TW202012391A - 二芳基醚型喹唑啉衍生物 - Google Patents
二芳基醚型喹唑啉衍生物 Download PDFInfo
- Publication number
- TW202012391A TW202012391A TW108123293A TW108123293A TW202012391A TW 202012391 A TW202012391 A TW 202012391A TW 108123293 A TW108123293 A TW 108123293A TW 108123293 A TW108123293 A TW 108123293A TW 202012391 A TW202012391 A TW 202012391A
- Authority
- TW
- Taiwan
- Prior art keywords
- oxy
- fluoro
- piperidin
- prop
- mmol
- Prior art date
Links
- -1 Biaryl ether Chemical compound 0.000 title claims description 74
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 title description 25
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 462
- 150000003839 salts Chemical class 0.000 claims abstract description 76
- 230000035772 mutation Effects 0.000 claims abstract description 56
- 238000003780 insertion Methods 0.000 claims abstract description 42
- 230000037431 insertion Effects 0.000 claims abstract description 42
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 claims abstract description 23
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 claims abstract description 23
- 102000052116 epidermal growth factor receptor activity proteins Human genes 0.000 claims abstract 6
- 108700015053 epidermal growth factor receptor activity proteins Proteins 0.000 claims abstract 6
- YOHYSYJDKVYCJI-UHFFFAOYSA-N n-[3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide Chemical compound FC(F)(F)C1=CC=CC(NC=2N=CN=C(NC=3C=C(NC(=O)C4CC4)C=CC=3)C=2)=C1 YOHYSYJDKVYCJI-UHFFFAOYSA-N 0.000 claims abstract 6
- 239000013078 crystal Substances 0.000 claims description 151
- 238000000034 method Methods 0.000 claims description 115
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 73
- 206010028980 Neoplasm Diseases 0.000 claims description 65
- 238000000634 powder X-ray diffraction Methods 0.000 claims description 59
- 125000001424 substituent group Chemical group 0.000 claims description 45
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 44
- 230000005855 radiation Effects 0.000 claims description 40
- 239000000843 powder Substances 0.000 claims description 35
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 29
- 125000005843 halogen group Chemical group 0.000 claims description 26
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 24
- 229910052731 fluorine Inorganic materials 0.000 claims description 23
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 claims description 22
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 claims description 21
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 claims description 21
- 125000003277 amino group Chemical group 0.000 claims description 17
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 13
- 125000001153 fluoro group Chemical group F* 0.000 claims description 13
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 206010006187 Breast cancer Diseases 0.000 claims description 12
- 208000026310 Breast neoplasm Diseases 0.000 claims description 12
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 12
- 206010033128 Ovarian cancer Diseases 0.000 claims description 12
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 12
- 201000005202 lung cancer Diseases 0.000 claims description 12
- 208000020816 lung neoplasm Diseases 0.000 claims description 12
- 206010005003 Bladder cancer Diseases 0.000 claims description 11
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims description 11
- 239000002246 antineoplastic agent Substances 0.000 claims description 11
- 201000005112 urinary bladder cancer Diseases 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- XTEGVFVZDVNBPF-UHFFFAOYSA-L naphthalene-1,5-disulfonate(2-) Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1S([O-])(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-L 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 8
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 8
- VKGDPIFIZRSHPU-UHFFFAOYSA-N 1-[4-[4-[2-fluoro-4-[1-(5-fluoro-6-methylpyridin-3-yl)pyrazol-3-yl]oxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound FC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC1=NN(C=C1)C=1C=NC(=C(C=1)F)C VKGDPIFIZRSHPU-UHFFFAOYSA-N 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 6
- 125000004076 pyridyl group Chemical group 0.000 claims description 6
- LFCHSMUFVWZDLF-UHFFFAOYSA-N 1-[4-[4-[2-fluoro-4-[1-(6-methylpyridin-3-yl)pyrazol-3-yl]oxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound FC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC1=NN(C=C1)C=1C=NC(=CC=1)C LFCHSMUFVWZDLF-UHFFFAOYSA-N 0.000 claims description 5
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- OITIZWFIUUVEFC-UHFFFAOYSA-N CC1=C(C=C(C=N1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F)F.C(C(=O)O)C(CC(=O)O)(C(=O)O)O Chemical compound CC1=C(C=C(C=N1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F)F.C(C(=O)O)C(CC(=O)O)(C(=O)O)O OITIZWFIUUVEFC-UHFFFAOYSA-N 0.000 claims description 4
- SYHCFFBKVHPNBQ-UHFFFAOYSA-N CC1=C(C=C(C=N1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F)F.C(C(C(=O)O)O)(C(=O)O)O Chemical compound CC1=C(C=C(C=N1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F)F.C(C(C(=O)O)O)(C(=O)O)O SYHCFFBKVHPNBQ-UHFFFAOYSA-N 0.000 claims description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- 150000004032 porphyrins Chemical class 0.000 claims description 4
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 3
- BNMLQGZQMQPHQL-UHFFFAOYSA-N 1-[4-[4-[2-fluoro-4-[1-(6-methylpyridin-3-yl)pyrazol-3-yl]oxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one hydrochloride Chemical compound CC1=NC=C(C=C1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F.Cl BNMLQGZQMQPHQL-UHFFFAOYSA-N 0.000 claims description 3
- HBZFJCXFYHMVCE-UHFFFAOYSA-N C1(=CC=CC=2C(=CC=CC12)S(=O)(=O)O)S(=O)(=O)O.FC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC1=NN(C=C1)C=1C=NC(=CC1)C Chemical compound C1(=CC=CC=2C(=CC=CC12)S(=O)(=O)O)S(=O)(=O)O.FC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC1=NN(C=C1)C=1C=NC(=CC1)C HBZFJCXFYHMVCE-UHFFFAOYSA-N 0.000 claims description 3
- DXSQJCNTRDXTOP-UHFFFAOYSA-N CC1=C(C=C(C=N1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F)F.C1=CC=C(C=C1)S(=O)(=O)O Chemical compound CC1=C(C=C(C=N1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F)F.C1=CC=C(C=C1)S(=O)(=O)O DXSQJCNTRDXTOP-UHFFFAOYSA-N 0.000 claims description 3
- BVBDKIPPTQNULW-UHFFFAOYSA-N CC1=NC=C(C=C1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F.C(C(=O)O)C(CC(=O)O)(C(=O)O)O Chemical compound CC1=NC=C(C=C1)N2C=CC(=N2)OC3=CC(=C(C=C3)NC4=NC=NC5=CC(=C(C=C54)OC6CCN(CC6)C(=O)C=C)OC)F.C(C(=O)O)C(CC(=O)O)(C(=O)O)O BVBDKIPPTQNULW-UHFFFAOYSA-N 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 3
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 claims description 3
- 239000005483 tyrosine kinase inhibitor Substances 0.000 claims description 3
- 150000004917 tyrosine kinase inhibitor derivatives Chemical class 0.000 claims description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 2
- 229940077388 benzenesulfonate Drugs 0.000 claims description 2
- 238000002425 crystallisation Methods 0.000 claims description 2
- 230000008025 crystallization Effects 0.000 claims description 2
- 125000002720 diazolyl group Chemical group 0.000 claims description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 2
- 229940095064 tartrate Drugs 0.000 claims description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 2
- 125000001425 triazolyl group Chemical group 0.000 claims description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims 5
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 claims 1
- 230000002401 inhibitory effect Effects 0.000 abstract description 8
- 108091000080 Phosphotransferase Proteins 0.000 abstract description 3
- 102000020233 phosphotransferase Human genes 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 447
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 295
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 245
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 177
- 230000002829 reductive effect Effects 0.000 description 176
- 239000000243 solution Substances 0.000 description 145
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 135
- 238000005160 1H NMR spectroscopy Methods 0.000 description 110
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 105
- 238000006243 chemical reaction Methods 0.000 description 94
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 88
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 85
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 81
- 238000001914 filtration Methods 0.000 description 78
- 238000010898 silica gel chromatography Methods 0.000 description 78
- 239000012044 organic layer Substances 0.000 description 77
- 239000002904 solvent Substances 0.000 description 77
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 74
- 239000011541 reaction mixture Substances 0.000 description 63
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 54
- 235000002639 sodium chloride Nutrition 0.000 description 54
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 50
- 238000003756 stirring Methods 0.000 description 49
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 48
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 46
- 239000000543 intermediate Substances 0.000 description 45
- 210000004027 cell Anatomy 0.000 description 43
- 239000000725 suspension Substances 0.000 description 42
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 36
- 239000000203 mixture Substances 0.000 description 36
- 239000007787 solid Substances 0.000 description 36
- 229940086542 triethylamine Drugs 0.000 description 35
- 0 *CCC(CC1)CCC1Oc(cc(C(O)=O)c(*)c1)c1F Chemical compound *CCC(CC1)CCC1Oc(cc(C(O)=O)c(*)c1)c1F 0.000 description 30
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 30
- XHFLOLLMZOTPSM-UHFFFAOYSA-M sodium;hydrogen carbonate;hydrate Chemical class [OH-].[Na+].OC(O)=O XHFLOLLMZOTPSM-UHFFFAOYSA-M 0.000 description 29
- 229910052739 hydrogen Inorganic materials 0.000 description 28
- 229910000027 potassium carbonate Inorganic materials 0.000 description 27
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 25
- 239000002585 base Substances 0.000 description 25
- 238000000921 elemental analysis Methods 0.000 description 25
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 229910052757 nitrogen Inorganic materials 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical group CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 21
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 20
- 150000001412 amines Chemical class 0.000 description 20
- 238000012360 testing method Methods 0.000 description 20
- 201000011510 cancer Diseases 0.000 description 19
- 238000010438 heat treatment Methods 0.000 description 19
- 239000012046 mixed solvent Substances 0.000 description 19
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 18
- 238000005406 washing Methods 0.000 description 18
- 238000005259 measurement Methods 0.000 description 17
- 239000007864 aqueous solution Substances 0.000 description 16
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 15
