TW416963B - Stabilized adhesive microspheres - Google Patents
Stabilized adhesive microspheres Download PDFInfo
- Publication number
- TW416963B TW416963B TW086113618A TW86113618A TW416963B TW 416963 B TW416963 B TW 416963B TW 086113618 A TW086113618 A TW 086113618A TW 86113618 A TW86113618 A TW 86113618A TW 416963 B TW416963 B TW 416963B
- Authority
- TW
- Taiwan
- Prior art keywords
- parts
- weight
- microspheres
- patent application
- amount
- Prior art date
Links
- 239000004005 microsphere Substances 0.000 title claims abstract description 150
- 230000001070 adhesive effect Effects 0.000 title claims abstract description 70
- 239000000853 adhesive Substances 0.000 title claims abstract description 69
- 239000000178 monomer Substances 0.000 claims abstract description 103
- 239000000203 mixture Substances 0.000 claims abstract description 49
- 238000006116 polymerization reaction Methods 0.000 claims abstract description 48
- 239000002904 solvent Substances 0.000 claims abstract description 32
- 239000000654 additive Substances 0.000 claims abstract description 29
- 239000003607 modifier Substances 0.000 claims abstract description 27
- 239000007858 starting material Substances 0.000 claims abstract description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 25
- 239000003999 initiator Substances 0.000 claims abstract description 21
- 239000003381 stabilizer Substances 0.000 claims abstract description 21
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 claims abstract description 20
- 239000004094 surface-active agent Substances 0.000 claims abstract description 16
- 230000000996 additive effect Effects 0.000 claims abstract description 15
- 230000002209 hydrophobic effect Effects 0.000 claims abstract description 14
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims abstract description 13
- 239000012986 chain transfer agent Substances 0.000 claims abstract description 11
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 5
- 239000000376 reactant Substances 0.000 claims abstract description 4
- -1 Methyl-N- (methyl-methacryloxyethyl) ammonium propionate Chemical compound 0.000 claims description 47
- 239000000463 material Substances 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 24
- 239000000725 suspension Substances 0.000 claims description 23
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 20
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 20
- 229920002554 vinyl polymer Polymers 0.000 claims description 19
- 239000003795 chemical substances by application Substances 0.000 claims description 17
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 230000002079 cooperative effect Effects 0.000 claims description 14
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 12
- 239000007900 aqueous suspension Substances 0.000 claims description 12
- 239000000052 vinegar Substances 0.000 claims description 12
- 235000021419 vinegar Nutrition 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 235000019260 propionic acid Nutrition 0.000 claims description 9
- 238000003756 stirring Methods 0.000 claims description 9
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 8
- 239000004014 plasticizer Substances 0.000 claims description 8
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 claims description 7
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 235000015170 shellfish Nutrition 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 5
- 239000005977 Ethylene Substances 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- CUXGDKOCSSIRKK-UHFFFAOYSA-N 7-methyloctyl prop-2-enoate Chemical compound CC(C)CCCCCCOC(=O)C=C CUXGDKOCSSIRKK-UHFFFAOYSA-N 0.000 claims description 4
- 125000005907 alkyl ester group Chemical group 0.000 claims description 4
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N fluorene Chemical group C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 claims description 4
- PSGCQDPCAWOCSH-UHFFFAOYSA-N (4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl) prop-2-enoate Chemical class C1CC2(C)C(OC(=O)C=C)CC1C2(C)C PSGCQDPCAWOCSH-UHFFFAOYSA-N 0.000 claims description 3
- LVGFPWDANALGOY-UHFFFAOYSA-N 8-methylnonyl prop-2-enoate Chemical compound CC(C)CCCCCCCOC(=O)C=C LVGFPWDANALGOY-UHFFFAOYSA-N 0.000 claims description 3
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims description 3
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 229960003237 betaine Drugs 0.000 claims description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical group 0.000 claims description 3
- 150000001735 carboxylic acids Chemical class 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 150000002170 ethers Chemical class 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 238000012986 modification Methods 0.000 claims description 3
- 230000004048 modification Effects 0.000 claims description 3
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 claims description 3
- CFGGNXFNDNQZKD-UHFFFAOYSA-N 2-(9H-fluoren-1-yl)prop-2-enoic acid Chemical compound C1C2=CC=CC=C2C2=C1C(C(=C)C(=O)O)=CC=C2 CFGGNXFNDNQZKD-UHFFFAOYSA-N 0.000 claims description 2
