | Polymer current limiting device and method of manufacture |
| US20050194378A1 (en) * | 2004-03-05 | 2005-09-08 | Adel Wiggins Group | Straight ribbon heater |
| US20060021752A1 (en) * | 2004-07-29 | 2006-02-02 | De St Remey Edward E | Subterranean electro-thermal heating system and method |
| US20070193747A1 (en) * | 2004-07-29 | 2007-08-23 | Tyco Thermal Controls Llc | Subterranean Electro-Thermal Heating System and Method |
| DE10029080B4 (de) * | 1998-04-13 | 2011-07-07 | Micropump, Inc., Wash. | Verfahren und Vorrichtung zur Geschwindigkeitsmodulation für einen pulsationsfreien Betrieb einer Pumpe |
| US20140166638A1 (en) * | 2012-12-14 | 2014-06-19 | Tech Design Llc | Self-regulating semi-conductive flexible heating element |
| US10872712B2 (en) | 2017-11-07 | 2020-12-22 | Hitachi Metals, Ltd. | Insulated wire |
| US11205525B2 (en) * | 2017-11-07 | 2021-12-21 | Hitachi Metals, Ltd. | Insulated wire |
| WO2023037235A1 (es) | 2021-09-07 | 2023-03-16 | Di Ciommo Jose Antonio | Formulación básica para fabricar compuestos aislantes o compuestos semiconductores, composición de compuesto aislante apto para uso en conductores de energía eléctrica, composición de compuesto semiconductor apto para uso en conductores de energía eléctrica y cable para distribución de energía eléctrica que previene el conexionado indeseado no autorizado al mismo. |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5113991A (en) * | 1974-07-23 | 1976-02-03 | Matsushita Electric Industrial Co Ltd | Teikotai |
| FR2533396B1 (fr) * | 1976-12-13 | 1988-08-05 | Raychem Corp | Dispositifs electriques comprenant une electrode en contact avec une composition polymere |
| GB1597007A (en) * | 1976-12-16 | 1981-09-03 | Raychem Corp | Conductive polymer compositions and devices |
| US4237441A (en) * | 1978-12-01 | 1980-12-02 | Raychem Corporation | Low resistivity PTC compositions |
| JPS5784586A (en) * | 1980-11-13 | 1982-05-26 | Hitachi Cable | Self-temperature controllable heater |
| JPS58164187A (ja) * | 1982-03-25 | 1983-09-29 | 日立電線株式会社 | 自己温度制御性ヒ−タ |
| JPS59102940A (ja) * | 1982-12-06 | 1984-06-14 | Hitachi Cable Ltd | 自己温度制御性ヒ−タ用樹脂組成物 |
| JPS6122590A (ja) * | 1984-07-10 | 1986-01-31 | ダイキン工業株式会社 | 高分子複合発熱体 |
| JPH0799721B2 (ja) * | 1986-09-13 | 1995-10-25 | 日本メクトロン株式会社 | Ptc組成物の製造法 |
| JPH0777161B2 (ja) * | 1986-10-24 | 1995-08-16 | 日本メクトロン株式会社 | Ptc組成物、その製造法およびptc素子 |
| DE3817437A1 (de) * | 1988-05-21 | 1989-11-30 | Asea Brown Boveri | Verfahren zum aufarbeiten von abfallmaterial |
| CA1314581C (en) * | 1988-07-08 | 1993-03-16 | Yoshinori Nishino | Heater device used for floor material etc. and floor material with heater contained therein |
| DE4024268A1 (de) * | 1990-07-31 | 1992-02-06 | Lehmann & Voss & Co | Elektrisch leitfaehiges kunststoffelement und seine verwendung |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2282832A (en) * | 1939-11-24 | 1942-05-12 | Gen Electric | Semiconducting tape |
| US2905919A (en) * | 1956-01-17 | 1959-09-22 | British Insulated Callenders | Electric heating cables |
| US3155631A (en) * | 1962-02-19 | 1964-11-03 | Du Pont | Semi-conductor, containing ethylene/ethyl acrylate copolymer, petroleum wax and carbon black |
| US3277419A (en) * | 1963-11-20 | 1966-10-04 | Du Pont | Laminated heating unit |
| US3308528A (en) * | 1963-11-06 | 1967-03-14 | Ibm | Fabrication of cermet film resistors to close tolerances |
| US3435401A (en) * | 1966-10-05 | 1969-03-25 | Texas Instruments Inc | Insulated electrical conductors |
| US3591526A (en) * | 1968-01-25 | 1971-07-06 | Polyelectric Corp | Method of manufacturing a temperature sensitive,electrical resistor material |
| US3629154A (en) * | 1969-10-30 | 1971-12-21 | Esb Inc | Thin electrically conductive nonporous polymeric film |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE562035A (ja�@�@) * | ||||