- 229910000024 caesium carbonate Inorganic materials 0.000 description 15
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 15
- 239000001257 hydrogen Substances 0.000 description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 14
- 239000012298 atmosphere Substances 0.000 description 14
- 239000012295 chemical reaction liquid Substances 0.000 description 14
- 125000006239 protecting group Chemical group 0.000 description 14
- 239000003054 catalyst Substances 0.000 description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 13
- 238000001228 spectrum Methods 0.000 description 13
- 125000000539 amino acid group Chemical group 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 230000009036 growth inhibition Effects 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 12
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 11
- 239000012264 purified product Substances 0.000 description 11
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 10
- 101150039808 Egfr gene Proteins 0.000 description 10
- FFDGPVCHZBVARC-UHFFFAOYSA-N N,N-dimethylglycine Chemical compound CN(C)CC(O)=O FFDGPVCHZBVARC-UHFFFAOYSA-N 0.000 description 10
- 239000002168 alkylating agent Substances 0.000 description 10
- 230000000259 anti-tumor effect Effects 0.000 description 10
- 238000004440 column chromatography Methods 0.000 description 10
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 10
- 238000010511 deprotection reaction Methods 0.000 description 10
- 239000003814 drug Substances 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- LVOICKNPHXSSQM-UHFFFAOYSA-N prop-2-en-1-one Chemical compound C=C[C]=O LVOICKNPHXSSQM-UHFFFAOYSA-N 0.000 description 10
- 108090000623 proteins and genes Proteins 0.000 description 10
- 229940100198 alkylating agent Drugs 0.000 description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 9
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 9
- 235000018102 proteins Nutrition 0.000 description 9
- 102000004169 proteins and genes Human genes 0.000 description 9
- 238000000746 purification Methods 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- 239000000758 substrate Substances 0.000 description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 8
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 8
- 150000001335 aliphatic alkanes Chemical class 0.000 description 8
- 108700021358 erbB-1 Genes Proteins 0.000 description 8
- 230000035755 proliferation Effects 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 229920002472 Starch Polymers 0.000 description 7
- 235000011054 acetic acid Nutrition 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 238000005859 coupling reaction Methods 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 239000002198 insoluble material Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000000523 sample Substances 0.000 description 7
- 239000008107 starch Substances 0.000 description 7
- 235000019698 starch Nutrition 0.000 description 7
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical group CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 7
- DDAHKTANFPBTJY-UHFFFAOYSA-N 1-[4-(4-chloro-7-methoxyquinazolin-6-yl)oxypiperidin-1-yl]prop-2-en-1-one Chemical compound ClC1=NC=NC2=CC(=C(C=C12)OC1CCN(CC1)C(C=C)=O)OC DDAHKTANFPBTJY-UHFFFAOYSA-N 0.000 description 6
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 238000005917 acylation reaction Methods 0.000 description 6
- 239000012267 brine Substances 0.000 description 6
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 6
- 238000010790 dilution Methods 0.000 description 6
- 239000012895 dilution Substances 0.000 description 6
- 230000032050 esterification Effects 0.000 description 6
- 238000005886 esterification reaction Methods 0.000 description 6
- 125000000524 functional group Chemical group 0.000 description 6
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- 239000011159 matrix material Substances 0.000 description 6
- 239000011259 mixed solution Substances 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 229920001296 polysiloxane Polymers 0.000 description 6
- 238000012746 preparative thin layer chromatography Methods 0.000 description 6
- 229940002612 prodrug Drugs 0.000 description 6
- 239000000651 prodrug Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000002002 slurry Substances 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- FLAUDKFKQXKGPV-UHFFFAOYSA-N 5-(2-chloro-5-fluoro-4-nitrophenoxy)-1H-pyrazole Chemical compound ClC1=C(OC2=NNC=C2)C=C(C(=C1)[N+](=O)[O-])F FLAUDKFKQXKGPV-UHFFFAOYSA-N 0.000 description 5
- 102000001301 EGF receptor Human genes 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 5
- 101150054472 HER2 gene Proteins 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 5
- 239000005909 Kieselgur Substances 0.000 description 5
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 5
- 108700020796 Oncogene Proteins 0.000 description 5
- 235000004279 alanine Nutrition 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 230000004663 cell proliferation Effects 0.000 description 5
- 108700003601 dimethylglycine Proteins 0.000 description 5
- 108700020302 erbB-2 Genes Proteins 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 229940078490 n,n-dimethylglycine Drugs 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- ZGRPZZHXNRSIMU-UHFFFAOYSA-N tert-butyl 3-(2-chloro-5-fluoro-4-nitrophenoxy)pyrazole-1-carboxylate Chemical compound ClC1=C(OC2=NN(C=C2)C(=O)OC(C)(C)C)C=C(C(=C1)[N+](=O)[O-])F ZGRPZZHXNRSIMU-UHFFFAOYSA-N 0.000 description 5
- VBBOZJFSLMRWDL-UHFFFAOYSA-N tert-butyl 3-(4-amino-3-fluorophenoxy)pyrazole-1-carboxylate Chemical compound NC1=C(C=C(OC2=NN(C=C2)C(=O)OC(C)(C)C)C=C1)F VBBOZJFSLMRWDL-UHFFFAOYSA-N 0.000 description 5
- UIOYEIHBWQTVJC-UHFFFAOYSA-N 1-chloro-2,4-difluoro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(F)C=C1F UIOYEIHBWQTVJC-UHFFFAOYSA-N 0.000 description 4
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 4
- 206010064571 Gene mutation Diseases 0.000 description 4
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 239000004471 Glycine Substances 0.000 description 4
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 4
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 4
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- LWLSVNFEVKJDBZ-UHFFFAOYSA-N N-[4-(trifluoromethoxy)phenyl]-4-[[3-[5-(trifluoromethyl)pyridin-2-yl]oxyphenyl]methyl]piperidine-1-carboxamide Chemical compound FC(OC1=CC=C(C=C1)NC(=O)N1CCC(CC1)CC1=CC(=CC=C1)OC1=NC=C(C=C1)C(F)(F)F)(F)F LWLSVNFEVKJDBZ-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 239000005557 antagonist Substances 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 4
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 4
- 235000015165 citric acid Nutrition 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- 229960001433 erlotinib Drugs 0.000 description 4
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 4
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 4
- 229960002584 gefitinib Drugs 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- 239000008103 glucose Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- YKUCHDXIBAQWSF-UHFFFAOYSA-N methyl 3-hydroxybenzoate Chemical compound COC(=O)C1=CC=CC(O)=C1 YKUCHDXIBAQWSF-UHFFFAOYSA-N 0.000 description 4
- NQVPSGXLCXZSTB-UHFFFAOYSA-N n-tert-butyl-2-chloroacetamide Chemical compound CC(C)(C)NC(=O)CCl NQVPSGXLCXZSTB-UHFFFAOYSA-N 0.000 description 4
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- RXWNCPJZOCPEPQ-NVWDDTSBSA-N puromycin Chemical compound C1=CC(OC)=CC=C1C[C@H](N)C(=O)N[C@H]1[C@@H](O)[C@H](N2C3=NC=NC(=C3N=C2)N(C)C)O[C@@H]1CO RXWNCPJZOCPEPQ-NVWDDTSBSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 4
- 229910052727 yttrium Inorganic materials 0.000 description 4
- JRHPOFJADXHYBR-HTQZYQBOSA-N (1r,2r)-1-n,2-n-dimethylcyclohexane-1,2-diamine Chemical compound CN[C@@H]1CCCC[C@H]1NC JRHPOFJADXHYBR-HTQZYQBOSA-N 0.000 description 3
- NXLNNXIXOYSCMB-UHFFFAOYSA-N (4-nitrophenyl) carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(OC(Cl)=O)C=C1 NXLNNXIXOYSCMB-UHFFFAOYSA-N 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 3
- DUIGUCQWPLZEKK-UHFFFAOYSA-N 3-(4-amino-3-fluorophenoxy)-N-propan-2-ylpyrazole-1-carboxamide Chemical compound NC1=C(C=C(OC2=NN(C=C2)C(=O)NC(C)C)C=C1)F DUIGUCQWPLZEKK-UHFFFAOYSA-N 0.000 description 3
- BTUQJHRJJONMLN-UHFFFAOYSA-N 3-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]benzoic acid Chemical compound C(C)(C)(C)OC(=O)NC1=C(C=C(OC=2C=C(C(=O)O)C=CC=2)C=C1)F BTUQJHRJJONMLN-UHFFFAOYSA-N 0.000 description 3
- KKYIIYMPHCZEHK-UHFFFAOYSA-N 4-chloro-7-methoxy-6-nitroquinazoline hydrochloride Chemical compound Cl.ClC1=NC=NC2=CC(=C(C=C12)[N+](=O)[O-])OC KKYIIYMPHCZEHK-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- 101100067974 Arabidopsis thaliana POP2 gene Proteins 0.000 description 3
- 239000004475 Arginine Substances 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 3
- AFSDHCUYEFJHEU-UHFFFAOYSA-N FC1=C(C=CC(=C1)OC1=CC(=CC=C1)C(=O)NN)NC(OC(C)(C)C)=O Chemical compound FC1=C(C=CC(=C1)OC1=CC(=CC=C1)C(=O)NN)NC(OC(C)(C)C)=O AFSDHCUYEFJHEU-UHFFFAOYSA-N 0.000 description 3
- 102000009465 Growth Factor Receptors Human genes 0.000 description 3
- 108010009202 Growth Factor Receptors Proteins 0.000 description 3
- 101100118549 Homo sapiens EGFR gene Proteins 0.000 description 3
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 3
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 3
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 102100029986 Receptor tyrosine-protein kinase erbB-3 Human genes 0.000 description 3
- 101710100969 Receptor tyrosine-protein kinase erbB-3 Proteins 0.000 description 3
- 102100029981 Receptor tyrosine-protein kinase erbB-4 Human genes 0.000 description 3
- 101710100963 Receptor tyrosine-protein kinase erbB-4 Proteins 0.000 description 3
- 101100123851 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) HER1 gene Proteins 0.000 description 3
- 241000009298 Trigla lyra Species 0.000 description 3
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 230000021736 acetylation Effects 0.000 description 3
- 238000006640 acetylation reaction Methods 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 229940024606 amino acid Drugs 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 3
- 235000003704 aspartic acid Nutrition 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 3
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 230000005540 biological transmission Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 239000004327 boric acid Substances 0.000 description 3
- 230000010261 cell growth Effects 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 150000001860 citric acid derivatives Chemical class 0.000 description 3
- 229940110456 cocoa butter Drugs 0.000 description 3