- ZTJLYUVAFAMUKO-UHFFFAOYSA-N 2-phenylethanesulfonic acid Chemical group OS(=O)(=O)CCC1=CC=CC=C1 ZTJLYUVAFAMUKO-UHFFFAOYSA-N 0.000 claims description 2
- BVDBXCXQMHBGQM-UHFFFAOYSA-N 4-methylpentan-2-yl prop-2-enoate Chemical compound CC(C)CC(C)OC(=O)C=C BVDBXCXQMHBGQM-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N allylamine Natural products NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 claims description 2
- 229940017219 methyl propionate Drugs 0.000 claims description 2
- SONHXMAHPHADTF-UHFFFAOYSA-M sodium;2-methylprop-2-enoate Chemical compound [Na+].CC(=C)C([O-])=O SONHXMAHPHADTF-UHFFFAOYSA-M 0.000 claims description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 claims 5
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 claims 2
- 125000002947 alkylene group Chemical group 0.000 claims 2
- 125000005670 ethenylalkyl group Chemical class 0.000 claims 2
- 150000002430 hydrocarbons Chemical group 0.000 claims 2
- GYSCBCSGKXNZRH-UHFFFAOYSA-N 1-benzothiophene-2-carboxamide Chemical compound C1=CC=C2SC(C(=O)N)=CC2=C1 GYSCBCSGKXNZRH-UHFFFAOYSA-N 0.000 claims 1
- XHZPRMZZQOIPDS-UHFFFAOYSA-N 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid Chemical group OS(=O)(=O)CC(C)(C)NC(=O)C=C XHZPRMZZQOIPDS-UHFFFAOYSA-N 0.000 claims 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 claims 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 claims 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 claims 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 claims 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-N Decanoic acid Natural products CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 claims 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 claims 1
- 150000001993 dienes Chemical class 0.000 claims 1
- 125000001072 heteroaryl group Chemical group 0.000 claims 1
- 150000002466 imines Chemical class 0.000 claims 1
- 239000004922 lacquer Substances 0.000 claims 1
- XQYMIMUDVJCMLU-UHFFFAOYSA-N phenoxyperoxybenzene Chemical compound C=1C=CC=CC=1OOOC1=CC=CC=C1 XQYMIMUDVJCMLU-UHFFFAOYSA-N 0.000 claims 1
- BOQSSGDQNWEFSX-UHFFFAOYSA-N propan-2-yl 2-methylprop-2-enoate Chemical compound CC(C)OC(=O)C(C)=C BOQSSGDQNWEFSX-UHFFFAOYSA-N 0.000 claims 1
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 28
- 239000002245 particle Substances 0.000 description 27
- 239000007787 solid Substances 0.000 description 23
- 229920000642 polymer Polymers 0.000 description 19
- 239000000243 solution Substances 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 14
- 239000000758 substrate Substances 0.000 description 13
- 238000012546 transfer Methods 0.000 description 12
- 238000000576 coating method Methods 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000011248 coating agent Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 238000010557 suspension polymerization reaction Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- 238000005054 agglomeration Methods 0.000 description 6
- 230000002776 aggregation Effects 0.000 description 6
- 239000003431 cross linking reagent Substances 0.000 description 6
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 5
- 238000013019 agitation Methods 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 230000000977 initiatory effect Effects 0.000 description 5
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 5
- 150000003254 radicals Chemical class 0.000 description 5
- 238000010558 suspension polymerization method Methods 0.000 description 5
- 102100026735 Coagulation factor VIII Human genes 0.000 description 4
- 101000911390 Homo sapiens Coagulation factor VIII Proteins 0.000 description 4
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 4
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 4
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 4
- 239000001913 cellulose Substances 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- 230000015271 coagulation Effects 0.000 description 4
- 238000005345 coagulation Methods 0.000 description 4
- 239000008367 deionised water Substances 0.000 description 4
- 229910021641 deionized water Inorganic materials 0.000 description 4
- 238000006392 deoxygenation reaction Methods 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 150000003871 sulfonates Chemical class 0.000 description 4
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 4
- DSCFFEYYQKSRSV-UHFFFAOYSA-N 1L-O1-methyl-muco-inositol Natural products COC1C(O)C(O)C(O)C(O)C1O DSCFFEYYQKSRSV-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical class O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920002125 Sokalan® Polymers 0.000 description 3
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 239000011324 bead Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000007720 emulsion polymerization reaction Methods 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 230000009477 glass transition Effects 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 239000006254 rheological additive Substances 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 229920001567 vinyl ester resin Polymers 0.000 description 3