| FR1305140A (fr) * | 1961-11-09 | 1962-09-28 | Montedison Spa | Mélanges à base de polyoléfines cristallines et éléments électriques de conductance variable formés de tels mélanges |
| US3243753A (en) * | 1962-11-13 | 1966-03-29 | Kohler Fred | Resistance element |
| LU45571A1 (ja�@�@) * | 1963-03-05 | 1964-05-04 | ||
| US3351882A (en) * | 1964-10-09 | 1967-11-07 | Polyelectric Corp | Plastic resistance elements and methods for making same |
| US3410984A (en) * | 1966-05-03 | 1968-11-12 | Gen Electric | Flexible electrically heated personal warming device |
| GB1201166A (en) * | 1967-12-04 | 1970-08-05 | Ici Ltd | Conducting plastic articles |
| CA949637A (en) * | 1970-08-03 | 1974-06-18 | Henry J. Stinger | Process for making electrically conductive heating elements |
-
1972
- 1972-09-08 US US287444A patent/US3861029A/en not_active Expired - Lifetime
-
1973
- 1973-09-07 SE SE7312196A patent/SE411086B/xx unknown
- 1973-09-07 JP JP48101001A patent/JPS5818722B2/ja not_active Expired
- 1973-09-07 FR FR7332300A patent/FR2199175B1/fr not_active Expired
- 1973-09-07 NO NO3500/73A patent/NO141489C/no unknown
- 1973-09-07 NL NL7312393A patent/NL7312393A/xx not_active Application Discontinuation
- 1973-09-07 CA CA180,537A patent/CA996171A/en not_active Expired
- 1973-09-07 GB GB4214073A patent/GB1449262A/en not_active Expired
- 1973-09-07 BE BE135466A patent/BE804628A/xx not_active IP Right Cessation
- 1973-09-07 DE DE2345303A patent/DE2345303C2/de not_active Expired
-
1982
- 1982-01-14 HK HK14/82A patent/HK1482A/xx unknown
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2282832A (en) * | 1939-11-24 | 1942-05-12 | Gen Electric | Semiconducting tape |
| US2905919A (en) * | 1956-01-17 | 1959-09-22 | British Insulated Callenders | Electric heating cables |
| US3155631A (en) * | 1962-02-19 | 1964-11-03 | Du Pont | Semi-conductor, containing ethylene/ethyl acrylate copolymer, petroleum wax and carbon black |
| US3308528A (en) * | 1963-11-06 | 1967-03-14 | Ibm | Fabrication of cermet film resistors to close tolerances |
| US3277419A (en) * | 1963-11-20 | 1966-10-04 | Du Pont | Laminated heating unit |
| US3435401A (en) * | 1966-10-05 | 1969-03-25 | Texas Instruments Inc | Insulated electrical conductors |
| US3591526A (en) * | 1968-01-25 | 1971-07-06 | Polyelectric Corp | Method of manufacturing a temperature sensitive,electrical resistor material |
| US3629154A (en) * | 1969-10-30 | 1971-12-21 | Esb Inc | Thin electrically conductive nonporous polymeric film |
Cited By (140)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4954695A (en) * | 1972-09-08 | 1990-09-04 | Raychem Corporation | Self-limiting conductive extrudates and methods therefor |
| US3972821A (en) * | 1973-04-30 | 1976-08-03 | Amchem Products, Inc. | Heat transfer composition and method of making |
| US4001760A (en) * | 1974-06-21 | 1977-01-04 | Pyrotenax Of Canada Limited | Heating cables and manufacture thereof |
| US4033028A (en) * | 1974-06-21 | 1977-07-05 | Pyrotenax Of Canada Limited | Method of making heating cables |
| US4334148A (en) * | 1974-08-30 | 1982-06-08 | Raychem Corporation | PTC Heaters |
| US4286376A (en) * | 1975-01-20 | 1981-09-01 | Raychem Corporation | Method of making heater cable of self-limiting conductive extrudates |
| US4061827A (en) * | 1975-03-03 | 1977-12-06 | Imperial Chemical Industries Limited | Fibres |
| FR2320617A1 (fr) * | 1975-08-04 | 1977-03-04 | Raychem Corp | Procede de fabrication d'un objet presentant un coefficient de temperature positif, et composition propres a servir a la preparation de tels objets |
| US4421582A (en) * | 1975-08-04 | 1983-12-20 | Raychem Corporation | Self-heating article with deformable electrodes |
