US2795731A - Cathode ray tube - Google Patents
Cathode ray tube Download PDFInfo
- Publication number
- US2795731A US2795731A US396120A US39612053A US2795731A US 2795731 A US2795731 A US 2795731A US 396120 A US396120 A US 396120A US 39612053 A US39612053 A US 39612053A US 2795731 A US2795731 A US 2795731A
- Authority
- US
- United States
- Prior art keywords
- cathode ray
- ray tube
- present
- deflection
- aiken
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000010894 electron beam technology Methods 0.000 description 8
- PLXMOAALOJOTIY-FPTXNFDTSA-N Aesculin Natural products OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1Oc2cc3C=CC(=O)Oc3cc2O PLXMOAALOJOTIY-FPTXNFDTSA-N 0.000 description 7
- 230000000873 masking effect Effects 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000007274 generation of a signal involved in cell-cell signaling Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
Images
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N9/00—Details of colour television systems
- H04N9/12—Picture reproducers
- H04N9/16—Picture reproducers using cathode ray tubes
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J21/00—Vacuum tubes
- H01J21/02—Tubes with a single discharge path
- H01J21/06—Tubes with a single discharge path having electrostatic control means only
- H01J21/10—Tubes with a single discharge path having electrostatic control means only with one or more immovable internal control electrodes, e.g. triode, pentode, octode
- H01J21/12—Tubes with variable amplification factor
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J29/00—Details of cathode-ray tubes or of electron-beam tubes of the types covered by group H01J31/00
- H01J29/46—Arrangements of electrodes and associated parts for generating or controlling the ray or beam, e.g. electron-optical arrangement
- H01J29/70—Arrangements for deflecting ray or beam
- H01J29/72—Arrangements for deflecting ray or beam along one straight line or along two perpendicular straight lines
- H01J29/74—Deflecting by electric fields only
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J31/00—Cathode ray tubes; Electron beam tubes
- H01J31/08—Cathode ray tubes; Electron beam tubes having a screen on or from which an image or pattern is formed, picked up, converted, or stored
- H01J31/10—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes
- H01J31/12—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes with luminescent screen
- H01J31/123—Flat display tubes
- H01J31/124—Flat display tubes using electron beam scanning
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J31/00—Cathode ray tubes; Electron beam tubes
- H01J31/08—Cathode ray tubes; Electron beam tubes having a screen on or from which an image or pattern is formed, picked up, converted, or stored
- H01J31/10—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes
- H01J31/12—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes with luminescent screen
- H01J31/128—Image or pattern display tubes, i.e. having electrical input and optical output; Flying-spot tubes for scanning purposes with luminescent screen provided with control means permitting the electron beam to reach selected parts of the screen, e.g. digitally controlled display tubes
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J2893/00—Discharge tubes and lamps
- H01J2893/0032—Tubes with variable amplification factor
Definitions
- Fig. 1 is a diagrammatic presentation in block form of the general arrangement of a cathode ray tube and control components therefor as contemplated by the present invention, wherein an electron beam from a suitable electron source is delivered throughout the horizontal dimension of an image screen by a deflection system comprising at least one deflection element arranged to accomplish such deflection in a plane substantially parallel and adjacent to the image screen, and wherein the electron beam is further delivered throughout the vertical dimension of the image screen by a deflection system comprising at least one deflection element arranged to deflect said beam toward said image screen.
- Fig. 2 is a schematic exploded perspective view of a monochrome cathode ray tube and associated components embodying certain features of the present invention, wherein the electron source is arranged to provide an electron beam in substantially parallel proximity with the viewing screen, wherein the horizontal sweep deflection system comprises a plurality of electrostatic deflection plates, the deflection control voltage to each of which is provided from a lineally arranged triode control tube comprising a variably spaced control grid, and wherein the vertical sweep deflection system comprises a plurality of electrostatic elongated plates arranged in a plane substantially parallel and slightly spaced from the viewing screen, the control voltages for said plurality of vertical sweep deflection plates being provided from a lineally arranged triode control tube comprising a variably spaced control grid.