- 235000019868 cocoa butter Nutrition 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- JMQGGPRJQOQKRT-UHFFFAOYSA-N diphenyl hydrogen phosphate;azide Chemical compound [N-]=[N+]=[N-].C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 JMQGGPRJQOQKRT-UHFFFAOYSA-N 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000000367 immunologic factor Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- YJARTYBPKHLZPW-UHFFFAOYSA-N methyl 3-[3-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]benzoate Chemical compound C(C)(C)(C)OC(=O)NC1=C(C=C(OC=2C=C(C(=O)OC)C=CC=2)C=C1)Cl YJARTYBPKHLZPW-UHFFFAOYSA-N 0.000 description 3
- XDDMBDPPZCOFTQ-UHFFFAOYSA-N methyl 3-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]benzoate Chemical compound C(C)(C)(C)OC(=O)NC1=C(C=C(OC=2C=C(C(=O)OC)C=CC=2)C=C1)F XDDMBDPPZCOFTQ-UHFFFAOYSA-N 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 3
- 238000010791 quenching Methods 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- FPSNILLJGPEYFL-UHFFFAOYSA-N tert-butyl 4-(2-hydroxy-5-methoxycarbonyl-4-nitrophenoxy)piperidine-1-carboxylate Chemical compound OC1=C(OC2CCN(CC2)C(=O)OC(C)(C)C)C=C(C(=C1)[N+](=O)[O-])C(=O)OC FPSNILLJGPEYFL-UHFFFAOYSA-N 0.000 description 3
- DBDTWEQAMRFDEF-UHFFFAOYSA-N tert-butyl N-[2-chloro-4-[3-(hydrazinecarbonyl)phenoxy]phenyl]carbamate Chemical compound ClC1=C(C=CC(=C1)OC1=CC(=CC=C1)C(=O)NN)NC(OC(C)(C)C)=O DBDTWEQAMRFDEF-UHFFFAOYSA-N 0.000 description 3
- YTCJHXKTPYOOOO-UHFFFAOYSA-N tert-butyl N-[2-fluoro-4-(1H-pyrazol-5-yloxy)phenyl]carbamate Chemical compound FC1=C(C=CC(=C1)OC1=NNC=C1)NC(OC(C)(C)C)=O YTCJHXKTPYOOOO-UHFFFAOYSA-N 0.000 description 3
- 229940124597 therapeutic agent Drugs 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- WQVPBCRZZWJBNT-UHFFFAOYSA-N (4-nitrophenyl) 3-(2-chloro-5-fluoro-4-nitrophenoxy)pyrazole-1-carboxylate Chemical compound ClC1=C(OC2=NN(C=C2)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])C=C(C(=C1)[N+](=O)[O-])F WQVPBCRZZWJBNT-UHFFFAOYSA-N 0.000 description 2
- KMSKQZKKOZQFFG-YXRRJAAWSA-N (7S,9S)-7-[[(2R,4S,5S,6S)-4-amino-6-methyl-5-[[(2R)-2-oxanyl]oxy]-2-oxanyl]oxy]-6,9,11-trihydroxy-9-(2-hydroxy-1-oxoethyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione Chemical compound O([C@H]1[C@@H](N)C[C@@H](O[C@H]1C)O[C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@@H]1CCCCO1 KMSKQZKKOZQFFG-YXRRJAAWSA-N 0.000 description 2
- NQQRXZOPZBKCNF-NSCUHMNNSA-N (e)-but-2-enamide Chemical compound C\C=C\C(N)=O NQQRXZOPZBKCNF-NSCUHMNNSA-N 0.000 description 2
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical group C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 2
- VWABZYXGESOZAK-UHFFFAOYSA-N 1-[4-[4-[2-fluoro-4-(1H-pyrazol-5-yloxy)anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound FC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC1=NNC=C1 VWABZYXGESOZAK-UHFFFAOYSA-N 0.000 description 2
- DMUCARIZUDDHGJ-UHFFFAOYSA-N 1-[4-[4-[4-[(4-bromo-1,3-thiazol-2-yl)oxy]-2-fluoroanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound BrC=1N=C(SC=1)OC1=CC(=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=C1)F DMUCARIZUDDHGJ-UHFFFAOYSA-N 0.000 description 2
- DNWOOOHUCRNQRX-UHFFFAOYSA-N 1-fluoro-2-methylpropan-2-amine;hydrochloride Chemical compound Cl.CC(C)(N)CF DNWOOOHUCRNQRX-UHFFFAOYSA-N 0.000 description 2
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- WLAKUAILRGATSL-UHFFFAOYSA-N 2,4-difluoropyridine Chemical compound FC1=CC=NC(F)=C1 WLAKUAILRGATSL-UHFFFAOYSA-N 0.000 description 2
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 2
- DUXQSKVWCOUNBL-UHFFFAOYSA-N 2-[3-[3-fluoro-4-[(7-methoxy-6-nitroquinazolin-4-yl)amino]phenoxy]phenyl]acetic acid Chemical compound FC=1C=C(OC=2C=C(C=CC=2)CC(=O)O)C=CC=1NC1=NC=NC2=CC(=C(C=C12)[N+](=O)[O-])OC DUXQSKVWCOUNBL-UHFFFAOYSA-N 0.000 description 2
- VNEGAQQNBISPQR-UHFFFAOYSA-N 2-chloro-4-(3-ethynylphenoxy)-1-nitrobenzene Chemical compound ClC1=C(C=CC(=C1)OC1=CC(=CC=C1)C#C)[N+](=O)[O-] VNEGAQQNBISPQR-UHFFFAOYSA-N 0.000 description 2
- KQOOFMWRLDRDAX-UHFFFAOYSA-N 2-chloro-4-fluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1Cl KQOOFMWRLDRDAX-UHFFFAOYSA-N 0.000 description 2
- VDHZOBZAVWKHOY-UHFFFAOYSA-N 2-fluoro-4-(3-methoxycarbonylphenoxy)benzoic acid Chemical compound FC1=C(C(=O)O)C=CC(=C1)OC1=CC(=CC=C1)C(=O)OC VDHZOBZAVWKHOY-UHFFFAOYSA-N 0.000 description 2
- IIDPTSZJFFYMJI-UHFFFAOYSA-N 2-fluoro-4-[1-(2-methoxypyridin-4-yl)pyrazol-3-yl]oxyaniline Chemical compound FC1=C(N)C=CC(=C1)OC1=NN(C=C1)C1=CC(=NC=C1)OC IIDPTSZJFFYMJI-UHFFFAOYSA-N 0.000 description 2
- FSBMJCMPDOTEPP-UHFFFAOYSA-N 2-fluoro-4-[[4-(5-fluoro-6-methylpyridin-3-yl)-1,3-thiazol-2-yl]oxy]aniline Chemical compound FC1=C(N)C=CC(=C1)OC=1SC=C(N=1)C=1C=NC(=C(C=1)F)C FSBMJCMPDOTEPP-UHFFFAOYSA-N 0.000 description 2
- PGHKJMVOHWKSLJ-UHFFFAOYSA-N 2-methoxyethyl n-(2-methoxyethoxycarbonylimino)carbamate Chemical compound COCCOC(=O)N=NC(=O)OCCOC PGHKJMVOHWKSLJ-UHFFFAOYSA-N 0.000 description 2
- JOFQYEDGSZTLNB-UHFFFAOYSA-N 3-(2-chloro-5-fluoro-4-nitrophenoxy)-N-(1-fluoro-2-methylpropan-2-yl)pyrazole-1-carboxamide Chemical compound ClC1=C(OC2=NN(C=C2)C(=O)NC(CF)(C)C)C=C(C(=C1)[N+](=O)[O-])F JOFQYEDGSZTLNB-UHFFFAOYSA-N 0.000 description 2
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 2
- HGGRAOYTQNFGGN-UHFFFAOYSA-N 4,5-difluoro-2-nitrobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C=C1[N+]([O-])=O HGGRAOYTQNFGGN-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- MJFJWOAETHEGGW-UHFFFAOYSA-N 4-chloro-7-methoxy-6-nitroquinazoline Chemical compound C1=NC(Cl)=C2C=C([N+]([O-])=O)C(OC)=CC2=N1 MJFJWOAETHEGGW-UHFFFAOYSA-N 0.000 description 2
- VEGGILRNZLVQHL-UHFFFAOYSA-N 4-chloro-7-methoxy-6-piperidin-4-yloxyquinazoline dihydrochloride Chemical compound Cl.Cl.ClC1=NC=NC2=CC(=C(C=C12)OC1CCNCC1)OC VEGGILRNZLVQHL-UHFFFAOYSA-N 0.000 description 2
- MPOBRURPHXIVTM-UHFFFAOYSA-N 5-(3-chloro-4-nitrophenoxy)-1H-pyrazole Chemical compound ClC=1C=C(OC2=NNC=C2)C=CC=1[N+](=O)[O-] MPOBRURPHXIVTM-UHFFFAOYSA-N 0.000 description 2
- DWVCZDMMGYIULX-UHFFFAOYSA-N 5-bromo-2-methoxypyrimidine Chemical compound COC1=NC=C(Br)C=N1 DWVCZDMMGYIULX-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- 208000031648 Body Weight Changes Diseases 0.000 description 2
- UMRBWWUPKSUEAS-UHFFFAOYSA-N C(C)(=O)Cl.C=CC Chemical compound C(C)(=O)Cl.C=CC UMRBWWUPKSUEAS-UHFFFAOYSA-N 0.000 description 2
- LNGDIDGLOHLBBE-UHFFFAOYSA-N C(C)(=O)NNC(=O)C=1C=C(OC2=CC(=C(C=C2)NC(OC(C)(C)C)=O)F)C=CC=1 Chemical compound C(C)(=O)NNC(=O)C=1C=C(OC2=CC(=C(C=C2)NC(OC(C)(C)C)=O)F)C=CC=1 LNGDIDGLOHLBBE-UHFFFAOYSA-N 0.000 description 2
- HMWIMAHIJYABPG-UHFFFAOYSA-N CC(C)OC(CC1)CCN1C(C=C)=O Chemical compound CC(C)OC(CC1)CCN1C(C=C)=O HMWIMAHIJYABPG-UHFFFAOYSA-N 0.000 description 2
- BRICKEIGCXFQMO-UHFFFAOYSA-N CCc1nnc(-c2cc(O)ccc2)[o]1 Chemical compound CCc1nnc(-c2cc(O)ccc2)[o]1 BRICKEIGCXFQMO-UHFFFAOYSA-N 0.000 description 2
- WVVNWSJPJWAZKR-UHFFFAOYSA-N CCc1nnc(-c2cccc(Oc(cc(c([N+]([O-])=O)c3)F)c3Cl)c2)[o]1 Chemical compound CCc1nnc(-c2cccc(Oc(cc(c([N+]([O-])=O)c3)F)c3Cl)c2)[o]1 WVVNWSJPJWAZKR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 2
- AOCCBINRVIKJHY-UHFFFAOYSA-N Carmofur Chemical compound CCCCCCNC(=O)N1C=C(F)C(=O)NC1=O AOCCBINRVIKJHY-UHFFFAOYSA-N 0.000 description 2
- RURLVUZRUFHCJO-UHFFFAOYSA-N Chromomycin A3 Natural products COC(C1Cc2cc3cc(OC4CC(OC(=O)C)C(OC5CC(O)C(OC)C(C)O5)C(C)O4)c(C)c(O)c3c(O)c2C(=O)C1OC6CC(OC7CC(C)(O)C(OC(=O)C)C(C)O7)C(O)C(C)O6)C(=O)C(O)C(C)O RURLVUZRUFHCJO-UHFFFAOYSA-N 0.000 description 2
- 206010009944 Colon cancer Diseases 0.000 description 2
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 108010092160 Dactinomycin Proteins 0.000 description 2
- 108060006698 EGF receptor Proteins 0.000 description 2
- 101150029707 ERBB2 gene Proteins 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- AHHUGRNITXNDAR-UHFFFAOYSA-N FC1=C(C=CC(=C1)OC1=NNC=C1)NC(OCC1=CC=CC=C1)=O Chemical compound FC1=C(C=CC(=C1)OC1=NNC=C1)NC(OCC1=CC=CC=C1)=O AHHUGRNITXNDAR-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 2
- 238000006736 Huisgen cycloaddition reaction Methods 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 2
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 2
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 description 2
- 206010027476 Metastases Diseases 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 2
- 102000043276 Oncogene Human genes 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 229920001214 Polysorbate 60 Polymers 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- WWGXOSCIRCYLPM-FXRZFVDSSA-N [(e)-but-2-enyl]-dimethylazanium;chloride Chemical compound [Cl-].C\C=C\C[NH+](C)C WWGXOSCIRCYLPM-FXRZFVDSSA-N 0.000 description 2
- PNDPGZBMCMUPRI-XXSWNUTMSA-N [125I][125I] Chemical compound [125I][125I] PNDPGZBMCMUPRI-XXSWNUTMSA-N 0.000 description 2
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 2
- RRUDCFGSUDOHDG-UHFFFAOYSA-N acetohydroxamic acid Chemical compound CC(O)=NO RRUDCFGSUDOHDG-UHFFFAOYSA-N 0.000 description 2
- 229960001171 acetohydroxamic acid Drugs 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229920013822 aminosilicone Polymers 0.000 description 2
- 229940045799 anthracyclines and related substance Drugs 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000035578 autophosphorylation Effects 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- RIWUODSSNOJZDW-UHFFFAOYSA-N benzyl N-[2-fluoro-4-[1-(2-fluoropyridin-4-yl)pyrazol-3-yl]oxyphenyl]carbamate Chemical compound FC1=C(C=CC(=C1)OC1=NN(C=C1)C1=CC(=NC=C1)F)NC(OCC1=CC=CC=C1)=O RIWUODSSNOJZDW-UHFFFAOYSA-N 0.000 description 2
- BJYGMMYTXSWUAX-UHFFFAOYSA-N benzyl N-[2-fluoro-4-[1-(5-fluoro-6-methylpyridin-3-yl)pyrazol-3-yl]oxyphenyl]carbamate Chemical compound FC1=C(C=CC(=C1)OC1=NN(C=C1)C=1C=NC(=C(C=1)F)C)NC(OCC1=CC=CC=C1)=O BJYGMMYTXSWUAX-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N beta-monoglyceryl stearate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- 229960000397 bevacizumab Drugs 0.000 description 2
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 2
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 2
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 230000004579 body weight change Effects 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- YJRGMUWRPCPLNH-UHFFFAOYSA-N butyl 2-chloroacetate Chemical group CCCCOC(=O)CCl YJRGMUWRPCPLNH-UHFFFAOYSA-N 0.000 description 2
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 229960003261 carmofur Drugs 0.000 description 2
- 210000000170 cell membrane Anatomy 0.000 description 2
- 229960005395 cetuximab Drugs 0.000 description 2
- 210000000038 chest Anatomy 0.000 description 2
- 229960003996 chlormadinone Drugs 0.000 description 2
- VUHJZBBCZGVNDZ-TTYLFXKOSA-N chlormadinone Chemical compound C1=C(Cl)C2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 VUHJZBBCZGVNDZ-TTYLFXKOSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- ZYVSOIYQKUDENJ-WKSBCEQHSA-N chromomycin A3 Chemical compound O([C@@H]1C[C@@H](O[C@H](C)[C@@H]1OC(C)=O)OC=1C=C2C=C3C[C@H]([C@@H](C(=O)C3=C(O)C2=C(O)C=1C)O[C@@H]1O[C@H](C)[C@@H](O)[C@H](O[C@@H]2O[C@H](C)[C@@H](O)[C@H](O[C@@H]3O[C@@H](C)[C@H](OC(C)=O)[C@@](C)(O)C3)C2)C1)[C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)[C@@H]1C[C@@H](O)[C@@H](OC)[C@@H](C)O1 ZYVSOIYQKUDENJ-WKSBCEQHSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 229960000640 dactinomycin Drugs 0.000 description 2
- 238000012217 deletion Methods 0.000 description 2
- 230000037430 deletion Effects 0.000 description 2