| US4560498A (en) * | 1975-08-04 | 1985-12-24 | Raychem Corporation | Positive temperature coefficient of resistance compositions |
| JPS5395298A (en) * | 1976-12-13 | 1978-08-21 | Raychem Corp | Means comprising electrode and conductive polymer and method of manufacturing or improving same |
| DE2760471C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Verfahren zur Herstellung einer aus einer Elektrode und einer elektrisch leitfähigen Polymermasse bestehenden elektrischen Vorrichtung |
| US4426339A (en) | 1976-12-13 | 1984-01-17 | Raychem Corporation | Method of making electrical devices comprising conductive polymer compositions |
| US4866253A (en) * | 1976-12-13 | 1989-09-12 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4876440A (en) * | 1976-12-13 | 1989-10-24 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4764664A (en) * | 1976-12-13 | 1988-08-16 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| DE2755077A1 (de) * | 1976-12-13 | 1978-06-29 | Raychem Corp | Elektrische vorrichtungen mit leitfaehigen polymermassen |
| DE2760408C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Heizstreifen und Verfahren zu seiner Herstellung |
| US4388607A (en) * | 1976-12-16 | 1983-06-14 | Raychem Corporation | Conductive polymer compositions, and to devices comprising such compositions |
| US4313101A (en) * | 1978-05-18 | 1982-01-26 | Hotfoil Limited | Electrically impedant articles |
| US4307290A (en) * | 1978-06-15 | 1981-12-22 | Hotfoil Limited | Electric heating tapes |
| FR2434543A1 (fr) * | 1978-06-15 | 1980-03-21 | Hotfoil Ltd | Ruban electrique chauffant |
| US4200973A (en) * | 1978-08-10 | 1980-05-06 | Samuel Moore And Company | Method of making self-temperature regulating electrical heating cable |
| US4242573A (en) * | 1979-01-24 | 1980-12-30 | Raychem Corporation | Water immersible heater |
| DE3011754A1 (de) * | 1979-03-26 | 1980-10-09 | Eb Ind Inc | Elektrisch leitfaehige zusammensetzung und verfahren zur herstellung eines gegenstandes unter deren verwendung |
| US4444708A (en) * | 1979-05-10 | 1984-04-24 | Sunbeam Corporation | Flexible production of heating elements |
| US4348584A (en) * | 1979-05-10 | 1982-09-07 | Sunbeam Corporation | Flexible heating elements and processes for the production thereof |
| FR2456453A1 (fr) * | 1979-05-10 | 1980-12-05 | Sunbeam Corp | Element chauffant flexible et son procede de fabrication |
| DE3017826A1 (de) * | 1979-05-10 | 1980-11-20 | Sunbeam Corp | Flexible heizelemente und verfahren zu deren herstellung |
| US5178797A (en) * | 1980-04-21 | 1993-01-12 | Raychem Corporation | Conductive polymer compositions having improved properties under electrical stress |
| US5049850A (en) * | 1980-04-21 | 1991-09-17 | Raychem Corporation | Electrically conductive device having improved properties under electrical stress |
| EP0040537A3 (en) * | 1980-05-19 | 1982-12-01 | Raychem Corporation | Ptc conductive polymer compositions and devices comprising them and a method of making them |
| US4318881A (en) * | 1980-05-19 | 1982-03-09 | Raychem Corporation | Method for annealing PTC compositions |
| US4591700A (en) * | 1980-05-19 | 1986-05-27 | Raychem Corporation | PTC compositions |
| US4309596A (en) * | 1980-06-24 | 1982-01-05 | Sunbeam Corporation | Flexible self-limiting heating cable |
| US4485297A (en) * | 1980-08-28 | 1984-11-27 | Flexwatt Corporation | Electrical resistance heater |
| US4951384A (en) * | 1981-04-02 | 1990-08-28 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US5195013A (en) * | 1981-04-02 | 1993-03-16 | Raychem Corporation | PTC conductive polymer compositions |
| US4951382A (en) * | 1981-04-02 | 1990-08-28 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US4845838A (en) * | 1981-04-02 | 1989-07-11 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US5227946A (en) * | 1981-04-02 | 1993-07-13 | Raychem Corporation | Electrical device comprising a PTC conductive polymer |