- Fig. 4 is a schematic exploded perspective view of a further embodiment of the present invention as applied
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Cathode-Ray Tubes And Fluorescent Screens For Display (AREA)
- Testing, Inspecting, Measuring Of Stereoscopic Televisions And Televisions (AREA)
- Vessels, Lead-In Wires, Accessory Apparatuses For Cathode-Ray Tubes (AREA)
- Video Image Reproduction Devices For Color Tv Systems (AREA)
- Transforming Electric Information Into Light Information (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US396120A US2795731A (en) | 1953-05-19 | 1953-12-04 | Cathode ray tube |
| GB14168/54A GB794257A (en) | 1953-05-19 | 1954-05-14 | Improvements relating to cathode ray tubes |
| DEW14017A DE1055586B (de) | 1953-05-19 | 1954-05-18 | Kathodenstrahlroehre |
| FR1105904D FR1105904A (fr) | 1953-05-19 | 1954-05-18 | Tube électronique ou à rayons cathodiques perfectionné |
| NL187677A NL99232C (Direct) | 1953-05-19 | 1954-05-18 | |
| GB34058/54A GB801841A (en) | 1953-05-19 | 1954-11-24 | Improvements in or relating to cathode ray tubes |
| NL192942A NL112043C (Direct) | 1953-05-19 | 1954-12-04 | |
| FR1123600D FR1123600A (fr) | 1953-05-19 | 1954-12-04 | Dispositifs perfectionnés à décharge électrique d'espace |
| DEW15486A DE1126444B (de) | 1953-05-19 | 1954-12-04 | Kathodenstrahlroehre |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US794257XA | 1953-05-19 | 1953-05-19 | |
| US396120A US2795731A (en) | 1953-05-19 | 1953-12-04 | Cathode ray tube |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2795731A true US2795731A (en) | 1957-06-11 |
Family
ID=26761989
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US396120A Expired - Lifetime US2795731A (en) | 1953-05-19 | 1953-12-04 | Cathode ray tube |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2795731A (Direct) |
| DE (2) | DE1055586B (Direct) |
| FR (2) | FR1105904A (Direct) |
| GB (2) | GB794257A (Direct) |
| NL (2) | NL99232C (Direct) |
Cited By (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2858464A (en) * | 1955-09-26 | 1958-10-28 | Westinghouse Electric Corp | Cathode ray tube |
| US2863091A (en) * | 1956-03-07 | 1958-12-02 | Rca Corp | Flat tri-color kinescopes |
| US2872607A (en) * | 1956-10-25 | 1959-02-03 | Nat Res Dev | Magnetic electron lenses |
| US2877376A (en) * | 1955-09-06 | 1959-03-10 | Itt | Phosphor screen device |
| US2878417A (en) * | 1956-03-23 | 1959-03-17 | Nat Res Dev | Cathode ray tubes |
| US2879446A (en) * | 1956-02-08 | 1959-03-24 | Kaiser Ind Corp | Electronic device |
| US2880341A (en) * | 1955-03-14 | 1959-03-31 | Kaiser Ind Corp | Facsimile tube |
| US2880365A (en) * | 1955-08-29 | 1959-03-31 | Rca Corp | Simplified scanning means for flat type kinescope |
| US2926255A (en) * | 1956-10-25 | 1960-02-23 | Nat Res Dev | Electron lenses |
| US2928014A (en) * | 1955-05-02 | 1960-03-08 | Kaiser Ind Corp | Electronic device cathode ray tubes |
| US2930930A (en) * | 1957-05-03 | 1960-03-29 | Kaiser Ind Corp | Electronic device |
| US2935643A (en) * | 1957-05-31 | 1960-05-03 | Motorola Inc | Cathode ray tube |
| US2945974A (en) * | 1957-01-14 | 1960-07-19 | Kaiser Ind Corp | Electronic device |
| US2945982A (en) * | 1955-09-21 | 1960-07-19 | Kaiser Ind Corp | Electronic device |
| US2957097A (en) * | 1957-01-30 | 1960-10-18 | Philips Corp | Cathode ray tube |