- 229960001251 denosumab Drugs 0.000 description 2
- 239000000032 diagnostic agent Substances 0.000 description 2
- 229940039227 diagnostic agent Drugs 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 230000004069 differentiation Effects 0.000 description 2
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 229960004679 doxorubicin Drugs 0.000 description 2
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 2
- APVFODFNSLWQTI-UHFFFAOYSA-N ethyl 2-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]-1,3-thiazole-4-carboxylate Chemical compound C(C)(C)(C)OC(=O)NC1=C(C=C(OC=2SC=C(N=2)C(=O)OCC)C=C1)F APVFODFNSLWQTI-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 2
- 235000013355 food flavoring agent Nutrition 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 235000001727 glucose Nutrition 0.000 description 2
- 235000013922 glutamic acid Nutrition 0.000 description 2
- 239000004220 glutamic acid Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- 150000005171 halobenzenes Chemical class 0.000 description 2
- 239000000833 heterodimer Substances 0.000 description 2
- VHHHONWQHHHLTI-UHFFFAOYSA-N hexachloroethane Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)Cl VHHHONWQHHHLTI-UHFFFAOYSA-N 0.000 description 2
- 229940088597 hormone Drugs 0.000 description 2
- 239000005556 hormone Substances 0.000 description 2
- JYGXADMDTFJGBT-VWUMJDOOSA-N hydrocortisone Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 JYGXADMDTFJGBT-VWUMJDOOSA-N 0.000 description 2
- 229960001101 ifosfamide Drugs 0.000 description 2
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 2
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 2
- 229960002411 imatinib Drugs 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 230000008595 infiltration Effects 0.000 description 2
- 238000001764 infiltration Methods 0.000 description 2
- 229960000598 infliximab Drugs 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229940044173 iodine-125 Drugs 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 229960002247 lomustine Drugs 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- FRQMUZJSZHZSGN-HBNHAYAOSA-N medroxyprogesterone Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](O)(C(C)=O)CC[C@H]21 FRQMUZJSZHZSGN-HBNHAYAOSA-N 0.000 description 2
- 229960004616 medroxyprogesterone Drugs 0.000 description 2
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- 230000009401 metastasis Effects 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- PNBUMSNPSWRFDG-UHFFFAOYSA-N methyl 2-[3-[3-fluoro-4-[(7-methoxy-6-nitroquinazolin-4-yl)amino]phenoxy]phenyl]acetate hydrochloride Chemical compound Cl.FC=1C=C(OC=2C=C(C=CC=2)CC(=O)OC)C=CC=1NC1=NC=NC2=CC(=C(C=C12)[N+](=O)[O-])OC PNBUMSNPSWRFDG-UHFFFAOYSA-N 0.000 description 2
- AXJVIYZXNIEZNB-UHFFFAOYSA-N methyl 3-(3-chloro-4-nitrophenoxy)benzoate Chemical compound ClC=1C=C(OC=2C=C(C(=O)OC)C=CC=2)C=CC=1[N+](=O)[O-] AXJVIYZXNIEZNB-UHFFFAOYSA-N 0.000 description 2
- GJUTXLZJCZFNJG-UHFFFAOYSA-N methyl 3-(4-amino-3-chlorophenoxy)benzoate Chemical compound NC1=C(C=C(OC=2C=C(C(=O)OC)C=CC=2)C=C1)Cl GJUTXLZJCZFNJG-UHFFFAOYSA-N 0.000 description 2
- 229940120152 methyl 3-hydroxybenzoate Drugs 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 229940050176 methyl chloride Drugs 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 229950010203 nimotuzumab Drugs 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 230000002018 overexpression Effects 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 229940127557 pharmaceutical product Drugs 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- 230000004962 physiological condition Effects 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229950010131 puromycin Drugs 0.000 description 2
- 230000000171 quenching effect Effects 0.000 description 2
- DRYRBWIFRVMRPV-UHFFFAOYSA-N quinazolin-4-amine Chemical compound C1=CC=C2C(N)=NC=NC2=C1 DRYRBWIFRVMRPV-UHFFFAOYSA-N 0.000 description 2
- 125000004547 quinazolin-6-yl group Chemical group N1=CN=CC2=CC(=CC=C12)* 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 229960004641 rituximab Drugs 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000010413 sodium alginate Nutrition 0.000 description 2
- 239000000661 sodium alginate Substances 0.000 description 2
- 229940005550 sodium alginate Drugs 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229960001674 tegafur Drugs 0.000 description 2
- WFWLQNSHRPWKFK-ZCFIWIBFSA-N tegafur Chemical compound O=C1NC(=O)C(F)=CN1[C@@H]1OCCC1 WFWLQNSHRPWKFK-ZCFIWIBFSA-N 0.000 description 2
- BMEGRZSBETYIEH-UHFFFAOYSA-N tert-butyl 3-[3-fluoro-4-[(7-methoxy-6-nitroquinazolin-4-yl)amino]phenoxy]pyrazole-1-carboxylate Chemical compound FC=1C=C(OC2=NN(C=C2)C(=O)OC(C)(C)C)C=CC=1NC1=NC=NC2=CC(=C(C=C12)[N+](=O)[O-])OC BMEGRZSBETYIEH-UHFFFAOYSA-N 0.000 description 2
- YVBHAAXKEFVMCW-UHFFFAOYSA-N tert-butyl 4-[2-(fluoromethoxy)-5-methoxycarbonyl-4-nitrophenoxy]piperidine-1-carboxylate Chemical compound FCOC1=C(OC2CCN(CC2)C(=O)OC(C)(C)C)C=C(C(=C1)[N+](=O)[O-])C(=O)OC YVBHAAXKEFVMCW-UHFFFAOYSA-N 0.000 description 2
- HONLXVCAMIDGAA-UHFFFAOYSA-N tert-butyl N-[2-fluoro-4-[3-(1-methyltriazol-4-yl)phenoxy]phenyl]carbamate Chemical compound FC1=C(C=CC(=C1)OC1=CC(=CC=C1)C=1N=NN(C=1)C)NC(OC(C)(C)C)=O HONLXVCAMIDGAA-UHFFFAOYSA-N 0.000 description 2
- KKWCHMDXRQNWSM-UHFFFAOYSA-N tert-butyl N-[2-fluoro-4-[3-(2-trimethylsilylethynyl)phenoxy]phenyl]carbamate Chemical compound FC1=C(C=CC(=C1)OC1=CC(=CC=C1)C#C[Si](C)(C)C)NC(OC(C)(C)C)=O KKWCHMDXRQNWSM-UHFFFAOYSA-N 0.000 description 2
- ZRCQANPJRFFKEG-UHFFFAOYSA-N tert-butyl N-[2-fluoro-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]oxy]phenyl]carbamate Chemical compound FC1=C(C=CC(=C1)OC=1SC=C(N=1)B1OC(C(O1)(C)C)(C)C)NC(OC(C)(C)C)=O ZRCQANPJRFFKEG-UHFFFAOYSA-N 0.000 description 2
- VRYGCRDENNRTBD-UHFFFAOYSA-N tert-butyl N-[2-fluoro-4-[[4-(hydroxymethyl)-1,3-thiazol-2-yl]oxy]phenyl]carbamate Chemical compound C1(=C(C=CC(=C1)OC1=NC(CO)=CS1)NC(=O)OC(C)(C)C)F VRYGCRDENNRTBD-UHFFFAOYSA-N 0.000 description 2
- OKKXRTVNANOBRI-UHFFFAOYSA-N tert-butyl N-[4-[3-(tert-butylcarbamoyl)phenoxy]-2-fluorophenyl]carbamate Chemical compound C(C)(C)(C)NC(=O)C=1C=C(OC2=CC(=C(C=C2)NC(OC(C)(C)C)=O)F)C=CC=1 OKKXRTVNANOBRI-UHFFFAOYSA-N 0.000 description 2
- ZVEXIMKCLVQNLC-UHFFFAOYSA-N tert-butyl N-[4-[[4-(cyanomethyl)-1,3-thiazol-2-yl]oxy]-2-fluorophenyl]carbamate Chemical compound C(#N)CC=1N=C(SC=1)OC1=CC(=C(C=C1)NC(OC(C)(C)C)=O)F ZVEXIMKCLVQNLC-UHFFFAOYSA-N 0.000 description 2
- OFMBTCUVYCQPQI-UHFFFAOYSA-N tert-butyl n-(2-fluoro-4-hydroxyphenyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=C(O)C=C1F OFMBTCUVYCQPQI-UHFFFAOYSA-N 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 229960000575 trastuzumab Drugs 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 229910052722 tritium Inorganic materials 0.000 description 2
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 2
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 239000011782 vitamin Substances 0.000 description 2
- 229930003231 vitamin Natural products 0.000 description 2
- 235000013343 vitamin Nutrition 0.000 description 2
- 229940088594 vitamin Drugs 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- WDQLRUYAYXDIFW-RWKIJVEZSA-N (2r,3r,4s,5r,6r)-4-[(2s,3r,4s,5r,6r)-3,5-dihydroxy-4-[(2r,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2r,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol Chemical compound O[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)[C@H](O)[C@@H](CO[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)O1 WDQLRUYAYXDIFW-RWKIJVEZSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- LPXSVMTZVQACFE-UHFFFAOYSA-N (6-ethylpyridin-3-yl)boronic acid Chemical compound CCC1=CC=C(B(O)O)C=N1 LPXSVMTZVQACFE-UHFFFAOYSA-N 0.000 description 1
- MZUSCPDSQJSBSY-UHFFFAOYSA-N (6-methylpyridin-3-yl)boronic acid Chemical compound CC1=CC=C(B(O)O)C=N1 MZUSCPDSQJSBSY-UHFFFAOYSA-N 0.000 description 1
- MHHIDDXQVQKSTI-SNAWJCMRSA-N (E)-4-(dimethylamino)-N-[4-[2-fluoro-4-(1H-pyrazol-5-yloxy)anilino]-7-methoxyquinazolin-6-yl]but-2-enamide Chemical compound CN(C/C=C/C(=O)NC=1C=C2C(=NC=NC2=CC=1OC)NC1=C(C=C(C=C1)OC1=NNC=C1)F)C MHHIDDXQVQKSTI-SNAWJCMRSA-N 0.000 description 1
- LMQPJAIWUDOUBH-AATRIKPKSA-N (E)-N-[4-[4-[1-[2-(tert-butylamino)-2-oxoethyl]-4-fluoropyrazol-3-yl]oxy-2-chloroanilino]-7-methoxyquinazolin-6-yl]-4-(3-fluoropyrrolidin-1-yl)but-2-enamide Chemical compound C(C)(C)(C)NC(CN1N=C(C(=C1)F)OC1=CC(=C(NC2=NC=NC3=CC(=C(C=C23)NC(\C=C\CN2CC(CC2)F)=O)OC)C=C1)Cl)=O LMQPJAIWUDOUBH-AATRIKPKSA-N 0.000 description 1
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- DOTGZROJTAUYFQ-OWOJBTEDSA-N (e)-4-bromobut-2-enoic acid Chemical compound OC(=O)\C=C\CBr DOTGZROJTAUYFQ-OWOJBTEDSA-N 0.000 description 1
- VLVCERQEOKPRTG-UHFFFAOYSA-N 1,1,1-trifluoropropan-2-amine;hydrochloride Chemical compound Cl.CC(N)C(F)(F)F VLVCERQEOKPRTG-UHFFFAOYSA-N 0.000 description 1
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 description 1
- SKCBKBCACWDALV-UHFFFAOYSA-N 1-(trifluoromethyl)cyclopropane-1-carboxylic acid Chemical compound OC(=O)C1(C(F)(F)F)CC1 SKCBKBCACWDALV-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- CIAUKXUCIBBXIE-UHFFFAOYSA-N 1-[3-(3-chloro-4-nitrophenoxy)pyrazol-1-yl]ethanone Chemical compound ClC=1C=C(OC2=NN(C=C2)C(C)=O)C=CC=1[N+](=O)[O-] CIAUKXUCIBBXIE-UHFFFAOYSA-N 0.000 description 1
- LPFWVDIFUFFKJU-UHFFFAOYSA-N 1-[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound C=12C=C(OC3CCN(CC3)C(=O)C=C)C(OC)=CC2=NC=NC=1NC1=CC=C(Cl)C(Cl)=C1F LPFWVDIFUFFKJU-UHFFFAOYSA-N 0.000 description 1
- OISNHCDHWSJXRQ-UHFFFAOYSA-N 1-[4-[4-[2-chloro-4-[3-(1-methyltriazol-4-yl)phenoxy]anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound ClC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC1=CC(=CC=C1)C=1N=NN(C=1)C OISNHCDHWSJXRQ-UHFFFAOYSA-N 0.000 description 1
- AZYFQNMMWYRZSI-UHFFFAOYSA-N 1-[4-[4-[2-fluoro-4-[1-(2-fluoropyridin-4-yl)pyrazol-3-yl]oxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound FC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC1=NN(C=C1)C1=CC(=NC=C1)F AZYFQNMMWYRZSI-UHFFFAOYSA-N 0.000 description 1
- KRJKCLAUAWHCJT-UHFFFAOYSA-N 1-[4-[4-[2-fluoro-4-[1-(2-methoxypyridin-4-yl)pyrazol-3-yl]oxyanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound FC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC1=NN(C=C1)C1=CC(=NC=C1)OC KRJKCLAUAWHCJT-UHFFFAOYSA-N 0.000 description 1
- RXIRUWJOIKBGNN-UHFFFAOYSA-N 1-[4-[4-[2-fluoro-4-[[4-(6-methylpyridin-3-yl)-1,3-thiazol-2-yl]oxy]anilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound FC1=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=CC(=C1)OC=1SC=C(N=1)C=1C=CC(=NC=1)C RXIRUWJOIKBGNN-UHFFFAOYSA-N 0.000 description 1
- UUNGLILFVFCJBI-UHFFFAOYSA-N 1-[4-[4-[4-[1-(2-chloropyridin-4-yl)pyrazol-3-yl]oxy-2-fluoroanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound ClC1=NC=CC(=C1)N1N=C(C=C1)OC1=CC(=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=C1)F UUNGLILFVFCJBI-UHFFFAOYSA-N 0.000 description 1
- LZLNQGXXKKRVLN-UHFFFAOYSA-N 1-[4-[4-[4-[1-(6-cyclopropylpyridin-3-yl)pyrazol-3-yl]oxy-2-fluoroanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound COC1=C(C=C2C(=C1)N=CN=C2NC3=C(C=C(C=C3)OC4=NN(C=C4)C5=CN=C(C=C5)C6CC6)F)OC7CCN(CC7)C(=O)C=C LZLNQGXXKKRVLN-UHFFFAOYSA-N 0.000 description 1