| US4955267A (en) * | 1981-04-02 | 1990-09-11 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US5140297A (en) * | 1981-04-02 | 1992-08-18 | Raychem Corporation | PTC conductive polymer compositions |
| US4791276A (en) * | 1982-04-16 | 1988-12-13 | Raychem Corporation | Elongate electrical assemblies |
| US4659913A (en) * | 1982-04-16 | 1987-04-21 | Raychem Corporation | Elongate electrical assemblies |
| US4582983A (en) * | 1982-04-16 | 1986-04-15 | Raychem Corporation | Elongate electrical assemblies |
| US4574188A (en) * | 1982-04-16 | 1986-03-04 | Raychem Corporation | Elongate electrical assemblies |
| US4459473A (en) * | 1982-05-21 | 1984-07-10 | Raychem Corporation | Self-regulating heaters |
| US4693940A (en) * | 1983-02-14 | 1987-09-15 | Raychem Corporation | Laminate and method of preparing same |
| US4560524A (en) * | 1983-04-15 | 1985-12-24 | Smuckler Jack H | Method of manufacturing a positive temperature coefficient resistive heating element |
| US4471215A (en) * | 1983-08-24 | 1984-09-11 | Eaton Corporation | Self-regulating heating cable having radiation grafted jacket |
| US4761541A (en) * | 1984-01-23 | 1988-08-02 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4719335A (en) * | 1984-01-23 | 1988-01-12 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US5089688A (en) * | 1984-07-10 | 1992-02-18 | Raychem Corporation | Composite circuit protection devices |
| US5148005A (en) * | 1984-07-10 | 1992-09-15 | Raychem Corporation | Composite circuit protection devices |
| US4780598A (en) * | 1984-07-10 | 1988-10-25 | Raychem Corporation | Composite circuit protection devices |
| US5064997A (en) * | 1984-07-10 | 1991-11-12 | Raychem Corporation | Composite circuit protection devices |
| US4777351A (en) * | 1984-09-14 | 1988-10-11 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4775500A (en) * | 1984-11-19 | 1988-10-04 | Matsushita Electric Industrial Co., Ltd. | Electrically conductive polymeric composite and method of making said composite |
| US4857880A (en) * | 1985-03-14 | 1989-08-15 | Raychem Corporation | Electrical devices comprising cross-linked conductive polymers |
| US4724417A (en) * | 1985-03-14 | 1988-02-09 | Raychem Corporation | Electrical devices comprising cross-linked conductive polymers |
| EP0196885A3 (en) * | 1985-03-26 | 1988-01-27 | RAYCHEM CORPORATION (a Delaware corporation) | Method for monitoring a heater |
| US4785163A (en) * | 1985-03-26 | 1988-11-15 | Raychem Corporation | Method for monitoring a heater |
| US4611588A (en) * | 1985-06-05 | 1986-09-16 | Pfizer Hospital Products Group, Inc. | Laser beam resistant material |
| US4668857A (en) * | 1985-08-16 | 1987-05-26 | Belton Corporation | Temperature self-regulating resistive heating element |
| US4689475A (en) * | 1985-10-15 | 1987-08-25 | Raychem Corporation | Electrical devices containing conductive polymers |
| US4800253A (en) * | 1985-10-15 | 1989-01-24 | Raychem Corporation | Electrical devices containing conductive polymers |
| US4849611A (en) * | 1985-12-16 | 1989-07-18 | Raychem Corporation | Self-regulating heater employing reactive components |
| US4801785A (en) * | 1986-01-14 | 1989-01-31 | Raychem Corporation | Electrical devices |
| DE3701814A1 (de) * | 1986-01-30 | 1987-08-06 | Sunbeam Corp | Elektrisch leitende polymerzusammensetzung mit positivem temperaturkoeffizienten sowie verfahren zu ihrer herstellung |
| EP0388990A2 (en) | 1986-02-20 | 1990-09-26 | RAYCHEM CORPORATION (a Delaware corporation) | Method and articles employing ion exchange material |
| JPS63278396A (ja) * | 1987-05-11 | 1988-11-16 | Nippon Mektron Ltd | 回路保護機能を有するプリント配線板 |