| US2961575A (en) * | 1955-06-30 | 1960-11-22 | Zenith Radio Corp | Electron discharge device |
| US2965801A (en) * | 1954-12-23 | 1960-12-20 | Philips Corp | Method of and apparatus for position-selection, scanning and the like |
| US2967262A (en) * | 1956-07-30 | 1961-01-03 | Madey Richard | Multi-color display tube |
| US2978601A (en) * | 1957-12-12 | 1961-04-04 | Kaiser Ind Corp | Electronic control system |
| US2982875A (en) * | 1959-12-29 | 1961-05-02 | Nat Res Dev | Cathode ray tubes |
| US2997621A (en) * | 1956-04-04 | 1961-08-22 | Motorola Inc | Image display device |
| US2999957A (en) * | 1956-08-01 | 1961-09-12 | Philips Corp | Cathode ray tube |
| US3005127A (en) * | 1955-04-27 | 1961-10-17 | Kaiser Ind Corp | Electronic device |
| US3021387A (en) * | 1956-04-13 | 1962-02-13 | Rca Corp | Electrical display device |
| US3088047A (en) * | 1958-03-04 | 1963-04-30 | Philips Corp | Circuit arrangement for the formation of pulses |
| US3181027A (en) * | 1963-01-14 | 1965-04-27 | Video Color Corp | Multiple beam flat color television tube and sweep system therefor |
| US3205391A (en) * | 1957-11-18 | 1965-09-07 | Multi Tron Lab Inc | Negative-lens type deflection magnifying means for electron beam in cathode ray tubes |
| US3226596A (en) * | 1963-06-21 | 1965-12-28 | Kasperowicz Henry | Flat color cathode ray tube |
| US3226587A (en) * | 1960-01-28 | 1965-12-28 | Rca Corp | Cathode ray tube and magnetic deflection means therefor |
| US3313970A (en) * | 1964-06-29 | 1967-04-11 | William R Aiken | Flat cathode ray tube traversed by tunnel containing magnetic deflector |
| US3408456A (en) * | 1965-10-23 | 1968-10-29 | Leo A. Shanafelt | Method for providing high definition colored television image |
| US3531681A (en) * | 1968-06-25 | 1970-09-29 | Joseph T Harden Jr | Flat display tube and method |
| US4752721A (en) * | 1984-09-12 | 1988-06-21 | Matsushita Electric Industrial Co., Ltd. | Charged particle beam deflector and flat CRT using the same |
| US4853587A (en) * | 1987-03-02 | 1989-08-01 | U.S. Philips Corporation | Flat cathode ray display tube with periodic beam refocusing means |
| US4956575A (en) * | 1989-03-23 | 1990-09-11 | Chang Kern K N | Flat panel display with deflection modulation structure |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4374343A (en) | 1980-08-25 | 1983-02-15 | Rca Corporation | Thin kinescope and electron beam reflector therefor |
| GB2213632A (en) * | 1987-12-11 | 1989-08-16 | Philips Electronic Associated | Flat cathode ray tube display apparatus |
Citations (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB315362A (en) * | 1928-07-12 | 1930-07-24 | Koloman Tihanyi | Improvements in television apparatus |
| US1962873A (en) * | 1933-08-11 | 1934-06-12 | Rogers Radio Tubes Ltd | Cathode ray oscillograph |
| US2059575A (en) * | 1933-03-29 | 1936-11-03 | Western Electric Co | Electronic indicating device |
| US2071382A (en) * | 1937-02-23 | Electron discharge device | ||
| US2090001A (en) * | 1933-04-22 | 1937-08-17 | Allg Elek Citatz Ges Friedrich | Transversally controlled electron tube |
| US2211844A (en) * | 1934-10-30 | 1940-08-20 | Rca Corp | Cathode ray tube |
| US2307188A (en) * | 1940-11-30 | 1943-01-05 | Rca Corp | Television system |
| US2363962A (en) * | 1934-02-24 | 1944-11-28 | Rca Corp | High frequency apparatus |
| US2394196A (en) * | 1943-07-09 | 1946-02-05 | Curtis Engineering Company | Multiscale instrument indicating system |