- NEWYHJSKRJIWAM-UHFFFAOYSA-N 1-[4-[4-[4-[[4-(6-ethylpyridin-3-yl)-1,3-thiazol-2-yl]oxy]-2-fluoroanilino]-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one Chemical compound C(C)C1=CC=C(C=N1)C=1N=C(SC=1)OC1=CC(=C(NC2=NC=NC3=CC(=C(C=C23)OC2CCN(CC2)C(C=C)=O)OC)C=C1)F NEWYHJSKRJIWAM-UHFFFAOYSA-N 0.000 description 1
- 102100025573 1-alkyl-2-acetylglycerophosphocholine esterase Human genes 0.000 description 1
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- WNWHHMBRJJOGFJ-UHFFFAOYSA-N 16-methylheptadecan-1-ol Chemical class CC(C)CCCCCCCCCCCCCCCO WNWHHMBRJJOGFJ-UHFFFAOYSA-N 0.000 description 1
- BFPYWIDHMRZLRN-UHFFFAOYSA-N 17alpha-ethynyl estradiol Natural products OC1=CC=C2C3CCC(C)(C(CC4)(O)C#C)C4C3CCC2=C1 BFPYWIDHMRZLRN-UHFFFAOYSA-N 0.000 description 1
- ZCEKDMSOCGIMEO-UHFFFAOYSA-N 2-[2-(4-amino-3-fluorophenoxy)-1,3-thiazol-4-yl]-N-tert-butylacetamide Chemical compound NC1=C(C=C(OC=2SC=C(N=2)CC(=O)NC(C)(C)C)C=C1)F ZCEKDMSOCGIMEO-UHFFFAOYSA-N 0.000 description 1
- HMBOFGLZFUBXNY-UHFFFAOYSA-N 2-[2-(4-amino-3-fluorophenoxy)-1,3-thiazol-4-yl]acetic acid hydrochloride Chemical compound Cl.NC1=C(C=C(OC=2SC=C(N2)CC(=O)O)C=C1)F HMBOFGLZFUBXNY-UHFFFAOYSA-N 0.000 description 1
- XETZEWJTPKCAMB-UHFFFAOYSA-N 2-[2-[4-[(6-amino-7-methoxyquinazolin-4-yl)amino]-3-fluorophenoxy]-1,3-thiazol-4-yl]-N-tert-butylacetamide Chemical compound NC=1C=C2C(=NC=NC2=CC=1OC)NC1=C(C=C(OC=2SC=C(N=2)CC(=O)NC(C)(C)C)C=C1)F XETZEWJTPKCAMB-UHFFFAOYSA-N 0.000 description 1
- FPCBXAFMRQRAQH-UHFFFAOYSA-N 2-[3-(3-chloro-4-nitrophenoxy)pyrazol-1-yl]acetic acid Chemical compound ClC=1C=C(OC2=NN(C=C2)CC(=O)O)C=CC=1[N+](=O)[O-] FPCBXAFMRQRAQH-UHFFFAOYSA-N 0.000 description 1
- LKNQMHJGIVJYDG-UHFFFAOYSA-N 2-[3-[4-[(6-amino-7-methoxyquinazolin-4-yl)amino]-3-fluorophenoxy]phenyl]-N-tert-butylacetamide Chemical compound NC=1C=C2C(=NC=NC2=CC=1OC)NC1=C(C=C(OC=2C=C(C=CC=2)CC(=O)NC(C)(C)C)C=C1)F LKNQMHJGIVJYDG-UHFFFAOYSA-N 0.000 description 1
- FECDJOFSRHTAMA-UHFFFAOYSA-N 2-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]-1,3-thiazole-4-carboxylic acid Chemical compound C(C)(C)(C)OC(=O)NC1=C(C=C(OC=2SC=C(N=2)C(=O)O)C=C1)F FECDJOFSRHTAMA-UHFFFAOYSA-N 0.000 description 1
- BDVADQLJNVTCIP-UHFFFAOYSA-N 2-[3-fluoro-4-[(7-methoxy-6-nitroquinazolin-4-yl)amino]phenoxy]-1,3-thiazole-4-carboxylic acid Chemical compound FC=1C=C(OC=2SC=C(N=2)C(=O)O)C=CC=1NC1=NC=NC2=CC(=C(C=C12)[N+](=O)[O-])OC BDVADQLJNVTCIP-UHFFFAOYSA-N 0.000 description 1
- QNVWAWJEUSFZNC-UHFFFAOYSA-N 2-[4-[(6-amino-7-methoxyquinazolin-4-yl)amino]-3-fluorophenoxy]-N-tert-butyl-1,3-thiazole-4-carboxamide Chemical compound NC=1C=C2C(=NC=NC2=CC=1OC)NC1=C(C=C(OC=2SC=C(N=2)C(=O)NC(C)(C)C)C=C1)F QNVWAWJEUSFZNC-UHFFFAOYSA-N 0.000 description 1
- RXNZFHIEDZEUQM-UHFFFAOYSA-N 2-bromo-1,3-thiazole Chemical compound BrC1=NC=CS1 RXNZFHIEDZEUQM-UHFFFAOYSA-N 0.000 description 1
- BTSHRVUWMKBAKD-UHFFFAOYSA-N 2-chloro-4-[3-(1-methyltriazol-4-yl)phenoxy]aniline Chemical compound ClC1=C(N)C=CC(=C1)OC1=CC(=CC=C1)C=1N=NN(C=1)C BTSHRVUWMKBAKD-UHFFFAOYSA-N 0.000 description 1
- FGSAQRJRWCZLOB-UHFFFAOYSA-N 2-chloro-4-fluoropyridine Chemical compound FC1=CC=NC(Cl)=C1 FGSAQRJRWCZLOB-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- NDMPLJNOPCLANR-UHFFFAOYSA-N 3,4-dihydroxy-15-(4-hydroxy-18-methoxycarbonyl-5,18-seco-ibogamin-18-yl)-16-methoxy-1-methyl-6,7-didehydro-aspidospermidine-3-carboxylic acid methyl ester Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 NDMPLJNOPCLANR-UHFFFAOYSA-N 0.000 description 1
- IOTQRSSKVIHPAC-UHFFFAOYSA-N 3-(2-chloro-5-fluoro-4-nitrophenoxy)-N-propan-2-ylpyrazole-1-carboxamide Chemical compound ClC1=C(OC2=NN(C=C2)C(=O)NC(C)C)C=C(C(=C1)[N+](=O)[O-])F IOTQRSSKVIHPAC-UHFFFAOYSA-N 0.000 description 1
- OAPPVMDUMDLPFB-UHFFFAOYSA-N 3-(4-amino-3-fluorophenoxy)-N-tert-butylpyrazole-1-carboxamide Chemical compound NC1=C(C=C(OC2=NN(C=C2)C(=O)NC(C)(C)C)C=C1)F OAPPVMDUMDLPFB-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 1
- AODMJIOEGCBUQL-UHFFFAOYSA-N 3-ethynylphenol Chemical group OC1=CC=CC(C#C)=C1 AODMJIOEGCBUQL-UHFFFAOYSA-N 0.000 description 1
- LENYOXXELREKGZ-UHFFFAOYSA-N 3-fluoropyrrolidine;hydron;chloride Chemical compound Cl.FC1CCNC1 LENYOXXELREKGZ-UHFFFAOYSA-N 0.000 description 1
- CISXCTKEQYOZAM-UHFFFAOYSA-N 3-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=CC=CC(OCC=2C=CC=CC=2)=C1 CISXCTKEQYOZAM-UHFFFAOYSA-N 0.000 description 1
- WVMLLEGBRHKVOS-UHFFFAOYSA-N 4-[3-(3-chloro-4-nitrophenoxy)phenyl]-1-methyltriazole Chemical compound ClC=1C=C(OC=2C=C(C=CC=2)C=2N=NN(C=2)C)C=CC=1[N+](=O)[O-] WVMLLEGBRHKVOS-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- MNPLTKHJEAFOCA-UHFFFAOYSA-N 4-amino-3-fluorophenol Chemical compound NC1=CC=C(O)C=C1F MNPLTKHJEAFOCA-UHFFFAOYSA-N 0.000 description 1
- UYQMNEZWVKRWMS-UHFFFAOYSA-N 4-chloro-7-fluoro-6-nitroquinazoline Chemical compound N1=CN=C2C=C(F)C([N+](=O)[O-])=CC2=C1Cl UYQMNEZWVKRWMS-UHFFFAOYSA-N 0.000 description 1
- KPDHDFAJVMZYBS-UHFFFAOYSA-N 4-fluoro-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxy-2-nitrobenzoic acid Chemical compound C(C)(C)(C)OC(=O)N1CCC(CC1)OC=1C(=CC(=C(C(=O)O)C=1)[N+](=O)[O-])F KPDHDFAJVMZYBS-UHFFFAOYSA-N 0.000 description 1
- WLJWEZIWWHAIEM-UHFFFAOYSA-N 5-bromo-2-cyclopropylpyridine Chemical compound N1=CC(Br)=CC=C1C1CC1 WLJWEZIWWHAIEM-UHFFFAOYSA-N 0.000 description 1
- KQCSRDNKPIPYIS-UHFFFAOYSA-N 5-bromo-3-fluoro-2-methylpyridine Chemical compound CC1=NC=C(Br)C=C1F KQCSRDNKPIPYIS-UHFFFAOYSA-N 0.000 description 1
- WOVKYSAHUYNSMH-RRKCRQDMSA-N 5-bromodeoxyuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(Br)=C1 WOVKYSAHUYNSMH-RRKCRQDMSA-N 0.000 description 1
- NKGPJODWTZCHGF-KQYNXXCUSA-N 6-thioinosinic acid Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(S)=C2N=C1 NKGPJODWTZCHGF-KQYNXXCUSA-N 0.000 description 1
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 1
- AJRGEVFKZSWGFX-UHFFFAOYSA-N 7-methoxy-6-nitro-1h-quinazolin-4-one Chemical compound N1=CNC(=O)C2=C1C=C(OC)C([N+]([O-])=O)=C2 AJRGEVFKZSWGFX-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 108010024976 Asparaginase Proteins 0.000 description 1
- DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Natural products OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 1
- WOVKYSAHUYNSMH-UHFFFAOYSA-N BROMODEOXYURIDINE Natural products C1C(O)C(CO)OC1N1C(=O)NC(=O)C(Br)=C1 WOVKYSAHUYNSMH-UHFFFAOYSA-N 0.000 description 1
- VGGGPCQERPFHOB-MCIONIFRSA-N Bestatin Chemical compound CC(C)C[C@H](C(O)=O)NC(=O)[C@@H](O)[C@H](N)CC1=CC=CC=C1 VGGGPCQERPFHOB-MCIONIFRSA-N 0.000 description 1
- 108010006654 Bleomycin Proteins 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- BVPFLVDXWBFEOB-UHFFFAOYSA-N BrC=1N=C(SC=1)OC1=CC(=C(C=C1)NC(OC(C)(C)C)=O)F Chemical compound BrC=1N=C(SC=1)OC1=CC(=C(C=C1)NC(OC(C)(C)C)=O)F BVPFLVDXWBFEOB-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- PFHYMHTYTZSFDU-HDXZFHHSSA-N CC(C)(C)OC(Nc(ccc(Oc1cc(/C(/N=N\I)=C/[IH]C)ccc1)c1)c1F)=O Chemical compound CC(C)(C)OC(Nc(ccc(Oc1cc(/C(/N=N\I)=C/[IH]C)ccc1)c1)c1F)=O PFHYMHTYTZSFDU-HDXZFHHSSA-N 0.000 description 1
- VXQMXIUGMFLXQW-UHFFFAOYSA-N CC(C)(C)OC(Nc(ccc(Oc1nc(-c2cc(F)c(C)nc2)c[s]1)c1)c1F)=O Chemical compound CC(C)(C)OC(Nc(ccc(Oc1nc(-c2cc(F)c(C)nc2)c[s]1)c1)c1F)=O VXQMXIUGMFLXQW-UHFFFAOYSA-N 0.000 description 1
- LQRNQHRPODRTES-BQYQJAHWSA-N CC(C)(C)OC([n](cc1)nc1Oc(cc1)cc(F)c1Nc1c(cc(c(OC)c2)NC(/C=C/CN(C)C)=O)c2ncn1)=O Chemical compound CC(C)(C)OC([n](cc1)nc1Oc(cc1)cc(F)c1Nc1c(cc(c(OC)c2)NC(/C=C/CN(C)C)=O)c2ncn1)=O LQRNQHRPODRTES-BQYQJAHWSA-N 0.000 description 1
- HERGYCURJUAOGA-WEVVVXLNSA-N CC(C)CC/C=C/C(CCCc1cc2c(Nc(ccc(Oc3n[nH]cc3)c3)c3F)ncnc2cc1OC)=O Chemical compound CC(C)CC/C=C/C(CCCc1cc2c(Nc(ccc(Oc3n[nH]cc3)c3)c3F)ncnc2cc1OC)=O HERGYCURJUAOGA-WEVVVXLNSA-N 0.000 description 1
- SCFFAFXXGKVJML-UHFFFAOYSA-N CCOC(C=C(C(C(OC)=O)=C1)N)=C1OC(CC1)CCN1C(O)=O Chemical compound CCOC(C=C(C(C(OC)=O)=C1)N)=C1OC(CC1)CCN1C(O)=O SCFFAFXXGKVJML-UHFFFAOYSA-N 0.000 description 1
- BAUWRHPMUVYFOD-UHFFFAOYSA-N CN(CC1)CCC1O Chemical compound CN(CC1)CCC1O BAUWRHPMUVYFOD-UHFFFAOYSA-N 0.000 description 1
- CZPFUGGIUHIPAS-UHFFFAOYSA-N COC(C(C([N+]([O-])=O)=C1)=CC(OC(CC2)CCN2C(O)=O)=C1F)=O Chemical compound COC(C(C([N+]([O-])=O)=C1)=CC(OC(CC2)CCN2C(O)=O)=C1F)=O CZPFUGGIUHIPAS-UHFFFAOYSA-N 0.000 description 1
- SJNFVAPZDCWYKE-UHFFFAOYSA-N COc(cc1ncnc(CCc(ccc(Oc2n[nH]cc2)c2)c2F)c1c1)c1OC1CCC(CC(C=C)=O)CC1 Chemical compound COc(cc1ncnc(CCc(ccc(Oc2n[nH]cc2)c2)c2F)c1c1)c1OC1CCC(CC(C=C)=O)CC1 SJNFVAPZDCWYKE-UHFFFAOYSA-N 0.000 description 1
- FVLVBPDQNARYJU-XAHDHGMMSA-N C[C@H]1CCC(CC1)NC(=O)N(CCCl)N=O Chemical compound C[C@H]1CCC(CC1)NC(=O)N(CCCl)N=O FVLVBPDQNARYJU-XAHDHGMMSA-N 0.000 description 1
- FZDCQMDEJJMLAZ-UHFFFAOYSA-O C[OH+]c(cc(c(F)c1)Cl)c1F Chemical compound C[OH+]c(cc(c(F)c1)Cl)c1F FZDCQMDEJJMLAZ-UHFFFAOYSA-O 0.000 description 1
- STQHEWMVSKQUCJ-UHFFFAOYSA-N C[n]1nnc(-c2cc(Oc(cc3)cc(F)c3N)ccc2)c1 Chemical compound C[n]1nnc(-c2cc(Oc(cc3)cc(F)c3N)ccc2)c1 STQHEWMVSKQUCJ-UHFFFAOYSA-N 0.000 description 1
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 description 1
- SHHKQEUPHAENFK-UHFFFAOYSA-N Carboquone Chemical compound O=C1C(C)=C(N2CC2)C(=O)C(C(COC(N)=O)OC)=C1N1CC1 SHHKQEUPHAENFK-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 1
- IKIPNQOAEKDEQP-UHFFFAOYSA-N Cc1ncc(-c2cc(Oc3cc(F)c(CCN)cc3)ccc2)[o]1 Chemical compound Cc1ncc(-c2cc(Oc3cc(F)c(CCN)cc3)ccc2)[o]1 IKIPNQOAEKDEQP-UHFFFAOYSA-N 0.000 description 1
- WZLSBZHCEXPJAU-UHFFFAOYSA-N Cc1ncnc(cc2OC)c1cc2[N+]([O-])=O Chemical compound Cc1ncnc(cc2OC)c1cc2[N+]([O-])=O WZLSBZHCEXPJAU-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- MKQWTWSXVILIKJ-LXGUWJNJSA-N Chlorozotocin Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](C=O)NC(=O)N(N=O)CCCl MKQWTWSXVILIKJ-LXGUWJNJSA-N 0.000 description 1
- JHGSUCXLXOWUNA-GQALSZNTSA-N ClC1=C(OC2=NN(C=C2)C(=O)NC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C=C(C(=C1)[N+](=O)[O-])F Chemical compound ClC1=C(OC2=NN(C=C2)C(=O)NC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C=C(C(=C1)[N+](=O)[O-])F JHGSUCXLXOWUNA-GQALSZNTSA-N 0.000 description 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- ZZZCUOFIHGPKAK-UHFFFAOYSA-N D-erythro-ascorbic acid Natural products OCC1OC(=O)C(O)=C1O ZZZCUOFIHGPKAK-UHFFFAOYSA-N 0.000 description 1
- 230000004544 DNA amplification Effects 0.000 description 1
- ZBNZXTGUTAYRHI-UHFFFAOYSA-N Dasatinib Chemical compound C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1Cl ZBNZXTGUTAYRHI-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- SAMRUMKYXPVKPA-VFKOLLTISA-N Enocitabine Chemical compound O=C1N=C(NC(=O)CCCCCCCCCCCCCCCCCCCCC)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 SAMRUMKYXPVKPA-VFKOLLTISA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- BFPYWIDHMRZLRN-SLHNCBLASA-N Ethinyl estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 BFPYWIDHMRZLRN-SLHNCBLASA-N 0.000 description 1
- ZYDYNJZLUIJYHP-UHFFFAOYSA-N FC(C(=O)O)(F)F.FC1=C(N)C=CC(=C1)OC1=CC(=CC=C1)C=1N=NN(C=1)C Chemical compound FC(C(=O)O)(F)F.FC1=C(N)C=CC(=C1)OC1=CC(=CC=C1)C=1N=NN(C=1)C ZYDYNJZLUIJYHP-UHFFFAOYSA-N 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- DCXXMTOCNZCJGO-UHFFFAOYSA-N Glycerol trioctadecanoate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000851181 Homo sapiens Epidermal growth factor receptor Proteins 0.000 description 1