| US4733059A (en) * | 1987-06-15 | 1988-03-22 | Thermon Manufacturing Company | Elongated parallel, constant wattage heating cable |
| EP0295359B1 (en) * | 1987-06-15 | 1993-04-14 | Thermon Manufacturing Company | Elongated parallel, constant wattage heating cable |
| US4924074A (en) * | 1987-09-30 | 1990-05-08 | Raychem Corporation | Electrical device comprising conductive polymers |
| US5166658A (en) * | 1987-09-30 | 1992-11-24 | Raychem Corporation | Electrical device comprising conductive polymers |
| US4907340A (en) * | 1987-09-30 | 1990-03-13 | Raychem Corporation | Electrical device comprising conductive polymers |
| US4889975A (en) * | 1988-03-16 | 1989-12-26 | The Fluorocarbon Company | Self-regulating heater having a heat tape that stops tracking |
| WO1989009427A1 (en) * | 1988-03-25 | 1989-10-05 | Raychem Corporation | Liquid crystal electrical fault indicators |
| US5066104A (en) * | 1988-03-25 | 1991-11-19 | Raychem Corporation | Liquid crystal electrical fault indicators |
| JPH02148591A (ja) * | 1988-04-22 | 1990-06-07 | Thermon Mfg Co | 電気式加熱ケーブル及びその組立て方法 |
| US4922083A (en) * | 1988-04-22 | 1990-05-01 | Thermon Manufacturing Company | Flexible, elongated positive temperature coefficient heating assembly and method |
| EP0338552A3 (en) * | 1988-04-22 | 1991-04-10 | Thermon Manufacturing Company | Flexible, elongated positive temperature coefficient heating assembly and method |
| JP2704430B2 (ja) | 1988-04-22 | 1998-01-26 | サーモン マニュファクチュアリング カンパニイ | 電気式加熱ケーブル及びその組立て方法 |
| US5057673A (en) * | 1988-05-19 | 1991-10-15 | Fluorocarbon Company | Self-current-limiting devices and method of making same |
| US5250226A (en) * | 1988-06-03 | 1993-10-05 | Raychem Corporation | Electrical devices comprising conductive polymers |
| US4967057A (en) * | 1988-08-02 | 1990-10-30 | Bayless Ronald E | Snow melting heater mats |
| US5300760A (en) * | 1989-03-13 | 1994-04-05 | Raychem Corporation | Method of making an electrical device comprising a conductive polymer |
| US5052699A (en) * | 1989-07-10 | 1991-10-01 | Raychem Corporation | Grommet |
| US5925276A (en) * | 1989-09-08 | 1999-07-20 | Raychem Corporation | Conductive polymer device with fuse capable of arc suppression |
| US5002501A (en) * | 1989-10-02 | 1991-03-26 | Raychem Corporation | Electrical plug |
| US5004432A (en) * | 1989-10-02 | 1991-04-02 | Raychem Corporation | Electrical connector |
| US5045673A (en) * | 1990-04-04 | 1991-09-03 | General Signal Corporation | PTC devices and their composition |
| WO1991017642A1 (en) * | 1990-05-07 | 1991-11-14 | Raychem Corporation | Elongated electrical resistance heater |
| US5174924A (en) * | 1990-06-04 | 1992-12-29 | Fujikura Ltd. | Ptc conductive polymer composition containing carbon black having large particle size and high dbp absorption |
| US6111234A (en) * | 1991-05-07 | 2000-08-29 | Batliwalla; Neville S. | Electrical device |
| US5313185A (en) * | 1991-05-20 | 1994-05-17 | Furon Company | Temperature sensing cable device and method of making same |
| US5185594A (en) * | 1991-05-20 | 1993-02-09 | Furon Company | Temperature sensing cable device and method of making same |
| US5558794A (en) * | 1991-08-02 | 1996-09-24 | Jansens; Peter J. | Coaxial heating cable with ground shield |
| US5317061A (en) * | 1993-02-24 | 1994-05-31 | Raychem Corporation | Fluoropolymer compositions |
| US5582770A (en) * | 1994-06-08 | 1996-12-10 | Raychem Corporation | Conductive polymer composition |
| US5580493A (en) * | 1994-06-08 | 1996-12-03 | Raychem Corporation | Conductive polymer composition and device |
| US5552199A (en) * | 1994-09-02 | 1996-09-03 | Minnesota Mining And Manufacturing Company | Melt-processable electroconductive fluoroplastic |