| US2416914A (en) * | 1943-07-30 | 1947-03-04 | Rca Corp | Electron discharge device |
| US2449339A (en) * | 1945-11-13 | 1948-09-14 | Rca Corp | Cathode-ray tube |
| US2449558A (en) * | 1945-12-14 | 1948-09-21 | Harold H Lanier | Cathode-ray tube |
| US2513742A (en) * | 1947-08-08 | 1950-07-04 | Pinciroli Andrea | Oscillographic cathode-ray tube with cylindrical fluorescent screen |
| US2558019A (en) * | 1939-02-02 | 1951-06-26 | Products & Licensing Corp | Signal distributing system for television receiver tube having equal number of picture elements and cathode rays |
| US2563807A (en) * | 1945-03-07 | 1951-08-14 | Ericsson Telefon Ab L M | Electron discharge apparatus circuit |
| US2623190A (en) * | 1950-02-13 | 1952-12-23 | Solo S Roth | Color television system |
| US2641699A (en) * | 1948-03-27 | 1953-06-09 | Gloess Paul Francois Marie | Multiplex pulse time modulation system |
| US2642535A (en) * | 1946-10-18 | 1953-06-16 | Rca Corp | Mass spectrometer |
| US2672573A (en) * | 1951-03-15 | 1954-03-16 | Nat Union Radio Corp | Beam shift electron tube |
| US2692532A (en) * | 1951-04-04 | 1954-10-26 | Chromatic Television Lab Inc | Cathode ray focusing apparatus |
| US2711493A (en) * | 1951-06-29 | 1955-06-21 | Chromatic Television Lab Inc | Direct-view color tube |
| US2711478A (en) * | 1952-04-18 | 1955-06-21 | Guenther H Krawinkel | Storing electrical signals and transferring the stored signals into a different circuit |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE418068A (Direct) * | 1935-10-25 | |||
| DE862186C (de) * | 1942-03-10 | 1953-01-08 | Atlas Werke Ag | Messeinrichtung mit Kathodenstrahlrohr |
| NL90351C (Direct) | 1952-09-15 |
-
1953
- 1953-12-04 US US396120A patent/US2795731A/en not_active Expired - Lifetime
-
1954
- 1954-05-14 GB GB14168/54A patent/GB794257A/en not_active Expired
- 1954-05-18 DE DEW14017A patent/DE1055586B/de active Pending
- 1954-05-18 FR FR1105904D patent/FR1105904A/fr not_active Expired
- 1954-05-18 NL NL187677A patent/NL99232C/xx active
- 1954-11-24 GB GB34058/54A patent/GB801841A/en not_active Expired
- 1954-12-04 DE DEW15486A patent/DE1126444B/de active Pending
- 1954-12-04 NL NL192942A patent/NL112043C/xx active
- 1954-12-04 FR FR1123600D patent/FR1123600A/fr not_active Expired
Patent Citations (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2071382A (en) * | 1937-02-23 | Electron discharge device | ||
| GB315362A (en) * | 1928-07-12 | 1930-07-24 | Koloman Tihanyi | Improvements in television apparatus |
| US2059575A (en) * | 1933-03-29 | 1936-11-03 | Western Electric Co | Electronic indicating device |
| US2090001A (en) * | 1933-04-22 | 1937-08-17 | Allg Elek Citatz Ges Friedrich | Transversally controlled electron tube |
| US1962873A (en) * | 1933-08-11 | 1934-06-12 | Rogers Radio Tubes Ltd | Cathode ray oscillograph |
| US2363962A (en) * | 1934-02-24 | 1944-11-28 | Rca Corp | High frequency apparatus |
| US2211844A (en) * | 1934-10-30 | 1940-08-20 | Rca Corp | Cathode ray tube |
| US2558019A (en) * | 1939-02-02 | 1951-06-26 | Products & Licensing Corp | Signal distributing system for television receiver tube having equal number of picture elements and cathode rays |
| US2307188A (en) * | 1940-11-30 | 1943-01-05 | Rca Corp | Television system |
| US2394196A (en) * | 1943-07-09 | 1946-02-05 | Curtis Engineering Company | Multiscale instrument indicating system |