- 239000002023 wood Substances 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- GXOXQGQKQSQBCV-UHFFFAOYSA-N 2-ethenyldecanoic acid Chemical class CCCCCCCCC(C=C)C(O)=O GXOXQGQKQSQBCV-UHFFFAOYSA-N 0.000 description 2
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical class OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 2
- IRLPACMLTUPBCL-KQYNXXCUSA-N 5'-adenylyl sulfate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OS(O)(=O)=O)[C@@H](O)[C@H]1O IRLPACMLTUPBCL-KQYNXXCUSA-N 0.000 description 2
- AIAMDEVDYXNNEU-UHFFFAOYSA-N 6-methylheptyl propanoate Chemical compound CCC(=O)OCCCCCC(C)C AIAMDEVDYXNNEU-UHFFFAOYSA-N 0.000 description 2
- IBPADELTPKRSCQ-UHFFFAOYSA-N 9h-fluoren-1-yl prop-2-enoate Chemical compound C1C2=CC=CC=C2C2=C1C(OC(=O)C=C)=CC=C2 IBPADELTPKRSCQ-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- VUIOYIORMDUADH-UHFFFAOYSA-J C(=O)([O-])OC(=O)OC(=O)OC(=O)[O-].[C+4].C(=O)([O-])OC(=O)OC(=O)OC(=O)[O-] Chemical compound C(=O)([O-])OC(=O)OC(=O)OC(=O)[O-].[C+4].C(=O)([O-])OC(=O)OC(=O)OC(=O)[O-] VUIOYIORMDUADH-UHFFFAOYSA-J 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- DICUPLXUNISGAQ-UHFFFAOYSA-N Isooctyl acetate Chemical compound CC(C)CCCCCOC(C)=O DICUPLXUNISGAQ-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 229910052770 Uranium Inorganic materials 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 125000005396 acrylic acid ester group Chemical group 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000003093 cationic surfactant Substances 0.000 description 2
- 239000000919 ceramic Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N dodecane Chemical compound CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- OVRWSOABJJYTBD-UHFFFAOYSA-N dodecylazanium;sulfate Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCN.CCCCCCCCCCCCN OVRWSOABJJYTBD-UHFFFAOYSA-N 0.000 description 2
- 230000009977 dual effect Effects 0.000 description 2
- GLVVKKSPKXTQRB-UHFFFAOYSA-N ethenyl dodecanoate Chemical compound CCCCCCCCCCCC(=O)OC=C GLVVKKSPKXTQRB-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000002563 ionic surfactant Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- XAOGXQMKWQFZEM-UHFFFAOYSA-N isoamyl propanoate Chemical compound CCC(=O)OCCC(C)C XAOGXQMKWQFZEM-UHFFFAOYSA-N 0.000 description 2
- 239000004816 latex Substances 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 150000002894 organic compounds Chemical group 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000003921 particle size analysis Methods 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 239000004584 polyacrylic acid Substances 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 238000010526 radical polymerization reaction Methods 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- MNCGMVDMOKPCSQ-UHFFFAOYSA-M sodium;2-phenylethenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C=CC1=CC=CC=C1 MNCGMVDMOKPCSQ-UHFFFAOYSA-M 0.000 description 2
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 2
- 230000006641 stabilisation Effects 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical class CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 description 1
- PSBDWGZCVUAZQS-UHFFFAOYSA-N (dimethylsulfonio)acetate Chemical compound C[S+](C)CC([O-])=O PSBDWGZCVUAZQS-UHFFFAOYSA-N 0.000 description 1
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- FWUIHQFQLSWYED-ONEGZZNKSA-N (e)-4-oxo-4-propan-2-yloxybut-2-enoic acid Chemical compound CC(C)OC(=O)\C=C\C(O)=O FWUIHQFQLSWYED-ONEGZZNKSA-N 0.000 description 1
- IQSMZLGOFYVLJP-UHFFFAOYSA-N 1-(2-phenylethyl)pyrene Chemical compound C=1C=C(C2=C34)C=CC3=CC=CC4=CC=C2C=1CCC1=CC=CC=C1 IQSMZLGOFYVLJP-UHFFFAOYSA-N 0.000 description 1
- KWVGIHKZDCUPEU-UHFFFAOYSA-N 2,2-dimethoxy-2-phenylacetophenone Chemical compound C=1C=CC=CC=1C(OC)(OC)C(=O)C1=CC=CC=C1 KWVGIHKZDCUPEU-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- RZRILSWMGXWSJY-UHFFFAOYSA-N 2-[bis(2-hydroxyethyl)amino]ethanol;sulfuric acid Chemical compound OS(O)(=O)=O.OCCN(CCO)CCO RZRILSWMGXWSJY-UHFFFAOYSA-N 0.000 description 1
- LJKDOMVGKKPJBH-UHFFFAOYSA-N 2-ethylhexyl dihydrogen phosphate Chemical compound CCCCC(CC)COP(O)(O)=O LJKDOMVGKKPJBH-UHFFFAOYSA-N 0.000 description 1
- NLGDWWCZQDIASO-UHFFFAOYSA-N 2-hydroxy-1-(7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-yl)-2-phenylethanone Chemical compound OC(C(=O)c1cccc2Oc12)c1ccccc1 NLGDWWCZQDIASO-UHFFFAOYSA-N 0.000 description 1
- SQVSEQUIWOQWAH-UHFFFAOYSA-N 2-hydroxy-3-(2-methylprop-2-enoyloxy)propane-1-sulfonic acid Chemical compound CC(=C)C(=O)OCC(O)CS(O)(=O)=O SQVSEQUIWOQWAH-UHFFFAOYSA-N 0.000 description 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-M 2-methylbutyrate Chemical compound CCC(C)C([O-])=O WLAMNBDJUVNPJU-UHFFFAOYSA-M 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- DXIJHCSGLOHNES-UHFFFAOYSA-N 3,3-dimethylbut-1-enylbenzene Chemical compound CC(C)(C)C=CC1=CC=CC=C1 DXIJHCSGLOHNES-UHFFFAOYSA-N 0.000 description 1