- 108010002386 Interleukin-3 Proteins 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical compound OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 1
- 239000002147 L01XE04 - Sunitinib Substances 0.000 description 1
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 1
- 239000002067 L01XE06 - Dasatinib Substances 0.000 description 1
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 1
- 239000005536 L01XE08 - Nilotinib Substances 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- XNRVGTHNYCNCFF-UHFFFAOYSA-N Lapatinib ditosylate monohydrate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1.CC1=CC=C(S(O)(=O)=O)C=C1.O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 XNRVGTHNYCNCFF-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- XOBKSJJDNFUZPF-UHFFFAOYSA-N Methoxyethane Chemical compound CCOC XOBKSJJDNFUZPF-UHFFFAOYSA-N 0.000 description 1
- FQISKWAFAHGMGT-SGJOWKDISA-M Methylprednisolone sodium succinate Chemical compound [Na+].C([C@@]12C)=CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C)[C@@](O)(C(=O)COC(=O)CCC([O-])=O)CC[C@H]21 FQISKWAFAHGMGT-SGJOWKDISA-M 0.000 description 1
- VFKZTMPDYBFSTM-KVTDHHQDSA-N Mitobronitol Chemical compound BrC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CBr VFKZTMPDYBFSTM-KVTDHHQDSA-N 0.000 description 1
- 238000006751 Mitsunobu reaction Methods 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 1
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 1
- NJARDRWHPKSZCD-UHFFFAOYSA-N N-tert-butyl-2-[3-(3-chloro-4-nitrophenoxy)-4-fluoropyrazol-1-yl]acetamide Chemical compound C(C)(C)(C)NC(CN1N=C(C(=C1)F)OC1=CC(=C(C=C1)[N+](=O)[O-])Cl)=O NJARDRWHPKSZCD-UHFFFAOYSA-N 0.000 description 1
- SPJGLYZKZJRORI-UHFFFAOYSA-N N-tert-butyl-2-[3-[3-fluoro-4-[(7-methoxy-6-nitroquinazolin-4-yl)amino]phenoxy]phenyl]acetamide Chemical compound C(C)(C)(C)NC(CC1=CC(=CC=C1)OC1=CC(=C(C=C1)NC1=NC=NC2=CC(=C(C=C12)[N+](=O)[O-])OC)F)=O SPJGLYZKZJRORI-UHFFFAOYSA-N 0.000 description 1
- BHLHPNFZGZIHGH-UHFFFAOYSA-N N-tert-butyl-2-[3-fluoro-4-[(7-methoxy-6-nitroquinazolin-4-yl)amino]phenoxy]-1,3-thiazole-4-carboxamide Chemical compound C(C)(C)(C)NC(=O)C=1N=C(SC=1)OC1=CC(=C(C=C1)NC1=NC=NC2=CC(=C(C=C12)[N+](=O)[O-])OC)F BHLHPNFZGZIHGH-UHFFFAOYSA-N 0.000 description 1
- JHGSUCXLXOWUNA-UHFFFAOYSA-N N-tert-butyl-3-(2-chloro-5-fluoro-4-nitrophenoxy)pyrazole-1-carboxamide Chemical compound C(C)(C)(C)NC(=O)N1N=C(C=C1)OC1=C(C=C(C(=C1)F)[N+](=O)[O-])Cl JHGSUCXLXOWUNA-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 101710204212 Neocarzinostatin Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- AFLXUQUGROGEFA-UHFFFAOYSA-N Nitrogen mustard N-oxide Chemical compound ClCC[N+]([O-])(C)CCCl AFLXUQUGROGEFA-UHFFFAOYSA-N 0.000 description 1
- 241001465805 Nymphalidae Species 0.000 description 1
- CWFZTJNCFQQMDK-UHFFFAOYSA-N OC1=NN(C=C1)C(=O)OCCCC Chemical group OC1=NN(C=C1)C(=O)OCCCC CWFZTJNCFQQMDK-UHFFFAOYSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 238000006086 Paal-Knorr synthesis reaction Methods 0.000 description 1
- 229930012538 Paclitaxel Natural products 0.000 description 1
- 108010057150 Peplomycin Proteins 0.000 description 1
- 244000134552 Plantago ovata Species 0.000 description 1
- 235000003421 Plantago ovata Nutrition 0.000 description 1
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 1
- 102100033237 Pro-epidermal growth factor Human genes 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000009223 Psyllium Substances 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical group C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 239000012980 RPMI-1640 medium Substances 0.000 description 1
- AHHFEZNOXOZZQA-ZEBDFXRSSA-N Ranimustine Chemical compound CO[C@H]1O[C@H](CNC(=O)N(CCCl)N=O)[C@@H](O)[C@H](O)[C@H]1O AHHFEZNOXOZZQA-ZEBDFXRSSA-N 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229920000519 Sizofiran Polymers 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 238000003477 Sonogashira cross-coupling reaction Methods 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229940123237 Taxane Drugs 0.000 description 1
- WFWLQNSHRPWKFK-UHFFFAOYSA-N Tegafur Chemical compound O=C1NC(=O)C(F)=CN1C1OCCC1 WFWLQNSHRPWKFK-UHFFFAOYSA-N 0.000 description 1
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 239000004473 Threonine Substances 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 1
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 1
- 229940122803 Vinca alkaloid Drugs 0.000 description 1
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 1
- 229930003268 Vitamin C Natural products 0.000 description 1
- 235000010724 Wisteria floribunda Nutrition 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical class [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- BOGSOFADOWIECK-UHFFFAOYSA-N [N].C=1C=NNC=1 Chemical group [N].C=1C=NNC=1 BOGSOFADOWIECK-UHFFFAOYSA-N 0.000 description 1
- 239000003655 absorption accelerator Substances 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- ZOZKYEHVNDEUCO-XUTVFYLZSA-N aceglatone Chemical compound O1C(=O)[C@H](OC(C)=O)[C@@H]2OC(=O)[C@@H](OC(=O)C)[C@@H]21 ZOZKYEHVNDEUCO-XUTVFYLZSA-N 0.000 description 1
- 229950002684 aceglatone Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- USZYSDMBJDPRIF-SVEJIMAYSA-N aclacinomycin A Chemical compound O([C@H]1[C@@H](O)C[C@@H](O[C@H]1C)O[C@H]1[C@H](C[C@@H](O[C@H]1C)O[C@H]1C[C@]([C@@H](C2=CC=3C(=O)C4=CC=CC(O)=C4C(=O)C=3C(O)=C21)C(=O)OC)(O)CC)N(C)C)[C@H]1CCC(=O)[C@H](C)O1 USZYSDMBJDPRIF-SVEJIMAYSA-N 0.000 description 1
- 229960004176 aclarubicin Drugs 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000005902 aminomethylation reaction Methods 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960003121 arginine Drugs 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000009582 asparagine Nutrition 0.000 description 1
- 229960001230 asparagine Drugs 0.000 description 1
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 1
- JNFRPHKXOCFXJF-UHFFFAOYSA-N azide Chemical compound [N-]=[N+]=[N-].[N-]=[N+]=[N-] JNFRPHKXOCFXJF-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- HTUFGZSNLPFBBO-UHFFFAOYSA-N benzyl N-[5-chloro-2-fluoro-4-(1H-pyrazol-5-yloxy)phenyl]carbamate Chemical compound ClC=1C(=CC(=C(C=1)NC(OCC1=CC=CC=C1)=O)F)OC1=NNC=C1 HTUFGZSNLPFBBO-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229960002537 betamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-DVTGEIKXSA-N betamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-DVTGEIKXSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 229960001561 bleomycin Drugs 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 229950004398 broxuridine Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229960002092 busulfan Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- PVQBFMMTUNVXJG-UHFFFAOYSA-N butyl 2,4-difluorobenzoate Chemical group CCCCOC(=O)C1=CC=C(F)C=C1F PVQBFMMTUNVXJG-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 229940127093 camptothecin Drugs 0.000 description 1
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 230000021235 carbamoylation Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 229960004562 carboplatin Drugs 0.000 description 1
- 229960002115 carboquone Drugs 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229960005243 carmustine Drugs 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 238000012054 celltiter-glo Methods 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229960004630 chlorambucil Drugs 0.000 description 1
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 1
- JWMLCCRPDOIBAV-UHFFFAOYSA-N chloro(methylsulfanyl)methane Chemical compound CSCCl JWMLCCRPDOIBAV-UHFFFAOYSA-N 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 229960001480 chlorozotocin Drugs 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- NWNLOVCQPONMMC-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1.OC(=O)C1CC1 NWNLOVCQPONMMC-UHFFFAOYSA-N 0.000 description 1
- 229960000684 cytarabine Drugs 0.000 description 1
- 229960003901 dacarbazine Drugs 0.000 description 1
- 229960002448 dasatinib Drugs 0.000 description 1
- 229960000975 daunorubicin Drugs 0.000 description 1
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229960003957 dexamethasone Drugs 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 150000001987 diarylethers Chemical class 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- YVHPHQBRUPLYOS-UHFFFAOYSA-N dichloromethane;methane Chemical compound C.ClCCl YVHPHQBRUPLYOS-UHFFFAOYSA-N 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- NLORYLAYLIXTID-ISLYRVAYSA-N diethylstilbestrol diphosphate Chemical compound C=1C=C(OP(O)(O)=O)C=CC=1C(/CC)=C(\CC)C1=CC=C(OP(O)(O)=O)C=C1 NLORYLAYLIXTID-ISLYRVAYSA-N 0.000 description 1
- 239000012470 diluted sample Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 1
- 229960003668 docetaxel Drugs 0.000 description 1
- ZWAOHEXOSAUJHY-ZIYNGMLESA-N doxifluridine Chemical compound O[C@@H]1[C@H](O)[C@@H](C)O[C@H]1N1C(=O)NC(=O)C(F)=C1 ZWAOHEXOSAUJHY-ZIYNGMLESA-N 0.000 description 1
- 229950005454 doxifluridine Drugs 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 229950011487 enocitabine Drugs 0.000 description 1
- 239000002662 enteric coated tablet Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 210000001339 epidermal cell Anatomy 0.000 description 1
- 229960001904 epirubicin Drugs 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 229960002568 ethinylestradiol Drugs 0.000 description 1
- WHTHQYKCCUBEPG-UHFFFAOYSA-N ethyl 2-[3-fluoro-4-[(7-methoxy-6-nitroquinazolin-4-yl)amino]phenoxy]-1,3-thiazole-4-carboxylate Chemical compound FC=1C=C(OC=2SC=C(N=2)C(=O)OCC)C=CC=1NC1=NC=NC2=CC(=C(C=C12)[N+](=O)[O-])OC WHTHQYKCCUBEPG-UHFFFAOYSA-N 0.000 description 1
- CNHISCQPKKGDPO-UHFFFAOYSA-N ethyl 2-bromo-1,3-thiazole-4-carboxylate Chemical compound CCOC(=O)C1=CSC(Br)=N1 CNHISCQPKKGDPO-UHFFFAOYSA-N 0.000 description 1
- KXXWEMURNXMWQT-UHFFFAOYSA-N ethyl 3-(4-amino-3-fluorophenoxy)benzoate Chemical compound NC1=C(C=C(OC=2C=C(C(=O)OCC)C=CC=2)C=C1)F KXXWEMURNXMWQT-UHFFFAOYSA-N 0.000 description 1
- POGCXCWRMMXDAQ-UHFFFAOYSA-N ethyl 3-iodobenzoate Chemical compound CCOC(=O)C1=CC=CC(I)=C1 POGCXCWRMMXDAQ-UHFFFAOYSA-N 0.000 description 1
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 1
- 229960005420 etoposide Drugs 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 229940121645 first-generation egfr tyrosine kinase inhibitor Drugs 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 229960000304 folic acid Drugs 0.000 description 1
- 235000019152 folic acid Nutrition 0.000 description 1
- 239000011724 folic acid Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 229960000297 fosfestrol Drugs 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 210000004211 gastric acid Anatomy 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 229960002989 glutamic acid Drugs 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- ALBYIUDWACNRRB-UHFFFAOYSA-N hexanamide Chemical group CCCCCC(N)=O ALBYIUDWACNRRB-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 239000000710 homodimer Substances 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229960000890 hydrocortisone Drugs 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 1