| US2416914A (en) * | 1943-07-30 | 1947-03-04 | Rca Corp | Electron discharge device |
| US2563807A (en) * | 1945-03-07 | 1951-08-14 | Ericsson Telefon Ab L M | Electron discharge apparatus circuit |
| US2449339A (en) * | 1945-11-13 | 1948-09-14 | Rca Corp | Cathode-ray tube |
| US2449558A (en) * | 1945-12-14 | 1948-09-21 | Harold H Lanier | Cathode-ray tube |
| US2642535A (en) * | 1946-10-18 | 1953-06-16 | Rca Corp | Mass spectrometer |
| US2513742A (en) * | 1947-08-08 | 1950-07-04 | Pinciroli Andrea | Oscillographic cathode-ray tube with cylindrical fluorescent screen |
| US2641699A (en) * | 1948-03-27 | 1953-06-09 | Gloess Paul Francois Marie | Multiplex pulse time modulation system |
| US2623190A (en) * | 1950-02-13 | 1952-12-23 | Solo S Roth | Color television system |
| US2672573A (en) * | 1951-03-15 | 1954-03-16 | Nat Union Radio Corp | Beam shift electron tube |
| US2692532A (en) * | 1951-04-04 | 1954-10-26 | Chromatic Television Lab Inc | Cathode ray focusing apparatus |
| US2711493A (en) * | 1951-06-29 | 1955-06-21 | Chromatic Television Lab Inc | Direct-view color tube |
| US2711478A (en) * | 1952-04-18 | 1955-06-21 | Guenther H Krawinkel | Storing electrical signals and transferring the stored signals into a different circuit |
Cited By (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2965801A (en) * | 1954-12-23 | 1960-12-20 | Philips Corp | Method of and apparatus for position-selection, scanning and the like |
| US2880341A (en) * | 1955-03-14 | 1959-03-31 | Kaiser Ind Corp | Facsimile tube |
| US3005127A (en) * | 1955-04-27 | 1961-10-17 | Kaiser Ind Corp | Electronic device |
| US2928014A (en) * | 1955-05-02 | 1960-03-08 | Kaiser Ind Corp | Electronic device cathode ray tubes |
| US2961575A (en) * | 1955-06-30 | 1960-11-22 | Zenith Radio Corp | Electron discharge device |
| US2880365A (en) * | 1955-08-29 | 1959-03-31 | Rca Corp | Simplified scanning means for flat type kinescope |
| US2877376A (en) * | 1955-09-06 | 1959-03-10 | Itt | Phosphor screen device |
| US2945982A (en) * | 1955-09-21 | 1960-07-19 | Kaiser Ind Corp | Electronic device |
| US2858464A (en) * | 1955-09-26 | 1958-10-28 | Westinghouse Electric Corp | Cathode ray tube |
| US2879446A (en) * | 1956-02-08 | 1959-03-24 | Kaiser Ind Corp | Electronic device |
| US2863091A (en) * | 1956-03-07 | 1958-12-02 | Rca Corp | Flat tri-color kinescopes |
| US2878417A (en) * | 1956-03-23 | 1959-03-17 | Nat Res Dev | Cathode ray tubes |
| US2997621A (en) * | 1956-04-04 | 1961-08-22 | Motorola Inc | Image display device |
| US3021387A (en) * | 1956-04-13 | 1962-02-13 | Rca Corp | Electrical display device |
| US2967262A (en) * | 1956-07-30 | 1961-01-03 | Madey Richard | Multi-color display tube |
| US2999957A (en) * | 1956-08-01 | 1961-09-12 | Philips Corp | Cathode ray tube |
| US2926255A (en) * | 1956-10-25 | 1960-02-23 | Nat Res Dev | Electron lenses |
| US2872607A (en) * | 1956-10-25 | 1959-02-03 | Nat Res Dev | Magnetic electron lenses |
| US2945974A (en) * | 1957-01-14 | 1960-07-19 | Kaiser Ind Corp | Electronic device |
| US2957097A (en) * | 1957-01-30 | 1960-10-18 | Philips Corp | Cathode ray tube |
| US2930930A (en) * | 1957-05-03 | 1960-03-29 | Kaiser Ind Corp | Electronic device |
| US2935643A (en) * | 1957-05-31 | 1960-05-03 | Motorola Inc | Cathode ray tube |
| US3205391A (en) * | 1957-11-18 | 1965-09-07 | Multi Tron Lab Inc | Negative-lens type deflection magnifying means for electron beam in cathode ray tubes |