- MAGFQRLKWCCTQJ-UHFFFAOYSA-N 4-ethenylbenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=C(C=C)C=C1 MAGFQRLKWCCTQJ-UHFFFAOYSA-N 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- OPRCENGOKJIGQF-UHFFFAOYSA-N 4-prop-2-enoyloxybutane-1-sulfonic acid Chemical compound OS(=O)(=O)CCCCOC(=O)C=C OPRCENGOKJIGQF-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229940122361 Bisphosphonate Drugs 0.000 description 1
- PUSHKFZARGFRAP-UHFFFAOYSA-N C1(=CC=CC=2C3=CC=CC=C3CC12)C(C#N)=C Chemical compound C1(=CC=CC=2C3=CC=CC=C3CC12)C(C#N)=C PUSHKFZARGFRAP-UHFFFAOYSA-N 0.000 description 1
- GQXNIZNAGDXVOP-UHFFFAOYSA-N C1(=CC=CC=C1)CCOC(C)=O.[Na] Chemical compound C1(=CC=CC=C1)CCOC(C)=O.[Na] GQXNIZNAGDXVOP-UHFFFAOYSA-N 0.000 description 1
- 101150030072 CNTF gene Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 229920001661 Chitosan Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- MAMMVUWCKMOLSG-UHFFFAOYSA-N Cyclohexyl propionate Chemical compound CCC(=O)OC1CCCCC1 MAMMVUWCKMOLSG-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Divinylene sulfide Natural products C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 1
- 229920001875 Ebonite Polymers 0.000 description 1
- YXAGIRHBJJLWHW-UHFFFAOYSA-N Ethyl 2-ethylhexanoate Chemical compound CCCCC(CC)C(=O)OCC YXAGIRHBJJLWHW-UHFFFAOYSA-N 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ICMAFTSLXCXHRK-UHFFFAOYSA-N Ethyl pentanoate Chemical compound CCCCC(=O)OCC ICMAFTSLXCXHRK-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 108010068370 Glutens Proteins 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 244000147568 Laurus nobilis Species 0.000 description 1
- 235000017858 Laurus nobilis Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910052765 Lutetium Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- 241000282376 Panthera tigris Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 235000005212 Terminalia tomentosa Nutrition 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- MLFHJEHSLIIPHL-UHFFFAOYSA-N acetic acid isopentyl ester Natural products CC(C)CCOC(C)=O MLFHJEHSLIIPHL-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- YBCVMFKXIKNREZ-UHFFFAOYSA-N acoh acetic acid Chemical compound CC(O)=O.CC(O)=O YBCVMFKXIKNREZ-UHFFFAOYSA-N 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000005529 alkyleneoxy group Chemical group 0.000 description 1
- 229940039409 ammonium valerate Drugs 0.000 description 1
- 239000012874 anionic emulsifier Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 229930010859 axane Natural products 0.000 description 1
- OPVLOHUACNWTQT-UHFFFAOYSA-N azane;2-dodecoxyethyl hydrogen sulfate Chemical compound N.CCCCCCCCCCCCOCCOS(O)(=O)=O OPVLOHUACNWTQT-UHFFFAOYSA-N 0.000 description 1
- WPKYZIPODULRBM-UHFFFAOYSA-N azane;prop-2-enoic acid Chemical compound N.OC(=O)C=C WPKYZIPODULRBM-UHFFFAOYSA-N 0.000 description 1
- XJMWHXZUIGHOBA-UHFFFAOYSA-N azane;propanoic acid Chemical compound N.CCC(O)=O XJMWHXZUIGHOBA-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- NZQQFMVULBBDSP-FPLPWBNLSA-N bis(4-methylpentan-2-yl) (z)-but-2-enedioate Chemical compound CC(C)CC(C)OC(=O)\C=C/C(=O)OC(C)CC(C)C NZQQFMVULBBDSP-FPLPWBNLSA-N 0.000 description 1
- 150000004663 bisphosphonates Chemical class 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- ZRBGYWKZMWPOEK-UHFFFAOYSA-N butanoic acid;prop-2-enoic acid Chemical compound OC(=O)C=C.CCCC(O)=O ZRBGYWKZMWPOEK-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- BTMVHUNTONAYDX-UHFFFAOYSA-N butyl propionate Chemical compound CCCCOC(=O)CC BTMVHUNTONAYDX-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 235000013351 cheese Nutrition 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000007607 die coating method Methods 0.000 description 1
- VVSMKOFFCAJOSC-UHFFFAOYSA-L disodium;dodecylbenzene;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCCCC1=CC=CC=C1 VVSMKOFFCAJOSC-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000009881 electrostatic interaction Effects 0.000 description 1
- IGBZOHMCHDADGY-UHFFFAOYSA-N ethenyl 2-ethylhexanoate Chemical compound CCCCC(CC)C(=O)OC=C IGBZOHMCHDADGY-UHFFFAOYSA-N 0.000 description 1
- CMDXMIHZUJPRHG-UHFFFAOYSA-N ethenyl decanoate Chemical compound CCCCCCCCCC(=O)OC=C CMDXMIHZUJPRHG-UHFFFAOYSA-N 0.000 description 1
- LZWYWAIOTBEZFN-UHFFFAOYSA-N ethenyl hexanoate Chemical compound CCCCCC(=O)OC=C LZWYWAIOTBEZFN-UHFFFAOYSA-N 0.000 description 1
- NWJTZFZQVYJIHU-UHFFFAOYSA-N ethenyl nonanoate Chemical compound CCCCCCCCC(=O)OC=C NWJTZFZQVYJIHU-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical class CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 125000005909 ethyl alcohol group Chemical group 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- HCIQUGMKXQZZMG-UHFFFAOYSA-N ethyl hexyl hydrogen phosphate Chemical compound CCCCCCOP(O)(=O)OCC HCIQUGMKXQZZMG-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 235000021312 gluten Nutrition 0.000 description 1