- DBIGHPPNXATHOF-UHFFFAOYSA-N improsulfan Chemical compound CS(=O)(=O)OCCCNCCCOS(C)(=O)=O DBIGHPPNXATHOF-UHFFFAOYSA-N 0.000 description 1
- 229950008097 improsulfan Drugs 0.000 description 1
- 238000011503 in vivo imaging Methods 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- QTBFPMKWQKYFLR-UHFFFAOYSA-N isobutyl chloride Chemical compound CC(C)CCl QTBFPMKWQKYFLR-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 230000000155 isotopic effect Effects 0.000 description 1
- 229960004891 lapatinib Drugs 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960004961 mechlorethamine Drugs 0.000 description 1
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical class ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 1
- 229960001924 melphalan Drugs 0.000 description 1
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 1
- 102000006240 membrane receptors Human genes 0.000 description 1
- 108020004084 membrane receptors Proteins 0.000 description 1
- 229960001428 mercaptopurine Drugs 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229960003578 metenolone Drugs 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- ANJQEDFWRSLVBR-VHUDCFPWSA-N methenolone Chemical compound C1C[C@@H]2[C@@]3(C)C(C)=CC(=O)C[C@@H]3CC[C@H]2[C@@H]2CC[C@H](O)[C@]21C ANJQEDFWRSLVBR-VHUDCFPWSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 229960000485 methotrexate Drugs 0.000 description 1
- ULSSGHADTSRELG-UHFFFAOYSA-N methyl 2-(3-bromophenyl)acetate Chemical compound COC(=O)CC1=CC=CC(Br)=C1 ULSSGHADTSRELG-UHFFFAOYSA-N 0.000 description 1
- FXTMDAYSUXUMPM-UHFFFAOYSA-N methyl 2-[3-(4-amino-3-fluorophenoxy)phenyl]acetate hydrochloride Chemical compound Cl.NC1=C(C=C(OC=2C=C(C=CC=2)CC(=O)OC)C=C1)F FXTMDAYSUXUMPM-UHFFFAOYSA-N 0.000 description 1
- QZHYMMTUMVSHRS-UHFFFAOYSA-N methyl 2-[3-[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]phenyl]acetate Chemical compound CC(C)(C)OC(=O)NC1=C(C=C(C=C1)OC2=CC=CC(=C2)CC(=O)OC)F QZHYMMTUMVSHRS-UHFFFAOYSA-N 0.000 description 1
- FLGJKAWEVKYTSD-UHFFFAOYSA-N methyl 2-amino-5-(1-phenylethyl)thiophene-3-carboxylate Chemical compound S1C(N)=C(C(=O)OC)C=C1C(C)C1=CC=CC=C1 FLGJKAWEVKYTSD-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 1
- 229960004584 methylprednisolone Drugs 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960005485 mitobronitol Drugs 0.000 description 1
- VFKZTMPDYBFSTM-GUCUJZIJSA-N mitolactol Chemical compound BrC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CBr VFKZTMPDYBFSTM-GUCUJZIJSA-N 0.000 description 1
- 229950010913 mitolactol Drugs 0.000 description 1
- 229960004857 mitomycin Drugs 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical group CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- XCVNDBIXFPGMIW-UHFFFAOYSA-N n-ethylpropan-1-amine Chemical compound CCCNCC XCVNDBIXFPGMIW-UHFFFAOYSA-N 0.000 description 1
- 229960004719 nandrolone Drugs 0.000 description 1
- NPAGDVCDWIYMMC-IZPLOLCNSA-N nandrolone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 NPAGDVCDWIYMMC-IZPLOLCNSA-N 0.000 description 1
- QZGIWPZCWHMVQL-UIYAJPBUSA-N neocarzinostatin chromophore Chemical compound O1[C@H](C)[C@H](O)[C@H](O)[C@@H](NC)[C@H]1O[C@@H]1C/2=C/C#C[C@H]3O[C@@]3([C@@H]3OC(=O)OC3)C#CC\2=C[C@H]1OC(=O)C1=C(O)C=CC2=C(C)C=C(OC)C=C12 QZGIWPZCWHMVQL-UIYAJPBUSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- HHZIURLSWUIHRB-UHFFFAOYSA-N nilotinib Chemical compound C1=NC(C)=CN1C1=CC(NC(=O)C=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)=CC(C(F)(F)F)=C1 HHZIURLSWUIHRB-UHFFFAOYSA-N 0.000 description 1
- 229960001346 nilotinib Drugs 0.000 description 1
- 229960001420 nimustine Drugs 0.000 description 1
- VFEDRRNHLBGPNN-UHFFFAOYSA-N nimustine Chemical compound CC1=NC=C(CNC(=O)N(CCCl)N=O)C(N)=N1 VFEDRRNHLBGPNN-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 238000011580 nude mouse model Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 229960003278 osimertinib Drugs 0.000 description 1
- DUYJMQONPNNFPI-UHFFFAOYSA-N osimertinib Chemical compound COC1=CC(N(C)CCN(C)C)=C(NC(=O)C=C)C=C1NC1=NC=CC(C=2C3=CC=CC=C3N(C)C=2)=N1 DUYJMQONPNNFPI-UHFFFAOYSA-N 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical group C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 1
- 229960001756 oxaliplatin Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229960005244 oxymetholone Drugs 0.000 description 1
- ICMWWNHDUZJFDW-DHODBPELSA-N oxymetholone Chemical compound C([C@@H]1CC2)C(=O)\C(=C/O)C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@](C)(O)[C@@]2(C)CC1 ICMWWNHDUZJFDW-DHODBPELSA-N 0.000 description 1
- ICMWWNHDUZJFDW-UHFFFAOYSA-N oxymetholone Natural products C1CC2CC(=O)C(=CO)CC2(C)C2C1C1CCC(C)(O)C1(C)CC2 ICMWWNHDUZJFDW-UHFFFAOYSA-N 0.000 description 1
- 229960001592 paclitaxel Drugs 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- QJPQVXSHYBGQGM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QJPQVXSHYBGQGM-UHFFFAOYSA-N 0.000 description 1
- UQPUONNXJVWHRM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UQPUONNXJVWHRM-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- JLFNLZLINWHATN-UHFFFAOYSA-N pentaethylene glycol Chemical compound OCCOCCOCCOCCOCCO JLFNLZLINWHATN-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- QIMGFXOHTOXMQP-GFAGFCTOSA-N peplomycin Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCCN[C@@H](C)C=1C=CC=CC=1)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1NC=NC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C QIMGFXOHTOXMQP-GFAGFCTOSA-N 0.000 description 1
- 229950003180 peplomycin Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229960000952 pipobroman Drugs 0.000 description 1
- NJBFOOCLYDNZJN-UHFFFAOYSA-N pipobroman Chemical compound BrCCC(=O)N1CCN(C(=O)CCBr)CC1 NJBFOOCLYDNZJN-UHFFFAOYSA-N 0.000 description 1
- 229960001221 pirarubicin Drugs 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 108010001062 polysaccharide-K Proteins 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- VZOPRCCTKLAGPN-ZFJVMAEJSA-L potassium;sodium;(2r,3r)-2,3-dihydroxybutanedioate;tetrahydrate Chemical compound O.O.O.O.[Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O VZOPRCCTKLAGPN-ZFJVMAEJSA-L 0.000 description 1
- 229950009876 poziotinib Drugs 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 229960005205 prednisolone Drugs 0.000 description 1
- OIGNJSKKLXVSLS-VWUMJDOOSA-N prednisolone Chemical compound O=C1C=C[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 OIGNJSKKLXVSLS-VWUMJDOOSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- CPTBDICYNRMXFX-UHFFFAOYSA-N procarbazine Chemical compound CNNCC1=CC=C(C(=O)NC(C)C)C=C1 CPTBDICYNRMXFX-UHFFFAOYSA-N 0.000 description 1
- 229960000624 procarbazine Drugs 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical class CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- UKPBXIFLSVLDPA-UHFFFAOYSA-N propylhydrazine Chemical compound CCCNN UKPBXIFLSVLDPA-UHFFFAOYSA-N 0.000 description 1
- 229940070687 psyllium Drugs 0.000 description 1
- 230000004144 purine metabolism Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- ZDYVRSLAEXCVBX-UHFFFAOYSA-N pyridinium p-toluenesulfonate Chemical compound C1=CC=[NH+]C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 ZDYVRSLAEXCVBX-UHFFFAOYSA-N 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 229960002185 ranimustine Drugs 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 229960003440 semustine Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- 238000004467 single crystal X-ray diffraction Methods 0.000 description 1
- 229950001403 sizofiran Drugs 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 1
- 235000019187 sodium-L-ascorbate Nutrition 0.000 description 1
- 239000011755 sodium-L-ascorbate Substances 0.000 description 1
- SUBJHSREKVAVAR-UHFFFAOYSA-N sodium;methanol;methanolate Chemical compound [Na+].OC.[O-]C SUBJHSREKVAVAR-UHFFFAOYSA-N 0.000 description 1
- 229960003787 sorafenib Drugs 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 235000013599 spices Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 229960001052 streptozocin Drugs 0.000 description 1
- ZSJLQEPLLKMAKR-GKHCUFPYSA-N streptozocin Chemical compound O=NN(C)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O ZSJLQEPLLKMAKR-GKHCUFPYSA-N 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- 229960001796 sunitinib Drugs 0.000 description 1
- WINHZLLDWRZWRT-ATVHPVEESA-N sunitinib Chemical compound CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C WINHZLLDWRZWRT-ATVHPVEESA-N 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229960001603 tamoxifen Drugs 0.000 description 1
- 239000013076 target substance Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 1
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 1
- 229960001278 teniposide Drugs 0.000 description 1
- PBLFGQPRDNKDTK-UHFFFAOYSA-N tert-butyl 2-[3-(3-chloro-4-nitrophenoxy)pyrazol-1-yl]acetate Chemical compound ClC=1C=C(OC2=NN(C=C2)CC(=O)OC(C)(C)C)C=CC=1[N+](=O)[O-] PBLFGQPRDNKDTK-UHFFFAOYSA-N 0.000 description 1
- PHYLDFNFDUYJRI-UHFFFAOYSA-N tert-butyl 3-(4-amino-2-chloro-5-fluorophenoxy)pyrazole-1-carboxylate Chemical compound NC1=CC(=C(OC2=NN(C=C2)C(=O)OC(C)(C)C)C=C1F)Cl PHYLDFNFDUYJRI-UHFFFAOYSA-N 0.000 description 1
- VRRIDQLXRSVSEN-UHFFFAOYSA-N tert-butyl 3-[3-fluoro-4-(phenylmethoxycarbonylamino)phenoxy]pyrazole-1-carboxylate Chemical compound C(C1=CC=CC=C1)OC(=O)NC1=C(C=C(OC2=NN(C=C2)C(=O)OC(C)(C)C)C=C1)F VRRIDQLXRSVSEN-UHFFFAOYSA-N 0.000 description 1
- HNLNHZUFFURFIR-UHFFFAOYSA-N tert-butyl 3-[4-[(6-amino-7-methoxyquinazolin-4-yl)amino]-3-fluorophenoxy]pyrazole-1-carboxylate Chemical compound NC=1C=C2C(=NC=NC2=CC=1OC)NC1=C(C=C(OC2=NN(C=C2)C(=O)OC(C)(C)C)C=C1)F HNLNHZUFFURFIR-UHFFFAOYSA-N 0.000 description 1
- LBANRTXDZCSRJQ-UHFFFAOYSA-N tert-butyl 4-(2-ethoxy-5-methoxycarbonyl-4-nitrophenoxy)piperidine-1-carboxylate Chemical compound C(C)OC1=C(OC2CCN(CC2)C(=O)OC(C)(C)C)C=C(C(=C1)[N+](=O)[O-])C(=O)OC LBANRTXDZCSRJQ-UHFFFAOYSA-N 0.000 description 1
- XBFJGSUESFFQLS-UHFFFAOYSA-N tert-butyl 4-(4-amino-2-ethoxy-5-methoxycarbonylphenoxy)piperidine-1-carboxylate Chemical compound NC1=CC(=C(OC2CCN(CC2)C(=O)OC(C)(C)C)C=C1C(=O)OC)OCC XBFJGSUESFFQLS-UHFFFAOYSA-N 0.000 description 1
- ZOBFOAWOTXARGS-UHFFFAOYSA-N tert-butyl 4-(4-chloro-7-methoxyquinazolin-6-yl)oxypiperidine-1-carboxylate Chemical compound COC1=CC2=NC=NC(Cl)=C2C=C1OC1CCN(C(=O)OC(C)(C)C)CC1 ZOBFOAWOTXARGS-UHFFFAOYSA-N 0.000 description 1
- YBCYAODJQPBHSU-UHFFFAOYSA-N tert-butyl 4-[(7-ethoxy-4-oxo-3H-quinazolin-6-yl)oxy]piperidine-1-carboxylate Chemical compound C(C)OC1=C(C=C2C(NC=NC2=C1)=O)OC1CCN(CC1)C(=O)OC(C)(C)C YBCYAODJQPBHSU-UHFFFAOYSA-N 0.000 description 1
- PWQLFIKTGRINFF-UHFFFAOYSA-N tert-butyl 4-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)CC1 PWQLFIKTGRINFF-UHFFFAOYSA-N 0.000 description 1
- NJBGXPJITDKQPS-UHFFFAOYSA-N tert-butyl 5-oxo-1h-pyrazole-2-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=CC(O)=N1 NJBGXPJITDKQPS-UHFFFAOYSA-N 0.000 description 1