| US2978601A (en) * | 1957-12-12 | 1961-04-04 | Kaiser Ind Corp | Electronic control system |
| US3088047A (en) * | 1958-03-04 | 1963-04-30 | Philips Corp | Circuit arrangement for the formation of pulses |
| US2982875A (en) * | 1959-12-29 | 1961-05-02 | Nat Res Dev | Cathode ray tubes |
| US3226587A (en) * | 1960-01-28 | 1965-12-28 | Rca Corp | Cathode ray tube and magnetic deflection means therefor |
| US3181027A (en) * | 1963-01-14 | 1965-04-27 | Video Color Corp | Multiple beam flat color television tube and sweep system therefor |
| US3226596A (en) * | 1963-06-21 | 1965-12-28 | Kasperowicz Henry | Flat color cathode ray tube |
| US3313970A (en) * | 1964-06-29 | 1967-04-11 | William R Aiken | Flat cathode ray tube traversed by tunnel containing magnetic deflector |
| US3408456A (en) * | 1965-10-23 | 1968-10-29 | Leo A. Shanafelt | Method for providing high definition colored television image |
| US3531681A (en) * | 1968-06-25 | 1970-09-29 | Joseph T Harden Jr | Flat display tube and method |
| US4752721A (en) * | 1984-09-12 | 1988-06-21 | Matsushita Electric Industrial Co., Ltd. | Charged particle beam deflector and flat CRT using the same |
| US4853587A (en) * | 1987-03-02 | 1989-08-01 | U.S. Philips Corporation | Flat cathode ray display tube with periodic beam refocusing means |
| US4956575A (en) * | 1989-03-23 | 1990-09-11 | Chang Kern K N | Flat panel display with deflection modulation structure |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1055586B (de) | 1959-04-23 |
| GB801841A (en) | 1958-09-24 |
| NL112043C (Direct) | 1965-11-15 |
| DE1126444B (de) | 1962-03-29 |
| FR1105904A (fr) | 1955-12-09 |
| FR1123600A (fr) | 1956-09-24 |
| NL99232C (Direct) | 1961-10-16 |
| GB794257A (en) | 1958-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2795731A (en) | Cathode ray tube | |
| US2549072A (en) | Recording apparatus for radar systems | |
| US2165028A (en) | Television and the like system employing cathode ray tubes | |
| US2764628A (en) | Television | |
| US2572858A (en) | Electron optical system | |
| US2742589A (en) | Electron beam convergence apparatus | |
| US2498705A (en) | Electronic color television | |
| US3852640A (en) | Cathode ray tube circuit | |
| US3921025A (en) | Dual-beam CRT with vertical trace bowing correction means | |
| US3930120A (en) | Multi-beam cathode ray tube having equalized line brightness | |
| US2687493A (en) | Dynamic electron beam control system | |
| US3860849A (en) | Channel plate with color selection electrodes and color phosphors | |
| US2961575A (en) | Electron discharge device | |
| US3548248A (en) | Misconvergence compensation for single gun,plural beam type color tv picture tube | |
| US2737609A (en) | Electron beam convergence systems | |
| US2831918A (en) | Color image reproducing apparatus | |
| US2997621A (en) | Image display device | |
| US2749473A (en) | Beam convergence system for tri-color kinescope | |
| US3258643A (en) | Electron beam convergence apparatus | |
| US2863939A (en) | Color receiver | |
| US3787609A (en) | Electronic color filter system | |
| US2904722A (en) | Electronic control system | |
| US2714688A (en) | Image-reproducing device | |
| US2804495A (en) | Color television transmitting system | |
| US3284658A (en) | Symbol generating tube having target matrix with conducting elements |