- HQLZFBUAULNEGP-UHFFFAOYSA-N hexan-3-amine Chemical compound CCCC(N)CC HQLZFBUAULNEGP-UHFFFAOYSA-N 0.000 description 1
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- SYJRVVFAAIUVDH-UHFFFAOYSA-N ipa isopropanol Chemical compound CC(C)O.CC(C)O SYJRVVFAAIUVDH-UHFFFAOYSA-N 0.000 description 1
- 229940117955 isoamyl acetate Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- XBTYSBUGTSUGJM-UHFFFAOYSA-N methyl prop-2-enoate;sodium Chemical compound [Na].COC(=O)C=C XBTYSBUGTSUGJM-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- ZUHZZVMEUAUWHY-UHFFFAOYSA-N n,n-dimethylpropan-1-amine Chemical compound CCCN(C)C ZUHZZVMEUAUWHY-UHFFFAOYSA-N 0.000 description 1
- GNVRJGIVDSQCOP-UHFFFAOYSA-N n-ethyl-n-methylethanamine Chemical compound CCN(C)CC GNVRJGIVDSQCOP-UHFFFAOYSA-N 0.000 description 1
- HRYADLYDADNZHC-UHFFFAOYSA-N n-ethylethanamine;prop-2-enoic acid Chemical compound CC[NH2+]CC.[O-]C(=O)C=C HRYADLYDADNZHC-UHFFFAOYSA-N 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 229920002114 octoxynol-9 Polymers 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- ULDDEWDFUNBUCM-UHFFFAOYSA-N pentyl prop-2-enoate Chemical compound CCCCCOC(=O)C=C ULDDEWDFUNBUCM-UHFFFAOYSA-N 0.000 description 1
- WCNLCIJMFAJCPX-UHFFFAOYSA-N pethidine hydrochloride Chemical compound Cl.C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 WCNLCIJMFAJCPX-UHFFFAOYSA-N 0.000 description 1
- CTYRPMDGLDAWRQ-UHFFFAOYSA-N phenyl hydrogen sulfate Chemical compound OS(=O)(=O)OC1=CC=CC=C1 CTYRPMDGLDAWRQ-UHFFFAOYSA-N 0.000 description 1
- 229920002401 polyacrylamide Chemical class 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920006254 polymer film Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- OCXNFVQUCDFUIG-UHFFFAOYSA-N propan-2-ol;prop-1-ene Chemical compound CC=C.CC(C)O OCXNFVQUCDFUIG-UHFFFAOYSA-N 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- MCSINKKTEDDPNK-UHFFFAOYSA-N propyl propionate Chemical compound CCCOC(=O)CC MCSINKKTEDDPNK-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- CFVUYTFLYMKIAG-UHFFFAOYSA-M sodium 2-phenylethanesulfonate Chemical compound C1(=CC=CC=C1)CCS(=O)(=O)[O-].[Na+] CFVUYTFLYMKIAG-UHFFFAOYSA-M 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 229940080236 sodium cetyl sulfate Drugs 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- GGHPAKFFUZUEKL-UHFFFAOYSA-M sodium;hexadecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCCCOS([O-])(=O)=O GGHPAKFFUZUEKL-UHFFFAOYSA-M 0.000 description 1
- JJMIAJGBZGZNHA-UHFFFAOYSA-N sodium;styrene Chemical compound [Na].C=CC1=CC=CC=C1 JJMIAJGBZGZNHA-UHFFFAOYSA-N 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 239000002594 sorbent Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 229940117986 sulfobetaine Drugs 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- SJMYWORNLPSJQO-UHFFFAOYSA-N tert-butyl 2-methylprop-2-enoate Chemical group CC(=C)C(=O)OC(C)(C)C SJMYWORNLPSJQO-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- 229940080117 triethanolamine sulfate Drugs 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical class OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- 239000002759 woven fabric Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J4/00—Adhesives based on organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond ; adhesives, based on monomers of macromolecular compounds of groups C09J183/00 - C09J183/16
- C09J4/06—Organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond in combination with a macromolecular compound other than an unsaturated polymer of groups C09J159/00 - C09J187/00
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08J—WORKING-UP; GENERAL PROCESSES OF COMPOUNDING; AFTER-TREATMENT NOT COVERED BY SUBCLASSES C08B, C08C, C08F, C08G or C08H
- C08J9/00—Working-up of macromolecular substances to porous or cellular articles or materials; After-treatment thereof
- C08J9/16—Making expandable particles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
- Graft Or Block Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/731,351 US5756625A (en) | 1996-10-11 | 1996-10-11 | Stabilized adhesive microspheres |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TW416963B true TW416963B (en) | 2001-01-01 |
Family
ID=24939135
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW086113618A TW416963B (en) | 1996-10-11 | 1997-09-19 | Stabilized adhesive microspheres |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US5756625A (enExample) |
| EP (1) | EP0931115B1 (enExample) |
| JP (1) | JP2001503087A (enExample) |
| KR (1) | KR20000049003A (enExample) |
| AU (1) | AU720856B2 (enExample) |
| CA (1) | CA2268149A1 (enExample) |
| DE (1) | DE69713120T2 (enExample) |
| SI (1) | SI20078A (enExample) |
| TW (1) | TW416963B (enExample) |
| WO (1) | WO1998016591A1 (enExample) |
Families Citing this family (73)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19700078A1 (de) | 1997-01-03 | 1998-07-09 | Huels Chemische Werke Ag | Herstellung von polymeren Materialien mit zellproliferationsbegünstigenden Eigenschaften |