| US5756972A (en) * | 1994-10-25 | 1998-05-26 | Raychem Corporation | Hinged connector for heating cables of various sizes |
| US5550350A (en) * | 1994-11-17 | 1996-08-27 | Donald W. Barnes | Heated ice-melting blocks for steps |
| US5622642A (en) * | 1995-02-06 | 1997-04-22 | Raychem Corporation | Sealing apparatus for elongate cables having movable insert with gripping members |
| US5802709A (en) * | 1995-08-15 | 1998-09-08 | Bourns, Multifuse (Hong Kong), Ltd. | Method for manufacturing surface mount conductive polymer devices |
| US5849137A (en) * | 1995-08-15 | 1998-12-15 | Bourns Multifuse (Hong Kong) Ltd. | Continuous process and apparatus for manufacturing conductive polymer components |
| US5849129A (en) * | 1995-08-15 | 1998-12-15 | Bourns Multifuse (Hong Kong) Ltd. | Continuous process and apparatus for manufacturing conductive polymer components |
| US5792987A (en) * | 1995-08-28 | 1998-08-11 | Raychem Corporation | Sealing device |
| DE19548741A1 (de) * | 1995-12-23 | 1997-06-26 | Abb Research Ltd | Verfahren zur Herstellung eines Materials für PTC-Widerstände |
| EP0780849A2 (de) | 1995-12-23 | 1997-06-25 | Abb Research Ltd. | Verfahren zur Herstellung eines Materials für PTC-Widerstände |
| US5913574A (en) * | 1996-01-17 | 1999-06-22 | Raychem Corporation | Cutting tool for electrical cable |
| US5924888A (en) * | 1996-01-17 | 1999-07-20 | Raychem Corporation | Electrical plug |
| US5718600A (en) * | 1996-01-17 | 1998-02-17 | Raychem Corporation | Electrical plug |
| US5814264A (en) * | 1996-04-12 | 1998-09-29 | Littelfuse, Inc. | Continuous manufacturing methods for positive temperature coefficient materials |
| US6005232A (en) * | 1996-06-28 | 1999-12-21 | Raychem Corporation | Heating cable |
| US5767448A (en) * | 1996-09-30 | 1998-06-16 | Raychem Corporation | Sealing device |
| US6020808A (en) * | 1997-09-03 | 2000-02-01 | Bourns Multifuse (Hong Kong) Ltd. | Multilayer conductive polymer positive temperature coefficent device |
| US6223423B1 (en) | 1997-09-03 | 2001-05-01 | Bourns Multifuse (Hong Kong) Ltd. | Multilayer conductive polymer positive temperature coefficient device |
| US6303866B1 (en) | 1997-12-08 | 2001-10-16 | Acome Societe Cooperative Detravailleurs | Self-adjusting cables and method for making same |
| WO1999030330A1 (fr) * | 1997-12-08 | 1999-06-17 | Acome Societe Cooperative De Travailleurs | Fil electrique ayant un isolant mince a base de polybutyleneterephtalate |
| WO1999030334A1 (fr) * | 1997-12-08 | 1999-06-17 | Acome Societe Cooperative De Travailleurs | Cables auto-regulants extrudes et leur procede de fabrication |
| DE10029080B4 (de) * | 1998-04-13 | 2011-07-07 | Micropump, Inc., Wash. | Verfahren und Vorrichtung zur Geschwindigkeitsmodulation für einen pulsationsfreien Betrieb einer Pumpe |
| US5993990A (en) * | 1998-05-15 | 1999-11-30 | Moltech Corporation | PTC current limiting header assembly |
| US6228287B1 (en) | 1998-09-25 | 2001-05-08 | Bourns, Inc. | Two-step process for preparing positive temperature coefficient polymer materials |
| US6206720B1 (en) | 1998-10-15 | 2001-03-27 | Tyco Electronics Corporation | Connector for electrical cable |
| US6564011B1 (en) * | 2000-08-23 | 2003-05-13 | Fmc Technologies, Inc. | Self-regulating heat source for subsea equipment |
| US6597551B2 (en) | 2000-12-13 | 2003-07-22 | Huladyne Corporation | Polymer current limiting device and method of manufacture |
| US20050194378A1 (en) * | 2004-03-05 | 2005-09-08 | Adel Wiggins Group | Straight ribbon heater |
| US7176421B2 (en) * | 2004-03-05 | 2007-02-13 | Transdigm Inc. | Straight ribbon heater |
| US20060021752A1 (en) * | 2004-07-29 | 2006-02-02 | De St Remey Edward E | Subterranean electro-thermal heating system and method |
| US7322415B2 (en) | 2004-07-29 | 2008-01-29 | Tyco Thermal Controls Llc | Subterranean electro-thermal heating system and method |