- BOJPSVNHQSITMG-UHFFFAOYSA-N tert-butyl N-[2-fluoro-4-[1-(2-methoxypyrimidin-5-yl)pyrazol-3-yl]oxyphenyl]carbamate Chemical compound CC(C)(C)OC(=O)NC1=C(C=C(C=C1)OC2=NN(C=C2)C3=CN=C(N=C3)OC)F BOJPSVNHQSITMG-UHFFFAOYSA-N 0.000 description 1
- FNPLOVDLBBCQIF-UHFFFAOYSA-N tert-butyl N-[2-fluoro-4-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenoxy]phenyl]carbamate Chemical compound FC1=C(C=CC(=C1)OC1=CC(=CC=C1)C=1SC(=NN=1)C)NC(OC(C)(C)C)=O FNPLOVDLBBCQIF-UHFFFAOYSA-N 0.000 description 1
- AOILBUZVZMELPO-UHFFFAOYSA-N tert-butyl N-[2-fluoro-4-[[4-(2-methoxypyrimidin-5-yl)-1,3-thiazol-2-yl]oxy]phenyl]carbamate Chemical compound FC1=CC(OC=2SC=C(N=2)C2=CN=C(N=C2)OC)=CC=C1NC(=O)OC(C)(C)C AOILBUZVZMELPO-UHFFFAOYSA-N 0.000 description 1
- CHZZSUBYXQXSNP-UHFFFAOYSA-N tert-butyl N-[4-(3-bromophenoxy)-2-fluorophenyl]carbamate Chemical compound BrC=1C=C(OC2=CC(=C(C=C2)NC(OC(C)(C)C)=O)F)C=CC=1 CHZZSUBYXQXSNP-UHFFFAOYSA-N 0.000 description 1
- AXEWWIFNOCITPC-UHFFFAOYSA-N tert-butyl N-[4-(3-ethynylphenoxy)-2-fluorophenyl]carbamate Chemical compound C(#C)C=1C=C(OC2=CC(=C(C=C2)NC(OC(C)(C)C)=O)F)C=CC=1 AXEWWIFNOCITPC-UHFFFAOYSA-N 0.000 description 1
- NAYOZKGPPFSDLI-UHFFFAOYSA-N tert-butyl N-[4-[3-[(cyclopropanecarbonylamino)carbamoyl]phenoxy]-2-fluorophenyl]carbamate Chemical compound C1(CC1)C(=O)NNC(=O)C=1C=C(OC2=CC(=C(C=C2)NC(OC(C)(C)C)=O)F)C=CC=1 NAYOZKGPPFSDLI-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 229960001196 thiotepa Drugs 0.000 description 1
- 229960003087 tioguanine Drugs 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 102000027257 transmembrane receptors Human genes 0.000 description 1
- 108091008578 transmembrane receptors Proteins 0.000 description 1
- 229960005294 triamcinolone Drugs 0.000 description 1
- GFNANZIMVAIWHM-OBYCQNJPSA-N triamcinolone Chemical compound O=C1C=C[C@]2(C)[C@@]3(F)[C@@H](O)C[C@](C)([C@@]([C@H](O)C4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 GFNANZIMVAIWHM-OBYCQNJPSA-N 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- NOYPYLRCIDNJJB-UHFFFAOYSA-N trimetrexate Chemical compound COC1=C(OC)C(OC)=CC(NCC=2C(=C3C(N)=NC(N)=NC3=CC=2)C)=C1 NOYPYLRCIDNJJB-UHFFFAOYSA-N 0.000 description 1
- 229960001099 trimetrexate Drugs 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 102000003390 tumor necrosis factor Human genes 0.000 description 1
- 229950009811 ubenimex Drugs 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 239000004474 valine Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- GPXBXXGIAQBQNI-UHFFFAOYSA-N vemurafenib Chemical compound CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C=2C3=CC(=CN=C3NC=2)C=2C=CC(Cl)=CC=2)=C1F GPXBXXGIAQBQNI-UHFFFAOYSA-N 0.000 description 1
- 229960003862 vemurafenib Drugs 0.000 description 1
- 229960003048 vinblastine Drugs 0.000 description 1
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 1
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 1
- 229960004528 vincristine Drugs 0.000 description 1
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 1
- HHJUWIANJFBDHT-KOTLKJBCSA-N vindesine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(N)=O)N4C)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 HHJUWIANJFBDHT-KOTLKJBCSA-N 0.000 description 1
- 229960004355 vindesine Drugs 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 235000019154 vitamin C Nutrition 0.000 description 1
- 239000011718 vitamin C Substances 0.000 description 1
- 229940045997 vitamin a Drugs 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 229950009268 zinostatin Drugs 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/517—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim ortho- or peri-condensed with carbocyclic ring systems, e.g. quinazoline, perimidine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/0012—Galenical forms characterised by the site of application
- A61K9/0053—Mouth and digestive tract, i.e. intraoral and peroral administration
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/94—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B2200/00—Indexing scheme relating to specific properties of organic compounds
- C07B2200/13—Crystalline forms, e.g. polymorphs
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Epidemiology (AREA)
- Nutrition Science (AREA)
- Physiology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2018-127829 | 2018-07-04 | ||
| JP2018127829 | 2018-07-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TW202012391A true TW202012391A (zh) | 2020-04-01 |
Family
ID=69059535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW108123293A TW202012391A (zh) | 2018-07-04 | 2019-07-02 | 二芳基醚型喹唑啉衍生物 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US20230025510A1 (https=) |
| EP (1) | EP3822263A4 (https=) |
| JP (1) | JP7288904B2 (https=) |
| KR (1) | KR20210029165A (https=) |
| CN (1) | CN112334460A (https=) |
| AU (1) | AU2019297889A1 (https=) |
| BR (1) | BR112020027064A2 (https=) |
| CA (1) | CA3105602A1 (https=) |
| CO (1) | CO2021000800A2 (https=) |
| IL (1) | IL279858A (https=) |
| MX (1) | MX2021000014A (https=) |
| PH (1) | PH12021550003A1 (https=) |
| SG (1) | SG11202013218QA (https=) |
| TW (1) | TW202012391A (https=) |
| WO (1) | WO2020009156A1 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TWI896726B (zh) * | 2020-08-10 | 2025-09-11 | 大陸商上海和譽生物醫藥科技有限公司 | 一種egfr抑制劑及其製備方法和應用 |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2020262998A1 (ko) * | 2019-06-26 | 2020-12-30 | 한미약품 주식회사 | 항 종양 활성을 갖는 신규 퀴나졸린 유도체 및 이를 포함하는 약학 조성물 |
| WO2022105908A1 (zh) * | 2020-11-23 | 2022-05-27 | 上海和誉生物医药科技有限公司 | Egfr抑制剂及其制备方法与在药学上的应用 |
| CN113264888A (zh) * | 2021-03-04 | 2021-08-17 | 江苏康可得生物技术股份有限公司 | 酪氨酸激酶抑制剂及其药物应用 |
| KR20230156767A (ko) * | 2021-03-19 | 2023-11-14 | 베이징 사이텍-엠큐 파마슈티컬즈 리미티드 | 퀴나졸린계 화합물, 조성물 및 퀴나졸린계 화합물의 적용 |
| EP4323356A1 (en) | 2021-04-13 | 2024-02-21 | Nuvalent, Inc. | Amino-substituted heterocycles for treating cancers with egfr mutations |
| US20250136595A1 (en) * | 2022-02-09 | 2025-05-01 | Enliven Inc. | Acylated heterocyclic quinazoline derivatives as inhibitors of erbb2 |
| TW202404590A (zh) * | 2022-04-05 | 2024-02-01 | 美商纜圖藥品公司 | Egfr抑制劑 |
| CN117384162A (zh) * | 2022-05-17 | 2024-01-12 | 浙江文达医药科技有限公司 | 选择性her2抑制剂 |
| WO2025167927A1 (zh) * | 2024-02-05 | 2025-08-14 | 苏州韬略生物科技股份有限公司 | 三取代喹唑啉衍生物及其酸加成盐及其药物组合物和用途 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU228446B1 (en) * | 1996-04-12 | 2013-03-28 | Warner Lambert Co | Kinazoline derivatives as irreversible inhibitors of protein-kinase, pharmaceutical compositions containing these compounds and use thereof |
| CA2527017A1 (en) * | 2003-05-27 | 2004-12-09 | Pfizer Products Inc. | Quinazolines and pyrido [3,4-d] pyrimidines as receptor tyrosine kinase inhibitors |
| TWI377944B (en) * | 2007-06-05 | 2012-12-01 | Hanmi Holdings Co Ltd | Novel amide derivative for inhibiting the growth of cancer cells |
| WO2013173254A1 (en) * | 2012-05-14 | 2013-11-21 | Dawei Zhang | Bicyclic compounds as kinases inhibitors |
| CN103965120B (zh) * | 2013-01-25 | 2016-08-17 | 上海医药集团股份有限公司 | 喹啉及喹唑啉衍生物、制备方法、中间体、组合物及应用 |
| MA46852A (fr) | 2016-11-17 | 2019-09-25 | Univ Texas | Composés à activité antitumorale contre des cellules cancéreuses porteuses de mutations egfr ou her2 exon 20 |
| WO2020262998A1 (ko) * | 2019-06-26 | 2020-12-30 | 한미약품 주식회사 | 항 종양 활성을 갖는 신규 퀴나졸린 유도체 및 이를 포함하는 약학 조성물 |
-
2019
- 2019-07-02 TW TW108123293A patent/TW202012391A/zh unknown
- 2019-07-03 WO PCT/JP2019/026483 patent/WO2020009156A1/ja not_active Ceased
- 2019-07-03 CA CA3105602A patent/CA3105602A1/en active Pending
- 2019-07-03 JP JP2020529034A patent/JP7288904B2/ja active Active
- 2019-07-03 BR BR112020027064-4A patent/BR112020027064A2/pt not_active Application Discontinuation
- 2019-07-03 AU AU2019297889A patent/AU2019297889A1/en not_active Abandoned
- 2019-07-03 KR KR1020207038066A patent/KR20210029165A/ko not_active Withdrawn
- 2019-07-03 MX MX2021000014A patent/MX2021000014A/es unknown
- 2019-07-03 EP EP19830650.8A patent/EP3822263A4/en not_active Withdrawn
- 2019-07-03 CN CN201980044514.8A patent/CN112334460A/zh active Pending
- 2019-07-03 SG SG11202013218QA patent/SG11202013218QA/en unknown
- 2019-07-03 US US17/257,238 patent/US20230025510A1/en not_active Abandoned
-
2020
- 2020-12-30 IL IL279858A patent/IL279858A/en unknown
-
2021
- 2021-01-03 PH PH12021550003A patent/PH12021550003A1/en unknown
- 2021-01-25 CO CONC2021/0000800A patent/CO2021000800A2/es unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TWI896726B (zh) * | 2020-08-10 | 2025-09-11 | 大陸商上海和譽生物醫藥科技有限公司 | 一種egfr抑制劑及其製備方法和應用 |
Also Published As
| Publication number | Publication date |
|---|---|
| PH12021550003A1 (en) | 2021-09-20 |
| IL279858A (en) | 2021-03-01 |
| AU2019297889A1 (en) | 2021-02-18 |
| EP3822263A1 (en) | 2021-05-19 |
| CA3105602A1 (en) | 2020-01-09 |
| JPWO2020009156A1 (ja) | 2021-07-15 |
| KR20210029165A (ko) | 2021-03-15 |
| MX2021000014A (es) | 2021-03-09 |
| CO2021000800A2 (es) | 2021-02-08 |
| WO2020009156A1 (ja) | 2020-01-09 |
| EP3822263A4 (en) | 2022-03-16 |
| SG11202013218QA (en) | 2021-02-25 |
| CN112334460A (zh) | 2021-02-05 |
| US20230025510A1 (en) | 2023-01-26 |
| JP7288904B2 (ja) | 2023-06-08 |
| BR112020027064A2 (pt) | 2021-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TW202012391A (zh) | 二芳基醚型喹唑啉衍生物 | |
| CN114026073B (zh) | 用于治疗braf相关的疾病和障碍的喹唑啉-4-酮衍生物 | |
| EP3423443B1 (en) | Cyano-substituted indole compounds and uses thereof as lsd1 inhibitors | |
| EP3896062A1 (en) | Isoindoline compound, and preparation method, pharmaceutical composition, and application of isoindoline compound | |
| US12077519B2 (en) | Heteroaryl carboxamide compound | |
| EP3022202B1 (en) | Autotaxin inhibitors comprising a heteroaromatic ring-benzyl-amide-cycle core | |
| JP2022078109A (ja) | 核輸送モジュレーターとしての化合物およびその使用 | |
| EP1559715B1 (en) | N-{2-chloro-4-[(6,7-dimethoxy-4-quinolyl)oxy]phenyl}-n'-(5-methyl-3-isoxazolyl)urea salt in crystalline form | |
| JP6433505B2 (ja) | オレキシン受容体アンタゴニストとしての1,2−置換シクロペンタン | |
| CN108026102A (zh) | 可用于治疗与kit和pdgfr相关的病症的化合物 | |
| WO2024067744A1 (zh) | 杂环取代喹唑啉及其制备方法和应用 | |
| EP3985000A1 (en) | 2,4-disubstituted pyrimidine derivative, preparation method for same, and uses thereof | |
| JP2018520205A (ja) | レンバチニブメシル酸塩の新規結晶形及びその製造方法 | |
| EP3590941B1 (en) | Urea-substituted aromatic ring-linked dioxane-quinazoline and -linked dioxane-quinoline compounds, preparation method therefor and use thereof | |
| CN116323590A (zh) | 取代苯并或吡啶并嘧啶胺类抑制剂及其制备方法和应用 | |
| JP7840327B2 (ja) | 新規インダゾールアセチレン誘導体 | |
| EP2303276B1 (en) | Fumarate salt of 4-(3-chloro-2-fluoroanilino)-7-methoxy-6-{[1-(n-methylcarbamoylmethyl)piperidin-4-yl]oxy}quinazoline | |
| US9884856B2 (en) | Crystal form of Dabrafenib mesylate and preparation method thereof | |
| WO2021129841A1 (zh) | 用作ret激酶抑制剂的化合物及其应用 | |
| CN108368094B (zh) | 用于局部药物递送的非甾体类糖皮质激素受体调节剂 | |
| JP5748745B2 (ja) | p70S6キナーゼの阻害剤としての置換ベンゾトリアジン類およびキノキサリン類 | |
| TW202012414A (zh) | 三環ask1抑制劑 | |
| HK40043221A (en) | Biaryl ether-type quinazoline derivative | |
| CN111620821A (zh) | 取代的吡唑类化合物及包含该化合物的组合物及其用途 | |
| TW202110844A (zh) | 具有二螺二酮哌構造之化合物 |