| US6218492B1 (en) * | 1997-01-03 | 2001-04-17 | Huels Aktiengesellschaft | Water insoluble bacteriophobic polymers containing carboxyl and sulfonic acid groups |
| US6296932B1 (en) * | 1998-12-14 | 2001-10-02 | 3M Innovative Properties Company | Microsphere adhesive coated article for use with coated papers |
| US6713414B1 (en) | 2000-05-04 | 2004-03-30 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6579570B1 (en) | 2000-05-04 | 2003-06-17 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6423804B1 (en) | 1998-12-31 | 2002-07-23 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive hard water dispersible polymers and applications therefor |
| US7276459B1 (en) | 2000-05-04 | 2007-10-02 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6620874B1 (en) * | 1999-11-17 | 2003-09-16 | 3M Innovative Properties Co | Method of making ionomeric particulates by suspension polymerization |
| US6835678B2 (en) | 2000-05-04 | 2004-12-28 | Kimberly-Clark Worldwide, Inc. | Ion sensitive, water-dispersible fabrics, a method of making same and items using same |
| US6599848B1 (en) | 2000-05-04 | 2003-07-29 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6653406B1 (en) | 2000-05-04 | 2003-11-25 | Kimberly Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6429261B1 (en) | 2000-05-04 | 2002-08-06 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6683143B1 (en) * | 2000-05-04 | 2004-01-27 | Kimberly Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6444214B1 (en) | 2000-05-04 | 2002-09-03 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6548592B1 (en) | 2000-05-04 | 2003-04-15 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive, water-dispersible polymers, a method of making same and items using same |
| US6537663B1 (en) | 2000-05-04 | 2003-03-25 | Kimberly-Clark Worldwide, Inc. | Ion-sensitive hard water dispersible polymers and applications therefor |
| EP1177897A1 (en) | 2000-08-01 | 2002-02-06 | Agfa-Gevaert N.V. | A droplet deposition apparatus with releasably attached nozzle plate |
| US6573349B2 (en) | 2000-08-01 | 2003-06-03 | Dow Global Technologies Inc. | High molecular weight monovinylidene aromatic polymers with good processability |
| KR100369845B1 (ko) * | 2000-10-20 | 2003-01-30 | 한솔제지주식회사 | 포어 마이크로스피어 구조의 리포지션어블 점착제 및 그제조방법 |
| WO2002041987A2 (en) * | 2000-10-25 | 2002-05-30 | Tufts University | Polymeric microspheres |
| US6883908B2 (en) | 2001-01-08 | 2005-04-26 | 3M Innovative Properties Company | Methods and compositions for ink jet printing of pressure sensitive adhesive patterns or films on a wide range of substrates |
| US20040202812A1 (en) * | 2001-09-07 | 2004-10-14 | Congard Pierre M. | Photoluminescent adhesive tape |
| US7772138B2 (en) | 2002-05-21 | 2010-08-10 | Kimberly-Clark Worldwide, Inc. | Ion sensitive, water-dispersible polymers, a method of making same and items using same |
| US20040043199A1 (en) * | 2002-08-27 | 2004-03-04 | 3M Innovative Properties Company | Lithographic ink composition |
| US6994865B2 (en) * | 2002-09-20 | 2006-02-07 | Kimberly-Clark Worldwide, Inc. | Ion triggerable, cationic polymers, a method of making same and items using same |
| US7101456B2 (en) * | 2002-09-20 | 2006-09-05 | Kimberly-Clark Worldwide, Inc. | Ion triggerable, cationic polymers, a method of making same and items using same |
| US6960371B2 (en) * | 2002-09-20 | 2005-11-01 | Kimberly-Clark Worldwide, Inc. | Water-dispersible, cationic polymers, a method of making same and items using same |
| US7141519B2 (en) * | 2002-09-20 | 2006-11-28 | Kimberly-Clark Worldwide, Inc. | Ion triggerable, cationic polymers, a method of making same and items using same |
| US7157389B2 (en) * | 2002-09-20 | 2007-01-02 | Kimberly-Clark Worldwide, Inc. | Ion triggerable, cationic polymers, a method of making same and items using same |
| US20040058600A1 (en) * | 2002-09-20 | 2004-03-25 | Bunyard W. Clayton | Water-dispersible, cationic polymers, a method of making same and items using same |
| US7300700B2 (en) * | 2003-12-02 | 2007-11-27 | 3M Innovative Properties Company | Cationic microspheres and method of making cationic microspheres |
| US20060147636A1 (en) * | 2004-12-30 | 2006-07-06 | Cooprider Terrence E | Method and apparatus of forming a coating fluid pattern |
| US7625605B2 (en) * | 2004-12-30 | 2009-12-01 | 3M Innovative Properties Company | Method for coating a surface with a pattern of coating fluid |
| US20070089832A1 (en) * | 2005-09-15 | 2007-04-26 | Kitchin Jonathan P | Repositionable matte photo media |
| US20070059613A1 (en) * | 2005-09-15 | 2007-03-15 | Kitchin Jonathan P | Repositionable photo card |
| US20070059631A1 (en) * | 2005-09-15 | 2007-03-15 | Kitchin Jonathan P | Repositionable glossy photo media |
| US20080003383A1 (en) * | 2005-09-15 | 2008-01-03 | 3M Innovative Properties Company | Repositionable photo paper |
| US20070059652A1 (en) * | 2005-09-15 | 2007-03-15 | Kitchin Jonathan P | Repositionable glossy photo media |
| US20070059472A1 (en) * | 2005-09-15 | 2007-03-15 | 3M Innovative Properties Company | Repositionable photo media and photographs |