| US7568526B2 (en) | 2004-07-29 | 2009-08-04 | Tyco Thermal Controls Llc | Subterranean electro-thermal heating system and method |
| US20070193747A1 (en) * | 2004-07-29 | 2007-08-23 | Tyco Thermal Controls Llc | Subterranean Electro-Thermal Heating System and Method |
| US20140166638A1 (en) * | 2012-12-14 | 2014-06-19 | Tech Design Llc | Self-regulating semi-conductive flexible heating element |
| US9603196B2 (en) * | 2012-12-14 | 2017-03-21 | Tech Design Llc | Self-regulating semi-conductive flexible heating element |
| US10872712B2 (en) | 2017-11-07 | 2020-12-22 | Hitachi Metals, Ltd. | Insulated wire |
| US11205525B2 (en) * | 2017-11-07 | 2021-12-21 | Hitachi Metals, Ltd. | Insulated wire |
| WO2023037235A1 (es) | 2021-09-07 | 2023-03-16 | Di Ciommo Jose Antonio | Formulación básica para fabricar compuestos aislantes o compuestos semiconductores, composición de compuesto aislante apto para uso en conductores de energía eléctrica, composición de compuesto semiconductor apto para uso en conductores de energía eléctrica y cable para distribución de energía eléctrica que previene el conexionado indeseado no autorizado al mismo. |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2345303A1 (de) | 1974-04-18 |
| FR2199175A1 (ja�@�@) | 1974-04-05 |
| NO141489C (no) | 1980-03-19 |
| BE804628A (fr) | 1974-03-07 |
| SE411086B (sv) | 1979-11-26 |
| GB1449262A (en) | 1976-09-15 |
| AU6016873A (en) | 1975-03-13 |
| JPS4968296A (ja�@�@) | 1974-07-02 |
| CA996171A (en) | 1976-08-31 |
| FR2199175B1 (ja�@�@) | 1977-09-23 |
| NL7312393A (ja�@�@) | 1974-03-12 |
| DE2345303C2 (de) | 1984-09-20 |
| JPS5818722B2 (ja) | 1983-04-14 |
| HK1482A (en) | 1982-01-22 |
| NO141489B (no) | 1979-12-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3861029A (en) | Method of making heater cable | |
| US4286376A (en) | Method of making heater cable of self-limiting conductive extrudates | |
| US3823217A (en) | Resistivity variance reduction | |
| US3914363A (en) | Method of forming self-limiting conductive extrudates | |
| US3858144A (en) | Voltage stress-resistant conductive articles | |
| US3793716A (en) | Method of making self limiting heat elements | |
| US4534889A (en) | PTC Compositions and devices comprising them | |
| US4200973A (en) | Method of making self-temperature regulating electrical heating cable | |
| US4775778A (en) | PTC compositions and devices comprising them | |
| US4237441A (en) | Low resistivity PTC compositions | |
| US4277673A (en) | Electrically conductive self-regulating article | |
| US6221282B1 (en) | Electrical devices comprising conductive polymer compositions | |
| US4188276A (en) | Voltage stable positive temperature coefficient of resistance crosslinked compositions | |
| US4426339A (en) | Method of making electrical devices comprising conductive polymer compositions | |
| CA1067947A (en) | Positive temperature coefficient resistance heating elements | |
| US4668857A (en) | Temperature self-regulating resistive heating element | |
| US5250226A (en) | Electrical devices comprising conductive polymers | |
| US4367168A (en) | Electrically conductive composition, process for making an article using same | |
| US4876440A (en) | Electrical devices comprising conductive polymer compositions | |
| US4954695A (en) | Self-limiting conductive extrudates and methods therefor | |
| US4318881A (en) | Method for annealing PTC compositions | |
| US5057673A (en) | Self-current-limiting devices and method of making same | |
| GB1597007A (en) | Conductive polymer compositions and devices | |
| US4327480A (en) | Electrically conductive composition, process for making an article using same | |
| US4908156A (en) | Self-regulating heating element and a process for the production thereof |