| US7467873B2 (en) * | 2005-10-14 | 2008-12-23 | 3M Innovative Properties Company | Privacy film |
| US7326504B2 (en) * | 2005-10-14 | 2008-02-05 | 3M Innovative Properties Company | Imaged anti-copy film |
| GB2432338A (en) * | 2005-11-21 | 2007-05-23 | 3M Innovative Properties Co | Personalised adhesive memoboard |
| US20070138044A1 (en) * | 2005-12-19 | 2007-06-21 | Trotter Byron E | Article for storing and organizing materials |
| US20070147712A1 (en) * | 2005-12-19 | 2007-06-28 | 3M Innovative Properties Company | Method of making articles for storing and organizing materials |
| US20070140597A1 (en) * | 2005-12-19 | 2007-06-21 | Eser Ozdeger Donovan | Method of making articles for storing and organizing materials |
| US7494027B2 (en) * | 2006-01-27 | 2009-02-24 | 3M Innovative Properties Company | Dispenser package |
| US20080063842A1 (en) * | 2006-09-12 | 2008-03-13 | 3M Innovative Properties Company | Repositionable privacy note |
| USD564583S1 (en) | 2006-09-15 | 2008-03-18 | 3M Innovative Properties Company | Marking device |
| USD564582S1 (en) | 2006-09-15 | 2008-03-18 | 3M Innovative Properties Company | Marking device |
| USD564584S1 (en) | 2006-09-15 | 2008-03-18 | 3M Innovative Properties Company | Marking device |
| US7547155B2 (en) * | 2006-09-15 | 2009-06-16 | 3M Innovative Properties Company | Marking device |
| USD564023S1 (en) | 2006-09-15 | 2008-03-11 | 3M Innovative Properties Company | Marking device |
| US20080087376A1 (en) * | 2006-10-11 | 2008-04-17 | 3M Innovative Properties Company | Method of making a photographic print with an adhesive composite |
| US20080087379A1 (en) * | 2006-10-11 | 2008-04-17 | 3M Innovative Properties Company | Repositionable adhesive-backed photographs and photo media and methods of making |
| US7645355B2 (en) | 2006-11-17 | 2010-01-12 | 3M Innovative Properties Company | Method of making a microsphere transfer adhesive |
| US7674345B2 (en) * | 2006-12-08 | 2010-03-09 | 3M Innovative Properties Company | Adhesive articles with discontinuities and methods of making the same |
| WO2008156918A1 (en) * | 2007-06-13 | 2008-12-24 | 3M Innovative Properties Company | Repositionable mounting material, pollution control device, and methods of making the same |
| US20090050646A1 (en) * | 2007-08-22 | 2009-02-26 | 3M Innovative Properties Company | Compact sheet dispenser |
| USD581978S1 (en) | 2007-08-22 | 2008-12-02 | 3M Innovative Properties Company | Writing instrument with sheet dispenser |
| US20090052973A1 (en) * | 2007-08-22 | 2009-02-26 | 3M Innovative Properties Company | Writing instrument with compact sheet dispenser |
| US20090075007A1 (en) * | 2007-09-13 | 2009-03-19 | 3M Innovative Properties Company | Adhesive composite |
| US20090075070A1 (en) * | 2007-09-13 | 2009-03-19 | 3M Innovative Properties Company | Photographic print with an adhesive composite |
| JP5348875B2 (ja) * | 2007-12-10 | 2013-11-20 | 日本合成化学工業株式会社 | 剥離型水性粘着剤組成物、剥離型粘着剤及びそれを用いた養生用粘着シートまたはテープ |
| BRPI0821118B1 (pt) * | 2007-12-14 | 2018-11-06 | Prad Research And Development Limited | método de completar um poço, método de tratar uma formação subterrânea interceptada por um poço, utilizando aditivos mutáveis, e método |
| WO2009079231A2 (en) * | 2007-12-14 | 2009-06-25 | Schlumberger Canada Limited | Methods of contacting and/or treating a subterranean formation |
| MX2010006456A (es) * | 2007-12-14 | 2010-09-28 | Schlumberger Technology Bv | Materiales de consolidacion y usos de los mismos. |
| US8353344B2 (en) * | 2007-12-14 | 2013-01-15 | 3M Innovative Properties Company | Fiber aggregate |
| US20090162595A1 (en) * | 2007-12-19 | 2009-06-25 | Chan Ko | Striped adhesive construction and method and die for making same |
| JP2012514083A (ja) * | 2008-12-24 | 2012-06-21 | スリーエム イノベイティブ プロパティズ カンパニー | 微小球感圧接着剤組成物 |
| KR20150046884A (ko) * | 2013-10-23 | 2015-05-04 | 동우 화인켐 주식회사 | 접착제 조성물 및 이를 이용한 복합 편광판 |
| JP6646469B2 (ja) * | 2015-02-23 | 2020-02-14 | 株式会社Nbcメッシュテック | 抗ウイルス性を有する吸水性高分子 |
| US20180304592A1 (en) * | 2015-12-29 | 2018-10-25 | 3M Innovative Properties Company | Mounting tab, dispenser for same, and method of use |
| JP7261001B2 (ja) * | 2018-12-06 | 2023-04-19 | 日東電工株式会社 | 水分散型粘着剤組成物および粘着シート |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3620988A (en) * | 1968-10-31 | 1971-11-16 | Goodrich Co B F | Method of preparing bead-type polymers |
| US3691140A (en) * | 1970-03-09 | 1972-09-12 | Spencer Ferguson Silver | Acrylate copolymer microspheres |
| US3857731A (en) * | 1973-04-06 | 1974-12-31 | Minnesota Mining & Mfg | Acrylate microsphere-surfaced sheet material |
| US4166152B1 (en) * | 1977-08-17 | 1999-05-18 | Minnesota Mining & Mfg | Tacky polymeric microspheres |
| US4276212A (en) * | 1978-12-11 | 1981-06-30 | E. I. Du Pont De Nemours And Company | High solids coating composition of a low molecular weight acrylic polymer and an alkylated melamine cross-linking agent |
| US4495318A (en) * | 1984-03-21 | 1985-01-22 | International Cube Corporation | Low tack microsphere glue |
| US4598112A (en) * | 1984-09-14 | 1986-07-01 | International Cube Corp. | Low tack cationic microsphere glue |
| US4645783A (en) * | 1985-02-08 | 1987-02-24 | Sanyo Kokusaku Pulp Co. | Adhesive copolymer microspheres-containing aqueous suspension and method for producing the same |
| US4656218A (en) * | 1985-02-08 | 1987-04-07 | Sanyo Kokusaku Pulp Co., Ltd. | Adhesive copolymer microspheres-containing aqueous suspension and method for producing the same |
| JPH0414434Y2 (enExample) * | 1985-04-08 | 1992-03-31 | ||
| JPS61258854A (ja) * | 1985-05-13 | 1986-11-17 | Nichiban Co Ltd | アクリル酸エステル系架橋重合体微小球及びその製法 |
| DE3677843D1 (de) * | 1985-07-13 | 1991-04-11 | Smith & Mclaurin | Klebstoffe. |
| US4786696A (en) * | 1987-02-06 | 1988-11-22 | Minnesota Mining And Manufacturing Company | Process for the preparation of tacky polymeric microspheres |
| US4952650A (en) * | 1987-07-27 | 1990-08-28 | Minnesota Mining And Manufacturing Company | Suspension polymerization |
| US5053436A (en) * | 1988-11-30 | 1991-10-01 | Minnesota Mining And Manufacturing Company | Hollow acrylate polymer microspheres |
| US4988567A (en) * | 1990-02-27 | 1991-01-29 | Minnesota Mining And Manufacturing Company | Hollow acid-free acrylate polymeric microspheres having multiple small voids |
| US5215818A (en) * | 1990-04-20 | 1993-06-01 | Minnesota Mining And Manufacturing Company | Pressure-sensitive adhesive comprising solid tacky microspheres and macromonomer-containing binder copolymer |
| EP0617708B1 (en) * | 1991-12-17 | 1996-09-11 | Minnesota Mining And Manufacturing Company | Tack-free elastomeric acrylate microspheres |
| US6048611A (en) * | 1992-02-03 | 2000-04-11 | 3M Innovative Properties Company | High solids moisture resistant latex pressure-sensitive adhesive |
| US5571617A (en) * | 1993-04-23 | 1996-11-05 | Minnesota Mining And Manufacturing Company | Pressure sensitive adhesive comprising tacky surface active microspheres |
-
1996
- 1996-10-11 US US08/731,351 patent/US5756625A/en not_active Expired - Lifetime
-
1997
- 1997-02-24 AU AU19712/97A patent/AU720856B2/en not_active Ceased
- 1997-02-24 SI SI9720061A patent/SI20078A/sl not_active IP Right Cessation
- 1997-02-24 EP EP97907811A patent/EP0931115B1/en not_active Expired - Lifetime
- 1997-02-24 CA CA002268149A patent/CA2268149A1/en not_active Abandoned
- 1997-02-24 DE DE69713120T patent/DE69713120T2/de not_active Expired - Lifetime
- 1997-02-24 JP JP10518305A patent/JP2001503087A/ja not_active Ceased
- 1997-02-24 WO PCT/US1997/002849 patent/WO1998016591A1/en not_active Ceased
- 1997-02-24 KR KR1019990703062A patent/KR20000049003A/ko not_active Ceased
- 1997-09-19 TW TW086113618A patent/TW416963B/zh not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE69713120T2 (de) | 2003-01-16 |
| AU720856B2 (en) | 2000-06-15 |
| US5756625A (en) | 1998-05-26 |
| WO1998016591A1 (en) | 1998-04-23 |
| DE69713120D1 (de) | 2002-07-11 |
| JP2001503087A (ja) | 2001-03-06 |
| SI20078A (sl) | 2000-04-30 |
| EP0931115B1 (en) | 2002-06-05 |
| AU1971297A (en) | 1998-05-11 |
| KR20000049003A (ko) | 2000-07-25 |
| EP0931115A1 (en) | 1999-07-28 |
| CA2268149A1 (en) | 1998-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TW416963B (en) | Stabilized adhesive microspheres | |
| AU627607B2 (en) | Pressure-sensitive adhesive comprising hollow tacky microspheres and macromonomer-containing binder copolymer | |
| TW450989B (en) | A sheet material comprising a coating of repositionable pressure-sensitive adhesive containing tacky surface active microspheres and one-step and two-step suspension polymerization processes for preparing said microspheres | |
| US4968562A (en) | Hollow acid-free acrylate polymeric microspheres having multiple small voids | |
| USRE37563E1 (en) | Partially crosslinked microspheres | |
| US4988567A (en) | Hollow acid-free acrylate polymeric microspheres having multiple small voids | |
| US5118750A (en) | Pressure-sensitive adhesive comprising solid tacky microspheres and macromonomer-containing binder copolymer | |
| CN1090660C (zh) | 可除去的压敏粘合剂及其制品 | |
| US5215818A (en) | Pressure-sensitive adhesive comprising solid tacky microspheres and macromonomer-containing binder copolymer | |
| DK153683B (da) | Smelteklaebestofblanding og dens anvendelse | |
| CN101903486A (zh) | 微球压敏粘合剂组合物 | |
| US5292844A (en) | Vinyl acetate modified suspension polymer beads, adhesives made therefrom and a method of making | |
| CN102822298A (zh) | 具有氨基烷基(甲基)丙烯酰溶剂单体的可交联浆料共聚物 | |
| AU2167492A (en) | Vinyl acetate modified suspension polymer beads, adhesives made therefrom, and a method of making | |
| JPH04173890A (ja) | 感圧接着剤及び粘着部材 | |
| JPH0238154B2 (enExample) | ||
| JPS58167667A (ja) | 感圧性接着テ−プの製造方法 | |
| JPS6143394B2 (enExample) | ||
| JPS6149350B2 (enExample) | ||
| MXPA99003243A (en) | Stabilized adhesive microspheres |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| GD4A | Issue of patent certificate for granted invention patent | ||
| MM4A | Annulment or lapse of patent due to non-payment of fees |